| 1 | [13:13:53] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLServerTweaker
|
| 2 | [13:13:53] [main/INFO] [LaunchWrapper]: Using primary tweak class name net.minecraftforge.fml.common.launcher.FMLServerTweaker
|
| 3 | [13:13:53] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLServerTweaker
|
| 4 | [13:13:54] [main/DEBUG] [FML]: Injecting tracing printstreams for STDOUT/STDERR.
|
| 5 | [13:13:54] [main/INFO] [FML]: Forge Mod Loader version 14.23.5.2855 for Minecraft 1.12.2 loading
|
| 6 | [13:13:54] [main/INFO] [FML]: Java is OpenJDK 64-Bit Server VM, version 1.8.0_282, running on Linux:amd64:5.4.0-64-generic, installed at /usr/local/openjdk-8/jre
|
| 7 | [13:13:54] [main/DEBUG] [FML]: Java classpath at launch is:
|
| 8 | [13:13:54] [main/DEBUG] [FML]: forge.jar
|
| 9 | [13:13:54] [main/DEBUG] [FML]: /jolokia/jolokia.jar
|
| 10 | [13:13:54] [main/DEBUG] [FML]: Java library path at launch is:
|
| 11 | [13:13:54] [main/DEBUG] [FML]: /usr/java/packages/lib/amd64
|
| 12 | [13:13:54] [main/DEBUG] [FML]: /usr/lib64
|
| 13 | [13:13:54] [main/DEBUG] [FML]: /lib64
|
| 14 | [13:13:54] [main/DEBUG] [FML]: /lib
|
| 15 | [13:13:54] [main/DEBUG] [FML]: /usr/lib
|
| 16 | [13:13:54] [main/DEBUG] [FML]: Determined Minecraft Libraries Root: /server/libraries
|
| 17 | [13:13:54] [main/DEBUG] [FML]: Cleaning up mods folder: ./mods
|
| 18 | [13:13:54] [main/DEBUG] [FML]: Examining file: PTRLib-1.0.4.jar
|
| 19 | [13:13:54] [main/DEBUG] [FML]: Examining file: jei_1.12.2-4.16.1.302.jar
|
| 20 | [13:13:54] [main/DEBUG] [FML]: Examining file: Blocklings 6.0.1_b - 1.12.2.jar
|
| 21 | [13:13:54] [main/DEBUG] [FML]: Examining file: aether_ii-1.12.2-0.3.0+build411-universal.jar
|
| 22 | [13:13:55] [main/DEBUG] [FML]: Found existing ContainedDep orbis-lib-1.12.2-0.2.0+build411-universal.jar(com.gildedgames:orbis-lib:1.12.2-0.2.0+build411) from /server/mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar extracted to ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar, skipping extraction
|
| 23 | [13:13:55] [main/DEBUG] [FML]: Examining file: orbis-lib-1.12.2-0.2.0+build411.jar
|
| 24 | [13:13:56] [main/DEBUG] [FML]: Found existing ContainedDep phosphor-1.12.2-0.2.6+build50-universal.jar(me.jellysquid.mods:phosphor:1.12.2-0.2.6+build50) from /server/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar extracted to ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar, skipping extraction
|
| 25 | [13:13:56] [main/DEBUG] [FML]: Examining file: phosphor-1.12.2-0.2.6+build50.jar
|
| 26 | [13:13:56] [main/DEBUG] [FML]: Examining file: Placebo-1.12.2-1.6.0.jar
|
| 27 | [13:13:56] [main/DEBUG] [FML]: Examining file: EnderStorage-1.12.2-2.4.6.137-universal.jar
|
| 28 | [13:13:56] [main/DEBUG] [FML]: Examining file: CustomMobSpawner-3.11.5.jar
|
| 29 | [13:13:56] [main/DEBUG] [FML]: Examining file: Decocraft-2.6.3_1.12.2.jar
|
| 30 | [13:13:56] [main/DEBUG] [FML]: Examining file: ironchest-1.12.2-7.0.72.847.jar
|
| 31 | [13:13:56] [main/DEBUG] [FML]: Examining file: CosmicArmoury-1.6.55.jar
|
| 32 | [13:13:56] [main/DEBUG] [FML]: Examining file: CTM-MC1.12.2-1.0.2.31.jar
|
| 33 | [13:13:56] [main/DEBUG] [FML]: Examining file: NotEnoughItems-1.12.2-2.4.3.245-universal.jar
|
| 34 | [13:13:56] [main/DEBUG] [FML]: Examining file: AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar
|
| 35 | [13:13:56] [main/DEBUG] [FML]: Examining file: SimplyJetpacks2-1.12.2-2.2.19.0.jar
|
| 36 | [13:13:56] [main/DEBUG] [FML]: Examining file: Bloodmoon-MC1.12.2-1.5.3.jar
|
| 37 | [13:13:56] [main/DEBUG] [FML]: Examining file: backpacked-1.4.2-1.12.2.jar
|
| 38 | [13:13:56] [main/DEBUG] [FML]: Examining file: DoomlikeDungeons-1.13.2-MC1.12.2.jar
|
| 39 | [13:13:56] [main/DEBUG] [FML]: Examining file: FastFurnace-1.12.2-1.3.1.jar
|
| 40 | [13:13:56] [main/DEBUG] [FML]: Examining file: Schematics-1.12.2.12.jar
|
| 41 | [13:13:56] [main/DEBUG] [FML]: Examining file: LunatriusCore-1.12.2-1.2.0.42-universal.jar
|
| 42 | [13:13:56] [main/DEBUG] [FML]: Examining file: Netherending-Ores-1.12.2-1.4.2.jar
|
| 43 | [13:13:56] [main/DEBUG] [FML]: Examining file: DrZharks MoCreatures Mod-12.0.5.jar
|
| 44 | [13:13:56] [main/DEBUG] [FML]: Examining file: Schematica-1.12.2-1.8.0.169-universal.jar
|
| 45 | [13:13:56] [main/DEBUG] [FML]: Examining file: Chisel-MC1.12.2-1.0.2.45.jar
|
| 46 | [13:13:56] [main/DEBUG] [FML]: Examining file: UndergroundBiomesConstructs-1.12-1.3.8.jar
|
| 47 | [13:13:56] [main/DEBUG] [FML]: Examining file: CodeChickenLib-1.12.2-3.2.3.358-universal.jar
|
| 48 | [13:13:56] [main/DEBUG] [FML]: File already proccessed /server/./mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar, Skipping
|
| 49 | [13:13:56] [main/DEBUG] [FML]: File already proccessed /server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar, Skipping
|
| 50 | [13:13:56] [main/DEBUG] [FML]: Enabling runtime deobfuscation
|
| 51 | [13:13:56] [main/DEBUG] [FML]: Instantiating coremod class FMLCorePlugin
|
| 52 | [13:13:56] [main/DEBUG] [FML]: Found signing certificates for coremod FMLCorePlugin (net.minecraftforge.fml.relauncher.FMLCorePlugin)
|
| 53 | [13:13:56] [main/DEBUG] [FML]: Found certificate e3c3d50c7c986df74c645c0ac54639741c90a557
|
| 54 | [13:13:56] [main/DEBUG] [FML]: Added access transformer class net.minecraftforge.fml.common.asm.transformers.AccessTransformer to enqueued access transformers
|
| 55 | [13:13:57] [main/DEBUG] [FML]: Enqueued coremod FMLCorePlugin
|
| 56 | [13:13:57] [main/DEBUG] [FML]: Instantiating coremod class FMLForgePlugin
|
| 57 | [13:13:57] [main/DEBUG] [FML]: Found signing certificates for coremod FMLForgePlugin (net.minecraftforge.classloading.FMLForgePlugin)
|
| 58 | [13:13:57] [main/DEBUG] [FML]: Found certificate e3c3d50c7c986df74c645c0ac54639741c90a557
|
| 59 | [13:13:57] [main/DEBUG] [FML]: Enqueued coremod FMLForgePlugin
|
| 60 | [13:13:57] [main/DEBUG] [FML]: All fundamental core mods are successfully located
|
| 61 | [13:13:57] [main/DEBUG] [FML]: Discovering coremods
|
| 62 | [13:13:57] [main/INFO] [FML]: Searching /server/./mods for mods
|
| 63 | [13:13:57] [main/DEBUG] [FML]: Adding PTRLib-1.0.4.jar to the mod list
|
| 64 | [13:13:57] [main/DEBUG] [FML]: Adding jei_1.12.2-4.16.1.302.jar to the mod list
|
| 65 | [13:13:57] [main/DEBUG] [FML]: Adding Blocklings 6.0.1_b - 1.12.2.jar to the mod list
|
| 66 | [13:13:57] [main/DEBUG] [FML]: Adding aether_ii-1.12.2-0.3.0+build411-universal.jar to the mod list
|
| 67 | [13:13:57] [main/DEBUG] [FML]: Adding Placebo-1.12.2-1.6.0.jar to the mod list
|
| 68 | [13:13:57] [main/DEBUG] [FML]: Adding EnderStorage-1.12.2-2.4.6.137-universal.jar to the mod list
|
| 69 | [13:13:57] [main/DEBUG] [FML]: Adding CustomMobSpawner-3.11.5.jar to the mod list
|
| 70 | [13:13:57] [main/DEBUG] [FML]: Adding Decocraft-2.6.3_1.12.2.jar to the mod list
|
| 71 | [13:13:57] [main/DEBUG] [FML]: Adding ironchest-1.12.2-7.0.72.847.jar to the mod list
|
| 72 | [13:13:57] [main/DEBUG] [FML]: Adding CosmicArmoury-1.6.55.jar to the mod list
|
| 73 | [13:13:57] [main/DEBUG] [FML]: Adding CTM-MC1.12.2-1.0.2.31.jar to the mod list
|
| 74 | [13:13:57] [main/DEBUG] [FML]: Adding NotEnoughItems-1.12.2-2.4.3.245-universal.jar to the mod list
|
| 75 | [13:13:57] [main/DEBUG] [FML]: Adding AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar to the mod list
|
| 76 | [13:13:57] [main/DEBUG] [FML]: Adding SimplyJetpacks2-1.12.2-2.2.19.0.jar to the mod list
|
| 77 | [13:13:57] [main/DEBUG] [FML]: Adding Bloodmoon-MC1.12.2-1.5.3.jar to the mod list
|
| 78 | [13:13:57] [main/DEBUG] [FML]: Adding backpacked-1.4.2-1.12.2.jar to the mod list
|
| 79 | [13:13:57] [main/DEBUG] [FML]: Adding DoomlikeDungeons-1.13.2-MC1.12.2.jar to the mod list
|
| 80 | [13:13:57] [main/DEBUG] [FML]: Adding FastFurnace-1.12.2-1.3.1.jar to the mod list
|
| 81 | [13:13:57] [main/DEBUG] [FML]: Adding Schematics-1.12.2.12.jar to the mod list
|
| 82 | [13:13:57] [main/DEBUG] [FML]: Adding LunatriusCore-1.12.2-1.2.0.42-universal.jar to the mod list
|
| 83 | [13:13:57] [main/DEBUG] [FML]: Adding Netherending-Ores-1.12.2-1.4.2.jar to the mod list
|
| 84 | [13:13:57] [main/DEBUG] [FML]: Adding DrZharks MoCreatures Mod-12.0.5.jar to the mod list
|
| 85 | [13:13:57] [main/DEBUG] [FML]: Adding Schematica-1.12.2-1.8.0.169-universal.jar to the mod list
|
| 86 | [13:13:57] [main/DEBUG] [FML]: Adding Chisel-MC1.12.2-1.0.2.45.jar to the mod list
|
| 87 | [13:13:57] [main/DEBUG] [FML]: Adding UndergroundBiomesConstructs-1.12-1.3.8.jar to the mod list
|
| 88 | [13:13:57] [main/DEBUG] [FML]: Adding CodeChickenLib-1.12.2-3.2.3.358-universal.jar to the mod list
|
| 89 | [13:13:57] [main/DEBUG] [FML]: Examining for coremod candidacy AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar
|
| 90 | [13:13:57] [main/DEBUG] [FML]: Not found coremod data in AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar
|
| 91 | [13:13:57] [main/DEBUG] [FML]: Examining for coremod candidacy aether_ii-1.12.2-0.3.0+build411-universal.jar
|
| 92 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in aether_ii-1.12.2-0.3.0+build411-universal.jar
|
| 93 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy backpacked-1.4.2-1.12.2.jar
|
| 94 | [13:13:58] [main/TRACE] [FML]: Adding backpacked-1.4.2-1.12.2.jar to the list of known coremods, it will not be examined again
|
| 95 | [13:13:58] [main/DEBUG] [FML]: Instantiating coremod class BackpackedPlugin
|
| 96 | [13:13:58] [main/TRACE] [FML]: coremod named Backpacked is loading
|
| 97 | [13:13:58] [main/DEBUG] [FML]: The coremod com.mrcrayfish.backpacked.asm.BackpackedPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
|
| 98 | [13:13:58] [main/WARN] [FML]: The coremod Backpacked (com.mrcrayfish.backpacked.asm.BackpackedPlugin) is not signed!
|
| 99 | [13:13:58] [main/DEBUG] [FML]: Enqueued coremod Backpacked
|
| 100 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy Blocklings 6.0.1_b - 1.12.2.jar
|
| 101 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in Blocklings 6.0.1_b - 1.12.2.jar
|
| 102 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy Bloodmoon-MC1.12.2-1.5.3.jar
|
| 103 | [13:13:58] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in Bloodmoon-MC1.12.2-1.5.3.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
|
| 104 | [13:13:58] [main/DEBUG] [FML]: Instantiating coremod class LoadingPlugin
|
| 105 | [13:13:58] [main/WARN] [FML]: The coremod lumien.bloodmoon.asm.LoadingPlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft
|
| 106 | [13:13:58] [main/DEBUG] [FML]: Found signing certificates for coremod LoadingPlugin (lumien.bloodmoon.asm.LoadingPlugin)
|
| 107 | [13:13:58] [main/DEBUG] [FML]: Found certificate d72e0dd57935b3e9476212aea0c0df352dd76291
|
| 108 | [13:13:58] [main/DEBUG] [FML]: Enqueued coremod LoadingPlugin
|
| 109 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy Chisel-MC1.12.2-1.0.2.45.jar
|
| 110 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in Chisel-MC1.12.2-1.0.2.45.jar
|
| 111 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy CodeChickenLib-1.12.2-3.2.3.358-universal.jar
|
| 112 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in CodeChickenLib-1.12.2-3.2.3.358-universal.jar
|
| 113 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy CosmicArmoury-1.6.55.jar
|
| 114 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in CosmicArmoury-1.6.55.jar
|
| 115 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy CTM-MC1.12.2-1.0.2.31.jar
|
| 116 | [13:13:58] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in CTM-MC1.12.2-1.0.2.31.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
|
| 117 | [13:13:58] [main/DEBUG] [FML]: Instantiating coremod class CTMCorePlugin
|
| 118 | [13:13:58] [main/WARN] [FML]: The coremod team.chisel.ctm.client.asm.CTMCorePlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft
|
| 119 | [13:13:58] [main/WARN] [FML]: The coremod CTMCorePlugin (team.chisel.ctm.client.asm.CTMCorePlugin) is not signed!
|
| 120 | [13:13:58] [main/DEBUG] [FML]: Enqueued coremod CTMCorePlugin
|
| 121 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy CustomMobSpawner-3.11.5.jar
|
| 122 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in CustomMobSpawner-3.11.5.jar
|
| 123 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy Decocraft-2.6.3_1.12.2.jar
|
| 124 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in Decocraft-2.6.3_1.12.2.jar
|
| 125 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy DoomlikeDungeons-1.13.2-MC1.12.2.jar
|
| 126 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in DoomlikeDungeons-1.13.2-MC1.12.2.jar
|
| 127 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy DrZharks MoCreatures Mod-12.0.5.jar
|
| 128 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in DrZharks MoCreatures Mod-12.0.5.jar
|
| 129 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy EnderStorage-1.12.2-2.4.6.137-universal.jar
|
| 130 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in EnderStorage-1.12.2-2.4.6.137-universal.jar
|
| 131 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy FastFurnace-1.12.2-1.3.1.jar
|
| 132 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in FastFurnace-1.12.2-1.3.1.jar
|
| 133 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy ironchest-1.12.2-7.0.72.847.jar
|
| 134 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in ironchest-1.12.2-7.0.72.847.jar
|
| 135 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy jei_1.12.2-4.16.1.302.jar
|
| 136 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in jei_1.12.2-4.16.1.302.jar
|
| 137 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy LunatriusCore-1.12.2-1.2.0.42-universal.jar
|
| 138 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in LunatriusCore-1.12.2-1.2.0.42-universal.jar
|
| 139 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy Netherending-Ores-1.12.2-1.4.2.jar
|
| 140 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in Netherending-Ores-1.12.2-1.4.2.jar
|
| 141 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy NotEnoughItems-1.12.2-2.4.3.245-universal.jar
|
| 142 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in NotEnoughItems-1.12.2-2.4.3.245-universal.jar
|
| 143 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy Placebo-1.12.2-1.6.0.jar
|
| 144 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in Placebo-1.12.2-1.6.0.jar
|
| 145 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy PTRLib-1.0.4.jar
|
| 146 | [13:13:58] [main/DEBUG] [FML]: Not found coremod data in PTRLib-1.0.4.jar
|
| 147 | [13:13:58] [main/DEBUG] [FML]: Examining for coremod candidacy Schematica-1.12.2-1.8.0.169-universal.jar
|
| 148 | [13:13:59] [main/DEBUG] [FML]: Not found coremod data in Schematica-1.12.2-1.8.0.169-universal.jar
|
| 149 | [13:13:59] [main/DEBUG] [FML]: Examining for coremod candidacy Schematics-1.12.2.12.jar
|
| 150 | [13:13:59] [main/DEBUG] [FML]: Not found coremod data in Schematics-1.12.2.12.jar
|
| 151 | [13:13:59] [main/DEBUG] [FML]: Examining for coremod candidacy SimplyJetpacks2-1.12.2-2.2.19.0.jar
|
| 152 | [13:13:59] [main/DEBUG] [FML]: Not found coremod data in SimplyJetpacks2-1.12.2-2.2.19.0.jar
|
| 153 | [13:13:59] [main/DEBUG] [FML]: Examining for coremod candidacy UndergroundBiomesConstructs-1.12-1.3.8.jar
|
| 154 | [13:13:59] [main/DEBUG] [FML]: Not found coremod data in UndergroundBiomesConstructs-1.12-1.3.8.jar
|
| 155 | [13:13:59] [main/DEBUG] [FML]: Examining for coremod candidacy orbis-lib-1.12.2-0.2.0+build411.jar
|
| 156 | [13:13:59] [main/DEBUG] [FML]: Not found coremod data in orbis-lib-1.12.2-0.2.0+build411.jar
|
| 157 | [13:13:59] [main/DEBUG] [FML]: Examining for coremod candidacy phosphor-1.12.2-0.2.6+build50.jar
|
| 158 | [13:13:59] [main/INFO] [FML]: Loading tweaker org.spongepowered.asm.launch.MixinTweaker from phosphor-1.12.2-0.2.6+build50.jar
|
| 159 | [13:13:59] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker
|
| 160 | [13:13:59] [main/INFO] [LaunchWrapper]: Loading tweak class name org.spongepowered.asm.launch.MixinTweaker
|
| 161 | [13:13:59] [main/DEBUG] [mixin]: MixinService [LaunchWrapper] was successfully booted in sun.misc.Launcher$AppClassLoader@18b4aac2
|
| 162 | [13:13:59] [main/INFO] [mixin]: SpongePowered MIXIN Subsystem Version=0.7.11 Source=file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar Service=LaunchWrapper Env=SERVER
|
| 163 | [13:13:59] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #1
|
| 164 | [13:13:59] [main/DEBUG] [mixin]: Initialising Mixin Platform Manager
|
| 165 | [13:13:59] [main/DEBUG] [mixin]: Mixin platform: primary container is file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
|
| 166 | [13:13:59] [main/DEBUG] [mixin]: Adding mixin platform agents for container file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
|
| 167 | [13:13:59] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentFML for file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
|
| 168 | [13:13:59] [main/DEBUG] [mixin]: ForceLoadAsMod was specified for phosphor-1.12.2-0.2.6+build50.jar, attempting force-load
|
| 169 | [13:13:59] [main/DEBUG] [mixin]: Adding phosphor-1.12.2-0.2.6+build50.jar to reparseable coremod collection
|
| 170 | [13:13:59] [main/DEBUG] [mixin]: phosphor-1.12.2-0.2.6+build50.jar has core plugin me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin. Injecting it into FML for co-initialisation:
|
| 171 | [13:13:59] [main/DEBUG] [FML]: Instantiating coremod class PhosphorFMLLoadingPlugin
|
| 172 | [13:14:00] [main/DEBUG] [FML]: The coremod me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
|
| 173 | [13:14:00] [main/DEBUG] [FML]: Found signing certificates for coremod PhosphorFMLLoadingPlugin (me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin)
|
| 174 | [13:14:00] [main/DEBUG] [FML]: Found certificate f0387d288626cc2d937daa504e74af570c52a2f1
|
| 175 | [13:14:00] [main/DEBUG] [FML]: Enqueued coremod PhosphorFMLLoadingPlugin
|
| 176 | [13:14:00] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentDefault for file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
|
| 177 | [13:14:00] [main/DEBUG] [mixin]: Scanning file:/server/forge.jar for mixin tweaker
|
| 178 | [13:14:00] [main/DEBUG] [mixin]: Scanning file:/jolokia/jolokia.jar for mixin tweaker
|
| 179 | [13:14:00] [main/DEBUG] [mixin]: Scanning file:/server/./mods/backpacked-1.4.2-1.12.2.jar for mixin tweaker
|
| 180 | [13:14:00] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Bloodmoon-MC1.12.2-1.5.3.jar for mixin tweaker
|
| 181 | [13:14:00] [main/DEBUG] [mixin]: Scanning file:/server/./mods/CTM-MC1.12.2-1.0.2.31.jar for mixin tweaker
|
| 182 | [13:14:00] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLDeobfTweaker
|
| 183 | [13:14:00] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker
|
| 184 | [13:14:00] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker
|
| 185 | [13:14:00] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
|
| 186 | [13:14:00] [main/DEBUG] [FML]: Injecting coremod FMLCorePlugin \{net.minecraftforge.fml.relauncher.FMLCorePlugin\} class transformers
|
| 187 | [13:14:00] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.SideTransformer
|
| 188 | [13:14:00] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[PREINIT]
|
| 189 | [13:14:00] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer
|
| 190 | [13:14:00] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer
|
| 191 | [13:14:00] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer
|
| 192 | [13:14:00] [main/DEBUG] [FML]: Injection complete
|
| 193 | [13:14:00] [main/DEBUG] [FML]: Running coremod plugin for FMLCorePlugin \{net.minecraftforge.fml.relauncher.FMLCorePlugin\}
|
| 194 | [13:14:00] [main/DEBUG] [FML]: Running coremod plugin FMLCorePlugin
|
| 195 | [13:14:10] [main/DEBUG] [FML]: Read 1154 binary patches
|
| 196 | [13:14:11] [main/DEBUG] [FML]: Loading deobfuscation resource /deobfuscation_data-1.12.2.lzma with 36076 records
|
| 197 | [13:14:14] [main/INFO] [FML]: Found valid fingerprint for Minecraft Forge. Certificate fingerprint e3c3d50c7c986df74c645c0ac54639741c90a557
|
| 198 | [13:14:14] [main/DEBUG] [FML]: Coremod plugin class FMLCorePlugin run successfully
|
| 199 | [13:14:14] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
|
| 200 | [13:14:14] [main/DEBUG] [FML]: Injecting coremod FMLForgePlugin \{net.minecraftforge.classloading.FMLForgePlugin\} class transformers
|
| 201 | [13:14:14] [main/DEBUG] [FML]: Injection complete
|
| 202 | [13:14:14] [main/DEBUG] [FML]: Running coremod plugin for FMLForgePlugin \{net.minecraftforge.classloading.FMLForgePlugin\}
|
| 203 | [13:14:14] [main/DEBUG] [FML]: Running coremod plugin FMLForgePlugin
|
| 204 | [13:14:14] [main/DEBUG] [FML]: Coremod plugin class FMLForgePlugin run successfully
|
| 205 | [13:14:14] [main/INFO] [LaunchWrapper]: Calling tweak class org.spongepowered.asm.launch.MixinTweaker
|
| 206 | [13:14:14] [main/DEBUG] [mixin]: Processing prepare() for PlatformAgent[MixinPlatformAgentFML:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
|
| 207 | [13:14:14] [main/DEBUG] [mixin]: Processing prepare() for PlatformAgent[MixinPlatformAgentDefault:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
|
| 208 | [13:14:14] [main/DEBUG] [mixin]: Processing launch tasks for PlatformAgent[MixinPlatformAgentFML:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
|
| 209 | [13:14:14] [main/DEBUG] [mixin]: Creating FML remapper adapter: org.spongepowered.asm.bridge.RemapperAdapterFML
|
| 210 | [13:14:14] [main/INFO] [mixin]: Initialised Mixin FML Remapper Adapter with net.minecraftforge.fml.common.asm.transformers.deobf.FMLDeobfuscatingRemapper@29852487
|
| 211 | [13:14:14] [main/DEBUG] [mixin]: Processing launch tasks for PlatformAgent[MixinPlatformAgentDefault:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
|
| 212 | [13:14:14] [main/DEBUG] [mixin]: Scanning file:/server/forge.jar for mixin tweaker
|
| 213 | [13:14:14] [main/DEBUG] [mixin]: Scanning file:/jolokia/jolokia.jar for mixin tweaker
|
| 214 | [13:14:14] [main/DEBUG] [mixin]: Scanning file:/server/./mods/backpacked-1.4.2-1.12.2.jar for mixin tweaker
|
| 215 | [13:14:14] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Bloodmoon-MC1.12.2-1.5.3.jar for mixin tweaker
|
| 216 | [13:14:14] [main/DEBUG] [mixin]: Scanning file:/server/./mods/CTM-MC1.12.2-1.0.2.31.jar for mixin tweaker
|
| 217 | [13:14:14] [main/DEBUG] [mixin]: Scanning asmgen:/ for mixin tweaker
|
| 218 | [13:14:14] [main/DEBUG] [mixin]: inject() running with 1 agents
|
| 219 | [13:14:14] [main/DEBUG] [mixin]: Processing inject() for PlatformAgent[MixinPlatformAgentFML:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
|
| 220 | [13:14:14] [main/DEBUG] [mixin]: FML agent is co-initiralising coremod instance PhosphorFMLLoadingPlugin {[]} for file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
|
| 221 | [13:14:14] [main/DEBUG] [FML]: Injecting coremod PhosphorFMLLoadingPlugin \{me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin\} class transformers
|
| 222 | [13:14:14] [main/DEBUG] [FML]: Injection complete
|
| 223 | [13:14:14] [main/DEBUG] [FML]: Running coremod plugin for PhosphorFMLLoadingPlugin \{me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin\}
|
| 224 | [13:14:14] [main/DEBUG] [FML]: Running coremod plugin PhosphorFMLLoadingPlugin
|
| 225 | [13:14:14] [main/DEBUG] [Phosphor Forge Core]: Success! Phosphor has been called into from Forge... initializing Mixin environment and configurations
|
| 226 | [13:14:15] [main/INFO] [mixin]: Compatibility level set to JAVA_8
|
| 227 | [13:14:15] [main/DEBUG] [FML]: Coremod plugin class PhosphorFMLLoadingPlugin run successfully
|
| 228 | [13:14:15] [main/DEBUG] [mixin]: Processing inject() for PlatformAgent[MixinPlatformAgentDefault:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
|
| 229 | [13:14:15] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLDeobfTweaker
|
| 230 | [13:14:15] [main/DEBUG] [FML]: Loaded 215 rules from AccessTransformer config file forge_at.cfg
|
| 231 | [13:14:15] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file ./mods/EnderStorage-1.12.2-2.4.6.137-universal.jar!META-INF/es_at.cfg
|
| 232 |
|
| 233 | [13:14:15] [main/DEBUG] [FML]: Loaded 46 rules from AccessTransformer mod jar file ./mods/CodeChickenLib-1.12.2-3.2.3.358-universal.jar!META-INF/ccl_at.cfg
|
| 234 |
|
| 235 | [13:14:15] [main/DEBUG] [FML]: Loaded 4 rules from AccessTransformer mod jar file ./mods/DrZharks MoCreatures Mod-12.0.5.jar!META-INF/mocreatures_at.cfg
|
| 236 |
|
| 237 | [13:14:15] [main/DEBUG] [FML]: Loaded 9 rules from AccessTransformer mod jar file ./mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar!META-INF/orbis-lib_at.cfg
|
| 238 |
|
| 239 | [13:14:15] [main/DEBUG] [FML]: Loaded 8 rules from AccessTransformer mod jar file ./mods/Chisel-MC1.12.2-1.0.2.45.jar!META-INF/chisel_at.cfg
|
| 240 |
|
| 241 | [13:14:15] [main/DEBUG] [FML]: Loaded 20 rules from AccessTransformer mod jar file ./mods/NotEnoughItems-1.12.2-2.4.3.245-universal.jar!META-INF/nei_at.cfg
|
| 242 |
|
| 243 | [13:14:15] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file ./mods/FastFurnace-1.12.2-1.3.1.jar!META-INF/fastfurnace_at.cfg
|
| 244 |
|
| 245 | [13:14:15] [main/DEBUG] [FML]: Loaded 29 rules from AccessTransformer mod jar file ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar!META-INF/aether_at.cfg
|
| 246 |
|
| 247 | [13:14:15] [main/DEBUG] [FML]: Loaded 3 rules from AccessTransformer mod jar file ./mods/Bloodmoon-MC1.12.2-1.5.3.jar!META-INF/Bloodmoon_at.cfg
|
| 248 |
|
| 249 | [13:14:15] [main/DEBUG] [FML]: Loaded 4 rules from AccessTransformer mod jar file ./mods/CustomMobSpawner-3.11.5.jar!META-INF/customspawner_at.cfg
|
| 250 |
|
| 251 | [13:14:15] [main/DEBUG] [FML]: Loaded 3 rules from AccessTransformer mod jar file ./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar!META-INF/phosphor_at.cfg
|
| 252 |
|
| 253 | [13:14:15] [main/DEBUG] [FML]: Loaded 13 rules from AccessTransformer mod jar file ./mods/jei_1.12.2-4.16.1.302.jar!META-INF/jei_at.cfg
|
| 254 |
|
| 255 | [13:14:15] [main/DEBUG] [FML]: Loaded 4 rules from AccessTransformer mod jar file ./mods/Placebo-1.12.2-1.6.0.jar!META-INF/placebo_at.cfg
|
| 256 |
|
| 257 | [13:14:15] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file ./mods/Decocraft-2.6.3_1.12.2.jar!META-INF/decocraft_at.cfg
|
| 258 |
|
| 259 | [13:14:15] [main/DEBUG] [FML]: Loaded 5 rules from AccessTransformer mod jar file ./mods/CTM-MC1.12.2-1.0.2.31.jar!META-INF/ctm_at.cfg
|
| 260 |
|
| 261 | [13:14:15] [main/DEBUG] [FML]: Loaded 11 rules from AccessTransformer mod jar file ./mods/Schematica-1.12.2-1.8.0.169-universal.jar!META-INF/schematica_at.cfg
|
| 262 |
|
| 263 | [13:14:15] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #2
|
| 264 | [13:14:15] [main/DEBUG] [FML]: Validating minecraft
|
| 265 | [13:14:15] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[INIT]
|
| 266 | [13:14:17] [main/DEBUG] [FML]: Minecraft validated, launching...
|
| 267 | [13:14:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
|
| 268 | [13:14:17] [main/DEBUG] [FML]: Injecting coremod Backpacked \{com.mrcrayfish.backpacked.asm.BackpackedPlugin\} class transformers
|
| 269 | [13:14:17] [main/TRACE] [FML]: Registering transformer com.mrcrayfish.backpacked.asm.BackpackedTransformer
|
| 270 | [13:14:17] [main/DEBUG] [FML]: Injection complete
|
| 271 | [13:14:17] [main/DEBUG] [FML]: Running coremod plugin for Backpacked \{com.mrcrayfish.backpacked.asm.BackpackedPlugin\}
|
| 272 | [13:14:17] [main/DEBUG] [FML]: Running coremod plugin Backpacked
|
| 273 | [13:14:17] [main/DEBUG] [FML]: Coremod plugin class BackpackedPlugin run successfully
|
| 274 | [13:14:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
|
| 275 | [13:14:17] [main/DEBUG] [FML]: Injecting coremod LoadingPlugin \{lumien.bloodmoon.asm.LoadingPlugin\} class transformers
|
| 276 | [13:14:17] [main/TRACE] [FML]: Registering transformer lumien.bloodmoon.asm.ClassTransformer
|
| 277 | [13:14:17] [main/DEBUG] [FML]: Injection complete
|
| 278 | [13:14:17] [main/DEBUG] [FML]: Running coremod plugin for LoadingPlugin \{lumien.bloodmoon.asm.LoadingPlugin\}
|
| 279 | [13:14:17] [main/DEBUG] [FML]: Running coremod plugin LoadingPlugin
|
| 280 | [13:14:17] [main/DEBUG] [FML]: Coremod plugin class LoadingPlugin run successfully
|
| 281 | [13:14:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
|
| 282 | [13:14:17] [main/DEBUG] [FML]: Injecting coremod CTMCorePlugin \{team.chisel.ctm.client.asm.CTMCorePlugin\} class transformers
|
| 283 | [13:14:17] [main/TRACE] [FML]: Registering transformer team.chisel.ctm.client.asm.CTMTransformer
|
| 284 | [13:14:17] [main/DEBUG] [FML]: Injection complete
|
| 285 | [13:14:17] [main/DEBUG] [FML]: Running coremod plugin for CTMCorePlugin \{team.chisel.ctm.client.asm.CTMCorePlugin\}
|
| 286 | [13:14:17] [main/DEBUG] [FML]: Running coremod plugin CTMCorePlugin
|
| 287 | [13:14:17] [main/DEBUG] [FML]: Coremod plugin class CTMCorePlugin run successfully
|
| 288 | [13:14:17] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.TerminalTweaker
|
| 289 | [13:14:17] [main/INFO] [LaunchWrapper]: Loading tweak class name org.spongepowered.asm.mixin.EnvironmentStateTweaker
|
| 290 | [13:14:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.TerminalTweaker
|
| 291 | [13:14:17] [main/INFO] [LaunchWrapper]: Calling tweak class org.spongepowered.asm.mixin.EnvironmentStateTweaker
|
| 292 | [13:14:17] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #3
|
| 293 | [13:14:18] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[DEFAULT]
|
| 294 | [13:14:18] [main/DEBUG] [mixin]: Selecting config mixins.phosphor.json
|
| 295 | [13:14:18] [main/DEBUG] [Phosphor Plugin]: Loading configuration
|
| 296 | [13:14:18] [main/DEBUG] [mixin]: Preparing mixins.phosphor.json (9)
|
| 297 | [13:14:18] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
|
| 298 | [13:14:18] [main/DEBUG] [mixin]: Rebuilding transformer delegation list:
|
| 299 | [13:14:18] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
|
| 300 | [13:14:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PatchingTransformer
|
| 301 | [13:14:18] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
|
| 302 | [13:14:18] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SideTransformer
|
| 303 | [13:14:18] [main/DEBUG] [mixin]: Excluding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer
|
| 304 | [13:14:18] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer
|
| 305 | [13:14:18] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer
|
| 306 | [13:14:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
|
| 307 | [13:14:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.AccessTransformer
|
| 308 | [13:14:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ModAccessTransformer
|
| 309 | [13:14:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemStackTransformer
|
| 310 | [13:14:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockTransformer
|
| 311 | [13:14:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockSpecialTransformer
|
| 312 | [13:14:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PotionEffectTransformer
|
| 313 | [13:14:18] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
|
| 314 | [13:14:18] [main/DEBUG] [mixin]: Adding: $wrapper.com.mrcrayfish.backpacked.asm.BackpackedTransformer
|
| 315 | [13:14:18] [main/DEBUG] [mixin]: Adding: $wrapper.lumien.bloodmoon.asm.ClassTransformer
|
| 316 | [13:14:18] [main/DEBUG] [mixin]: Adding: $wrapper.team.chisel.ctm.client.asm.CTMTransformer
|
| 317 | [13:14:18] [main/DEBUG] [mixin]: Excluding: net.minecraftforge.fml.common.asm.transformers.TerminalTransformer
|
| 318 | [13:14:18] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
|
| 319 | [13:14:18] [main/DEBUG] [mixin]: Transformer delegation list created with 14 entries
|
| 320 | [13:14:19] [main/DEBUG] [Phosphor Plugin]: Disabled patch 'me.jellysquid.mods.phosphor.mixins.lighting.client.MixinMinecraft' because it targets an client-side class unavailable in the current environment
|
| 321 | [13:14:19] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/storage/AnvilChunkLoader to metadata cache
|
| 322 | [13:14:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/Chunk to metadata cache
|
| 323 | [13:14:20] [main/DEBUG] [Phosphor Plugin]: Disabled patch 'me.jellysquid.mods.phosphor.mixins.lighting.common.MixinChunk$Sponge' because we are in a standard Vanilla/Forge environment
|
| 324 | [13:14:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/gen/ChunkProviderServer to metadata cache
|
| 325 | [13:14:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/storage/ExtendedBlockStorage to metadata cache
|
| 326 | [13:14:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/network/play/server/SPacketChunkData to metadata cache
|
| 327 | [13:14:20] [main/DEBUG] [Bloodmoon]: Found World Class: net/minecraft/world/World
|
| 328 | [13:14:20] [main/INFO] [mixin]: A re-entrant transformer '$wrapper.lumien.bloodmoon.asm.ClassTransformer' was detected and will no longer process meta class data
|
| 329 | [13:14:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/World to metadata cache
|
| 330 | [13:14:20] [main/DEBUG] [mixin]: Rebuilding transformer delegation list:
|
| 331 | [13:14:20] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
|
| 332 | [13:14:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PatchingTransformer
|
| 333 | [13:14:20] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
|
| 334 | [13:14:20] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SideTransformer
|
| 335 | [13:14:20] [main/DEBUG] [mixin]: Excluding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer
|
| 336 | [13:14:20] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer
|
| 337 | [13:14:20] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer
|
| 338 | [13:14:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
|
| 339 | [13:14:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.AccessTransformer
|
| 340 | [13:14:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ModAccessTransformer
|
| 341 | [13:14:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemStackTransformer
|
| 342 | [13:14:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockTransformer
|
| 343 | [13:14:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockSpecialTransformer
|
| 344 | [13:14:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PotionEffectTransformer
|
| 345 | [13:14:20] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
|
| 346 | [13:14:20] [main/DEBUG] [mixin]: Adding: $wrapper.com.mrcrayfish.backpacked.asm.BackpackedTransformer
|
| 347 | [13:14:20] [main/DEBUG] [mixin]: Excluding: $wrapper.lumien.bloodmoon.asm.ClassTransformer
|
| 348 | [13:14:20] [main/DEBUG] [mixin]: Adding: $wrapper.team.chisel.ctm.client.asm.CTMTransformer
|
| 349 | [13:14:20] [main/DEBUG] [mixin]: Excluding: net.minecraftforge.fml.common.asm.transformers.TerminalTransformer
|
| 350 | [13:14:20] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
|
| 351 | [13:14:20] [main/DEBUG] [mixin]: Transformer delegation list created with 13 entries
|
| 352 | [13:14:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/Chunk$EnumCreateEntityType to metadata cache
|
| 353 | [13:14:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/EnumFacing$Plane to metadata cache
|
| 354 | [13:14:20] [main/DEBUG] [mixin]: Prepared 7 mixins in 2.142 sec (306.0ms avg) (7ms load, 915ms transform, 0ms plugin)
|
| 355 | [13:14:21] [main/DEBUG] [Bloodmoon]: Found World Class: net/minecraft/world/World
|
| 356 | [13:14:21] [main/DEBUG] [mixin]: Mixing common.MixinWorld from mixins.phosphor.json into net.minecraft.world.World
|
| 357 | [13:14:21] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/ILightingEngineProvider to metadata cache
|
| 358 | [13:14:21] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/mod/world/lighting/LightingEngine to metadata cache
|
| 359 | [13:14:21] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/ILightingEngine to metadata cache
|
| 360 | [13:14:21] [main/TRACE] [mixin]: Added class metadata for java/lang/Boolean to metadata cache
|
| 361 | [13:14:21] [main/TRACE] [mixin]: Added class metadata for java/io/Serializable to metadata cache
|
| 362 | [13:14:21] [main/TRACE] [mixin]: Added class metadata for java/lang/Comparable to metadata cache
|
| 363 | [13:14:21] [main/TRACE] [mixin]: Added class metadata for org/spongepowered/asm/mixin/injection/callback/CallbackInfoReturnable to metadata cache
|
| 364 | [13:14:21] [main/TRACE] [mixin]: Added class metadata for org/spongepowered/asm/mixin/injection/callback/CallbackInfo to metadata cache
|
| 365 | [13:14:21] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/EnumSkyBlock to metadata cache
|
| 366 | [13:14:21] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/math/BlockPos to metadata cache
|
| 367 | [13:14:23] [main/INFO] [STDOUT]: [com.mrcrayfish.backpacked.asm.BackpackedTransformer:patch:68]: [Backpacked] Starting to patch: net.minecraft.entity.player.EntityPlayer#<init>(Lnet/minecraft/world/World;Lcom/mojang/authlib/GameProfile;)V
|
| 368 | [13:14:23] [main/INFO] [STDOUT]: [com.mrcrayfish.backpacked.asm.BackpackedTransformer:patch:71]: [Backpacked] Successfully patched: net.minecraft.entity.player.EntityPlayer#<init>(Lnet/minecraft/world/World;Lcom/mojang/authlib/GameProfile;)V
|
| 369 | [13:14:24] [main/INFO] [LaunchWrapper]: Launching wrapped minecraft {net.minecraft.server.MinecraftServer}
|
| 370 | [13:14:25] [main/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:preTransform:230]: Transforming Class [net.minecraft.block.Block], Method [getExtendedState]
|
| 371 | [13:14:25] [main/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:finishTransform:242]: Transforming net.minecraft.block.Block Finished.
|
| 372 | [13:14:43] [main/DEBUG] [FML]: Creating vanilla freeze snapshot
|
| 373 | [13:14:44] [main/DEBUG] [FML]: Vanilla freeze snapshot created
|
| 374 | [13:14:44] [main/DEBUG] [mixin]: Mixing common.MixinAnvilChunkLoader from mixins.phosphor.json into net.minecraft.world.chunk.storage.AnvilChunkLoader
|
| 375 | [13:14:44] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/mod/world/lighting/LightingHooks to metadata cache
|
| 376 | [13:14:44] [main/TRACE] [mixin]: Added class metadata for net/minecraft/nbt/NBTTagCompound to metadata cache
|
| 377 | [13:14:44] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/IChunkLightingData to metadata cache
|
| 378 | [13:14:44] [main/TRACE] [mixin]: Added class metadata for java/lang/Exception to metadata cache
|
| 379 | [13:14:44] [main/TRACE] [mixin]: Added class metadata for java/lang/Throwable to metadata cache
|
| 380 | [13:14:44] [main/TRACE] [mixin]: Added class metadata for net/minecraft/nbt/NBTBase to metadata cache
|
| 381 | [13:14:49] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Starting minecraft server version 1.12.2
|
| 382 | [13:14:49] [Server thread/INFO] [FML]: MinecraftForge v14.23.5.2855 Initialized
|
| 383 | [13:14:49] [Server thread/INFO] [FML]: Starts to replace vanilla recipe ingredients with ore ingredients.
|
| 384 | [13:14:51] [Server thread/INFO] [FML]: Invalid recipe found with multiple oredict ingredients in the same ingredient...
|
| 385 | [13:14:52] [Server thread/INFO] [FML]: Replaced 1227 ore ingredients
|
| 386 | [13:14:53] [Server thread/DEBUG] [FML]: File /server/config/injectedDependencies.json not found. No dependencies injected
|
| 387 | [13:14:54] [Server thread/DEBUG] [FML]: Building injected Mod Containers [net.minecraftforge.fml.common.FMLContainer, net.minecraftforge.common.ForgeModContainer, com.mrcrayfish.backpacked.Backpacked]
|
| 388 | [13:14:54] [Server thread/DEBUG] [FML]: Attempting to load mods contained in the minecraft jar file and associated classes
|
| 389 | [13:14:54] [Server thread/DEBUG] [FML]: Found a minecraft related file at /server/forge.jar, examining for mod candidates
|
| 390 | [13:14:54] [Server thread/DEBUG] [FML]: Found a minecraft related file at /jolokia/jolokia.jar, examining for mod candidates
|
| 391 | [13:14:54] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/backpacked-1.4.2-1.12.2.jar
|
| 392 | [13:14:54] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/Bloodmoon-MC1.12.2-1.5.3.jar
|
| 393 | [13:14:54] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/CTM-MC1.12.2-1.0.2.31.jar
|
| 394 | [13:14:54] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
|
| 395 | [13:14:54] [Server thread/DEBUG] [FML]: Minecraft jar mods loaded successfully
|
| 396 | [13:14:54] [Server thread/INFO] [FML]: Searching /server/./mods for mods
|
| 397 | [13:14:54] [Server thread/DEBUG] [FML]: Adding PTRLib-1.0.4.jar to the mod list
|
| 398 | [13:14:54] [Server thread/DEBUG] [FML]: Adding jei_1.12.2-4.16.1.302.jar to the mod list
|
| 399 | [13:14:54] [Server thread/DEBUG] [FML]: Adding Blocklings 6.0.1_b - 1.12.2.jar to the mod list
|
| 400 | [13:14:54] [Server thread/DEBUG] [FML]: Adding aether_ii-1.12.2-0.3.0+build411-universal.jar to the mod list
|
| 401 | [13:14:54] [Server thread/DEBUG] [FML]: Adding Placebo-1.12.2-1.6.0.jar to the mod list
|
| 402 | [13:14:54] [Server thread/DEBUG] [FML]: Adding EnderStorage-1.12.2-2.4.6.137-universal.jar to the mod list
|
| 403 | [13:14:54] [Server thread/DEBUG] [FML]: Adding CustomMobSpawner-3.11.5.jar to the mod list
|
| 404 | [13:14:54] [Server thread/DEBUG] [FML]: Adding Decocraft-2.6.3_1.12.2.jar to the mod list
|
| 405 | [13:14:54] [Server thread/DEBUG] [FML]: Adding ironchest-1.12.2-7.0.72.847.jar to the mod list
|
| 406 | [13:14:54] [Server thread/DEBUG] [FML]: Adding CosmicArmoury-1.6.55.jar to the mod list
|
| 407 | [13:14:54] [Server thread/DEBUG] [FML]: Adding CTM-MC1.12.2-1.0.2.31.jar to the mod list
|
| 408 | [13:14:54] [Server thread/DEBUG] [FML]: Adding NotEnoughItems-1.12.2-2.4.3.245-universal.jar to the mod list
|
| 409 | [13:14:54] [Server thread/DEBUG] [FML]: Adding AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar to the mod list
|
| 410 | [13:14:54] [Server thread/DEBUG] [FML]: Adding SimplyJetpacks2-1.12.2-2.2.19.0.jar to the mod list
|
| 411 | [13:14:54] [Server thread/DEBUG] [FML]: Adding Bloodmoon-MC1.12.2-1.5.3.jar to the mod list
|
| 412 | [13:14:54] [Server thread/DEBUG] [FML]: Adding backpacked-1.4.2-1.12.2.jar to the mod list
|
| 413 | [13:14:54] [Server thread/DEBUG] [FML]: Adding DoomlikeDungeons-1.13.2-MC1.12.2.jar to the mod list
|
| 414 | [13:14:54] [Server thread/DEBUG] [FML]: Adding FastFurnace-1.12.2-1.3.1.jar to the mod list
|
| 415 | [13:14:54] [Server thread/DEBUG] [FML]: Adding Schematics-1.12.2.12.jar to the mod list
|
| 416 | [13:14:54] [Server thread/DEBUG] [FML]: Adding LunatriusCore-1.12.2-1.2.0.42-universal.jar to the mod list
|
| 417 | [13:14:54] [Server thread/DEBUG] [FML]: Adding Netherending-Ores-1.12.2-1.4.2.jar to the mod list
|
| 418 | [13:14:54] [Server thread/DEBUG] [FML]: Adding DrZharks MoCreatures Mod-12.0.5.jar to the mod list
|
| 419 | [13:14:54] [Server thread/DEBUG] [FML]: Adding Schematica-1.12.2-1.8.0.169-universal.jar to the mod list
|
| 420 | [13:14:54] [Server thread/DEBUG] [FML]: Adding Chisel-MC1.12.2-1.0.2.45.jar to the mod list
|
| 421 | [13:14:54] [Server thread/DEBUG] [FML]: Adding UndergroundBiomesConstructs-1.12-1.3.8.jar to the mod list
|
| 422 | [13:14:54] [Server thread/DEBUG] [FML]: Adding CodeChickenLib-1.12.2-3.2.3.358-universal.jar to the mod list
|
| 423 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar
|
| 424 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file aether_ii-1.12.2-0.3.0+build411-universal.jar
|
| 425 | [13:14:54] [Server thread/TRACE] [FML]: Skipping already parsed coremod or tweaker backpacked-1.4.2-1.12.2.jar
|
| 426 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Blocklings 6.0.1_b - 1.12.2.jar
|
| 427 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Bloodmoon-MC1.12.2-1.5.3.jar
|
| 428 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Chisel-MC1.12.2-1.0.2.45.jar
|
| 429 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CodeChickenLib-1.12.2-3.2.3.358-universal.jar
|
| 430 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CosmicArmoury-1.6.55.jar
|
| 431 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CTM-MC1.12.2-1.0.2.31.jar
|
| 432 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CustomMobSpawner-3.11.5.jar
|
| 433 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Decocraft-2.6.3_1.12.2.jar
|
| 434 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file DoomlikeDungeons-1.13.2-MC1.12.2.jar
|
| 435 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file DrZharks MoCreatures Mod-12.0.5.jar
|
| 436 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file EnderStorage-1.12.2-2.4.6.137-universal.jar
|
| 437 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file FastFurnace-1.12.2-1.3.1.jar
|
| 438 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file ironchest-1.12.2-7.0.72.847.jar
|
| 439 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file jei_1.12.2-4.16.1.302.jar
|
| 440 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file LunatriusCore-1.12.2-1.2.0.42-universal.jar
|
| 441 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Netherending-Ores-1.12.2-1.4.2.jar
|
| 442 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file NotEnoughItems-1.12.2-2.4.3.245-universal.jar
|
| 443 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Placebo-1.12.2-1.6.0.jar
|
| 444 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file PTRLib-1.0.4.jar
|
| 445 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Schematica-1.12.2-1.8.0.169-universal.jar
|
| 446 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Schematics-1.12.2.12.jar
|
| 447 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file SimplyJetpacks2-1.12.2-2.2.19.0.jar
|
| 448 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file UndergroundBiomesConstructs-1.12-1.3.8.jar
|
| 449 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file orbis-lib-1.12.2-0.2.0+build411.jar
|
| 450 | [13:14:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file phosphor-1.12.2-0.2.6+build50.jar
|
| 451 | [13:14:54] [Server thread/DEBUG] [FML]: Examining file forge.jar for potential mods
|
| 452 | [13:14:54] [Server thread/DEBUG] [FML]: The mod container forge.jar appears to be missing an mcmod.info file
|
| 453 | [13:14:58] [Server thread/DEBUG] [FML]: Examining file jolokia.jar for potential mods
|
| 454 | [13:14:58] [Server thread/DEBUG] [FML]: The mod container jolokia.jar appears to be missing an mcmod.info file
|
| 455 | [13:14:58] [Server thread/DEBUG] [FML]: Examining file AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar for potential mods
|
| 456 | [13:14:58] [Server thread/TRACE] [FML]: Located mcmod.info file in file AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar
|
| 457 | [13:14:58] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.shinoow.abyssalcraft.AbyssalCraft) - loading
|
| 458 | [13:14:58] [Server thread/TRACE] [FML]: Parsed dependency info for abyssalcraft: Requirements: [forge@[14.23.4.2747,)] After:[forge@[14.23.4.2747,), jei@[4.11.0,)] Before:[]
|
| 459 | [13:14:59] [Server thread/DEBUG] [FML]: Examining file aether_ii-1.12.2-0.3.0+build411-universal.jar for potential mods
|
| 460 | [13:14:59] [Server thread/TRACE] [FML]: Located mcmod.info file in file aether_ii-1.12.2-0.3.0+build411-universal.jar
|
| 461 | [13:15:00] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.gildedgames.aether.common.AetherCore) - loading
|
| 462 | [13:15:00] [Server thread/TRACE] [FML]: Parsed dependency info for aether: Requirements: [forge@[14.23.5.2816,), orbis-lib@[0.2.0,)] After:[orbis-lib@[0.2.0,), forge@[14.23.5.2816,)] Before:[]
|
| 463 | [13:15:01] [Server thread/DEBUG] [FML]: Examining file Blocklings 6.0.1_b - 1.12.2.jar for potential mods
|
| 464 | [13:15:01] [Server thread/TRACE] [FML]: Located mcmod.info file in file Blocklings 6.0.1_b - 1.12.2.jar
|
| 465 | [13:15:01] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.blocklings.main.Blocklings) - loading
|
| 466 | [13:15:01] [Server thread/TRACE] [FML]: Parsed dependency info for blocklings: Requirements: [] After:[] Before:[]
|
| 467 | [13:15:01] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from Blocklings 6.0.1_b - 1.12.2.jar to locate a version number for mod blocklings
|
| 468 | [13:15:01] [Server thread/WARN] [FML]: Mod blocklings is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.0
|
| 469 | [13:15:01] [Server thread/DEBUG] [FML]: Examining file Bloodmoon-MC1.12.2-1.5.3.jar for potential mods
|
| 470 | [13:15:01] [Server thread/TRACE] [FML]: Located mcmod.info file in file Bloodmoon-MC1.12.2-1.5.3.jar
|
| 471 | [13:15:01] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (lumien.bloodmoon.Bloodmoon) - loading
|
| 472 | [13:15:01] [Server thread/TRACE] [FML]: Parsed dependency info for bloodmoon: Requirements: [] After:[] Before:[]
|
| 473 | [13:15:01] [Server thread/DEBUG] [FML]: Examining file Chisel-MC1.12.2-1.0.2.45.jar for potential mods
|
| 474 | [13:15:01] [Server thread/TRACE] [FML]: Located mcmod.info file in file Chisel-MC1.12.2-1.0.2.45.jar
|
| 475 | [13:15:01] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (team.chisel.Chisel) - loading
|
| 476 | [13:15:02] [Server thread/TRACE] [FML]: Parsed dependency info for chisel: Requirements: [forge@[14.23.5.2806,)] After:[forge@[14.23.5.2806,), jei@[4.12.0,5)] Before:[]
|
| 477 | [13:15:02] [Server thread/DEBUG] [FML]: Examining file CodeChickenLib-1.12.2-3.2.3.358-universal.jar for potential mods
|
| 478 | [13:15:02] [Server thread/TRACE] [FML]: Located mcmod.info file in file CodeChickenLib-1.12.2-3.2.3.358-universal.jar
|
| 479 | [13:15:02] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (codechicken.lib.CodeChickenLib) - loading
|
| 480 | [13:15:02] [Server thread/TRACE] [FML]: Parsed dependency info for codechickenlib: Requirements: [forge@[14.23.4.2718,)] After:[forge@[14.23.4.2718,)] Before:[]
|
| 481 | [13:15:02] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from CodeChickenLib-1.12.2-3.2.3.358-universal.jar to locate a version number for mod codechickenlib
|
| 482 | [13:15:02] [Server thread/WARN] [FML]: Mod codechickenlib is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version **.**.**.**
|
| 483 | [13:15:02] [Server thread/DEBUG] [FML]: Examining file CosmicArmoury-1.6.55.jar for potential mods
|
| 484 | [13:15:02] [Server thread/TRACE] [FML]: Located mcmod.info file in file CosmicArmoury-1.6.55.jar
|
| 485 | [13:15:02] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mic.testmod.Main) - loading
|
| 486 | [13:15:02] [Server thread/TRACE] [FML]: Parsed dependency info for miccw: Requirements: [] After:[] Before:[]
|
| 487 | [13:15:02] [Server thread/DEBUG] [FML]: Examining file CTM-MC1.12.2-1.0.2.31.jar for potential mods
|
| 488 | [13:15:02] [Server thread/TRACE] [FML]: Located mcmod.info file in file CTM-MC1.12.2-1.0.2.31.jar
|
| 489 | [13:15:02] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (team.chisel.ctm.CTM) - loading
|
| 490 | [13:15:02] [Server thread/INFO] [FML]: Disabling mod ctm it is client side only.
