[23:29:12] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLServerTweaker
[23:29:12] [main/INFO] [LaunchWrapper]: Using primary tweak class name net.minecraftforge.fml.common.launcher.FMLServerTweaker
[23:29:12] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLServerTweaker
[23:29:12] [main/DEBUG] [FML]: Injecting tracing printstreams for STDOUT/STDERR.
[23:29:12] [main/INFO] [FML]: Forge Mod Loader version 14.23.5.2860 for Minecraft 1.12.2 loading
[23:29:12] [main/INFO] [FML]: Java is OpenJDK 64-Bit Server VM, version 1.8.0_312, running on Linux:amd64:5.4.0-99-generic, installed at /usr/local/openjdk-8/jre
[23:29:12] [main/DEBUG] [FML]: Java classpath at launch is:
[23:29:12] [main/DEBUG] [FML]: forge.jar
[23:29:12] [main/DEBUG] [FML]: /jolokia/jolokia.jar
[23:29:12] [main/DEBUG] [FML]: Java library path at launch is:
[23:29:12] [main/DEBUG] [FML]: /usr/java/packages/lib/amd64
[23:29:12] [main/DEBUG] [FML]: /usr/lib64
[23:29:12] [main/DEBUG] [FML]: /lib64
[23:29:12] [main/DEBUG] [FML]: /lib
[23:29:12] [main/DEBUG] [FML]: /usr/lib
[23:29:12] [main/DEBUG] [FML]: Determined Minecraft Libraries Root: /server/libraries
[23:29:12] [main/DEBUG] [FML]: Cleaning up mods folder: ./mods
[23:29:12] [main/DEBUG] [FML]: Examining file: iChunUtil-1.12.2-7.2.2.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: bewitchment-1.12.2-0.0.22.64.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Bloodmoon-MC1.12.2-1.5.3.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Morph-1.12.2-7.2.1.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Pam's HarvestCraft 1.12.2zg.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: FTBQuests-1202.9.0.15.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: lootbagmod-1.12.2-1.5.2-FINAL.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Decocraft-2.6.3.7_1.12.2.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: FTBMoney-1.2.0.47.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Guide-API-1.12-2.1.8-63.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: CoFHCore-1.12.2-4.6.6.1-universal.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: DrZharks MoCreatures Mod-12.0.5.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: astralsorcery-1.12.2-1.10.27.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: BiblioCraft[v2.4.6][MC1.12.2].jar
[23:29:12] [main/DEBUG] [FML]: Examining file: RandomThings-MC1.12.2-4.2.7.4.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: ProjectIntelligence-1.12.2-1.0.9.28-universal.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: ItemFilters-1.0.4.2.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: llibrary-1.7.20-1.12.2.jar
[23:29:12] [main/DEBUG] [FML]: Found existing ContainedDep llibrary-core-1.0.11-1.12.2.jar(net.ilexiconn:llibrary-core:1.0.11-1.12.2) from /server/mods/memory_repo/net/ilexiconn/llibrary-core/1.0.11-1.12.2/llibrary-core-1.0.11-1.12.2.jar extracted to ./mods/llibrary-1.7.20-1.12.2.jar, skipping extraction
[23:29:12] [main/DEBUG] [FML]: Examining file: llibrary-core-1.0.11-1.12.2.jar
[23:29:12] [main/DEBUG] [FML]: Making maven link for net.ilexiconn:llibrary:1.7.20-1.12.2 in memory to /server/./mods/llibrary-1.7.20-1.12.2.jar.
[23:29:12] [main/DEBUG] [FML]: Examining file: Patchouli-1.0-23.6.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Hats-1.12.2-7.1.1.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Chisel-MC1.12.2-1.0.2.45.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: CustomMobSpawner-3.11.5.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: AutoRegLib-1.3-32.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Quark-r1.6-179.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: mysticalworld-1.12.2-1.11.0.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Roots-1.12.2-3.1.5.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: CoFHWorld-1.12.2-1.4.0.1-universal.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: CraftStudioAPI-universal-1.0.1.95-mc1.12-alpha.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: CTM-MC1.12.2-1.0.2.31.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: twilightforest-1.12.2-3.11.1021-universal.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Baubles-1.12-1.5.2.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: journeymap-1.12.2-5.7.1.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: mysticallib-1.12.2-1.13.0.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: RedstoneFlux-1.12-2.1.1.1-universal.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: FTBLib-5.4.7.2.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: GrimoireOfGaia3-1.12.2-1.7.2.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Thaumcraft-1.12.2-6.1.BETA26.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: betteranimalsplus-1.12.2-9.0.1.jar
[23:29:12] [main/DEBUG] [FML]: Making maven link for dev.itsmeow.betteranimalsplus:betteranimalsplus:1.12.2-9.0.1 in memory to /server/./mods/betteranimalsplus-1.12.2-9.0.1.jar.
[23:29:12] [main/DEBUG] [FML]: Examining file: fossilsarcheology-8.0.5.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: ThermalFoundation-1.12.2-2.6.7.1-universal.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: CodeChickenLib-1.12.2-3.2.3.358-universal.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Mantle-1.12-1.3.3.55.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: natura-1.12.2-4.3.2.69.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: forestry_1.12.2-5.8.2.422.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Botania r1.10-364.4.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: TConstruct-1.12.2-2.13.0.183.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: extrautils2-1.12-1.9.9.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: ironchest-1.12.2-7.0.67.844.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: BloodMagic-1.12.2-2.4.3-105.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: BrandonsCore-1.12.2-2.4.20.162-universal.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: rats-3.2.14-1.12.2.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: Tabula-1.12.2-7.1.0.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: aether_ii-1.12.2-0.3.0+build411-universal.jar
[23:29:12] [main/DEBUG] [FML]: Extracting ContainedDep orbis-lib-1.12.2-0.2.0+build411-universal.jar(com.gildedgames:orbis-lib:1.12.2-0.2.0+build411) from ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar to /server/mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar
[23:29:12] [main/DEBUG] [FML]: Extracted ContainedDep orbis-lib-1.12.2-0.2.0+build411-universal.jar(com.gildedgames:orbis-lib:1.12.2-0.2.0+build411) from ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar to /server/mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar
[23:29:12] [main/DEBUG] [FML]: Examining file: orbis-lib-1.12.2-0.2.0+build411.jar
[23:29:13] [main/DEBUG] [FML]: Extracting ContainedDep phosphor-1.12.2-0.2.6+build50-universal.jar(me.jellysquid.mods:phosphor:1.12.2-0.2.6+build50) from ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar to /server/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
[23:29:13] [main/DEBUG] [FML]: Extracted ContainedDep phosphor-1.12.2-0.2.6+build50-universal.jar(me.jellysquid.mods:phosphor:1.12.2-0.2.6+build50) from ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar to /server/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
[23:29:13] [main/DEBUG] [FML]: Examining file: phosphor-1.12.2-0.2.6+build50.jar
[23:29:13] [main/DEBUG] [FML]: Examining file: PTRLib-1.0.5.jar
[23:29:13] [main/DEBUG] [FML]: Examining file: BiomesOPlenty-1.12.2-7.0.1.2445-universal.jar
[23:29:13] [main/DEBUG] [FML]: File already proccessed /server/./mods/memory_repo/net/ilexiconn/llibrary-core/1.0.11-1.12.2/llibrary-core-1.0.11-1.12.2.jar, Skipping
[23:29:13] [main/DEBUG] [FML]: File already proccessed /server/./mods/llibrary-1.7.20-1.12.2.jar, Skipping
[23:29:13] [main/DEBUG] [FML]: File already proccessed /server/./mods/betteranimalsplus-1.12.2-9.0.1.jar, Skipping
[23:29:13] [main/DEBUG] [FML]: File already proccessed /server/./mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar, Skipping
[23:29:13] [main/DEBUG] [FML]: File already proccessed /server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar, Skipping
[23:29:13] [main/DEBUG] [FML]: Enabling runtime deobfuscation
[23:29:13] [main/DEBUG] [FML]: Instantiating coremod class FMLCorePlugin
[23:29:13] [main/DEBUG] [FML]: Found signing certificates for coremod FMLCorePlugin (net.minecraftforge.fml.relauncher.FMLCorePlugin)
[23:29:13] [main/DEBUG] [FML]: Found certificate e3c3d50c7c986df74c645c0ac54639741c90a557
[23:29:13] [main/DEBUG] [FML]: Added access transformer class net.minecraftforge.fml.common.asm.transformers.AccessTransformer to enqueued access transformers
[23:29:13] [main/DEBUG] [FML]: Enqueued coremod FMLCorePlugin
[23:29:13] [main/DEBUG] [FML]: Instantiating coremod class FMLForgePlugin
[23:29:13] [main/DEBUG] [FML]: Found signing certificates for coremod FMLForgePlugin (net.minecraftforge.classloading.FMLForgePlugin)
[23:29:13] [main/DEBUG] [FML]: Found certificate e3c3d50c7c986df74c645c0ac54639741c90a557
[23:29:13] [main/DEBUG] [FML]: Enqueued coremod FMLForgePlugin
[23:29:13] [main/DEBUG] [FML]: All fundamental core mods are successfully located
[23:29:13] [main/DEBUG] [FML]: Discovering coremods
[23:29:13] [main/INFO] [FML]: Searching /server/./mods for mods
[23:29:13] [main/DEBUG] [FML]: Adding iChunUtil-1.12.2-7.2.2.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding bewitchment-1.12.2-0.0.22.64.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Bloodmoon-MC1.12.2-1.5.3.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Morph-1.12.2-7.2.1.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Pam's HarvestCraft 1.12.2zg.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding FTBQuests-1202.9.0.15.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding lootbagmod-1.12.2-1.5.2-FINAL.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Decocraft-2.6.3.7_1.12.2.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding FTBMoney-1.2.0.47.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Guide-API-1.12-2.1.8-63.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding CoFHCore-1.12.2-4.6.6.1-universal.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding DrZharks MoCreatures Mod-12.0.5.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding astralsorcery-1.12.2-1.10.27.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding BiblioCraft[v2.4.6][MC1.12.2].jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding RandomThings-MC1.12.2-4.2.7.4.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding ProjectIntelligence-1.12.2-1.0.9.28-universal.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding ItemFilters-1.0.4.2.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding llibrary-1.7.20-1.12.2.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Patchouli-1.0-23.6.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Hats-1.12.2-7.1.1.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Chisel-MC1.12.2-1.0.2.45.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding CustomMobSpawner-3.11.5.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding AutoRegLib-1.3-32.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Quark-r1.6-179.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding mysticalworld-1.12.2-1.11.0.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Roots-1.12.2-3.1.5.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding CoFHWorld-1.12.2-1.4.0.1-universal.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding CraftStudioAPI-universal-1.0.1.95-mc1.12-alpha.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding CTM-MC1.12.2-1.0.2.31.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding twilightforest-1.12.2-3.11.1021-universal.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Baubles-1.12-1.5.2.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding journeymap-1.12.2-5.7.1.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding mysticallib-1.12.2-1.13.0.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding RedstoneFlux-1.12-2.1.1.1-universal.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding FTBLib-5.4.7.2.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding GrimoireOfGaia3-1.12.2-1.7.2.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Thaumcraft-1.12.2-6.1.BETA26.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding betteranimalsplus-1.12.2-9.0.1.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding fossilsarcheology-8.0.5.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding ThermalFoundation-1.12.2-2.6.7.1-universal.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding CodeChickenLib-1.12.2-3.2.3.358-universal.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Mantle-1.12-1.3.3.55.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding natura-1.12.2-4.3.2.69.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding forestry_1.12.2-5.8.2.422.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Botania r1.10-364.4.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding TConstruct-1.12.2-2.13.0.183.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding extrautils2-1.12-1.9.9.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding ironchest-1.12.2-7.0.67.844.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding BloodMagic-1.12.2-2.4.3-105.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding BrandonsCore-1.12.2-2.4.20.162-universal.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding rats-3.2.14-1.12.2.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding Tabula-1.12.2-7.1.0.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding aether_ii-1.12.2-0.3.0+build411-universal.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding PTRLib-1.0.5.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Adding BiomesOPlenty-1.12.2-7.0.1.2445-universal.jar to the mod list
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy aether_ii-1.12.2-0.3.0+build411-universal.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in aether_ii-1.12.2-0.3.0+build411-universal.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy astralsorcery-1.12.2-1.10.27.jar
[23:29:13] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in astralsorcery-1.12.2-1.10.27.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[23:29:13] [main/DEBUG] [FML]: Instantiating coremod class AstralCore
[23:29:13] [main/TRACE] [FML]: coremod named AstralCore is loading
[23:29:13] [main/WARN] [FML]: The coremod hellfirepvp.astralsorcery.core.AstralCore does not have a MCVersion annotation, it may cause issues with this version of Minecraft
[23:29:13] [main/DEBUG] [FML]: Found signing certificates for coremod AstralCore (hellfirepvp.astralsorcery.core.AstralCore)
[23:29:13] [main/DEBUG] [FML]: Found certificate a0f0b759d895c15ceb3e3bcb5f3c2db7c582edf0
[23:29:13] [main/INFO] [Astral Core]: [AstralCore] Initialized.
[23:29:13] [main/DEBUG] [FML]: Added access transformer class hellfirepvp.astralsorcery.core.AstralTransformer to enqueued access transformers
[23:29:13] [main/DEBUG] [FML]: Enqueued coremod AstralCore
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy AutoRegLib-1.3-32.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in AutoRegLib-1.3-32.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Baubles-1.12-1.5.2.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Baubles-1.12-1.5.2.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy bewitchment-1.12.2-0.0.22.64.jar
[23:29:13] [main/INFO] [FML]: Loading tweaker org.spongepowered.asm.launch.MixinTweaker from bewitchment-1.12.2-0.0.22.64.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy BiblioCraft[v2.4.6][MC1.12.2].jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in BiblioCraft[v2.4.6][MC1.12.2].jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy BiomesOPlenty-1.12.2-7.0.1.2445-universal.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in BiomesOPlenty-1.12.2-7.0.1.2445-universal.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy BloodMagic-1.12.2-2.4.3-105.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in BloodMagic-1.12.2-2.4.3-105.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Bloodmoon-MC1.12.2-1.5.3.jar
[23:29:13] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in Bloodmoon-MC1.12.2-1.5.3.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[23:29:13] [main/DEBUG] [FML]: Instantiating coremod class LoadingPlugin
[23:29:13] [main/WARN] [FML]: The coremod lumien.bloodmoon.asm.LoadingPlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft
[23:29:13] [main/DEBUG] [FML]: Found signing certificates for coremod LoadingPlugin (lumien.bloodmoon.asm.LoadingPlugin)
[23:29:13] [main/DEBUG] [FML]: Found certificate d72e0dd57935b3e9476212aea0c0df352dd76291
[23:29:13] [main/DEBUG] [FML]: Enqueued coremod LoadingPlugin
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Botania r1.10-364.4.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Botania r1.10-364.4.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy BrandonsCore-1.12.2-2.4.20.162-universal.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in BrandonsCore-1.12.2-2.4.20.162-universal.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Chisel-MC1.12.2-1.0.2.45.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Chisel-MC1.12.2-1.0.2.45.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy CodeChickenLib-1.12.2-3.2.3.358-universal.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in CodeChickenLib-1.12.2-3.2.3.358-universal.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy CoFHCore-1.12.2-4.6.6.1-universal.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in CoFHCore-1.12.2-4.6.6.1-universal.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy CoFHWorld-1.12.2-1.4.0.1-universal.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in CoFHWorld-1.12.2-1.4.0.1-universal.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy CraftStudioAPI-universal-1.0.1.95-mc1.12-alpha.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in CraftStudioAPI-universal-1.0.1.95-mc1.12-alpha.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy CTM-MC1.12.2-1.0.2.31.jar
[23:29:13] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in CTM-MC1.12.2-1.0.2.31.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[23:29:13] [main/DEBUG] [FML]: Instantiating coremod class CTMCorePlugin
[23:29:13] [main/WARN] [FML]: The coremod team.chisel.ctm.client.asm.CTMCorePlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft
[23:29:13] [main/WARN] [FML]: The coremod CTMCorePlugin (team.chisel.ctm.client.asm.CTMCorePlugin) is not signed!
[23:29:13] [main/DEBUG] [FML]: Enqueued coremod CTMCorePlugin
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy CustomMobSpawner-3.11.5.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in CustomMobSpawner-3.11.5.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Decocraft-2.6.3.7_1.12.2.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Decocraft-2.6.3.7_1.12.2.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy DrZharks MoCreatures Mod-12.0.5.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in DrZharks MoCreatures Mod-12.0.5.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy extrautils2-1.12-1.9.9.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in extrautils2-1.12-1.9.9.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy forestry_1.12.2-5.8.2.422.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in forestry_1.12.2-5.8.2.422.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy fossilsarcheology-8.0.5.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in fossilsarcheology-8.0.5.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy FTBLib-5.4.7.2.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in FTBLib-5.4.7.2.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy FTBMoney-1.2.0.47.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in FTBMoney-1.2.0.47.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy FTBQuests-1202.9.0.15.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in FTBQuests-1202.9.0.15.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy GrimoireOfGaia3-1.12.2-1.7.2.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in GrimoireOfGaia3-1.12.2-1.7.2.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Guide-API-1.12-2.1.8-63.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Guide-API-1.12-2.1.8-63.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Hats-1.12.2-7.1.1.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Hats-1.12.2-7.1.1.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy iChunUtil-1.12.2-7.2.2.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in iChunUtil-1.12.2-7.2.2.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy ironchest-1.12.2-7.0.67.844.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in ironchest-1.12.2-7.0.67.844.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy ItemFilters-1.0.4.2.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in ItemFilters-1.0.4.2.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy journeymap-1.12.2-5.7.1.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in journeymap-1.12.2-5.7.1.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy lootbagmod-1.12.2-1.5.2-FINAL.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in lootbagmod-1.12.2-1.5.2-FINAL.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Mantle-1.12-1.3.3.55.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Mantle-1.12-1.3.3.55.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Morph-1.12.2-7.2.1.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Morph-1.12.2-7.2.1.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy mysticallib-1.12.2-1.13.0.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in mysticallib-1.12.2-1.13.0.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy mysticalworld-1.12.2-1.11.0.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in mysticalworld-1.12.2-1.11.0.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy natura-1.12.2-4.3.2.69.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in natura-1.12.2-4.3.2.69.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Pam's HarvestCraft 1.12.2zg.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Pam's HarvestCraft 1.12.2zg.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Patchouli-1.0-23.6.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Patchouli-1.0-23.6.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy ProjectIntelligence-1.12.2-1.0.9.28-universal.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in ProjectIntelligence-1.12.2-1.0.9.28-universal.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy PTRLib-1.0.5.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in PTRLib-1.0.5.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Quark-r1.6-179.jar
[23:29:13] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in Quark-r1.6-179.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[23:29:13] [main/DEBUG] [FML]: Instantiating coremod class LoadingPlugin
[23:29:13] [main/TRACE] [FML]: coremod named Quark Plugin is loading
[23:29:13] [main/DEBUG] [FML]: The coremod vazkii.quark.base.asm.LoadingPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
[23:29:13] [main/WARN] [FML]: The coremod Quark Plugin (vazkii.quark.base.asm.LoadingPlugin) is not signed!
[23:29:13] [main/DEBUG] [FML]: Enqueued coremod Quark Plugin
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy RandomThings-MC1.12.2-4.2.7.4.jar
[23:29:13] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in RandomThings-MC1.12.2-4.2.7.4.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[23:29:13] [main/DEBUG] [FML]: Instantiating coremod class LoadingPlugin
[23:29:13] [main/WARN] [FML]: The coremod lumien.randomthings.asm.LoadingPlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft
[23:29:13] [main/DEBUG] [FML]: Found signing certificates for coremod LoadingPlugin (lumien.randomthings.asm.LoadingPlugin)
[23:29:13] [main/DEBUG] [FML]: Found certificate d72e0dd57935b3e9476212aea0c0df352dd76291
[23:29:13] [main/DEBUG] [FML]: Enqueued coremod LoadingPlugin
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy rats-3.2.14-1.12.2.jar
[23:29:13] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in rats-3.2.14-1.12.2.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[23:29:13] [main/DEBUG] [FML]: Instantiating coremod class RatsPlugin
[23:29:13] [main/TRACE] [FML]: coremod named ratscore is loading
[23:29:13] [main/DEBUG] [FML]: The coremod com.github.alexthe666.rats.server.asm.RatsPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
[23:29:13] [main/WARN] [FML]: The coremod ratscore (com.github.alexthe666.rats.server.asm.RatsPlugin) is not signed!
[23:29:13] [main/DEBUG] [FML]: Enqueued coremod ratscore
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy RedstoneFlux-1.12-2.1.1.1-universal.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in RedstoneFlux-1.12-2.1.1.1-universal.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Roots-1.12.2-3.1.5.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Roots-1.12.2-3.1.5.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Tabula-1.12.2-7.1.0.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Tabula-1.12.2-7.1.0.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy TConstruct-1.12.2-2.13.0.183.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in TConstruct-1.12.2-2.13.0.183.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy Thaumcraft-1.12.2-6.1.BETA26.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in Thaumcraft-1.12.2-6.1.BETA26.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy ThermalFoundation-1.12.2-2.6.7.1-universal.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in ThermalFoundation-1.12.2-2.6.7.1-universal.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy twilightforest-1.12.2-3.11.1021-universal.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in twilightforest-1.12.2-3.11.1021-universal.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy llibrary-core-1.0.11-1.12.2.jar
[23:29:13] [main/TRACE] [FML]: Adding llibrary-core-1.0.11-1.12.2.jar to the list of known coremods, it will not be examined again
[23:29:13] [main/DEBUG] [FML]: Instantiating coremod class LLibraryPlugin
[23:29:13] [main/TRACE] [FML]: coremod named llibrary is loading
[23:29:13] [main/DEBUG] [FML]: The coremod net.ilexiconn.llibrary.server.core.plugin.LLibraryPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
[23:29:13] [main/DEBUG] [FML]: Found signing certificates for coremod llibrary (net.ilexiconn.llibrary.server.core.plugin.LLibraryPlugin)
[23:29:13] [main/DEBUG] [FML]: Found certificate b9f30a813bee3b9dd5652c460310cfcd54f6b7ec
[23:29:13] [main/DEBUG] [FML]: Enqueued coremod llibrary
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy llibrary-1.7.20-1.12.2.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in llibrary-1.7.20-1.12.2.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy betteranimalsplus-1.12.2-9.0.1.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in betteranimalsplus-1.12.2-9.0.1.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy orbis-lib-1.12.2-0.2.0+build411.jar
[23:29:13] [main/DEBUG] [FML]: Not found coremod data in orbis-lib-1.12.2-0.2.0+build411.jar
[23:29:13] [main/DEBUG] [FML]: Examining for coremod candidacy phosphor-1.12.2-0.2.6+build50.jar
[23:29:13] [main/INFO] [FML]: Loading tweaker org.spongepowered.asm.launch.MixinTweaker from phosphor-1.12.2-0.2.6+build50.jar
[23:29:13] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker
[23:29:13] [main/INFO] [LaunchWrapper]: Loading tweak class name org.spongepowered.asm.launch.MixinTweaker
[23:29:13] [main/DEBUG] [mixin]: Mixin bootstrap service org.spongepowered.asm.service.modlauncher.MixinServiceModLauncherBootstrap is not available: ModLauncher is not available
[23:29:13] [main/DEBUG] [mixin]: MixinService [LaunchWrapper] was successfully booted in sun.misc.Launcher$AppClassLoader@18b4aac2
[23:29:13] [main/INFO] [mixin]: SpongePowered MIXIN Subsystem Version=0.8 Source=file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar Service=LaunchWrapper Env=SERVER
[23:29:13] [main/DEBUG] [mixin]: Error cleaning class output directory: .mixin.out/class: failed to delete one or more files; see suppressed exceptions for details
[23:29:13] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #1
[23:29:13] [main/DEBUG] [mixin]: Initialising Mixin Platform Manager
[23:29:13] [main/DEBUG] [mixin]: Adding mixin platform agents for container ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)
[23:29:13] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentFMLLegacy for ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)
[23:29:13] [main/DEBUG] [mixin]: ForceLoadAsMod was specified for bewitchment-1.12.2-0.0.22.64.jar, attempting force-load
[23:29:13] [main/DEBUG] [mixin]: Adding bewitchment-1.12.2-0.0.22.64.jar to reparseable coremod collection
[23:29:13] [main/DEBUG] [mixin]: bewitchment-1.12.2-0.0.22.64.jar has core plugin com.bewitchment.core.BewitchmentFMLLoadingPlugin. Injecting it into FML for co-initialisation:
[23:29:13] [main/DEBUG] [FML]: Instantiating coremod class BewitchmentFMLLoadingPlugin
[23:29:13] [main/DEBUG] [FML]: The coremod com.bewitchment.core.BewitchmentFMLLoadingPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
[23:29:13] [main/WARN] [FML]: The coremod BewitchmentFMLLoadingPlugin (com.bewitchment.core.BewitchmentFMLLoadingPlugin) is not signed!
[23:29:13] [main/DEBUG] [FML]: Enqueued coremod BewitchmentFMLLoadingPlugin
[23:29:13] [main/DEBUG] [mixin]: MixinPlatformAgentFMLLegacy accepted container ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)
[23:29:13] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentLiteLoaderLegacy for ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)
[23:29:13] [main/DEBUG] [mixin]: MixinPlatformAgentLiteLoaderLegacy rejected container ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)
[23:29:13] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentDefault for ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)
[23:29:13] [main/DEBUG] [mixin]: MixinPlatformAgentDefault accepted container ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)
[23:29:13] [main/DEBUG] [mixin]: Scanning file:/server/forge.jar for mixin tweaker
[23:29:13] [main/DEBUG] [mixin]: Scanning file:/jolokia/jolokia.jar for mixin tweaker
[23:29:13] [main/DEBUG] [mixin]: Scanning file:/server/./mods/astralsorcery-1.12.2-1.10.27.jar for mixin tweaker
[23:29:13] [main/DEBUG] [mixin]: Scanning file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar for mixin tweaker
[23:29:13] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Bloodmoon-MC1.12.2-1.5.3.jar for mixin tweaker
[23:29:13] [main/DEBUG] [mixin]: Scanning file:/server/./mods/CTM-MC1.12.2-1.0.2.31.jar for mixin tweaker
[23:29:13] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Quark-r1.6-179.jar for mixin tweaker
[23:29:13] [main/DEBUG] [mixin]: Scanning file:/server/./mods/RandomThings-MC1.12.2-4.2.7.4.jar for mixin tweaker
[23:29:13] [main/DEBUG] [mixin]: Scanning file:/server/./mods/rats-3.2.14-1.12.2.jar for mixin tweaker
[23:29:13] [main/DEBUG] [mixin]: Scanning file:/server/./mods/memory_repo/net/ilexiconn/llibrary-core/1.0.11-1.12.2/llibrary-core-1.0.11-1.12.2.jar for mixin tweaker
[23:29:13] [main/DEBUG] [mixin]: Scanning file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar for mixin tweaker
[23:29:13] [main/DEBUG] [mixin]: Adding agents for Mixin Container ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)
[23:29:13] [main/DEBUG] [mixin]: Adding agents for Mixin Container ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)
[23:29:13] [main/DEBUG] [mixin]: Adding mixin platform agents for container ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)
[23:29:13] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentFMLLegacy for ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)
[23:29:13] [main/DEBUG] [mixin]: ForceLoadAsMod was specified for phosphor-1.12.2-0.2.6+build50.jar, attempting force-load
[23:29:13] [main/DEBUG] [mixin]: Adding phosphor-1.12.2-0.2.6+build50.jar to reparseable coremod collection
[23:29:13] [main/DEBUG] [mixin]: phosphor-1.12.2-0.2.6+build50.jar has core plugin me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin. Injecting it into FML for co-initialisation:
[23:29:13] [main/DEBUG] [FML]: Instantiating coremod class PhosphorFMLLoadingPlugin
[23:29:13] [main/DEBUG] [FML]: The coremod me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
[23:29:13] [main/DEBUG] [FML]: Found signing certificates for coremod PhosphorFMLLoadingPlugin (me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin)
[23:29:13] [main/DEBUG] [FML]: Found certificate f0387d288626cc2d937daa504e74af570c52a2f1
[23:29:13] [main/DEBUG] [FML]: Enqueued coremod PhosphorFMLLoadingPlugin
[23:29:13] [main/DEBUG] [mixin]: MixinPlatformAgentFMLLegacy accepted container ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)
[23:29:13] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentLiteLoaderLegacy for ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)
[23:29:13] [main/DEBUG] [mixin]: MixinPlatformAgentLiteLoaderLegacy rejected container ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)
[23:29:13] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentDefault for ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)
[23:29:13] [main/DEBUG] [mixin]: MixinPlatformAgentDefault accepted container ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)
[23:29:13] [main/WARN] [LaunchWrapper]: Tweak class name org.spongepowered.asm.launch.MixinTweaker has already been visited -- skipping
[23:29:13] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLDeobfTweaker
[23:29:13] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker
[23:29:13] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker
[23:29:13] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[23:29:13] [main/DEBUG] [FML]: Injecting coremod FMLCorePlugin \{net.minecraftforge.fml.relauncher.FMLCorePlugin\} class transformers
[23:29:13] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.SideTransformer
[23:29:13] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[PREINIT]
[23:29:13] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer
[23:29:13] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer
[23:29:13] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer
[23:29:13] [main/DEBUG] [FML]: Injection complete
[23:29:13] [main/DEBUG] [FML]: Running coremod plugin for FMLCorePlugin \{net.minecraftforge.fml.relauncher.FMLCorePlugin\}
[23:29:13] [main/DEBUG] [FML]: Running coremod plugin FMLCorePlugin
[23:29:15] [main/DEBUG] [FML]: Read 1154 binary patches
[23:29:15] [main/DEBUG] [FML]: Loading deobfuscation resource /deobfuscation_data-1.12.2.lzma with 36076 records
[23:29:15] [main/INFO] [FML]: Found valid fingerprint for Minecraft Forge. Certificate fingerprint e3c3d50c7c986df74c645c0ac54639741c90a557
[23:29:15] [main/DEBUG] [FML]: Coremod plugin class FMLCorePlugin run successfully
[23:29:15] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[23:29:15] [main/DEBUG] [FML]: Injecting coremod FMLForgePlugin \{net.minecraftforge.classloading.FMLForgePlugin\} class transformers
[23:29:15] [main/DEBUG] [FML]: Injection complete
[23:29:15] [main/DEBUG] [FML]: Running coremod plugin for FMLForgePlugin \{net.minecraftforge.classloading.FMLForgePlugin\}
[23:29:15] [main/DEBUG] [FML]: Running coremod plugin FMLForgePlugin
[23:29:15] [main/DEBUG] [FML]: Coremod plugin class FMLForgePlugin run successfully
[23:29:15] [main/INFO] [LaunchWrapper]: Calling tweak class org.spongepowered.asm.launch.MixinTweaker
[23:29:15] [main/DEBUG] [mixin]: Processing prepare() for PlatformAgent[MixinPlatformAgentFMLLegacy:ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)]
[23:29:15] [main/DEBUG] [mixin]: Processing prepare() for PlatformAgent[MixinPlatformAgentDefault:ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)]
[23:29:15] [main/DEBUG] [mixin]: Registering mixin config: mixins.bewitchment.json
[23:29:16] [main/INFO] [mixin]: Compatibility level set to JAVA_8
[23:29:16] [main/DEBUG] [mixin]: Processing prepare() for PlatformAgent[MixinPlatformAgentFMLLegacy:ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)]
[23:29:16] [main/DEBUG] [mixin]: Processing prepare() for PlatformAgent[MixinPlatformAgentDefault:ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)]
[23:29:16] [main/DEBUG] [mixin]: Processing launch tasks for PlatformAgent[MixinPlatformAgentFMLLegacy:ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)]
[23:29:16] [main/DEBUG] [mixin]: Creating FML remapper adapter: org.spongepowered.asm.bridge.RemapperAdapterFML
[23:29:16] [main/DEBUG] [mixin]: Checking for additional mixins for MixinEnvironment[PREINIT]
[23:29:16] [main/INFO] [mixin]: Initialised Mixin FML Remapper Adapter with net.minecraftforge.fml.common.asm.transformers.deobf.FMLDeobfuscatingRemapper@6b410923
[23:29:16] [main/DEBUG] [mixin]: Processing launch tasks for PlatformAgent[MixinPlatformAgentDefault:ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)]
[23:29:16] [main/DEBUG] [mixin]: Scanning file:/server/forge.jar for mixin tweaker
[23:29:16] [main/DEBUG] [mixin]: Scanning file:/jolokia/jolokia.jar for mixin tweaker
[23:29:16] [main/DEBUG] [mixin]: Scanning file:/server/./mods/astralsorcery-1.12.2-1.10.27.jar for mixin tweaker
[23:29:16] [main/DEBUG] [mixin]: Scanning file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar for mixin tweaker
[23:29:16] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Bloodmoon-MC1.12.2-1.5.3.jar for mixin tweaker
[23:29:16] [main/DEBUG] [mixin]: Scanning file:/server/./mods/CTM-MC1.12.2-1.0.2.31.jar for mixin tweaker
[23:29:16] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Quark-r1.6-179.jar for mixin tweaker
[23:29:16] [main/DEBUG] [mixin]: Scanning file:/server/./mods/RandomThings-MC1.12.2-4.2.7.4.jar for mixin tweaker
[23:29:16] [main/DEBUG] [mixin]: Scanning file:/server/./mods/rats-3.2.14-1.12.2.jar for mixin tweaker
[23:29:16] [main/DEBUG] [mixin]: Scanning file:/server/./mods/memory_repo/net/ilexiconn/llibrary-core/1.0.11-1.12.2/llibrary-core-1.0.11-1.12.2.jar for mixin tweaker
[23:29:16] [main/DEBUG] [mixin]: Scanning file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar for mixin tweaker
[23:29:16] [main/DEBUG] [mixin]: Scanning asmgen:/ for mixin tweaker
[23:29:16] [main/DEBUG] [mixin]: Adding agents for Mixin Container ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)
[23:29:16] [main/DEBUG] [mixin]: Adding agents for Mixin Container ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)
[23:29:16] [main/DEBUG] [mixin]: inject() running with 2 agents
[23:29:16] [main/DEBUG] [mixin]: Processing inject() for PlatformAgent[MixinPlatformAgentFMLLegacy:ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)]
[23:29:16] [main/DEBUG] [mixin]: FML agent is co-initiralising coremod instance BewitchmentFMLLoadingPlugin {[]} for ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)
[23:29:16] [main/DEBUG] [FML]: Injecting coremod BewitchmentFMLLoadingPlugin \{com.bewitchment.core.BewitchmentFMLLoadingPlugin\} class transformers
[23:29:16] [main/DEBUG] [FML]: Injection complete
[23:29:16] [main/DEBUG] [FML]: Running coremod plugin for BewitchmentFMLLoadingPlugin \{com.bewitchment.core.BewitchmentFMLLoadingPlugin\}
[23:29:16] [main/DEBUG] [FML]: Running coremod plugin BewitchmentFMLLoadingPlugin
[23:29:16] [main/DEBUG] [Bewitchment Forge Core]: initializing Mixin environment and configurations
[23:29:16] [main/DEBUG] [FML]: Coremod plugin class BewitchmentFMLLoadingPlugin run successfully
[23:29:16] [main/DEBUG] [mixin]: Processing inject() for PlatformAgent[MixinPlatformAgentDefault:ContainerHandleURI(file:/server/./mods/bewitchment-1.12.2-0.0.22.64.jar)]
[23:29:16] [main/DEBUG] [mixin]: Processing inject() for PlatformAgent[MixinPlatformAgentFMLLegacy:ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)]
[23:29:16] [main/DEBUG] [mixin]: FML agent is co-initiralising coremod instance PhosphorFMLLoadingPlugin {[]} for ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)
[23:29:16] [main/DEBUG] [FML]: Injecting coremod PhosphorFMLLoadingPlugin \{me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin\} class transformers
[23:29:16] [main/DEBUG] [FML]: Injection complete
[23:29:16] [main/DEBUG] [FML]: Running coremod plugin for PhosphorFMLLoadingPlugin \{me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin\}
[23:29:16] [main/DEBUG] [FML]: Running coremod plugin PhosphorFMLLoadingPlugin
[23:29:16] [main/DEBUG] [Phosphor Forge Core]: Success! Phosphor has been called into from Forge... initializing Mixin environment and configurations
[23:29:16] [main/DEBUG] [FML]: Coremod plugin class PhosphorFMLLoadingPlugin run successfully
[23:29:16] [main/DEBUG] [mixin]: Processing inject() for PlatformAgent[MixinPlatformAgentDefault:ContainerHandleURI(file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar)]
[23:29:16] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLDeobfTweaker
[23:29:16] [main/DEBUG] [FML]: Loaded 215 rules from AccessTransformer config file forge_at.cfg
[23:29:16] [main/INFO] [Astral Core]: [AstralTransformer] Loading patches...