|
| 491 | [13:15:02] [Server thread/DEBUG] [FML]: Skipping mod team.chisel.ctm.CTM, container opted to not load.
|
| 492 | [13:15:02] [Server thread/DEBUG] [FML]: Examining file CustomMobSpawner-3.11.5.jar for potential mods
|
| 493 | [13:15:02] [Server thread/TRACE] [FML]: Located mcmod.info file in file CustomMobSpawner-3.11.5.jar
|
| 494 | [13:15:02] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (drzhark.customspawner.CustomSpawner) - loading
|
| 495 | [13:15:02] [Server thread/TRACE] [FML]: Parsed dependency info for customspawner: Requirements: [] After:[] Before:[]
|
| 496 | [13:15:02] [Server thread/DEBUG] [FML]: Examining file Decocraft-2.6.3_1.12.2.jar for potential mods
|
| 497 | [13:15:02] [Server thread/TRACE] [FML]: Located mcmod.info file in file Decocraft-2.6.3_1.12.2.jar
|
| 498 | [13:15:03] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mia.props.Props) - loading
|
| 499 | [13:15:03] [Server thread/TRACE] [FML]: Parsed dependency info for props: Requirements: [] After:[ptrmodellib] Before:[]
|
| 500 | [13:15:03] [Server thread/DEBUG] [FML]: Examining file DoomlikeDungeons-1.13.2-MC1.12.2.jar for potential mods
|
| 501 | [13:15:03] [Server thread/TRACE] [FML]: Located mcmod.info file in file DoomlikeDungeons-1.13.2-MC1.12.2.jar
|
| 502 | [13:15:03] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (jaredbgreat.dldungeons.DoomlikeDungeons) - loading
|
| 503 | [13:15:03] [Server thread/TRACE] [FML]: Parsed dependency info for dldungeonsjbg: Requirements: [] After:[] Before:[]
|
| 504 | [13:15:03] [Server thread/DEBUG] [FML]: Examining file DrZharks MoCreatures Mod-12.0.5.jar for potential mods
|
| 505 | [13:15:03] [Server thread/TRACE] [FML]: Located mcmod.info file in file DrZharks MoCreatures Mod-12.0.5.jar
|
| 506 | [13:15:04] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (drzhark.mocreatures.MoCreatures) - loading
|
| 507 | [13:15:04] [Server thread/TRACE] [FML]: Using mcmod dependency info for mocreatures: [] [CustomSpawner] []
|
| 508 | [13:15:04] [Server thread/DEBUG] [FML]: Examining file EnderStorage-1.12.2-2.4.6.137-universal.jar for potential mods
|
| 509 | [13:15:04] [Server thread/TRACE] [FML]: Located mcmod.info file in file EnderStorage-1.12.2-2.4.6.137-universal.jar
|
| 510 | [13:15:04] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (codechicken.enderstorage.EnderStorage) - loading
|
| 511 | [13:15:04] [Server thread/TRACE] [FML]: Parsed dependency info for enderstorage: Requirements: [forge@[14.23.4,), codechickenlib@[3.2.3,)] After:[forge@[14.23.4,), codechickenlib@[3.2.3,)] Before:[]
|
| 512 | [13:15:04] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from EnderStorage-1.12.2-2.4.6.137-universal.jar to locate a version number for mod enderstorage
|
| 513 | [13:15:04] [Server thread/WARN] [FML]: Mod enderstorage is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version **.**.**.**
|
| 514 | [13:15:04] [Server thread/DEBUG] [FML]: Examining file FastFurnace-1.12.2-1.3.1.jar for potential mods
|
| 515 | [13:15:04] [Server thread/TRACE] [FML]: Located mcmod.info file in file FastFurnace-1.12.2-1.3.1.jar
|
| 516 | [13:15:04] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (shadows.fastfurnace.FastFurnace) - loading
|
| 517 | [13:15:04] [Server thread/TRACE] [FML]: Parsed dependency info for fastfurnace: Requirements: [] After:[] Before:[]
|
| 518 | [13:15:04] [Server thread/DEBUG] [FML]: Examining file ironchest-1.12.2-7.0.72.847.jar for potential mods
|
| 519 | [13:15:04] [Server thread/TRACE] [FML]: Located mcmod.info file in file ironchest-1.12.2-7.0.72.847.jar
|
| 520 | [13:15:04] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cpw.mods.ironchest.IronChest) - loading
|
| 521 | [13:15:04] [Server thread/TRACE] [FML]: Parsed dependency info for ironchest: Requirements: [forge@[14.21.0.2359,)] After:[forge@[14.21.0.2359,)] Before:[]
|
| 522 | [13:15:04] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from ironchest-1.12.2-7.0.72.847.jar to locate a version number for mod ironchest
|
| 523 | [13:15:04] [Server thread/DEBUG] [FML]: Found version null for mod ironchest in version.properties, using
|
| 524 | [13:15:04] [Server thread/WARN] [FML]: Mod ironchest is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.12.2-7.0.67.844
|
| 525 | [13:15:04] [Server thread/DEBUG] [FML]: Examining file jei_1.12.2-4.16.1.302.jar for potential mods
|
| 526 | [13:15:04] [Server thread/TRACE] [FML]: Located mcmod.info file in file jei_1.12.2-4.16.1.302.jar
|
| 527 | [13:15:04] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (mezz.jei.JustEnoughItems) - loading
|
| 528 | [13:15:04] [Server thread/TRACE] [FML]: Parsed dependency info for jei: Requirements: [forge@[14.23.5.2816,)] After:[forge@[14.23.5.2816,)] Before:[]
|
| 529 | [13:15:04] [Server thread/DEBUG] [FML]: Examining file LunatriusCore-1.12.2-1.2.0.42-universal.jar for potential mods
|
| 530 | [13:15:04] [Server thread/TRACE] [FML]: Located mcmod.info file in file LunatriusCore-1.12.2-1.2.0.42-universal.jar
|
| 531 | [13:15:04] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.github.lunatrius.core.LunatriusCore) - loading
|
| 532 | [13:15:04] [Server thread/TRACE] [FML]: Using mcmod dependency info for lunatriuscore: [forge@[14.23.0.2491,)] [forge@[14.23.0.2491,)] []
|
| 533 | [13:15:04] [Server thread/DEBUG] [FML]: Examining file Netherending-Ores-1.12.2-1.4.2.jar for potential mods
|
| 534 | [13:15:04] [Server thread/TRACE] [FML]: Located mcmod.info file in file Netherending-Ores-1.12.2-1.4.2.jar
|
| 535 | [13:15:04] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (org.icannt.netherendingores.NetherendingOres) - loading
|
| 536 | [13:15:04] [Server thread/TRACE] [FML]: Parsed dependency info for netherendingores: Requirements: [forge@[14.23.5.2847,)] After:[forge@[14.23.5.2847,), mantle@[1.12-1.3.1,), tconstruct@[1.12.2-2.9.1,), plustic, appliedenergistics2, mekanism@[1.12.2-9.4.13.349,), matteroverdrive, bigreactors, immersiveengineering, waila, wawla, aether, aether_legacy, projectred-exploration] Before:[]
|
| 537 | [13:15:04] [Server thread/DEBUG] [FML]: Examining file NotEnoughItems-1.12.2-2.4.3.245-universal.jar for potential mods
|
| 538 | [13:15:04] [Server thread/TRACE] [FML]: Located mcmod.info file in file NotEnoughItems-1.12.2-2.4.3.245-universal.jar
|
| 539 | [13:15:05] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (codechicken.nei.NotEnoughItems) - loading
|
| 540 | [13:15:05] [Server thread/TRACE] [FML]: Parsed dependency info for nei: Requirements: [jei@[4.12.0.+.,), forge@[14.23.5.2768,), codechickenlib@[3.2.3,)] After:[codechickenlib@[3.2.3,), jei@[4.12.0.+.,), forge@[14.23.5.2768,)] Before:[]
|
| 541 | [13:15:05] [Server thread/DEBUG] [FML]: Examining file Placebo-1.12.2-1.6.0.jar for potential mods
|
| 542 | [13:15:05] [Server thread/TRACE] [FML]: Located mcmod.info file in file Placebo-1.12.2-1.6.0.jar
|
| 543 | [13:15:05] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (shadows.placebo.Placebo) - loading
|
| 544 | [13:15:05] [Server thread/TRACE] [FML]: Parsed dependency info for placebo: Requirements: [] After:[] Before:[]
|
| 545 | [13:15:05] [Server thread/DEBUG] [FML]: Examining file PTRLib-1.0.4.jar for potential mods
|
| 546 | [13:15:05] [Server thread/TRACE] [FML]: Located mcmod.info file in file PTRLib-1.0.4.jar
|
| 547 | [13:15:05] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mia.craftstudio.minecraft.forge.CSLibMod) - loading
|
| 548 | [13:15:05] [Server thread/INFO] [FML]: Disabling mod ptrmodellib it is client side only.
|
| 549 | [13:15:05] [Server thread/DEBUG] [FML]: Skipping mod com.mia.craftstudio.minecraft.forge.CSLibMod, container opted to not load.
|
| 550 | [13:15:05] [Server thread/DEBUG] [FML]: Examining file Schematica-1.12.2-1.8.0.169-universal.jar for potential mods
|
| 551 | [13:15:05] [Server thread/TRACE] [FML]: Located mcmod.info file in file Schematica-1.12.2-1.8.0.169-universal.jar
|
| 552 | [13:15:05] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.github.lunatrius.schematica.Schematica) - loading
|
| 553 | [13:15:05] [Server thread/TRACE] [FML]: Using mcmod dependency info for schematica: [forge@[14.23.0.2491,), lunatriuscore@[**.**.**.**,)] [forge@[14.23.0.2491,), lunatriuscore@[**.**.**.**,)] []
|
| 554 | [13:15:05] [Server thread/DEBUG] [FML]: Examining file Schematics-1.12.2.12.jar for potential mods
|
| 555 | [13:15:05] [Server thread/TRACE] [FML]: Located mcmod.info file in file Schematics-1.12.2.12.jar
|
| 556 | [13:15:05] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.dyn.schematics.SchematicMod) - loading
|
| 557 | [13:15:05] [Server thread/TRACE] [FML]: Parsed dependency info for schematics: Requirements: [] After:[] Before:[]
|
| 558 | [13:15:05] [Server thread/DEBUG] [FML]: Examining file SimplyJetpacks2-1.12.2-2.2.19.0.jar for potential mods
|
| 559 | [13:15:05] [Server thread/TRACE] [FML]: Located mcmod.info file in file SimplyJetpacks2-1.12.2-2.2.19.0.jar
|
| 560 | [13:15:05] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (tonius.simplyjetpacks.SimplyJetpacks) - loading
|
| 561 | [13:15:05] [Server thread/TRACE] [FML]: Parsed dependency info for simplyjetpacks: Requirements: [] After:[thermalexpansion, thermaldynamics, enderio, redstonearsenal, redstonerepository, immersiveengineering, mekanism] Before:[]
|
| 562 | [13:15:05] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from SimplyJetpacks2-1.12.2-2.2.19.0.jar to locate a version number for mod simplyjetpacks
|
| 563 | [13:15:05] [Server thread/WARN] [FML]: Mod simplyjetpacks is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.12.2-2.2.19.0
|
| 564 | [13:15:05] [Server thread/DEBUG] [FML]: Examining file UndergroundBiomesConstructs-1.12-1.3.8.jar for potential mods
|
| 565 | [13:15:05] [Server thread/TRACE] [FML]: Located mcmod.info file in file UndergroundBiomesConstructs-1.12-1.3.8.jar
|
| 566 | [13:15:05] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (exterminatorjeff.undergroundbiomes.core.UndergroundBiomes) - loading
|
| 567 | [13:15:05] [Server thread/TRACE] [FML]: Using mcmod dependency info for undergroundbiomes: [] [actuallyadditions, forestry, ic2] []
|
| 568 | [13:15:05] [Server thread/DEBUG] [FML]: Examining file orbis-lib-1.12.2-0.2.0+build411.jar for potential mods
|
| 569 | [13:15:05] [Server thread/TRACE] [FML]: Located mcmod.info file in file orbis-lib-1.12.2-0.2.0+build411.jar
|
| 570 | [13:15:05] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.gildedgames.orbis.lib.OrbisLib) - loading
|
| 571 | [13:15:05] [Server thread/TRACE] [FML]: Using mcmod dependency info for orbis-lib: [] [] []
|
| 572 | [13:15:06] [Server thread/DEBUG] [FML]: Examining file phosphor-1.12.2-0.2.6+build50.jar for potential mods
|
| 573 | [13:15:06] [Server thread/TRACE] [FML]: Located mcmod.info file in file phosphor-1.12.2-0.2.6+build50.jar
|
| 574 | [13:15:06] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.jellysquid.mods.phosphor.mod.PhosphorMod) - loading
|
| 575 | [13:15:06] [Server thread/TRACE] [FML]: Parsed dependency info for phosphor-lighting: Requirements: [] After:[neid@[**.**.**.**,), spongeforge@[1.12.2-2838-7.1.7-RC3844,)] Before:[]
|
| 576 | [13:15:07] [Server thread/INFO] [FML]: Forge Mod Loader has identified 30 mods to load
|
| 577 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.entity (owned by abyssalcraft providing AbyssalCraftAPI|Entity) embedded in abyssalcraft
|
| 578 | [13:15:07] [Server thread/DEBUG] [FML]: Found API jaredbgreat.dldungeons.api (owned by DLDungeonsJBG providing DLDungeonsAPI) embedded in dldungeonsjbg
|
| 579 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.github.lunatrius.schematica.api.event (owned by SchematicaAPI providing SchematicaAPI|Events) embedded in schematica
|
| 580 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.integration (owned by abyssalcraft providing AbyssalCraftAPI|Integration) embedded in abyssalcraft
|
| 581 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.biome (owned by abyssalcraft providing AbyssalCraftAPI|Biome) embedded in abyssalcraft
|
| 582 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.item (owned by abyssalcraft providing AbyssalCraftAPI|Item) embedded in abyssalcraft
|
| 583 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.spell (owned by abyssalcraft providing AbyssalCraftAPI|Spell) embedded in abyssalcraft
|
| 584 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.github.lunatrius.schematica.api (owned by Schematica providing SchematicaAPI) embedded in schematica
|
| 585 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.energy.disruption (owned by abyssalcraft providing AbyssalCraftAPI|Disruption) embedded in abyssalcraft
|
| 586 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.transfer (owned by abyssalcraft providing AbyssalCraftAPI|Transfer) embedded in abyssalcraft
|
| 587 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.internal (owned by abyssalcraft providing AbyssalCraftAPI|Internal) embedded in abyssalcraft
|
| 588 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.transfer.caps (owned by abyssalcraft providing AbyssalCraftAPI|TransferCaps) embedded in abyssalcraft
|
| 589 | [13:15:07] [Server thread/DEBUG] [FML]: Found API team.chisel.api (owned by chisel providing Chisel-API) embedded in chisel
|
| 590 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.dimension (owned by abyssalcraft providing AbyssalCraftAPI|Dimension) embedded in abyssalcraft
|
| 591 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.necronomicon (owned by abyssalcraft providing AbyssalCraftAPI|Necronomicon) embedded in abyssalcraft
|
| 592 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.block (owned by abyssalcraft providing AbyssalCraftAPI|Block) embedded in abyssalcraft
|
| 593 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.rending (owned by abyssalcraft providing AbyssalCraftAPI|Rending) embedded in abyssalcraft
|
| 594 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.necronomicon.condition (owned by abyssalcraft providing AbyssalCraftAPI|Condition) embedded in abyssalcraft
|
| 595 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.energy.structure (owned by abyssalcraft providing AbyssalCraftAPI|Structure) embedded in abyssalcraft
|
| 596 | [13:15:07] [Server thread/DEBUG] [FML]: Found API mezz.jei.api (owned by jei providing JustEnoughItemsAPI) embedded in jei
|
| 597 | [13:15:07] [Server thread/DEBUG] [FML]: Found API team.chisel.api.carving (owned by Chisel providing ChiselAPI|Carving) embedded in chisel
|
| 598 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.energy (owned by abyssalcraft providing AbyssalCraftAPI|Energy) embedded in abyssalcraft
|
| 599 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.event (owned by abyssalcraft providing AbyssalCraftAPI|Event) embedded in abyssalcraft
|
| 600 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.ritual (owned by abyssalcraft providing AbyssalCraftAPI|Ritual) embedded in abyssalcraft
|
| 601 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.necronomicon.condition.caps (owned by abyssalcraft providing AbyssalCraftAPI|Caps) embedded in abyssalcraft
|
| 602 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api (owned by abyssalcraft providing AbyssalCraftAPI) embedded in abyssalcraft
|
| 603 | [13:15:07] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.recipe (owned by abyssalcraft providing AbyssalCraftAPI|Recipe) embedded in abyssalcraft
|
| 604 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Integration: owner: abyssalcraft, dependents: []
|
| 605 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API SchematicaAPI: owner: Schematica, dependents: [schematica]
|
| 606 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Caps: owner: abyssalcraft, dependents: []
|
| 607 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Event: owner: abyssalcraft, dependents: []
|
| 608 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Transfer: owner: abyssalcraft, dependents: []
|
| 609 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI: owner: abyssalcraft, dependents: []
|
| 610 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-utils: owner: ctm, dependents: []
|
| 611 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Recipe: owner: abyssalcraft, dependents: []
|
| 612 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|TransferCaps: owner: abyssalcraft, dependents: []
|
| 613 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Rending: owner: abyssalcraft, dependents: []
|
| 614 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Biome: owner: abyssalcraft, dependents: []
|
| 615 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-models: owner: ctm, dependents: []
|
| 616 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Energy: owner: abyssalcraft, dependents: []
|
| 617 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-textures: owner: ctm, dependents: []
|
| 618 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API ChiselAPI|Carving: owner: Chisel, dependents: [chisel]
|
| 619 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Structure: owner: abyssalcraft, dependents: []
|
| 620 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Necronomicon: owner: abyssalcraft, dependents: []
|
| 621 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Disruption: owner: abyssalcraft, dependents: []
|
| 622 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Block: owner: abyssalcraft, dependents: []
|
| 623 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API JustEnoughItemsAPI: owner: jei, dependents: []
|
| 624 | [13:15:07] [Server thread/TRACE] [FML]: Removing upstream parent Schematica from APIContainer{SchematicaAPI|Events:1.1}
|
| 625 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API SchematicaAPI|Events: owner: SchematicaAPI, dependents: [schematica]
|
| 626 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Ritual: owner: abyssalcraft, dependents: []
|
| 627 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API DLDungeonsAPI: owner: DLDungeonsJBG, dependents: [dldungeonsjbg]
|
| 628 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-events: owner: ctm, dependents: []
|
| 629 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Condition: owner: abyssalcraft, dependents: []
|
| 630 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Dimension: owner: abyssalcraft, dependents: []
|
| 631 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API Chisel-API: owner: chisel, dependents: []
|
| 632 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Internal: owner: abyssalcraft, dependents: []
|
| 633 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Spell: owner: abyssalcraft, dependents: []
|
| 634 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api: owner: ctm, dependents: []
|
| 635 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Item: owner: abyssalcraft, dependents: []
|
| 636 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Entity: owner: abyssalcraft, dependents: []
|
| 637 | [13:15:07] [Server thread/DEBUG] [FML]: Creating API container dummy for API CSLib|API: owner: ptrmodellib, dependents: []
|
| 638 | [13:15:07] [Server thread/TRACE] [FML]: Received a system property request ''
|
| 639 | [13:15:07] [Server thread/TRACE] [FML]: System property request managing the state of 0 mods
|
| 640 | [13:15:07] [Server thread/DEBUG] [FML]: After merging, found state information for 0 mods
|
| 641 | [13:15:07] [Server thread/WARN] [FML]: Missing English translation for FML: assets/fml/lang/en_us.lang
|
| 642 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod abyssalcraft
|
| 643 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod aether
|
| 644 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod blocklings
|
| 645 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod bloodmoon
|
| 646 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod chisel
|
| 647 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod codechickenlib
|
| 648 | [13:15:07] [Server thread/WARN] [FML]: Missing English translation for codechickenlib: assets/codechickenlib/lang/en_us.lang
|
| 649 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod miccw
|
| 650 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod customspawner
|
| 651 | [13:15:07] [Server thread/WARN] [FML]: Missing English translation for customspawner: assets/customspawner/lang/en_us.lang
|
| 652 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod props
|
| 653 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod dldungeonsjbg
|
| 654 | [13:15:07] [Server thread/WARN] [FML]: Missing English translation for dldungeonsjbg: assets/dldungeonsjbg/lang/en_us.lang
|
| 655 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod mocreatures
|
| 656 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod enderstorage
|
| 657 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod fastfurnace
|
| 658 | [13:15:07] [Server thread/WARN] [FML]: Missing English translation for fastfurnace: assets/fastfurnace/lang/en_us.lang
|
| 659 | [13:15:07] [Server thread/DEBUG] [FML]: Enabling mod ironchest
|
| 660 | [13:15:08] [Server thread/DEBUG] [FML]: Enabling mod jei
|
| 661 | [13:15:08] [Server thread/DEBUG] [FML]: Enabling mod lunatriuscore
|
| 662 | [13:15:08] [Server thread/WARN] [FML]: Missing English translation for lunatriuscore: assets/lunatriuscore/lang/en_us.lang
|
| 663 | [13:15:08] [Server thread/DEBUG] [FML]: Enabling mod netherendingores
|
| 664 | [13:15:08] [Server thread/DEBUG] [FML]: Enabling mod nei
|
| 665 | [13:15:08] [Server thread/DEBUG] [FML]: Enabling mod placebo
|
| 666 | [13:15:08] [Server thread/WARN] [FML]: Missing English translation for placebo: assets/placebo/lang/en_us.lang
|
| 667 | [13:15:08] [Server thread/DEBUG] [FML]: Enabling mod schematica
|
| 668 | [13:15:08] [Server thread/DEBUG] [FML]: Enabling mod schematics
|
| 669 | [13:15:08] [Server thread/DEBUG] [FML]: Enabling mod simplyjetpacks
|
| 670 | [13:15:08] [Server thread/DEBUG] [FML]: Enabling mod undergroundbiomes
|
| 671 | [13:15:08] [Server thread/DEBUG] [FML]: Enabling mod orbis-lib
|
| 672 | [13:15:08] [Server thread/WARN] [FML]: Missing English translation for orbis-lib: assets/orbis-lib/lang/en_us.lang
|
| 673 | [13:15:08] [Server thread/DEBUG] [FML]: Enabling mod phosphor-lighting
|
| 674 | [13:15:08] [Server thread/WARN] [FML]: Missing English translation for phosphor-lighting: assets/phosphor-lighting/lang/en_us.lang
|
| 675 | [13:15:08] [Server thread/TRACE] [FML]: Verifying mod requirements are satisfied
|
| 676 | [13:15:08] [Server thread/TRACE] [FML]: All mod requirements are satisfied
|
| 677 | [13:15:08] [Server thread/TRACE] [FML]: Sorting mods into an ordered list
|
| 678 | [13:15:08] [Server thread/TRACE] [FML]: Mod sorting completed successfully
|
| 679 | [13:15:08] [Server thread/DEBUG] [FML]: Mod sorting data
|
| 680 | [13:15:08] [Server thread/DEBUG] [FML]: jei(Just Enough Items:**.**.**.**): jei_1.12.2-4.16.1.302.jar (required-after:forge@[14.23.5.2816,);)
|
| 681 | [13:15:08] [Server thread/DEBUG] [FML]: abyssalcraft(AbyssalCraft:2.0.0-ALPHA-2): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar (required-after:forge@[14.23.4.2747,);after:jei@[4.11.0,))
|
| 682 | [13:15:08] [Server thread/DEBUG] [FML]: orbis-lib(OrbisLib:0.2.0): orbis-lib-1.12.2-0.2.0+build411.jar ()
|
| 683 | [13:15:08] [Server thread/DEBUG] [FML]: aether(Aether II:0.3.0): aether_ii-1.12.2-0.3.0+build411-universal.jar (required-after:orbis-lib@[0.2.0,);required-after:forge@[14.23.5.2816,))
|
| 684 | [13:15:08] [Server thread/DEBUG] [FML]: blocklings(Blocklings Mod:1.0): Blocklings 6.0.1_b - 1.12.2.jar ()
|
| 685 | [13:15:08] [Server thread/DEBUG] [FML]: bloodmoon(Bloodmoon:1.5.3): Bloodmoon-MC1.12.2-1.5.3.jar ()
|
| 686 | [13:15:08] [Server thread/DEBUG] [FML]: ChiselAPI|Carving(API: ChiselAPI|Carving:0.0.1): Chisel-MC1.12.2-1.0.2.45.jar ()
|
| 687 | [13:15:08] [Server thread/DEBUG] [FML]: chisel(Chisel:MC1.12.2-1.0.2.45): Chisel-MC1.12.2-1.0.2.45.jar (required-after:forge@[14.23.5.2806,);required-after-client:ctm@[MC1.12.2-1.0.2.31,);after:jei@[4.12.0,5))
|
| 688 | [13:15:08] [Server thread/DEBUG] [FML]: codechickenlib(CodeChicken Lib:**.**.**.**): CodeChickenLib-1.12.2-3.2.3.358-universal.jar (required-after:forge@[14.23.4.2718,))
|
| 689 | [13:15:08] [Server thread/DEBUG] [FML]: miccw(Cosmic Weaponry:1.0): CosmicArmoury-1.6.55.jar ()
|
| 690 | [13:15:08] [Server thread/DEBUG] [FML]: customspawner(DrZhark's CustomSpawner:3.11.4): CustomMobSpawner-3.11.5.jar ()
|
| 691 | [13:15:08] [Server thread/DEBUG] [FML]: props(Decocraft:2.6.3): Decocraft-2.6.3_1.12.2.jar (required-after-client:ptrmodellib@[1.0.3,);after:ptrmodellib)
|
| 692 | [13:15:08] [Server thread/DEBUG] [FML]: DLDungeonsAPI(API: DLDungeonsAPI:1.1): DoomlikeDungeons-1.13.2-MC1.12.2.jar ()
|
| 693 | [13:15:08] [Server thread/DEBUG] [FML]: dldungeonsjbg(Doomlike Dungeons:1.13.2): DoomlikeDungeons-1.13.2-MC1.12.2.jar ()
|
| 694 | [13:15:08] [Server thread/DEBUG] [FML]: mocreatures(DrZhark's Mo'Creatures Mod:12.0.5): DrZharks MoCreatures Mod-12.0.5.jar ()
|
| 695 | [13:15:08] [Server thread/DEBUG] [FML]: enderstorage(EnderStorage:**.**.**.**): EnderStorage-1.12.2-2.4.6.137-universal.jar (required-after:forge@[14.23.4,);required-after:codechickenlib@[3.2.3,);)
|
| 696 | [13:15:08] [Server thread/DEBUG] [FML]: fastfurnace(FastFurnace:1.3.1): FastFurnace-1.12.2-1.3.1.jar ()
|
| 697 | [13:15:08] [Server thread/DEBUG] [FML]: ironchest(Iron Chest:1.12.2-7.0.67.844): ironchest-1.12.2-7.0.72.847.jar (required-after:forge@[14.21.0.2359,))
|
| 698 | [13:15:08] [Server thread/DEBUG] [FML]: lunatriuscore(LunatriusCore:**.**.**.**): LunatriusCore-1.12.2-1.2.0.42-universal.jar ()
|
| 699 | [13:15:08] [Server thread/DEBUG] [FML]: netherendingores(Netherending Ores:1.12.2-1.4.2): Netherending-Ores-1.12.2-1.4.2.jar (required-after:forge@[14.23.5.2847,);after:mantle@[1.12-1.3.1,);after:tconstruct@[1.12.2-2.9.1,);after:plustic;after:appliedenergistics2;after:mekanism@[1.12.2-9.4.13.349,);after:matteroverdrive;after:bigreactors;after:immersiveengineering;after:waila;after:wawla;after:aether;after:aether_legacy;after:projectred-exploration;)
|
| 700 | [13:15:08] [Server thread/DEBUG] [FML]: nei(Not Enough Items:2.4.3): NotEnoughItems-1.12.2-2.4.3.245-universal.jar (required-after:codechickenlib@[3.2.3,);;required-after:jei@[4.12.0.+.,);required-after:forge@[14.23.5.2768,))
|
| 701 | [13:15:08] [Server thread/DEBUG] [FML]: placebo(Placebo:1.6.0): Placebo-1.12.2-1.6.0.jar ()
|
| 702 | [13:15:08] [Server thread/DEBUG] [FML]: SchematicaAPI(API: SchematicaAPI:1.1): Schematica-1.12.2-1.8.0.169-universal.jar ()
|
| 703 | [13:15:08] [Server thread/DEBUG] [FML]: SchematicaAPI|Events(API: SchematicaAPI|Events:1.1): Schematica-1.12.2-1.8.0.169-universal.jar ()
|
| 704 | [13:15:08] [Server thread/DEBUG] [FML]: schematica(Schematica:**.**.**.**): Schematica-1.12.2-1.8.0.169-universal.jar ()
|
| 705 | [13:15:08] [Server thread/DEBUG] [FML]: schematics(Schematics:**.**.**.**): Schematics-1.12.2.12.jar ()
|
| 706 | [13:15:08] [Server thread/DEBUG] [FML]: simplyjetpacks(Simply Jetpacks 2:1.12.2-2.2.19.0): SimplyJetpacks2-1.12.2-2.2.19.0.jar (after:thermalexpansion;after:thermaldynamics;after:enderio;after:redstonearsenal;after:redstonerepository;after:immersiveengineering;after:mekanism;)
|
| 707 | [13:15:08] [Server thread/DEBUG] [FML]: undergroundbiomes(Underground Biomes:1.3.8): UndergroundBiomesConstructs-1.12-1.3.8.jar ()
|
| 708 | [13:15:08] [Server thread/DEBUG] [FML]: phosphor-lighting(Phosphor Lighting Engine:1.12.2-0.2.6): phosphor-1.12.2-0.2.6+build50.jar (after:neid@[**.**.**.**,);after:spongeforge@[1.12.2-2838-7.1.7-RC3844,))
|
| 709 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Integration(API: AbyssalCraftAPI|Integration:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 710 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Caps(API: AbyssalCraftAPI|Caps:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 711 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Event(API: AbyssalCraftAPI|Event:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 712 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Transfer(API: AbyssalCraftAPI|Transfer:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 713 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI(API: AbyssalCraftAPI:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 714 | [13:15:08] [Server thread/DEBUG] [FML]: ctm-api-utils(API: ctm-api-utils:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
|
| 715 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Recipe(API: AbyssalCraftAPI|Recipe:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 716 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|TransferCaps(API: AbyssalCraftAPI|TransferCaps:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 717 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Rending(API: AbyssalCraftAPI|Rending:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 718 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Biome(API: AbyssalCraftAPI|Biome:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 719 | [13:15:08] [Server thread/DEBUG] [FML]: ctm-api-models(API: ctm-api-models:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
|
| 720 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Energy(API: AbyssalCraftAPI|Energy:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 721 | [13:15:08] [Server thread/DEBUG] [FML]: ctm-api-textures(API: ctm-api-textures:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
|
| 722 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Structure(API: AbyssalCraftAPI|Structure:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 723 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Necronomicon(API: AbyssalCraftAPI|Necronomicon:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 724 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Disruption(API: AbyssalCraftAPI|Disruption:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 725 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Block(API: AbyssalCraftAPI|Block:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 726 | [13:15:08] [Server thread/DEBUG] [FML]: JustEnoughItemsAPI(API: JustEnoughItemsAPI:4.13.0): jei_1.12.2-4.16.1.302.jar ()
|
| 727 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Ritual(API: AbyssalCraftAPI|Ritual:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 728 | [13:15:08] [Server thread/DEBUG] [FML]: ctm-api-events(API: ctm-api-events:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
|
| 729 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Condition(API: AbyssalCraftAPI|Condition:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 730 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Dimension(API: AbyssalCraftAPI|Dimension:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 731 | [13:15:08] [Server thread/DEBUG] [FML]: Chisel-API(API: Chisel-API:0.0.1): Chisel-MC1.12.2-1.0.2.45.jar ()
|
| 732 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Internal(API: AbyssalCraftAPI|Internal:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 733 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Spell(API: AbyssalCraftAPI|Spell:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 734 | [13:15:08] [Server thread/DEBUG] [FML]: ctm-api(API: ctm-api:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
|
| 735 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Item(API: AbyssalCraftAPI|Item:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 736 | [13:15:08] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Entity(API: AbyssalCraftAPI|Entity:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
| 737 | [13:15:08] [Server thread/DEBUG] [FML]: CSLib|API(API: CSLib|API:1.0.1): PTRLib-1.0.4.jar ()
|
| 738 | [13:15:08] [Server thread/INFO] [FML]: FML has found a non-mod file CTM-MC1.12.2-1.0.2.31.jar in your mods directory. It will now be injected into your classpath. This could severe stability issues, it should be removed if possible.
|
| 739 | [13:15:08] [Server thread/INFO] [FML]: FML has found a non-mod file PTRLib-1.0.4.jar in your mods directory. It will now be injected into your classpath. This could severe stability issues, it should be removed if possible.
|
| 740 | [13:15:08] [Server thread/DEBUG] [FML]: Loading @Config anotation data
|
| 741 | [13:15:08] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod minecraft
|
| 742 | [13:15:08] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod minecraft
|
| 743 | [13:15:08] [Server thread/DEBUG] [FML]: Bar Step: Construction - Minecraft took 0.002s
|
| 744 | [13:15:08] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mcp
|
| 745 | [13:15:08] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mcp
|
| 746 | [13:15:08] [Server thread/DEBUG] [FML]: Bar Step: Construction - Minecraft Coder Pack took 0.013s
|
| 747 | [13:15:08] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod FML
|
| 748 | [13:15:10] [Server thread/TRACE] [FML]: Mod FML is using network checker : Invoking method checkModLists
|
| 749 | [13:15:10] [Server thread/TRACE] [FML]: Testing mod FML to verify it accepts its own version in a remote connection
|
| 750 | [13:15:10] [Server thread/TRACE] [FML]: The mod FML accepts its own version (**.**.**.**)
|
| 751 | [13:15:10] [Server thread/INFO] [FML]: Attempting connection with missing mods [minecraft, mcp, FML, forge, backpacked, abyssalcraft, aether, blocklings, bloodmoon, chisel, codechickenlib, miccw, customspawner, props, dldungeonsjbg, mocreatures, enderstorage, fastfurnace, ironchest, jei, lunatriuscore, netherendingores, nei, placebo, schematica, schematics, simplyjetpacks, undergroundbiomes, orbis-lib, phosphor-lighting] at CLIENT
|
| 752 | [13:15:10] [Server thread/INFO] [FML]: Attempting connection with missing mods [minecraft, mcp, FML, forge, backpacked, abyssalcraft, aether, blocklings, bloodmoon, chisel, codechickenlib, miccw, customspawner, props, dldungeonsjbg, mocreatures, enderstorage, fastfurnace, ironchest, jei, lunatriuscore, netherendingores, nei, placebo, schematica, schematics, simplyjetpacks, undergroundbiomes, orbis-lib, phosphor-lighting] at SERVER
|
| 753 | [13:15:12] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod FML
|
| 754 | [13:15:12] [Server thread/DEBUG] [FML]: Bar Step: Construction - Forge Mod Loader took 3.150s
|
| 755 | [13:15:12] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod forge
|
| 756 | [13:15:12] [Server thread/DEBUG] [forge]: Loading Vanilla annotations: null
|
| 757 | [13:15:12] [Server thread/DEBUG] [forge]: Preloading CrashReport Classes
|
| 758 | [13:15:12] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable
|
| 759 | [13:15:12] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Alignment
|
| 760 | [13:15:12] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Column
|
| 761 | [13:15:12] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Row
|
| 762 | [13:15:12] [Server thread/DEBUG] [forge]: net/minecraftforge/fml/client/SplashProgress$1
|
| 763 | [13:15:12] [Server thread/DEBUG] [forge]: net/minecraftforge/fml/common/FMLCommonHandler$1
|
| 764 | [13:15:12] [Server thread/DEBUG] [forge]: net/minecraftforge/fml/common/Loader$1
|
| 765 | [13:15:12] [Server thread/TRACE] [FML]: Mod forge is using network checker : No network checking performed
|
| 766 | [13:15:12] [Server thread/TRACE] [FML]: Testing mod forge to verify it accepts its own version in a remote connection
|
| 767 | [13:15:12] [Server thread/TRACE] [FML]: The mod forge accepts its own version (14.23.5.2855)
|
| 768 | [13:15:12] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into forge for type INSTANCE
|
| 769 | [13:15:12] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod forge
|
| 770 | [13:15:12] [Server thread/DEBUG] [FML]: Bar Step: Construction - Minecraft Forge took 0.287s
|
| 771 | [13:15:12] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod backpacked
|
| 772 | [13:15:12] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into backpacked for type INSTANCE
|
| 773 | [13:15:12] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod backpacked
|
| 774 | [13:15:12] [Server thread/DEBUG] [FML]: Bar Step: Construction - Backpacked took 0.052s
|
| 775 | [13:15:12] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod jei
|
| 776 | [13:15:12] [Server thread/TRACE] [FML]: Mod jei is using network checker : Invoking method checkModLists
|
| 777 | [13:15:12] [Server thread/TRACE] [FML]: Testing mod jei to verify it accepts its own version in a remote connection
|
| 778 | [13:15:12] [Server thread/TRACE] [FML]: The mod jei accepts its own version (**.**.**.**)
|
| 779 | [13:15:12] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into jei
|
| 780 | [13:15:12] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for jei
|
| 781 | [13:15:12] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into jei for type INSTANCE
|
| 782 | [13:15:12] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod jei
|
| 783 | [13:15:12] [Server thread/DEBUG] [FML]: Bar Step: Construction - Just Enough Items took 0.333s
|
| 784 | [13:15:12] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod abyssalcraft
|
| 785 | [13:15:16] [Server thread/TRACE] [FML]: Mod abyssalcraft is using network checker : Accepting version 2.0.0-ALPHA-2
|
| 786 | [13:15:16] [Server thread/TRACE] [FML]: Testing mod abyssalcraft to verify it accepts its own version in a remote connection
|
| 787 | [13:15:16] [Server thread/TRACE] [FML]: The mod abyssalcraft accepts its own version (2.0.0-ALPHA-2)
|
| 788 | [13:15:16] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into abyssalcraft
|
| 789 | [13:15:16] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for abyssalcraft
|
| 790 | [13:15:16] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into abyssalcraft for type INSTANCE
|
| 791 | [13:15:16] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod abyssalcraft
|
| 792 | [13:15:16] [Server thread/DEBUG] [FML]: Bar Step: Construction - AbyssalCraft took 3.754s
|
| 793 | [13:15:16] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod orbis-lib
|
| 794 | [13:15:16] [Server thread/TRACE] [FML]: Mod orbis-lib is using network checker : Accepting version 0.2.0
|
| 795 | [13:15:16] [Server thread/TRACE] [FML]: Testing mod orbis-lib to verify it accepts its own version in a remote connection
|
| 796 | [13:15:16] [Server thread/TRACE] [FML]: The mod orbis-lib accepts its own version (0.2.0)
|
| 797 | [13:15:16] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into orbis-lib
|
| 798 | [13:15:16] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for orbis-lib
|
| 799 | [13:15:16] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.orbis.lib.CapabilityManagerOrbisLib for mod orbis-lib
|
| 800 | [13:15:16] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.orbis.lib.CapabilityManagerOrbisLib
|
| 801 | [13:15:16] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.orbis.lib.OrbisLib for mod orbis-lib
|
| 802 | [13:15:16] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.orbis.lib.OrbisLib
|
| 803 | [13:15:16] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into orbis-lib for type INSTANCE
|
| 804 | [13:15:16] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod orbis-lib
|
| 805 | [13:15:16] [Server thread/DEBUG] [FML]: Bar Step: Construction - OrbisLib took 0.313s
|
| 806 | [13:15:16] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod aether
|
| 807 | [13:15:17] [Server thread/TRACE] [FML]: Mod aether is using network checker : Accepting version 0.3.0
|
| 808 | [13:15:17] [Server thread/TRACE] [FML]: Testing mod aether to verify it accepts its own version in a remote connection
|
| 809 | [13:15:17] [Server thread/TRACE] [FML]: The mod aether accepts its own version (0.3.0)
|
| 810 | [13:15:17] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into aether
|
| 811 | [13:15:19] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for aether
|
| 812 | [13:15:19] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerPlaceBlockListener for mod aether
|
| 813 | [13:15:19] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerPlaceBlockListener
|
| 814 | [13:15:19] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerRespawnListener for mod aether
|
| 815 | [13:15:19] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerRespawnListener
|
| 816 | [13:15:19] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.BlocksAetherInit for mod aether
|
| 817 | [13:15:20] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.BlocksAetherInit
|
| 818 | [13:15:20] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.trade.TradeItemPickupListener for mod aether
|
| 819 | [13:15:20] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.trade.TradeItemPickupListener
|
| 820 | [13:15:20] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.capabilities.CapabilityManagerAether for mod aether
|
| 821 | [13:15:20] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.capabilities.CapabilityManagerAether
|
| 822 | [13:15:20] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.world.WorldTickListener for mod aether
|
| 823 | [13:15:21] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.world.WorldTickListener
|
| 824 | [13:15:21] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.world.preparation.PrepEventListener for mod aether
|
| 825 | [13:15:21] [Server thread/DEBUG] [mixin]: Mixing common.MixinChunk from mixins.phosphor.json into net.minecraft.world.chunk.Chunk
|
| 826 | [13:15:21] [Server thread/WARN] [mixin]: Static binding violation: PRIVATE @Overwrite method func_76615_h in mixins.phosphor.json:common.MixinChunk cannot reduce visibiliy of PUBLIC target method, visibility will be upgraded.
|
| 827 | [13:15:21] [Server thread/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/IChunkLighting to metadata cache
|
| 828 | [13:15:21] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/util/math/Vec3i to metadata cache
|
| 829 | [13:15:21] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/WorldProvider to metadata cache
|
| 830 | [13:15:21] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/profiler/Profiler to metadata cache
|
| 831 | [13:15:21] [Server thread/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/mod/world/WorldChunkSlice to metadata cache
|
| 832 | [13:15:21] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/util/EnumFacing to metadata cache
|
| 833 | [13:15:21] [Server thread/TRACE] [mixin]: Added class metadata for java/lang/Math to metadata cache
|
| 834 | [13:15:21] [Server thread/DEBUG] [mixin]: Mixing common.MixinChunk$Vanilla from mixins.phosphor.json into net.minecraft.world.chunk.Chunk
|
| 835 | [13:15:21] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/block/state/IBlockState to metadata cache
|
| 836 | [13:15:21] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/IBlockAccess to metadata cache
|
| 837 | [13:15:21] [Server thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:preTransform:230]: Transforming Class [net.minecraft.block.Block], Method [getExtendedState]
|
| 838 | [13:15:21] [Server thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:finishTransform:242]: Transforming net.minecraft.block.Block Finished.