[23:29:16] [main/INFO] [Astral Core]: [AstralTransformer] Initialized! Loaded 14 class patches!
[23:29:16] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file ./mods/journeymap-1.12.2-5.7.1.jar!META-INF/journeymap_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 8 rules from AccessTransformer mod jar file ./mods/Mantle-1.12-1.3.3.55.jar!META-INF/mantle_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 3 rules from AccessTransformer mod jar file ./mods/ProjectIntelligence-1.12.2-1.0.9.28-universal.jar!META-INF/ProjectIntelligence_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 46 rules from AccessTransformer mod jar file ./mods/CodeChickenLib-1.12.2-3.2.3.358-universal.jar!META-INF/ccl_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 11 rules from AccessTransformer mod jar file ./mods/llibrary-1.7.20-1.12.2.jar!META-INF/llibrary_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 4 rules from AccessTransformer mod jar file ./mods/RandomThings-MC1.12.2-4.2.7.4.jar!META-INF/randomthings_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 8 rules from AccessTransformer mod jar file ./mods/Chisel-MC1.12.2-1.0.2.45.jar!META-INF/chisel_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file ./mods/Decocraft-2.6.3.7_1.12.2.jar!META-INF/decocraft_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 3 rules from AccessTransformer mod jar file ./mods/Bloodmoon-MC1.12.2-1.5.3.jar!META-INF/Bloodmoon_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 18 rules from AccessTransformer mod jar file ./mods/FTBLib-5.4.7.2.jar!META-INF/ftblib_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 4 rules from AccessTransformer mod jar file ./mods/CustomMobSpawner-3.11.5.jar!META-INF/customspawner_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 3 rules from AccessTransformer mod jar file ./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar!META-INF/phosphor_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file ./mods/Quark-r1.6-179.jar!META-INF/quark_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 5 rules from AccessTransformer mod jar file ./mods/CTM-MC1.12.2-1.0.2.31.jar!META-INF/ctm_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 21 rules from AccessTransformer mod jar file ./mods/twilightforest-1.12.2-3.11.1021-universal.jar!META-INF/tf_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 3 rules from AccessTransformer mod jar file ./mods/fossilsarcheology-8.0.5.jar!META-INF/fossil_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 4 rules from AccessTransformer mod jar file ./mods/DrZharks MoCreatures Mod-12.0.5.jar!META-INF/mocreatures_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 24 rules from AccessTransformer mod jar file ./mods/Thaumcraft-1.12.2-6.1.BETA26.jar!META-INF/tc_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 9 rules from AccessTransformer mod jar file ./mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar!META-INF/orbis-lib_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 35 rules from AccessTransformer mod jar file ./mods/Botania r1.10-364.4.jar!META-INF/botania_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 53 rules from AccessTransformer mod jar file ./mods/BrandonsCore-1.12.2-2.4.20.162-universal.jar!META-INF/BrandonsCore_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 29 rules from AccessTransformer mod jar file ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar!META-INF/aether_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 119 rules from AccessTransformer mod jar file ./mods/iChunUtil-1.12.2-7.2.2.jar!META-INF/iChunUtil_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 97 rules from AccessTransformer mod jar file ./mods/extrautils2-1.12-1.9.9.jar!META-INF/extrautils2_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 13 rules from AccessTransformer mod jar file ./mods/BiomesOPlenty-1.12.2-7.0.1.2445-universal.jar!META-INF/biomesoplenty_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 45 rules from AccessTransformer mod jar file ./mods/CoFHCore-1.12.2-4.6.6.1-universal.jar!META-INF/cofh_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 10 rules from AccessTransformer mod jar file ./mods/forestry_1.12.2-5.8.2.422.jar!META-INF/forestry_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 39 rules from AccessTransformer mod jar file ./mods/TConstruct-1.12.2-2.13.0.183.jar!META-INF/tconstruct_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 23 rules from AccessTransformer mod jar file ./mods/astralsorcery-1.12.2-1.10.27.jar!META-INF/astralsorcery_at.cfg
[23:29:16] [main/DEBUG] [FML]: Loaded 5 rules from AccessTransformer mod jar file ./mods/mysticallib-1.12.2-1.13.0.jar!META-INF/mysticallib_at.cfg
[23:29:16] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #2
[23:29:16] [main/DEBUG] [FML]: Validating minecraft
[23:29:16] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[INIT]
[23:29:17] [main/DEBUG] [FML]: Minecraft validated, launching...
[23:29:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[23:29:17] [main/DEBUG] [FML]: Injecting coremod LoadingPlugin \{lumien.bloodmoon.asm.LoadingPlugin\} class transformers
[23:29:17] [main/TRACE] [FML]: Registering transformer lumien.bloodmoon.asm.ClassTransformer
[23:29:17] [main/DEBUG] [FML]: Injection complete
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin for LoadingPlugin \{lumien.bloodmoon.asm.LoadingPlugin\}
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin LoadingPlugin
[23:29:17] [main/DEBUG] [FML]: Coremod plugin class LoadingPlugin run successfully
[23:29:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[23:29:17] [main/DEBUG] [FML]: Injecting coremod Quark Plugin \{vazkii.quark.base.asm.LoadingPlugin\} class transformers
[23:29:17] [main/TRACE] [FML]: Registering transformer vazkii.quark.base.asm.ClassTransformer
[23:29:17] [main/DEBUG] [FML]: Injection complete
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin for Quark Plugin \{vazkii.quark.base.asm.LoadingPlugin\}
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin Quark Plugin
[23:29:17] [main/DEBUG] [FML]: Coremod plugin class LoadingPlugin run successfully
[23:29:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[23:29:17] [main/DEBUG] [FML]: Injecting coremod LoadingPlugin \{lumien.randomthings.asm.LoadingPlugin\} class transformers
[23:29:17] [main/TRACE] [FML]: Registering transformer lumien.randomthings.asm.ClassTransformer
[23:29:17] [main/DEBUG] [RandomThingsCore]: Starting Class Transformation
[23:29:17] [main/DEBUG] [FML]: Injection complete
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin for LoadingPlugin \{lumien.randomthings.asm.LoadingPlugin\}
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin LoadingPlugin
[23:29:17] [main/DEBUG] [FML]: Coremod plugin class LoadingPlugin run successfully
[23:29:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[23:29:17] [main/DEBUG] [FML]: Injecting coremod llibrary \{net.ilexiconn.llibrary.server.core.plugin.LLibraryPlugin\} class transformers
[23:29:17] [main/TRACE] [FML]: Registering transformer net.ilexiconn.llibrary.server.core.plugin.LLibraryTransformer
[23:29:17] [main/TRACE] [FML]: Registering transformer net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher
[23:29:17] [main/DEBUG] [LLibrary Core]: Found runtime patcher net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher
[23:29:17] [main/DEBUG] [FML]: Injection complete
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin for llibrary \{net.ilexiconn.llibrary.server.core.plugin.LLibraryPlugin\}
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin llibrary
[23:29:17] [main/DEBUG] [FML]: Coremod plugin class LLibraryPlugin run successfully
[23:29:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[23:29:17] [main/DEBUG] [FML]: Injecting coremod ratscore \{com.github.alexthe666.rats.server.asm.RatsPlugin\} class transformers
[23:29:17] [main/DEBUG] [LLibrary Core]: Found runtime patcher com.github.alexthe666.rats.server.misc.RatsRuntimePatcher
[23:29:17] [main/DEBUG] [LLibrary Core]: Found no method mapping for java/lang/String/format(Ljava/lang/String;[Ljava/lang/Object;)Ljava/lang/String;
[23:29:17] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/minecraft/client/model/ModelBiped/<init>(FZ)V
[23:29:17] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/minecraft/client/renderer/entity/RenderPlayer/<init>(Lnet/minecraft/client/renderer/entity/RenderManager;Z)V
[23:29:17] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/minecraftforge/client/ForgeHooksClient/handleCameraTransforms(Lnet/minecraft/client/renderer/block/model/IBakedModel;Lnet/minecraft/client/renderer/block/model/ItemCameraTransforms$TransformType;Z)Lnet/minecraft/client/renderer/block/model/IBakedModel;
[23:29:17] [main/TRACE] [FML]: Registering transformer com.github.alexthe666.rats.server.misc.RatsRuntimePatcher
[23:29:17] [main/DEBUG] [FML]: Injection complete
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin for ratscore \{com.github.alexthe666.rats.server.asm.RatsPlugin\}
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin ratscore
[23:29:17] [main/DEBUG] [FML]: Coremod plugin class RatsPlugin run successfully
[23:29:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[23:29:17] [main/DEBUG] [FML]: Injecting coremod AstralCore \{hellfirepvp.astralsorcery.core.AstralCore\} class transformers
[23:29:17] [main/DEBUG] [FML]: Injection complete
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin for AstralCore \{hellfirepvp.astralsorcery.core.AstralCore\}
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin AstralCore
[23:29:17] [main/DEBUG] [FML]: Coremod plugin class AstralCore run successfully
[23:29:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[23:29:17] [main/DEBUG] [FML]: Injecting coremod CTMCorePlugin \{team.chisel.ctm.client.asm.CTMCorePlugin\} class transformers
[23:29:17] [main/TRACE] [FML]: Registering transformer team.chisel.ctm.client.asm.CTMTransformer
[23:29:17] [main/DEBUG] [FML]: Injection complete
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin for CTMCorePlugin \{team.chisel.ctm.client.asm.CTMCorePlugin\}
[23:29:17] [main/DEBUG] [FML]: Running coremod plugin CTMCorePlugin
[23:29:17] [main/DEBUG] [FML]: Coremod plugin class CTMCorePlugin run successfully
[23:29:17] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.TerminalTweaker
[23:29:17] [main/INFO] [LaunchWrapper]: Loading tweak class name org.spongepowered.asm.mixin.EnvironmentStateTweaker
[23:29:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.TerminalTweaker
[23:29:17] [main/INFO] [LaunchWrapper]: Calling tweak class org.spongepowered.asm.mixin.EnvironmentStateTweaker
[23:29:17] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #3
[23:29:17] [main/DEBUG] [LLibrary Core]: Patching class net/minecraft/server/MinecraftServer
[23:29:17] [main/DEBUG] [LLibrary Core]: Patching method run()V
[23:29:17] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getTickRate()J
[23:29:17] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getTickRate()J
[23:29:17] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getTickRate()J
[23:29:17] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getTickRate()J
[23:29:17] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[DEFAULT]
[23:29:17] [main/DEBUG] [mixin]: Selecting config mixins.bewitchment.json
[23:29:17] [main/DEBUG] [mixin]: Selecting config mixins.phosphor.json
[23:29:17] [main/DEBUG] [Phosphor Plugin]: Loading configuration
[23:29:17] [main/DEBUG] [mixin]: Preparing mixins.bewitchment.json (2)
[23:29:17] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
[23:29:17] [main/DEBUG] [mixin]: Rebuilding transformer delegation list:
[23:29:17] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PatchingTransformer
[23:29:17] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
[23:29:17] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SideTransformer
[23:29:17] [main/DEBUG] [mixin]: Excluding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.AccessTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: hellfirepvp.astralsorcery.core.AstralTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ModAccessTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemStackTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockSpecialTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PotionEffectTransformer
[23:29:17] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
[23:29:17] [main/DEBUG] [mixin]: Adding: $wrapper.lumien.bloodmoon.asm.ClassTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: $wrapper.vazkii.quark.base.asm.ClassTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: $wrapper.lumien.randomthings.asm.ClassTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: $wrapper.net.ilexiconn.llibrary.server.core.plugin.LLibraryTransformer
[23:29:17] [main/DEBUG] [mixin]: Adding: $wrapper.net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher
[23:29:17] [main/DEBUG] [mixin]: Adding: $wrapper.com.github.alexthe666.rats.server.misc.RatsRuntimePatcher
[23:29:17] [main/DEBUG] [mixin]: Adding: $wrapper.team.chisel.ctm.client.asm.CTMTransformer
[23:29:17] [main/DEBUG] [mixin]: Excluding: net.minecraftforge.fml.common.asm.transformers.TerminalTransformer
[23:29:17] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
[23:29:17] [main/DEBUG] [mixin]: Transformer delegation list created with 19 entries
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/entity/projectile/EntityPotion to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/entity/projectile/EntityArrow to metadata cache
[23:29:18] [main/DEBUG] [mixin]: Preparing mixins.phosphor.json (9)
[23:29:18] [main/DEBUG] [Phosphor Plugin]: Disabled patch 'me.jellysquid.mods.phosphor.mixins.lighting.client.MixinMinecraft' because it targets an client-side class unavailable in the current environment
[23:29:18] [main/DEBUG] [Phosphor Plugin]: Disabled patch 'me.jellysquid.mods.phosphor.mixins.lighting.common.MixinChunk$Sponge' because we are in a standard Vanilla/Forge environment
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/storage/AnvilChunkLoader to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/Chunk to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/gen/ChunkProviderServer to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/storage/ExtendedBlockStorage to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/network/play/server/SPacketChunkData to metadata cache
[23:29:18] [main/INFO] [Astral Core]: [AstralTransformer] Transforming amu : net.minecraft.world.World with 2 patches!
[23:29:18] [main/INFO] [Astral Core]: [AstralTransformer] Skipping PATCHSUNBRIGHTNESSWORLDCLIENT as it can't be applied for side SERVER
[23:29:18] [main/INFO] [Astral Core]: [AstralTransformer] Applied patch PATCHSUNBRIGHTNESSWORLDCOMMON
[23:29:18] [main/DEBUG] [Bloodmoon]: Found World Class: net/minecraft/world/World
[23:29:18] [main/INFO] [mixin]: A re-entrant transformer '$wrapper.lumien.bloodmoon.asm.ClassTransformer' was detected and will no longer process meta class data
[23:29:18] [main/DEBUG] [RandomThingsCore]: Found World Class: net/minecraft/world/World
[23:29:18] [main/DEBUG] [RandomThingsCore]: - Found getRedstonePower (1/5)
[23:29:18] [main/DEBUG] [RandomThingsCore]: - Found getStrongPower (2/5)
[23:29:18] [main/DEBUG] [RandomThingsCore]: - Found isRainingAt (3/5)
[23:29:18] [main/DEBUG] [RandomThingsCore]: - Found canSnowAt (4/5)
[23:29:18] [main/INFO] [mixin]: A re-entrant transformer '$wrapper.lumien.randomthings.asm.ClassTransformer' was detected and will no longer process meta class data
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/World to metadata cache
[23:29:18] [main/DEBUG] [mixin]: Registering new injector for @Inject with org.spongepowered.asm.mixin.injection.struct.CallbackInjectionInfo
[23:29:18] [main/DEBUG] [mixin]: Registering new injector for @ModifyArg with org.spongepowered.asm.mixin.injection.struct.ModifyArgInjectionInfo
[23:29:18] [main/DEBUG] [mixin]: Registering new injector for @ModifyArgs with org.spongepowered.asm.mixin.injection.struct.ModifyArgsInjectionInfo
[23:29:18] [main/DEBUG] [mixin]: Registering new injector for @Redirect with org.spongepowered.asm.mixin.injection.struct.RedirectInjectionInfo
[23:29:18] [main/DEBUG] [mixin]: Registering new injector for @ModifyVariable with org.spongepowered.asm.mixin.injection.struct.ModifyVariableInjectionInfo
[23:29:18] [main/DEBUG] [mixin]: Registering new injector for @ModifyConstant with org.spongepowered.asm.mixin.injection.struct.ModifyConstantInjectionInfo
[23:29:18] [main/DEBUG] [mixin]: Rebuilding transformer delegation list:
[23:29:18] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PatchingTransformer
[23:29:18] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
[23:29:18] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SideTransformer
[23:29:18] [main/DEBUG] [mixin]: Excluding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.AccessTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: hellfirepvp.astralsorcery.core.AstralTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ModAccessTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemStackTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockSpecialTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PotionEffectTransformer
[23:29:18] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
[23:29:18] [main/DEBUG] [mixin]: Excluding: $wrapper.lumien.bloodmoon.asm.ClassTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: $wrapper.vazkii.quark.base.asm.ClassTransformer
[23:29:18] [main/DEBUG] [mixin]: Excluding: $wrapper.lumien.randomthings.asm.ClassTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: $wrapper.net.ilexiconn.llibrary.server.core.plugin.LLibraryTransformer
[23:29:18] [main/DEBUG] [mixin]: Adding: $wrapper.net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher
[23:29:18] [main/DEBUG] [mixin]: Adding: $wrapper.com.github.alexthe666.rats.server.misc.RatsRuntimePatcher
[23:29:18] [main/DEBUG] [mixin]: Adding: $wrapper.team.chisel.ctm.client.asm.CTMTransformer
[23:29:18] [main/DEBUG] [mixin]: Excluding: net.minecraftforge.fml.common.asm.transformers.TerminalTransformer
[23:29:18] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
[23:29:18] [main/DEBUG] [mixin]: Transformer delegation list created with 17 entries
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/math/RayTraceResult$Type to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/Chunk$EnumCreateEntityType to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/EnumFacing$Plane to metadata cache
[23:29:18] [main/DEBUG] [mixin]: Prepared 9 mixins in 0.730 sec (81.1ms avg) (11ms load, 415ms transform, 0ms plugin)
[23:29:18] [main/INFO] [Astral Core]: [AstralTransformer] Transforming amu : net.minecraft.world.World with 2 patches!
[23:29:18] [main/INFO] [Astral Core]: [AstralTransformer] Skipping PATCHSUNBRIGHTNESSWORLDCLIENT as it can't be applied for side SERVER
[23:29:18] [main/INFO] [Astral Core]: [AstralTransformer] Applied patch PATCHSUNBRIGHTNESSWORLDCOMMON
[23:29:18] [main/DEBUG] [Bloodmoon]: Found World Class: net/minecraft/world/World
[23:29:18] [main/DEBUG] [RandomThingsCore]: Found World Class: net/minecraft/world/World
[23:29:18] [main/DEBUG] [RandomThingsCore]: - Found getRedstonePower (1/5)
[23:29:18] [main/DEBUG] [RandomThingsCore]: - Found getStrongPower (2/5)
[23:29:18] [main/DEBUG] [RandomThingsCore]: - Found isRainingAt (3/5)
[23:29:18] [main/DEBUG] [RandomThingsCore]: - Found canSnowAt (4/5)
[23:29:18] [main/DEBUG] [mixin]: Mixing common.MixinWorld from mixins.phosphor.json into net.minecraft.world.World
[23:29:18] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/ILightingEngineProvider to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/mod/world/lighting/LightingEngine to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/ILightingEngine to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for java/lang/Boolean to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for java/io/Serializable to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for java/lang/Comparable to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for org/spongepowered/asm/mixin/injection/callback/CallbackInfoReturnable to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraftforge/common/capabilities/ICapabilityProvider to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/IBlockAccess to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for org/spongepowered/asm/mixin/injection/callback/CallbackInfo to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/EnumSkyBlock to metadata cache
[23:29:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/math/BlockPos to metadata cache
[23:29:18] [main/INFO] [Quark ASM]: Transforming net.minecraft.world.WorldServer
[23:29:18] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [areAllPlayersAsleep, func_73056_e] Descriptor ()Z)
[23:29:18] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:18] [main/INFO] [Quark ASM]: Patch result: true
[23:29:18] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [wakeAllPlayers, func_73053_d] Descriptor ()V)
[23:29:18] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:18] [main/INFO] [Quark ASM]: Patch result: true
[23:29:19] [main/INFO] [Astral Core]: [AstralTransformer] Transforming vp : net.minecraft.entity.EntityLivingBase with 4 patches!
[23:29:19] [main/INFO] [Astral Core]: [AstralTransformer] Applied patch PATCHAPPLYPOTIONEFFECTEVENT
[23:29:19] [main/INFO] [Astral Core]: [AstralTransformer] Applied patch PATCHENTITYLIVINGBASEWATERSLOWDOWN
[23:29:19] [main/INFO] [Astral Core]: [AstralTransformer] Applied patch PATCHSETPLAYERATTRIBUTE
[23:29:19] [main/INFO] [Astral Core]: [AstralTransformer] Applied patch PATCHUPDATEELYTRA
[23:29:19] [main/DEBUG] [RandomThingsCore]: Found EntityLivingBase Class: net/minecraft/entity/EntityLivingBase
[23:29:19] [main/DEBUG] [RandomThingsCore]: - Found updatePotionEffects (1/2)
[23:29:19] [main/DEBUG] [RandomThingsCore]: - Found travel (2/2)
[23:29:19] [main/INFO] [Quark ASM]: Transforming net.minecraft.entity.Entity
[23:29:19] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [move, func_70091_d] Descriptor (Lnet/minecraft/entity/MoverType;DDD)V)
[23:29:19] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:19] [main/INFO] [Quark ASM]: Patch result: true
[23:29:19] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:19] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/entity/Entity.func_145775_I ()V
[23:29:19] [main/INFO] [Quark ASM]: Patch result: true
[23:29:19] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [onEntityUpdate, func_70030_z] Descriptor ()V)
[23:29:19] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:19] [main/INFO] [Quark ASM]: Patch result: true
[23:29:19] [main/INFO] [LaunchWrapper]: Launching wrapped minecraft {net.minecraft.server.MinecraftServer}
[23:29:19] [main/DEBUG] [RandomThingsCore]: Found Block Class: net/minecraft/block/Block
[23:29:19] [main/DEBUG] [RandomThingsCore]: - Found getLightValue (1/2)
[23:29:19] [main/DEBUG] [RandomThingsCore]: - Found addCollisionBoxesToList (2/2)
[23:29:19] [main/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:preTransform:230]: Transforming Class [net.minecraft.block.Block], Method [getExtendedState]
[23:29:19] [main/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:finishTransform:242]: Transforming net.minecraft.block.Block Finished.
[23:29:19] [main/INFO] [Quark ASM]: Transforming net.minecraft.enchantment.Enchantment
[23:29:19] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [canApply, func_92089_a] Descriptor (Lnet/minecraft/item/ItemStack;)Z)
[23:29:19] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:19] [main/INFO] [Quark ASM]: Located patch target node IRETURN
[23:29:19] [main/INFO] [Quark ASM]: Patch result: true
[23:29:19] [main/INFO] [Quark ASM]: Transforming net.minecraft.entity.item.EntityItem
[23:29:19] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [onUpdate, func_70071_h_] Descriptor ()V)
[23:29:19] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:19] [main/INFO] [Quark ASM]: Patch result: true
[23:29:20] [main/INFO] [Astral Core]: [AstralTransformer] Transforming aip : net.minecraft.item.ItemStack with 2 patches!
[23:29:20] [main/INFO] [Astral Core]: [AstralTransformer] Skipping PATCHMODIFYENCHANTMENTLEVELSTOOLTIP as it can't be applied for side SERVER
[23:29:20] [main/INFO] [Astral Core]: [AstralTransformer] Skipping PATCHMODIFYENCHANTMENTLEVELSTOOLTIPEVENT as it can't be applied for side SERVER
[23:29:20] [main/INFO] [Quark ASM]: Transforming net.minecraft.item.ItemStack
[23:29:20] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [getTextComponent, func_151000_E] Descriptor ()Lnet/minecraft/util/text/ITextComponent;)
[23:29:20] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:20] [main/INFO] [Quark ASM]: Located patch target node ARETURN
[23:29:20] [main/INFO] [Quark ASM]: Patch result: true
[23:29:20] [main/DEBUG] [RandomThingsCore]: Found WorldGenAbstractTree Class: net/minecraft/world/gen/feature/WorldGenAbstractTree
[23:29:20] [main/DEBUG] [RandomThingsCore]: - Patching setDirtAt
[23:29:20] [main/DEBUG] [RandomThingsCore]: - Patched setDirtAt
[23:29:20] [main/INFO] [Quark ASM]: Transforming net.minecraft.block.BlockDynamicLiquid
[23:29:20] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [isBlocked, func_176372_g] Descriptor (Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/block/state/IBlockState;)Z)
[23:29:20] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:20] [main/INFO] [Quark ASM]: Located patch target node IRETURN
[23:29:20] [main/INFO] [Quark ASM]: Located patch target node IRETURN
[23:29:20] [main/INFO] [Quark ASM]: Patch result: true
[23:29:20] [main/DEBUG] [RandomThingsCore]: Found BlockFalling Class: net/minecraft/block/BlockFalling
[23:29:20] [main/DEBUG] [RandomThingsCore]: - Found canFallThrough
[23:29:20] [main/INFO] [Quark ASM]: Transforming net.minecraft.block.BlockPistonBase
[23:29:20] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [canPush, func_185646_a] Descriptor (Lnet/minecraft/block/state/IBlockState;Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/util/EnumFacing;ZLnet/minecraft/util/EnumFacing;)Z)
[23:29:20] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:20] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/block/Block.hasTileEntity (Lnet/minecraft/block/state/IBlockState;)Z
[23:29:20] [main/INFO] [Quark ASM]: Patch result: true
[23:29:20] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [doMove, func_176319_a] Descriptor (Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/util/EnumFacing;Z)Z)
[23:29:20] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:20] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/block/state/BlockPistonStructureHelper.func_177254_c ()Ljava/util/List;
[23:29:20] [main/INFO] [Quark ASM]: Patch result: true
[23:29:20] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [doMove, func_176319_a] Descriptor (Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/util/EnumFacing;Z)Z)
[23:29:20] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:20] [main/INFO] [Quark ASM]: Located patch target node INVOKESPECIAL net/minecraft/block/state/BlockPistonStructureHelper.<init> (Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/util/EnumFacing;Z)V
[23:29:20] [main/INFO] [Quark ASM]: Patch result: true
[23:29:20] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [checkForMove, func_176316_e] Descriptor (Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/block/state/IBlockState;)V)
[23:29:20] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:20] [main/INFO] [Quark ASM]: Located patch target node INVOKESPECIAL net/minecraft/block/state/BlockPistonStructureHelper.<init> (Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/util/EnumFacing;Z)V
[23:29:20] [main/INFO] [Quark ASM]: Patch result: true
[23:29:20] [main/INFO] [Quark ASM]: Transforming net.minecraft.tileentity.TileEntityPiston
[23:29:20] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [update, func_73660_a] Descriptor ()V)
[23:29:20] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:20] [main/INFO] [Quark ASM]: Patch result: true
[23:29:20] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [clearPistonTileEntity, func_145866_f] Descriptor ()V)
[23:29:20] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:20] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/world/World.func_180501_a (Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/block/state/IBlockState;I)Z
[23:29:20] [main/INFO] [Quark ASM]: Patch result: true
[23:29:20] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [update, func_73660_a] Descriptor ()V)
[23:29:20] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:20] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/world/World.func_180501_a (Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/block/state/IBlockState;I)Z
[23:29:20] [main/INFO] [Quark ASM]: Patch result: true
[23:29:22] [main/INFO] [Quark ASM]: Transforming net.minecraft.enchantment.EnchantmentDamage
[23:29:22] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [canApply, func_92089_a] Descriptor (Lnet/minecraft/item/ItemStack;)Z)
[23:29:22] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:22] [main/INFO] [Quark ASM]: Located patch target node IRETURN
[23:29:22] [main/INFO] [Quark ASM]: Located patch target node IRETURN
[23:29:22] [main/INFO] [Quark ASM]: Patch result: true
[23:29:22] [main/DEBUG] [mixin]: Mixing MixinEntityTippedArrow from mixins.bewitchment.json into net.minecraft.entity.projectile.EntityArrow
[23:29:22] [main/INFO] [Quark ASM]: Transforming net.minecraft.entity.Entity
[23:29:22] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [move, func_70091_d] Descriptor (Lnet/minecraft/entity/MoverType;DDD)V)
[23:29:22] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:22] [main/INFO] [Quark ASM]: Patch result: true
[23:29:22] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:22] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/entity/Entity.func_145775_I ()V
[23:29:22] [main/INFO] [Quark ASM]: Patch result: true
[23:29:22] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [onEntityUpdate, func_70030_z] Descriptor ()V)
[23:29:22] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:22] [main/INFO] [Quark ASM]: Patch result: true
[23:29:22] [main/TRACE] [mixin]: Added class metadata for net/minecraft/entity/Entity to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for net/minecraftforge/fml/common/ObfuscationReflectionHelper to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for net/minecraft/entity/projectile/EntityTippedArrow to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/math/RayTraceResult to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for java/util/Set to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for java/util/Iterator to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for net/minecraft/potion/PotionEffect to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for com/bewitchment/common/potion/util/ModPotion to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for net/minecraft/command/ICommandSender to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for net/minecraftforge/common/capabilities/ICapabilitySerializable to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for net/minecraftforge/common/util/INBTSerializable to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for net/minecraft/entity/IProjectile to metadata cache
[23:29:22] [main/INFO] [Quark ASM]: Transforming net.minecraft.entity.item.EntityMinecart
[23:29:22] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [killMinecart, func_94095_a] Descriptor (Lnet/minecraft/util/DamageSource;)V)
[23:29:22] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:22] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/entity/item/EntityMinecart.func_70099_a (Lnet/minecraft/item/ItemStack;F)Lnet/minecraft/entity/item/EntityItem;
[23:29:22] [main/INFO] [Quark ASM]: Patch result: true
[23:29:22] [main/INFO] [Quark ASM]: Transforming net.minecraft.entity.item.EntityBoat
[23:29:22] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [attackEntityFrom, func_70097_a] Descriptor (Lnet/minecraft/util/DamageSource;F)Z)
[23:29:22] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:22] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/entity/item/EntityBoat.func_145778_a (Lnet/minecraft/item/Item;IF)Lnet/minecraft/entity/item/EntityItem;
[23:29:22] [main/INFO] [Quark ASM]: Patch result: true
[23:29:22] [main/INFO] [Quark ASM]: Transforming net.minecraft.item.ItemBanner
[23:29:22] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [appendHoverTextFromTileEntityTag, func_185054_a] Descriptor (Lnet/minecraft/item/ItemStack;Ljava/util/List;)V)
[23:29:22] [main/INFO] [Quark ASM]: Failed to locate the method!
[23:29:22] [main/DEBUG] [mixin]: Mixing MixinEntityPotion from mixins.bewitchment.json into net.minecraft.entity.projectile.EntityPotion
[23:29:22] [main/TRACE] [mixin]: Added class metadata for net/minecraft/entity/projectile/EntityThrowable to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for net/minecraft/potion/PotionUtils to metadata cache
[23:29:22] [main/TRACE] [mixin]: Added class metadata for java/util/List to metadata cache
[23:29:22] [main/INFO] [Astral Core]: [AstralTransformer] Transforming wg : net.minecraft.entity.ai.attributes.AbstractAttributeMap with 1 patches!
[23:29:22] [main/INFO] [Astral Core]: [AstralTransformer] Applied patch PATCHADDPLAYERATTRIBUTE
[23:29:22] [main/INFO] [Quark ASM]: Transforming net.minecraft.entity.ai.EntityAITarget
[23:29:22] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [isSuitableTarget, func_179445_a] Descriptor (Lnet/minecraft/entity/EntityLiving;Lnet/minecraft/entity/EntityLivingBase;ZZ)Z)
[23:29:22] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:22] [main/INFO] [Quark ASM]: Patch result: true
[23:29:23] [main/DEBUG] [RandomThingsCore]: Found EntitySlime Class: net/minecraft/entity/monster/EntitySlime
[23:29:23] [main/DEBUG] [RandomThingsCore]: - Found getCanSpawnHere
[23:29:23] [main/DEBUG] [RandomThingsCore]: - Found Insertion Point
[23:29:23] [main/INFO] [Quark ASM]: Transforming net.minecraft.item.crafting.RecipesBanners$RecipeAddPattern
[23:29:23] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [matches, func_77569_a] Descriptor (Lnet/minecraft/inventory/InventoryCrafting;Lnet/minecraft/world/World;)Z)
[23:29:23] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:23] [main/INFO] [Quark ASM]: Located patch target node INVOKESTATIC net/minecraft/tileentity/TileEntityBanner.func_175113_c (Lnet/minecraft/item/ItemStack;)I
[23:29:23] [main/INFO] [Quark ASM]: Patch result: true
[23:29:23] [main/DEBUG] [FML]: Creating vanilla freeze snapshot
[23:29:23] [main/DEBUG] [FML]: Vanilla freeze snapshot created
[23:29:24] [main/INFO] [Quark ASM]: Transforming net.minecraft.inventory.ContainerMerchant
[23:29:24] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [transferStackInSlot, func_82846_b] Descriptor (Lnet/minecraft/entity/player/EntityPlayer;I)Lnet/minecraft/item/ItemStack;)
[23:29:24] [main/INFO] [Quark ASM]: Located Method, patching...