|
| 839 | [13:15:22] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/block/Block to metadata cache
|
| 840 | [13:15:22] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.world.preparation.PrepEventListener
|
| 841 | [13:15:22] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemToolListener for mod aether
|
| 842 | [13:15:22] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemToolListener
|
| 843 | [13:15:22] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerHealListener for mod aether
|
| 844 | [13:15:22] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerHealListener
|
| 845 | [13:15:22] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerMovementListener for mod aether
|
| 846 | [13:15:22] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerMovementListener
|
| 847 | [13:15:22] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerJoinListener for mod aether
|
| 848 | [13:15:22] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerJoinListener
|
| 849 | [13:15:22] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.RecipesAether for mod aether
|
| 850 | [13:15:22] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.RecipesAether
|
| 851 | [13:15:22] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerAetherListener for mod aether
|
| 852 | [13:15:22] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerAetherListener
|
| 853 | [13:15:22] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemAetherShieldListener for mod aether
|
| 854 | [13:15:22] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemAetherShieldListener
|
| 855 | [13:15:22] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerTeleportListener for mod aether
|
| 856 | [13:15:22] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerTeleportListener
|
| 857 | [13:15:22] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityDeathListener for mod aether
|
| 858 | [13:15:22] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityDeathListener
|
| 859 | [13:15:22] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerAttackListener for mod aether
|
| 860 | [13:15:22] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerAttackListener
|
| 861 | [13:15:22] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerWakeListener for mod aether
|
| 862 | [13:15:22] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerWakeListener
|
| 863 | [13:15:22] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemCrossbowSpecialListener for mod aether
|
| 864 | [13:15:23] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemCrossbowSpecialListener
|
| 865 | [13:15:23] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.ItemsAetherInit for mod aether
|
| 866 | [13:15:23] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.ItemsAetherInit
|
| 867 | [13:15:23] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.capabilities.DamageSystem for mod aether
|
| 868 | [13:15:23] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.capabilities.DamageSystem
|
| 869 | [13:15:23] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.items.weapons.swords.ItemSkyrootSword for mod aether
|
| 870 | [13:15:23] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.items.weapons.swords.ItemSkyrootSword
|
| 871 | [13:15:23] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerMountListener for mod aether
|
| 872 | [13:15:23] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerMountListener
|
| 873 | [13:15:23] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.BiomesAetherInit for mod aether
|
| 874 | [13:15:23] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.BiomesAetherInit
|
| 875 | [13:15:23] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerEatListener for mod aether
|
| 876 | [13:15:23] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerEatListener
|
| 877 | [13:15:23] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityXPListener for mod aether
|
| 878 | [13:15:23] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityXPListener
|
| 879 | [13:15:23] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerEquipItemListener for mod aether
|
| 880 | [13:15:23] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerEquipItemListener
|
| 881 | [13:15:23] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityFallListener for mod aether
|
| 882 | [13:15:23] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityFallListener
|
| 883 | [13:15:23] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.CapabilityAttachListener for mod aether
|
| 884 | [13:15:23] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.CapabilityAttachListener
|
| 885 | [13:15:23] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityJumpListener for mod aether
|
| 886 | [13:15:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityJumpListener
|
| 887 | [13:15:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.trade.TradeInteractListener for mod aether
|
| 888 | [13:15:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.trade.TradeInteractListener
|
| 889 | [13:15:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemBucketEventListener for mod aether
|
| 890 | [13:15:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemBucketEventListener
|
| 891 | [13:15:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemSkyrootSwordListener for mod aether
|
| 892 | [13:15:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemSkyrootSwordListener
|
| 893 | [13:15:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemGlovesListener for mod aether
|
| 894 | [13:15:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemGlovesListener
|
| 895 | [13:15:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.ServerTickListener for mod aether
|
| 896 | [13:15:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.ServerTickListener
|
| 897 | [13:15:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.SoundsAetherInit for mod aether
|
| 898 | [13:15:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.SoundsAetherInit
|
| 899 | [13:15:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.world.WorldFallListener for mod aether
|
| 900 | [13:15:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.world.WorldFallListener
|
| 901 | [13:15:24] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into aether for type INSTANCE
|
| 902 | [13:15:24] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod aether
|
| 903 | [13:15:24] [Server thread/DEBUG] [FML]: Bar Step: Construction - Aether II took 7.717s
|
| 904 | [13:15:24] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod blocklings
|
| 905 | [13:15:24] [Server thread/TRACE] [FML]: Mod blocklings is using network checker : Accepting version 1.0
|
| 906 | [13:15:24] [Server thread/TRACE] [FML]: Testing mod blocklings to verify it accepts its own version in a remote connection
|
| 907 | [13:15:24] [Server thread/TRACE] [FML]: The mod blocklings accepts its own version (1.0)
|
| 908 | [13:15:24] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into blocklings
|
| 909 | [13:15:24] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for blocklings
|
| 910 | [13:15:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.blocklings.items.BlocklingsItems for mod blocklings
|
| 911 | [13:15:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.blocklings.items.BlocklingsItems
|
| 912 | [13:15:24] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into blocklings for type INSTANCE
|
| 913 | [13:15:24] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod blocklings
|
| 914 | [13:15:24] [Server thread/DEBUG] [FML]: Bar Step: Construction - Blocklings Mod took 0.097s
|
| 915 | [13:15:24] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod bloodmoon
|
| 916 | [13:15:24] [Server thread/TRACE] [FML]: Mod bloodmoon is using network checker : Accepting version 1.5.3
|
| 917 | [13:15:24] [Server thread/TRACE] [FML]: Testing mod bloodmoon to verify it accepts its own version in a remote connection
|
| 918 | [13:15:24] [Server thread/TRACE] [FML]: The mod bloodmoon accepts its own version (1.5.3)
|
| 919 | [13:15:24] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into bloodmoon
|
| 920 | [13:15:24] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for bloodmoon
|
| 921 | [13:15:24] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into bloodmoon for type INSTANCE
|
| 922 | [13:15:24] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod bloodmoon
|
| 923 | [13:15:24] [Server thread/DEBUG] [FML]: Bar Step: Construction - Bloodmoon took 0.108s
|
| 924 | [13:15:24] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod chisel
|
| 925 | [13:15:25] [Server thread/TRACE] [FML]: Mod chisel is using network checker : Accepting version MC1.12.2-1.0.2.45
|
| 926 | [13:15:25] [Server thread/TRACE] [FML]: Testing mod chisel to verify it accepts its own version in a remote connection
|
| 927 | [13:15:25] [Server thread/TRACE] [FML]: The mod chisel accepts its own version (MC1.12.2-1.0.2.45)
|
| 928 | [13:15:25] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into chisel
|
| 929 | [13:15:25] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for chisel
|
| 930 | [13:15:25] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for team.chisel.Features for mod chisel
|
| 931 | [13:15:26] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class team.chisel.Features
|
| 932 | [13:15:26] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for team.chisel.common.block.BreakSpeedHandler for mod chisel
|
| 933 | [13:15:26] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class team.chisel.common.block.BreakSpeedHandler
|
| 934 | [13:15:26] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into chisel for type INSTANCE
|
| 935 | [13:15:26] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod chisel
|
| 936 | [13:15:26] [Server thread/DEBUG] [FML]: Bar Step: Construction - Chisel took 1.516s
|
| 937 | [13:15:26] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod codechickenlib
|
| 938 | [13:15:26] [Server thread/TRACE] [FML]: Mod codechickenlib is using network checker : Accepting version **.**.**.**
|
| 939 | [13:15:26] [Server thread/TRACE] [FML]: Testing mod codechickenlib to verify it accepts its own version in a remote connection
|
| 940 | [13:15:26] [Server thread/TRACE] [FML]: The mod codechickenlib accepts its own version (**.**.**.**)
|
| 941 | [13:15:26] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into codechickenlib
|
| 942 | [13:15:27] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for codechickenlib
|
| 943 | [13:15:27] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for codechicken.lib.configuration.ConfigSyncManager for mod codechickenlib
|
| 944 | [13:15:28] [Server thread/INFO] [STDOUT]: [com.mrcrayfish.backpacked.asm.BackpackedTransformer:patch:68]: [Backpacked] Starting to patch: net.minecraft.network.NetHandlerPlayServer#processCreativeInventoryAction(Lnet/minecraft/network/play/client/CPacketCreativeInventoryAction;)V
|
| 945 | [13:15:28] [Server thread/INFO] [STDOUT]: [com.mrcrayfish.backpacked.asm.BackpackedTransformer:patch:71]: [Backpacked] Successfully patched: net.minecraft.network.NetHandlerPlayServer#processCreativeInventoryAction(Lnet/minecraft/network/play/client/CPacketCreativeInventoryAction;)V
|
| 946 | [13:15:28] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class codechicken.lib.configuration.ConfigSyncManager
|
| 947 | [13:15:28] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for codechicken.lib.internal.CCLLog for mod codechickenlib
|
| 948 | [13:15:28] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class codechicken.lib.internal.CCLLog
|
| 949 | [13:15:28] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into codechickenlib for type INSTANCE
|
| 950 | [13:15:28] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod codechickenlib
|
| 951 | [13:15:28] [Server thread/DEBUG] [FML]: Bar Step: Construction - CodeChicken Lib took 2.142s
|
| 952 | [13:15:28] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod miccw
|
| 953 | [13:15:28] [Server thread/TRACE] [FML]: Mod miccw is using network checker : Accepting version 1.0
|
| 954 | [13:15:28] [Server thread/TRACE] [FML]: Testing mod miccw to verify it accepts its own version in a remote connection
|
| 955 | [13:15:28] [Server thread/TRACE] [FML]: The mod miccw accepts its own version (1.0)
|
| 956 | [13:15:28] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into miccw
|
| 957 | [13:15:28] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for miccw
|
| 958 | [13:15:28] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mic.testmod.util.handlers.RegistryHandler for mod miccw
|
| 959 | [13:15:28] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mic.testmod.util.handlers.RegistryHandler
|
| 960 | [13:15:28] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into miccw for type INSTANCE
|
| 961 | [13:15:28] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod miccw
|
| 962 | [13:15:28] [Server thread/DEBUG] [FML]: Bar Step: Construction - Cosmic Weaponry took 0.081s
|
| 963 | [13:15:28] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod customspawner
|
| 964 | [13:15:28] [Server thread/DEBUG] [mixin]: Mixing common.MixinChunkProviderServer from mixins.phosphor.json into net.minecraft.world.gen.ChunkProviderServer
|
| 965 | [13:15:28] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/WorldServer to metadata cache
|
| 966 | [13:15:28] [Server thread/TRACE] [mixin]: Added class metadata for java/util/Set to metadata cache
|
| 967 | [13:15:28] [Server thread/TRACE] [FML]: Mod customspawner is using network checker : Accepting version 3.11.4
|
| 968 | [13:15:28] [Server thread/TRACE] [FML]: Testing mod customspawner to verify it accepts its own version in a remote connection
|
| 969 | [13:15:28] [Server thread/TRACE] [FML]: The mod customspawner accepts its own version (3.11.4)
|
| 970 | [13:15:28] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into customspawner
|
| 971 | [13:15:28] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for customspawner
|
| 972 | [13:15:28] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into customspawner for type INSTANCE
|
| 973 | [13:15:28] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod customspawner
|
| 974 | [13:15:28] [Server thread/DEBUG] [FML]: Bar Step: Construction - DrZhark's CustomSpawner took 0.392s
|
| 975 | [13:15:28] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod props
|
| 976 | [13:15:28] [Server thread/TRACE] [FML]: Mod props is using network checker : Accepting version 2.6.3
|
| 977 | [13:15:29] [Server thread/TRACE] [FML]: Testing mod props to verify it accepts its own version in a remote connection
|
| 978 | [13:15:29] [Server thread/TRACE] [FML]: The mod props accepts its own version (2.6.3)
|
| 979 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into props
|
| 980 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for props
|
| 981 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into props for type INSTANCE
|
| 982 | [13:15:29] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod props
|
| 983 | [13:15:29] [Server thread/DEBUG] [FML]: Bar Step: Construction - Decocraft took 0.156s
|
| 984 | [13:15:29] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod dldungeonsjbg
|
| 985 | [13:15:29] [Server thread/TRACE] [FML]: Mod dldungeonsjbg is using network checker : No network checking performed
|
| 986 | [13:15:29] [Server thread/TRACE] [FML]: Testing mod dldungeonsjbg to verify it accepts its own version in a remote connection
|
| 987 | [13:15:29] [Server thread/TRACE] [FML]: The mod dldungeonsjbg accepts its own version (1.13.2)
|
| 988 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into dldungeonsjbg
|
| 989 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for dldungeonsjbg
|
| 990 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into dldungeonsjbg for type INSTANCE
|
| 991 | [13:15:29] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod dldungeonsjbg
|
| 992 | [13:15:29] [Server thread/DEBUG] [FML]: Bar Step: Construction - Doomlike Dungeons took 0.065s
|
| 993 | [13:15:29] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mocreatures
|
| 994 | [13:15:29] [Server thread/TRACE] [FML]: Mod mocreatures is using network checker : Accepting range 12.0.5
|
| 995 | [13:15:29] [Server thread/TRACE] [FML]: Testing mod mocreatures to verify it accepts its own version in a remote connection
|
| 996 | [13:15:29] [Server thread/TRACE] [FML]: The mod mocreatures accepts its own version (12.0.5)
|
| 997 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into mocreatures
|
| 998 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for mocreatures
|
| 999 | [13:15:29] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCBiomes$RegistrationHandler for mod mocreatures
|
| 1000 | [13:15:29] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCBiomes$RegistrationHandler
|
| 1001 | [13:15:29] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCEntities$RegistrationHandler for mod mocreatures
|
| 1002 | [13:15:29] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCEntities$RegistrationHandler
|
| 1003 | [13:15:29] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCSoundEvents$RegistrationHandler for mod mocreatures
|
| 1004 | [13:15:29] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCSoundEvents$RegistrationHandler
|
| 1005 | [13:15:29] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCRecipes$RegistrationHandler for mod mocreatures
|
| 1006 | [13:15:29] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCRecipes$RegistrationHandler
|
| 1007 | [13:15:29] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCItems$RegistrationHandler for mod mocreatures
|
| 1008 | [13:15:29] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCItems$RegistrationHandler
|
| 1009 | [13:15:29] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCBlocks$RegistrationHandler for mod mocreatures
|
| 1010 | [13:15:29] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCBlocks$RegistrationHandler
|
| 1011 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into mocreatures for type INSTANCE
|
| 1012 | [13:15:29] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mocreatures
|
| 1013 | [13:15:29] [Server thread/DEBUG] [FML]: Bar Step: Construction - DrZhark's Mo'Creatures Mod took 0.511s
|
| 1014 | [13:15:29] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderstorage
|
| 1015 | [13:15:29] [Server thread/TRACE] [FML]: Mod enderstorage is using network checker : Accepting version **.**.**.**
|
| 1016 | [13:15:29] [Server thread/TRACE] [FML]: Testing mod enderstorage to verify it accepts its own version in a remote connection
|
| 1017 | [13:15:29] [Server thread/TRACE] [FML]: The mod enderstorage accepts its own version (**.**.**.**)
|
| 1018 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderstorage
|
| 1019 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderstorage
|
| 1020 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into enderstorage for type INSTANCE
|
| 1021 | [13:15:29] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderstorage
|
| 1022 | [13:15:29] [Server thread/DEBUG] [FML]: Bar Step: Construction - EnderStorage took 0.117s
|
| 1023 | [13:15:29] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod fastfurnace
|
| 1024 | [13:15:29] [Server thread/TRACE] [FML]: Mod fastfurnace is using network checker : Accepting version 1.3.1
|
| 1025 | [13:15:29] [Server thread/TRACE] [FML]: Testing mod fastfurnace to verify it accepts its own version in a remote connection
|
| 1026 | [13:15:29] [Server thread/TRACE] [FML]: The mod fastfurnace accepts its own version (1.3.1)
|
| 1027 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into fastfurnace
|
| 1028 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for fastfurnace
|
| 1029 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into fastfurnace for type INSTANCE
|
| 1030 | [13:15:29] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod fastfurnace
|
| 1031 | [13:15:29] [Server thread/DEBUG] [FML]: Bar Step: Construction - FastFurnace took 0.053s
|
| 1032 | [13:15:29] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ironchest
|
| 1033 | [13:15:29] [Server thread/TRACE] [FML]: Mod ironchest is using network checker : Accepting version 1.12.2-7.0.67.844
|
| 1034 | [13:15:29] [Server thread/TRACE] [FML]: Testing mod ironchest to verify it accepts its own version in a remote connection
|
| 1035 | [13:15:29] [Server thread/TRACE] [FML]: The mod ironchest accepts its own version (1.12.2-7.0.67.844)
|
| 1036 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ironchest
|
| 1037 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ironchest
|
| 1038 | [13:15:29] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for cpw.mods.ironchest.common.core.IronChestBlocks$Registration for mod ironchest
|
| 1039 | [13:15:29] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class cpw.mods.ironchest.common.core.IronChestBlocks$Registration
|
| 1040 | [13:15:29] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for cpw.mods.ironchest.common.core.IronChestItems$Registration for mod ironchest
|
| 1041 | [13:15:29] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class cpw.mods.ironchest.common.core.IronChestItems$Registration
|
| 1042 | [13:15:29] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into ironchest for type INSTANCE
|
| 1043 | [13:15:29] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ironchest
|
| 1044 | [13:15:29] [Server thread/DEBUG] [FML]: Bar Step: Construction - Iron Chest took 0.203s
|
| 1045 | [13:15:29] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod lunatriuscore
|
| 1046 | [13:15:30] [Server thread/TRACE] [FML]: Mod lunatriuscore is using network checker : Invoking method checkModList
|
| 1047 | [13:15:30] [Server thread/TRACE] [FML]: Testing mod lunatriuscore to verify it accepts its own version in a remote connection
|
| 1048 | [13:15:30] [Server thread/TRACE] [FML]: The mod lunatriuscore accepts its own version (**.**.**.**)
|
| 1049 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into lunatriuscore
|
| 1050 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for lunatriuscore
|
| 1051 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into lunatriuscore for type INSTANCE
|
| 1052 | [13:15:30] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod lunatriuscore
|
| 1053 | [13:15:30] [Server thread/DEBUG] [FML]: Bar Step: Construction - LunatriusCore took 0.179s
|
| 1054 | [13:15:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod netherendingores
|
| 1055 | [13:15:30] [Server thread/TRACE] [FML]: Mod netherendingores is using network checker : Accepting version 1.12.2-1.4.2
|
| 1056 | [13:15:30] [Server thread/TRACE] [FML]: Testing mod netherendingores to verify it accepts its own version in a remote connection
|
| 1057 | [13:15:30] [Server thread/TRACE] [FML]: The mod netherendingores accepts its own version (1.12.2-1.4.2)
|
| 1058 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into netherendingores
|
| 1059 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for netherendingores
|
| 1060 | [13:15:30] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.common.registry.BlockRegistry$RegistrationHandler for mod netherendingores
|
| 1061 | [13:15:30] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.common.registry.BlockRegistry$RegistrationHandler
|
| 1062 | [13:15:30] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.common.registry.BlockRegistry$BlockEventHandler for mod netherendingores
|
| 1063 | [13:15:30] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.common.registry.BlockRegistry$BlockEventHandler
|
| 1064 | [13:15:30] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.common.registry.RegistryEvents$RegistrationHandler for mod netherendingores
|
| 1065 | [13:15:30] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.common.registry.RegistryEvents$RegistrationHandler
|
| 1066 | [13:15:30] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.integration.common.registry.RegistryIntegrationEvents$Events for mod netherendingores
|
| 1067 | [13:15:30] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.integration.common.registry.RegistryIntegrationEvents$Events
|
| 1068 | [13:15:30] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.proxy.CommonProxy for mod netherendingores
|
| 1069 | [13:15:30] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.proxy.CommonProxy
|
| 1070 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into netherendingores for type INSTANCE
|
| 1071 | [13:15:30] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod netherendingores
|
| 1072 | [13:15:30] [Server thread/DEBUG] [FML]: Bar Step: Construction - Netherending Ores took 0.207s
|
| 1073 | [13:15:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod nei
|
| 1074 | [13:15:30] [Server thread/TRACE] [FML]: Mod nei is using network checker : Accepting version 2.4.3
|
| 1075 | [13:15:30] [Server thread/TRACE] [FML]: Testing mod nei to verify it accepts its own version in a remote connection
|
| 1076 | [13:15:30] [Server thread/TRACE] [FML]: The mod nei accepts its own version (2.4.3)
|
| 1077 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into nei
|
| 1078 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for nei
|
| 1079 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into nei for type INSTANCE
|
| 1080 | [13:15:30] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod nei
|
| 1081 | [13:15:30] [Server thread/DEBUG] [FML]: Bar Step: Construction - Not Enough Items took 0.087s
|
| 1082 | [13:15:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod placebo
|
| 1083 | [13:15:30] [Server thread/TRACE] [FML]: Mod placebo is using network checker : No network checking performed
|
| 1084 | [13:15:30] [Server thread/TRACE] [FML]: Testing mod placebo to verify it accepts its own version in a remote connection
|
| 1085 | [13:15:30] [Server thread/TRACE] [FML]: The mod placebo accepts its own version (1.6.0)
|
| 1086 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into placebo
|
| 1087 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for placebo
|
| 1088 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into placebo for type INSTANCE
|
| 1089 | [13:15:30] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod placebo
|
| 1090 | [13:15:30] [Server thread/DEBUG] [FML]: Bar Step: Construction - Placebo took 0.032s
|
| 1091 | [13:15:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod schematica
|
| 1092 | [13:15:30] [Server thread/TRACE] [FML]: Mod schematica is using network checker : Invoking method checkModList
|
| 1093 | [13:15:30] [Server thread/TRACE] [FML]: Testing mod schematica to verify it accepts its own version in a remote connection
|
| 1094 | [13:15:30] [Server thread/TRACE] [FML]: The mod schematica accepts its own version (**.**.**.**)
|
| 1095 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into schematica
|
| 1096 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for schematica
|
| 1097 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into schematica for type INSTANCE
|
| 1098 | [13:15:30] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod schematica
|
| 1099 | [13:15:30] [Server thread/DEBUG] [FML]: Bar Step: Construction - Schematica took 0.146s
|
| 1100 | [13:15:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod schematics
|
| 1101 | [13:15:30] [Server thread/TRACE] [FML]: Mod schematics is using network checker : Accepting version **.**.**.**
|
| 1102 | [13:15:30] [Server thread/TRACE] [FML]: Testing mod schematics to verify it accepts its own version in a remote connection
|
| 1103 | [13:15:30] [Server thread/TRACE] [FML]: The mod schematics accepts its own version (**.**.**.**)
|
| 1104 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into schematics
|
| 1105 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for schematics
|
| 1106 | [13:15:30] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.dyn.schematics.registry.RegistrationHandler for mod schematics
|
| 1107 | [13:15:30] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.dyn.schematics.registry.RegistrationHandler
|
| 1108 | [13:15:30] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into schematics for type INSTANCE
|
| 1109 | [13:15:30] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod schematics
|
| 1110 | [13:15:30] [Server thread/DEBUG] [FML]: Bar Step: Construction - Schematics took 0.353s
|
| 1111 | [13:15:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod simplyjetpacks
|
| 1112 | [13:15:31] [Server thread/TRACE] [FML]: Mod simplyjetpacks is using network checker : Accepting version 1.12.2-2.2.19.0
|
| 1113 | [13:15:31] [Server thread/TRACE] [FML]: Testing mod simplyjetpacks to verify it accepts its own version in a remote connection
|
| 1114 | [13:15:31] [Server thread/TRACE] [FML]: The mod simplyjetpacks accepts its own version (1.12.2-2.2.19.0)
|
| 1115 | [13:15:31] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into simplyjetpacks
|
| 1116 | [13:15:31] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for simplyjetpacks
|
| 1117 | [13:15:31] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for tonius.simplyjetpacks.setup.ModEnchantments for mod simplyjetpacks
|
| 1118 | [13:15:31] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class tonius.simplyjetpacks.setup.ModEnchantments
|
| 1119 | [13:15:31] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for tonius.simplyjetpacks.handler.EventHandler for mod simplyjetpacks
|
| 1120 | [13:15:31] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class tonius.simplyjetpacks.handler.EventHandler
|
| 1121 | [13:15:31] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into simplyjetpacks for type INSTANCE
|
| 1122 | [13:15:31] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod simplyjetpacks
|
| 1123 | [13:15:31] [Server thread/DEBUG] [FML]: Bar Step: Construction - Simply Jetpacks 2 took 0.093s
|
| 1124 | [13:15:31] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod undergroundbiomes
|
| 1125 | [13:15:31] [Server thread/TRACE] [FML]: Mod undergroundbiomes is using network checker : Accepting version 1.3.8
|
| 1126 | [13:15:31] [Server thread/TRACE] [FML]: Testing mod undergroundbiomes to verify it accepts its own version in a remote connection
|
| 1127 | [13:15:31] [Server thread/TRACE] [FML]: The mod undergroundbiomes accepts its own version (1.3.8)
|
| 1128 | [13:15:31] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into undergroundbiomes
|
| 1129 | [13:15:31] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for undergroundbiomes
|
| 1130 | [13:15:31] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for exterminatorjeff.undergroundbiomes.core.UndergroundBiomes for mod undergroundbiomes
|
| 1131 | [13:15:31] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class exterminatorjeff.undergroundbiomes.core.UndergroundBiomes
|
| 1132 | [13:15:31] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into undergroundbiomes for type INSTANCE
|
| 1133 | [13:15:31] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod undergroundbiomes
|
| 1134 | [13:15:31] [Server thread/DEBUG] [FML]: Bar Step: Construction - Underground Biomes took 0.714s
|
| 1135 | [13:15:31] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod phosphor-lighting
|
| 1136 | [13:15:31] [Server thread/TRACE] [FML]: Mod phosphor-lighting is using network checker : No network checking performed
|
| 1137 | [13:15:31] [Server thread/TRACE] [FML]: Testing mod phosphor-lighting to verify it accepts its own version in a remote connection
|
| 1138 | [13:15:31] [Server thread/TRACE] [FML]: The mod phosphor-lighting accepts its own version (1.12.2-0.2.6)
|
| 1139 | [13:15:31] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into phosphor-lighting
|
| 1140 | [13:15:31] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for phosphor-lighting
|
| 1141 | [13:15:31] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into phosphor-lighting for type INSTANCE
|
| 1142 | [13:15:31] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod phosphor-lighting
|
| 1143 | [13:15:31] [Server thread/DEBUG] [FML]: Bar Step: Construction - Phosphor Lighting Engine took 0.009s
|
| 1144 | [13:15:31] [Server thread/DEBUG] [FML]: Bar Finished: Construction took 22.882s
|
| 1145 | [13:15:31] [Server thread/DEBUG] [FML]: Mod signature data
|
| 1146 | [13:15:31] [Server thread/DEBUG] [FML]: Valid Signatures:
|
| 1147 | [13:15:31] [Server thread/DEBUG] [FML]: (e3c3d50c7c986df74c645c0ac54639741c90a557) FML (Forge Mod Loader **.**.**.**) forge.jar
|
| 1148 | [13:15:31] [Server thread/DEBUG] [FML]: (e3c3d50c7c986df74c645c0ac54639741c90a557) forge (Minecraft Forge 14.23.5.2855) forge.jar
|
| 1149 | [13:15:31] [Server thread/DEBUG] [FML]: (220f10d3a93b3ff5fbaa7434cc629d863d6751b9) abyssalcraft (AbyssalCraft 2.0.0-ALPHA-2) AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar
|
| 1150 | [13:15:31] [Server thread/DEBUG] [FML]: (db341c083b1b8ce9160a769b569ef6737b3f4cdf) orbis-lib (OrbisLib 0.2.0) orbis-lib-1.12.2-0.2.0+build411.jar
|
| 1151 | [13:15:31] [Server thread/DEBUG] [FML]: (db341c083b1b8ce9160a769b569ef6737b3f4cdf) aether (Aether II 0.3.0) aether_ii-1.12.2-0.3.0+build411-universal.jar
|
| 1152 | [13:15:31] [Server thread/DEBUG] [FML]: (d72e0dd57935b3e9476212aea0c0df352dd76291) bloodmoon (Bloodmoon 1.5.3) Bloodmoon-MC1.12.2-1.5.3.jar
|
| 1153 | [13:15:31] [Server thread/DEBUG] [FML]: (f1850c39b2516232a2108a7bd84d1cb5df93b261) codechickenlib (CodeChicken Lib **.**.**.**) CodeChickenLib-1.12.2-3.2.3.358-universal.jar
|
| 1154 | [13:15:31] [Server thread/DEBUG] [FML]: (f1850c39b2516232a2108a7bd84d1cb5df93b261) enderstorage (EnderStorage **.**.**.**) EnderStorage-1.12.2-2.4.6.137-universal.jar
|
| 1155 | [13:15:31] [Server thread/DEBUG] [FML]: (f1850c39b2516232a2108a7bd84d1cb5df93b261) nei (Not Enough Items 2.4.3) NotEnoughItems-1.12.2-2.4.3.245-universal.jar
|
| 1156 | [13:15:31] [Server thread/DEBUG] [FML]: (f0387d288626cc2d937daa504e74af570c52a2f1) phosphor-lighting (Phosphor Lighting Engine 1.12.2-0.2.6) phosphor-1.12.2-0.2.6+build50.jar
|
| 1157 | [13:15:31] [Server thread/DEBUG] [FML]: Missing Signatures:
|
| 1158 | [13:15:31] [Server thread/DEBUG] [FML]: minecraft (Minecraft 1.12.2) minecraft.jar
|
| 1159 | [13:15:31] [Server thread/DEBUG] [FML]: mcp (Minecraft Coder Pack 9.42) minecraft.jar
|
| 1160 | [13:15:31] [Server thread/DEBUG] [FML]: backpacked (Backpacked 1.4.2) backpacked-1.4.2-1.12.2.jar
|
| 1161 | [13:15:31] [Server thread/DEBUG] [FML]: jei (Just Enough Items **.**.**.**) jei_1.12.2-4.16.1.302.jar
|
| 1162 | [13:15:31] [Server thread/DEBUG] [FML]: blocklings (Blocklings Mod 1.0) Blocklings 6.0.1_b - 1.12.2.jar
|
| 1163 | [13:15:31] [Server thread/DEBUG] [FML]: chisel (Chisel MC1.12.2-1.0.2.45) Chisel-MC1.12.2-1.0.2.45.jar
|
| 1164 | [13:15:31] [Server thread/DEBUG] [FML]: miccw (Cosmic Weaponry 1.0) CosmicArmoury-1.6.55.jar
|
| 1165 | [13:15:31] [Server thread/DEBUG] [FML]: customspawner (DrZhark's CustomSpawner 3.11.4) CustomMobSpawner-3.11.5.jar
|
| 1166 | [13:15:31] [Server thread/DEBUG] [FML]: props (Decocraft 2.6.3) Decocraft-2.6.3_1.12.2.jar
|
| 1167 | [13:15:31] [Server thread/DEBUG] [FML]: dldungeonsjbg (Doomlike Dungeons 1.13.2) DoomlikeDungeons-1.13.2-MC1.12.2.jar
|
| 1168 | [13:15:31] [Server thread/DEBUG] [FML]: mocreatures (DrZhark's Mo'Creatures Mod 12.0.5) DrZharks MoCreatures Mod-12.0.5.jar
|
| 1169 | [13:15:31] [Server thread/DEBUG] [FML]: fastfurnace (FastFurnace 1.3.1) FastFurnace-1.12.2-1.3.1.jar
|
| 1170 | [13:15:31] [Server thread/DEBUG] [FML]: ironchest (Iron Chest 1.12.2-7.0.67.844) ironchest-1.12.2-7.0.72.847.jar
|
| 1171 | [13:15:31] [Server thread/DEBUG] [FML]: lunatriuscore (LunatriusCore **.**.**.**) LunatriusCore-1.12.2-1.2.0.42-universal.jar
|
| 1172 | [13:15:31] [Server thread/DEBUG] [FML]: netherendingores (Netherending Ores 1.12.2-1.4.2) Netherending-Ores-1.12.2-1.4.2.jar
|
| 1173 | [13:15:31] [Server thread/DEBUG] [FML]: placebo (Placebo 1.6.0) Placebo-1.12.2-1.6.0.jar
|
| 1174 | [13:15:31] [Server thread/DEBUG] [FML]: schematica (Schematica **.**.**.**) Schematica-1.12.2-1.8.0.169-universal.jar
|
| 1175 | [13:15:31] [Server thread/DEBUG] [FML]: schematics (Schematics **.**.**.**) Schematics-1.12.2.12.jar
|
| 1176 | [13:15:31] [Server thread/DEBUG] [FML]: simplyjetpacks (Simply Jetpacks 2 1.12.2-2.2.19.0) SimplyJetpacks2-1.12.2-2.2.19.0.jar
|
| 1177 | [13:15:31] [Server thread/DEBUG] [FML]: undergroundbiomes (Underground Biomes 1.3.8) UndergroundBiomesConstructs-1.12-1.3.8.jar
|
| 1178 | [13:15:31] [Server thread/INFO] [FML]: Processing ObjectHolder annotations
|
| 1179 | [13:15:32] [Server thread/INFO] [FML]: Found 1861 ObjectHolder annotations
|
| 1180 | [13:15:32] [Server thread/INFO] [FML]: Identifying ItemStackHolder annotations
|
| 1181 | [13:15:32] [Server thread/INFO] [FML]: Found 65 ItemStackHolder annotations
|
| 1182 | [13:15:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod minecraft
|
| 1183 | [13:15:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod minecraft
|
| 1184 | [13:15:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Minecraft took 0.021s
|
| 1185 | [13:15:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mcp
|
| 1186 | [13:15:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mcp
|
| 1187 | [13:15:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Minecraft Coder Pack took 0.001s
|
| 1188 | [13:15:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod FML
|
| 1189 | [13:15:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod FML
|
| 1190 | [13:15:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Forge Mod Loader took 0.002s
|
| 1191 | [13:15:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod forge
|
| 1192 | [13:15:33] [Server thread/INFO] [FML]: Configured a dormant chunk cache size of 0
|
| 1193 | [13:15:33] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod forge
|
| 1194 | [13:15:33] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Minecraft Forge took 0.615s
|
| 1195 | [13:15:33] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod backpacked
|
| 1196 | [13:15:33] [Forge Version Check/INFO] [forge.VersionCheck]: [forge] Starting version check at http://files.minecraftforge.net/maven/net/minecraftforge/forge/promotions_slim.json
|
| 1197 | [13:15:33] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod backpacked
|
| 1198 | [13:15:33] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Backpacked took 0.049s
|
| 1199 | [13:15:33] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod jei
|
| 1200 | [13:15:33] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod jei
|
| 1201 | [13:15:33] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Just Enough Items took 0.366s
|
| 1202 | [13:15:33] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod abyssalcraft
|
| 1203 | [13:15:42] [Forge Version Check/DEBUG] [forge.VersionCheck]: [forge] Received version check data:
|
| 1204 | {
|
| 1205 | "homepage": "http://files.minecraftforge.net/maven/net/minecraftforge/forge/",
|
| 1206 | "promos": {
|
| 1207 | "1.1-latest": "**.**.**.**",
|
| 1208 | "1.10-latest": "12.18.0.2000",
|
| 1209 | "1.10.2-latest": "12.18.3.2511",
|
| 1210 | "1.10.2-recommended": "12.18.3.2185",
|
| 1211 | "1.11-latest": "13.19.1.2199",
|
| 1212 | "1.11-recommended": "13.19.1.2189",
|
| 1213 | "1.11.2-latest": "13.20.1.2588",
|
| 1214 | "1.11.2-recommended": "13.20.1.2386",
|
| 1215 | "1.12-latest": "14.21.1.2443",
|
| 1216 | "1.12-recommended": "14.21.1.2387",
|
| 1217 | "1.12.1-latest": "14.22.1.2485",
|
| 1218 | "1.12.1-recommended": "14.22.1.2478",
|
| 1219 | "1.12.2-latest": "14.23.5.2854",
|
| 1220 | "1.12.2-recommended": "14.23.5.2854",
|
| 1221 | "1.13.2-latest": "25.0.219",
|
| 1222 | "1.14.2-latest": "26.0.63",
|
| 1223 | "1.14.3-latest": "27.0.60",
|
| 1224 | "1.14.4-latest": "28.2.23",
|
| 1225 | "1.14.4-recommended": "28.2.0",
|
| 1226 | "1.15-latest": "29.0.4",
|
| 1227 | "1.15.1-latest": "30.0.51",
|
| 1228 | "1.15.2-latest": "31.2.49",
|
| 1229 | "1.15.2-recommended": "31.2.0",
|
| 1230 | "1.16.1-latest": "32.0.108",
|
| 1231 | "1.16.2-latest": "33.0.61",
|
| 1232 | "1.16.3-latest": "34.1.42",
|
| 1233 | "1.16.3-recommended": "34.1.0",
|
| 1234 | "1.16.4-latest": "35.1.37",
|
| 1235 | "1.16.4-recommended": "35.1.4",
|
| 1236 | "1.16.5-latest": "36.1.0",
|
| 1237 | "1.16.5-recommended": "36.1.0",
|
| 1238 | "1.5.2-latest": "**.**.**.**",
|
| 1239 | "1.5.2-recommended": "**.**.**.**",
|
| 1240 | "1.6.1-latest": "**.**.**.**",
|
| 1241 | "1.6.2-latest": "**.**.**.**",
|
| 1242 | "1.6.2-recommended": "**.**.**.**",
|
| 1243 | "1.6.3-latest": "**.**.**.**",
|
| 1244 | "1.6.4-latest": "9.11.1.1345",
|
| 1245 | "1.6.4-recommended": "9.11.1.1345",
|
| 1246 | "1.7.10-latest": "10.13.4.1614",
|
| 1247 | "1.7.10-latest-1.7.10": "10.13.2.1343",
|
| 1248 | "1.7.10-recommended": "10.13.4.1558",
|
| 1249 | "1.7.2-latest": "10.12.2.1147",
|
| 1250 | "1.7.2-recommended": "10.12.2.1121",
|
| 1251 | "1.8-latest": "11.14.4.1577",
|
| 1252 | "1.8-recommended": "11.14.4.1563",
|
| 1253 | "1.8.8-latest": "11.15.0.1655",
|
| 1254 | "1.8.9-latest": "11.15.1.2318",
|
| 1255 | "1.8.9-recommended": "11.15.1.1722",
|
| 1256 | "1.9-latest": "12.16.0.1942",
|
| 1257 | "1.9-recommended": "12.16.1.1887",
|
| 1258 | "1.9.4-latest": "12.17.0.2051",
|
| 1259 | "1.9.4-recommended": "12.17.0.1976",
|
| 1260 | "latest-1.7.10": "10.13.2.1343"
|
| 1261 | }
|
| 1262 | }
|
| 1263 | [13:15:42] [Forge Version Check/INFO] [forge.VersionCheck]: [forge] Found status: AHEAD Target: null
|
| 1264 | [13:15:42] [Forge Version Check/INFO] [forge.VersionCheck]: [nei] Starting version check at http://chickenbones.net/Files/notification/version.php?query=forge&version=1.12&file=NotEnoughItems
|
| 1265 | [13:15:42] [Forge Version Check/DEBUG] [forge.VersionCheck]: [nei] Received version check data:
|
| 1266 | {"homepage": "http://chickenbones.net/Pages/links.html","promos": {"1.12-recommended": "**.**.**.**"}}
|
| 1267 | [13:15:42] [Forge Version Check/INFO] [forge.VersionCheck]: [nei] Found status: BETA Target: null
|
| 1268 | [13:15:42] [Forge Version Check/INFO] [forge.VersionCheck]: [enderstorage] Starting version check at http://chickenbones.net/Files/notification/version.php?query=forge&version=1.12&file=EnderStorage
|
| 1269 | [13:15:43] [Forge Version Check/DEBUG] [forge.VersionCheck]: [enderstorage] Received version check data:
|
| 1270 | {"homepage": "http://chickenbones.net/Pages/links.html","promos": {"1.12-recommended": "**.**.**.**"}}
|
| 1271 | [13:15:43] [Forge Version Check/INFO] [forge.VersionCheck]: [enderstorage] Found status: BETA Target: null
|
| 1272 | [13:15:43] [Forge Version Check/INFO] [forge.VersionCheck]: [codechickenlib] Starting version check at http://chickenbones.net/Files/notification/version.php?query=forge&version=1.12&file=CodeChickenLib
|
| 1273 | [13:15:43] [Forge Version Check/DEBUG] [forge.VersionCheck]: [codechickenlib] Received version check data:
|
| 1274 | {"homepage": "http://chickenbones.net/Pages/links.html","promos": {"1.12-recommended": "**.**.**.**"}}
|
| 1275 | [13:15:43] [Forge Version Check/INFO] [forge.VersionCheck]: [codechickenlib] Found status: BETA Target: null
|
| 1276 | [13:15:43] [Forge Version Check/INFO] [forge.VersionCheck]: [abyssalcraft] Starting version check at https://raw.githubusercontent.com/Shinoow/AbyssalCraft/master/version.json
|
| 1277 | [13:15:43] [Forge Version Check/DEBUG] [forge.VersionCheck]: [abyssalcraft] Received version check data:
|
| 1278 | {
|
| 1279 | "homepage": "https://shinoow.github.io/AbyssalCraft/",
|
| 1280 | "promos": {
|
| 1281 | "1.12.2-latest": "2.0.0-ALPHA-2",
|
| 1282 | "1.12.2-recommended": "1.10.3",
|
| 1283 | "1.12-latest": "1.9.4-pre-4",
|
| 1284 | "1.12-recommended": "1.9.4-pre-4",
|
| 1285 | "1.11.2-latest": "**.**.**.**-FINAL",
|
| 1286 | "1.11.2-recommended": "**.**.**.**-FINAL",
|
| 1287 | "1.11-latest": "**.**.**.**",
|
| 1288 | "1.11-recommended": "**.**.**.**",
|
| 1289 | "1.10.2-latest": "**.**.**.**-FINAL",
|
| 1290 | "1.10.2-recommended": "**.**.**.**-FINAL",
|
| 1291 | "1.10-latest": "**.**.**.**",
|
| 1292 | "1.10-recommended": "**.**.**.**",
|
| 1293 | "1.9.4-latest": "**.**.**.**-FINAL",
|
| 1294 | "1.9.4-recommended": "**.**.**.**-FINAL",
|
| 1295 | "1.9-latest": "**.**.**.**-FINAL",
|
| 1296 | "1.9-recommended": "**.**.**.**-FINAL",
|
| 1297 | "1.8.9-latest": "**.**.**.**-FINAL",
|
| 1298 | "1.8.9-recommended": "**.**.**.**-FINAL"
|
| 1299 | },
|
| 1300 | "1.12.2": {
|
| 1301 | "2.0.0-ALPHA-2": "- The temple structure in Omothol no longer drops 3 Cthulhu Statues when it generates\n- Antidotes now gives you a Potion Effect that negates the plague it cures\n-Flattened more Blocks\n-Fixed a startup crash on servers",
|
| 1302 | "2.0.0-ALPHA-1": "- Removed Plate food\n- Removed MRE\n- Removed Fried Egg\n- Removed Iron Plates\n- Removed Washcloth\n- Removed Upgrade Kits\n- Removed the Coralium and Dread Enchantments\n- Portals are now entities instead of nether portal-shaped portals\n- Added Portal Anchors (logical blocks used for linking the new portals)\n- The Gateway Keys no longer create portals by right-clicking, it instead cycles between the available dimensions to use\n- Added a ritual that creates portals\n- Changed the dimension ID wildcard for rituals (so you can add Nether-specific rituals if you want to)\n- Try naming an Abyssal Zombie \"shinoow\"\n- Added the Silver Key (final upgrade to the Gateway Key)\n- Added the Book of Many Faces (item that displays a list of dead creatures that the Dark Resurrection ritual can respawn, along with crystal sizes)\n- Reduced the amount of mobs that spawn during the Cha'garoth fight\n- Removed the config options for disabling stair and slab blocks\n- Added a config option to specify which dimension the portal to the Abyssal Wasteland is created in\n- Added a crafting recipe for turning the secondary variant of Darklands Oak Logs into planks\n- Added some new config categories, and re-organized the options in the others\n- Corrected the translation string for the description of the Teleport Home spell\n- Dreadlands Grass no longer converts Grass and Dirt into itself\n- Added a config option that toggles whether or not non-shadow mobs emit smoke particles inside the Dark Realm\n- Added config options for setting the spawn limits of Dread Spawns and Greater Dread Spawns\n- Localized some texts that previously weren't localized\n- The Staff of Rending now drops the essence on the ground if your inventory's full when it creates it\n- Flattened a plethora of Block IDs (you might notice some missing items and/or blocks if you load up an older world)\n- Removed the old portal blocks along with their fire blocks (since portals are no longer made out of blocks)\n- Added glowing parts to the textures of a bunch of mobs (including Abyssal Zombies, Depths Ghouls and Coralium Infested Squids)\n- Changed the \"Portal cooldown\" config option default to 200 (should've done this after the default option survey)\n- Added the Sequential Brewing Stand, a Brewing Stand with some additional built-in automation\n- Fixed a bug with the Materializer being unable to list all recipes when surpassing 110 registered recipes",
|
| 1303 | "1.10.3": "- Fixed a startup crash with Stackup\n- Fixed a world corrupting crash when a block without a proper capability implementation is \n- Added Korean translations (courtesy of hwantube)",
|
| 1304 | "1.10.2": "- Corrected some NBT checking when using keybinds on the Staff of The Gatekeeper, Interdimensional Cage and Spirit Tablet\n- Added a config option that sets the minimum distance two Shoggoth Lairs can generate from each \n- The Chinese, French and Spanish translations have been updated (by Determancer, PrizmaTec and Tosa13)",
|
| 1305 | "1.10.1": "- Fixed a server crash involving the Item Transportation System\n- The Potion Effects given from wearing various armor sets from the mod no longer display particles\n- Changed the sound of Shoggoth Ooze to slime",
|
| 1306 | "1.10.0": "- The ritual of Corruption now convert logs into both variants of the Darklands Oak Log (not just the ordinary without animations)\n- The ritual of Purging is now available with the Dreadlands Necronomicon, instead of the Omothol one\n- Added a ritual to cure the Dreadlands (changing the Dreadlands biome into the nearest non-dreadlands biome)\n- Fixed an exploit involving the Materializer\n- Fixed the tooltip texts on the Rending Pedestal\n- Fixed a crash when Potion AoE rituals tries to apply the potion effect to a player\n- Added a new item transportation system (more info in the Necronomicon)\n- Added the Spirit Tablet (the tool used to configure the item transportation system)\n- Added Spirit Tablet Shards (used to make the Spirit Tablet)\n- Added a spell that displays nearby routes for the item transportation system\n- Added a spell that allows you to start/stop the item transportation of nearby blocks\n- Added a configurable blacklist for the Item transportation system\n- Remnant Blacksmiths and Master Blacksmiths sell Spirit Tablet Shards\n- Overhauled random structure generation inside Omothol (no more village around the temple, random structures on islands)\n- Added a plethora of new loot tables to accompany the new buildings in Omothol\n- Added a spell that allows you to walk on air (unlocked around Omothol)\n- Added a spell that teleports you to your spawn point\n- Fixed a bug where you couldn't deal melee damage to J'zahar if Tough As Nails was installed\n- Amplifiers on Statues now last forever, instead of a minute, when applied",
|
| 1307 | "**.**.**.**": "- The Staff of Rending no longer stops producing items after filling up an energy type once",
|
| 1308 | "1.9.19": "- Changed the default values for a couple of config options (check the description of GitHub commit 69817fc for more info)\n- Changed the internals of fuel handling for the Crystallizer and Transmutator (event runs before the defaults are applied, so you can override them)\n- Added some ambient void particle rendering in Omothol and the Dark Realm\n- Added a config option that toggles whether or not Evil Animals spawn Demon Animals on death\n- Added a config option that toggles whether or not Evil Animals only spawn at night during a new moon\n- Fixed the sky color in the Darklands biome\n- Omothol Ghouls are actually immune to fire now (apparently they weren't, despite the book claiming they were)\n- The PE Stream particle (the thing you see when PE is being transferred) now respects the particle settings (lower setting = fewer particles)\n- Changed a plethora of Crystallizer recipes (added ore doubling, among others) and Transmutator recipes (reverting crystals is cost inefficient) along with removing crystals as fuels\n- Added a config option (under modules) to revert back to the old recipes and behavior\n- Crystal Clusters are now in the Ore Dictionary (as \"crystalClusterX\", where X is the element)\n- Added Calcium, Beryllium and Beryl crystals to the Ore Dictionary\n- Reworked the PE transfer logic in the statues to increase performance\n- Added an upper limit to how many PE particles can spawn at a time (should boost performance for larger PE generation and/or transportation setups)\n- Optimized the worshiping AI for Lesser Shoggoths and Remnants slightly\n- Added a config option that toggles whether or not Lesser Shoggoth eyes will glow (will save you some performance if you drop FPS while looking at them)\n- Added API support for adding your own Rendings to the Staff of Rending (currently the Rending Pedestal doesn't support custom Rendings)",
|
| 1309 | "1.9.18": "- Fixed a rendering-related crash with the various fire blocks added in the mod\n- If \"Ooze Expiration\" is enabled, Shoggoth Ooze blocks that aren't full will shrink in size until they perish\n- Tied some loose ends triggering log errors when some modules are disabled\n- Added a config option to toggle whether or not Anti-Players can pick up loot (you really should just blacklist them in the mob spawner/duplicator instead)\n- You can now open Necronomicons and Crystal Bags in the off hand\n- Energy draining (through rituals and spells) now both take the off hand slot into account",
|
| 1310 | "1.9.17": "- Fixed a bug where the Materializer GUI would crash if more than 110 recipes were available\n- The Interdimensional Cage blacklist actually works now\n- The obsidian platform that generates when Sacthoth spawns doesn't replace blocks that the explosion couldn't destroy\n- Added a config option to toggle whether or not the Night Vision buff from the Plated Coralium Helmet should be applied in all dimensions\n- Reworked the internals of the Dark Resurrection ritual to properly support having multiple dead mobs with the same name\n- Improved the code that checks if a player has a Necronomcion when interacting with a Remnant\n- Engravings no longer stack if they have lost durability\n- All offensive spells now respect PVP settings and player teams\n- Engravings can no longer be repaired\n- Added a new config section for spells (so you can disable individual spells)",
|
| 1311 | "1.9.16": "- The Altar of Cha'garoth now actually checks the height prior to generating the lair\n- Remnants should no longer potentially have trades where they don't sell anything\n- Made the bark of the Darklands Oak Wood texture brighter\n- Added a bunch of Materializer recipes (including stone and all parts of a tree)\n- The Materializer now uses the Ore Dictionary for finding blocks and items of the same type to materialize\n- Fixed a bug related to fetching available Materialization recipes\n- Fixed a crash that happened if you replaced a Ritual Altar with a non-Ritual Altar Tile Entity\n- You can no longer kill the bosses by having them fall out of the world (they'll just despawn)\n- Dreadlands Stalagmites no longer crash the game if they generate outside building height (only really noticeable with amplified terrain)\n- Fixed a bug where all scroll rituals always returned the Basic Scroll (might be similar instances with other rituals)\n- Lesser Shoggoth sounds and projectiles can now be customized with resource packs (courtesy of Mike-U5)\n- Statues no longer crash when generating Disruptions while affected by tick accelerators",
|
| 1312 | "1.9.15": "- Anti-Players now despawn (under normal circumstances)\n- If a player dies to Antimatter, the Anti-Player that spawns will have the player's name\n- If an Anti-Player kills a player, there will actually be a chance of an Anti-Player spawning\n- Air pockets no longer generate beneath shoggoth lairs\n- Spectral Dragons, Asorah, Cha'garoth, J'zahar and Sacthoth can now be killed using /kill\n- Improved the scrolling inside the Materializer GUI (also fixes a bug related to scrolling)\n- Added some more Materialization recipes (Coal Block, Redstone Block, Diamond and Diamond Ore)",
|
| 1313 | "1.9.14": "- Added a config option to disable the plague Enchantments\n- The Ritual Altar and Sacrificial Altar now adds the Glowing Potion Effect to its target (instead of making it emit smoke)\n- Place of Power previews now show a tooltip with the blocks used to build it when hovered over\n- All Shadow mobs now become completely invisible when it's dark enough (instead of barely visible). Bring torches with you to the Dark Realm!\n- You can no longer brew Potions of Annihilation (considering how powerful the Potion Effect is, being able to brew it was just broken OP)\n- Made the usability check in the crystal bag inventory more strict (fixes a dupe bug)\n- Added a ritual (named Mass Enchantment) that combines the Enchantments of 8 Enchanted Books, then applies them on whatever is on the altar\n- Added a config option to set the combined max level a single Enchantment can have in the Mass Enchantment ritual\n- Added a config option to toggle whether or not you can enchant books through the Mass Enchantment ritual\n- Added a Creative Tab for all registered spells\n- Fixed the rendering of the primed ODB (should've done this half a decade ago...), also changed the particle spawning\n- Also totally a 7 year anniversary update",
|
| 1314 | "**.**.**.**": "- Fixed a crash when any boss dialog is sent to chat on servers",
|
| 1315 | "1.9.13": "- Capabilities (like Embers heat) will now persist with Upgrade Kit upgrading\n- Improved the explosion code a fair bit\n- Large explosions no longer create particles (either the particles were oddly placed, or simply too many, might replace with something else in the future)\n- Added a config option for the size of an ODB explosion (also increased the default size)\n- Added a config option for the size of antimatter explosions (also increased the default size)\n- AbyssalCraft Explosions now deal more correct amounts of damage (the exposure property from the vanilla explosion damage code kinda nullified the damage)\n- The particle display from the Ritual Pedestals can now be customized for each individual ritual through a set of predefined sequences\n- Added a config option to toggle whether or not Upgrade Kits and the mechanic for them are added (courtesy of Mike-U5)\n- The ritual chant is now played on the server side instead of the client (so you'll always hear a chant when performing rituals while playing on a server)\n- Changed most of the ritual types to use the new particle displays\n- Sacthoth now wields his Soul Reaper Blade (and swings his arm)\n- Added two Enchantments for the Staff of Rending (Sapping and Multi-rend, Sapping increases the amount of energy drained by the staff, and Multi-rend drains energy from mobs near the target)\n- Moved the Potential Energy section out from the Ritual section in the Necronomicon\n- All Tile Entities with Capabilities properly indicate that they have them (so that pipes, for one, interacts with them)",
|
| 1316 | "1.9.12": "- Added a config option to toggle whether or not food items are added (courtesy of Mike-U5)\n- Added a config option to toggle whether or not the dimension terrain will be affected by the Amplified world type\n- Improved the generation code for the random Abyssal Wasteland structures (they're no longer height dependent, so they're more likely to generate in an amplified world)\n- Attempting to use any bonemeal-esque items in a Purged biome won't consume the item if it's not stackable\n- Added a config option to toggle whether or not statues can generate inside Shoggoth Lairs\n- The \"Dark Resurrection\" Ritual can now resurrect any named mob that has died (and any player can resurrect any named dead mob)\n- Adjusted the rotation of Remnant leg tentacles when riding something\n- Added a JSON file with previously hardcoded colors (for resource packs to override) named \"clientvars.json\"\n- Dread Spawn, Greater Dread Spawn, Lesser Dreadbeast and Spawn of Cha'garoth now have their own textures (rather than using the Dreadguard texture)",
|
| 1317 | "1.9.11": "- Improved the portal teleportation code (fixes the missing exp bug, hopefully also puts a more permanent end to portal looping)\n- The spawn weight for Dark Offsprings is now configurable\n- Added a config option to toggle whether or not ODBs can explode\n- The cooldown for the Lesser Shoggoth monolith building AI is now configurable\n- Added a configurable range for how many chunks the Ritual of Corruption can affect\n- Added a configurable range for how many chunks the Ritual of Cleansing can affect\n- Added a configurable range for how many chunks the Ritual of Purging can affect",
|
| 1318 | "1.9.10": "- All bosses are now immune to Potion Effects\n- The Materializer no longer crashes when you put a Crystal Bag in the Crystal Bag slot\n- Prevented some tooltips in other mods from revealing the text of locked items\n- Removed Abyssalnite Armor from the Village Blacksmith loot table\n- Added a config option to toggle whether or not mod items should be added to vanilla loot tables\n- Dreadlands portals can no longer spread Dreadlands around themselves\n- Added a config option to toggle whether or not Depths Ghouls should use the Biome Dictionary for finding biomes to spawn in\n- Added a config option to toggle whether or not Abyssal Zombies should use the Biome Dictionary for finding biomes to spawn in",