[23:29:24] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerMerchant.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[23:29:24] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerMerchant.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[23:29:24] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerMerchant.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[23:29:24] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerMerchant.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[23:29:24] [main/INFO] [Quark ASM]: Patch result: true
[23:29:24] [main/DEBUG] [mixin]: Mixing common.MixinAnvilChunkLoader from mixins.phosphor.json into net.minecraft.world.chunk.storage.AnvilChunkLoader
[23:29:24] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/mod/world/lighting/LightingHooks to metadata cache
[23:29:24] [main/TRACE] [mixin]: Added class metadata for net/minecraft/nbt/NBTTagCompound to metadata cache
[23:29:24] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/IChunkLightingData to metadata cache
[23:29:24] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/storage/IChunkLoader to metadata cache
[23:29:24] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/storage/IThreadedFileIO to metadata cache
[23:29:24] [main/TRACE] [mixin]: Added class metadata for java/lang/Exception to metadata cache
[23:29:24] [main/TRACE] [mixin]: Added class metadata for java/lang/Throwable to metadata cache
[23:29:24] [main/TRACE] [mixin]: Added class metadata for net/minecraft/nbt/NBTBase to metadata cache
[23:29:24] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Starting minecraft server version 1.12.2
[23:29:24] [Server thread/INFO] [FML]: MinecraftForge v14.23.5.2860 Initialized
[23:29:24] [Server thread/INFO] [FML]: Starts to replace vanilla recipe ingredients with ore ingredients.
[23:29:24] [Server thread/INFO] [FML]: Invalid recipe found with multiple oredict ingredients in the same ingredient...
[23:29:25] [Server thread/INFO] [FML]: Replaced 1227 ore ingredients
[23:29:25] [Server thread/DEBUG] [FML]: File /server/config/injectedDependencies.json not found. No dependencies injected
[23:29:25] [Server thread/DEBUG] [FML]: Building injected Mod Containers [net.minecraftforge.fml.common.FMLContainer, net.minecraftforge.common.ForgeModContainer]
[23:29:25] [Server thread/DEBUG] [FML]: Attempting to load mods contained in the minecraft jar file and associated classes
[23:29:25] [Server thread/DEBUG] [FML]: Found a minecraft related file at /server/forge.jar, examining for mod candidates
[23:29:25] [Server thread/DEBUG] [FML]: Found a minecraft related file at /jolokia/jolokia.jar, examining for mod candidates
[23:29:25] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/astralsorcery-1.12.2-1.10.27.jar
[23:29:25] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/bewitchment-1.12.2-0.0.22.64.jar
[23:29:25] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/Bloodmoon-MC1.12.2-1.5.3.jar
[23:29:25] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/CTM-MC1.12.2-1.0.2.31.jar
[23:29:25] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/Quark-r1.6-179.jar
[23:29:25] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/RandomThings-MC1.12.2-4.2.7.4.jar
[23:29:25] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/rats-3.2.14-1.12.2.jar
[23:29:25] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/memory_repo/net/ilexiconn/llibrary-core/1.0.11-1.12.2/llibrary-core-1.0.11-1.12.2.jar
[23:29:25] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
[23:29:25] [Server thread/DEBUG] [FML]: Minecraft jar mods loaded successfully
[23:29:25] [Server thread/INFO] [FML]: Searching /server/./mods for mods
[23:29:25] [Server thread/DEBUG] [FML]: Adding iChunUtil-1.12.2-7.2.2.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding bewitchment-1.12.2-0.0.22.64.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Bloodmoon-MC1.12.2-1.5.3.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Morph-1.12.2-7.2.1.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Pam's HarvestCraft 1.12.2zg.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding FTBQuests-1202.9.0.15.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding lootbagmod-1.12.2-1.5.2-FINAL.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Decocraft-2.6.3.7_1.12.2.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding FTBMoney-1.2.0.47.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Guide-API-1.12-2.1.8-63.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding CoFHCore-1.12.2-4.6.6.1-universal.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding DrZharks MoCreatures Mod-12.0.5.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding astralsorcery-1.12.2-1.10.27.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding BiblioCraft[v2.4.6][MC1.12.2].jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding RandomThings-MC1.12.2-4.2.7.4.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding ProjectIntelligence-1.12.2-1.0.9.28-universal.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding ItemFilters-1.0.4.2.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding llibrary-1.7.20-1.12.2.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Patchouli-1.0-23.6.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Hats-1.12.2-7.1.1.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Chisel-MC1.12.2-1.0.2.45.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding CustomMobSpawner-3.11.5.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding AutoRegLib-1.3-32.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Quark-r1.6-179.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding mysticalworld-1.12.2-1.11.0.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Roots-1.12.2-3.1.5.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding CoFHWorld-1.12.2-1.4.0.1-universal.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding CraftStudioAPI-universal-1.0.1.95-mc1.12-alpha.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding CTM-MC1.12.2-1.0.2.31.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding twilightforest-1.12.2-3.11.1021-universal.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Baubles-1.12-1.5.2.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding journeymap-1.12.2-5.7.1.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding mysticallib-1.12.2-1.13.0.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding RedstoneFlux-1.12-2.1.1.1-universal.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding FTBLib-5.4.7.2.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding GrimoireOfGaia3-1.12.2-1.7.2.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Thaumcraft-1.12.2-6.1.BETA26.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding betteranimalsplus-1.12.2-9.0.1.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding fossilsarcheology-8.0.5.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding ThermalFoundation-1.12.2-2.6.7.1-universal.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding CodeChickenLib-1.12.2-3.2.3.358-universal.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Mantle-1.12-1.3.3.55.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding natura-1.12.2-4.3.2.69.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding forestry_1.12.2-5.8.2.422.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Botania r1.10-364.4.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding TConstruct-1.12.2-2.13.0.183.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding extrautils2-1.12-1.9.9.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding ironchest-1.12.2-7.0.67.844.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding BloodMagic-1.12.2-2.4.3-105.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding BrandonsCore-1.12.2-2.4.20.162-universal.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding rats-3.2.14-1.12.2.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding Tabula-1.12.2-7.1.0.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding aether_ii-1.12.2-0.3.0+build411-universal.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding PTRLib-1.0.5.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Adding BiomesOPlenty-1.12.2-7.0.1.2445-universal.jar to the mod list
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file aether_ii-1.12.2-0.3.0+build411-universal.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file astralsorcery-1.12.2-1.10.27.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file AutoRegLib-1.3-32.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Baubles-1.12-1.5.2.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file bewitchment-1.12.2-0.0.22.64.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file BiblioCraft[v2.4.6][MC1.12.2].jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file BiomesOPlenty-1.12.2-7.0.1.2445-universal.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file BloodMagic-1.12.2-2.4.3-105.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Bloodmoon-MC1.12.2-1.5.3.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Botania r1.10-364.4.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file BrandonsCore-1.12.2-2.4.20.162-universal.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Chisel-MC1.12.2-1.0.2.45.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CodeChickenLib-1.12.2-3.2.3.358-universal.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CoFHCore-1.12.2-4.6.6.1-universal.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CoFHWorld-1.12.2-1.4.0.1-universal.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CraftStudioAPI-universal-1.0.1.95-mc1.12-alpha.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CTM-MC1.12.2-1.0.2.31.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CustomMobSpawner-3.11.5.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Decocraft-2.6.3.7_1.12.2.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file DrZharks MoCreatures Mod-12.0.5.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file extrautils2-1.12-1.9.9.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file forestry_1.12.2-5.8.2.422.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file fossilsarcheology-8.0.5.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file FTBLib-5.4.7.2.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file FTBMoney-1.2.0.47.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file FTBQuests-1202.9.0.15.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file GrimoireOfGaia3-1.12.2-1.7.2.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Guide-API-1.12-2.1.8-63.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Hats-1.12.2-7.1.1.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file iChunUtil-1.12.2-7.2.2.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file ironchest-1.12.2-7.0.67.844.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file ItemFilters-1.0.4.2.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file journeymap-1.12.2-5.7.1.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file lootbagmod-1.12.2-1.5.2-FINAL.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Mantle-1.12-1.3.3.55.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Morph-1.12.2-7.2.1.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file mysticallib-1.12.2-1.13.0.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file mysticalworld-1.12.2-1.11.0.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file natura-1.12.2-4.3.2.69.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Pam's HarvestCraft 1.12.2zg.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Patchouli-1.0-23.6.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file ProjectIntelligence-1.12.2-1.0.9.28-universal.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file PTRLib-1.0.5.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Quark-r1.6-179.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file RandomThings-MC1.12.2-4.2.7.4.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file rats-3.2.14-1.12.2.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file RedstoneFlux-1.12-2.1.1.1-universal.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Roots-1.12.2-3.1.5.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Tabula-1.12.2-7.1.0.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file TConstruct-1.12.2-2.13.0.183.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Thaumcraft-1.12.2-6.1.BETA26.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file ThermalFoundation-1.12.2-2.6.7.1-universal.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file twilightforest-1.12.2-3.11.1021-universal.jar
[23:29:25] [Server thread/TRACE] [FML]: Skipping already parsed coremod or tweaker llibrary-core-1.0.11-1.12.2.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file llibrary-1.7.20-1.12.2.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file betteranimalsplus-1.12.2-9.0.1.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file orbis-lib-1.12.2-0.2.0+build411.jar
[23:29:25] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file phosphor-1.12.2-0.2.6+build50.jar
[23:29:25] [Server thread/DEBUG] [FML]: Examining file forge.jar for potential mods
[23:29:25] [Server thread/DEBUG] [FML]: The mod container forge.jar appears to be missing an mcmod.info file
[23:29:25] [Server thread/DEBUG] [FML]: Examining file jolokia.jar for potential mods
[23:29:25] [Server thread/DEBUG] [FML]: The mod container jolokia.jar appears to be missing an mcmod.info file
[23:29:26] [Server thread/DEBUG] [FML]: Examining file aether_ii-1.12.2-0.3.0+build411-universal.jar for potential mods
[23:29:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file aether_ii-1.12.2-0.3.0+build411-universal.jar
[23:29:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.gildedgames.aether.common.AetherCore) - loading
[23:29:26] [Server thread/TRACE] [FML]: Parsed dependency info for aether: Requirements: [orbis-lib@[0.2.0,), forge@[14.23.5.2816,)] After:[orbis-lib@[0.2.0,), forge@[14.23.5.2816,)] Before:[]
[23:29:26] [Server thread/DEBUG] [FML]: Examining file astralsorcery-1.12.2-1.10.27.jar for potential mods
[23:29:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file astralsorcery-1.12.2-1.10.27.jar
[23:29:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (hellfirepvp.astralsorcery.AstralSorcery) - loading
[23:29:26] [Server thread/TRACE] [FML]: Parsed dependency info for astralsorcery: Requirements: [baubles, forge@[14.23.5.2781,)] After:[forge@[14.23.5.2781,), baubles, crafttweaker] Before:[]
[23:29:26] [Server thread/DEBUG] [FML]: Examining file AutoRegLib-1.3-32.jar for potential mods
[23:29:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file AutoRegLib-1.3-32.jar
[23:29:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (vazkii.arl.AutoRegLib) - loading
[23:29:26] [Server thread/TRACE] [FML]: Parsed dependency info for autoreglib: Requirements: [forge@[14.21.1.2387,)] After:[forge@[14.21.1.2387,)] Before:[]
[23:29:26] [Server thread/DEBUG] [FML]: Examining file Baubles-1.12-1.5.2.jar for potential mods
[23:29:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file Baubles-1.12-1.5.2.jar
[23:29:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (baubles.common.Baubles) - loading
[23:29:26] [Server thread/TRACE] [FML]: Parsed dependency info for baubles: Requirements: [forge@[14.21.0.2348,)] After:[forge@[14.21.0.2348,)] Before:[]
[23:29:26] [Server thread/DEBUG] [FML]: Examining file bewitchment-1.12.2-0.0.22.64.jar for potential mods
[23:29:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file bewitchment-1.12.2-0.0.22.64.jar
[23:29:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.bewitchment.Bewitchment) - loading
[23:29:26] [Server thread/TRACE] [FML]: Using mcmod dependency info for bewitchment: [baubles, forge, patchouli] [baubles, forge, patchouli, dynamictrees, thaumcraft, mowziesmobs, elementaristics, covetedmobs, botania, betteranimalsplus, consecration, quark, miskatonicmysteries, toughasnails] []
[23:29:26] [Server thread/DEBUG] [FML]: Examining file BiblioCraft[v2.4.6][MC1.12.2].jar for potential mods
[23:29:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file BiblioCraft[v2.4.6][MC1.12.2].jar
[23:29:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (jds.bibliocraft.BiblioCraft) - loading
[23:29:26] [Server thread/TRACE] [FML]: Parsed dependency info for bibliocraft: Requirements: [] After:[] Before:[]
[23:29:26] [Server thread/DEBUG] [FML]: Examining file BiomesOPlenty-1.12.2-7.0.1.2445-universal.jar for potential mods
[23:29:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file BiomesOPlenty-1.12.2-7.0.1.2445-universal.jar
[23:29:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (biomesoplenty.core.BiomesOPlenty) - loading
[23:29:26] [Server thread/TRACE] [FML]: Parsed dependency info for biomesoplenty: Requirements: [forge@[14.23.5.2858,)] After:[forge@[14.23.5.2858,)] Before:[]
[23:29:26] [Server thread/DEBUG] [FML]: Examining file BloodMagic-1.12.2-2.4.3-105.jar for potential mods
[23:29:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file BloodMagic-1.12.2-2.4.3-105.jar
[23:29:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (WayofTime.bloodmagic.BloodMagic) - loading
[23:29:26] [Server thread/TRACE] [FML]: Parsed dependency info for bloodmagic: Requirements: [guideapi] After:[guideapi] Before:[]
[23:29:26] [Server thread/DEBUG] [FML]: Examining file Bloodmoon-MC1.12.2-1.5.3.jar for potential mods
[23:29:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file Bloodmoon-MC1.12.2-1.5.3.jar
[23:29:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (lumien.bloodmoon.Bloodmoon) - loading
[23:29:26] [Server thread/TRACE] [FML]: Parsed dependency info for bloodmoon: Requirements: [] After:[] Before:[]
[23:29:26] [Server thread/DEBUG] [FML]: Examining file Botania r1.10-364.4.jar for potential mods
[23:29:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file Botania r1.10-364.4.jar
[23:29:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (vazkii.botania.common.Botania) - loading
[23:29:26] [Server thread/TRACE] [FML]: Parsed dependency info for botania: Requirements: [baubles@[1.5.2,)] After:[baubles@[1.5.2,), thaumcraft@[6.1.BETA21,), jei@[1.12.2-4.13.1.220,), albedo@[1.0.0,)] Before:[]
[23:29:27] [Server thread/DEBUG] [FML]: Examining file BrandonsCore-1.12.2-2.4.20.162-universal.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file BrandonsCore-1.12.2-2.4.20.162-universal.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.brandon3055.brandonscore.BrandonsCore) - loading
[23:29:27] [Server thread/TRACE] [FML]: Parsed dependency info for brandonscore: Requirements: [codechickenlib@[3.2.0,), redstoneflux] After:[codechickenlib@[3.2.0,), redstoneflux] Before:[]
[23:29:27] [Server thread/DEBUG] [FML]: Examining file Chisel-MC1.12.2-1.0.2.45.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file Chisel-MC1.12.2-1.0.2.45.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (team.chisel.Chisel) - loading
[23:29:27] [Server thread/TRACE] [FML]: Parsed dependency info for chisel: Requirements: [forge@[14.23.5.2806,)] After:[forge@[14.23.5.2806,), jei@[4.12.0,5)] Before:[]
[23:29:27] [Server thread/DEBUG] [FML]: Examining file CodeChickenLib-1.12.2-3.2.3.358-universal.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file CodeChickenLib-1.12.2-3.2.3.358-universal.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (codechicken.lib.CodeChickenLib) - loading
[23:29:27] [Server thread/TRACE] [FML]: Parsed dependency info for codechickenlib: Requirements: [forge@[14.23.4.2718,)] After:[forge@[14.23.4.2718,)] Before:[]
[23:29:27] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from CodeChickenLib-1.12.2-3.2.3.358-universal.jar to locate a version number for mod codechickenlib
[23:29:27] [Server thread/WARN] [FML]: Mod codechickenlib is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 3.2.3.358
[23:29:27] [Server thread/DEBUG] [FML]: Examining file CoFHCore-1.12.2-4.6.6.1-universal.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file CoFHCore-1.12.2-4.6.6.1-universal.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cofh.CoFHCore) - loading
[23:29:27] [Server thread/TRACE] [FML]: Parsed dependency info for cofhcore: Requirements: [redstoneflux@[2.1.0,2.2.0), forge@[14.23.4.2705,**.**.**.**)] After:[forge@[14.23.4.2705,**.**.**.**), redstoneflux@[2.1.0,2.2.0)] Before:[]
[23:29:27] [Server thread/DEBUG] [FML]: Examining file CoFHWorld-1.12.2-1.4.0.1-universal.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file CoFHWorld-1.12.2-1.4.0.1-universal.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cofh.cofhworld.CoFHWorld) - loading
[23:29:27] [Server thread/TRACE] [FML]: Parsed dependency info for cofhworld: Requirements: [forge@[14.23.3.2655,**.**.**.**)] After:[forge@[14.23.3.2655,**.**.**.**)] Before:[]
[23:29:27] [Server thread/DEBUG] [FML]: Examining file CraftStudioAPI-universal-1.0.1.95-mc1.12-alpha.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file CraftStudioAPI-universal-1.0.1.95-mc1.12-alpha.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.leviathanstudio.craftstudio.CraftStudioApi) - loading
[23:29:27] [Server thread/TRACE] [FML]: Parsed dependency info for craftstudioapi: Requirements: [] After:[] Before:[]
[23:29:27] [Server thread/DEBUG] [FML]: Examining file CTM-MC1.12.2-1.0.2.31.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file CTM-MC1.12.2-1.0.2.31.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (team.chisel.ctm.CTM) - loading
[23:29:27] [Server thread/INFO] [FML]: Disabling mod ctm it is client side only.