|
| 1319 | "1.9.9": "- Energy Container/Pedestal/Collector/Relay and Sacrificial Altars now behave as Items capable of holding PE in Item form (instead of only displaying the amount of energy contained)\n- However, they don't transfer/receive PE externally, so rituals won't drain from them, nor will statues charge them while in your hand or on the ground\n- The Dreadium Katana can now be enchanted properly on an enchanting table\n- Added Cha'rcoal (like Charcoal, except something's off about it...)\n- Added configurable plague immunities (you can make mobs from other mods immune and or carriers of the Coralium and Dread Plagues)\n- Added a secondary Darklands Oak Wood Block, which has the blinking spots\n- Re-added Inventory Tweaks support for Crystal Bags\n- Added a config option that toggles whether or not J'zahar can break the fourth wall\n- Added a config option that toggles whether or not Lesser Shoggoths are immune to projectile damage\n- The \"Liquid Coralium transmutation\" config option now also controls whether or not Liquid Coralium can transmute non-fluid blocks into their Abyssal Wasteland counterparts\n- Added a config option that toggles whether or not Disruptions can occur from statues or failing rituals\n- Added a config option to disable J'zahar's black hole attack\n- Reduced the amount of skins needed to upgrade the Necronomicon (3 now, previously 8)",
|
| 1320 | "1.9.8": "- Decorative Statue crafting recipes now use the Ore Dictionary for the dyes\n- The Interdimensional Cage ritual now requires the Dreadlands Necronomicon (it's only required in the Dreadlands for progression, and was obtainable form the start)\n- If all registered dimensions are blacklisted, J'zahar's black holes will teleport you to the Dark Realm\n- The chest in Cha'garoth's Lair now generates with treasure inside again\n- The Dreadium Katana can now be enchanted\n- The various rituals for changing biomes now change a much larger area (32x32 chunks, previously 8x8)\n- The Ritual of Corruption now changes birch and roofed forests too (rather than only oak forests)\n- Started work on optimizing the explosion code for the ODB (and ODB Core by extension)\n- Deduplicated language keys used by other mods\n- Depths Ghoul heads now work as Thaumcraft infusion crafting stabilisers again (did I forget to...? Yes, yes I did)\n- The Depths armor set now provides a vis discount again\n- Lesser Shoggoths now only build monoliths on Shoggoth Ooze blocks, preventing them from building them in the lair walls (or any inaccessible space)",
|
| 1321 | "1.9.7": "- Lesser Shoggoths now ignore Zombie Villagers\n- If any of the \"Shoggoth Lair Generation Chance\" options are set to 0, lairs won't generate in those areas, instead of causing a crash\n- The textures for the Dark Offspring have been tweaked to look a bit more spooky and goatish\n- Started preliminary work on optimizing worldgen features (trees, structures etc). Might not have a noticeable effect, but it's better than it was before\n- Swapped the texts on the pages for the Decorative Shub-Niggurath and Yog-Sothoth Statues\n- NecroData Chapter Page removal now reorders the remaining pages, instead of leaving blanks\n- Added a method to Chapters allowing you to insert Pages (which doesn't override existing Pages, as the method for adding Pages does)\n- Fuel registration for the Crystallizer and Transmutator are now handled through an event\n- Dark Offsprings now only spawn during night, and their spawning is dependant on the moon phase (more common during a new moon, very rare during a full moon)\n- Lowered the sound volume of the Dark Offspring\n- Added a much needed information section to spells explaining how to inscribe them, cast them, and other useful information (the amount of information is a bit limited right now)\n- Added some new Place of Power structures\n- The Great Old Ones Necronomicon section is now named \"The Great Old Ones\" again, instead of \"Pantheon\" (which is the name of the category it's part of)",
|
| 1322 | "1.9.6": "- Demon Animals no longer ignite if they come into contact with fire while \"Demon Animal burning\" is disabled (unless Hardcore Mode is enabled)\n- Burning Demon Animals can be extinguished by coming into contact with water, stopping the fire spread\n- Split the Shoggoth Lair Generation Chance into two options, one for rivers and one for swamps\n- Crystallizing Container Items (like filled bottles and filled buckets) leaves the container\n- The Place of Power multiblock structure block now has hardness\n- Biome transformation handling has been streamlined for easier support in JEID (courtesy of sk2048)\n- Fixed a bug where shift-clicking the second output slot of the Crystallizer dupes the output\n- Fixed the crafting recipe for turning an ODB into a Sacthoth spawn egg\n- Fixed a bug where the Crystallizer and Transmutator wouldn't re-evaluate the output if the input changed during processing\n- Remnant librarians now sell Basic, Lesser and Moderate Scrolls, and Remnant priests can upgrade Greater Scrolls into the various unique scrolls\n- AbyssalCraft bosses drop Greater Scrolls on death\n- Moved all trades for different kinds of flesh from the Remnant librarian to the Remnant priest\n- Added rituals for creating Basic, Lesser and Moderate Scrolls\n- Added Shub-Niggurath's Dark Offspring (model and texture made by Cybercat5555)\n- Spiders and Cave Spiders are now considered Shoggoth food\n- Lesser Shoggoths now attack Skeletons and Zombies (except Zombie Villagers)\n- Only a single Spectral Dragon can spawn at any time when one spawns (instead of it rarely being several at once)",
|
| 1323 | "**.**.**.**": "- Custom NBT added through a summoning ritual will now work for all properties that can be changed through NBT (instead of only mob-specific properties)\n- Fuzzy NBT checking is now handled properly (if Item Stack A has no NBT, but Item Stack B does, they will be equal as B \"contains\" A)",
|
| 1324 | "**.**.**.**": "- The plague antidotes can now be used 10 times before they run out (and the texture indicates how many uses are left)\n- The plague enchantments no longer infect other players if you hit them while PVP is disabled\n- Rituals now drain energy every second, instead of every tick (fixes rounding errors for energy amounts below 100)\n- Knowledge syncing when changing dimensions now has a configurable delay (sending the data later should reduce initial lag when loading the dimension)\n- Revamped the Lair of Cha'garoth a bit (Dreadstone Cobblestone floor, 30% of the Dreadstone Bricks are cracked)\n- You can now automatically insert items into the Energy Depositioner\n- The rotation of a Energy Relay can be changed by right-clicking it (which cycles through the possible directions)\n- Powerstone Trackers now move towards the nearest unexplored stronghold (a stronghold is considered explored if the Dreadlands Infused Powerstone has been mined)\n- Removed Oblivion Catalysts from the village blacksmith chest loot table (not sure why I added it there in the first place, nor why I didn't remove it earlier)\n- Lowered the chance of finding a Transmutation Gem in the Abyssal Stronghold and Dreadlands Mineshaft loot tables (made more sense back when they were single-use items, they're also damaged when you find them)\n- Transmutation Gems no longer display their durability tooltip if advanced tooltips (F3 + H) are shown\n- Changed the \"The Great Old Ones\" Necronomicon section name to \"Pantheon\" (as opposed to having the former appear twice)\n- All crafting recipes (except the NBT-sensitive ones) are now JSON files\n- Heavily reduced the amount of crafting recipes for the Coralium Infused Stone and the various Coralium Gem Clusters (60 of those recipes were probably never used)\n- Added a hook that allows you do add custom NBT data to a mob summoned through a summoning ritual",
|
| 1325 | "**.**.**.**": "- When \"Display Item Names\" is enabled, you actually see the Item names, instead of \"Lorem ipsum\"\n- The Purging ritual now ignores unbreakable blocks (so modded bedrock blocks won't get replaced)\n- Shoggoth Biomass no longer spawn anything if the doMobSpawning gamerule is set to false\n- Changed the default value for Portal Cooldown to 100 ticks (previously 10)",
|
| 1326 | "**.**.**.**": "- The Necronomicon GUI will no longer try to divide by zero when drawing ItemStacks\n- Darklands Oak Doors now generate in Abyssal Strongholds, instead of vanilla oak ones\n- Darklands Oak and Dreadlands Doors are now randomly picked for the buildings in Omothol that have doors",
|
| 1327 | "1.9.5": "- Darklands Oak Wood Slabs, Darklands Oak Wood Fence and Dreadlands Wood Fence are now registered in the Ore Dictionary\n- Added compatibility with Hardcore Darkness (if it's installed, all dimensions will be dark if the respective config options are enabled)\n- Added a configuration category for options related to mod compatiblity\n- Added configurable blacklists for Overworld structure and ore generation in other surface worlds\n- Darkstone, Abyssal Stone etc, Abyssal Sand and Abyssal Sand Glass can now be manipulated through Chisel & Bits\n- Textures for all Darkstone-based blocks, Darklands Oak Plank, Monolith Stone + Pillar, Shadow Fragment, Shadow Gem Shard and various Altar/Pedestal overlays have been revamped (courtesy of Cybercat5555)\n- Be sure to name your anti-animals, or any anti-mob for that matter!\n- Added a bunch of new spells (you can try them out by spawning in some scrolls)\n- The game should no longer crash if a tamed and named horse dies without it's owner present in the same dimension\n- Changed the damage cap on J'zahar to 20, and made it so that you can't bypass his invincibility frames\n- Added a config option to toggle whether or not portals require a player to be nearby in order to rarely spawn mobs\n- Portal blocks now have a spawn cap on how many of the rarely spawned mobs it can spawn (if enough are nearby the portal, no more spawn)\n- Dread Spawns can no longer merge into a Greater Dread Spawn if 10 of those area within 32 blocks of them\n- Greater Dread Spawns can no longer merge into a Lesser Dreadbeast of 4 of those are within 32 blocks of them, nor spawn Dread Spawns if 20 of those are within the same distance\n- Lesser Dreadbeasts can't spawn Greater Dread Spawns if 10 of those are within 32 blocks of it, nor Dread Spawns of 20 of those are within the same distance\n- The aforementioned spawn restrictions also applies for Cha'garoth when he spawns the same mobs during his fight\n- Shoggoth Biomass now checks for Lesser Shoggoths within 32 blocks of it (instead of 16) when determining if it should spawn one\n- Lesser Shoggoths can now be hurt through their main body again (instead of only their multiparts), so that blocks used to kill mobs in mob grinders hurt them again\n- Rending Pedestals can now also target multipart entities\n- Fixed a crash when a specific disruption was triggered by failing a ritual\n- Items and Blocks with subtypes that can be used in a ritual now cycles through them when shown in the Necronomicon\n- The Coralium and Dread enchantments can no longer be applied through an Anvil with an enchanted book\n- Increased the follow range of the Skeleton Goliath\n- Added doors for Darklands Oak and Dreadlands Wood (textures by Seth0067 and Cybercat5555)\n- Fixed the models for the various cobblestone walls (now every connected wall block doesn't have the wall post part)\n- Centered the MRE in its texture\n- Added a texture with a snow overlay for the Dreadlands Grass\n- Ritual Altars now check if the Necronomicon it's attempting to drain energy from during a ritual actually has energy stored before draining (in case someone has multiple books in their inventory)\n- Lesser Shoggoths no longer spawn naturally in the Overworld (only through lairs)\n- Added a configuration category for disabling things like Dreadlands spread (named \"Wet Noodle\")\n- Updated the Lesser Shoggoth picture in the Necronomicon\n- Added a config option to toggle whether or not boss dialogs display\n- Added some variations to the Shoggoth Lairs, and statues (both normal and decorative) have a chance of generating inside them\n- Changed the creature types of a few mobs (might add some more new ones to properly classify some mobs, or add some enchantments for extra damage against more stuff)\n- Evil animals now always spawn like mobs, instead of broad daylight, like normal animals\n- The disruptions that spawn random mobs from the current biome can no longer spawn Lesser Dreadbeasts\n- Added Places of Power (multiblocks capable of harvesting PE from statues without causing Disruptions)\n- Added a section with information about Places of Power in the Necronomicon (under Information in the Ritual section)\n- There is currently only one Place of Power structure, but more will be added in future updates",
|
| 1328 | "**.**.**.**": "- Bounding boxes for tiered Energy Relays now continue to face the correct direction after a chunk reload\n- Revamped the mob spawn placement of Disruptions that spawn mobs\n- Statues now generate particles to indicate that a ritual charm is active on them again\n- Lesser Shoggoths have a new model (courtesy of Cybercat5555)\n- The unlock condition for the Cudgel now checks for the correct mob\n- Rituals can now be locked behind obtaining knowledge (currently unused)\n- The Staff of Rending can now target multipart entities\n- Lesser Shoggoths are now multipart entities",
|
| 1329 | "**.**.**.**": "- Added a config option that toggles if item names should display regardless of them being locked or not\n- Cha'garoth now opens his mouth during his barf attack (courtesy of Enderman_Of_D00m)\n- Fixed the crystallizer recipes for processing Bronze\n- J'zahar has been buffed with new attacks (including shouts, earthquakes and conjuring black holes and gravity anomalies)\n- Added a dimension blacklist for the aforementioned black holes\n- I'm not gonna reveal the actual change, but it involves Creative Mode and a certain gatekeeper\n- The Dreadlands Portal now spawn Dreadlings instead of Dread Spawns\n- Energy Containers can now display values over 32767 in their GUIs\n- Doubled the time it takes for a Lesser Dreadbeast to spawn a Dread Spawn",
|
| 1330 | "**.**.**.**": "- Added a keybind for capturing mobs with the Interdimensional Cage\n- Added some default items to the various item pickup blacklists\n- Increased the amount of energy collected and transferred by the tiered Energy Relays\n- Made the knowledge syncing slightly more efficient\n- Fixed a server crash caused by Liquid Coralium flowing\n- Removed a dot from the Russian translation in order to stop a crash with letters exceeding the maximum allowed in a Necronomicon page",
|
| 1331 | "**.**.**.**": "- Dreadlands Grass can now convert Grass and Dirt into itself (no biome spread, only block transformation, can be disabled in the config)\n- The JEI plugin now loads properly again (tested with **.**.**.**)\n- If Liquid Coralium flows into the ocean while \"Oceanic Coralium Pollution\" is disabled, infinite blocks of Cobblestone no longer drops in the water\n- Optimized the Transmutator and Crystallizer (probably barely noticable, but its processing is handled more efficiently internally)\n- Shift-clicking the first output slot of the Crystallizer no longer moves the ouput to the second output slot\n- Added Advancements (a few, more will come in the next update or so) based on the Achievements in previous MC versions\n- Configuration category comments are now properly applied again\n- Added a config category (and a plethora of options) for disabling blocks\n- Creation Ritual now does a proper ItemStack comparison check when replacing the possibly existing Item placed on the ritual altar with the product Item\n- Rituals are now handled server-side (with the exception of particles), and the client is updated on completion\n- Added a event that fires off when a Ritual is failed (allows you to change the Disruption triggered, or do stuff, cancelling defaults back to random Disruption)\n- Fixed numerous instances of sentences using the wrong indefinite article in the en_us lang file (courtesy of mcBegins2Snow)\n- Crafting recipes for Darklands Oak Fence and Dreadlands Fence are no longer overriden by vanilla (Darklands Oak Button and Pressure Plates are still, however)\n- Updated the tooltip for Transmutator and Crystallizer fuel recipes in JEI\n- Added Russian translation (courtesy of AlekseiVoronin)\n- Chinese translations have been updated (courtesy of mcBegins2Snow)\n- Now runs on Forge 14.23.4.2747",
|
| 1332 | "**.**.**.**": "- The purging ritual now only converts biomes that are Dreadlands biomes\n- Added loot tables to all bosses (empty), Coralium Infested Squid and all Remnant types\n- Statues now have their Deity Type assigned to them again, instead of null\n- Lesser Shoggoths now have an AI for monolith construction, which makes the construction happen more frequently\n- The biome transformation of the Dread Plague only happens to those inflicted with Dread Plague II\n- If two mobs/players/whatevers close to each other both have Dread Plague I, they can infect each other with Dread Plague II\n- If the Hardcode Mode config option is enabled biome transformation will happen regardless of Dread Plague amplifier\n- The purging ritual now checks the surrounding area instead of the position of the altar for nearby Dreadlands biomes when checking if the ritual can be performed\n- The cleansing and corruptions rituals now both do the same thing as the purging when checking if the ritual can be performed\n- Reduced the luminosity of the foliage color in the Coralium Infested Swamp, making it blend better with adjacent biomes\n- Lesser Shoggoths now swim faster (and can move against flowing water)\n- Increased the range of the Corruption, Cleansing and Purging rituals to 8x8 chunks (previously 3x3)\n- Eyes (and other luminous bits) now glow on Lesser Shoggoths\n- The crafting recipe for the Transmutator now works with used Transmutation Gems again\n- Any NBT checks for crafting recipes and/or rituals are now a lot less strict (the placed item needs to contain the recipe item NBT tags)\n- Remapped the Tile Entities to use the proper prefix (stops log warnings on startup)\n- Now runs on Forge 14.23.4.2705\n- Bump to JEI **.**.**.**",
|
| 1333 | "**.**.**.**": "- A bunch of textures have been revamped (courtesy of Dylan4ever)\n- Lesser Shoggoths can no longer break Bedrock (or other unbreakable blocks) with their acid\n- Acid Projectiles no longer break blocks with Tile Entities when hitting Players or other mobs\n- Scaled down the model of the baby Lesser Shoggoth (to be more proportional with the hitbox, also made the eyes a bit bigger)\n- Slowed down the initial velocity of the Acid Projectile, increased the time between each projectile being fired, and made it so baby Lesser Shoggoths won't fire them\n- Added a config option for changing the frequency at which Lesser Shoggoths spit acid\n- J'zahar now respects the mobGriefing gamerule with his explosion\n- Fixed a dupe bug in the Materializer GUI\n- Mobs spawned through a summoning ritual now have their portal cooldown set to max\n- Increased the time it takes for a Greater Dread Spawn and Lesser Dreadbeast to spawn a regular Dread Spawn\n- Increased the time it takes for Cha'garoth to spawn the various things he spawns, and removed the direct physical damage dealt by his fireballs\n- Reduced the range of Cha'garoth's melee attacks\n- Fixed the pick block for Calcified Stone",
|
| 1334 | "**.**.**.**": "- Removed the End Abyssal Zombie\n- Remnants now also worship statues at times\n- Added a config option that toggles if knowledge should be synced to the client every time a player opens their Necronomicon\n- The lightning bolt that strikes a statue when a Disruption triggers is now only the effect\n- Added a new Disruption that generates a random amount of Shoggoth Ooze around the source\n- Added a new Disruption that spawns random mobs that normally spawn in the current biome\n- Added a new Disruption that spawns a single random mob that normally spawn in the current biome\n- Added missing null check to the Purge Event Handler, fixing a Sponge-related crash\n- Capability data is no longer lost upon leaving the End\n- Lesser Shoggoths now respect the mobGriefing Game Rule when it comes to their acid-based attacks\n- Changed the minimum Block hardness for resisting acid to 2.1 (previously 3.0)",
|
| 1335 | "**.**.**.**": "- Dreadguards are now regarded as undead\n- Changed the particles used in the Dreadguard/Cha'garoth barf attack (since they're not breathing fire)\n- The plagues no longer reinfect their host (effectively refreshing themselves)\n- Lesser Shoggoth acid projectiles can now be blocked with a shield (the player will still take half a heart of damage)\n- Added a config option to toggle whether or not shields can block acid projectiles\n- Statues don't trigger disruptions inside Omothol\n- If a Lesser Shoggoth has a target when it spawns an offspring, it has a 33% chance of throwing it at the target\n- Added a config option for the minimum Block Hardness required to stop Shoggoth Acid from destroying the Block\n- Abyssal Zombies now attack Villagers\n- Sacthoth no longer despawns in the Dark Realm\n- Asorah now has full knockback resistance (you're gonna need bigger arrows)",
|
| 1336 | "**.**.**.**": "- Shoggoth Biomass no longer randomly spawn Lesser Shoggoths client-side\n- Added some text (with pictures) to better explain the transfer range of Statues to nearby Collectors\n- Shoggoth Biomass blocks don't spawn any Lesser Shoggoths unless a player is within 32 blocks of it\n- Lesser Shoggoths can now secrete acid as a means of defending themselves (or a ranged attack) which can destroy blocks in their path\n- Lesser Shoggoths can now consume any item they run into, which is also configurable\n- Lesser Shoggoths now have a chance to locate a nearby statue and chant by it\n- Increased the hitbox size of Lesser Shoggoths (and reduced their hit range)\n- Removed the disruption that converts the surrounding chunk into Darklands (better leave the fate of their world to the player)\n- The Dread Plague Antidote now requires a Dreadlands Sapling instead of Omothol Ghoul Flesh\n- Fixed a few minor derps in some of the segments of the Remnant leg tentacles\n- Child Lesser Shoggoths now have half the health and attack damage of an adult one\n- The Temple of J'zahar has been revamped\n- Greater Dread Spawns will now deal damage with their Dread Slugs again\n- Rituals Pedestals now project bits of their placed object rather than smoke during rituals\n- Rituals that require sacrifices now requires the player performing the ritual to sacrifice the animal, rather than it being killed automatically\n- The Wooden Crate now supports capabilities for insertion and extraction\n- Fixed the secondary death message for shadow damage\n- Added a ritual to purge the Dreadlands (while also rendering the area uninhabitable)\n- Added Calcified Stone (what everything turns into when the purging ritual has been used)",
|
| 1337 | "**.**.**.**": "- Shadow mobs are now immune to fire, and capable of swimming\n- Changed the texture for Liquid Antimatter (darker spots within the liquid, making it a bit less milk-like)\n- Added a config option that turns antimatter explosions nuclear (off by default)\n- Dread-plagued mobs now automatically leave a lingering cloud of Dread Plague on death\n- Added a new config category for misc out of place settings\n- The amount of animals a Lesser Shoggoth has to eat in order to multiply/grow up now depends on the size of the animals it eats (1 adult cow = 3 adult chickens)\n- The advancement trigger for summoning entities now fires for nearby players when completing a Summoning Ritual",
|
| 1338 | "**.**.**.**": "- Applying a redstone signal to an Energy Relay pauses it\n- The Overworld biomes are always registered now, just not added to the list of biomes to generate if set not to\n- Statues can now transfer PE to dropped items (provided they can accept PE)\n- Redrafted a bunch of text inside the Necronomicon (removing redundant/incorrect information and adding new information)\n- Replaced all mob pictures in the Necronomicon with ones that look more like something drawn in the book\n- Fixed an infinite loop in the mining spell when mining upwards\n- Added a small section that explains how to obtain knowledge, unlocking information in the Necronomicon and unmasks Items and Blocks\n- Reduced the duration of fire applied to attackers when attacking someone wearing Dreaded Abyssalnite gear\n- The Coralium Plague and Dread Plague now act more like actual plagues (they spread a lot easier, can't be cured with milk)\n- Abyssalnite Golems now turn into Dreaded Abyssalnite Golems if killed by the Dread Plague\n- Portals now have a small chance of spawning a mob from their dimension\n- Shadow mobs now change their transparency based on light level (bright = visible, dark = not so visible)\n- The Dreadlands can leak out of it's portals, so keep a lookout in case too much gets out\n- Added Antidotes for the Coralium and Dread Plague (used to cure them instead of milk, which no longer cures them)\n- Increased the amount of Coralium Ore that generates in the Overworld (also made it configurable)\n- Knowledge unlock syncing is now done on a per unlock basis, rather than when opening the Necronomicon or changing dimensions\n- Asorah and Spectral Dragons now have the undead creature attribute",
|
| 1339 | "**.**.**.**": "- Fixed some redundancy in the FireMessage packet that's sent when hitting any of the mods fire blocks\n- Ritual ground creation is now less sensitive about surrounding blocks (as long as they aren't full cubes)\n- Spell recipes can now be displayed in the Necronomicon\n- The tooltip of Energy Relays now display the range of the block\n- Item information can now be locked, resulting in the tooltip font being replaced by the Aklo Font\n- Added a command to automatically unlock all Necronomicon knowledge\n- Leaving Omothol portals now return you to the Dreadlands, not the Abyssal Wasteland\n- Randomized the texture rotation of the Fused Abyssal Sand\n- Made the outlines of the Abyssal Stone Brick, Abyssalnite Stone Brick and Dreadstone Brick more consistent\n- Created a new texture for Dreadstone\n- Shift-clicking output slots now works in the Materializer (giving you up to a stack of the output per click)\n- Now runs on Forge 14.23.2.2611",
|
| 1340 | "**.**.**.**": "- Added a barfing sound to Dreadguards and Cha'garoth (instead of playing the sound for when a Ghast shoots a fireball)\n- Added Crystallized Calcium, Beryllium and Beryl\n- Materializer recipes can now be displayed in JEI\n- The biome transformation from Cha'garoth and his Dreaded Charges has been optimized (code only runs on the server, only affects non-dreadlands biomes)\n- The Rending Pedestal works on Omothol creatures again\n- Rather than crashing, an error will be logged when failing to convert an ItemStack from the Ore Dictionary into a BlockState during startup\n- Overworld structure generation now checks for the Overworld World Provider rather than Dimension ID",
|
| 1341 | "**.**.**.**": "- Ticking Tile Entities that don't do anything client side no longer ticks client side\n- Added a hurt sound to Anti-Players that those who played Minecraft before beta ended might recognize (props to BordListian for letting me know of it's prescence in Better With Mods)\n- Non-player entities can now use portals\n- Anti-mobs now attack their regular countepart (for more destruction and chaos) and Anti-Players has a chance of targeting any non Anti-Player\n- Mobs capable of spreading the Dread Plague no longer tries to apply it on something that's already immune to it\n- Added a new attack to Shadow Beasts and Sacthoth (credits to Enderman_of_D00M for the code)\n- The Materializer is now functional\n- Greater Dread Spawns and Lesser Dreadbeasts now swap between melee and ranged attacks\n- Added a new attack to Dreadguards (credits to Enderman_of_D00M for the code)\n- Cha'garoth's heads now move independantly, and each has attacks of their own (credits to Enderman_of_D00M for the code)\n- Loot Tables are now initialized during loading stages (instead of being initialized when something relying on one of them references it)\n- Disruption Packets now send the correct String value representation of the Deity, stopping even more error log spam\n- The beams that spawn during Asorah's death animation are now more properly colored\n- J'zahar has longer reach for his staff-whacking\n- J'zahar is now immune to fire, explosions, magic and fall damage\n- Adjusted the bounding boxes and eye heights of Remnant and Minions of The Gatekeeper\n- Spectral Dragons now only knocks mobs and players away in Hardcore Mode\n- Dreadium Samurai armor now reduces the amount of Dread damage you receive\n- Materializer recipes can now be displayed in the Necronomicon\n- Spectral Dragons now only lose health when Asorah doesn't have full health",
|
| 1342 | "**.**.**.**": "- The JEI plugin now properly filters out invalid Transmutator and Crystallizer fuels\n- Baby Lesser Shoggoths are 40% slower now (compared to their movement speed in previous versions)\n- The Transmutator no longer transmutes things without recipes into air",
|
| 1343 | "1.9.4": "- Added a configurable list of mobs to spawn Demon Animals from on death\n- The Necronomicon now saves the last page viewed before closing (doesn't persist across restarts, however)\n- Increased the spawn rate of shadow mobs in Darklands biomes\n- Shadow Creatures now have a guaranteed chance of dropping Shadow Fragments\n- Shoggoth Ooze no longer spreads on Monolith Stone\n- Greatly increased the spawn chance of Shoggoth Lairs while making it more configurable\n- If a ritual doesn't have a description, the Necronomicon won't try to display it on the ritual page\n- Item tooltips and the background gradient now displays in GUIs where you interact with inventories\n- Fixed a metadata mismatch for Dreadlands Ritual Altars/Pedestals\n- Optimized the performance of Energy Relays slightly (probably mostly noticeable in larger networks of them)\n- Disruption packets without a Deity are now properly handled, stopping the error log spam\n- Shoggoth Ooze is now corrosive, dealing durability damage to leg and foot armor while exposed to it\n- Fixed a bunch of derps regarding bounding box based Entity searching\n- The NecroData Capability now filters out things that are no longer registered on load\n- All Ethaxium blocks (dark or not) are now Ender Dragon and Wither-proof\n- Transmutator and Crystallizer fuels with container items (like filled buckets) now return the container item\n- Portal blocks now fire the EntityTravelToDimensionEvent prior to teleporting the player, making it possible to cancel teleportation between AbyssalCraft dimensions\n- Added additional buttons to the Necronomicon GUI (skip multiple pages, go back multiple pages, go back to the front page)\n- Energy Relays can now collect PE from Energy Containers too\n- Fixed the eye layer on the Anti-Spiders (now the eyes are the only bits that glow, instead of the whole spider)\n- Ritual altar sacrifices can now also be NBT sensitive\n- Added a config option to stop armor sets from applying Potion Effects or dispell other Potion Effects\n- Added scrolls (currently not usable, nor craftable)\n- Spells are close to being fully implemented, with most of the backing code done\n- Recompiled against 1.12.2\n- Now runs on Forge 14.23.0.2500"
|
| 1344 | },
|
| 1345 | "1.12": {
|
| 1346 | "1.9.4-pre-4": "- Ported to Minecraft 1.12\n- Removed deprecated things from the API\n- Condensed a bunch of blocks to use a single ID\n- Removed Darklands Grass"
|
| 1347 | },
|
| 1348 | "1.11.2": {
|
| 1349 | "**.**.**.**-FINAL": "- The purging ritual now only converts biomes that are Dreadlands biomes\n- Added loot tables to all bosses (empty), Coralium Infested Squid and all Remnant types\n- Lesser Shoggoths now have an AI for monolith construction, which makes the construction happen more frequently\n- The biome transformation of the Dread Plague only happens to those inflicted with Dread Plague II\n- If two mobs/players/whatevers close to each other both have Dread Plague I, they can infect each other with Dread Plague II\n- If the Hardcode Mode config option is enabled biome transformation will happen regardless of Dread Plague amplifier\n- The purging ritual now checks the surrounding area instead of the position of the altar for nearby Dreadlands biomes when checking if the ritual can be performed\n- The cleansing and corruptions rituals now both do the same thing as the purging when checking if the ritual can be performed\n- Reduced the luminosity of the foliage color in the Coralium Infested Swamp, making it blend better with adjacent biomes\n- Lesser Shoggoths now swim faster (and can move against flowing water)\n- Increased the range of the Corruption, Cleansing and Purging rituals to 8x8 chunks (previously 3x3)\n- Eyes (and other luminous bits) now glow on Lesser Shoggoths\n- Any NBT checks for crafting recipes and/or rituals are now a lot less strict (the placed item needs to contain the recipe item NBT tags)",
|
| 1350 | "**.**.**.**": "- A bunch of textures have been revamped (courtesy of Dylan4ever)\n- Lesser Shoggoths can no longer break Bedrock (or other unbreakable blocks) with their acid\n- Acid Projectiles no longer break blocks with Tile Entities when hitting Players or other mobs\n- Scaled down the model of the baby Lesser Shoggoth (to be more proportional with the hitbox, also made the eyes a bit bigger)\n- Slowed down the initial velocity of the Acid Projectile, increased the time between each projectile being fired, and made it so baby Lesser Shoggoths won't fire them\n- Added a config option for changing the frequency at which Lesser Shoggoths spit acid\n- J'zahar now respects the mobGriefing gamerule with his explosion\n- Fixed a dupe bug in the Materializer GUI\n- Mobs spawned through a summoning ritual now have their portal cooldown set to max\n- Increased the time it takes for a Greater Dread Spawn and Lesser Dreadbeast to spawn a regular Dread Spawn\n- Increased the time it takes for Cha'garoth to spawn the various things he spawns, and removed the direct physical damage dealt by his fireballs\n- Reduced the range of Cha'garoth's melee attacks\n- Fixed the pick block for Calcified Stone",
|
| 1351 | "**.**.**.**": "- Removed the End Abyssal Zombie\n- Remnants now also worship statues at times\n- Added a config option that toggles if knowledge should be synced to the client every time a player opens their Necronomicon\n- The lightning bolt that strikes a statue when a Disruption triggers is now only the effect\n- Added a new Disruption that generates a random amount of Shoggoth Ooze around the source\n- Added a new Disruption that spawns random mobs that normally spawn in the current biome\n- Added a new Disruption that spawns a single random mob that normally spawn in the current biome\n- Added missing null check to the Purge Event Handler, fixing a Sponge-related crash\n- Capability data is no longer lost upon leaving the End\n- Lesser Shoggoths now respect the mobGriefing Game Rule when it comes to their acid-based attacks\n- Changed the minimum Block hardness for resisting acid to 2.1 (previously 3.0)",
|
| 1352 | "**.**.**.**": "- Dreadguards are now regarded as undead\n- Changed the particles used in the Dreadguard/Cha'garoth barf attack (since they're not breathing fire)\n- The plagues no longer reinfect their host (effectively refreshing themselves)\n- Lesser Shoggoth acid projectiles can now be blocked with a shield (the player will still take half a heart of damage)\n- Added a config option to toggle whether or not shields can block acid projectiles\n- Statues don't trigger disruptions inside Omothol\n- If a Lesser Shoggoth has a target when it spawns an offspring, it has a 33% chance of throwing it at the target\n- Added a config option for the minimum Block Hardness required to stop Shoggoth Acid from destroying the Block\n- Abyssal Zombies now attack Villagers\n- Sacthoth no longer despawns in the Dark Realm\n- Asorah now has full knockback resistance (you're gonna need bigger arrows)",
|
| 1353 | "**.**.**.**": "- Shoggoth Biomass no longer randomly spawn Lesser Shoggoths client-side\n- Added some text (with pictures) to better explain the transfer range of Statues to nearby Collectors\n- Shoggoth Biomass blocks don't spawn any Lesser Shoggoths unless a player is within 32 blocks of it\n- Lesser Shoggoths can now secrete acid as a means of defending themselves (or a ranged attack) which can destroy blocks in their path\n- Lesser Shoggoths can now consume any item they run into, which is also configurable\n- Lesser Shoggoths now have a chance to locate a nearby statue and chant by it\n- Increased the hitbox size of Lesser Shoggoths (and reduced their hit range)\n- Removed the disruption that converts the surrounding chunk into Darklands (better leave the fate of their world to the player)\n- The Dread Plague Antidote now requires a Dreadlands Sapling instead of Omothol Ghoul Flesh\n- Fixed a few minor derps in some of the segments of the Remnant leg tentacles\n- Child Lesser Shoggoths now have half the health and attack damage of an adult one\n- The Temple of J'zahar has been revamped\n- Greater Dread Spawns will now deal damage with their Dread Slugs again\n- Rituals Pedestals now project bits of their placed object rather than smoke during rituals\n- Rituals that require sacrifices now requires the player performing the ritual to sacrifice the animal, rather than it being killed automatically\n- The Wooden Crate now supports capabilities for insertion and extraction\n- Fixed the secondary death message for shadow damage\n- Added a ritual to purge the Dreadlands (while also rendering the area uninhabitable)\n- Added Calcified Stone (what everything turns into when the purging ritual has been used)",
|
| 1354 | "**.**.**.**": "- Shadow mobs are now immune to fire, and capable of swimming\n- Changed the texture for Liquid Antimatter (darker spots within the liquid, making it a bit less milk-like)\n- Added a config option that turns antimatter explosions nuclear (off by default)\n- Dread-plagued mobs now automatically leave a lingering cloud of Dread Plague on death\n- Added a new config category for misc out of place settings\n- The amount of animals a Lesser Shoggoth has to eat in order to multiply/grow up now depends on the size of the animals it eats (1 adult cow = 3 adult chickens)",
|
| 1355 | "**.**.**.**": "- Applying a redstone signal to an Energy Relay pauses it\n- The Overworld biomes are always registered now, just not added to the list of biomes to generate if set not to\n- Statues can now transfer PE to dropped items (provided they can accept PE)\n- Redrafted a bunch of text inside the Necronomicon (removing redundant/incorrect information and adding new information)\n- Replaced all mob pictures in the Necronomicon with ones that look more like something drawn in the book\n- Fixed an infinite loop in the mining spell when mining upwards\n- Added a small section that explains how to obtain knowledge, unlocking information in the Necronomicon and unmasks Items and Blocks\n- Reduced the duration of fire applied to attackers when attacking someone wearing Dreaded Abyssalnite gear\n- The Coralium Plague and Dread Plague now act more like actual plagues (they spread a lot easier, can't be cured with milk)\n- Abyssalnite Golems now turn into Dreaded Abyssalnite Golems if killed by the Dread Plague\n- Portals now have a small chance of spawning a mob from their dimension\n- Shadow mobs now change their transparency based on light level (bright = visible, dark = not so visible)\n- The Dreadlands can leak out of it's portals, so keep a lookout in case too much gets out\n- Added Antidotes for the Coralium and Dread Plague (used to cure them instead of milk, which no longer cures them)\n- Increased the amount of Coralium Ore that generates in the Overworld (also made it configurable)\n- Knowledge unlock syncing is now done on a per unlock basis, rather than when opening the Necronomicon or changing dimensions\n- Asorah and Spectral Dragons now have the undead creature attribute",
|
| 1356 | "**.**.**.**": "- Fixed some redundancy in the FireMessage packet that's sent when hitting any of the mods fire blocks\n- Ritual ground creation is now less sensitive about surrounding blocks (as long as they aren't full cubes)\n- Spell recipes can now be displayed in the Necronomicon\n- The tooltip of Energy Relays now display the range of the block\n- Item information can now be locked, resulting in the tooltip font being replaced by the Aklo Font\n- Added a command to automatically unlock all Necronomicon knowledge\n- Leaving Omothol portals now return you to the Dreadlands, not the Abyssal Wasteland\n- Randomized the texture rotation of the Fused Abyssal Sand\n- Made the outlines of the Abyssal Stone Brick, Abyssalnite Stone Brick and Dreadstone Brick more consistent\n- Created a new texture for Dreadstone\n- Shift-clicking output slots now works in the Materializer (giving you up to a stack of the output per click)",
|
| 1357 | "**.**.**.**": "- Added a barfing sound to Dreadguards and Cha'garoth (instead of playing the sound for when a Ghast shoots a fireball)\n- Added Crystallized Calcium, Beryllium and Beryl\n- Materializer recipes can now be displayed in JEI\n- The biome transformation from Cha'garoth and his Dreaded Charges has been optimized (code only runs on the server, only affects non-dreadlands biomes)\n- The Rending Pedestal works on Omothol creatures again\n- Rather than crashing, an error will be logged when failing to convert an ItemStack from the Ore Dictionary into a BlockState during startup\n- Overworld structure generation now checks for the Overworld World Provider rather than Dimension ID",
|
| 1358 | "**.**.**.**": "- The JEI plugin no longer stops at Transmutator Fuel recipe registration\n- Ticking Tile Entities that don't do anything client side no longer ticks client side\n- Added a hurt sound to Anti-Players that those who played Minecraft before beta ended might recognize (props to BordListian for letting me know of it's prescence in Better With Mods)\n- Non-player entities can now use portals\n- Anti-mobs now attack their regular countepart (for more destruction and chaos) and Anti-Players has a chance of targeting any non Anti-Player\n- Mobs capable of spreading the Dread Plague no longer tries to apply it on something that's already immune to it\n- Added a new attack to Shadow Beasts and Sacthoth (credits to Enderman_of_D00M for the code)\n- The Materializer is now functional\n- Greater Dread Spawns and Lesser Dreadbeasts now swap between melee and ranged attacks\n- Added a new attack to Dreadguards (credits to Enderman_of_D00M for the code)\n- Cha'garoth's heads now move independantly, and each has attacks of their own (credits to Enderman_of_D00M for the code)\n- Loot Tables are now initialized during loading stages (instead of being initialized when something relying on one of them references it)\n- Disruption Packets now send the correct String value representation of the Deity, stopping even more error log spam\n- The beams that spawn during Asorah's death animation are now more properly colored\n- J'zahar has longer reach for his staff-whacking\n- J'zahar is now immune to fire, explosions, magic and fall damage\n- Adjusted the bounding boxes and eye heights of Remnant and Minions of The Gatekeeper\n- Spectral Dragons now only knocks mobs and players away in Hardcore Mode\n- Dreadium Samurai armor now reduces the amount of Dread damage you receive\n- Materializer recipes can now be displayed in the Necronomicon\n- Spectral Dragons now only lose health when Asorah doesn't have full health",
|
| 1359 | "**.**.**.**": "- The JEI plugin now properly filters out invalid Transmutator and Crystallizer fuels\n- Baby Lesser Shoggoths are 40% slower now (compared to their movement speed in previous versions)\n- The Transmutator no longer transmutes things without recipes into air",
|
| 1360 | "1.9.4": "- Added a configurable list of mobs to spawn Demon Animals from on death\n- Maps now works inside AbyssalCraft dimensions\n- The Necronomicon now saves the last page viewed before closing (doesn't persist across restarts, however)\n- Increased the spawn rate of shadow mobs in Darklands biomes\n- Shadow Creatures now have a guaranteed chance of dropping Shadow Fragments\n- Shoggoth Ooze no longer spreads on Monolith Stone\n- Greatly increased the spawn chance of Shoggoth Lairs while making it more configurable\n- If a ritual doesn't have a description, the Necronomicon won't try to display it on the ritual page\n- Optimized the performance of Energy Relays slightly (probably mostly noticeable in larger networks of them)\n- Disruption packets without a Deity are now properly handled, stopping the error log spam\n- Shoggoth Ooze is now corrosive, dealing durability damage to leg and foot armor while exposed to it\n- The NecroData Capability now filters out things that are no longer registered on load\n- All Ethaxium blocks (dark or not) are now Ender Dragon and Wither-proof\n- Transmutator and Crystallizer fuels with container items (like filled buckets) now return the container item\n- Portal blocks now fire the EntityTravelToDimensionEvent prior to teleporting the player, making it possible to cancel teleportation between AbyssalCraft dimensions\n- Added additional buttons to the Necronomicon GUI (skip multiple pages, go back multiple pages, go back to the front page)\n- Energy Relays can now collect PE from Energy Containers too\n- Fixed the eye layer on the Anti-Spiders (now the eyes are the only bits that glow, instead of the whole spider)\n- Ritual altar sacrifices can now also be NBT sensitive\n- Added a config option to stop armor sets from applying Potion Effects or dispell other Potion Effects\n- Added scrolls (currently not usable, nor craftable)\n- Spells are close to being fully implemented, with most of the backing code done",
|
| 1361 | "1.9.4-pre-4": "- Fixed a small derp in the Crystallizer recipe handling code\n- Improved explosion code for ODB and ODB Cores (along with some performance improvements)\n- Fixed a crash with BoP (or any other mod adding specific blocks to the OreDictionary with the wildcard value as meta)",
|
| 1362 | "1.9.4-pre-3": "- The Knowledge event handler shouldn't crash from trying to save the ID of an unregistered entity\n- Fixed a small client de-sync when draining energy for a ritual\n- Added a ritual that allows you to \"purge\" the Darklands, coverting areas of it into their Overworld counterparts\n- Added a ritual that allows you to \"corrupt\" Overworld biomes, converting areas of them into their Darklands counterparts\n- Added a ritual to resurrect dead companions (tamed and named)\n- Slowed down the spread of Mimic Fire (now it spreads about as fast as normal Fire)\n- Slightly more information is now locked (also overhaul of Necronomicon internals)\n- Changed the model of the Sacrificial Altar (so that it's easily distinguishable from the Ritual Altar)\n- More worldgen performance improvements in the Overworld and Dreadlands\n- Fixed a minor derp in the Gateway Key portal placement code and made it a bit more modular\n- Made some alterations to the Dread Spawn model (the \"arm\" is now composed of a independently moving tentacle, and the other bit has tendrils sprouting out of it)\n- Reduced the movement speed of Greater Dread Spawns and Lesser Dreadbeasts\n- The Crystallizer now stops trying to crystallize something when the output slots are full\n- Added Energy Depositioner (block that can generate PE by siphoning it out of Stone Tablets)\n- Added Stone Tablets (used in the Energy Depositioner, can also be used as alternate storage solution)\n- Added State Transformer (used for filling the Stone Tablets with items/energy)\n- Performance improvement to most PE blocks\n- Smoke from the pedestals during a ritual only comes from the ones that had something on them\n- The Staff of The Gatekeeper now works like a Staff of Rending and a Gateway Key combined\n- Particles from PE transfers made by statues are now synced to the transfer, instead of random\n- Highly optimized particle rendering for PE transfers\n- Changed the recipe for the Sacrificial Altar (replaced Torches with Shadow Fragments)\n- Upgrade Kit recipes can now be viewed in JEI\n- Now runs on Forge 13.20.0.2258",
|
| 1363 | "1.9.4-pre-2": "- Fixed crashes regarding saving NBT for the NecroData Capability (also cleaned up the saving part)\n- Fixed some small quirks with the Shoggoth Ooze blocks\n- Added a config option to toggle whether or not Demon Animals should place down Mimic Fire instead of normal Fire\n- Any Darklands Structures that generate Shoggoth Ooze should now have full blocks instead of a single layer",
|
| 1364 | "1.9.4-pre-1": "- Darklands Highlands and Mountains are now in the cold biome group, and snow generates in them\n- Initial Spellbook implementation (WIP, GUI and some backbone code, nothing functional yet)\n- Added a new font, used along with wharrgarbl to produce unreadable stuff\n- Remnant legs are now composed of more flexible limbs\n- Initial implementation of unlockable knowledge (WIP, only Entity information is partially locked, kill them to unlock the pages\n- The Decorative Statues now have their own recipe (Monolith Stone, Clay and a dye)\n- Added Rending Pedestals (PE powered blocks that collects essences through the use of a Staff of Rending)\n- Set harvest tool for a plethora of blocks that didn't have that set\n- The Abyssal Zombie has a new texture\n- The Abyssal Zombie now has it's own sounds\n- Improved worldgen performance (especially Overworld structures)\n- When broken or placed, the Luminous Thistle and Wasteland's Thorn now plays the correct sounds\n- You can't pick up the item placed on a altar/pedestal if your inventory is full\n- Shoggoth Ooze blocks are now made out of layers (like snow) instead of being a solid block\n- Removed the majority of the Shoggoth Ooze config options (superseded by the layered ooze blocks)\n- The skies in the dimensions are now composed of a skybox rather than a single color\n- Added a disruption that transforms surrounding animals\n- Item pages in the Necronomicon now has a frame around the displayed Item\n- Upgrade Kits are now applied at an Anvil, instead of the crafting grid\n- Improved the rendering of Items placed on altars/pedestals\n- Night Vision is no longer given from the normal armor sets, and the special ones only give it while in the Overworld\n- You shouldn't be able to repair Transmutation Gems with repairing items/blocks from other mods\n- Spectral Dragon and Asorah's hitboxes work now (huge shoutout to Vadis365 for the code that helped debugging the entity part placement)\n- Most player interactions with Necronomicons can't be completed unless the player owns the Necronomicon\n- You can now till Darklands Grass, Dreadlands Grass and Dreadlands Dirt with any hoe\n- You can now plant more things on Darklands Grass, Dreadlands Grass and Dreadlands Dirt\n- The Darklands Oak Log now has the correct textures when rotated",
|
| 1365 | "**.**.**.**": "- Demon Animals now starts spreading fire if they get in contact with any source of fire\n- Something happens if you use Shears on Evil Animals\n- Improved the rendering of the Visage of The Depths overlay (should fix any rendering issues regarding it)\n- A fully usable ritual formation no longer generates along with the Temple of J'zahar (you have to do the Necronomcion part)\n- Applying the Coralium and Dread enchantments through rituals works now\n- Improved cave and ravine generation in the Abyssal Wasteland and the Dreadlands\n- Caves and ravines now generate in the Dark Realm\n- Reduced the amount of smoke Shadow mobs emit while inside the Dark Realm\n- Shadow mobs (and Lesser Shadow Shoggoths) are all translucent\n- When a Lesser Shoggoth spawns a child, the child will be of the same type as the parent\n- Added a config option for setting whether or not Lesser Shoggoths should have a chance of spawning in the Overworld\n- Added Crystal Fragments (even smaller pieces of Crystallized Elements)\n- Set proper map colors for the various blocks\n- Shadow mobs now have a chance of spawning in all Darklands biomes (but they're still more common in the mountains)\n- Changed some internal code for the Essence of The Gatekeeper Item Entity (fixes crashes with Extra Utilities 2)\n- The Dreadlands Grass now has the correct bottom and particle texture\n- Mob spawning in the Dreadlands should be more frequent, while mob spawning in the Abyssal Wasteland should be a bit less frequent\n- Lesser Shoggoths no longer spread a layer of ooze below the layer they've already spread\n- Applied the correct colors for the last 8 Crystal Clusters\n- Fixed numerous crafting recipes for crystal items/blocks\n- Changed the color palette for the Darklands biomes (now uses a indigo-esque color instead of the previous purple)\n- Made the color of the various Darkstone blocks a shade bluer\n- The foliage color in the Abyssal Wasteland now matches the color of the Fused Abyssal Sand\n- Removed the random blindness from the Darklands biomes\n- Lowered the height at which Items placed on Altars/Pedestals are rendered\n- Updated a bunch of pictures in the Necronomicon (anything involving either Darkstone or the Darklands)\n- Remnants no longer say 2 insults at once, and no longer tell you they're busy when you initialize a trade with one\n- Added an API hook to enable Gateway Keys to function in any dimension registered there\n- The Darklands Oak and Dreadlands Tree are less randomized, and taller in general\n- Increased the amount of Darklands Oaks that generate in Darklands Forests\n- Replaced the Darklands Oak Log texture with a different animation and darkened both the Log and Plank textures\n- The Ritual of Fertility now also targets Rabbits\n- Added a config option to change the opacity of the overlay displayed when wearing the Visage of The Depths\n- Re-balanced armor smelting recipes to match Vanilla's (for AbyssalCraft armor)\n- Now runs on Forge 13.20.0.2223"
|
| 1366 | },
|
| 1367 | "1.11": {
|
| 1368 | "**.**.**.**": "- The terrain in the Dark Realm now has holes resembling the various islands in Omothol generating at the same coordinates\n- Reduced the damage of the Dreadium Katana by 5\n- Halved the durability of the Dreadium Katana and reduced the durability of the Cudgel by 500\n- Sacrificial Altars no longer target Shadow mobs\n- Fixed incorrect corner stair rotation\n- Added more Darklands structures\n- Tiered Sacrificial Altars now share the same cooldown as the regular one (instead of scaling it up unreasonably)\n- The information about Sacrificial Altars now mention the PE collection limit (a fifth of the max capacity)\n- Replaced the Obsidian pillars in the Abyssal Wasteland with giant chains of various lengths (extending downwards from the top)\n- Added additional conditions for Shoggoth Lairs to generate (prevents the derps where they generate almost entirely above ground)\n- Removed all instances of Refined Coralium from the Vanilla Loot Tables\n- The mob spawn list purging is now run in load complete (stops any mob spawn adding done in post-init)\n- It now rains in Darklands Plains and Darklands Mountains\n- Added Coralium Infested Squid\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth can now breathe under water\n- The various dimensional essences now have new textures (which resemble their dimension slightly)\n- The Iron Wall Enchantment now works\n- Added a configurable blacklist for the Interdimensional Cage\n- Liquid Coralium now transmutes Cobblestone blocks into Abyssal Cobblestone, instead of Abyssal Stone\n- Abyssal Sand now randomly turns into Fused Abyssal Sand when exposed to light levels higher than 13\n- Shoggoth Ooze now turns into more dimension-specific blocks instead of Dirt if it's set to expire\n- Spectral Dragons now apply Coralium Plague instead of dealing physical damage\n- Updated a whole bunch of pictures in the Necronomicon\n- Ritual offerings that have Container Items (Buckets, among others) will now return the Container Item instead of consuming the Item altogether\n- Increased the spawn rate and vein size of Abyssal Coralium Ore, while reducing the spawn rate and vein size of Abyssal Diamond Ore\n- Rituals required to progress through the dimensions now appear first on their individual ritual section\n- The metadata wildcard now works correctly for ritual offerings (allowing you to use the same Transmutation Gem in multiple rituals, among things)\n- Added a config option to amplify the armor-piercing damage dealt by mobs in Hardcore Mode\n- The Coralium Plague and Dread Plague damage becomes armor-piercing when Hardcore Mode is enabled\n- Set a more proper attack damage to the various axes\n- The spawner blocks now properly initialize the entities they spawn before spawning them\n- Now runs on Forge 13.19.1.2188",
|
| 1369 | "**.**.**.**": "- The Achievements and Rituals with Water Bottles should display Water Bottles, and nothing else\n- Switched the internal method of killing the sacrifice in rituals that requires a sacrifice (Pigs will no longer turn into Zombie Pigmen)\n- The Forge Universal Bucket is actually registered for the fluids, instead of it not being that\n- Set the correct textures for the Ritual Altars/Pedestals that didn't have the correct texture\n- All of the Ritual Altars/Pedestals now drop the correct block\n- Expanded the amount of different types of objects you can input as offerings in a Ritual\n- Made the bounding boxes for Shoggoth Ooze, Shoggoth Biomass and Solid Lava the size of a full block\n- Fixed the placement of Torches and Buttons in Abyssal Strongholds\n- Fixed the placement of Torches in Dreadlands Mineshafts\n- The Dread Spawn now plays it's sounds (instead of the Zombie ones)\n- Ported to 1.11"
|
| 1370 | },
|
| 1371 | "1.10.2": {
|
| 1372 | "**.**.**.**-FINAL": "- The purging ritual now only converts biomes that are Dreadlands biomes\n- Added loot tables to all bosses (empty), Coralium Infested Squid and all Remnant types\n- Lesser Shoggoths now have an AI for monolith construction, which makes the construction happen more frequently\n- The biome transformation of the Dread Plague only happens to those inflicted with Dread Plague II\n- If two mobs/players/whatevers close to each other both have Dread Plague I, they can infect each other with Dread Plague II\n- If the Hardcode Mode config option is enabled biome transformation will happen regardless of Dread Plague amplifier\n- The purging ritual now checks the surrounding area instead of the position of the altar for nearby Dreadlands biomes when checking if the ritual can be performed\n- The cleansing and corruptions rituals now both do the same thing as the purging when checking if the ritual can be performed\n- Reduced the luminosity of the foliage color in the Coralium Infested Swamp, making it blend better with adjacent biomes\n- Lesser Shoggoths now swim faster (and can move against flowing water)\n- Increased the range of the Corruption, Cleansing and Purging rituals to 8x8 chunks (previously 3x3)\n- Eyes (and other luminous bits) now glow on Lesser Shoggoths\n- Any NBT checks for crafting recipes and/or rituals are now a lot less strict (the placed item needs to contain the recipe item NBT tags)",