[23:29:27] [Server thread/DEBUG] [FML]: Skipping mod team.chisel.ctm.CTM, container opted to not load.
[23:29:27] [Server thread/DEBUG] [FML]: Examining file CustomMobSpawner-3.11.5.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file CustomMobSpawner-3.11.5.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (drzhark.customspawner.CustomSpawner) - loading
[23:29:27] [Server thread/TRACE] [FML]: Parsed dependency info for customspawner: Requirements: [] After:[] Before:[]
[23:29:27] [Server thread/DEBUG] [FML]: Examining file Decocraft-2.6.3.7_1.12.2.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file Decocraft-2.6.3.7_1.12.2.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mia.props.Props) - loading
[23:29:27] [Server thread/TRACE] [FML]: Parsed dependency info for props: Requirements: [] After:[ptrmodellib] Before:[]
[23:29:27] [Server thread/DEBUG] [FML]: Examining file DrZharks MoCreatures Mod-12.0.5.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file DrZharks MoCreatures Mod-12.0.5.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (drzhark.mocreatures.MoCreatures) - loading
[23:29:27] [Server thread/TRACE] [FML]: Using mcmod dependency info for mocreatures: [] [CustomSpawner] []
[23:29:27] [Server thread/DEBUG] [FML]: Examining file extrautils2-1.12-1.9.9.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file extrautils2-1.12-1.9.9.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.rwtema.extrautils2.ExtraUtils2) - loading
[23:29:27] [Server thread/TRACE] [FML]: Parsed dependency info for extrautils2: Requirements: [] After:[tconstruct] Before:[]
[23:29:27] [Server thread/DEBUG] [FML]: Examining file forestry_1.12.2-5.8.2.422.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file forestry_1.12.2-5.8.2.422.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (forestry.Forestry) - loading
[23:29:27] [Server thread/TRACE] [FML]: Parsed dependency info for forestry: Requirements: [forge@[14.23.5.2847,)] After:[forge@[14.23.5.2847,), jei@[**.**.**.**,), ic2, natura, toughasnails, techreborn, buildcraftenergy] Before:[binniecore@[**.**.**.**,)]
[23:29:27] [Server thread/DEBUG] [FML]: Examining file fossilsarcheology-8.0.5.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file fossilsarcheology-8.0.5.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (fossilsarcheology.Revival) - loading
[23:29:27] [Server thread/TRACE] [FML]: Using mcmod dependency info for fossil: [llibrary@[1.7.17-1.12.2,)] [llibrary@[1.7.17-1.12.2,)] []
[23:29:27] [Server thread/DEBUG] [FML]: Examining file FTBLib-5.4.7.2.jar for potential mods
[23:29:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file FTBLib-5.4.7.2.jar
[23:29:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.feed_the_beast.ftblib.FTBLib) - loading
[23:29:27] [Server thread/TRACE] [FML]: Parsed dependency info for ftblib: Requirements: [forge@[14.23.5.2768,)] After:[forge@[14.23.5.2768,), jei@[4.6.0,)] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file FTBMoney-1.2.0.47.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file FTBMoney-1.2.0.47.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.feed_the_beast.mods.money.FTBMoney) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for ftbmoney: Requirements: [ftblib@[**.**.**.**,), ftbquests] After:[ftblib@[**.**.**.**,), ftbquests] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file FTBQuests-1202.9.0.15.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file FTBQuests-1202.9.0.15.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.feed_the_beast.ftbquests.FTBQuests) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for ftbquests: Requirements: [itemfilters, ftblib@[**.**.**.**,)] After:[ftblib@[**.**.**.**,), itemfilters, gamestages, ic2, ftbutilities, botania, buildcraftcore, projecte, customnpcs, reskillable] Before:[kubejs]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file GrimoireOfGaia3-1.12.2-1.7.2.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file GrimoireOfGaia3-1.12.2-1.7.2.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (gaia.Gaia) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for grimoireofgaia: Requirements: [forge@[14.23.4.2705,)] After:[forge@[14.23.4.2705,), baubles@[1.4.2,]] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file Guide-API-1.12-2.1.8-63.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file Guide-API-1.12-2.1.8-63.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (amerifrance.guideapi.GuideMod) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for guideapi: Requirements: [] After:[] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file Hats-1.12.2-7.1.1.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file Hats-1.12.2-7.1.1.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ichun.mods.hats.common.Hats) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for hats: Requirements: [ichunutil@[7.0.2,8.0.0)] After:[ichunutil@[7.0.2,8.0.0)] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file iChunUtil-1.12.2-7.2.2.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file iChunUtil-1.12.2-7.2.2.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ichun.mods.ichunutil.common.iChunUtil) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for ichunutil: Requirements: [forge@[14.23.5.2781,99999.24.0.0)] After:[forge@[14.23.5.2781,99999.24.0.0)] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file ironchest-1.12.2-7.0.67.844.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file ironchest-1.12.2-7.0.67.844.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cpw.mods.ironchest.IronChest) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for ironchest: Requirements: [forge@[14.21.0.2359,)] After:[forge@[14.21.0.2359,)] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from ironchest-1.12.2-7.0.67.844.jar to locate a version number for mod ironchest
[23:29:28] [Server thread/DEBUG] [FML]: Found version null for mod ironchest in version.properties, using
[23:29:28] [Server thread/WARN] [FML]: Mod ironchest is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.12.2-7.0.67.844
[23:29:28] [Server thread/DEBUG] [FML]: Examining file ItemFilters-1.0.4.2.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file ItemFilters-1.0.4.2.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.latmod.mods.itemfilters.ItemFilters) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for itemfilters: Requirements: [] After:[forestry] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file journeymap-1.12.2-5.7.1.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file journeymap-1.12.2-5.7.1.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (journeymap.common.Journeymap) - loading
[23:29:28] [Server thread/TRACE] [FML]: Using mcmod dependency info for journeymap: [] [Forge@[14.23.5.2768,)] []
[23:29:28] [Server thread/DEBUG] [FML]: Examining file lootbagmod-1.12.2-1.5.2-FINAL.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file lootbagmod-1.12.2-1.5.2-FINAL.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.github.trhod177.lootbagmod.LootBagMod) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for lootbagmod: Requirements: [] After:[] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file Mantle-1.12-1.3.3.55.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file Mantle-1.12-1.3.3.55.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (slimeknights.mantle.Mantle) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for mantle: Requirements: [forge@[14.21.1.2387,)] After:[forge@[14.21.1.2387,)] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file Morph-1.12.2-7.2.1.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file Morph-1.12.2-7.2.1.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ichun.mods.morph.common.Morph) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for morph: Requirements: [ichunutil@[7.2.0,8.0.0)] After:[ichunutil@[7.2.0,8.0.0)] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file mysticallib-1.12.2-1.13.0.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file mysticallib-1.12.2-1.13.0.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (epicsquid.mysticallib.MysticalLib) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for mysticallib: Requirements: [forge@[14.23.5.2847,)] After:[forge@[14.23.5.2847,), *] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file mysticalworld-1.12.2-1.11.0.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file mysticalworld-1.12.2-1.11.0.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (epicsquid.mysticalworld.MysticalWorld) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for mysticalworld: Requirements: [forge@[14.23.5.2847,), mysticallib@[1.9,), patchouli] After:[forge@[14.23.5.2847,)] Before:[mysticallib@[1.9,), harvest, chisel, endercore]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file natura-1.12.2-4.3.2.69.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file natura-1.12.2-4.3.2.69.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.progwml6.natura.Natura) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for natura: Requirements: [forge@[14.23.3.2673,), mantle@[1.12-1.3.0,)] After:[forge@[14.23.3.2673,), mantle@[1.12-1.3.0,)] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file Pam's HarvestCraft 1.12.2zg.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file Pam's HarvestCraft 1.12.2zg.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.pam.harvestcraft.HarvestCraft) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for harvestcraft: Requirements: [] After:[] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file Patchouli-1.0-23.6.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file Patchouli-1.0-23.6.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (vazkii.patchouli.common.base.Patchouli) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for patchouli: Requirements: [] After:[] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from Patchouli-1.0-23.6.jar to locate a version number for mod patchouli
[23:29:28] [Server thread/WARN] [FML]: Mod patchouli is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.0-23.6
[23:29:28] [Server thread/DEBUG] [FML]: Examining file ProjectIntelligence-1.12.2-1.0.9.28-universal.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file ProjectIntelligence-1.12.2-1.0.9.28-universal.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.brandon3055.projectintelligence.ProjectIntelligence) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for projectintelligence: Requirements: [brandonscore@[2.4.17,)] After:[brandonscore@[2.4.17,)] Before:[nei]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file PTRLib-1.0.5.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file PTRLib-1.0.5.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mia.craftstudio.minecraft.forge.CSLibMod) - loading
[23:29:28] [Server thread/INFO] [FML]: Disabling mod ptrmodellib it is client side only.
[23:29:28] [Server thread/DEBUG] [FML]: Skipping mod com.mia.craftstudio.minecraft.forge.CSLibMod, container opted to not load.
[23:29:28] [Server thread/DEBUG] [FML]: Examining file Quark-r1.6-179.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file Quark-r1.6-179.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (vazkii.quark.base.Quark) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for quark: Requirements: [forge@[14.23.5.2831,), autoreglib@[1.3-32,)] After:[forge@[14.23.5.2831,), jei@[4.6.0,)] Before:[autoreglib@[1.3-32,)]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file RandomThings-MC1.12.2-4.2.7.4.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file RandomThings-MC1.12.2-4.2.7.4.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (lumien.randomthings.RandomThings) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for randomthings: Requirements: [] After:[jei@[**.**.**.**,)] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file rats-3.2.14-1.12.2.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file rats-3.2.14-1.12.2.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.github.alexthe666.rats.RatsMod) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for rats: Requirements: [llibrary@[1.7.9,)] After:[llibrary@[1.7.9,)] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file RedstoneFlux-1.12-2.1.1.1-universal.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file RedstoneFlux-1.12-2.1.1.1-universal.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cofh.redstoneflux.RedstoneFlux) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for redstoneflux: Requirements: [] After:[] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file Roots-1.12.2-3.1.5.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file Roots-1.12.2-3.1.5.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (epicsquid.roots.Roots) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for roots: Requirements: [] After:[maindependencies] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file Tabula-1.12.2-7.1.0.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file Tabula-1.12.2-7.1.0.jar
[23:29:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ichun.mods.tabula.common.Tabula) - loading
[23:29:28] [Server thread/TRACE] [FML]: Parsed dependency info for tabula: Requirements: [ichunutil@[7.2.0,8.0.0)] After:[ichunutil@[7.2.0,8.0.0)] Before:[]
[23:29:28] [Server thread/DEBUG] [FML]: Examining file TConstruct-1.12.2-2.13.0.183.jar for potential mods
[23:29:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file TConstruct-1.12.2-2.13.0.183.jar
[23:29:29] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (slimeknights.tconstruct.TConstruct) - loading
[23:29:29] [Server thread/TRACE] [FML]: Parsed dependency info for tconstruct: Requirements: [mantle@[1.12-1.3.3.49,), forge@[14.23.1.2577,)] After:[forge@[14.23.1.2577,), mantle@[1.12-1.3.3.49,), jei@[4.8,), chisel, quark@[r1.6-177,)] Before:[taiga@(1.3.0,)]
[23:29:29] [Server thread/DEBUG] [FML]: Examining file Thaumcraft-1.12.2-6.1.BETA26.jar for potential mods
[23:29:29] [Server thread/TRACE] [FML]: Located mcmod.info file in file Thaumcraft-1.12.2-6.1.BETA26.jar
[23:29:29] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (thaumcraft.Thaumcraft) - loading
[23:29:29] [Server thread/TRACE] [FML]: Parsed dependency info for thaumcraft: Requirements: [baubles@[1.5.2,), forge@[14.23.5.2768,)] After:[forge@[14.23.5.2768,), baubles@[1.5.2,)] Before:[]
[23:29:29] [Server thread/DEBUG] [FML]: Examining file ThermalFoundation-1.12.2-2.6.7.1-universal.jar for potential mods
[23:29:29] [Server thread/TRACE] [FML]: Located mcmod.info file in file ThermalFoundation-1.12.2-2.6.7.1-universal.jar
[23:29:29] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cofh.thermalfoundation.ThermalFoundation) - loading
[23:29:29] [Server thread/TRACE] [FML]: Parsed dependency info for thermalfoundation: Requirements: [cofhcore@[4.6.0,4.7.0), cofhworld@[1.2.0,2.0.0)] After:[cofhcore@[4.6.0,4.7.0), cofhworld@[1.2.0,2.0.0)] Before:[enderio, immersiveengineering]
[23:29:29] [Server thread/DEBUG] [FML]: Examining file twilightforest-1.12.2-3.11.1021-universal.jar for potential mods
[23:29:29] [Server thread/TRACE] [FML]: Located mcmod.info file in file twilightforest-1.12.2-3.11.1021-universal.jar
[23:29:29] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (twilightforest.TwilightForestMod) - loading
[23:29:29] [Server thread/TRACE] [FML]: Parsed dependency info for twilightforest: Requirements: [forge@[14.23.5.2813,)] After:[ctm@[MC1.12.2-0.3.2.18,), forge@[14.23.5.2813,), thaumcraft@[6.1.BETA21,)] Before:[immersiveengineering@[0.12-83,), tconstruct]
[23:29:29] [Server thread/DEBUG] [FML]: Examining file llibrary-1.7.20-1.12.2.jar for potential mods
[23:29:29] [Server thread/TRACE] [FML]: Located mcmod.info file in file llibrary-1.7.20-1.12.2.jar
[23:29:29] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.ilexiconn.llibrary.LLibrary) - loading
[23:29:29] [Server thread/TRACE] [FML]: Parsed dependency info for llibrary: Requirements: [forge@[14.23.5.2772,)] After:[forge@[14.23.5.2772,)] Before:[]
[23:29:29] [Server thread/DEBUG] [FML]: Examining file betteranimalsplus-1.12.2-9.0.1.jar for potential mods
[23:29:29] [Server thread/TRACE] [FML]: Located mcmod.info file in file betteranimalsplus-1.12.2-9.0.1.jar
[23:29:29] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (its_meow.betteranimalsplus.BetterAnimalsPlusMod) - loading
[23:29:29] [Server thread/TRACE] [FML]: Parsed dependency info for betteranimalsplus: Requirements: [] After:[] Before:[]
[23:29:29] [Server thread/DEBUG] [FML]: Examining file orbis-lib-1.12.2-0.2.0+build411.jar for potential mods
[23:29:29] [Server thread/TRACE] [FML]: Located mcmod.info file in file orbis-lib-1.12.2-0.2.0+build411.jar
[23:29:29] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.gildedgames.orbis.lib.OrbisLib) - loading
[23:29:29] [Server thread/TRACE] [FML]: Using mcmod dependency info for orbis-lib: [] [] []
[23:29:29] [Server thread/DEBUG] [FML]: Examining file phosphor-1.12.2-0.2.6+build50.jar for potential mods
[23:29:29] [Server thread/TRACE] [FML]: Located mcmod.info file in file phosphor-1.12.2-0.2.6+build50.jar
[23:29:29] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.jellysquid.mods.phosphor.mod.PhosphorMod) - loading
[23:29:29] [Server thread/TRACE] [FML]: Parsed dependency info for phosphor-lighting: Requirements: [] After:[neid@[**.**.**.**,), spongeforge@[1.12.2-2838-7.1.7-RC3844,)] Before:[]
[23:29:29] [Server thread/INFO] [FML]: Forge Mod Loader has identified 59 mods to load
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.lepidopterology (owned by ForestryAPI|core providing ForestryAPI|lepidopterology) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.world (owned by ForestryAPI|core providing ForestryAPI|world) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.modules (owned by ForestryAPI|core providing ForestryAPI|modules) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.apiculture.hives (owned by ForestryAPI|apiculture providing ForestryAPI|hives) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API me.ichun.mods.ichunutil.api (owned by iChun providing iChunUtil API) embedded in ichunutil
[23:29:29] [Server thread/DEBUG] [FML]: Found API journeymap.client.api.display (owned by journeymap providing journeymap|client-api-display) embedded in journeymap
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.recipes (owned by ForestryAPI|core providing ForestryAPI|recipes) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API vazkii.quark.api (owned by quark providing QuarkAPI) embedded in quark
[23:29:29] [Server thread/DEBUG] [FML]: Found API cofh.redstoneflux (owned by redstoneflux providing redstonefluxapi) embedded in redstoneflux
[23:29:29] [Server thread/DEBUG] [FML]: Found API amerifrance.guideapi.api (owned by guideapi providing Guide-API|API) embedded in guideapi
[23:29:29] [Server thread/DEBUG] [FML]: Found API vazkii.botania.api (owned by Botania providing BotaniaAPI) embedded in botania
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.genetics (owned by ForestryAPI|core providing ForestryAPI|genetics) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API WayofTime.bloodmagic.api (owned by bloodmagic providing bloodmagic-api) embedded in bloodmagic
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.core (owned by Forestry providing ForestryAPI|core) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API team.chisel.api.carving (owned by Chisel providing ChiselAPI|Carving) embedded in chisel
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.arboriculture (owned by ForestryAPI|core providing ForestryAPI|arboriculture) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.apiculture (owned by ForestryAPI|core providing ForestryAPI|apiculture) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API cofh.api (owned by cofhcore providing cofhapi) embedded in cofhcore
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.farming (owned by ForestryAPI|core providing ForestryAPI|farming) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.multiblock (owned by ForestryAPI|core providing ForestryAPI|multiblock) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.book (owned by ForestryAPI|core providing ForestryAPI|book) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API team.chisel.api (owned by chisel providing Chisel-API) embedded in chisel
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.storage (owned by ForestryAPI|core providing ForestryAPI|storage) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API baubles.api (owned by Baubles providing Baubles|API) embedded in baubles
[23:29:29] [Server thread/DEBUG] [FML]: Found API thaumcraft.api (owned by Thaumcraft providing Thaumcraft|API) embedded in thaumcraft