|
| 1373 | "**.**.**.**": "- A bunch of textures have been revamped (courtesy of Dylan4ever)\n- Lesser Shoggoths can no longer break Bedrock (or other unbreakable blocks) with their acid\n- Acid Projectiles no longer break blocks with Tile Entities when hitting Players or other mobs\n- Scaled down the model of the baby Lesser Shoggoth (to be more proportional with the hitbox, also made the eyes a bit bigger)\n- Slowed down the initial velocity of the Acid Projectile, increased the time between each projectile being fired, and made it so baby Lesser Shoggoths won't fire them\n- Added a config option for changing the frequency at which Lesser Shoggoths spit acid\n- J'zahar now respects the mobGriefing gamerule with his explosion\n- Fixed a dupe bug in the Materializer GUI\n- Mobs spawned through a summoning ritual now have their portal cooldown set to max\n- Increased the time it takes for a Greater Dread Spawn and Lesser Dreadbeast to spawn a regular Dread Spawn\n- Increased the time it takes for Cha'garoth to spawn the various things he spawns, and removed the direct physical damage dealt by his fireballs\n- Reduced the range of Cha'garoth's melee attacks\n- Fixed the pick block for Calcified Stone",
|
| 1374 | "**.**.**.**": "- Removed the End Abyssal Zombie\n- Remnants now also worship statues at times\n- Added a config option that toggles if knowledge should be synced to the client every time a player opens their Necronomicon\n- The lightning bolt that strikes a statue when a Disruption triggers is now only the effect\n- Added a new Disruption that generates a random amount of Shoggoth Ooze around the source\n- Added a new Disruption that spawns random mobs that normally spawn in the current biome\n- Added a new Disruption that spawns a single random mob that normally spawn in the current biome\n- Added missing null check to the Purge Event Handler, fixing a Sponge-related crash\n- Capability data is no longer lost upon leaving the End\n- Lesser Shoggoths now respect the mobGriefing Game Rule when it comes to their acid-based attacks\n- Changed the minimum Block hardness for resisting acid to 2.1 (previously 3.0)",
|
| 1375 | "**.**.**.**": "- Dreadguards are now regarded as undead\n- Changed the particles used in the Dreadguard/Cha'garoth barf attack (since they're not breathing fire)\n- The plagues no longer reinfect their host (effectively refreshing themselves)\n- Lesser Shoggoth acid projectiles can now be blocked with a shield (the player will still take half a heart of damage)\n- Added a config option to toggle whether or not shields can block acid projectiles\n- Statues don't trigger disruptions inside Omothol\n- If a Lesser Shoggoth has a target when it spawns an offspring, it has a 33% chance of throwing it at the target\n- Added a config option for the minimum Block Hardness required to stop Shoggoth Acid from destroying the Block\n- Abyssal Zombies now attack Villagers\n- Sacthoth no longer despawns in the Dark Realm\n- Asorah now has full knockback resistance (you're gonna need bigger arrows)\n- Fixed NPE in the Lesser Shoggoth acid spraying attack",
|
| 1376 | "**.**.**.**": "- Shoggoth Biomass no longer randomly spawn Lesser Shoggoths client-side\n- Added some text (with pictures) to better explain the transfer range of Statues to nearby Collectors\n- Shoggoth Biomass blocks don't spawn any Lesser Shoggoths unless a player is within 32 blocks of it\n- Lesser Shoggoths can now secrete acid as a means of defending themselves (or a ranged attack) which can destroy blocks in their path\n- Lesser Shoggoths can now consume any item they run into, which is also configurable\n- Lesser Shoggoths now have a chance to locate a nearby statue and chant by it\n- Increased the hitbox size of Lesser Shoggoths (and reduced their hit range)\n- Removed the disruption that converts the surrounding chunk into Darklands (better leave the fate of their world to the player)\n- The Dread Plague Antidote now requires a Dreadlands Sapling instead of Omothol Ghoul Flesh\n- Child Lesser Shoggoths now have half the health and attack damage of an adult one\n- The Temple of J'zahar has been revamped\n- Greater Dread Spawns will now deal damage with their Dread Slugs again\n- Rituals Pedestals now project bits of their placed object rather than smoke during rituals\n- Rituals that require sacrifices now requires the player performing the ritual to sacrifice the animal, rather than it being killed automatically\n- The Wooden Crate now supports capabilities for insertion and extraction\n- Fixed the secondary death message for shadow damage\n- Added a ritual to purge the Dreadlands (while also rendering the area uninhabitable)\n- Added Calcified Stone (what everything turns into when the purging ritual has been used)",
|
| 1377 | "**.**.**.**": "- Shadow mobs are now immune to fire, and capable of swimming\n- Changed the texture for Liquid Antimatter (darker spots within the liquid, making it a bit less milk-like)\n- Added a config option that turns antimatter explosions nuclear (off by default)\n- Dread-plagued mobs now automatically leave a lingering cloud of Dread Plague on death\n- Added a new config category for misc out of place settings\n- The amount of animals a Lesser Shoggoth has to eat in order to multiply/grow up now depends on the size of the animals it eats (1 adult cow = 3 adult chickens)",
|
| 1378 | "**.**.**.**": "- Applying a redstone signal to an Energy Relay pauses it\n- The Overworld biomes are always registered now, just not added to the list of biomes to generate if set not to\n- Statues can now transfer PE to dropped items (provided they can accept PE)\n- Redrafted a bunch of text inside the Necronomicon (removing redundant/incorrect information and adding new information)\n- Replaced all mob pictures in the Necronomicon with ones that look more like something drawn in the book\n- Fixed an infinite loop in the mining spell when mining upwards\n- Added a small section that explains how to obtain knowledge, unlocking information in the Necronomicon and unmasks Items and Blocks\n- Reduced the duration of fire applied to attackers when attacking someone wearing Dreaded Abyssalnite gear\n- The Coralium Plague and Dread Plague now act more like actual plagues (they spread a lot easier, can't be cured with milk)\n- Abyssalnite Golems now turn into Dreaded Abyssalnite Golems if killed by the Dread Plague\n- Portals now have a small chance of spawning a mob from their dimension\n- Shadow mobs now change their transparency based on light level (bright = visible, dark = not so visible)\n- The Dreadlands can leak out of it's portals, so keep a lookout in case too much gets out\n- Added Antidotes for the Coralium and Dread Plague (used to cure them instead of milk, which no longer cures them)\n- Increased the amount of Coralium Ore that generates in the Overworld (also made it configurable)\n- Knowledge unlock syncing is now done on a per unlock basis, rather than when opening the Necronomicon or changing dimensions\n- Asorah and Spectral Dragons now have the undead creature attribute",
|
| 1379 | "**.**.**.**": "- Fixed some redundancy in the FireMessage packet that's sent when hitting any of the mods fire blocks\n- Ritual ground creation is now less sensitive about surrounding blocks (as long as they aren't full cubes)\n- Spell recipes can now be displayed in the Necronomicon\n- The tooltip of Energy Relays now display the range of the block\n- Item information can now be locked, resulting in the tooltip font being replaced by the Aklo Font\n- Added a command to automatically unlock all Necronomicon knowledge\n- Leaving Omothol portals now return you to the Dreadlands, not the Abyssal Wasteland\n- Randomized the texture rotation of the Fused Abyssal Sand\n- Made the outlines of the Abyssal Stone Brick, Abyssalnite Stone Brick and Dreadstone Brick more consistent\n- Created a new texture for Dreadstone\n- Shift-clicking output slots now works in the Materializer (giving you up to a stack of the output per click)",
|
| 1380 | "**.**.**.**": "- Added a barfing sound to Dreadguards and Cha'garoth (instead of playing the sound for when a Ghast shoots a fireball)\n- Added Crystallized Calcium, Beryllium and Beryl\n- Materializer recipes can now be displayed in JEI\n- The biome transformation from Cha'garoth and his Dreaded Charges has been optimized (code only runs on the server, only affects non-dreadlands biomes)\n- The Rending Pedestal works on Omothol creatures again\n- Rather than crashing, an error will be logged when failing to convert an ItemStack from the Ore Dictionary into a BlockState during startup\n- Overworld structure generation now checks for the Overworld World Provider rather than Dimension ID",
|
| 1381 | "**.**.**.**": "- The JEI plugin no longer stops at Transmutator Fuel recipe registration\n- The State Transformer's extraction mechanic now works\n- Ticking Tile Entities that don't do anything client side no longer ticks client side\n- Added a hurt sound to Anti-Players that those who played Minecraft before beta ended might recognize (props to BordListian for letting me know of it's prescence in Better With Mods)\n- Non-player entities can now use portals\n- Anti-mobs now attack their regular countepart (for more destruction and chaos) and Anti-Players has a chance of targeting any non Anti-Player\n- Mobs capable of spreading the Dread Plague no longer tries to apply it on something that's already immune to it\n- Added a new attack to Shadow Beasts and Sacthoth (credits to Enderman_of_D00M for the code)\n- The Materializer is now functional\n- Greater Dread Spawns and Lesser Dreadbeasts now swap between melee and ranged attacks\n- Added a new attack to Dreadguards (credits to Enderman_of_D00M for the code)\n- Cha'garoth's heads now move independantly, and each has attacks of their own (credits to Enderman_of_D00M for the code)\n- Loot Tables are now initialized during loading stages (instead of being initialized when something relying on one of them references it)\n- Disruption Packets now send the correct String value representation of the Deity, stopping even more error log spam\n- The beams that spawn during Asorah's death animation are now more properly colored\n- J'zahar has longer reach for his staff-whacking\n- J'zahar is now immune to fire, explosions, magic and fall damage\n- Adjusted the bounding boxes and eye heights of Remnant and Minions of The Gatekeeper\n- Spectral Dragons now only knocks mobs and players away in Hardcore Mode\n- Dreadium Samurai armor now reduces the amount of Dread damage you receive\n- Materializer recipes can now be displayed in the Necronomicon\n- Spectral Dragons now only lose health when Asorah doesn't have full health",
|
| 1382 | "**.**.**.**": "- The JEI plugin now properly filters out invalid Transmutator and Crystallizer fuels\n- Baby Lesser Shoggoths are 40% slower now (compared to their movement speed in previous versions)",
|
| 1383 | "1.9.4": "- Added a configurable list of mobs to spawn Demon Animals from on death\n- Maps now works inside AbyssalCraft dimensions\n- The Necronomicon now saves the last page viewed before closing (doesn't persist across restarts, however)\n- Increased the spawn rate of shadow mobs in Darklands biomes\n- Shadow Creatures now have a guaranteed chance of dropping Shadow Fragments\n- Shoggoth Ooze no longer spreads on Monolith Stone\n- Greatly increased the spawn chance of Shoggoth Lairs while making it more configurable\n- If a ritual doesn't have a description, the Necronomicon won't try to display it on the ritual page\n- Optimized the performance of Energy Relays slightly (probably mostly noticeable in larger networks of them)\n- Disruption packets without a Deity are now properly handled, stopping the error log spam\n- Shoggoth Ooze is now corrosive, dealing durability damage to leg and foot armor while exposed to it\n- The NecroData Capability now filters out things that are no longer registered on load\n- All Ethaxium blocks (dark or not) are now Ender Dragon and Wither-proof\n- Portal blocks now fire the EntityTravelToDimensionEvent prior to teleporting the player, making it possible to cancel teleportation between AbyssalCraft dimensions\n- Added additional buttons to the Necronomicon GUI (skip multiple pages, go back multiple pages, go back to the front page)\n- Energy Relays can now collect PE from Energy Containers too\n- Fixed the eye layer on the Anti-Spiders (now the eyes are the only bits that glow, instead of the whole spider)\n- Ritual altar sacrifices can now also be NBT sensitive\n- Added a config option to stop armor sets from applying Potion Effects or dispell other Potion Effects\n- Added scrolls (currently not usable, nor craftable)\n- Spells are close to being fully implemented, with most of the backing code done",
|
| 1384 | "1.9.4-pre-4": "- Changed the ritual for the Staff of The Gatekeeper to require Cha'garoth's R'lyehian Gateway Key\n- Fixed a small derp in the Crystallizer recipe handling code\n- Improved explosion code for ODB and ODB Cores (along with some performance improvements)\n- Fixed a crash with BoP (or any other mod adding specific blocks to the OreDictionary with the wildcard value as meta)",
|
| 1385 | "1.9.4-pre-3": "- The Knowledge event handler shouldn't crash from trying to save the ID of an unregistered entity\n- Fixed a small client de-sync when draining energy for a ritual\n- Added a ritual that allows you to \"purge\" the Darklands, coverting areas of it into their Overworld counterparts\n- Added a ritual that allows you to \"corrupt\" Overworld biomes, converting areas of them into their Darklands counterparts\n- Added a ritual to resurrect dead companions (tamed and named)\n- Slowed down the spread of Mimic Fire (now it spreads about as fast as normal Fire)\n- Slightly more information is now locked (also overhaul of Necronomicon internals)\n- Changed the model of the Sacrificial Altar (so that it's easily distinguishable from the Ritual Altar)\n- More worldgen performance improvements in the Overworld and Dreadlands\n- Fixed a minor derp in the Gateway Key portal placement code and made it a bit more modular\n- Made some alterations to the Dread Spawn model (the \"arm\" is now composed of a independently moving tentacle, and the other bit has tendrils sprouting out of it)\n- Reduced the movement speed of Greater Dread Spawns and Lesser Dreadbeasts\n- The Crystallizer now stops trying to crystallize something when the output slots are full\n- Added Energy Depositioner (block that can generate PE by siphoning it out of Stone Tablets)\n- Added Stone Tablets (used in the Energy Depositioner, can also be used as alternate storage solution)\n- Added State Transformer (used for filling the Stone Tablets with items/energy)\n- Performance improvement to most PE blocks\n- Smoke from the pedestals during a ritual only comes from the ones that had something on them\n- The Staff of The Gatekeeper now works like a Staff of Rending and a Gateway Key combined\n- Particles from PE transfers made by statues are now synced to the transfer, instead of random\n- Highly optimized particle rendering for PE transfers\n- Changed the recipe for the Sacrificial Altar (replaced Torches with Shadow Fragments)\n- Upgrade Kit recipes can now be viewed in JEI",
|
| 1386 | "1.9.4-pre-2": "- Fixed crashes regarding saving NBT for the NecroData Capability (also cleaned up the saving part)\n- Fixed some small quirks with the Shoggoth Ooze blocks\n- Added a config option to toggle whether or not Demon Animals should place down Mimic Fire instead of normal Fire",
|
| 1387 | "1.9.4-pre-1": "- Darklands Highlands and Mountains are now in the cold biome group, and snow generates in them\n- Initial Spellbook implementation (WIP, GUI and some backbone code, nothing functional yet)\n- Added a new font, used along with wharrgarbl to produce unreadable stuff\n- Remnant legs are now composed of more flexible limbs\n- Initial implementation of unlockable knowledge (WIP, only Entity information is partially locked, kill them to unlock the pages\n- The Decorative Statues now have their own recipe (Monolith Stone, Clay and a dye)\n- Added Rending Pedestals (PE powered blocks that collects essences through the use of a Staff of Rending)\n- Set harvest tool for a plethora of blocks that didn't have that set\n- The Abyssal Zombie has a new texture\n- The Abyssal Zombie now has it's own sounds\n- Improved worldgen performance (especially Overworld structures)\n- When broken or placed, the Luminous Thistle and Wasteland's Thorn now plays the correct sounds\n- You can't pick up the item placed on a altar/pedestal if your inventory is full\n- Shoggoth Ooze blocks are now made out of layers (like snow) instead of being a solid block\n- Removed the majority of the Shoggoth Ooze config options (superseded by the layered ooze blocks)\n- The skies in the dimensions are now composed of a skybox rather than a single color\n- Added a disruption that transforms surrounding animals\n- Item pages in the Necronomicon now has a frame around the displayed Item\n- Upgrade Kits are now applied at an Anvil, instead of the crafting grid\n- Improved the rendering of Items placed on altars/pedestals\n- Night Vision is no longer given from the normal armor sets, and the special ones only give it while in the Overworld\n- You shouldn't be able to repair Transmutation Gems with repairing items/blocks from other mods\n- Spectral Dragon and Asorah's hitboxes work now (huge shoutout to Vadis365 for the code that helped debugging the entity part placement)\n- Most player interactions with Necronomicons can't be completed unless the player owns the Necronomicon\n- You can now till Darklands Grass, Dreadlands Grass and Dreadlands Dirt with any hoe\n- You can now plant more things on Darklands Grass, Dreadlands Grass and Dreadlands Dirt",
|
| 1388 | "**.**.**.**": "- Demon Animals now starts spreading fire if they get in contact with any source of fire\n- Something happens if you use Shears on Evil Animals\n- Improved the rendering of the Visage of The Depths overlay (should fix any rendering issues regarding it)\n- A fully usable ritual formation no longer generates along with the Temple of J'zahar (you have to do the Necronomcion part)\n- Applying the Coralium and Dread enchantments through rituals works now\n- Improved cave and ravine generation in the Abyssal Wasteland and the Dreadlands\n- Caves and ravines now generate in the Dark Realm\n- Reduced the amount of smoke Shadow mobs emit while inside the Dark Realm\n- Shadow mobs (and Lesser Shadow Shoggoths) are all translucent\n- When a Lesser Shoggoth spawns a child, the child will be of the same type as the parent\n- Added a config option for setting whether or not Lesser Shoggoths should have a chance of spawning in the Overworld\n- Added Crystal Fragments (even smaller pieces of Crystallized Elements)\n- Set proper map colors for the various blocks\n- Shadow mobs now have a chance of spawning in all Darklands biomes (but they're still more common in the mountains)\n- Changed some internal code for the Essence of The Gatekeeper Item Entity (fixes crashes with Extra Utilities 2)\n- The Dreadlands Grass now has the correct bottom and particle texture\n- Mob spawning in the Dreadlands should be more frequent, while mob spawning in the Abyssal Wasteland should be a bit less frequent\n- Lesser Shoggoths no longer spread a layer of ooze below the layer they've already spread\n- Applied the correct colors for the last 8 Crystal Clusters\n- Fixed numerous crafting recipes for crystal items/blocks\n- Changed the color palette for the Darklands biomes (now uses a indigo-esque color instead of the previous purple)\n- Made the color of the various Darkstone blocks a shade bluer\n- The foliage color in the Abyssal Wasteland now matches the color of the Fused Abyssal Sand\n- Removed the random blindness from the Darklands biomes\n- Lowered the height at which Items placed on Altars/Pedestals are rendered\n- Updated a bunch of pictures in the Necronomicon (anything involving either Darkstone or the Darklands)\n- Remnants no longer say 2 insults at once, and no longer tell you they're busy when you initialize a trade with one\n- Added an API hook to enable Gateway Keys to function in any dimension registered there\n- The Darklands Oak and Dreadlands Tree are less randomized, and taller in general\n- Increased the amount of Darklands Oaks that generate in Darklands Forests\n- Replaced the Darklands Oak Log texture with a different animation and darkened both the Log and Plank textures\n- The Ritual of Fertility now also targets Rabbits\n- Added a config option to change the opacity of the overlay displayed when wearing the Visage of The Depths",
|
| 1389 | "**.**.**.**": "- The terrain in the Dark Realm now has holes resembling the various islands in Omothol generating at the same coordinates\n- Reduced the damage of the Dreadium Katana by 5\n- Halved the durability of the Dreadium Katana and reduced the durability of the Cudgel by 500\n- Sacrificial Altars no longer target Shadow mobs\n- Fixed incorrect corner stair rotation\n- Added more Darklands structures\n- Tiered Sacrificial Altars now share the same cooldown as the regular one (instead of scaling it up unreasonably)\n- The information about Sacrificial Altars now mention the PE collection limit (a fifth of the max capacity)\n- Replaced the Obsidian pillars in the Abyssal Wasteland with giant chains of various lengths (extending downwards from the top)\n- Added additional conditions for Shoggoth Lairs to generate (prevents the derps where they generate almost entirely above ground)\n- Removed all instances of Refined Coralium from the Vanilla Loot Tables\n- The mob spawn list purging is now run in load complete (stops any mob spawn adding done in post-init)\n- It now rains in Darklands Plains and Darklands Mountains\n- Added Coralium Infested Squid\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth can now breathe under water\n- The various dimensional essences now have new textures (which resemble their dimension slightly)\n- The Iron Wall Enchantment now works\n- Added a configurable blacklist for the Interdimensional Cage\n- Liquid Coralium now transmutes Cobblestone blocks into Abyssal Cobblestone, instead of Abyssal Stone\n- Abyssal Sand now randomly turns into Fused Abyssal Sand when exposed to light levels higher than 13\n- Shoggoth Ooze now turns into more dimension-specific blocks instead of Dirt if it's set to expire\n- Spectral Dragons now apply Coralium Plague instead of dealing physical damage\n- Updated a whole bunch of pictures in the Necronomicon\n- Ritual offerings that have Container Items (Buckets, among others) will now return the Container Item instead of consuming the Item altogether\n- Increased the spawn rate and vein size of Abyssal Coralium Ore, while reducing the spawn rate and vein size of Abyssal Diamond Ore\n- Rituals required to progress through the dimensions now appear first on their individual ritual section\n- The metadata wildcard now works correctly for ritual offerings (allowing you to use the same Transmutation Gem in multiple rituals, among things)\n- Added a config option to amplify the armor-piercing damage dealt by mobs in Hardcore Mode\n- The Coralium Plague and Dread Plague damage becomes armor-piercing when Hardcore Mode is enabled\n- Set a more proper attack damage to the various axes\n- The spawner blocks now properly initialize the entities they spawn before spawning them\n- Now runs on Forge 12.18.3.2185",
|
| 1390 | "**.**.**.**": "- The Achievements and Rituals with Water Bottles should display Water Bottles, and nothing else\n- Switched the internal method of killing the sacrifice in rituals that requires a sacrifice (Pigs will no longer turn into Zombie Pigmen)\n- The Forge Universal Bucket is actually registered for the fluids, instead of it not being that\n- Set the correct textures for the Ritual Altars/Pedestals that didn't have the correct texture\n- All of the Ritual Altars/Pedestals now drop the correct block\n- Expanded the amount of different types of objects you can input as offerings in a Ritual\n- Made the bounding boxes for Shoggoth Ooze, Shoggoth Biomass and Solid Lava the size of a full block\n- Fixed the placement of Torches and Buttons in Abyssal Strongholds\n- Fixed the placement of Torches in Dreadlands Mineshafts\n- The Dread Spawn now plays it's sounds (instead of the Zombie ones)",
|
| 1391 | "**.**.**.**": "- Fixed crashes related to opening the Achievements page\n- Dreadlands Trees won't turn Dreadlands Dirt into regular Dirt if grown on it\n- Dreadlands Grass now reverts into Dreadlands Dirt when a block is placed on it, instead of regular Dirt",
|
| 1392 | "**.**.**.**": "- Added missing client-side check when fetching the Patreon data\n- Added Luminous Thistle\n- Added Wasteland's Thorn\n- Replaced the mushroom generation in the Abyssal Wastelands with the aforementioned plants",
|
| 1393 | "**.**.**.**": "- Asorah and Spectral Dragons are now immune to fire\n- Reduced the amount of smoke particles during a ritual\n- Ritual Altar creation now has more visual effects\n- Loading stages are no longer logged\n- A few Item textures have been updated\n- Patron Necronomicon info is now fetched from a remote file (has a local version if something goes wrong)\n- A Necronomicon Page object can now specify a URL that points to an image, which will then be displayed (if the image can be located)\n- Any JSON file added to the \"abyssalcraft\" folder in the config directory that's properly formatted will be injected into the \"Other Information\" section of the Necronomicon\n- The \"AbyssalCraft Tools\" Creative Tab now has a Interdimensional Cage filled with PE alongside the normal empty one\n- Fixed the Item name colors on the Gateway Keys\n- Replaced half of the Darklands structures\n- Added API hooks for generating Darklands structures\n- Added config option to force the dimension biomes to reset the mob spawning lists in order to stop mobs from other mods from populating the lists\n- Made the teal tint on the Depths Helmet overlay A LOT more transparent\n- Added Abyssal Sand\n- Added Fused Abyssal Sand\n- Added Abyssal Sand Glass\n- The terrain in the Abyssal Wasteland now has a top layer of Fused Abyssal Sand, with patches of Abyssal Stone\n- Added Dreadlands Dirt\n- Updated the textures on Dreadstone, Abyssalnite Stone and their brick counterparts\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone Stairs, Slabs and Walls\n- Changed the ritual formation blocks to use the Cobblestone blocks instead of Bricks where applicable\n- Updated the information about statues to mention them needing an open sky to operate\n- Fixed the bug where the random blindness from Darklands biomes would stay when it's reached 0\n- Replaced the Darkstone Cobblestone in Abyssal Strongholds with Abyssal Cobblestone\n- Rituals can now be NBT sensitive (pedestal offerings must have identical NBT tags to the ones in the ritual recipe)\n- You can no longer process Liquid Antimatter or Liquid Coralium Buckets in Furnaces, Transmutators or Crystallizers\n- Removed the crafting recipe for a Liquid Antimatter Bucket\n- Changed some of the Potion Effects added by the various armor sets\n- Now runs on Java 8\n- Deprecated the Liquid Coralium and Liquid Antimatter Buckets, they're now handled by the Forge Universal Bucket\n- Fixed a bug with Potion brewing\n- Fixed crashes with GregTech 5 Unofficial",
|
| 1394 | "**.**.**.**": "- The staff of Rending upgrades are now set to require the correct Necronomicons\n- Added config option to disable armor smelting recipes\n- More entities now has a chance to spawn wearing random armor\n- Fixed crashes regarding the Halloween easter egg",
|
| 1395 | "**.**.**.**": "- Fixed crashes on World load from particles",
|
| 1396 | "**.**.**.**": "- The Abyssal Stone Bricks in the Abyssal Stronghold now occasionally generate as their cracked version\n- Updated the pictures in the Potential Energy section (took new ones on regular Grass, instead of Darklands Grass)\n- Fixed crashes (or just log errors) from Disruptions being triggered after failing to complete a ritual\n- Replaced the smoke from various PE blocks with a particle meant to represent PE\n- Energy Pedestals can now harvest PE from statues again\n- You can now use Energy Relays on Energy Pedestals and Sacrificial Altars",
|
| 1397 | "**.**.**.**": "- Fixed crashes from completing Infusion Rituals",
|
| 1398 | "1.9.3": "- You can now configure the chance of a Shoggoth Lair generating in the Overworld\n- The Fire Rain Disruption will now fire a random amount of fireballs (so possibly not 8 at once)\n- Sacthoth now turns day into night when he spawns through a ODB explosion\n- Added Energy Collector\n- Added Energy Relay\n- Energy Pedestals no longer passively generate PE\n- Disruptions triggered from Ritual Altars now only fire server-side (apparently forgot to make that adjustement there)\n- Collected PE now persist when you break a block that can hold it, and the tooltip displays how much is contained\n- You can now have NBT tags persist through Infusion Rituals\n- Gateway Keys will now display a line of text in their tooltip when you can't use them\n- The Dreaded Abyssalnite Chestplate and Plated Coralium Chestplate's aura is now replaced with the effect being applied to attackers on hit\n- Added Energy Container\n- The Ethaxium Boots now applies a Speed boost like the other boots\n- The upgraded Gateway Keys can now place the previous key's portal in it's dimension\n- Added Interdimensional Cage (item that can capture entities)\n- Updated the information in the Ritual Information section\n- Fixed a performance hit caused by viewing pages that had pictures on them (in specifc cases)\n- Fixed the derp where the \"next turn-up\" button disappeared in the Machines section\n- Added a config option to make Shoggoth Ooze turn into dirt after being exposed to light for a random period of time\n- Added Tiered Energy Collectors\n- Added Tiered Energy Relays\n- Added Tiered Energy Containers\n- Changed the defaults to lower numbers for a couple of config options (biome spawn weights, entity spawn weights)\n- Min and max and default values for numerical config options are now provided in the comments (in favor of those not using the config GUI)\n- Updated nearly all of the pictures in the Necronomicon\n- The Abyssalnite Golem and Dreaded Abyssalnite Golem have new skins\n- Spiced up Hardcore Mode a bit\n- Anti-Ghouls now swing their arms when attacking\n- The Ritual of Fertility no longer has a chance of spawning Lesser Shoggoths\n- Remove the \"Shoggoth infestation\" Achievement, since that event no longer triggers\n- The Transmutation Gem now consumes durability when used for crafting, instead of being consumed directly\n- The \"AbyssalCraft Items\" Creative Tab now has each Necronomicon filled with PE alongside the normal empty one\n- The Staff of Rending and Staff of The Gatekeeper now raytrace properly\n- The Staff of Rending can now be upgraded to increase the amount of energy collected\n- A lot of items now have new textures (courtesy of Tiktalik)\n- The JEI integration now displays information regarding things created with the Staff of Rending\n- Darkened the sky color in the Abyssal Wasteland\n- Statues refuse to transport any PE if they're not under a clear sky\n- Statues now have a tolerance value, which increases the more you harvest PE from them, which eventually triggers a Disruption\n- Players no longer emit smoke inside the Dark Realm, only other entities\n- Sounds now play again in a few instances where they didn't\n- Fixed crashes regarding the Anti-Spider loot table",
|
| 1399 | "1.9.3-pre-1": "- Removed the hurt sounds for the Pete Depths Ghoul variant\n- The Pete, Mr. Wilson and Dr. Orange Depths Ghoul variants now have 3 individual idle sounds, mixed with the regular\n- Added Evil Sheep\n- Added Demon Sheep\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth now have their own set of sounds\n- Villages no longer generate in Darklands Highland and Mountain biomes\n- The large Obsidian pillars now generate in the Abyssal Wasteland again\n- Added Enchantment descriptions (can be seen using WAWLA, among others)\n- Getting killed by either plague shouldn't be able to result in entities spawning indefinitely in the death screen\n- Statues now fire disruptions in a more balanced matter (very rare in a normal state, more common when amplified)\n- Removed the Monolith Disruption (will re-add it when there's a lot more disruptions, or not)\n- Added a Disruption that has a chance to completely drain nearby PE Collectors\n- Disruptions are now properly synced between client and server\n- Did some changes to Overworld worldgen: Less Darkstone generation, slightly reduced Shoggoth Lair generation, heavily reduced Liquid Antimatter pool generation\n- The alternate Depths Ghoul variants no longer have different stats\n- The chance of a Depths Ghoul spawning as one of the variants is now 20%\n- Fixed a typo in the Lesser Shoggoth loot tables\n- Added subtitles to all sounds added by the mod\n- All Crystal Clusters should now have correct names\n- Now runs on Forge 12.18.1.2073",
|
| 1400 | "**.**.**.**": "- Added chiseled variants to the Brick types that didn't previously have one\n- Made more crafting recipes depend on the Ore Dictionary\n- Added a cracked variant to all the Brick types\n- Added configurable Item Blacklists for Entities that can pick up item\n- Removed the config option for Abyssal Zombies picking up rotten flesh (superseded by the above)\n- Remnants now have their own yes/no sounds when trading\n- A random chant will now play when performing a ritual\n- Remnant priests will randomly chant\n- Added a ritual that allows you to change the weather in the Biome you're currently at (if possible)\n- The Dreadium Katana and Sacthoth's Soul Reaper Blade now swing like regular swords",
|
| 1401 | "**.**.**.**": "- Statues now refuse to transfer PE if there's adjacent Statues on any side\n- Demon Animals now use the BiomeDictionary entry NETHER instead of the Nether Biome for Biomes to spawn in\n- All entities (except the bosses) now have their own loot tables\n- Now runs on Forge 12.18.1.2046\n- Split the Crystal Clusters into 2 blocks (solves the startup crashes with Forge 2044+)",
|
| 1402 | "**.**.**.**": "- Fixed crashes with placing double slab blocks\n- Darklands Oaks and Dreadlands Trees will now burn\n- Spectral Dragons can no longer fly through portal blocks (they bounce off)\n- Spectral Dragons now fly a bit slower, and are more suspectible to damage",
|
| 1403 | "**.**.**.**": "- Fixed crashes relating to statues transferring PE to Players\n- Fixed a slight derp in the Sacrificial Altar\n- Replaced a couple of textures\n- Added configuration category comments in the config file",
|
| 1404 | "**.**.**.**": "- Each boss' death ticks variable is now saved to NBT (fixes oddities in regards to world unloads during death animations)\n- Added hooks for registering armor textures for Ghoul armor rendering\n- If any Ghoul entity holds an item, it now renders in it's hand\n- Omothol Ghouls now have a chance to pick up items\n- Armor and held items should now render on Abyssal Anti-Zombies\n- Armor now renders on Ghoul entities (with a default texture if there isn't one assigned)\n- Armor Stands are no longer regarded as proper sacrifices for the Sacrificial Altar\n- Statues can now transfer PE to blocks in all directions (and any range boost increases the transfer range)\n- The Depths Ghoul heads are now back in the decorative block tab\n- The spawn weight for Demon Animals in the Nether is now configurable\n- Fixed crashes related to being teleported to the Dark Realm\n- Fixed a mathematical mishap in the Coralium Gem Cluster recipes\n- Added initial Capability support\n- You can now configure whether or not Abyssal Zombies should pick up Rotten Flesh\n- Removed the Biome ID configuration category (hasn't been used since moving past 1.9)\n- Corrected a few cases where TileEntity NBT data wouldn't sync properly\n- You should now sink into Shoggoth Ooze, Shoggoth Biomass and Solid Lava again\n- Removed duplicate diamond entry in the Dreadlands Mineshaft loot table\n- Fixes crashes regarding Ethaxium Pillars\n- Statues should now transfer PE to nearby players again\n- Asorah's GUI health bar will now decrement when his health decreases\n- Now runs on Forge 12.18.0.2007\n- Updated to 1.10.2"
|
| 1405 | },
|
| 1406 | "1.10": {
|
| 1407 | "**.**.**.**": "- Ported to 1.10"
|
| 1408 | },
|
| 1409 | "1.9.4": {
|
| 1410 | "**.**.**.**-FINAL": "- Demon Animals now starts spreading fire if they get in contact with any source of fire\n- Something happens if you use Shears on Evil Animals\n- Improved the rendering of the Visage of The Depths overlay (should fix any rendering issues regarding it)\n- A fully usable ritual formation no longer generates along with the Temple of J'zahar (you have to do the Necronomcion part)\n- Applying the Coralium and Dread enchantments through rituals works now\n- Improved cave and ravine generation in the Abyssal Wasteland and the Dreadlands\n- Caves and ravines now generate in the Dark Realm\n- Reduced the amount of smoke Shadow mobs emit while inside the Dark Realm\n- Shadow mobs (and Lesser Shadow Shoggoths) are all translucent\n- When a Lesser Shoggoth spawns a child, the child will be of the same type as the parent\n- Added a config option for setting whether or not Lesser Shoggoths should have a chance of spawning in the Overworld\n- Added Crystal Fragments (even smaller pieces of Crystallized Elements)\n- Set proper map colors for the various blocks\n- Shadow mobs now have a chance of spawning in all Darklands biomes (but they're still more common in the mountains)\n- Changed some internal code for the Essence of The Gatekeeper Item Entity (fixes crashes with Extra Utilities 2)\n- The Dreadlands Grass now has the correct bottom and particle texture\n- Mob spawning in the Dreadlands should be more frequent, while mob spawning in the Abyssal Wasteland should be a bit less frequent\n- Lesser Shoggoths no longer spread a layer of ooze below the layer they've already spread\n- Changed the color palette for the Darklands biomes (now uses a indigo-esque color instead of the previous purple)\n- Made the color of the various Darkstone blocks a shade bluer\n- The foliage color in the Abyssal Wasteland now matches the color of the Fused Abyssal Sand\n- Removed the random blindness from the Darklands biomes\n- Lowered the height at which Items placed on Altars/Pedestals are rendered\n- Updated a bunch of pictures in the Necronomicon (anything involving either Darkstone or the Darklands)\n- Remnants no longer say 2 insults at once, and no longer tell you they're busy when you initialize a trade with one\n- Added an API hook to enable Gateway Keys to function in any dimension registered there\n- The Darklands Oak and Dreadlands Tree are less randomized, and taller in general\n- Increased the amount of Darklands Oaks that generate in Darklands Forests\n- Replaced the Darklands Oak Log texture with a different animation and darkened both the Log and Plank textures\n- The Ritual of Fertility now also targets Rabbits\n- Added a config option to change the opacity of the overlay displayed when wearing the Visage of The Depths",
|
| 1411 | "**.**.**.**-FINAL": "- The terrain in the Dark Realm now has holes resembling the various islands in Omothol generating at the same coordinates\n- Reduced the damage of the Dreadium Katana by 5\n- Halved the durability of the Dreadium Katana and reduced the durability of the Cudgel by 500\n- Sacrificial Altars no longer target Shadow mobs\n- Fixed incorrect corner stair rotation\n- Added more Darklands structures\n- Tiered Sacrificial Altars now share the same cooldown as the regular one (instead of scaling it up unreasonably)\n- The information about Sacrificial Altars now mention the PE collection limit (a fifth of the max capacity)\n- Replaced the Obsidian pillars in the Abyssal Wasteland with giant chains of various lengths (extending downwards from the top)\n- Added additional conditions for Shoggoth Lairs to generate (prevents the derps where they generate almost entirely above ground)\n- Removed all instances of Refined Coralium from the Vanilla Loot Tables\n- The mob spawn list purging is now run in load complete (stops any mob spawn adding done in post-init)\n- It now rains in Darklands Plains and Darklands Mountains\n- Added Coralium Infested Squid\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth can now breathe under water\n- The various dimensional essences now have new textures (which resemble their dimension slightly)\n- The Iron Wall Enchantment now works\n- Added a configurable blacklist for the Interdimensional Cage\n- Liquid Coralium now transmutes Cobblestone blocks into Abyssal Cobblestone, instead of Abyssal Stone\n- Abyssal Sand now randomly turns into Fused Abyssal Sand when exposed to light levels higher than 13\n- Shoggoth Ooze now turns into more dimension-specific blocks instead of Dirt if it's set to expire\n- Spectral Dragons now apply Coralium Plague instead of dealing physical damage\n- Updated a whole bunch of pictures in the Necronomicon\n- Ritual offerings that have Container Items (Buckets, among others) will now return the Container Item instead of consuming the Item altogether\n- Increased the spawn rate and vein size of Abyssal Coralium Ore, while reducing the spawn rate and vein size of Abyssal Diamond Ore\n- Rituals required to progress through the dimensions now appear first on their individual ritual section\n- The metadata wildcard now works correctly for ritual offerings (allowing you to use the same Transmutation Gem in multiple rituals, among things)\n- Added a config option to amplify the armor-piercing damage dealt by mobs in Hardcore Mode\n- The Coralium Plague and Dread Plague damage becomes armor-piercing when Hardcore Mode is enabled\n- Set a more proper attack damage to the various axes\n- The spawner blocks now properly initialize the entities they spawn before spawning them\n- Now runs on Forge 12.17.0.2051",
|
| 1412 | "**.**.**.**-FINAL": "- The Achievements and Rituals with Water Bottles should display Water Bottles, and nothing else\n- Switched the internal method of killing the sacrifice in rituals that requires a sacrifice (Pigs will no longer turn into Zombie Pigmen)\n- The Forge Universal Bucket is actually registered for the fluids, instead of it not being that\n- Set the correct textures for the Ritual Altars/Pedestals that didn't have the correct texture\n- All of the Ritual Altars/Pedestals now drop the correct block\n- Expanded the amount of different types of objects you can input as offerings in a Ritual\n- Made the bounding boxes for Shoggoth Ooze, Shoggoth Biomass and Solid Lava the size of a full block\n- Fixed the placement of Torches and Buttons in Abyssal Strongholds\n- Fixed the placement of Torches in Dreadlands Mineshafts",
|
| 1413 | "**.**.**.**-FINAL": "- Fixed crashes related to opening the Achievements page\n- Dreadlands Trees won't turn Dreadlands Dirt into regular Dirt if grown on it\n- Dreadlands Grass now reverts into Dreadlands Dirt when a block is placed on it, instead of regular Dirt",
|
| 1414 | "**.**.**.**-FINAL": "- Added missing client-side check when fetching the Patreon data\n- Added Luminous Thistle\n- Added Wasteland's Thorn\n- Replaced the mushroom generation in the Abyssal Wastelands with the aforementioned plants",
|
| 1415 | "**.**.**.**-FINAL": "- Asorah and Spectral Dragons are now immune to fire\n- Reduced the amount of smoke particles during a ritual\n- Ritual Altar creation now has more visual effects\n- Loading stages are no longer logged\n- A few Item textures have been updated\n- Patron Necronomicon info is now fetched from a remote file (has a local version if something goes wrong)\n- A Necronomicon Page object can now specify a URL that points to an image, which will then be displayed (if the image can be located)\n- Any JSON file added to the \"abyssalcraft\" folder in the config directory that's properly formatted will be injected into the \"Other Information\" section of the Necronomicon\n- The \"AbyssalCraft Tools\" Creative Tab now has a Interdimensional Cage filled with PE alongside the normal empty one\n- Fixed the Item name colors on the Gateway Keys\n- Replaced half of the Darklands structures\n- Added API hooks for generating Darklands structures\n- Added config option to force the dimension biomes to reset the mob spawning lists in order to stop mobs from other mods from populating the lists\n- Made the teal tint on the Depths Helmet overlay A LOT more transparent\n- Added Abyssal Sand\n- Added Fused Abyssal Sand\n- Added Abyssal Sand Glass\n- The terrain in the Abyssal Wasteland now has a top layer of Fused Abyssal Sand, with patches of Abyssal Stone\n- Added Dreadlands Dirt\n- Updated the textures on Dreadstone, Abyssalnite Stone and their brick counterparts\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone Stairs, Slabs and Walls\n- Changed the ritual formation blocks to use the Cobblestone blocks instead of Bricks where applicable\n- Updated the information about statues to mention them needing an open sky to operate\n- Fixed the bug where the random blindness from Darklands biomes would stay when it's reached 0\n- Replaced the Darkstone Cobblestone in Abyssal Strongholds with Abyssal Cobblestone\n- Rituals can now be NBT sensitive (pedestal offerings must have identical NBT tags to the ones in the ritual recipe)\n- You can no longer process Liquid Antimatter or Liquid Coralium Buckets in Furnaces, Transmutators or Crystallizers\n- Removed the crafting recipe for a Liquid Antimatter Bucket\n- Changed some of the Potion Effects added by the various armor sets\n- Now runs on Java 8\n- Deprecated the Liquid Coralium and Liquid Antimatter Buckets, they're now handled by the Forge Universal Bucket\n- Fixed a bug with Potion brewing",
|
| 1416 | "**.**.**.**": "- The staff of Rending upgrades are now set to require the correct Necronomicons\n- Added config option to disable armor smelting recipes\n- More entities now has a chance to spawn wearing random armor\n- Fixed crashes regarding the Halloween easter egg",
|
| 1417 | "**.**.**.**": "- Fixed crashes on World load from particles",
|
| 1418 | "**.**.**.**": "- The Abyssal Stone Bricks in the Abyssal Stronghold now occasionally generate as their cracked version\n- Updated the pictures in the Potential Energy section (took new ones on regular Grass, instead of Darklands Grass)\n- Fixed crashes (or just log errors) from Disruptions being triggered after failing to complete a ritual\n- Replaced the smoke from various PE blocks with a particle meant to represent PE\n- Energy Pedestals can now harvest PE from statues again\n- You can now use Energy Relays on Energy Pedestals and Sacrificial Altars",
|
| 1419 | "**.**.**.**": "- Fixed crashes from completing Infusion Rituals",
|
| 1420 | "1.9.3": "- You can now configure the chance of a Shoggoth Lair generating in the Overworld\n- The Fire Rain Disruption will now fire a random amount of fireballs (so possibly not 8 at once)\n- Sacthoth now turns day into night when he spawns through a ODB explosion\n- Added Energy Collector\n- Added Energy Relay\n- Energy Pedestals no longer passively generate PE\n- Disruptions triggered from Ritual Altars now only fire server-side (apparently forgot to make that adjustement there)\n- Collected PE now persist when you break a block that can hold it, and the tooltip displays how much is contained\n- You can now have NBT tags persist through Infusion Rituals\n- Gateway Keys will now display a line of text in their tooltip when you can't use them\n- The Dreaded Abyssalnite Chestplate and Plated Coralium Chestplate's aura is now replaced with the effect being applied to attackers on hit\n- Added Energy Container\n- The Ethaxium Boots now applies a Speed boost like the other boots\n- The upgraded Gateway Keys can now place the previous key's portal in it's dimension\n- Added Interdimensional Cage (item that can capture entities)\n- Updated the information in the Ritual Information section\n- Fixed a performance hit caused by viewing pages that had pictures on them (in specifc cases)\n- Fixed the derp where the \"next turn-up\" button disappeared in the Machines section\n- Added a config option to make Shoggoth Ooze turn into dirt after being exposed to light for a random period of time\n- Added Tiered Energy Collectors\n- Added Tiered Energy Relays\n- Added Tiered Energy Containers\n- Changed the defaults to lower numbers for a couple of config options (biome spawn weights, entity spawn weights)\n- Min and max and default values for numerical config options are now provided in the comments (in favor of those not using the config GUI)\n- Updated nearly all of the pictures in the Necronomicon\n- The Abyssalnite Golem and Dreaded Abyssalnite Golem have new skins\n- Spiced up Hardcore Mode a bit\n- Anti-Ghouls now swing their arms when attacking\n- The Ritual of Fertility no longer has a chance of spawning Lesser Shoggoths\n- Remove the \"Shoggoth infestation\" Achievement, since that event no longer triggers\n- The Transmutation Gem now consumes durability when used for crafting, instead of being consumed directly\n- The \"AbyssalCraft Items\" Creative Tab now has each Necronomicon filled with PE alongside the normal empty one\n- The Staff of Rending and Staff of The Gatekeeper now raytrace properly\n- The Staff of Rending can now be upgraded to increase the amount of energy collected\n- A lot of items now have new textures (courtesy of Tiktalik)\n- The JEI integration now displays information regarding things created with the Staff of Rending\n- Darkened the sky color in the Abyssal Wasteland\n- Statues refuse to transport any PE if they're not under a clear sky\n- Statues now have a tolerance value, which increases the more you harvest PE from them, which eventually triggers a Disruption\n- Players no longer emit smoke inside the Dark Realm, only other entities\n- Sounds now play again in a few instances where they didn't\n- Fixed crashes regarding the Anti-Spider loot table",
|
| 1421 | "1.9.3-pre-1": "- Removed the hurt sounds for the Pete Depths Ghoul variant\n- The Pete, Mr. Wilson and Dr. Orange Depths Ghoul variants now have 3 individual idle sounds, mixed with the regular\n- Added Evil Sheep\n- Added Demon Sheep\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth now have their own set of sounds\n- Villages no longer generate in Darklands Highland and Mountain biomes\n- The large Obsidian pillars now generate in the Abyssal Wasteland again\n- Added Enchantment descriptions (can be seen using WAWLA, among others)\n- Getting killed by either plague shouldn't be able to result in entities spawning indefinitely in the death screen\n- Statues now fire disruptions in a more balanced matter (very rare in a normal state, more common when amplified)\n- Removed the Monolith Disruption (will re-add it when there's a lot more disruptions, or not)\n- Added a Disruption that has a chance to completely drain nearby PE Collectors\n- Disruptions are now properly synced between client and server\n- Did some changes to Overworld worldgen: Less Darkstone generation, slightly reduced Shoggoth Lair generation, heavily reduced Liquid Antimatter pool generation\n- The alternate Depths Ghoul variants no longer have different stats\n- The chance of a Depths Ghoul spawning as one of the variants is now 20%\n- Fixed a typo in the Lesser Shoggoth loot tables\n- Added subtitles to all sounds added by the mod",
|
| 1422 | "**.**.**.**": "- Added chiseled variants to the Brick types that didn't previously have one\n- Made more crafting recipes depend on the Ore Dictionary\n- Added a cracked variant to all the Brick types\n- Added configurable Item Blacklists for Entities that can pick up item\n- Removed the config option for Abyssal Zombies picking up rotten flesh (superseded by the above)\n- Remnants now have their own yes/no sounds when trading\n- A random chant will now play when performing a ritual\n- Remnant priests will randomly chant\n- Added a ritual that allows you to change the weather in the Biome you're currently at (if possible)\n- The Dreadium Katana and Sacthoth's Soul Reaper Blade now swing like regular swords\n- Statues now transfer PE to players again",
|
| 1423 | "**.**.**.**": "- Statues now refuse to transfer PE if there's adjacent Statues on any side\n- Demon Animals now use the BiomeDictionary entry NETHER instead of the Nether Biome for Biomes to spawn in\n- All entities (except the bosses) now have their own loot tables",
|
| 1424 | "**.**.**.**": "- Really fixed that slight derp in the Sacrificial Altar (was fixed in the tiered one, but not the normal)\n- Fixed crashes with placing double slab blocks\n- Darklands Oaks and Dreadlands Trees will now burn\n- Spectral Dragons can no longer fly through portal blocks (they bounce off)\n- Spectral Dragons now fly a bit slower, and are more suspectible to damage",
|
| 1425 | "**.**.**.**": "- Fixed crashes relating to statues transferring PE to Players\n- Fixed a slight derp in the Sacrificial Altar\n- Replaced a couple of textures\n- Added configuration category comments in the config file",
|
| 1426 | "**.**.**.**": "- Each boss' death ticks variable is now saved to NBT (fixes oddities in regards to world unloads during death animations)\n- You should no longer hear random Ghast sounds around Anti-Bats\n- Added hooks for registering armor textures for Ghoul armor rendering\n- If any Ghoul entity holds an item, it now renders in it's hand\n- Omothol Ghouls now have a chance to pick up items\n- Armor and held items should now render on Abyssal Anti-Zombies\n- Armor now renders on Ghoul entities (with a default texture if there isn't one assigned)\n- Armor Stands are no longer regarded as proper sacrifices for the Sacrificial Altar\n- Statues can now transfer PE to blocks in all directions (and any range boost increases the transfer range)\n- The Depths Ghoul heads are now back in the decorative block tab\n- The spawn weight for Demon Animals in the Nether is now configurable\n- Fixed crashes related to being teleported to the Dark Realm\n- Fixed a mathematical mishap in the Coralium Gem Cluster recipes\n- Added initial Capability support\n- You can now configure whether or not Abyssal Zombies should pick up Rotten Flesh\n- Removed the Biome ID configuration category (hasn't been used since moving past 1.9)\n- Corrected a few cases where TileEntity NBT data wouldn't sync properly\n- You should now sink into Shoggoth Ooze, Shoggoth Biomass and Solid Lava again\n- Removed duplicate diamond entry in the Dreadlands Mineshaft loot table\n- Fixes crashes regarding Ethaxium Pillars\n- Statues should now transfer PE to nearby players again\n- Asorah's GUI health bar will now decrement when his health decreases\n- Now runs on Forge 12.17.0.1976",
|
| 1427 | "**.**.**.**": "- Fixed the missing texture for the Staff of The Gatekeeper\n- The sacrificial mechanic should work now (some old code still present broke it)",
|
| 1428 | "1.9.2": "- Fixed a couple of achievement icons looking weird\n- If you for some reason manage to exceed the max energy values, the Staff of Rending will reset the value and give you a essence\n- Adjusted the colors of the Abyssalnite and Dreadium crystals\n- Fixed custom particle color\n- Tweaked the FOV modification for the Coralium Longbow (should fix a crash with Blood Magic)\n- Added Spanish translation (thanks Moichrocks)\n- Added decorative versions of the statues (they're just blocks, no disruptions or anything)\n- The message that should appear in chat when the \"Ritual of reversed time\" is performed will now display\n- The death animation for J'zahar has been changed slightly (including a new sound effect, courtesy of Funwayguy)\n- Boss messages shouldn't display twice while in multiplayer\n- The Staff of The Gatekeeper, Dreadium Katana and Cudgel have their 3D models back!\n- Added Crystal Clusters (storage blocks for Crystals)\n- Things added to the crystal list are now properly regarded as crystals\n- Slightly re-balanced fuel values for Crystal-based fuels\n- Added a event that fires before Disruptions are triggered (can be cancelled)\n- Added a event that fires before a Lesser Shoggoth places down a Ooze block (allowing you to replace the Ooze block, or cancel the event)\n- Reduced the follow range on a couple of mobs\n- Ethaxium/Dark Ethaxium Pillars can now be rotated when placed (like Quartz Pillars)\n- Failing to complete a ritual now triggers a Disruption\n- It should be impossible to enchant the Dreadium Katana, Cudgel and Sacthoth's Soul Reaper Blade now (not even possible by anvil now)\n- Added Enchantment Rituals (allows you to enchant an item through a ritual)\n- The leaves on AbyssalCraft trees should now decay when there isn't any nearby log\n- The Altar of Cha'garoth is now created through rituals (instead of crafting)\n- The Coralium and Dread enchantments are now applied through rituals\n- Improved the custom explosion code a bit\n- You can now brew AbyssalCraft potions again\n- All things regarding Shoggoth food has now been moved over to EntityUtil\n- Implemented the sacrifice mechanic for rituals (some rituals will require you to present a living entity as an additional offering)\n- AbyssalCraft loot has been added to the vanilla loot tables\n- The spawn weight of End Abyssal Zombies is now configurable (replaces the previous config option to stop them from spawning)\n- Renamed the config option \"Evil Animal spawn rate\" to \"Evil Animal spawn weight\"\n- The fire rain disruption has been reduced to 8 fireballs (previously 20)\n- Some rituals now require a sacrifice (and the statue rituals can be performed anywhere)\n- Portal teleportation in survival mode should work normally again\n- You can now configure the portal cooldown (time it takes before you can use a portal again)\n- Now runs on Forge 12.17.0.1962",
|
| 1429 | "**.**.**.**": "- Ported to Minecraft 1.9.4\n- All armor sets currently uses the Diamond Armor Material (due to a small bug in Forge)"
|
| 1430 | },
|
| 1431 | "1.9": {
|
| 1432 | "**.**.**.**-FINAL": "- Demon Animals now starts spreading fire if they get in contact with any source of fire\n- Something happens if you use Shears on Evil Animals\n- Improved the rendering of the Visage of The Depths overlay (should fix any rendering issues regarding it)\n- A fully usable ritual formation no longer generates along with the Temple of J'zahar (you have to do the Necronomcion part)\n- Applying the Coralium and Dread enchantments through rituals works now\n- Improved cave and ravine generation in the Abyssal Wasteland and the Dreadlands\n- Caves and ravines now generate in the Dark Realm\n- Reduced the amount of smoke Shadow mobs emit while inside the Dark Realm\n- Shadow mobs (and Lesser Shadow Shoggoths) are all translucent\n- When a Lesser Shoggoth spawns a child, the child will be of the same type as the parent\n- Added a config option for setting whether or not Lesser Shoggoths should have a chance of spawning in the Overworld\n- Added Crystal Fragments (even smaller pieces of Crystallized Elements)\n- Set proper map colors for the various blocks\n- Shadow mobs now have a chance of spawning in all Darklands biomes (but they're still more common in the mountains)\n- Changed some internal code for the Essence of The Gatekeeper Item Entity (fixes crashes with Extra Utilities 2)\n- The Dreadlands Grass now has the correct bottom and particle texture\n- Mob spawning in the Dreadlands should be more frequent, while mob spawning in the Abyssal Wasteland should be a bit less frequent\n- Lesser Shoggoths no longer spread a layer of ooze below the layer they've already spread\n- Changed the color palette for the Darklands biomes (now uses a indigo-esque color instead of the previous purple)\n- Made the color of the various Darkstone blocks a shade bluer\n- The foliage color in the Abyssal Wasteland now matches the color of the Fused Abyssal Sand\n- Removed the random blindness from the Darklands biomes\n- Lowered the height at which Items placed on Altars/Pedestals are rendered\n- Updated a bunch of pictures in the Necronomicon (anything involving either Darkstone or the Darklands)\n- Remnants no longer say 2 insults at once, and no longer tell you they're busy when you initialize a trade with one\n- Added an API hook to enable Gateway Keys to function in any dimension registered there\n- The Darklands Oak and Dreadlands Tree are less randomized, and taller in general\n- Increased the amount of Darklands Oaks that generate in Darklands Forests\n- Replaced the Darklands Oak Log texture with a different animation and darkened both the Log and Plank textures\n- The Ritual of Fertility now also targets Rabbits\n- Added a config option to change the opacity of the overlay displayed when wearing the Visage of The Depths",
|
| 1433 | "**.**.**.**-FINAL": "- The terrain in the Dark Realm now has holes resembling the various islands in Omothol generating at the same coordinates\n- Reduced the damage of the Dreadium Katana by 5\n- Halved the durability of the Dreadium Katana and reduced the durability of the Cudgel by 500\n- Sacrificial Altars no longer target Shadow mobs\n- Fixed incorrect corner stair rotation\n- Added more Darklands structures\n- Tiered Sacrificial Altars now share the same cooldown as the regular one (instead of scaling it up unreasonably)\n- The information about Sacrificial Altars now mention the PE collection limit (a fifth of the max capacity)\n- Replaced the Obsidian pillars in the Abyssal Wasteland with giant chains of various lengths (extending downwards from the top)\n- Added additional conditions for Shoggoth Lairs to generate (prevents the derps where they generate almost entirely above ground)\n- Removed all instances of Refined Coralium from the Vanilla Loot Tables\n- The mob spawn list purging is now run in load complete (stops any mob spawn adding done in post-init)\n- It now rains in Darklands Plains and Darklands Mountains\n- Added Coralium Infested Squid\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth can now breathe under water\n- The various dimensional essences now have new textures (which resemble their dimension slightly)\n- The Iron Wall Enchantment now works\n- Added a configurable blacklist for the Interdimensional Cage\n- Liquid Coralium now transmutes Cobblestone blocks into Abyssal Cobblestone, instead of Abyssal Stone\n- Abyssal Sand now randomly turns into Fused Abyssal Sand when exposed to light levels higher than 13\n- Shoggoth Ooze now turns into more dimension-specific blocks instead of Dirt if it's set to expire\n- Spectral Dragons now apply Coralium Plague instead of dealing physical damage\n- Updated a whole bunch of pictures in the Necronomicon\n- Ritual offerings that have Container Items (Buckets, among others) will now return the Container Item instead of consuming the Item altogether\n- Increased the spawn rate and vein size of Abyssal Coralium Ore, while reducing the spawn rate and vein size of Abyssal Diamond Ore\n- Rituals required to progress through the dimensions now appear first on their individual ritual section\n- The metadata wildcard now works correctly for ritual offerings (allowing you to use the same Transmutation Gem in multiple rituals, among things)\n- Added a config option to amplify the armor-piercing damage dealt by mobs in Hardcore Mode\n- The Coralium Plague and Dread Plague damage becomes armor-piercing when Hardcore Mode is enabled\n- Set a more proper attack damage to the various axes\n- The spawner blocks now properly initialize the entities they spawn before spawning them",
|
| 1434 | "**.**.**.**-FINAL": "- The Achievements and Rituals with Water Bottles should display Water Bottles, and nothing else\n- Switched the internal method of killing the sacrifice in rituals that requires a sacrifice (Pigs will no longer turn into Zombie Pigmen)\n- All of the Ritual Altars/Pedestals now drop the correct block\n- Expanded the amount of different types of objects you can input as offerings in a Ritual\n- Fixed the placement of Torches and Buttons in Abyssal Strongholds\n- Fixed the placement of Torches in Dreadlands Mineshafts",
|
| 1435 | "**.**.**.**-FINAL": "- Fixed crashes related to opening the Achievements page\n- Dreadlands Trees won't turn Dreadlands Dirt into regular Dirt if grown on it",
|
| 1436 | "**.**.**.**-FINAL": "- Added missing client-side check when fetching the Patreon data\n- Added Luminous Thistle\n- Added Wasteland's Thorn\n- Replaced the mushroom generation in the Abyssal Wastelands with the aforementioned plants",
|
| 1437 | "**.**.**.**-FINAL": "- Asorah and Spectral Dragons are now immune to fire\n- Reduced the amount of smoke particles during a ritual\n- Ritual Altar creation now has more visual effects\n- Loading stages are no longer logged\n- A few Item textures have been updated\n- Patron Necronomicon info is now fetched from a remote file (has a local version if something goes wrong)\n- A Necronomicon Page object can now specify a URL that points to an image, which will then be displayed (if the image can be located)\n- Any JSON file added to the \"abyssalcraft\" folder in the config directory that's properly formatted will be injected into the \"Other Information\" section of the Necronomicon\n- The \"AbyssalCraft Tools\" Creative Tab now has a Interdimensional Cage filled with PE alongside the normal empty one\n- Fixed the Item name colors on the Gateway Keys\n- Replaced half of the Darklands structures\n- Added API hooks for generating Darklands structures\n- Added config option to force the dimension biomes to reset the mob spawning lists in order to stop mobs from other mods from populating the lists\n- Made the teal tint on the Depths Helmet overlay A LOT more transparent\n- Added Abyssal Sand\n- Added Fused Abyssal Sand\n- Added Abyssal Sand Glass\n- The terrain in the Abyssal Wasteland now has a top layer of Fused Abyssal Sand, with patches of Abyssal Stone\n- Added Dreadlands Dirt\n- Updated the textures on Dreadstone, Abyssalnite Stone and their brick counterparts\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone Stairs, Slabs and Walls\n- Changed the ritual formation blocks to use the Cobblestone blocks instead of Bricks where applicable\n- Updated the information about statues to mention them needing an open sky to operate\n- Fixed the bug where the random blindness from Darklands biomes would stay when it's reached 0\n- Replaced the Darkstone Cobblestone in Abyssal Strongholds with Abyssal Cobblestone\n- Rituals can now be NBT sensitive (pedestal offerings must have identical NBT tags to the ones in the ritual recipe)\n- You can no longer process Liquid Antimatter or Liquid Coralium Buckets in Furnaces, Transmutators or Crystallizers\n- Removed the crafting recipe for a Liquid Antimatter Bucket\n- Changed some of the Potion Effects added by the various armor sets\n- Now runs on Java 8\n- Wooden Pressure Plates in Darklands villages is now replaced with Darklands Oak Pressure Plates\n- Deprecated the Liquid Coralium and Liquid Antimatter Buckets, they're now handled by the Forge Universal Bucket\n- Fixed a bug with Potion brewing",
|
| 1438 | "**.**.**.**": "- The staff of Rending upgrades are now set to require the correct Necronomicons\n- Added config option to disable armor smelting recipes\n- More entities now has a chance to spawn wearing random armor\n- Fixed crashes regarding the Halloween easter egg",
|
| 1439 | "**.**.**.**": "- Fixed crashes on World load from particles",
|
| 1440 | "**.**.**.**": "- The Abyssal Stone Bricks in the Abyssal Stronghold now occasionally generate as their cracked version\n- Updated the pictures in the Potential Energy section (took new ones on regular Grass, instead of Darklands Grass)\n- Fixed crashes (or just log errors) from Disruptions being triggered after failing to complete a ritual\n- Replaced the smoke from various PE blocks with a particle meant to represent PE\n- Energy Pedestals can now harvest PE from statues again\n- You can now use Energy Relays on Energy Pedestals and Sacrificial Altars",
|
| 1441 | "**.**.**.**": "- Fixed crashes from completing Infusion Rituals",
|
| 1442 | "1.9.3": "- You can now configure the chance of a Shoggoth Lair generating in the Overworld\n- The Fire Rain Disruption will now fire a random amount of fireballs (so possibly not 8 at once)\n- Sacthoth now turns day into night when he spawns through a ODB explosion\n- Added Energy Collector\n- Added Energy Relay\n- Energy Pedestals no longer passively generate PE\n- Disruptions triggered from Ritual Altars now only fire server-side (apparently forgot to make that adjustement there)\n- Collected PE now persist when you break a block that can hold it, and the tooltip displays how much is contained\n- You can now have NBT tags persist through Infusion Rituals\n- Gateway Keys will now display a line of text in their tooltip when you can't use them\n- The Dreaded Abyssalnite Chestplate and Plated Coralium Chestplate's aura is now replaced with the effect being applied to attackers on hit\n- Added Energy Container\n- The Ethaxium Boots now applies a Speed boost like the other boots\n- The upgraded Gateway Keys can now place the previous key's portal in it's dimension\n- Added Interdimensional Cage (item that can capture entities)\n- Updated the information in the Ritual Information section\n- Fixed a performance hit caused by viewing pages that had pictures on them (in specifc cases)\n- Fixed the derp where the \"next turn-up\" button disappeared in the Machines section\n- Added a config option to make Shoggoth Ooze turn into dirt after being exposed to light for a random period of time\n- Added Tiered Energy Collectors\n- Added Tiered Energy Relays\n- Added Tiered Energy Containers\n- Changed the defaults to lower numbers for a couple of config options (biome spawn weights, entity spawn weights)\n- Min and max and default values for numerical config options are now provided in the comments (in favor of those not using the config GUI)\n- Updated nearly all of the pictures in the Necronomicon\n- The Abyssalnite Golem and Dreaded Abyssalnite Golem have new skins\n- Spiced up Hardcore Mode a bit\n- Anti-Ghouls now swing their arms when attacking\n- The Ritual of Fertility no longer has a chance of spawning Lesser Shoggoths\n- Remove the \"Shoggoth infestation\" Achievement, since that event no longer triggers\n- The Transmutation Gem now consumes durability when used for crafting, instead of being consumed directly\n- The \"AbyssalCraft Items\" Creative Tab now has each Necronomicon filled with PE alongside the normal empty one\n- The Staff of Rending and Staff of The Gatekeeper now raytrace properly\n- The Staff of Rending can now be upgraded to increase the amount of energy collected\n- A lot of items now have new textures (courtesy of Tiktalik)\n- The JEI integration now displays information regarding things created with the Staff of Rending\n- Darkened the sky color in the Abyssal Wasteland\n- Statues refuse to transport any PE if they're not under a clear sky\n- Statues now have a tolerance value, which increases the more you harvest PE from them, which eventually triggers a Disruption\n- Players no longer emit smoke inside the Dark Realm, only other entities\n- Sounds now play again in a few instances where they didn't\n- Fixed crashes regarding the Anti-Spider loot table",
|
| 1443 | "1.9.3-pre-1": "- Removed the hurt sounds for the Pete Depths Ghoul variant\n- The Pete, Mr. Wilson and Dr. Orange Depths Ghoul variants now have 3 individual idle sounds, mixed with the regular\n- Added Evil Sheep\n- Added Demon Sheep\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth now have their own set of sounds\n- Villages no longer generate in Darklands Highland and Mountain biomes\n- The large Obsidian pillars now generate in the Abyssal Wasteland again\n- Added Enchantment descriptions (can be seen using WAWLA, among others)\n- Getting killed by either plague shouldn't be able to result in entities spawning indefinitely in the death screen\n- Statues now fire disruptions in a more balanced matter (very rare in a normal state, more common when amplified)\n- Removed the Monolith Disruption (will re-add it when there's a lot more disruptions, or not)\n- Added a Disruption that has a chance to completely drain nearby PE Collectors\n- Disruptions are now properly synced between client and server\n- Did some changes to Overworld worldgen: Less Darkstone generation, slightly reduced Shoggoth Lair generation, heavily reduced Liquid Antimatter pool generation\n- The alternate Depths Ghoul variants no longer have different stats\n- The chance of a Depths Ghoul spawning as one of the variants is now 20%\n- Fixed a typo in the Lesser Shoggoth loot tables\n- Added subtitles to all sounds added by the mod",
|
| 1444 | "**.**.**.**": "- Added chiseled variants to the Brick types that didn't previously have one\n- Made more crafting recipes depend on the Ore Dictionary\n- Added a cracked variant to all the Brick types\n- Added configurable Item Blacklists for Entities that can pick up item\n- Removed the config option for Abyssal Zombies picking up rotten flesh (superseded by the above)\n- Remnants now have their own yes/no sounds when trading\n- A random chant will now play when performing a ritual\n- Remnant priests will randomly chant\n- Added a ritual that allows you to change the weather in the Biome you're currently at (if possible)\n- The Dreadium Katana and Sacthoth's Soul Reaper Blade now swing like regular swords",
|
| 1445 | "**.**.**.**": "- Statues now refuse to transfer PE if there's adjacent Statues on any side\n- Demon Animals now use the BiomeDictionary entry NETHER instead of the Nether Biome for Biomes to spawn in\n- All entities (except the bosses) now have their own loot tables",
|
| 1446 | "**.**.**.**": "- Fixed crashes with placing double slab blocks\n- Darklands Oaks and Dreadlands Trees will now burn\n- Spectral Dragons can no longer fly through portal blocks (they bounce off)\n- Spectral Dragons now fly a bit slower, and are more suspectible to damage",
|
| 1447 | "**.**.**.**": "- Fixed crashes relating to statues transferring PE to Players\n- Fixed a slight derp in the Sacrificial Altar\n- Replaced a couple of textures\n- Added configuration category comments in the config file",
|
| 1448 | "**.**.**.**": "- Each boss' death ticks variable is now saved to NBT (fixes oddities in regards to world unloads during death animations)\n- You should no longer hear random Ghast sounds around Anti-Bats\n- Added hooks for registering armor textures for Ghoul armor rendering\n- If any Ghoul entity holds an item, it now renders in it's hand\n- Omothol Ghouls now have a chance to pick up items\n- Armor and held items should now render on Abyssal Anti-Zombies\n- Armor now renders on Ghoul entities (with a default texture if there isn't one assigned)\n- Armor Stands are no longer regarded as proper sacrifices for the Sacrificial Altar\n- Statues can now transfer PE to blocks in all directions (and any range boost increases the transfer range)\n- The Depths Ghoul heads are now back in the decorative block tab\n- The spawn weight for Demon Animals in the Nether is now configurable\n- Fixed crashes related to being teleported to the Dark Realm\n- Fixed a mathematical mishap in the Coralium Gem Cluster recipes\n- Added initial Capability support\n- You can now configure whether or not Abyssal Zombies should pick up Rotten Flesh\n- Removed the Biome ID configuration category (hasn't been used since moving past 1.9)\n- Corrected a few cases where TileEntity NBT data wouldn't sync properly\n- Removed duplicate diamond entry in the Dreadlands Mineshaft loot table\n- Fixes crashes regarding Ethaxium Pillars\n- Statues should now transfer PE to nearby players again\n- Asorah's GUI health bar will now decrement when his health decreases",
|
| 1449 | "**.**.**.**": "- Fixed the missing texture for the Staff of The Gatekeeper\n- The sacrificial mechanic should work now (some old code still present broke it)",
|
| 1450 | "1.9.2": "- Fixed a couple of achievement icons looking weird\n- If you for some reason manage to exceed the max energy values, the Staff of Rending will reset the value and give you a essence\n- Adjusted the colors of the Abyssalnite and Dreadium crystals\n- Fixed custom particle color\n- Added Spanish translation (thanks Moichrocks)\n- Tweaked the FOV modification for the Coralium Longbow (should fix a crash with Blood Magic)\n- Added decorative versions of the statues (they're just blocks, no disruptions or anything)\n- The message that should appear in chat when the \"Ritual of reversed time\" is performed will now display\n- The death animation for J'zahar has been changed slightly (including a new sound effect, courtesy of Funwayguy)\n- Boss messages shouldn't display twice while in multiplayer\n- The Staff of The Gatekeeper, Dreadium Katana and Cudgel have their 3D models back!\n- Added Crystal Clusters (storage blocks for Crystals)\n- Things added to the crystal list are now properly regarded as crystals\n- Slightly re-balanced fuel values for Crystal-based fuels\n- Added a event that fires before Disruptions are triggered (can be cancelled)\n- Added a event that fires before a Lesser Shoggoth places down a Ooze block (allowing you to replace the Ooze block, or cancel the event)\n- Reduced the follow range on a couple of mobs\n- Ethaxium/Dark Ethaxium Pillars can now be rotated when placed (like Quartz Pillars)\n- Failing to complete a ritual now triggers a Disruption\n- It should be impossible to enchant the Dreadium Katana, Cudgel and Sacthoth's Soul Reaper Blade now (not even possible by anvil now)\n- Added Enchantment Rituals (allows you to enchant an item through a ritual)\n- The leaves on AbyssalCraft trees should now decay when there isn't any nearby log\n- The Altar of Cha'garoth is now created through rituals (instead of crafting)\n- The Coralium and Dread enchantments are now applied through rituals\n- Improved the custom explosion code a bit\n- You can now brew AbyssalCraft potions again\n- All things regarding Shoggoth food has now been moved over to EntityUtil\n- Implemented the sacrifice mechanic for rituals (some rituals will require you to present a living entity as an additional offering)\n- AbyssalCraft loot has been added to the vanilla loot tables\n- The spawn weight of End Abyssal Zombies is now configurable (replaces the previous config option to stop them from spawning)\n- Renamed the config option \"Evil Animal spawn rate\" to \"Evil Animal spawn weight\"\n- The fire rain disruption has been reduced to 8 fireballs (previously 20)\n- Some rituals now require a sacrifice (and the statue rituals can be performed anywhere)\n- Portal teleportation in survival mode should work normally again\n- You can now configure the portal cooldown (time it takes before you can use a portal again)\n- Now runs on Forge 12.16.1.1938",
|
| 1451 | "**.**.**.**": "- Shoggoth Ooze should no longer spread onto Monolith Stone\n- Changed the picture for the Shoggoth Infestation page\n- Fixed a duplication bug with Ritual Altars and the like\n- When naturally grown into trees, Darklands Oaks and Dreadlands Trees should not turn into regular Oaks",
|
| 1452 | "**.**.**.**": "- Actually fix the client-side crashes exposed in the previous versions\n- Now runs on Forge 12.16.1.1887\n- Recipe categories in the JEI integration now shows what's used for what recipe (like how the Furnace is shown for smelting)\n- Altar/Pedestal interaction now sync between players again\n- There is no longer a limit on how many rituals can be displayed per section\n- You can now add infinite pages to a Necronomicon Category\n- The Darklands Oak and Dreadlands Tree now have a new design\n- Darklands Grass can now sustain Flowers, Tall Grass and Mushrooms again\n- Rebranded all API packages (now named \"AbyssalCraftAPI\" instead of \"AbyssalCraftAPI|Core\" for instance)\n- Replaced the Necronomicon \"missing texture\" with one that has a more fitting color scheme\n- If the Necronomicon GUI is unable to load an image, it will substitute to it's own \"missing texture\" (instead of the vanilla one)",
|
| 1453 | "**.**.**.**": "- Fixed crash at server startup",
|
| 1454 | "**.**.**.**": "- Leaf blocks now look correct when using fast graphics (thanks to vadis365)\n- Fixed random crashes occurring when hitting entities from certain angles\n- Added information regarding Shoggoth infestations to the Potential Energy section of Ritual Information",
|
| 1455 | "**.**.**.**": "- Fixed any crashes related to ClassCastExceptions regarding strongholds or mineshafts\n- The \"AbyssalCraft Items\" Creative Tab now has a Necronomicon as tab icon\n- Implemented loot tables (Abyssal Strongholds and Dreadlands Mineshafts have their own loot)\n- The Antimatter Potion Effect should no longer continue to spawn Anti-Players while the death screen is displaying\n- The AbyssalCraft biomes can now be accessed in the API (and you can create Darklands and Dreadlands biomes)\n- Any Fire block added by AbyssalCraft can now be exstinghished by hand like vanilla Fire\n- Displacement disruptions now properly move players around (along with other entities)",
|
| 1456 | "**.**.**.**": "- Recipes involving wooden planks should work with all types of planks now",
|
| 1457 | "1.9.1": "- Depths Ghouls now have their own hurt sound\n- Lesser Shoggoths now have their own living/hurt/death sounds\n- The ritual for respawning J'zahar will appear before the various Charms in the Omothol ritual section\n- Increased the PE requirement for a few rituals\n- Now runs on Forge 12.16.0.1851\n- Biome ID config options have been removed (as they are assigned automatically)\n- Nerfed the various tool materials a bit (reduced efficiency and durability)\n- A lot of API related things have been refactored\n- Right-clicking with a bucket should no longer crash the game\n- Inventory syncing for when the Staff of Rending gives you a essence/shadow gem should be a lot better now",
|
| 1458 | "1.9.1-pre-2": "- Now runs on Forge 12.16.0.1811\n- InventoryTweaks integration is back (you can sort crystal bag content again)\n- The Dreadium Samurai armor now animates correctly again (but the swing animation still de-syncs a bit)\n- Oblivion Deathbombs and ODB Cores now animate like TNT when primed\n- The death animation time for J'zahar has been increased to 40 seconds (so you can keep up with his speech)\n- The dialogues shown upon Asorah's and Cha'garoth's deaths now display each sentence with a 3 second pause between them\n- Added information about Enchantments to the Misc Information section\n- Added a ritual that allows you to respawn J'zahar (can only be performed at his temple)\n- Fixed a lot of issues related to tracking entities within close proximity of a block",
|
| 1459 | "1.9.1-pre-1": "- Demon Animals now have a 50% chance of not burning when spawning in the Nether\n- Added a mimic fire (exstinguishes after 6 seconds, can't be sustained by netherrack)\n- Integrations no longer need to be registered (added a plugin annotation that allows for 100% soft dependencies)\n- Fixed animations for the Dreadium Samurai Armor (arms should move correctly, and armor renders correctly on Armor Stands)\n- Improved the buttons in the Necronomicon GUI (they don't overlay anymore, and a transparent gradient displays on a button when hovered over)\n- Fixed potential crashes related to CraftingStacks where the recipe uses the OreDictionary\n- Automatically fetched crafting recipes will now also fetch the output quantity from the recipe\n- Sacthoth no longer spawns in the Dark Realm\n- Added a Misc Information section to the Necronomicon (displays things not mentioned anywhere else, among them crafting recipes)\n- The range from J'zahar in which you need to be in order for him to drop his essence has been increased to 32 blocks (previously 10)\n- Ported to Minecraft 1.9 (there may be bugs left from the port)\n- All boss health bars now uses the new system (and they also change color depending on how much health the boss has)"
|
| 1460 | },
|
| 1461 | "1.8.9": {
|
| 1462 | "**.**.**.**-FINAL": "- Demon Animals now starts spreading fire if they get in contact with any source of fire\n- Something happens if you use Shears on Evil Animals\n- Improved the rendering of the Visage of The Depths overlay (should fix any rendering issues regarding it)\n- A fully usable ritual formation no longer generates along with the Temple of J'zahar (you have to do the Necronomcion part)\n- Applying the Coralium and Dread enchantments through rituals works now\n- Improved cave and ravine generation in the Abyssal Wasteland and the Dreadlands\n- Caves and ravines now generate in the Dark Realm\n- Reduced the amount of smoke Shadow mobs emit while inside the Dark Realm\n- Shadow mobs (and Lesser Shadow Shoggoths) are all translucent\n- When a Lesser Shoggoth spawns a child, the child will be of the same type as the parent\n- Added a config option for setting whether or not Lesser Shoggoths should have a chance of spawning in the Overworld\n- Added Crystal Fragments (even smaller pieces of Crystallized Elements)\n- Set proper map colors for the various blocks\n- Shadow mobs now have a chance of spawning in all Darklands biomes (but they're still more common in the mountains)\n- Mob spawning in the Dreadlands should be more frequent, while mob spawning in the Abyssal Wasteland should be a bit less frequent\n- Lesser Shoggoths no longer spread a layer of ooze below the layer they've already spread\n- Changed the color palette for the Darklands biomes (now uses a indigo-esque color instead of the previous purple)\n- Made the color of the various Darkstone blocks a shade bluer\n- The foliage color in the Abyssal Wasteland now matches the color of the Fused Abyssal Sand\n- Removed the random blindness from the Darklands biomes\n- Lowered the height at which Items placed on Altars/Pedestals are rendered\n- Updated a bunch of pictures in the Necronomicon (anything involving either Darkstone or the Darklands)\n- Added an API hook to enable Gateway Keys to function in any dimension registered there\n- The Darklands Oak and Dreadlands Tree are less randomized, and taller in general\n- Increased the amount of Darklands Oaks that generate in Darklands Forests\n- Replaced the Darklands Oak Log texture with a different animation and darkened both the Log and Plank textures\n- The Ritual of Fertility now also targets Rabbits\n- Added a config option to change the opacity of the overlay displayed when wearing the Visage of The Depths",
|
| 1463 | "**.**.**.**-FINAL": "- The terrain in the Dark Realm now has holes resembling the various islands in Omothol generating at the same coordinates\n- Reduced the damage of the Dreadium Katana by 5\n- Halved the durability of the Dreadium Katana and reduced the durability of the Cudgel by 500\n- Sacrificial Altars no longer target Shadow mobs\n- Added more Darklands structures\n- Tiered Sacrificial Altars now share the same cooldown as the regular one (instead of scaling it up unreasonably)\n- The information about Sacrificial Altars now mention the PE collection limit (a fifth of the max capacity)\n- Replaced the Obsidian pillars in the Abyssal Wasteland with giant chains of various lengths (extending downwards from the top)\n- Added additional conditions for Shoggoth Lairs to generate (prevents the derps where they generate almost entirely above ground)\n- Removed all instances of Refined Coralium from the Vanilla Loot Tables\n- The mob spawn list purging is now run in load complete (stops any mob spawn adding done in post-init)\n- It now rains in Darklands Plains and Darklands Mountains\n- Added Coralium Infested Squid\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth can now breathe under water\n- The various dimensional essences now have new textures (which resemble their dimension slightly)\n- The Iron Wall Enchantment now works\n- Added a configurable blacklist for the Interdimensional Cage\n- Liquid Coralium now transmutes Cobblestone blocks into Abyssal Cobblestone, instead of Abyssal Stone\n- Abyssal Sand now randomly turns into Fused Abyssal Sand when exposed to light levels higher than 13\n- Shoggoth Ooze now turns into more dimension-specific blocks instead of Dirt if it's set to expire\n- Spectral Dragons now apply Coralium Plague instead of dealing physical damage\n- Updated a whole bunch of pictures in the Necronomicon\n- Ritual offerings that have Container Items (Buckets, among others) will now return the Container Item instead of consuming the Item altogether\n- Increased the spawn rate and vein size of Abyssal Coralium Ore, while reducing the spawn rate and vein size of Abyssal Diamond Ore\n- Rituals required to progress through the dimensions now appear first on their individual ritual section\n- The metadata wildcard now works correctly for ritual offerings (allowing you to use the same Transmutation Gem in multiple rituals, among things)\n- Added a config option to amplify the armor-piercing damage dealt by mobs in Hardcore Mode\n- The Coralium Plague and Dread Plague damage becomes armor-piercing when Hardcore Mode is enabled\n- The spawner blocks now properly initialize the entities they spawn before spawning them",
|
| 1464 | "**.**.**.**-FINAL": "- Switched the internal method of killing the sacrifice in rituals that requires a sacrifice (Pigs will no longer turn into Zombie Pigmen)\n- All of the Ritual Altars/Pedestals now drop the correct block\n- Expanded the amount of different types of objects you can input as offerings in a Ritual",
|
| 1465 | "**.**.**.**-FINAL": "- Fixed crashes related to opening the Achievements page\n- Dreadlands Trees won't turn Dreadlands Dirt into regular Dirt if grown on it",
|
| 1466 | "**.**.**.**-FINAL": "- Added missing client-side check when fetching the Patreon data\n- Added Luminous Thistle\n- Added Wasteland's Thorn\n- Replaced the mushroom generation in the Abyssal Wastelands with the aforementioned plants",
|
| 1467 | "**.**.**.**-FINAL": "- Asorah and Spectral Dragons are now immune to fire\n- Reduced the amount of smoke particles during a ritual\n- Ritual Altar creation now has more visual effects\n- Loading stages are no longer logged\n- A few Item textures have been updated\n- Patron Necronomicon info is now fetched from a remote file (has a local version if something goes wrong)\n- A Necronomicon Page object can now specify a URL that points to an image, which will then be displayed (if the image can be located)\n- Any JSON file added to the \"abyssalcraft\" folder in the config directory that's properly formatted will be injected into the \"Other Information\" section of the Necronomicon\n- The \"AbyssalCraft Tools\" Creative Tab now has a Interdimensional Cage filled with PE alongside the normal empty one\n- Fixed the Item name colors on the Gateway Keys\n- Replaced half of the Darklands structures\n- Added API hooks for generating Darklands structures\n- Added config option to force the dimension biomes to reset the mob spawning lists in order to stop mobs from other mods from populating the lists\n- Made the teal tint on the Depths Helmet overlay A LOT more transparent\n- Added Abyssal Sand\n- Added Fused Abyssal Sand\n- Added Abyssal Sand Glass\n- The terrain in the Abyssal Wasteland now has a top layer of Fused Abyssal Sand, with patches of Abyssal Stone\n- Added Dreadlands Dirt\n- Updated the textures on Dreadstone, Abyssalnite Stone and their brick counterparts\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone Stairs, Slabs and Walls\n- Changed the ritual formation blocks to use the Cobblestone blocks instead of Bricks where applicable\n- Updated the information about statues to mention them needing an open sky to operate\n- Fixed the bug where the random blindness from Darklands biomes would stay when it's reached 0\n- Replaced the Darkstone Cobblestone in Abyssal Strongholds with Abyssal Cobblestone\n- Rituals can now be NBT sensitive (pedestal offerings must have identical NBT tags to the ones in the ritual recipe)\n- You can no longer process Liquid Antimatter or Liquid Coralium Buckets in Furnaces, Transmutators or Crystallizers\n- Removed the crafting recipe for a Liquid Antimatter Bucket\n- Changed some of the Potion Effects added by the various armor sets\n- Now runs on Java 8",
|
| 1468 | "**.**.**.**": "- The staff of Rending upgrades are now set to require the correct Necronomicons\n- Added config option to disable armor smelting recipes\n- More entities now has a chance to spawn wearing random armor",
|
| 1469 | "**.**.**.**": "- Fixed crashes on World load from particles",
|
| 1470 | "**.**.**.**": "- The Abyssal Stone Bricks in the Abyssal Stronghold now occasionally generate as their cracked version\n- Updated the pictures in the Potential Energy section (took new ones on regular Grass, instead of Darklands Grass)\n- Fixed crashes (or just log errors) from Disruptions being triggered after failing to complete a ritual\n- Replaced the smoke from various PE blocks with a particle meant to represent PE",
|
| 1471 | "**.**.**.**": "- Fixed crashes from completing Infusion Rituals",
|
| 1472 | "1.9.3": "- You can now configure the chance of a Shoggoth Lair generating in the Overworld\n- The Fire Rain Disruption will now fire a random amount of fireballs (so possibly not 8 at once)\n- Sacthoth now turns day into night when he spawns through a ODB explosion\n- Added Energy Collector\n- Added Energy Relay\n- Energy Pedestals no longer passively generate PE\n- Disruptions triggered from Ritual Altars now only fire server-side (apparently forgot to make that adjustement there)\n- Collected PE now persist when you break a block that can hold it, and the tooltip displays how much is contained\n- You can now have NBT tags persist through Infusion Rituals\n- Gateway Keys will now display a line of text in their tooltip when you can't use them\n- The Dreaded Abyssalnite Chestplate and Plated Coralium Chestplate's aura is now replaced with the effect being applied to attackers on hit\n- Added Energy Container\n- The Ethaxium Boots now applies a Speed boost like the other boots\n- The upgraded Gateway Keys can now place the previous key's portal in it's dimension\n- Added Interdimensional Cage (item that can capture entities)\n- Updated the information in the Ritual Information section\n- Fixed a performance hit caused by viewing pages that had pictures on them (in specifc cases)\n- Fixed the derp where the \"next turn-up\" button disappeared in the Machines section\n- Added a config option to make Shoggoth Ooze turn into dirt after being exposed to light for a random period of time\n- Added Tiered Energy Collectors\n- Added Tiered Energy Relays\n- Added Tiered Energy Containers\n- Changed the defaults to lower numbers for a couple of config options (biome spawn weights, entity spawn weights)\n- Min and max and default values for numerical config options are now provided in the comments (in favor of those not using the config GUI)\n- The Demon Sheep's name is now localized\n- Updated nearly all of the pictures in the Necronomicon\n- The Abyssalnite Golem and Dreaded Abyssalnite Golem have new skins\n- Spiced up Hardcore Mode a bit\n- Depths Ghouls no longer spread the Dread Plague (that's apparently been a thing since 1.9.2)\n- Anti-Ghouls now swing their arms when attacking\n- The Ritual of Fertility no longer has a chance of spawning Lesser Shoggoths\n- Remove the \"Shoggoth infestation\" Achievement, since that event no longer triggers\n- The Transmutation Gem now consumes durability when used for crafting, instead of being consumed directly\n- The \"AbyssalCraft Items\" Creative Tab now has each Necronomicon filled with PE alongside the normal empty one\n- The Staff of Rending and Staff of The Gatekeeper now raytrace properly\n- The Staff of Rending can now be upgraded to increase the amount of energy collected\n- A lot of items now have new textures (courtesy of Tiktalik)\n- The JEI integration now displays information regarding things created with the Staff of Rending\n- Darkened the sky color in the Abyssal Wasteland\n- Statues refuse to transport any PE if they're not under a clear sky\n- Statues now have a tolerance value, which increases the more you harvest PE from them, which eventually triggers a Disruption\n- Players no longer emit smoke inside the Dark Realm, only other entities",
|
| 1473 | "1.9.3-pre-1": "- Removed the hurt sounds for the Pete Depths Ghoul variant\n- The Pete, Mr. Wilson and Dr. Orange Depths Ghoul variants now have 3 individual idle sounds, mixed with the regular\n- Added Evil Sheep\n- Added Demon Sheep\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth now have their own set of sounds\n- Villages no longer generate in Darklands Highland and Mountain biomes\n- The large Obsidian pillars now generate in the Abyssal Wasteland again\n- Added Enchantment descriptions (can be seen using WAWLA, among others)\n- Getting killed by either plague shouldn't be able to result in entities spawning indefinitely in the death screen\n- Statues now fire disruptions in a more balanced matter (very rare in a normal state, more common when amplified)\n- Removed the Monolith Disruption (will re-add it when there's a lot more disruptions, or not)\n- Added a Disruption that has a chance to completely drain nearby PE Collectors\n- Disruptions are now properly synced between client and server\n- Did some changes to Overworld worldgen: Less Darkstone generation, slightly reduced Shoggoth Lair generation, heavily reduced Liquid Antimatter pool generation\n- The alternate Depths Ghoul variants no longer have different stats\n- The chance of a Depths Ghoul spawning as one of the variants is now 20%",
|
| 1474 | "**.**.**.**": "- Added chiseled variants to the Brick types that didn't previously have one\n- Made more crafting recipes depend on the Ore Dictionary\n- Added a cracked variant to all the Brick types\n- Added configurable Item Blacklists for Entities that can pick up item\n- Removed the config option for Abyssal Zombies picking up rotten flesh (superseded by the above)\n- Remnants now have their own yes/no sounds when trading\n- A random chant will now play when performing a ritual\n- Remnant priests will randomly chant\n- Added a ritual that allows you to change the weather in the Biome you're currently at (if possible)",
|
| 1475 | "**.**.**.**": "- Statues now refuse to transfer PE if there's adjacent Statues on any side\n-Demon Animals now use the BiomeDictionary entry NETHER instead of the Nether Biome for Biomes to spawn in",
|
| 1476 | "**.**.**.**": "- Fixed crashes with placing double slab blocks\n- Darklands Oaks and Dreadlands Trees will now burn\n- Spectral Dragons can no longer fly through portal blocks (they bounce off)\n- Spectral Dragons now fly a bit slower, and are more suspectible to damage",
|
| 1477 | "**.**.**.**": "- Increased the amount of Abyssal Strongholds generating in the Abyssal Wasteland\n- Fixed a slight derp in the Sacrificial Altar\n- Replaced a couple of textures\n- Crates can now be opened again\n- Added configuration category comments in the config file",
|
| 1478 | "**.**.**.**": "- Each boss' death ticks variable is now saved to NBT (fixes oddities in regards to world unloads during death animations)\n- Added hooks for registering armor textures for Ghoul armor rendering\n- If any Ghoul entity holds an item, it now renders in it's hand\n- Omothol Ghouls now have a chance to pick up items\n- Armor and held items should now render on Abyssal Anti-Zombies\n- Armor now renders on Ghoul entities (with a default texture if there isn't one assigned)\n- Armor Stands are no longer regarded as proper sacrifices for the Sacrificial Altar\n- Statues can now transfer PE to blocks in all directions (and any range boost increases the transfer range)\n- The Depths Ghoul heads are now back in the decorative block tab\n- The spawn weight for Demon Animals in the Nether is now configurable\n- Fixed crashes related to being teleported to the Dark Realm\n- Fixed a mathematical mishap in the Coralium Gem Cluster recipes\n- Added initial Capability support\n- You can now configure whether or not Abyssal Zombies should pick up Rotten Flesh\n- Fixed bug where the Coralium Longbow would turn into a missing texture block when pulling",
|
| 1479 | "**.**.**.**": "- Fixed the missing texture for the Staff of The Gatekeeper",
|
| 1480 | "1.9.2": "- The Staff of Rending should now sync better when reaching the max energy values\n- If you for some reason manage to exceed the max energy values, the Staff of Rending will reset the value and give you a essence\n- Adjusted the colors of the Abyssalnite and Dreadium crystals\n- Fixed custom particle color\n- Tweaked the FOV modification for the Coralium Longbow (should fix a crash with Blood Magic)\n- Added Spanish translation (thanks Moichrocks)\n- Added decorative versions of the statues (they're just blocks, no disruptions or anything)\n- The message that should appear in chat when the \"Ritual of reversed time\" is performed will now display\n- The death animation for J'zahar has been changed slightly (including a new sound effect, courtesy of Funwayguy)\n- Boss messages shouldn't display twice while in multiplayer\n- The Staff of The Gatekeeper, Dreadium Katana and Cudgel have their 3D models back!\n- Added Crystal Clusters (storage blocks for Crystals)\n- Things added to the crystal list are now properly regarded as crystals\n- Slightly re-balanced fuel values for Crystal-based fuels\n- Added a event that fires before Disruptions are triggered (can be cancelled)\n- Added a event that fires before a Lesser Shoggoth places down a Ooze block (allowing you to replace the Ooze block, or cancel the event)\n- Reduced the follow range on a couple of mobs\n- Ethaxium/Dark Ethaxium Pillars can now be rotated when placed (like Quartz Pillars)\n- Failing to complete a ritual now triggers a Disruption\n- It should be impossible to enchant the Dreadium Katana, Cudgel and Sacthoth's Soul Reaper Blade now (not even possible by anvil now)\n- Added Enchantment Rituals (allows you to enchant an item through a ritual)\n- The leaves on AbyssalCraft trees should now decay when there isn't any nearby log\n- The Altar of Cha'garoth is now created through rituals (instead of crafting)\n- The Coralium and Dread enchantments are now applied through rituals\n- Improved the custom explosion code a bit\n- You can no longer brew any AbyssalCraft potions\n- All things regarding Shoggoth food has now been moved over to EntityUtil\n- Implemented the sacrifice mechanic for rituals (some rituals will require you to present a living entity as an additional offering)\n- The spawn weight of End Abyssal Zombies is now configurable (replaces the previous config option to stop them from spawning)\n- Renamed the config option \"Evil Animal spawn rate\" to \"Evil Animal spawn weight\"\n- The fire rain disruption has been reduced to 8 fireballs (previously 20)\n- Some rituals now require a sacrifice (and the statue rituals can be performed anywhere)\n- You can now configure the portal cooldown (time it takes before you can use a portal again)",
|
| 1481 | "**.**.**.**": "- Shoggoth Ooze should no longer spread onto Monolith Stone\n- Changed the picture for the Shoggoth Infestation page\n- When naturally grown into trees, Darklands Oaks and Dreadlands Trees should not turn into regular Oaks",
|
| 1482 | "**.**.**.**": "- Actually fix the client-side crashes exposed in the previous versions\n- Now runs on Forge 11.15.1.1875\n- There is no longer a limit on how many rituals can be displayed per section\n- You can now add infinite pages to a Necronomicon Category\n- The Darklands Oak and Dreadlands Tree now have a new design\n- Darklands Grass can now sustain Flowers, Tall Grass and Mushrooms again\n- Rebranded all API packages (now named \"AbyssalCraftAPI\" instead of \"AbyssalCraftAPI|Core\" for instance)\n- Replaced the Necronomicon \"missing texture\" with one that has a more fitting color scheme\n- If the Necronomicon GUI is unable to load an image, it will substitute to it's own \"missing texture\" (instead of the vanilla one)",
|
| 1483 | "**.**.**.**": "- Fixed crash at server startup",
|
| 1484 | "**.**.**.**": "- Leaf blocks now look correct when using fast graphics (thanks to vadis365)\n- Fixed random crashes occurring when hitting entities from certain angles\n- Added information regarding Shoggoth infestations to the Potential Energy section of Ritual Information",
|
| 1485 | "**.**.**.**": "- Fixed any crashes related to ClassCastExceptions regarding strongholds or mineshafts\n- The \"AbyssalCraft Items\" Creative Tab now has a Necronomicon as tab icon\n- The AbyssalCraft biomes can now be accessed in the API (and you can create Darklands and Dreadlands biomes)\n- Any Fire block added by AbyssalCraft can now be exstinghished by hand like vanilla Fire\n- Displacement disruptions now properly move players around (along with other entities)",
|
| 1486 | "**.**.**.**": "- Recipes involving wooden planks should work with all types of planks now",
|
| 1487 | "1.9.1": "- Demon Animals now have a 50% chance of not burning when spawning in the Nether\n- Added a mimic fire (exstinguishes after 6 seconds, can't be sustained by netherrack)\n- Integrations no longer need to be registered (added a plugin annotation that allows for 100% soft dependencies)\n- Fixed animations for the Dreadium Samurai Armor (arms should move correctly, and armor renders correctly on Armor Stands)\n- Improved the buttons in the Necronomicon GUI (they don't overlay anymore, and a transparent gradient displays on a button when hovered over)\n- Fixed potential crashes related to CraftingStacks where the recipe uses the OreDictionary\n- Automatically fetched crafting recipes will now also fetch the output quantity from the recipe\n- Sacthoth no longer spawns in the Dark Realm\n- Added a Misc Information section to the Necronomicon (displays things not mentioned anywhere else, among them crafting recipes)\n- The range from J'zahar in which you need to be in order for him to drop his essence has been increased to 32 blocks (previously 10)\n- Oblivion Deathbombs and ODB Cores now animate like TNT when primed\n- The death animation time for J'zahar has been increased to 40 seconds (so you can keep up with his speech)\n- The dialogues shown upon Asorah's and Cha'garoth's deaths now display each sentence with a 3 second pause between them\n- Added a ritual that allows you to respawn J'zahar (can only be performed at his temple)\n- Depths Ghouls now have their own hurt sound\n- Lesser Shoggoths now have their own living/hurt/death sounds\n- Increased the PE requirement for a few rituals\n- Nerfed the various tool materials a bit (reduced efficiency and durability)\n- A lot of API related things have been refactored\n- Inventory syncing for when the Staff of Rending gives you a essence/shadow gem should be a lot better now\n- Now runs on Forge 11.15.1.1847\n- Fixed any remaining issues related to tracking entities within close proximity of a block",
|
| 1488 | "1.9.0": "- Added missing page to the Potential Energy section of Ritual Information (mentions how monoliths are created)\n- Darklands Villages should now have Darklands Oak Pressure Plates and Darkstone Double slabs (instead of the vanilla equivalents)\n- Anti-Spiders are now hostile during night again\n- Fixed the third person rendering of some blocks (large upside-down models when held in third person)\n- The Dreadlands Infused Powerstone now has a model (semi-temp if I can get the OBj one to work, otherwise permanent)\n- Fixed the Abyssal Stone Slab and Darklands Oak Slab not rendering correctly when placed\n- Depths Ghouls, Abyssal Zombies and Lesser Shoggoths should no longer spawn at Mushroom Island Shores\n- It's possible to enter Cha'garoth's lair again (minor derp in the code)\n- Fixed some Necronomicon Pages with the wrong text\n- Added a config option that allows you to change how Evil Animals spawn\n- Disabled any test code in the Materializer that could trigger a crash (since it's incomplete)\n- Fixed bug related to crafting recipes involving upgrading Necronomicons/Crystal Bags and using Upgrade Kits\n- Lesser Shoggoths outside of the Overworld should drop the correct item when killed now (applying metadata to the dropped item)\n- Spectral Dragons should now be easier to hit without getting hit from them\n- Spectral Dragon spawn rate has been reduced to the lowest possible (encountering one now should be very rare, unless another mod tweaks the spawn rate)\n- Darklands Oak Slabs are no longer treated as stone\n- Added a config option allowing you to toggle whether or not Liquid Antimatter should disintegrate any item dropped into it\n- Crystallizer and Transmutator automation works correctly again (output slot is depleted from the bottom)\n- Leaves, Saplings and Logs should be treated as such by other mods now\n- Liquid Coralium shouldn't spread into ocean biomes when told not to\n- Remnants should now stop attacking whatever angered them when the anger timer runs out (and they don't slow the game down while they're angry)\n- The Crate now renders when placed\n- Replaced the Fist of Cha'garoth spawner block with a J'zahar spawner block\n- J'zahar has increased in size\n- If a Spectral Dragon dies while Asorah is draining it, Asorah won't take explosion damage\n- Any item placed on a Ritual/Sacrificial Altar or Ritual/Energy Pedestal will also render for other players\n- The smoke projected when a ritual is performed also renders for other players\n- Shoggoth Lairs should now longer spawn in biomes registered to the BiomeDictionary as the \"WATER\" type\n- The Staff of Rending will now continue to drain energy when the right mouse button is pressed\n- Shadow Fragments/Shards/Gems now spawn in dungeon/mineshaft/pyramid/stronghold chests\n- The Shard of Oblivion now requires 4 Shadow Gems (previously 8)\n- Remnants can now open doors\n- Added the Temple of J'zahar (generates in Omothol)\n- Added the City of Omothol\n- Updated the Omothol Progression section of the Necronomicon\n- Added Essence of The Gatekeeper (replacement for the Oblivion Catalyst in the Abyssalnomicon recipe, dropped by J'zahar)\n- Staff of The Gatekeeper is now created through a ritual (instead of dropped by J'zahar)\n- Added a Minion of The Gatekeeper spawner block\n- Potion of Annihilation and Potion of Dread Plague can now be brewed again\n- Remnants and Minions of The Gatekeeper no longer despawn\n- Spawn rate of Remnants and Minions of The Gatekeeper has been heavily reduced (quite rare now)\n- Minions of The Gatekeeper now has a 10% chance of dropping Ethaxium Ingots (while Eldritch Scales are the regular drop)\n- Now runs on Forge 11.15.1.1764",
|
| 1489 | "1.9.0-pre-4": "- Adjusted a few things in the JEI integration (fuel categories, method for fetching fuels)\n- The bounding box on Depths Ghoul/Anti-Ghoul/Omothol Ghoul has been reduced (the width was far off)\n- Lesser Shoggoths should now be possible to hit without them landing a couple of hits on you\n- Baby versions of all AbyssalCraft mobs (that has a baby version) now has a bounding box half the size of the adult one\n- Crafting recipes displayed in the Necronomicon are now automatically fetched (eg. a MineTweaked recipe will display)\n- Added a new config category: Worldgen\n- Nearly all structure generation and all ore generation can now be disabled in the config\n- You can now add/edit/remove pages in the Necronomicon (MineTweaker support in next ACI release)\n- The second Yog-Sothoth page now displays the correct text (eg. not the same as the first one)\n- Fixed the Ethaxium Hoe texture (file name derp)\n- Fixed the Plated Coralium Armor piece names being way off\n- Fixed Plate Coralium and Dreadium Samurai Armor textures missing\n- Fixed crashes when trying to equip Plated Coralium and Dreaded Abyssalnite Chestplates\n- Now runs on Forge 11.15.1.1741",
|
| 1490 | "1.9.0-pre-3": "- Removed all Transmutator/Crystallizer recipes involving Water of Lava (in block forms)\n- Fixed bug where some text in the Necronomicon didn't display\n- All explosives explode again\n- Fixed the third person rendering on all tools and weapons (swords are held by the hilt etc)\n- Fixed crashes related to missing classes (file paths to come Thaumcraft interfaces have changed, and I was checking for the old path)\n- The Depths Helmet overlay is displaying again\n- Fixed a glitch where walking into blocks that aren't full cubes would cause entities to suffocate\n- Monolith Disruptions shouldn't crash the game (and they work a bit better now)\n- All custom block and item models are now used (but the Staff of The Gatekeeper, the Cudgel and the Dreadlands Infused Powerstone currently has no models)\n- Added a JEI (Just Enough Items) integration (does exactly everything the NEI integration did)"
|
| 1491 | }
|
| 1492 | }
|
| 1493 |
|
| 1494 | [13:15:44] [Forge Version Check/INFO] [forge.VersionCheck]: [abyssalcraft] Found status: AHEAD Target: null
|
| 1495 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.depthsghoul as abyssalcraft:depthsghoul
|
| 1496 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.evilpig as abyssalcraft:evilpig
|
| 1497 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.abyssalzombie as abyssalcraft:abyssalzombie
|
| 1498 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity Primed ODB as abyssalcraft:primedodb
|
| 1499 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.Jzahar as abyssalcraft:jzahar
|
| 1500 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.abygolem as abyssalcraft:abygolem
|
| 1501 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.dreadgolem as abyssalcraft:dreadgolem
|
| 1502 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.dreadguard as abyssalcraft:dreadguard
|
| 1503 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity PowerstoneTracker as abyssalcraft:powerstonetracker
|
| 1504 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.dragonminion as abyssalcraft:dragonminion
|
| 1505 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.dragonboss as abyssalcraft:dragonboss
|
| 1506 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity Primed ODB Core as abyssalcraft:primedodbcore
|
| 1507 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.shadowcreature as abyssalcraft:shadowcreature
|
| 1508 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.shadowmonster as abyssalcraft:shadowmonster
|
| 1509 | [13:15:54] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.dreadling as abyssalcraft:dreadling
|
| 1510 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.dreadspawn as abyssalcraft:dreadspawn
|
| 1511 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.demonpig as abyssalcraft:demonpig
|
| 1512 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.gskeleton as abyssalcraft:gskeleton
|
| 1513 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.chagarothspawn as abyssalcraft:chagarothspawn
|
| 1514 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.chagarothfist as abyssalcraft:chagarothfist
|
| 1515 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.chagaroth as abyssalcraft:chagaroth
|
| 1516 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.shadowbeast as abyssalcraft:shadowbeast
|
| 1517 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.shadowboss as abyssalcraft:shadowboss
|
| 1518 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antiabyssalzombie as abyssalcraft:antiabyssalzombie
|
| 1519 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antibat as abyssalcraft:antibat
|
| 1520 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antichicken as abyssalcraft:antichicken
|
| 1521 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.anticow as abyssalcraft:anticow
|
| 1522 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.anticreeper as abyssalcraft:anticreeper
|
| 1523 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antighoul as abyssalcraft:antighoul
|
| 1524 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antipig as abyssalcraft:antipig
|
| 1525 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antiplayer as abyssalcraft:antiplayer
|
| 1526 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antiskeleton as abyssalcraft:antiskeleton
|
| 1527 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antispider as abyssalcraft:antispider
|
| 1528 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antizombie as abyssalcraft:antizombie
|
| 1529 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.remnant as abyssalcraft:remnant
|
| 1530 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.omotholghoul as abyssalcraft:omotholghoul
|
| 1531 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity CoraliumArrow as abyssalcraft:coraliumarrow
|
| 1532 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.jzaharminion as abyssalcraft:jzaharminion
|
| 1533 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.greaterdreadspawn as abyssalcraft:greaterdreadspawn
|
| 1534 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.lesserdreadbeast as abyssalcraft:lesserdreadbeast
|
| 1535 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity DreadSlug as abyssalcraft:dreadslug
|
| 1536 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.lessershoggoth as abyssalcraft:lessershoggoth
|
| 1537 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.evilcow as abyssalcraft:evilcow
|
| 1538 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.evilchicken as abyssalcraft:evilchicken
|
| 1539 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.demoncow as abyssalcraft:demoncow
|
| 1540 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.demonchicken as abyssalcraft:demonchicken
|
| 1541 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity GatekeeperEssence as abyssalcraft:gatekeeperessence
|
| 1542 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.evilsheep as abyssalcraft:evilsheep
|
| 1543 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.demonsheep as abyssalcraft:demonsheep
|
| 1544 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.coraliumsquid as abyssalcraft:coraliumsquid
|
| 1545 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity inkprojectile as abyssalcraft:inkprojectile
|
| 1546 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity dreadedcharge as abyssalcraft:dreadedcharge
|
| 1547 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity acidprojectile as abyssalcraft:acidprojectile
|
| 1548 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity blackhole as abyssalcraft:blackhole
|
| 1549 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity implosion as abyssalcraft:implosion
|
| 1550 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.shuboffspring as abyssalcraft:shuboffspring
|
| 1551 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity spirititem as abyssalcraft:spirititem
|
| 1552 | [13:15:55] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity portal as abyssalcraft:portal
|
| 1553 | [13:15:56] [Server thread/INFO] [AbyssalCraft]: Starting the Integration Handler.