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.circuits (owned by ForestryAPI|core providing ForestryAPI|circuits) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API journeymap.client.api.model (owned by journeymap providing journeymap|client-api-model) embedded in journeymap
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.food (owned by ForestryAPI|core providing ForestryAPI|food) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API journeymap.client.api.event (owned by journeymap providing journeymap|client-api-event) embedded in journeymap
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.climate (owned by Forestry providing ForestryAPI|climate) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API journeymap.client.api.util (owned by journeymap providing journeymap|client-api-util) embedded in journeymap
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.fuels (owned by ForestryAPI|core providing ForestryAPI|fuels) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.mail (owned by ForestryAPI|core providing ForestryAPI|mail) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API vazkii.patchouli.api (owned by patchouli providing PatchouliAPI) embedded in patchouli
[23:29:29] [Server thread/DEBUG] [FML]: Found API forestry.api.gui (owned by ForestryAPI|core providing ForestryAPI|gui) embedded in forestry
[23:29:29] [Server thread/DEBUG] [FML]: Found API journeymap.client.api (owned by journeymap providing journeymap|client-api) embedded in journeymap
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|world:2.1.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|world: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent ForestryAPI|core from APIContainer{ForestryAPI|hives:4.1.0}
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|hives:4.1.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|hives: owner: ForestryAPI|apiculture, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API redstonefluxapi: owner: redstoneflux, dependents: []
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|storage:5.0.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|storage: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API BotaniaAPI: owner: Botania, dependents: [botania]
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|book:5.8.1}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|book: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-utils: owner: ctm, dependents: []
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|core: owner: Forestry, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|climate: owner: Forestry, dependents: [forestry]
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|food:1.1.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|food: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API PatchouliAPI: owner: patchouli, dependents: []
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|gui:5.8.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|gui: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-models: owner: ctm, dependents: []
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|mail:3.1.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|mail: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-textures: owner: ctm, dependents: []
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|multiblock:3.0.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|multiblock: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API QuarkAPI: owner: quark, dependents: []
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ChiselAPI|Carving: owner: Chisel, dependents: [chisel]
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|genetics:5.7.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|genetics: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|fuels:3.0.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|fuels: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API Guide-API|API: owner: guideapi, dependents: []
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|recipes:5.4.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|recipes: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|farming:5.8.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|farming: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API bloodmagic-api: owner: bloodmagic, dependents: []
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|apiculture:5.0.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|apiculture: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API Baubles|API: owner: Baubles, dependents: [baubles]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API iChunUtil API: owner: iChun, dependents: [ichunutil]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API journeymap|client-api-display: owner: journeymap, dependents: []
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API Thaumcraft|API: owner: Thaumcraft, dependents: [thaumcraft]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-events: owner: ctm, dependents: []
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API cofhapi: owner: cofhcore, dependents: []
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|modules:5.7.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|modules: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API Chisel-API: owner: chisel, dependents: []
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|circuits:3.1.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|circuits: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|arboriculture:4.3.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|arboriculture: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API journeymap|client-api-model: owner: journeymap, dependents: []
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API journeymap|client-api: owner: journeymap, dependents: []
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API journeymap|client-api-event: owner: journeymap, dependents: []
[23:29:29] [Server thread/TRACE] [FML]: Removing upstream parent Forestry from APIContainer{ForestryAPI|lepidopterology:1.4.0}
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ForestryAPI|lepidopterology: owner: ForestryAPI|core, dependents: [forestry]
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API journeymap|client-api-util: owner: journeymap, dependents: []
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api: owner: ctm, dependents: []
[23:29:29] [Server thread/DEBUG] [FML]: Creating API container dummy for API CSLib|API: owner: ptrmodellib, dependents: []
[23:29:29] [Server thread/TRACE] [FML]: Received a system property request ''
[23:29:29] [Server thread/TRACE] [FML]: System property request managing the state of 0 mods
[23:29:29] [Server thread/DEBUG] [FML]: After merging, found state information for 0 mods
[23:29:29] [Server thread/WARN] [FML]: Missing English translation for FML: assets/fml/lang/en_us.lang
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod aether
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod astralsorcery
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod autoreglib
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod baubles
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod bewitchment
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod bibliocraft
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod biomesoplenty
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod bloodmagic
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod bloodmoon
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod botania
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod brandonscore
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod chisel
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod codechickenlib
[23:29:29] [Server thread/WARN] [FML]: Missing English translation for codechickenlib: assets/codechickenlib/lang/en_us.lang
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod cofhcore
[23:29:29] [Server thread/WARN] [FML]: Missing English translation for cofhcore: assets/cofhcore/lang/en_us.lang
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod cofhworld
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod craftstudioapi
[23:29:29] [Server thread/WARN] [FML]: Missing English translation for craftstudioapi: assets/craftstudioapi/lang/en_us.lang
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod customspawner
[23:29:29] [Server thread/WARN] [FML]: Missing English translation for customspawner: assets/customspawner/lang/en_us.lang
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod props
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod mocreatures
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod extrautils2
[23:29:29] [Server thread/DEBUG] [FML]: Enabling mod forestry
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod fossil
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod ftblib
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod ftbmoney
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod ftbquests
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod grimoireofgaia
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod guideapi
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod hats
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod ichunutil
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod ironchest
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod itemfilters
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod journeymap
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod lootbagmod
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod mantle
[23:29:30] [Server thread/WARN] [FML]: Missing English translation for mantle: assets/mantle/lang/en_us.lang
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod morph
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod mysticallib
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod mysticalworld
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod natura
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod harvestcraft
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod patchouli
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod projectintelligence
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod quark
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod randomthings
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod rats
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod redstoneflux
[23:29:30] [Server thread/WARN] [FML]: Missing English translation for redstoneflux: assets/redstoneflux/lang/en_us.lang
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod roots
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod tabula
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod tconstruct
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod thaumcraft
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod thermalfoundation
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod twilightforest
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod llibrary
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod betteranimalsplus
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod orbis-lib
[23:29:30] [Server thread/WARN] [FML]: Missing English translation for orbis-lib: assets/orbis-lib/lang/en_us.lang
[23:29:30] [Server thread/DEBUG] [FML]: Enabling mod phosphor-lighting
[23:29:30] [Server thread/WARN] [FML]: Missing English translation for phosphor-lighting: assets/phosphor-lighting/lang/en_us.lang
[23:29:30] [Server thread/TRACE] [FML]: Verifying mod requirements are satisfied
[23:29:30] [Server thread/TRACE] [FML]: All mod requirements are satisfied
[23:29:30] [Server thread/TRACE] [FML]: Sorting mods into an ordered list
[23:29:30] [Server thread/TRACE] [FML]: Mod sorting completed successfully
[23:29:30] [Server thread/DEBUG] [FML]: Mod sorting data
[23:29:30] [Server thread/DEBUG] [FML]: orbis-lib(OrbisLib:0.2.0): orbis-lib-1.12.2-0.2.0+build411.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: aether(Aether II:0.3.0): aether_ii-1.12.2-0.3.0+build411-universal.jar (required-after:orbis-lib@[0.2.0,);required-after:forge@[14.23.5.2816,))
[23:29:30] [Server thread/DEBUG] [FML]: Baubles|API(API: Baubles|API:**.**.**.**): Baubles-1.12-1.5.2.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: baubles(Baubles:1.5.2): Baubles-1.12-1.5.2.jar (required-after:forge@[14.21.0.2348,);)
[23:29:30] [Server thread/DEBUG] [FML]: astralsorcery(Astral Sorcery:1.10.27): astralsorcery-1.12.2-1.10.27.jar (required-after:forge@[14.23.5.2781,);required-after:baubles;after:crafttweaker)
[23:29:30] [Server thread/DEBUG] [FML]: quark(Quark:r1.6-179): Quark-r1.6-179.jar (required-after:forge@[14.23.5.2831,);required-before:autoreglib@[1.3-32,);after:jei@[4.6.0,);)
[23:29:30] [Server thread/DEBUG] [FML]: autoreglib(AutoRegLib:1.3-32): AutoRegLib-1.3-32.jar (required-after:forge@[14.21.1.2387,))
[23:29:30] [Server thread/DEBUG] [FML]: Thaumcraft|API(API: Thaumcraft|API:6.0.2): Thaumcraft-1.12.2-6.1.BETA26.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: thaumcraft(Thaumcraft:6.1.BETA26): Thaumcraft-1.12.2-6.1.BETA26.jar (required-after:forge@[14.23.5.2768,);required-after:baubles@[1.5.2,))
[23:29:30] [Server thread/DEBUG] [FML]: BotaniaAPI(API: BotaniaAPI:93): Botania r1.10-364.4.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: botania(Botania:r1.10-364): Botania r1.10-364.4.jar (required-after:baubles@[1.5.2,);after:thaumcraft@[6.1.BETA21,);after:jei@[1.12.2-4.13.1.220,);after:albedo@[1.0.0,))
[23:29:30] [Server thread/DEBUG] [FML]: patchouli(Patchouli:1.0-23.6): Patchouli-1.0-23.6.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: betteranimalsplus(Better Animals Plus:9.0.1): betteranimalsplus-1.12.2-9.0.1.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: bewitchment(Bewitchment:0.22.63): bewitchment-1.12.2-0.0.22.64.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: bibliocraft(BiblioCraft:2.4.6): BiblioCraft[v2.4.6][MC1.12.2].jar ()
[23:29:30] [Server thread/DEBUG] [FML]: biomesoplenty(Biomes O' Plenty:7.0.1.2445): BiomesOPlenty-1.12.2-7.0.1.2445-universal.jar (required-after:forge@[14.23.5.2858,))
[23:29:30] [Server thread/DEBUG] [FML]: guideapi(Guide-API:1.12-2.1.8-63): Guide-API-1.12-2.1.8-63.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: bloodmagic(Blood Magic: Alchemical Wizardry:1.12.2-2.4.3-105): BloodMagic-1.12.2-2.4.3-105.jar (required-after:guideapi;)
[23:29:30] [Server thread/DEBUG] [FML]: bloodmoon(Bloodmoon:1.5.3): Bloodmoon-MC1.12.2-1.5.3.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: codechickenlib(CodeChicken Lib:**.**.**.**): CodeChickenLib-1.12.2-3.2.3.358-universal.jar (required-after:forge@[14.23.4.2718,))
[23:29:30] [Server thread/DEBUG] [FML]: redstoneflux(Redstone Flux:2.1.1): RedstoneFlux-1.12-2.1.1.1-universal.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: brandonscore(Brandon's Core:2.4.20): BrandonsCore-1.12.2-2.4.20.162-universal.jar (required-after:codechickenlib@[3.2.0,);required-after:redstoneflux;)
[23:29:30] [Server thread/DEBUG] [FML]: mysticalworld(Mystical World:1.12.2-1.11.0): mysticalworld-1.12.2-1.11.0.jar (required-after:forge@[14.23.5.2847,);required-before:mysticallib@[1.9,);before:harvest;before:chisel;before:endercore;required:patchouli)
[23:29:30] [Server thread/DEBUG] [FML]: ChiselAPI|Carving(API: ChiselAPI|Carving:0.0.1): Chisel-MC1.12.2-1.0.2.45.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: chisel(Chisel:MC1.12.2-1.0.2.45): Chisel-MC1.12.2-1.0.2.45.jar (required-after:forge@[14.23.5.2806,);required-after-client:ctm@[MC1.12.2-1.0.2.31,);after:jei@[4.12.0,5))
[23:29:30] [Server thread/DEBUG] [FML]: cofhcore(CoFH Core:4.6.6): CoFHCore-1.12.2-4.6.6.1-universal.jar (required-after:forge@[14.23.4.2705,**.**.**.**);required-after:redstoneflux@[2.1.0,2.2.0);)
[23:29:30] [Server thread/DEBUG] [FML]: cofhworld(CoFH World:1.4.0): CoFHWorld-1.12.2-1.4.0.1-universal.jar (required-after:forge@[14.23.3.2655,**.**.**.**);)
[23:29:30] [Server thread/DEBUG] [FML]: craftstudioapi(CraftStudio API:1.0.0): CraftStudioAPI-universal-1.0.1.95-mc1.12-alpha.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: customspawner(DrZhark's CustomSpawner:3.11.4): CustomMobSpawner-3.11.5.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: props(Decocraft:**.**.**.**): Decocraft-2.6.3.7_1.12.2.jar (required-after-client:ptrmodellib@[1.0.5,);after:ptrmodellib)
[23:29:30] [Server thread/DEBUG] [FML]: mocreatures(DrZhark's Mo'Creatures Mod:12.0.5): DrZharks MoCreatures Mod-12.0.5.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: mantle(Mantle:1.12-1.3.3.55): Mantle-1.12-1.3.3.55.jar (required-after:forge@[14.21.1.2387,))
[23:29:30] [Server thread/DEBUG] [FML]: twilightforest(The Twilight Forest:3.11.1021): twilightforest-1.12.2-3.11.1021-universal.jar (after:ctm@[MC1.12.2-0.3.2.18,);before:immersiveengineering@[0.12-83,);before:tconstruct;required-after:forge@[14.23.5.2813,);after:thaumcraft@[6.1.BETA21,))
[23:29:30] [Server thread/DEBUG] [FML]: tconstruct(Tinkers' Construct:1.12.2-2.13.0.183): TConstruct-1.12.2-2.13.0.183.jar (required-after:forge@[14.23.1.2577,);required-after:mantle@[1.12-1.3.3.49,);after:jei@[4.8,);before:taiga@(1.3.0,);after:chisel;after:quark@[r1.6-177,))
[23:29:30] [Server thread/DEBUG] [FML]: extrautils2(Extra Utilities 2:1.0): extrautils2-1.12-1.9.9.jar (after:tconstruct)
[23:29:30] [Server thread/DEBUG] [FML]: natura(Natura:1.12.2-4.3.2.69): natura-1.12.2-4.3.2.69.jar (required-after:forge@[14.23.3.2673,);required-after:mantle@[1.12-1.3.0,);)
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|core(API: ForestryAPI|core:5.7.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|world(API: ForestryAPI|world:2.1.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|apiculture(API: ForestryAPI|apiculture:5.0.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|hives(API: ForestryAPI|hives:4.1.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|storage(API: ForestryAPI|storage:5.0.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|book(API: ForestryAPI|book:5.8.1): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|climate(API: ForestryAPI|climate:5.0.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|food(API: ForestryAPI|food:1.1.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|gui(API: ForestryAPI|gui:5.8.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|mail(API: ForestryAPI|mail:3.1.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|multiblock(API: ForestryAPI|multiblock:3.0.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|genetics(API: ForestryAPI|genetics:5.7.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|fuels(API: ForestryAPI|fuels:3.0.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|recipes(API: ForestryAPI|recipes:5.4.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|farming(API: ForestryAPI|farming:5.8.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|modules(API: ForestryAPI|modules:5.7.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|circuits(API: ForestryAPI|circuits:3.1.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|arboriculture(API: ForestryAPI|arboriculture:4.3.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ForestryAPI|lepidopterology(API: ForestryAPI|lepidopterology:1.4.0): forestry_1.12.2-5.8.2.422.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: forestry(Forestry:**.**.**.**): forestry_1.12.2-5.8.2.422.jar (required-after:forge@[14.23.5.2847,);after:jei@[**.**.**.**,);after:ic2;after:natura;after:toughasnails;after:techreborn;after:buildcraftenergy;before:binniecore@[**.**.**.**,))
[23:29:30] [Server thread/DEBUG] [FML]: llibrary(LLibrary:1.7.20): llibrary-1.7.20-1.12.2.jar (required-after:forge@[14.23.5.2772,))
[23:29:30] [Server thread/DEBUG] [FML]: fossil(Fossils and Archeology Revival:8.0.5): fossilsarcheology-8.0.5.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ftblib(FTB Library:**.**.**.**): FTBLib-5.4.7.2.jar (required-after:forge@[14.23.5.2768,);after:jei@[4.6.0,);)
[23:29:30] [Server thread/DEBUG] [FML]: itemfilters(Item Filters:**.**.**.**): ItemFilters-1.0.4.2.jar (after:forestry)
[23:29:30] [Server thread/DEBUG] [FML]: ftbquests(FTB Quests:1202.9.0.15): FTBQuests-1202.9.0.15.jar (required-after:ftblib@[**.**.**.**,);required-after:itemfilters;before:kubejs;after:gamestages;after:ic2;after:ftbutilities;after:botania;after:buildcraftcore;after:projecte;after:customnpcs;after:reskillable)
[23:29:30] [Server thread/DEBUG] [FML]: ftbmoney(FTB Money:**.**.**.**): FTBMoney-1.2.0.47.jar (required-after:ftblib@[**.**.**.**,);required-after:ftbquests)
[23:29:30] [Server thread/DEBUG] [FML]: grimoireofgaia(Grimoire of Gaia 3:1.7.2): GrimoireOfGaia3-1.12.2-1.7.2.jar (required-after:forge@[14.23.4.2705,);after:baubles@[1.4.2,])
[23:29:30] [Server thread/DEBUG] [FML]: iChunUtil API(API: iChunUtil API:1.2.0): iChunUtil-1.12.2-7.2.2.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ichunutil(iChunUtil:7.2.2): iChunUtil-1.12.2-7.2.2.jar (required-after:forge@[14.23.5.2781,99999.24.0.0))