|
| 1554 | [13:15:56] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod abyssalcraft
|
| 1555 | [13:15:56] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - AbyssalCraft took 22.856s
|
| 1556 | [13:15:56] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod orbis-lib
|
| 1557 | [13:15:56] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod orbis-lib
|
| 1558 | [13:15:56] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - OrbisLib took 0.000s
|
| 1559 | [13:15:56] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod aether
|
| 1560 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.altar`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1561 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.holystone_furnace`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1562 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.skyroot_chest`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1563 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.skyroot_sign`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1564 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.multiblock_dummy`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1565 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.moa_egg`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1566 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.icestone_cooler`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1567 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.incubator`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1568 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.present`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1569 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.wildcard`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1570 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.masonry_bench`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1571 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.outpost_campfire`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1572 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.aether_teleporter`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1573 | [13:16:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.skyroot_bed`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
| 1574 | [13:16:00] [Server thread/DEBUG] [AetherII]: 'Pre-initialize tiles' completed in 304ms
|
| 1575 | [13:16:01] [Server thread/DEBUG] [AetherII]: 'Pre-initialize dimensions' completed in 36ms
|
| 1576 | [13:16:01] [Server thread/DEBUG] [AetherII]: 'Pre-initialize loot tables' completed in 12ms
|
| 1577 | [13:16:01] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.aechor_plant as aether:aechor_plant
|
| 1578 | [13:16:01] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.aerbunny as aether:aerbunny
|
| 1579 | [13:16:01] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.carrion_sprout as aether:carrion_sprout
|
| 1580 | [13:16:01] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.cockatrice as aether:cockatrice
|
| 1581 | [13:16:01] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.kirrid as aether:kirrid
|
| 1582 | [13:16:01] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.aerwhale as aether:aerwhale
|
| 1583 | [13:16:01] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.zephyr as aether:zephyr
|
| 1584 | [13:16:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.tempest as aether:tempest
|
| 1585 | [13:16:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.swet as aether:swet
|
| 1586 | [13:16:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.taegore as aether:taegore
|
| 1587 | [13:16:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.glitterwing as aether:glitterwing
|
| 1588 | [13:16:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.edison as aether:edison
|
| 1589 | [13:16:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.burrukai as aether:burrukai
|
| 1590 | [13:16:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.necromancer as aether:necromancer
|
| 1591 | [13:16:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.josediya as aether:josediya
|
| 1592 | [13:16:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.tivalier as aether:tivalier
|
| 1593 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.glactrix as aether:glactrix
|
| 1594 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.mysterious_figure as aether:mysterious_figure
|
| 1595 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.varanys as aether:varanys
|
| 1596 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.skyroot_lizard as aether:skyroot_lizard
|
| 1597 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.sheepuff as aether:sheepuff
|
| 1598 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.frostpine_totem as aether:frostpine_totem
|
| 1599 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.kraisith as aether:kraisith
|
| 1600 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.shade_of_arkenzus as aether:shade_of_arkenzus
|
| 1601 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.ethereal_wisp as aether:ethereal_wisp
|
| 1602 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.fleeting_wisp as aether:fleeting_wisp
|
| 1603 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.soaring_wisp as aether:soaring_wisp
|
| 1604 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.fangrin as aether:fangrin
|
| 1605 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.nex_spirit as aether:nex_spirit
|
| 1606 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.pink_baby_swet as aether:pink_baby_swet
|
| 1607 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.floating_block as aether:floating_block
|
| 1608 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.moving_block as aether:moving_block
|
| 1609 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.dart as aether:dart
|
| 1610 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.daggerfrost_snowball as aether:daggerfrost_snowball
|
| 1611 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.bolt as aether:bolt
|
| 1612 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.parachute as aether:parachute
|
| 1613 | [13:16:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.tnt_present as aether:tnt_present
|
| 1614 | [13:16:04] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.moa as aether:moa
|
| 1615 | [13:16:04] [Server thread/DEBUG] [AetherII]: 'Pre-initialize entities' completed in 3314ms
|
| 1616 | [13:16:07] [Server thread/DEBUG] [AetherII]: 'Pre-initialize networking' completed in 3127ms
|
| 1617 | [13:16:07] [Server thread/DEBUG] [AetherII]: 'Pre-initialize patron rewards' completed in 73ms
|
| 1618 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/aechor_plant.json
|
| 1619 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/aerbunny.json
|
| 1620 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/burrukai.json
|
| 1621 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/carrion_sprout.json
|
| 1622 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/cockatrice.json
|
| 1623 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/glactrix.json
|
| 1624 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/glitterwing.json
|
| 1625 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/kirrid.json
|
| 1626 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/moa.json
|
| 1627 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/sheepuff.json
|
| 1628 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/skyroot_lizard.json
|
| 1629 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/swet.json
|
| 1630 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/taegore.json
|
| 1631 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/tempest.json
|
| 1632 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/varanys.json
|
| 1633 | [13:16:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/zephyr.json
|
| 1634 | [13:16:07] [Server thread/DEBUG] [AetherII]: 'Pre-initialize definitions' completed in 241ms
|
| 1635 | [13:16:07] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod aether
|
| 1636 | [13:16:07] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Aether II took 11.589s
|
| 1637 | [13:16:07] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod blocklings
|
| 1638 | [13:16:08] [Server thread/TRACE] [FML]: Automatically registered mod blocklings entity blockling as blocklings:entity_blockling
|
| 1639 | [13:16:08] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod blocklings
|
| 1640 | [13:16:08] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Blocklings Mod took 0.749s
|
| 1641 | [13:16:08] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod bloodmoon
|
| 1642 | [13:16:08] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod bloodmoon
|
| 1643 | [13:16:08] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Bloodmoon took 0.033s
|
| 1644 | [13:16:08] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod chisel
|
| 1645 | [13:16:08] [Server thread/INFO] [FML]: Applying holder lookups
|
| 1646 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_iron for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_iron. This means the object wasn't registered. It's likely just mod options.
|
| 1647 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_diamond for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_diamond. This means the object wasn't registered. It's likely just mod options.
|
| 1648 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_hitech for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_hitech. This means the object wasn't registered. It's likely just mod options.
|
| 1649 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:offsettool for public static team.chisel.common.item.ItemOffsetTool team.chisel.common.init.ChiselItems.offsettool. This means the object wasn't registered. It's likely just mod options.
|
| 1650 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aercloud for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aercloud. This means the object wasn't registered. It's likely just mod options.
|
| 1651 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_crafting_table for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_crafting_table. This means the object wasn't registered. It's likely just mod options.
|
| 1652 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_dirt for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_dirt. This means the object wasn't registered. It's likely just mod options.
|
| 1653 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_flower for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_flower. This means the object wasn't registered. It's likely just mod options.
|
| 1654 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_grass. This means the object wasn't registered. It's likely just mod options.
|
| 1655 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_portal for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_portal. This means the object wasn't registered. It's likely just mod options.
|
| 1656 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_teleporter for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_teleporter. This means the object wasn't registered. It's likely just mod options.
|
| 1657 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite. This means the object wasn't registered. It's likely just mod options.
|
| 1658 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick. This means the object wasn't registered. It's likely just mod options.
|
| 1659 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1660 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1661 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1662 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1663 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_pillar. This means the object wasn't registered. It's likely just mod options.
|
| 1664 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1665 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1666 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1667 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:altar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.altar. This means the object wasn't registered. It's likely just mod options.
|
| 1668 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:amberoot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.amberoot_leaves. This means the object wasn't registered. It's likely just mod options.
|
| 1669 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ambrosium_ore. This means the object wasn't registered. It's likely just mod options.
|
| 1670 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_torch for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ambrosium_torch. This means the object wasn't registered. It's likely just mod options.
|
| 1671 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arctic_spikespring for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.arctic_spikespring. This means the object wasn't registered. It's likely just mod options.
|
| 1672 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_door for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.arkenium_door. This means the object wasn't registered. It's likely just mod options.
|
| 1673 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.arkenium_ore. This means the object wasn't registered. It's likely just mod options.
|
| 1674 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:barkshroom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.barkshroom. This means the object wasn't registered. It's likely just mod options.
|
| 1675 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_dark_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_dark_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
| 1676 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_light_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_light_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
| 1677 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
| 1678 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_swingtip for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_swingtip. This means the object wasn't registered. It's likely just mod options.
|
| 1679 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberry_bush for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blueberry_bush. This means the object wasn't registered. It's likely just mod options.
|
| 1680 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_plant for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.brettl_plant. This means the object wasn't registered. It's likely just mod options.
|
| 1681 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.candy_cane_block. This means the object wasn't registered. It's likely just mod options.
|
| 1682 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.candy_cane_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1683 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudwool_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.cloudwool_block. This means the object wasn't registered. It's likely just mod options.
|
| 1684 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudwool_carpet for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.cloudwool_carpet. This means the object wasn't registered. It's likely just mod options.
|
| 1685 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass. This means the object wasn't registered. It's likely just mod options.
|
| 1686 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1687 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_pane for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass_pane. This means the object wasn't registered. It's likely just mod options.
|
| 1688 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_pane_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass_pane_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1689 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_blue_dark_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_blue_dark_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
| 1690 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_blue_light_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_blue_light_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
| 1691 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_blue_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_blue_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
| 1692 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_beam. This means the object wasn't registered. It's likely just mod options.
|
| 1693 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1694 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_log. This means the object wasn't registered. It's likely just mod options.
|
| 1695 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_planks. This means the object wasn't registered. It's likely just mod options.
|
| 1696 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick. This means the object wasn't registered. It's likely just mod options.
|
| 1697 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1698 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1699 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1700 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_pillar. This means the object wasn't registered. It's likely just mod options.
|
| 1701 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1702 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:ferrosite for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ferrosite. This means the object wasn't registered. It's likely just mod options.
|
| 1703 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:ferrosite_sand for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ferrosite_sand. This means the object wasn't registered. It's likely just mod options.
|
| 1704 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:forgotten_rose for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.forgotten_rose. This means the object wasn't registered. It's likely just mod options.
|
| 1705 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:golden_oak_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.golden_oak_log. This means the object wasn't registered. It's likely just mod options.
|
| 1706 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.gravitite_block. This means the object wasn't registered. It's likely just mod options.
|
| 1707 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.gravitite_ore. This means the object wasn't registered. It's likely just mod options.
|
| 1708 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_button. This means the object wasn't registered. It's likely just mod options.
|
| 1709 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_fence. This means the object wasn't registered. It's likely just mod options.
|
| 1710 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_fence_gate. This means the object wasn't registered. It's likely just mod options.
|
| 1711 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_log_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1712 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_pressure_plate. This means the object wasn't registered. It's likely just mod options.
|
| 1713 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_sapling. This means the object wasn't registered. It's likely just mod options.
|
| 1714 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1715 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1716 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_dark_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_dark_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
| 1717 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_light_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_light_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
| 1718 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
| 1719 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_swingtip for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_swingtip. This means the object wasn't registered. It's likely just mod options.
|
| 1720 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick. This means the object wasn't registered. It's likely just mod options.
|
| 1721 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1722 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1723 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1724 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1725 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_lantern for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_lantern. This means the object wasn't registered. It's likely just mod options.
|
| 1726 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_pillar. This means the object wasn't registered. It's likely just mod options.
|
| 1727 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_bush for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_bush. This means the object wasn't registered. It's likely just mod options.
|
| 1728 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_ice for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_ice. This means the object wasn't registered. It's likely just mod options.
|
| 1729 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_ice_crystal for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_ice_crystal. This means the object wasn't registered. It's likely just mod options.
|
| 1730 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_packed_ice for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_packed_ice. This means the object wasn't registered. It's likely just mod options.
|
| 1731 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_snow for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_snow. This means the object wasn't registered. It's likely just mod options.
|
| 1732 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_snow_layer for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_snow_layer. This means the object wasn't registered. It's likely just mod options.
|
| 1733 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_tulips for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_tulips. This means the object wasn't registered. It's likely just mod options.
|
| 1734 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone. This means the object wasn't registered. It's likely just mod options.
|
| 1735 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_bookshelf for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_bookshelf. This means the object wasn't registered. It's likely just mod options.
|
| 1736 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick. This means the object wasn't registered. It's likely just mod options.
|
| 1737 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1738 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1739 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1740 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1741 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_button. This means the object wasn't registered. It's likely just mod options.
|
| 1742 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_furnace for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_furnace. This means the object wasn't registered. It's likely just mod options.
|
| 1743 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_pillar. This means the object wasn't registered. It's likely just mod options.
|
| 1744 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_pressure_plate. This means the object wasn't registered. It's likely just mod options.
|
| 1745 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_rock for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_rock. This means the object wasn't registered. It's likely just mod options.
|
| 1746 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1747 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1748 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1749 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1750 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_bricks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_bricks. This means the object wasn't registered. It's likely just mod options.
|
| 1751 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_bricks_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_bricks_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1752 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_cooler for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_cooler. This means the object wasn't registered. It's likely just mod options.
|
| 1753 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_ore. This means the object wasn't registered. It's likely just mod options.
|
| 1754 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_pillar. This means the object wasn't registered. It's likely just mod options.
|
| 1755 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1756 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1757 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:incubator for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.incubator. This means the object wasn't registered. It's likely just mod options.
|
| 1758 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_flower for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.irradiated_flower. This means the object wasn't registered. It's likely just mod options.
|
| 1759 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_beam. This means the object wasn't registered. It's likely just mod options.
|
| 1760 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1761 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_log. This means the object wasn't registered. It's likely just mod options.
|
| 1762 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_planks. This means the object wasn't registered. It's likely just mod options.
|
| 1763 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:magnetic_shroom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.magnetic_shroom. This means the object wasn't registered. It's likely just mod options.
|
| 1764 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:masonry_bench for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.masonry_bench. This means the object wasn't registered. It's likely just mod options.
|
| 1765 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_egg for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.moa_egg. This means the object wasn't registered. It's likely just mod options.
|
| 1766 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mossy_holystone_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mossy_holystone_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1767 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mossy_holystone_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mossy_holystone_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1768 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mossy_holystone_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mossy_holystone_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1769 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:multiblock_dummy for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.multiblock_dummy. This means the object wasn't registered. It's likely just mod options.
|
| 1770 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:multiblock_dummy_half for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.multiblock_dummy_half. This means the object wasn't registered. It's likely just mod options.
|
| 1771 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mutant_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mutant_leaves. This means the object wasn't registered. It's likely just mod options.
|
| 1772 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mutant_leaves_decorated for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mutant_leaves_decorated. This means the object wasn't registered. It's likely just mod options.
|
| 1773 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:neverbloom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.neverbloom. This means the object wasn't registered. It's likely just mod options.
|
| 1774 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange_tree for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.orange_tree. This means the object wasn't registered. It's likely just mod options.
|
| 1775 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:outpost_campfire for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.outpost_campfire. This means the object wasn't registered. It's likely just mod options.
|
| 1776 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:pink_swingtip for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.pink_swingtip. This means the object wasn't registered. It's likely just mod options.
|
| 1777 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.plumproot. This means the object wasn't registered. It's likely just mod options.
|
| 1778 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:present for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.present. This means the object wasn't registered. It's likely just mod options.
|
| 1779 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:quickshoot for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quickshoot. This means the object wasn't registered. It's likely just mod options.
|
| 1780 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil. This means the object wasn't registered. It's likely just mod options.
|
| 1781 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass. This means the object wasn't registered. It's likely just mod options.
|
| 1782 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1783 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass_pane for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass_pane. This means the object wasn't registered. It's likely just mod options.
|
| 1784 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass_pane_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass_pane_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1785 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:rusted_ferrosite for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.rusted_ferrosite. This means the object wasn't registered. It's likely just mod options.
|
| 1786 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass. This means the object wasn't registered. It's likely just mod options.
|
| 1787 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1788 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_pane for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_pane. This means the object wasn't registered. It's likely just mod options.
|
| 1789 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_pane_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_pane_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1790 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1791 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1792 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1793 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_door for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.secret_skyroot_door. This means the object wasn't registered. It's likely just mod options.
|
| 1794 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_trapdoor for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.secret_skyroot_trapdoor. This means the object wasn't registered. It's likely just mod options.
|
| 1795 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick. This means the object wasn't registered. It's likely just mod options.
|
| 1796 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1797 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_decorative_lit for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_decorative_lit. This means the object wasn't registered. It's likely just mod options.
|
| 1798 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1799 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1800 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1801 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_pillar. This means the object wasn't registered. It's likely just mod options.
|
| 1802 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_pillar_lit for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_pillar_lit. This means the object wasn't registered. It's likely just mod options.
|
| 1803 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_beam. This means the object wasn't registered. It's likely just mod options.
|
| 1804 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bed for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_bed. This means the object wasn't registered. It's likely just mod options.
|
| 1805 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bookshelf for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_bookshelf. This means the object wasn't registered. It's likely just mod options.
|
| 1806 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_button. This means the object wasn't registered. It's likely just mod options.
|
| 1807 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_chest for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_chest. This means the object wasn't registered. It's likely just mod options.
|
| 1808 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1809 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_door for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_door. This means the object wasn't registered. It's likely just mod options.
|
| 1810 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_fence. This means the object wasn't registered. It's likely just mod options.
|
| 1811 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_fence_gate. This means the object wasn't registered. It's likely just mod options.
|
| 1812 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_ladder for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_ladder. This means the object wasn't registered. It's likely just mod options.
|
| 1813 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_log. This means the object wasn't registered. It's likely just mod options.
|
| 1814 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_log_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1815 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_planks. This means the object wasn't registered. It's likely just mod options.
|
| 1816 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_pressure_plate. This means the object wasn't registered. It's likely just mod options.
|
| 1817 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_sapling. This means the object wasn't registered. It's likely just mod options.
|
| 1818 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1819 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1820 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_trapdoor for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_trapdoor. This means the object wasn't registered. It's likely just mod options.
|
| 1821 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_twigs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_twigs. This means the object wasn't registered. It's likely just mod options.
|
| 1822 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:standing_skyroot_sign for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.standing_skyroot_sign. This means the object wasn't registered. It's likely just mod options.
|
| 1823 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:stoneshroom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.stoneshroom. This means the object wasn't registered. It's likely just mod options.
|
| 1824 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:tall_aether_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.tall_aether_grass. This means the object wasn't registered. It's likely just mod options.
|
| 1825 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:thera_dirt for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.thera_dirt. This means the object wasn't registered. It's likely just mod options.
|
| 1826 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:thera_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.thera_grass. This means the object wasn't registered. It's likely just mod options.
|
| 1827 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick. This means the object wasn't registered. It's likely just mod options.
|
| 1828 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1829 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1830 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1831 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1832 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_pillar. This means the object wasn't registered. It's likely just mod options.
|
| 1833 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_beam. This means the object wasn't registered. It's likely just mod options.
|
| 1834 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_decorative. This means the object wasn't registered. It's likely just mod options.
|
| 1835 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_fence. This means the object wasn't registered. It's likely just mod options.
|
| 1836 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_fence_gate. This means the object wasn't registered. It's likely just mod options.
|
| 1837 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_leaves. This means the object wasn't registered. It's likely just mod options.
|
| 1838 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_log. This means the object wasn't registered. It's likely just mod options.
|
| 1839 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_log_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1840 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_planks. This means the object wasn't registered. It's likely just mod options.
|
| 1841 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1842 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1843 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:unique_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.unique_sapling. This means the object wasn't registered. It's likely just mod options.
|
| 1844 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.valkyrie_grass. This means the object wasn't registered. It's likely just mod options.
|
| 1845 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wall_skyroot_sign for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wall_skyroot_sign. This means the object wasn't registered. It's likely just mod options.
|
| 1846 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wildcard for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wildcard. This means the object wasn't registered. It's likely just mod options.
|
| 1847 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_button. This means the object wasn't registered. It's likely just mod options.
|
| 1848 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_fence. This means the object wasn't registered. It's likely just mod options.
|
| 1849 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_fence_gate. This means the object wasn't registered. It's likely just mod options.
|
| 1850 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_log_wall. This means the object wasn't registered. It's likely just mod options.
|
| 1851 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_pressure_plate. This means the object wasn't registered. It's likely just mod options.
|
| 1852 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_sapling. This means the object wasn't registered. It's likely just mod options.
|
| 1853 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_slab. This means the object wasn't registered. It's likely just mod options.
|
| 1854 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_stairs. This means the object wasn't registered. It's likely just mod options.
|
| 1855 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:woven_sticks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.woven_sticks. This means the object wasn't registered. It's likely just mod options.
|
| 1856 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.zanite_block. This means the object wasn't registered. It's likely just mod options.
|
| 1857 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.zanite_ore. This means the object wasn't registered. It's likely just mod options.
|
| 1858 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aechor_petal for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aechor_petal. This means the object wasn't registered. It's likely just mod options.
|
| 1859 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aerwhale_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aerwhale_music_disc. This means the object wasn't registered. It's likely just mod options.
|
| 1860 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_saddle for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aether_saddle. This means the object wasn't registered. It's likely just mod options.
|
| 1861 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:antitoxin_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.antitoxin_vial. This means the object wasn't registered. It's likely just mod options.
|
| 1862 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:antivenom_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.antivenom_vial. This means the object wasn't registered. It's likely just mod options.
|
| 1863 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_chunk for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ambrosium_chunk. This means the object wasn't registered. It's likely just mod options.
|
| 1864 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_shard for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ambrosium_shard. This means the object wasn't registered. It's likely just mod options.
|
| 1865 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium. This means the object wasn't registered. It's likely just mod options.
|
| 1866 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_axe. This means the object wasn't registered. It's likely just mod options.
|
| 1867 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_boots. This means the object wasn't registered. It's likely just mod options.
|
| 1868 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_chestplate. This means the object wasn't registered. It's likely just mod options.
|
| 1869 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_crossbow. This means the object wasn't registered. It's likely just mod options.
|
| 1870 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_door_item. This means the object wasn't registered. It's likely just mod options.
|
| 1871 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_gloves. This means the object wasn't registered. It's likely just mod options.
|
| 1872 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_helmet. This means the object wasn't registered. It's likely just mod options.
|
| 1873 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_leggings. This means the object wasn't registered. It's likely just mod options.
|
| 1874 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
| 1875 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shears for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shears. This means the object wasn't registered. It's likely just mod options.
|
| 1876 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shield. This means the object wasn't registered. It's likely just mod options.
|
| 1877 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shovel. This means the object wasn't registered. It's likely just mod options.
|
| 1878 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_strip for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_strip. This means the object wasn't registered. It's likely just mod options.
|
| 1879 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_sword. This means the object wasn't registered. It's likely just mod options.
|
| 1880 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:bandage for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.bandage. This means the object wasn't registered. It's likely just mod options.
|
| 1881 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.blueberries. This means the object wasn't registered. It's likely just mod options.
|
| 1882 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberry_lollipop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.blueberry_lollipop. This means the object wasn't registered. It's likely just mod options.
|
| 1883 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:bolt for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.bolt. This means the object wasn't registered. It's likely just mod options.
|
| 1884 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_cane for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_cane. This means the object wasn't registered. It's likely just mod options.
|
| 1885 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_grass for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_grass. This means the object wasn't registered. It's likely just mod options.
|
| 1886 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_rope for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_rope. This means the object wasn't registered. It's likely just mod options.
|
| 1887 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt. This means the object wasn't registered. It's likely just mod options.
|
| 1888 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_boots. This means the object wasn't registered. It's likely just mod options.
|
| 1889 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_chestplate. This means the object wasn't registered. It's likely just mod options.
|
| 1890 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_gloves. This means the object wasn't registered. It's likely just mod options.
|
| 1891 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_helmet. This means the object wasn't registered. It's likely just mod options.
|
| 1892 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_leggings. This means the object wasn't registered. It's likely just mod options.
|
| 1893 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_rib_cut for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_rib_cut. This means the object wasn't registered. It's likely just mod options.
|
| 1894 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_ribs for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_ribs. This means the object wasn't registered. It's likely just mod options.
|
| 1895 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.candy_cane. This means the object wasn't registered. It's likely just mod options.
|
| 1896 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_corn for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.candy_corn. This means the object wasn't registered. It's likely just mod options.
|
| 1897 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloud_parachute for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cloud_parachute. This means the object wasn't registered. It's likely just mod options.
|
| 1898 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudtwine for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cloudtwine. This means the object wasn't registered. It's likely just mod options.
|
| 1899 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:cockatrice_feather for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cockatrice_feather. This means the object wasn't registered. It's likely just mod options.
|
| 1900 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:cocoatrice for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cocoatrice. This means the object wasn't registered. It's likely just mod options.
|
| 1901 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_shard for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.crude_scatterglass_shard. This means the object wasn't registered. It's likely just mod options.
|
| 1902 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:dart for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.dart. This means the object wasn't registered. It's likely just mod options.
|
| 1903 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:dart_shooter for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.dart_shooter. This means the object wasn't registered. It's likely just mod options.
|
| 1904 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:eggnog for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.eggnog. This means the object wasn't registered. It's likely just mod options.
|
| 1905 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:enchanted_blueberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.enchanted_blueberry. This means the object wasn't registered. It's likely just mod options.
|
| 1906 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:enchanted_wyndberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.enchanted_wyndberry. This means the object wasn't registered. It's likely just mod options.
|
| 1907 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:fried_moa_egg for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.fried_moa_egg. This means the object wasn't registered. It's likely just mod options.
|
| 1908 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:ginger_bread_man for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ginger_bread_man. This means the object wasn't registered. It's likely just mod options.
|
| 1909 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:golden_amber for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.golden_amber. This means the object wasn't registered. It's likely just mod options.
|
| 1910 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_axe. This means the object wasn't registered. It's likely just mod options.
|
| 1911 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_boots. This means the object wasn't registered. It's likely just mod options.
|
| 1912 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_chestplate. This means the object wasn't registered. It's likely just mod options.
|
| 1913 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_crossbow. This means the object wasn't registered. It's likely just mod options.
|
| 1914 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_gloves. This means the object wasn't registered. It's likely just mod options.
|
| 1915 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_helmet. This means the object wasn't registered. It's likely just mod options.
|
| 1916 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_leggings. This means the object wasn't registered. It's likely just mod options.
|
| 1917 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
| 1918 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_plate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_plate. This means the object wasn't registered. It's likely just mod options.
|
| 1919 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_shield. This means the object wasn't registered. It's likely just mod options.
|
| 1920 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_shovel. This means the object wasn't registered. It's likely just mod options.
|
| 1921 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_sword. This means the object wasn't registered. It's likely just mod options.
|
| 1922 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:healing_stone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.healing_stone. This means the object wasn't registered. It's likely just mod options.
|
| 1923 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:healing_stone_depleted for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.healing_stone_depleted. This means the object wasn't registered. It's likely just mod options.
|
| 1924 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_axe. This means the object wasn't registered. It's likely just mod options.
|
| 1925 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_crossbow. This means the object wasn't registered. It's likely just mod options.
|
| 1926 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
| 1927 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_shield. This means the object wasn't registered. It's likely just mod options.
|
| 1928 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_shovel. This means the object wasn't registered. It's likely just mod options.
|
| 1929 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_sword. This means the object wasn't registered. It's likely just mod options.
|
| 1930 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.icestone. This means the object wasn't registered. It's likely just mod options.
|
| 1931 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_poprocks for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.icestone_poprocks. This means the object wasn't registered. It's likely just mod options.
|
| 1932 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_armor for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_armor. This means the object wasn't registered. It's likely just mod options.
|
| 1933 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_charm for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_charm. This means the object wasn't registered. It's likely just mod options.
|
| 1934 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_chunk for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_chunk. This means the object wasn't registered. It's likely just mod options.
|
| 1935 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_dust for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_dust. This means the object wasn't registered. It's likely just mod options.
|
| 1936 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_neckwear for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_neckwear. This means the object wasn't registered. It's likely just mod options.
|
| 1937 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_ring for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_ring. This means the object wasn't registered. It's likely just mod options.
|
| 1938 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_sword. This means the object wasn't registered. It's likely just mod options.
|
| 1939 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_tool for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_tool. This means the object wasn't registered. It's likely just mod options.
|
| 1940 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:jelly_plumproot for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.jelly_plumproot. This means the object wasn't registered. It's likely just mod options.
|
| 1941 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:kirrid_cutlet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.kirrid_cutlet. This means the object wasn't registered. It's likely just mod options.
|
| 1942 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:kirrid_loin for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.kirrid_loin. This means the object wasn't registered. It's likely just mod options.
|
| 1943 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:labyrinth_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.labyrinth_music_disc. This means the object wasn't registered. It's likely just mod options.
|
| 1944 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_egg_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_egg_item. This means the object wasn't registered. It's likely just mod options.
|
| 1945 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feather for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feather. This means the object wasn't registered. It's likely just mod options.
|
| 1946 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed. This means the object wasn't registered. It's likely just mod options.
|
| 1947 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed_blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed_blueberries. This means the object wasn't registered. It's likely just mod options.
|
| 1948 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed_enchanted_blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed_enchanted_blueberries. This means the object wasn't registered. It's likely just mod options.
|
| 1949 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_music_disc. This means the object wasn't registered. It's likely just mod options.
|
| 1950 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.orange. This means the object wasn't registered. It's likely just mod options.
|
| 1951 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange_lollipop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.orange_lollipop. This means the object wasn't registered. It's likely just mod options.
|
| 1952 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot_mash for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.plumproot_mash. This means the object wasn't registered. It's likely just mod options.
|
| 1953 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot_pie for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.plumproot_pie. This means the object wasn't registered. It's likely just mod options.
|
| 1954 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:rainbow_moa_egg for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.rainbow_moa_egg. This means the object wasn't registered. It's likely just mod options.
|
| 1955 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:raw_taegore_meat for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.raw_taegore_meat. This means the object wasn't registered. It's likely just mod options.
|
| 1956 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:recording_892 for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.recording_892. This means the object wasn't registered. It's likely just mod options.
|
| 1957 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.scatterglass_vial. This means the object wasn't registered. It's likely just mod options.
|
| 1958 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.secret_skyroot_door_item. This means the object wasn't registered. It's likely just mod options.
|
| 1959 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:shard_of_life for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.shard_of_life. This means the object wasn't registered. It's likely just mod options.
|
| 1960 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_axe. This means the object wasn't registered. It's likely just mod options.
|
| 1961 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bed_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_bed_item. This means the object wasn't registered. It's likely just mod options.
|
| 1962 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_bucket. This means the object wasn't registered. It's likely just mod options.
|
| 1963 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_crossbow. This means the object wasn't registered. It's likely just mod options.
|
| 1964 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_door_item. This means the object wasn't registered. It's likely just mod options.
|
| 1965 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_lizard_stick for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_lizard_stick. This means the object wasn't registered. It's likely just mod options.
|
| 1966 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_lizard_stick_roasted for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_lizard_stick_roasted. This means the object wasn't registered. It's likely just mod options.
|
| 1967 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_milk_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_milk_bucket. This means the object wasn't registered. It's likely just mod options.
|
| 1968 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
| 1969 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pinecone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_pinecone. This means the object wasn't registered. It's likely just mod options.
|
| 1970 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_poison_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_poison_bucket. This means the object wasn't registered. It's likely just mod options.
|
| 1971 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_shield. This means the object wasn't registered. It's likely just mod options.
|
| 1972 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_shovel. This means the object wasn't registered. It's likely just mod options.
|
| 1973 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sign for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_sign. This means the object wasn't registered. It's likely just mod options.
|
| 1974 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_stick for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_stick. This means the object wasn't registered. It's likely just mod options.
|
| 1975 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_sword. This means the object wasn't registered. It's likely just mod options.
|
| 1976 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_water_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_water_bucket. This means the object wasn't registered. It's likely just mod options.
|
| 1977 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:splint for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.splint. This means the object wasn't registered. It's likely just mod options.
|
| 1978 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:stomper_pop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.stomper_pop. This means the object wasn't registered. It's likely just mod options.
|
| 1979 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_gel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_gel. This means the object wasn't registered. It's likely just mod options.
|
| 1980 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_jelly for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_jelly. This means the object wasn't registered. It's likely just mod options.
|
| 1981 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_sugar for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_sugar. This means the object wasn't registered. It's likely just mod options.
|
| 1982 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide. This means the object wasn't registered. It's likely just mod options.
|
| 1983 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_boots. This means the object wasn't registered. It's likely just mod options.
|
| 1984 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_chestplate. This means the object wasn't registered. It's likely just mod options.
|
| 1985 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_gloves. This means the object wasn't registered. It's likely just mod options.
|
| 1986 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_helmet. This means the object wasn't registered. It's likely just mod options.
|
| 1987 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_leggings. This means the object wasn't registered. It's likely just mod options.
|
| 1988 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_steak for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_steak. This means the object wasn't registered. It's likely just mod options.
|
| 1989 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_music_disc. This means the object wasn't registered. It's likely just mod options.
|
| 1990 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_tea for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_tea. This means the object wasn't registered. It's likely just mod options.
|
| 1991 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_wings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_wings. This means the object wasn't registered. It's likely just mod options.
|
| 1992 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:water_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.water_vial. This means the object wasn't registered. It's likely just mod options.
|
| 1993 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:winter_hat for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.winter_hat. This means the object wasn't registered. It's likely just mod options.
|
| 1994 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wrapped_chocolates for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wrapped_chocolates. This means the object wasn't registered. It's likely just mod options.
|
| 1995 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wrapping_paper for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wrapping_paper. This means the object wasn't registered. It's likely just mod options.
|
| 1996 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:wyndberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wyndberry. This means the object wasn't registered. It's likely just mod options.
|
| 1997 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:yule_log for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.yule_log. This means the object wasn't registered. It's likely just mod options.
|
| 1998 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_axe. This means the object wasn't registered. It's likely just mod options.
|
| 1999 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_boots. This means the object wasn't registered. It's likely just mod options.
|
| 2000 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_chestplate. This means the object wasn't registered. It's likely just mod options.
|
| 2001 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_crossbow. This means the object wasn't registered. It's likely just mod options.
|
| 2002 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_gemstone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_gemstone. This means the object wasn't registered. It's likely just mod options.
|
| 2003 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_gloves. This means the object wasn't registered. It's likely just mod options.
|
| 2004 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_helmet. This means the object wasn't registered. It's likely just mod options.
|
| 2005 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_leggings. This means the object wasn't registered. It's likely just mod options.
|
| 2006 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
| 2007 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_shield. This means the object wasn't registered. It's likely just mod options.
|
| 2008 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_shovel. This means the object wasn't registered. It's likely just mod options.
|
| 2009 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_sword. This means the object wasn't registered. It's likely just mod options.
|
| 2010 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2011 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2012 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2013 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2014 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
|
| 2015 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
|
| 2016 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
|
| 2017 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
|
| 2018 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
|
| 2019 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
|
| 2020 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
|
| 2021 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2022 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2023 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2024 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
|
| 2025 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2026 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2027 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2028 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
|
| 2029 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
|
| 2030 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
|
| 2031 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
| 2032 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2033 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2034 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2035 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2036 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2037 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2038 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
|
| 2039 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2040 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2041 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2042 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2043 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
| 2044 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2045 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2046 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2047 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2048 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2049 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2050 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2051 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2052 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2053 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2054 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
|
| 2055 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
|
| 2056 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
|
| 2057 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
| 2058 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
|
| 2059 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
|
| 2060 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
|
| 2061 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
| 2062 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
|
| 2063 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
|
| 2064 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
|
| 2065 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
| 2066 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2067 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
| 2068 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
|
| 2069 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2070 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
|
| 2071 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
|
| 2072 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2073 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
|
| 2074 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2075 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
|
| 2076 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
|
| 2077 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
|
| 2078 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2079 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
|
| 2080 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
|
| 2081 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
|
| 2082 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2083 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
| 2084 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
| 2085 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
| 2086 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
|
| 2087 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
| 2088 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2089 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
| 2090 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
|
| 2091 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
| 2092 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2093 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
| 2094 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
| 2095 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
| 2096 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
| 2097 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2098 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
| 2099 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
| 2100 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2101 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
| 2102 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
| 2103 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
|
| 2104 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
|
| 2105 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2106 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
| 2107 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
|
| 2108 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
|
| 2109 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
|
| 2110 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
|
| 2111 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
|
| 2112 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2113 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
| 2114 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2115 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
| 2116 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2117 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
| 2118 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2119 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2120 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2121 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2122 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2123 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2124 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2125 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
| 2126 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2127 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2128 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2129 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2130 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
|
| 2131 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2132 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2133 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2134 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2135 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2136 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2137 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2138 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
|
| 2139 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2140 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2141 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
|
| 2142 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2143 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
| 2144 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2145 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2146 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
|
| 2147 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
|
| 2148 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
|
| 2149 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2150 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2151 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2152 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
| 2153 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2154 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
|
| 2155 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2156 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2157 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
| 2158 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2159 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
| 2160 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
| 2161 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2162 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
| 2163 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2164 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2165 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2166 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2167 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2168 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2169 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2170 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2171 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2172 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
| 2173 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
|
| 2174 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:antiblock for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.antiblock. This means the object wasn't registered. It's likely just mod options.
|
| 2175 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:auto_chisel for public static team.chisel.common.block.BlockAutoChisel team.chisel.common.init.ChiselBlocks.auto_chisel. This means the object wasn't registered. It's likely just mod options.
|
| 2176 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:basalt for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.basalt. This means the object wasn't registered. It's likely just mod options.
|
| 2177 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:basalt1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.basalt1. This means the object wasn't registered. It's likely just mod options.
|
| 2178 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:basalt2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.basalt2. This means the object wasn't registered. It's likely just mod options.
|
| 2179 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:block_charcoal2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.block_charcoal2. This means the object wasn't registered. It's likely just mod options.
|
| 2180 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bloodmagic for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bloodmagic. This means the object wasn't registered. It's likely just mod options.
|
| 2181 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_spruce for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_spruce. This means the object wasn't registered. It's likely just mod options.
|
| 2182 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_birch for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_birch. This means the object wasn't registered. It's likely just mod options.
|
| 2183 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_jungle for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_jungle. This means the object wasn't registered. It's likely just mod options.
|
| 2184 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_acacia for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_acacia. This means the object wasn't registered. It's likely just mod options.
|
| 2185 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_darkoak for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_darkoak. This means the object wasn't registered. It's likely just mod options.
|
| 2186 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:brownstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.brownstone. This means the object wasn't registered. It's likely just mod options.
|
| 2187 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
|
| 2188 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:cloud for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.cloud. This means the object wasn't registered. It's likely just mod options.
|
| 2189 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
|
| 2190 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_white for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_white. This means the object wasn't registered. It's likely just mod options.
|
| 2191 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_orange for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_orange. This means the object wasn't registered. It's likely just mod options.
|
| 2192 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_lightblue for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_lightblue. This means the object wasn't registered. It's likely just mod options.
|
| 2193 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_magenta for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_magenta. This means the object wasn't registered. It's likely just mod options.
|
| 2194 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_lime for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_lime. This means the object wasn't registered. It's likely just mod options.
|
| 2195 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_yellow for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_yellow. This means the object wasn't registered. It's likely just mod options.
|
| 2196 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_pink for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_pink. This means the object wasn't registered. It's likely just mod options.
|
| 2197 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_gray for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_gray. This means the object wasn't registered. It's likely just mod options.
|
| 2198 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_lightgray for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_lightgray. This means the object wasn't registered. It's likely just mod options.
|
| 2199 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_blue for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_blue. This means the object wasn't registered. It's likely just mod options.
|
| 2200 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_cyan for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_cyan. This means the object wasn't registered. It's likely just mod options.
|
| 2201 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_purple for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_purple. This means the object wasn't registered. It's likely just mod options.
|
| 2202 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_green for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_green. This means the object wasn't registered. It's likely just mod options.
|
| 2203 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_brown for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_brown. This means the object wasn't registered. It's likely just mod options.
|
| 2204 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_red for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_red. This means the object wasn't registered. It's likely just mod options.
|
| 2205 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_black for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_black. This means the object wasn't registered. It's likely just mod options.
|
| 2206 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
|
| 2207 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:dirt for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.dirt. This means the object wasn't registered. It's likely just mod options.
|
| 2208 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:factory for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.factory. This means the object wasn't registered. It's likely just mod options.
|
| 2209 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:futura for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.futura. This means the object wasn't registered. It's likely just mod options.
|
| 2210 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:glowstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.glowstone. This means the object wasn't registered. It's likely just mod options.
|
| 2211 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:glowstone1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.glowstone1. This means the object wasn't registered. It's likely just mod options.
|
| 2212 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:glowstone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.glowstone2. This means the object wasn't registered. It's likely just mod options.
|
| 2213 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:laboratory for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.laboratory. This means the object wasn't registered. It's likely just mod options.
|
| 2214 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:lavastone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.lavastone. This means the object wasn't registered. It's likely just mod options.
|
| 2215 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:lavastone1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.lavastone1. This means the object wasn't registered. It's likely just mod options.
|
| 2216 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:lavastone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.lavastone2. This means the object wasn't registered. It's likely just mod options.
|
| 2217 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:limestone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.limestone. This means the object wasn't registered. It's likely just mod options.
|
| 2218 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:limestone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.limestone2. This means the object wasn't registered. It's likely just mod options.
|
| 2219 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:marble for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.marble. This means the object wasn't registered. It's likely just mod options.
|
| 2220 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:marble2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.marble2. This means the object wasn't registered. It's likely just mod options.
|
| 2221 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:netherrack for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.netherrack. This means the object wasn't registered. It's likely just mod options.
|
| 2222 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:paper for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.paper. This means the object wasn't registered. It's likely just mod options.
|
| 2223 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:temple for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.temple. This means the object wasn't registered. It's likely just mod options.
|
| 2224 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:tyrian for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.tyrian. This means the object wasn't registered. It's likely just mod options.
|
| 2225 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:valentines for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.valentines. This means the object wasn't registered. It's likely just mod options.
|
| 2226 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:voidstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.voidstone. This means the object wasn't registered. It's likely just mod options.
|
| 2227 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstone. This means the object wasn't registered. It's likely just mod options.
|
| 2228 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstone1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstone1. This means the object wasn't registered. It's likely just mod options.
|
| 2229 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstone2. This means the object wasn't registered. It's likely just mod options.
|
| 2230 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
|
| 2231 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_black for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlackBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2232 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_brown for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBrownItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2233 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:block_end_endermite for public static org.icannt.netherendingores.common.block.blocks.BlockMonsterEndEndermite org.icannt.netherendingores.common.registry.BlockRegistry.BLOCK_END_ENDERMITE. This means the object wasn't registered. It's likely just mod options.
|
| 2234 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_death. This means the object wasn't registered. It's likely just mod options.
|
| 2235 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_ambient. This means the object wasn't registered. It's likely just mod options.
|
| 2236 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.lift for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_lift. This means the object wasn't registered. It's likely just mod options.
|
| 2237 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_irradiated_forests for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.IRRADIATED_FORESTS. This means the object wasn't registered. It's likely just mod options.
|
| 2238 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_end_vanilla for public static org.icannt.netherendingores.common.block.blocks.BlockOreEndVanilla org.icannt.netherendingores.common.registry.BlockRegistry.ORE_END_VANILLA. This means the object wasn't registered. It's likely just mod options.
|
| 2239 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_death. This means the object wasn't registered. It's likely just mod options.
|
| 2240 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_ambient. This means the object wasn't registered. It's likely just mod options.
|
| 2241 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.moa for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_moa. This means the object wasn't registered. It's likely just mod options.
|
| 2242 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dungeon.container.smash for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.break_labyrinth_container. This means the object wasn't registered. It's likely just mod options.
|
| 2243 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_ambient. This means the object wasn't registered. It's likely just mod options.
|
| 2244 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_hurt. This means the object wasn't registered. It's likely just mod options.
|
| 2245 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.electric_shock for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_electric_shock. This means the object wasn't registered. It's likely just mod options.
|
| 2246 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_magenta for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxMagentaBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2247 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_attack. This means the object wasn't registered. It's likely just mod options.
|
| 2248 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_blue for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlueBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2249 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_hurt. This means the object wasn't registered. It's likely just mod options.
|
| 2250 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_hurt. This means the object wasn't registered. It's likely just mod options.
|
| 2251 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_yellow for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxYellowBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2252 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_orange for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxOrangeBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2253 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.travel for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_travel. This means the object wasn't registered. It's likely just mod options.
|
| 2254 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_attack. This means the object wasn't registered. It's likely just mod options.
|
| 2255 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_yellow for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxYellowItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2256 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_lime for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLimeItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2257 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_ambient. This means the object wasn't registered. It's likely just mod options.
|
| 2258 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_nether_modded_2 for public static org.icannt.netherendingores.common.block.blocks.BlockOreNetherModded2 org.icannt.netherendingores.common.registry.BlockRegistry.ORE_NETHER_MODDED_2. This means the object wasn't registered. It's likely just mod options.
|
| 2259 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_light_blue for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLightBlueBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2260 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:entity.netherfish.death for public static net.minecraft.util.SoundEvent org.icannt.netherendingores.common.registry.RegistryEvents.ENTITY_NETHERFISH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
| 2261 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_magnetic_hills for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.MAGNETIC_HILLS. This means the object wasn't registered. It's likely just mod options.
|
| 2262 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_pink for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPinkBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2263 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_black for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlackItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2264 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_other_1 for public static org.icannt.netherendingores.common.block.blocks.BlockOreOther1 org.icannt.netherendingores.common.registry.BlockRegistry.ORE_OTHER_1. This means the object wasn't registered. It's likely just mod options.
|
| 2265 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_ambient. This means the object wasn't registered. It's likely just mod options.
|
| 2266 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_ambient. This means the object wasn't registered. It's likely just mod options.
|
| 2267 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_death. This means the object wasn't registered. It's likely just mod options.
|
| 2268 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.light for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_light. This means the object wasn't registered. It's likely just mod options.
|
| 2269 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_hurt. This means the object wasn't registered. It's likely just mod options.
|
| 2270 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:creative_tab for public static org.icannt.netherendingores.common.block.blocks.BlockCreativeTab org.icannt.netherendingores.common.registry.BlockRegistry.CREATIVE_TAB. This means the object wasn't registered. It's likely just mod options.
|
| 2271 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.labyrinth_totem.drone for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.labyrinth_totem_drone. This means the object wasn't registered. It's likely just mod options.
|
| 2272 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dart_shooter.fire for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.dart_shooter_fire. This means the object wasn't registered. It's likely just mod options.
|
| 2273 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_ambient. This means the object wasn't registered. It's likely just mod options.
|
| 2274 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:block_nether_netherfish for public static org.icannt.netherendingores.common.block.blocks.BlockMonsterNetherNetherfish org.icannt.netherendingores.common.registry.BlockRegistry.BLOCK_NETHER_NETHERFISH. This means the object wasn't registered. It's likely just mod options.
|
| 2275 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_forgotten_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.FORGOTTEN_HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
|
| 2276 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_end_modded_1 for public static org.icannt.netherendingores.common.block.blocks.BlockOreEndModded1 org.icannt.netherendingores.common.registry.BlockRegistry.ORE_END_MODDED_1. This means the object wasn't registered. It's likely just mod options.
|
| 2277 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_end_modded_2 for public static org.icannt.netherendingores.common.block.blocks.BlockOreEndModded2 org.icannt.netherendingores.common.registry.BlockRegistry.ORE_END_MODDED_2. This means the object wasn't registered. It's likely just mod options.
|
| 2278 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_white for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxWhiteBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2279 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_death. This means the object wasn't registered. It's likely just mod options.
|
| 2280 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.generic.wings.flap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.generic_wing_flap. This means the object wasn't registered. It's likely just mod options.
|
| 2281 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_void for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.VOID. This means the object wasn't registered. It's likely just mod options.
|
| 2282 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_chest for public static net.minecraft.item.Item cpw.mods.ironchest.common.core.IronChestBlocks.ironChestItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2283 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_gray for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGrayItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2284 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.labyrinth for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_labyrinth. This means the object wasn't registered. It's likely just mod options.
|
| 2285 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
|
| 2286 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.trigger for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_trigger. This means the object wasn't registered. It's likely just mod options.
|
| 2287 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_hurt. This means the object wasn't registered. It's likely just mod options.
|
| 2288 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.hum for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_hum. This means the object wasn't registered. It's likely just mod options.
|
| 2289 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.heavy for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_heavy. This means the object wasn't registered. It's likely just mod options.
|
| 2290 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_pink for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPinkItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2291 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_ambient. This means the object wasn't registered. It's likely just mod options.
|
| 2292 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_red for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxRedItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2293 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_silver for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxSilverItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2294 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_death. This means the object wasn't registered. It's likely just mod options.
|
| 2295 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_blue for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlueItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2296 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_cyan for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxCyanItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2297 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_silver for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxSilverBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2298 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:block.aercloud.bounce for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aercloud_bounce. This means the object wasn't registered. It's likely just mod options.
|
| 2299 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_orange for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxOrangeItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2300 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_red for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxRedBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2301 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_brown for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBrownBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2302 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_white for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxWhiteItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2303 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:entity.netherfish.ambient for public static net.minecraft.util.SoundEvent org.icannt.netherendingores.common.registry.RegistryEvents.ENTITY_NETHERFISH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
| 2304 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.angry for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_angry. This means the object wasn't registered. It's likely just mod options.
|
| 2305 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.puff for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_puff. This means the object wasn't registered. It's likely just mod options.
|
| 2306 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_green for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGreenBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2307 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.snow.wind for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_snow_wind. This means the object wasn't registered. It's likely just mod options.
|
| 2308 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_death. This means the object wasn't registered. It's likely just mod options.
|
| 2309 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_green for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGreenItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2310 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_magenta for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxMagentaItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2311 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.valkyrie for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_valkyrie. This means the object wasn't registered. It's likely just mod options.
|
| 2312 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_chest for public static cpw.mods.ironchest.common.blocks.chest.BlockIronChest cpw.mods.ironchest.common.core.IronChestBlocks.ironChestBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2313 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_death. This means the object wasn't registered. It's likely just mod options.
|
| 2314 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_hurt. This means the object wasn't registered. It's likely just mod options.
|
| 2315 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:instanced_zone for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.INSTANCED_ZONE. This means the object wasn't registered. It's likely just mod options.
|
| 2316 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_purple for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPurpleBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2317 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_purple for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPurpleItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2318 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_gray for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGrayBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2319 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.aerwhale for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_aerwhale. This means the object wasn't registered. It's likely just mod options.
|
| 2320 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_arctic_peaks for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.ARCTIC_PEAKS. This means the object wasn't registered. It's likely just mod options.
|
| 2321 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_ambient. This means the object wasn't registered. It's likely just mod options.
|
| 2322 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_nether_vanilla for public static org.icannt.netherendingores.common.block.blocks.BlockOreNetherVanilla org.icannt.netherendingores.common.registry.BlockRegistry.ORE_NETHER_VANILLA. This means the object wasn't registered. It's likely just mod options.
|
| 2323 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_cyan for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxCyanBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2324 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_light_blue for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLightBlueItemBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2325 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_hurt. This means the object wasn't registered. It's likely just mod options.
|
| 2326 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_lime for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLimeBlock. This means the object wasn't registered. It's likely just mod options.
|
| 2327 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:entity.netherfish.hurt for public static net.minecraft.util.SoundEvent org.icannt.netherendingores.common.registry.RegistryEvents.ENTITY_NETHERFISH_HURT. This means the object wasn't registered. It's likely just mod options.
|
| 2328 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.present_unwrap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.present_unwrap. This means the object wasn't registered. It's likely just mod options.
|
| 2329 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_nether_modded_1 for public static org.icannt.netherendingores.common.block.blocks.BlockOreNetherModded1 org.icannt.netherendingores.common.registry.BlockRegistry.ORE_NETHER_MODDED_1. This means the object wasn't registered. It's likely just mod options.
|
| 2330 | [13:16:08] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.recording_892 for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_recording_892. This means the object wasn't registered. It's likely just mod options.
|
| 2331 | [13:16:09] [Server thread/INFO] [FML]: Holder lookups applied
|
| 2332 | [13:16:09] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod chisel
|
| 2333 | [13:16:09] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Chisel took 0.461s
|
| 2334 | [13:16:09] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod codechickenlib
|
| 2335 | [13:16:09] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod codechickenlib
|
| 2336 | [13:16:09] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - CodeChicken Lib took 0.119s
|
| 2337 | [13:16:09] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod miccw
|
| 2338 | [13:16:09] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod miccw
|
| 2339 | [13:16:09] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Cosmic Weaponry took 0.006s
|
| 2340 | [13:16:09] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod customspawner
|
| 2341 | [13:16:09] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod customspawner
|
| 2342 | [13:16:09] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - DrZhark's CustomSpawner took 0.367s
|
| 2343 | [13:16:09] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod props
|
| 2344 | [13:16:10] [Server thread/TRACE] [FML]: Automatically registered mod props entity FakeChairEntity as props:chair
|
| 2345 | [13:16:10] [Server thread/INFO] [com.mia.craftstudio.CSPack]: Original locale was en, switching to Locale.US
|
| 2346 | [13:16:10] [Server thread/INFO] [com.mia.craftstudio.CSPack]: Locale is now en_US
|
| 2347 | [13:16:10] [Server thread/INFO] [com.mia.craftstudio.CSPack]: Locale was restored to en
|
| 2348 | [13:16:25] [Server thread/DEBUG] [FML]: Bar Finished: Loading models took 14.415s
|
| 2349 | [13:16:25] [Server thread/DEBUG] [FML]: Bar Finished: Loading models took 14.416s
|
| 2350 | [13:17:20] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod props
|
| 2351 | [13:17:20] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Decocraft took 71.151s
|
| 2352 | [13:17:20] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod dldungeonsjbg
|
| 2353 | [13:17:20] [Server thread/INFO] [DLDUNGEONS]: Doomlike Dungeons is in preInit, should now load config.
|
| 2354 | [13:17:20] [Server thread/INFO] [DLDUNGEONS]: themesdir is /server/config/DLDungeonsJBG
|
| 2355 | [13:17:20] [Server thread/INFO] [DLDUNGEONS]: Frequency Scaling Factor Set To: 8
|
| 2356 | [13:17:20] [Server thread/INFO] [DLDUNGEONS]: Minimum X Factor Set To: 16
|
| 2357 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: Difficulty set to: Normal difficulty.
|
| 2358 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: Will spawn dungeons in with world generation? true
|
| 2359 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: Will spawn dungeons even with structures disabled? false
|
| 2360 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: Will export item, block, and mob lists? false
|
| 2361 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: Will announce use of OP/cheat commands? true
|
| 2362 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: Will dungeons be easy to find? true
|
| 2363 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: Will dungeon all have single entrances? true
|
| 2364 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: Will themes be automatically install if themes folder is empty? true
|
| 2365 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: Can themes be (re)installed by command? true
|
| 2366 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: adding END to excusion list
|
| 2367 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: Will use API? true
|
| 2368 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: Will allow API base mob change? true
|
| 2369 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: Will self-profile? false
|
| 2370 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: themesdir will be set to /server/config/DLDungeonsJBG/themes/
|
| 2371 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: themesdir File is be set to /server/config/DLDungeonsJBG/themes
|
| 2372 | [13:17:21] [Server thread/INFO] [DLDUNGEONS]: themesdir is /server/config/DLDungeonsJBG/themes
|
| 2373 | [13:17:22] [Server thread/INFO] [STDOUT]: [jaredbgreat.dldungeons.setup.Externalizer:makeChestCfg:206]: [DLDUNGEONS] Installing files /server/config/DLDungeonsJBG/chests.cfg
|
| 2374 | [13:17:22] [Server thread/INFO] [DLDUNGEONS]: Config should now be loaded.
|
| 2375 | [13:17:22] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod dldungeonsjbg
|
| 2376 | [13:17:22] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Doomlike Dungeons took 1.870s
|
| 2377 | [13:17:22] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mocreatures
|
| 2378 | [13:17:22] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mocreatures
|
| 2379 | [13:17:22] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - DrZhark's Mo'Creatures Mod took 0.181s
|
| 2380 | [13:17:22] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod enderstorage
|
| 2381 | [13:17:23] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ender chest`, expected `enderstorage`. This could be a intended override, but in most cases indicates a broken mod.
|
| 2382 | [13:17:23] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ender tank`, expected `enderstorage`. This could be a intended override, but in most cases indicates a broken mod.
|
| 2383 | [13:17:23] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod enderstorage
|
| 2384 | [13:17:23] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - EnderStorage took 0.429s
|
| 2385 | [13:17:23] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod fastfurnace
|
| 2386 | [13:17:23] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `furnace`, expected `fastfurnace`. This could be a intended override, but in most cases indicates a broken mod.
|
| 2387 | [13:17:23] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod fastfurnace
|
| 2388 | [13:17:23] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - FastFurnace took 0.027s
|
| 2389 | [13:17:23] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod ironchest
|
| 2390 | [13:17:23] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from ironchest-1.12.2-7.0.72.847.jar to locate a version number for mod ironchest
|
| 2391 | [13:17:23] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod ironchest
|
| 2392 | [13:17:23] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Iron Chest took 0.092s
|
| 2393 | [13:17:23] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod lunatriuscore
|
| 2394 | [13:17:23] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod lunatriuscore
|
| 2395 | [13:17:23] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - LunatriusCore took 0.007s
|
| 2396 | [13:17:23] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod netherendingores
|
| 2397 | [13:17:23] [Server thread/TRACE] [FML]: Automatically registered mod netherendingores entity netherfish as netherendingores:netherfish
|
| 2398 | [13:17:23] [Server thread/TRACE] [FML]: Automatically registered mod netherendingores entity primedOre as netherendingores:primedore
|
| 2399 | [13:17:23] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod netherendingores
|
| 2400 | [13:17:23] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Netherending Ores took 0.324s
|
| 2401 | [13:17:23] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod nei
|
| 2402 | [13:17:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod nei
|
| 2403 | [13:17:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Not Enough Items took 0.285s
|
| 2404 | [13:17:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod placebo
|
| 2405 | [13:17:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod placebo
|
| 2406 | [13:17:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Placebo took 0.006s
|
| 2407 | [13:17:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod schematica
|
| 2408 | [13:17:24] [Server thread/DEBUG] [schematica]: Schematic path: /server/schematics
|
| 2409 | [13:17:24] [Server thread/DEBUG] [schematica]: Data path: /server
|
| 2410 | [13:17:24] [Server thread/DEBUG] [schematica]: New schematic path: ./schematics
|
| 2411 | [13:17:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod schematica
|
| 2412 | [13:17:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Schematica took 0.094s
|
| 2413 | [13:17:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod schematics
|
| 2414 | [13:17:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod schematics
|
| 2415 | [13:17:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Schematics took 0.147s
|
| 2416 | [13:17:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod simplyjetpacks
|
| 2417 | [13:17:24] [Server thread/INFO] [simplyjetpacks]: Starting Simply Jetpacks 2...
|
| 2418 | [13:17:24] [Server thread/INFO] [simplyjetpacks]: Loading Configuration Files...
|
| 2419 | [13:17:24] [Server thread/INFO] [simplyjetpacks]: Registering Items...
|
| 2420 | [13:17:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod simplyjetpacks
|
| 2421 | [13:17:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Simply Jetpacks 2 took 0.605s
|
| 2422 | [13:17:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod undergroundbiomes
|
| 2423 | [13:17:24] [Server thread/INFO] [undergroundbiomes]: [UndergroundBiomes] Start Pre-init!
|
| 2424 | [13:17:24] [Server thread/DEBUG] [undergroundbiomes]: [CommonProxy] Start preInit
|
| 2425 | [13:17:25] [Server thread/INFO] [undergroundbiomes]: [UBConfig] Loading configuration
|
| 2426 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property CrashOnProblems initialized with value false
|
| 2427 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Realistic initialized with value false
|
| 2428 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyRecipes initialized with value true
|
| 2429 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyOres initialized with value true
|
| 2430 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property RegularStoneCrafting initialized with value 4
|
| 2431 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property HarnessModifier initialized with value 1.0
|
| 2432 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ResistanceModifier initialized with value 1.0
|
| 2433 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property BiomeSize initialized with value 4
|
| 2434 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property GenerationHeight initialized with value 256
|
| 2435 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property RegularStoneBiomes initialized with value false
|
| 2436 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property HarmoniousStrata initialized with value false
|
| 2437 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property IncludedDimensions initialized with value *
|
| 2438 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ExcludedDimensions initialized with value -1,1
|
| 2439 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DimensionSpecificSeeds initialized with value false
|
| 2440 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyVillages initialized with value true
|
| 2441 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceCobblestone initialized with value true
|
| 2442 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceMonsterStone initialized with value true
|
| 2443 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceOvergrown initialized with value true
|
| 2444 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceMossyCobble initialized with value true
|
| 2445 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceQuarkSpeleothems initialized with value true
|
| 2446 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceGravel initialized with value true
|
| 2447 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSand initialized with value true
|
| 2448 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSandstone initialized with value true
|
| 2449 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceClay initialized with value true
|
| 2450 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSandExcludedBiomes initialized with value minecraft:beaches,minecraft:desert,minecraft:cold_beach,minecraft:desert_hills,biomesoplenty:oasis
|
| 2451 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceGravelExcludedBiomes initialized with value biomesoplenty:cold_desert
|
| 2452 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceClayExcludedBiomes initialized with value
|
| 2453 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property PlainSlabTextures initialized with value false
|
| 2454 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtons initialized with value true
|
| 2455 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtonsTypes initialized with value 7
|
| 2456 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtonsStyles initialized with value 3
|
| 2457 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairs initialized with value true
|
| 2458 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairsTypes initialized with value 7
|
| 2459 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairsStyles initialized with value 7
|
| 2460 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWalls initialized with value true
|
| 2461 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWallsTypes initialized with value 7
|
| 2462 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWallsStyles initialized with value 7
|
| 2463 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ChangeButtonRecipe initialized with value 8
|
| 2464 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DisableVanillaStoneVariants initialized with value false
|
| 2465 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DisplayOriginalModInOreTooltip initialized with value true
|
| 2466 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextBefore initialized with value Ore from
|
| 2467 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextBeforeFormatting initialized with value gray
|
| 2468 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipOreModNameFormatting initialized with value gold italic
|
| 2469 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextAfter initialized with value
|
| 2470 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextAfterFormatting initialized with value gray
|
| 2471 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property CustomOreHardness initialized with value null
|
| 2472 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.sandStone, metadata 0 initialized with value true
|
| 2473 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 0, limestone initialized with value true
|
| 2474 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 1, chalk initialized with value true
|
| 2475 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 2, shale initialized with value true
|
| 2476 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 3, siltstone initialized with value true
|
| 2477 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 4, lignite initialized with value true
|
| 2478 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 5, dolomite initialized with value true
|
| 2479 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 6, greywacke initialized with value true
|
| 2480 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 7, chert initialized with value true
|
| 2481 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 0, gneiss initialized with value true
|
| 2482 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 1, eclogite initialized with value true
|
| 2483 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 2, marble initialized with value true
|
| 2484 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 3, quartzite initialized with value true
|
| 2485 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 4, blueschist initialized with value true
|
| 2486 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 5, greenschist initialized with value true
|
| 2487 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 6, soapstone initialized with value true
|
| 2488 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 7, migmatite initialized with value true
|
| 2489 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 0, red_granite initialized with value true
|
| 2490 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 1, black_granite initialized with value true
|
| 2491 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 2, rhyolite initialized with value true
|
| 2492 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 3, andesite initialized with value true
|
| 2493 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 4, gabbro initialized with value true
|
| 2494 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 5, basalt initialized with value true
|
| 2495 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 6, komatiite initialized with value true
|
| 2496 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 7, dacite initialized with value true
|
| 2497 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.sand, metadata 0 initialized with value true
|
| 2498 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.stone, metadata 0 initialized with value true
|
| 2499 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
| 2500 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesWallsStyles = 2
|
| 2501 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
| 2502 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesButtonsStyles = 1
|
| 2503 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
| 2504 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesStairsStyles = 6
|
| 2505 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
| 2506 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> DisableVanillaStoneVariants = true
|
| 2507 | [13:17:25] [Server thread/INFO] [undergroundbiomes]: [UBConfig] Loading configuration
|
| 2508 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property CrashOnProblems initialized with value false
|
| 2509 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Realistic initialized with value false
|
| 2510 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyRecipes initialized with value true
|
| 2511 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyOres initialized with value true
|
| 2512 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property RegularStoneCrafting initialized with value 4
|
| 2513 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property HarnessModifier initialized with value 1.0
|
| 2514 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ResistanceModifier initialized with value 1.0
|
| 2515 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property BiomeSize initialized with value 4
|
| 2516 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property GenerationHeight initialized with value 256
|
| 2517 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property RegularStoneBiomes initialized with value false
|
| 2518 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property HarmoniousStrata initialized with value false
|
| 2519 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property IncludedDimensions initialized with value *
|
| 2520 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ExcludedDimensions initialized with value -1,1
|
| 2521 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DimensionSpecificSeeds initialized with value false
|
| 2522 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyVillages initialized with value true
|
| 2523 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceCobblestone initialized with value true
|
| 2524 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceMonsterStone initialized with value true
|
| 2525 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceOvergrown initialized with value true
|
| 2526 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceMossyCobble initialized with value true
|
| 2527 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceQuarkSpeleothems initialized with value true
|
| 2528 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceGravel initialized with value true
|
| 2529 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSand initialized with value true
|
| 2530 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSandstone initialized with value true
|
| 2531 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceClay initialized with value true
|
| 2532 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSandExcludedBiomes initialized with value minecraft:beaches,minecraft:desert,minecraft:cold_beach,minecraft:desert_hills,biomesoplenty:oasis
|
| 2533 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceGravelExcludedBiomes initialized with value biomesoplenty:cold_desert
|
| 2534 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceClayExcludedBiomes initialized with value
|
| 2535 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property PlainSlabTextures initialized with value false
|
| 2536 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtons initialized with value true
|
| 2537 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtonsTypes initialized with value 7
|
| 2538 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtonsStyles initialized with value 3
|
| 2539 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairs initialized with value true
|
| 2540 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairsTypes initialized with value 7
|
| 2541 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairsStyles initialized with value 7
|
| 2542 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWalls initialized with value true
|
| 2543 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWallsTypes initialized with value 7
|
| 2544 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWallsStyles initialized with value 7
|
| 2545 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ChangeButtonRecipe initialized with value 8
|
| 2546 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DisableVanillaStoneVariants initialized with value false
|
| 2547 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DisplayOriginalModInOreTooltip initialized with value true
|
| 2548 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextBefore initialized with value Ore from
|
| 2549 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextBeforeFormatting initialized with value gray
|
| 2550 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipOreModNameFormatting initialized with value gold italic
|
| 2551 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextAfter initialized with value
|
| 2552 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextAfterFormatting initialized with value gray
|
| 2553 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property CustomOreHardness initialized with value null
|
| 2554 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.stone, metadata 0 initialized with value true
|
| 2555 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.sandStone, metadata 0 initialized with value true
|
| 2556 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 0, limestone initialized with value true
|
| 2557 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 1, chalk initialized with value true
|
| 2558 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 2, shale initialized with value true
|
| 2559 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 3, siltstone initialized with value true
|
| 2560 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 4, lignite initialized with value true
|
| 2561 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 5, dolomite initialized with value true
|
| 2562 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 6, greywacke initialized with value true
|
| 2563 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 7, chert initialized with value true
|
| 2564 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 0, gneiss initialized with value true
|
| 2565 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 1, eclogite initialized with value true
|
| 2566 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 2, marble initialized with value true
|
| 2567 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 3, quartzite initialized with value true
|
| 2568 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 4, blueschist initialized with value true
|
| 2569 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 5, greenschist initialized with value true
|
| 2570 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 6, soapstone initialized with value true
|
| 2571 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 7, migmatite initialized with value true
|
| 2572 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 0, red_granite initialized with value true
|
| 2573 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 1, black_granite initialized with value true
|
| 2574 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 2, rhyolite initialized with value true
|
| 2575 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 3, andesite initialized with value true
|
| 2576 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 4, gabbro initialized with value true
|
| 2577 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 5, basalt initialized with value true
|
| 2578 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 6, komatiite initialized with value true
|
| 2579 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 7, dacite initialized with value true
|
| 2580 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.sand, metadata 0 initialized with value true
|
| 2581 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
| 2582 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesWallsStyles = 2
|
| 2583 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
| 2584 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesButtonsStyles = 1
|
| 2585 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
| 2586 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesStairsStyles = 6
|
| 2587 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
| 2588 | [13:17:25] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> DisableVanillaStoneVariants = true
|
| 2589 | [13:17:26] [Server thread/INFO] [undergroundbiomes]: [UndergroundBiomes] Pre-init done!
|
| 2590 | [13:17:26] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod undergroundbiomes
|
| 2591 | [13:17:26] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Underground Biomes took 1.105s
|
| 2592 | [13:17:26] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod phosphor-lighting
|
| 2593 | [13:17:26] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod phosphor-lighting
|
| 2594 | [13:17:26] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Phosphor Lighting Engine took 0.000s
|
| 2595 | [13:17:26] [Server thread/DEBUG] [FML]: Bar Finished: PreInitialization took 113.557s
|
| 2596 | [13:17:53] [Server thread/INFO] [Chisel]: Loading blocks...
|
| 2597 | [13:17:53] [Server thread/INFO] [Chisel]: Skipping feature arcaneStone as its required mod thaumcraft was missing.
|
| 2598 | [13:17:53] [Server thread/INFO] [Chisel]: Skipping feature bloodMagic as its required mod bloodmagic was missing.
|
| 2599 | [13:17:53] [Server thread/INFO] [Chisel]: Skipping feature certus as its required mod appliedenergistics2 was missing.
|
| 2600 | [13:18:11] [Server thread/INFO] [Chisel]: 72 Feature's blocks loaded.
|
| 2601 | [13:18:11] [Server thread/INFO] [Chisel]: Loading Tile Entities...
|
| 2602 | [13:18:11] [Server thread/INFO] [Chisel]: Tile Entities loaded.
|
| 2603 | [13:18:11] [Server thread/ERROR] [FML]: Exception caught during firing event net.minecraftforge.event.RegistryEvent$Register@3d429b3c:
|
| 2604 | java.lang.NoClassDefFoundError: org/lwjgl/opengl/GL11
|
| 2605 | at com.mic.testmod.blocks.machine.watersource.BlockWaterSource.<init>(BlockWaterSource.java:40) ~[BlockWaterSource.class:?]
|
| 2606 | at com.mic.testmod.init.ModBlocks.<clinit>(ModBlocks.java:52) ~[ModBlocks.class:?]
|
| 2607 | at com.mic.testmod.util.handlers.RegistryHandler.onBlockRegister(RegistryHandler.java:35) ~[RegistryHandler.class:?]
|
| 2608 | at net.minecraftforge.fml.common.eventhandler.ASMEventHandler_87_RegistryHandler_onBlockRegister_Register.invoke(.dynamic) ~[?:?]
|
| 2609 | at net.minecraftforge.fml.common.eventhandler.ASMEventHandler.invoke(ASMEventHandler.java:90) ~[ASMEventHandler.class:?]
|
| 2610 | at net.minecraftforge.fml.common.eventhandler.EventBus$1.invoke(EventBus.java:144) ~[EventBus$1.class:?]
|
| 2611 | at net.minecraftforge.fml.common.eventhandler.EventBus.post(EventBus.java:182) [EventBus.class:?]
|
| 2612 | at net.minecraftforge.registries.GameData.fireRegistryEvents(GameData.java:845) [GameData.class:?]
|
| 2613 | at net.minecraftforge.fml.common.Loader.preinitializeMods(Loader.java:630) [Loader.class:?]
|
| 2614 | at net.minecraftforge.fml.server.FMLServerHandler.beginServerLoading(FMLServerHandler.java:99) [FMLServerHandler.class:?]
|
| 2615 | at net.minecraftforge.fml.common.FMLCommonHandler.onServerStart(FMLCommonHandler.java:333) [FMLCommonHandler.class:?]
|
| 2616 | at net.minecraft.server.dedicated.DedicatedServer.func_71197_b(DedicatedServer.java:125) [nz.class:?]
|
| 2617 | at net.minecraft.server.MinecraftServer.run(MinecraftServer.java:486) [MinecraftServer.class:?]
|
| 2618 | at java.lang.Thread.run(Thread.java:748) [?:1.8.0_282]
|
| 2619 | Caused by: java.lang.ClassNotFoundException: org.lwjgl.opengl.GL11
|
| 2620 | at java.net.URLClassLoader.findClass(URLClassLoader.java:382) ~[?:1.8.0_282]
|
| 2621 | at java.lang.ClassLoader.loadClass(ClassLoader.java:418) ~[?:1.8.0_282]
|
| 2622 | at sun.misc.Launcher$AppClassLoader.loadClass(Launcher.java:352) ~[?:1.8.0_282]
|
| 2623 | at java.lang.ClassLoader.loadClass(ClassLoader.java:351) ~[?:1.8.0_282]
|
| 2624 | at net.minecraft.launchwrapper.LaunchClassLoader.findClass(LaunchClassLoader.java:106) ~[launchwrapper-1.12.jar:?]
|
| 2625 | at java.lang.ClassLoader.loadClass(ClassLoader.java:418) ~[?:1.8.0_282]
|
| 2626 | at java.lang.ClassLoader.loadClass(ClassLoader.java:351) ~[?:1.8.0_282]
|
| 2627 | ... 14 more
|
| 2628 | [13:18:11] [Server thread/ERROR] [FML]: Index: 13 Listeners:
|
| 2629 | [13:18:11] [Server thread/ERROR] [FML]: 0: NORMAL
|
| 2630 | [13:18:11] [Server thread/ERROR] [FML]: 1: net.minecraftforge.fml.common.eventhandler.EventBus$1@b1e0c8c
|
| 2631 | [13:18:11] [Server thread/ERROR] [FML]: 2: net.minecraftforge.fml.common.eventhandler.EventBus$1@70ee7529
|
| 2632 | [13:18:11] [Server thread/ERROR] [FML]: 3: net.minecraftforge.fml.common.eventhandler.EventBus$1@595c9b73
|
| 2633 | [13:18:11] [Server thread/ERROR] [FML]: 4: net.minecraftforge.fml.common.eventhandler.EventBus$1@713681b7
|
| 2634 | [13:18:11] [Server thread/ERROR] [FML]: 5: net.minecraftforge.fml.common.eventhandler.EventBus$1@ab79971
|
| 2635 | [13:18:11] [Server thread/ERROR] [FML]: 6: net.minecraftforge.fml.common.eventhandler.EventBus$1@9f3f233
|
| 2636 | [13:18:11] [Server thread/ERROR] [FML]: 7: net.minecraftforge.fml.common.eventhandler.EventBus$1@34c9677d
|
| 2637 | [13:18:11] [Server thread/ERROR] [FML]: 8: net.minecraftforge.fml.common.eventhandler.EventBus$1@7137636a
|
| 2638 | [13:18:11] [Server thread/ERROR] [FML]: 9: net.minecraftforge.fml.common.eventhandler.EventBus$1@477d102c
|
| 2639 | [13:18:11] [Server thread/ERROR] [FML]: 10: net.minecraftforge.fml.common.eventhandler.EventBus$1@5109009a
|
| 2640 | [13:18:11] [Server thread/ERROR] [FML]: 11: net.minecraftforge.fml.common.eventhandler.EventBus$1@2e846749
|
| 2641 | [13:18:11] [Server thread/ERROR] [FML]: 12: net.minecraftforge.fml.common.eventhandler.EventBus$1@64e26dc0
|
| 2642 | [13:18:11] [Server thread/ERROR] [FML]: 13: net.minecraftforge.fml.common.eventhandler.EventBus$1@4b31fd00
|
| 2643 | [13:18:11] [Server thread/ERROR] [FML]: 14: net.minecraftforge.fml.common.eventhandler.EventBus$1@52a5392c
|
| 2644 | [13:18:11] [Server thread/ERROR] [FML]: 15: net.minecraftforge.fml.common.eventhandler.EventBus$1@5f96a21e
|
| 2645 | [13:18:11] [Server thread/ERROR] [FML]: 16: net.minecraftforge.fml.common.eventhandler.EventBus$1@28ed5841
|
| 2646 | [13:18:11] [Server thread/ERROR] [FML]: 17: net.minecraftforge.fml.common.eventhandler.EventBus$1@6c7079a1
|
| 2647 | [13:18:11] [Server thread/ERROR] [FML]: 18: net.minecraftforge.fml.common.eventhandler.EventBus$1@1767415a
|
| 2648 | [13:18:11] [Server thread/ERROR] [FML]: 19: net.minecraftforge.fml.common.eventhandler.EventBus$1@7d8b97fa
|
| 2649 | [13:18:11] [Server thread/ERROR] [FML]: 20: net.minecraftforge.fml.common.eventhandler.EventBus$1@3fe6e75a
|
| 2650 | [13:18:11] [Server thread/ERROR] [FML]: 21: net.minecraftforge.fml.common.eventhandler.EventBus$1@50b42c76
|
| 2651 | [13:18:11] [Server thread/ERROR] [FML]: 22: net.minecraftforge.fml.common.eventhandler.EventBus$1@7df4caab
|
| 2652 | [13:18:11] [Server thread/ERROR] [FML]: 23: net.minecraftforge.fml.common.eventhandler.EventBus$1@5ce1a6a8
|
| 2653 | [13:18:11] [Server thread/ERROR] [FML]: 24: net.minecraftforge.fml.common.eventhandler.EventBus$1@54355659
|
| 2654 | [13:18:11] [Server thread/ERROR] [FML]: 25: net.minecraftforge.fml.common.eventhandler.EventBus$1@25930735
|
| 2655 | [13:18:11] [Server thread/ERROR] [FML]: 26: net.minecraftforge.fml.common.eventhandler.EventBus$1@7e6920be
|
| 2656 | [13:18:11] [Server thread/ERROR] [FML]: 27: net.minecraftforge.fml.common.eventhandler.EventBus$1@2f6c0d3d
|
| 2657 | [13:18:11] [Server thread/ERROR] [FML]: 28: net.minecraftforge.fml.common.eventhandler.EventBus$1@51951117
|
| 2658 | [13:18:11] [Server thread/ERROR] [FML]: 29: net.minecraftforge.fml.common.eventhandler.EventBus$1@6c021ebf
|
| 2659 | [13:18:11] [Server thread/ERROR] [FML]: 30: net.minecraftforge.fml.common.eventhandler.EventBus$1@5bd9af51
|
| 2660 | [13:18:11] [Server thread/ERROR] [FML]: 31: net.minecraftforge.fml.common.eventhandler.EventBus$1@149354f2
|
| 2661 | [13:18:11] [Server thread/ERROR] [FML]: 32: net.minecraftforge.fml.common.eventhandler.EventBus$1@6d77f2de
|
| 2662 | [13:18:11] [Server thread/ERROR] [FML]: 33: net.minecraftforge.fml.common.eventhandler.EventBus$1@11fcee29
|
| 2663 | [13:18:11] [Server thread/ERROR] [FML]: 34: net.minecraftforge.fml.common.eventhandler.EventBus$1@7496860
|
| 2664 | [13:18:11] [Server thread/ERROR] [FML]: 35: net.minecraftforge.fml.common.eventhandler.EventBus$1@97398bf
|
| 2665 | [13:18:11] [Server thread/ERROR] [FML]: 36: net.minecraftforge.fml.common.eventhandler.EventBus$1@5b407a4d
|
| 2666 | [13:18:11] [Server thread/ERROR] [FML]: 37: net.minecraftforge.fml.common.eventhandler.EventBus$1@2d3b4aaa
|
| 2667 | [13:18:11] [Server thread/ERROR] [FML]: 38: net.minecraftforge.fml.common.eventhandler.EventBus$1@617d2d05
|
| 2668 | [13:18:11] [Server thread/ERROR] [FML]: 39: net.minecraftforge.fml.common.eventhandler.EventBus$1@745ef7f5
|
| 2669 | [13:18:11] [Server thread/ERROR] [FML]: 40: net.minecraftforge.fml.common.eventhandler.EventBus$1@2c146921
|
| 2670 | [13:18:11] [Server thread/ERROR] [FML]: 41: net.minecraftforge.fml.common.eventhandler.EventBus$1@5b8d1813
|
| 2671 | [13:18:11] [Server thread/ERROR] [FML]: 42: net.minecraftforge.fml.common.eventhandler.EventBus$1@53101362
|
| 2672 | [13:18:11] [Server thread/ERROR] [FML]: 43: net.minecraftforge.fml.common.eventhandler.EventBus$1@50f2a7aa
|
| 2673 | [13:18:11] [Server thread/ERROR] [FML]: 44: net.minecraftforge.fml.common.eventhandler.EventBus$1@5f2091f4
|
| 2674 | [13:18:11] [Server thread/ERROR] [FML]: 45: net.minecraftforge.fml.common.eventhandler.EventBus$1@6cde4783
|
| 2675 | [13:18:11] [Server thread/ERROR] [FML]: 46: LOWEST
|
| 2676 | [13:18:11] [Server thread/ERROR] [FML]: 47: net.minecraftforge.fml.common.eventhandler.EventBus$1@3f86c279
|
| 2677 | [13:18:11] [Server thread/ERROR] [FML]: 48: net.minecraftforge.fml.common.eventhandler.EventBus$1@7a8cedd4
|
| 2678 | [13:18:11] [Server thread/ERROR] [net.minecraft.server.MinecraftServer]: Encountered an unexpected exception
|
| 2679 | java.lang.NoClassDefFoundError: org/lwjgl/opengl/GL11
|
| 2680 | at com.mic.testmod.blocks.machine.watersource.BlockWaterSource.<init>(BlockWaterSource.java:40) ~[BlockWaterSource.class:?]
|
| 2681 | at com.mic.testmod.init.ModBlocks.<clinit>(ModBlocks.java:52) ~[ModBlocks.class:?]
|
| 2682 | at com.mic.testmod.util.handlers.RegistryHandler.onBlockRegister(RegistryHandler.java:35) ~[RegistryHandler.class:?]
|
| 2683 | at net.minecraftforge.fml.common.eventhandler.ASMEventHandler_87_RegistryHandler_onBlockRegister_Register.invoke(.dynamic) ~[?:?]
|
| 2684 | at net.minecraftforge.fml.common.eventhandler.ASMEventHandler.invoke(ASMEventHandler.java:90) ~[ASMEventHandler.class:?]
|
| 2685 | at net.minecraftforge.fml.common.eventhandler.EventBus$1.invoke(EventBus.java:144) ~[EventBus$1.class:?]
|
| 2686 | at net.minecraftforge.fml.common.eventhandler.EventBus.post(EventBus.java:182) ~[EventBus.class:?]
|
| 2687 | at net.minecraftforge.registries.GameData.fireRegistryEvents(GameData.java:845) ~[GameData.class:?]
|
| 2688 | at net.minecraftforge.fml.common.Loader.preinitializeMods(Loader.java:630) ~[Loader.class:?]
|
| 2689 | at net.minecraftforge.fml.server.FMLServerHandler.beginServerLoading(FMLServerHandler.java:99) ~[FMLServerHandler.class:?]
|
| 2690 | at net.minecraftforge.fml.common.FMLCommonHandler.onServerStart(FMLCommonHandler.java:333) ~[FMLCommonHandler.class:?]
|
| 2691 | at net.minecraft.server.dedicated.DedicatedServer.func_71197_b(DedicatedServer.java:125) ~[nz.class:?]
|
| 2692 | at net.minecraft.server.MinecraftServer.run(MinecraftServer.java:486) [MinecraftServer.class:?]
|
| 2693 | at java.lang.Thread.run(Thread.java:748) [?:1.8.0_282]
|
| 2694 | Caused by: java.lang.ClassNotFoundException: org.lwjgl.opengl.GL11
|
| 2695 | at java.net.URLClassLoader.findClass(URLClassLoader.java:382) ~[?:1.8.0_282]
|
| 2696 | at java.lang.ClassLoader.loadClass(ClassLoader.java:418) ~[?:1.8.0_282]
|
| 2697 | at sun.misc.Launcher$AppClassLoader.loadClass(Launcher.java:352) ~[?:1.8.0_282]
|
| 2698 | at java.lang.ClassLoader.loadClass(ClassLoader.java:351) ~[?:1.8.0_282]
|
| 2699 | at net.minecraft.launchwrapper.LaunchClassLoader.findClass(LaunchClassLoader.java:106) ~[launchwrapper-1.12.jar:?]
|
| 2700 | at java.lang.ClassLoader.loadClass(ClassLoader.java:418) ~[?:1.8.0_282]
|
| 2701 | at java.lang.ClassLoader.loadClass(ClassLoader.java:351) ~[?:1.8.0_282]
|
| 2702 | ... 14 more
|
| 2703 | [13:18:11] [Server thread/ERROR] [net.minecraft.server.MinecraftServer]: This crash report has been saved to: /server/./crash-reports/crash-2021-03-17_13.18.11-server.txt
|
| 2704 | [13:18:11] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Stopping server
|
| 2705 | [13:18:11] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Saving worlds
|
| 2706 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod minecraft
|
| 2707 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod minecraft
|
| 2708 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Minecraft took 0.003s
|
| 2709 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod mcp
|
| 2710 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod mcp
|
| 2711 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Minecraft Coder Pack took 0.003s
|
| 2712 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod FML
|
| 2713 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod FML
|
| 2714 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Forge Mod Loader took 0.000s
|
| 2715 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod forge
|
| 2716 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod forge
|
| 2717 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Minecraft Forge took 0.001s
|
| 2718 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod backpacked
|
| 2719 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod backpacked
|
| 2720 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Backpacked took 0.000s
|
| 2721 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod jei
|
| 2722 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod jei
|
| 2723 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Just Enough Items took 0.014s
|
| 2724 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod abyssalcraft
|
| 2725 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod abyssalcraft
|
| 2726 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - AbyssalCraft took 0.000s
|
| 2727 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod orbis-lib
|
| 2728 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod orbis-lib
|
| 2729 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - OrbisLib took 0.008s
|
| 2730 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod aether
|
| 2731 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod aether
|
| 2732 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Aether II took 0.000s
|
| 2733 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod blocklings
|
| 2734 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod blocklings
|
| 2735 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Blocklings Mod took 0.000s
|
| 2736 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod bloodmoon
|
| 2737 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod bloodmoon
|
| 2738 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Bloodmoon took 0.000s
|
| 2739 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod chisel
|
| 2740 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod chisel
|
| 2741 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Chisel took 0.000s
|
| 2742 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod codechickenlib
|
| 2743 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod codechickenlib
|
| 2744 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - CodeChicken Lib took 0.000s
|
| 2745 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod miccw
|
| 2746 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod miccw
|
| 2747 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Cosmic Weaponry took 0.001s
|
| 2748 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod customspawner
|
| 2749 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod customspawner
|
| 2750 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - DrZhark's CustomSpawner took 0.000s
|
| 2751 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod props
|
| 2752 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod props
|
| 2753 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Decocraft took 0.000s
|
| 2754 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod dldungeonsjbg
|
| 2755 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod dldungeonsjbg
|
| 2756 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Doomlike Dungeons took 0.000s
|
| 2757 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod mocreatures
|
| 2758 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod mocreatures
|
| 2759 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - DrZhark's Mo'Creatures Mod took 0.000s
|
| 2760 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod enderstorage
|
| 2761 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod enderstorage
|
| 2762 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - EnderStorage took 0.000s
|
| 2763 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod fastfurnace
|
| 2764 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod fastfurnace
|
| 2765 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - FastFurnace took 0.009s
|
| 2766 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod ironchest
|
| 2767 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod ironchest
|
| 2768 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Iron Chest took 0.000s
|
| 2769 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod lunatriuscore
|
| 2770 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod lunatriuscore
|
| 2771 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - LunatriusCore took 0.000s
|
| 2772 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod netherendingores
|
| 2773 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod netherendingores
|
| 2774 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Netherending Ores took 0.000s
|
| 2775 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod nei
|
| 2776 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod nei
|
| 2777 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Not Enough Items took 0.000s
|
| 2778 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod placebo
|
| 2779 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod placebo
|
| 2780 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Placebo took 0.007s
|
| 2781 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod schematica
|
| 2782 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod schematica
|
| 2783 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Schematica took 0.000s
|
| 2784 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod schematics
|
| 2785 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod schematics
|
| 2786 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Schematics took 0.000s
|
| 2787 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod simplyjetpacks
|
| 2788 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod simplyjetpacks
|
| 2789 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Simply Jetpacks 2 took 0.000s
|
| 2790 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod undergroundbiomes
|
| 2791 | [13:18:11] [Server thread/INFO] [STDOUT]: [exterminatorjeff.undergroundbiomes.intermod.OresRegistry:recheckPile:352]: Blocks queued for redo: 0
|
| 2792 | [13:18:11] [Server thread/INFO] [undergroundbiomes]: [UndergroundBiomes] Server Stopped
|
| 2793 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod undergroundbiomes
|
| 2794 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Underground Biomes took 0.009s
|
| 2795 | [13:18:11] [Server thread/TRACE] [FML]: Sending event FMLServerStoppedEvent to mod phosphor-lighting
|
| 2796 | [13:18:11] [Server thread/TRACE] [FML]: Sent event FMLServerStoppedEvent to mod phosphor-lighting
|
| 2797 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Step: ServerStopped - Phosphor Lighting Engine took 0.001s
|
| 2798 | [13:18:11] [Server thread/DEBUG] [FML]: Bar Finished: ServerStopped took 0.061s
|
| 2799 | [13:18:11] [Server thread/INFO] [FML]: The state engine was in incorrect state INITIALIZATION and forced into state SERVER_STOPPED. Errors may have been discarded.
|
| 2800 | [13:18:11] [Server Shutdown Thread/INFO] [net.minecraft.server.MinecraftServer]: Stopping server
|
| 2801 | [13:18:11] [Server Shutdown Thread/INFO] [net.minecraft.server.MinecraftServer]: Saving worlds
|