[23:29:30] [Server thread/DEBUG] [FML]: hats(Hats:7.1.1): Hats-1.12.2-7.1.1.jar (required-after:ichunutil@[7.0.2,8.0.0))
[23:29:30] [Server thread/DEBUG] [FML]: ironchest(Iron Chest:1.12.2-7.0.67.844): ironchest-1.12.2-7.0.67.844.jar (required-after:forge@[14.21.0.2359,))
[23:29:30] [Server thread/DEBUG] [FML]: journeymap(JourneyMap:1.12.2-5.7.1): journeymap-1.12.2-5.7.1.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: lootbagmod(Loot Bag Mod:1.5.2): lootbagmod-1.12.2-1.5.2-FINAL.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: morph(Morph:7.2.0): Morph-1.12.2-7.2.1.jar (required-after:ichunutil@[7.2.0,8.0.0))
[23:29:30] [Server thread/DEBUG] [FML]: harvestcraft(Pam's HarvestCraft:1.12.2zb): Pam's HarvestCraft 1.12.2zg.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: projectintelligence(Project Intelligence:1.0.9): ProjectIntelligence-1.12.2-1.0.9.28-universal.jar (required-after:brandonscore@[2.4.17,);before:nei;)
[23:29:30] [Server thread/DEBUG] [FML]: randomthings(Random Things:**.**.**.**): RandomThings-MC1.12.2-4.2.7.4.jar (after:jei@[**.**.**.**,);)
[23:29:30] [Server thread/DEBUG] [FML]: rats(Rats:3.2.14): rats-3.2.14-1.12.2.jar (required-after:llibrary@[1.7.9,))
[23:29:30] [Server thread/DEBUG] [FML]: roots(Roots:@VERSION@): Roots-1.12.2-3.1.5.jar (after:maindependencies)
[23:29:30] [Server thread/DEBUG] [FML]: tabula(Tabula:7.1.0): Tabula-1.12.2-7.1.0.jar (required-after:ichunutil@[7.2.0,8.0.0))
[23:29:30] [Server thread/DEBUG] [FML]: thermalfoundation(Thermal Foundation:2.6.7): ThermalFoundation-1.12.2-2.6.7.1-universal.jar (required-after:cofhcore@[4.6.0,4.7.0);required-after:cofhworld@[1.2.0,2.0.0);before:enderio;before:immersiveengineering)
[23:29:30] [Server thread/DEBUG] [FML]: phosphor-lighting(Phosphor Lighting Engine:1.12.2-0.2.6): phosphor-1.12.2-0.2.6+build50.jar (after:neid@[**.**.**.**,);after:spongeforge@[1.12.2-2838-7.1.7-RC3844,))
[23:29:30] [Server thread/DEBUG] [FML]: redstonefluxapi(API: redstonefluxapi:2.1.1): RedstoneFlux-1.12-2.1.1.1-universal.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ctm-api-utils(API: ctm-api-utils:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: PatchouliAPI(API: PatchouliAPI:6): Patchouli-1.0-23.6.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ctm-api-models(API: ctm-api-models:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ctm-api-textures(API: ctm-api-textures:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: QuarkAPI(API: QuarkAPI:4): Quark-r1.6-179.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: Guide-API|API(API: Guide-API|API:2.0.0): Guide-API-1.12-2.1.8-63.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: bloodmagic-api(API: bloodmagic-api:2.0.0): BloodMagic-1.12.2-2.4.3-105.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: journeymap|client-api-display(API: journeymap|client-api-display:1.4): journeymap-1.12.2-5.7.1.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ctm-api-events(API: ctm-api-events:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: cofhapi(API: cofhapi:2.5.0): CoFHCore-1.12.2-4.6.6.1-universal.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: Chisel-API(API: Chisel-API:0.0.1): Chisel-MC1.12.2-1.0.2.45.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: journeymap|client-api-model(API: journeymap|client-api-model:1.4): journeymap-1.12.2-5.7.1.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: journeymap|client-api(API: journeymap|client-api:1.4): journeymap-1.12.2-5.7.1.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: journeymap|client-api-event(API: journeymap|client-api-event:1.4): journeymap-1.12.2-5.7.1.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: journeymap|client-api-util(API: journeymap|client-api-util:1.4): journeymap-1.12.2-5.7.1.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: ctm-api(API: ctm-api:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: CSLib|API(API: CSLib|API:1.0.1): PTRLib-1.0.5.jar ()
[23:29:30] [Server thread/DEBUG] [FML]: mysticallib(Mystical Lib:1.12.2-1.13.0): mysticallib-1.12.2-1.13.0.jar (required-after:forge@[14.23.5.2847 ,);after:*)
[23:29:30] [Server thread/INFO] [FML]: FML has found a non-mod file CTM-MC1.12.2-1.0.2.31.jar in your mods directory. It will now be injected into your classpath. This could severe stability issues, it should be removed if possible.
[23:29:30] [Server thread/INFO] [FML]: FML has found a non-mod file PTRLib-1.0.5.jar in your mods directory. It will now be injected into your classpath. This could severe stability issues, it should be removed if possible.
[23:29:30] [Server thread/DEBUG] [FML]: Loading @Config anotation data
[23:29:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod minecraft
[23:29:30] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod minecraft
[23:29:30] [Server thread/DEBUG] [FML]: Bar Step: Construction - Minecraft took 0.002s
[23:29:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mcp
[23:29:30] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mcp
[23:29:30] [Server thread/DEBUG] [FML]: Bar Step: Construction - Minecraft Coder Pack took 0.002s
[23:29:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod FML
[23:29:31] [Server thread/TRACE] [FML]: Mod FML is using network checker : Invoking method checkModLists
[23:29:31] [Server thread/TRACE] [FML]: Testing mod FML to verify it accepts its own version in a remote connection
[23:29:31] [Server thread/TRACE] [FML]: The mod FML accepts its own version (**.**.**.**)
[23:29:31] [Server thread/INFO] [FML]: Attempting connection with missing mods [minecraft, mcp, FML, forge, aether, astralsorcery, autoreglib, baubles, bewitchment, bibliocraft, biomesoplenty, bloodmagic, bloodmoon, botania, brandonscore, chisel, codechickenlib, cofhcore, cofhworld, craftstudioapi, customspawner, props, mocreatures, extrautils2, forestry, fossil, ftblib, ftbmoney, ftbquests, grimoireofgaia, guideapi, hats, ichunutil, ironchest, itemfilters, journeymap, lootbagmod, mantle, morph, mysticallib, mysticalworld, natura, harvestcraft, patchouli, projectintelligence, quark, randomthings, rats, redstoneflux, roots, tabula, tconstruct, thaumcraft, thermalfoundation, twilightforest, llibrary, betteranimalsplus, orbis-lib, phosphor-lighting] at CLIENT
[23:29:31] [Server thread/INFO] [FML]: Attempting connection with missing mods [minecraft, mcp, FML, forge, aether, astralsorcery, autoreglib, baubles, bewitchment, bibliocraft, biomesoplenty, bloodmagic, bloodmoon, botania, brandonscore, chisel, codechickenlib, cofhcore, cofhworld, craftstudioapi, customspawner, props, mocreatures, extrautils2, forestry, fossil, ftblib, ftbmoney, ftbquests, grimoireofgaia, guideapi, hats, ichunutil, ironchest, itemfilters, journeymap, lootbagmod, mantle, morph, mysticallib, mysticalworld, natura, harvestcraft, patchouli, projectintelligence, quark, randomthings, rats, redstoneflux, roots, tabula, tconstruct, thaumcraft, thermalfoundation, twilightforest, llibrary, betteranimalsplus, orbis-lib, phosphor-lighting] at SERVER
[23:29:31] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod FML
[23:29:31] [Server thread/DEBUG] [FML]: Bar Step: Construction - Forge Mod Loader took 1.143s
[23:29:31] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod forge
[23:29:31] [Server thread/DEBUG] [forge]: Loading Vanilla annotations: null
[23:29:31] [Server thread/DEBUG] [forge]: Preloading CrashReport Classes
[23:29:31] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable
[23:29:31] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Alignment
[23:29:31] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Column
[23:29:31] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Row
[23:29:31] [Server thread/DEBUG] [forge]: net/minecraftforge/fml/client/SplashProgress$1
[23:29:31] [Server thread/DEBUG] [forge]: net/minecraftforge/fml/common/FMLCommonHandler$1
[23:29:31] [Server thread/DEBUG] [forge]: net/minecraftforge/fml/common/Loader$1
[23:29:31] [Server thread/TRACE] [FML]: Mod forge is using network checker : No network checking performed
[23:29:31] [Server thread/TRACE] [FML]: Testing mod forge to verify it accepts its own version in a remote connection
[23:29:31] [Server thread/TRACE] [FML]: The mod forge accepts its own version (14.23.5.2860)
[23:29:31] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into forge for type INSTANCE
[23:29:31] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod forge
[23:29:31] [Server thread/DEBUG] [FML]: Bar Step: Construction - Minecraft Forge took 0.036s
[23:29:31] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod orbis-lib
[23:29:31] [Server thread/TRACE] [FML]: Mod orbis-lib is using network checker : Accepting version 0.2.0
[23:29:31] [Server thread/TRACE] [FML]: Testing mod orbis-lib to verify it accepts its own version in a remote connection
[23:29:31] [Server thread/TRACE] [FML]: The mod orbis-lib accepts its own version (0.2.0)
[23:29:31] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into orbis-lib
[23:29:31] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for orbis-lib
[23:29:31] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.orbis.lib.CapabilityManagerOrbisLib for mod orbis-lib
[23:29:31] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.orbis.lib.CapabilityManagerOrbisLib
[23:29:31] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.orbis.lib.OrbisLib for mod orbis-lib
[23:29:31] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.orbis.lib.OrbisLib
[23:29:31] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into orbis-lib for type INSTANCE
[23:29:31] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod orbis-lib
[23:29:31] [Server thread/DEBUG] [FML]: Bar Step: Construction - OrbisLib took 0.156s
[23:29:31] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod aether
[23:29:31] [Server thread/TRACE] [FML]: Mod aether is using network checker : Accepting version 0.3.0
[23:29:31] [Server thread/TRACE] [FML]: Testing mod aether to verify it accepts its own version in a remote connection
[23:29:31] [Server thread/TRACE] [FML]: The mod aether accepts its own version (0.3.0)
[23:29:31] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into aether
[23:29:31] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for aether
[23:29:31] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemBucketEventListener for mod aether
[23:29:31] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemBucketEventListener
[23:29:31] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.trade.TradeItemPickupListener for mod aether
[23:29:31] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.trade.TradeItemPickupListener
[23:29:31] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerPlaceBlockListener for mod aether
[23:29:31] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerPlaceBlockListener
[23:29:31] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.CapabilityAttachListener for mod aether
[23:29:32] [Server thread/DEBUG] [mixin]: Mixing common.MixinChunk from mixins.phosphor.json into net.minecraft.world.chunk.Chunk
[23:29:32] [Server thread/WARN] [mixin]: Static binding violation: PRIVATE @Overwrite method func_76615_h in mixins.phosphor.json:common.MixinChunk cannot reduce visibiliy of PUBLIC target method, visibility will be upgraded.
[23:29:32] [Server thread/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/IChunkLighting to metadata cache
[23:29:32] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/util/math/Vec3i to metadata cache
[23:29:32] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/WorldProvider to metadata cache
[23:29:32] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/profiler/Profiler to metadata cache
[23:29:32] [Server thread/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/mod/world/WorldChunkSlice to metadata cache
[23:29:32] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/util/EnumFacing to metadata cache
[23:29:32] [Server thread/TRACE] [mixin]: Added class metadata for java/lang/Math to metadata cache
[23:29:32] [Server thread/DEBUG] [mixin]: Mixing common.MixinChunk$Vanilla from mixins.phosphor.json into net.minecraft.world.chunk.Chunk
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.CapabilityAttachListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemGlovesListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemGlovesListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerTeleportListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerTeleportListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemCrossbowSpecialListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemCrossbowSpecialListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerRespawnListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerRespawnListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.ItemsAetherInit for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.ItemsAetherInit
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.world.WorldFallListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.world.WorldFallListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerEatListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerEatListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.SoundsAetherInit for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.SoundsAetherInit
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityFallListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityFallListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerHealListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerHealListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityXPListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityXPListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityJumpListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityJumpListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerAttackListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerAttackListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.trade.TradeInteractListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.trade.TradeInteractListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemAetherShieldListener for mod aether
[23:29:32] [Server thread/INFO] [Quark ASM]: Transforming net.minecraft.util.DamageSource
[23:29:32] [Server thread/INFO] [Quark ASM]: Applying Transformation to method (Names [causePlayerDamage, func_76365_a] Descriptor (Lnet/minecraft/entity/player/EntityPlayer;)Lnet/minecraft/util/DamageSource;)
[23:29:32] [Server thread/INFO] [Quark ASM]: Located Method, patching...
[23:29:32] [Server thread/INFO] [Quark ASM]: Patch result: true
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemAetherShieldListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.ServerTickListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.ServerTickListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.world.WorldTickListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.world.WorldTickListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.BlocksAetherInit for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.BlocksAetherInit
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.items.weapons.swords.ItemSkyrootSword for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.items.weapons.swords.ItemSkyrootSword
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityDeathListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityDeathListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemToolListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemToolListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerEquipItemListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerEquipItemListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerMovementListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerMovementListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerWakeListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerWakeListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerJoinListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerJoinListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.capabilities.DamageSystem for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.capabilities.DamageSystem
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerAetherListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerAetherListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemSkyrootSwordListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemSkyrootSwordListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.capabilities.CapabilityManagerAether for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.capabilities.CapabilityManagerAether
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.BiomesAetherInit for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.BiomesAetherInit
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.world.preparation.PrepEventListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.world.preparation.PrepEventListener
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.RecipesAether for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.RecipesAether
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerMountListener for mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerMountListener
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into aether for type INSTANCE
[23:29:32] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod aether
[23:29:32] [Server thread/DEBUG] [FML]: Bar Step: Construction - Aether II took 1.235s
[23:29:32] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod baubles
[23:29:32] [Server thread/TRACE] [FML]: Mod baubles is using network checker : Accepting version 1.5.2
[23:29:32] [Server thread/TRACE] [FML]: Testing mod baubles to verify it accepts its own version in a remote connection
[23:29:32] [Server thread/TRACE] [FML]: The mod baubles accepts its own version (1.5.2)
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into baubles
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for baubles
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for baubles.common.items.ItemRing for mod baubles
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class baubles.common.items.ItemRing
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into baubles for type INSTANCE
[23:29:32] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod baubles
[23:29:32] [Server thread/DEBUG] [FML]: Bar Step: Construction - Baubles took 0.014s
[23:29:32] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod astralsorcery
[23:29:32] [Server thread/TRACE] [FML]: Mod astralsorcery is using network checker : Invoking method checkModLists
[23:29:32] [Server thread/TRACE] [FML]: Testing mod astralsorcery to verify it accepts its own version in a remote connection
[23:29:32] [Server thread/TRACE] [FML]: The mod astralsorcery accepts its own version (1.10.27)
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into astralsorcery
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for astralsorcery
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into astralsorcery for type INSTANCE
[23:29:32] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod astralsorcery
[23:29:32] [Server thread/DEBUG] [FML]: Bar Step: Construction - Astral Sorcery took 0.110s
[23:29:32] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod quark
[23:29:32] [Server thread/TRACE] [FML]: Mod quark is using network checker : Invoking method acceptsMods
[23:29:32] [Server thread/TRACE] [FML]: Testing mod quark to verify it accepts its own version in a remote connection
[23:29:32] [Server thread/TRACE] [FML]: The mod quark accepts its own version (r1.6-179)
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into quark
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for quark
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.quark.base.client.ContributorRewardHandler for mod quark
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.quark.base.client.ContributorRewardHandler
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.quark.base.capability.CapabilityHandler for mod quark
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.quark.base.capability.CapabilityHandler
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.quark.base.module.ModuleLoader$EventHandler for mod quark
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.quark.base.module.ModuleLoader$EventHandler
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into quark for type INSTANCE
[23:29:32] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod quark
[23:29:32] [Server thread/DEBUG] [FML]: Bar Step: Construction - Quark took 0.031s
[23:29:32] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod autoreglib
[23:29:32] [Server thread/TRACE] [FML]: Mod autoreglib is using network checker : Accepting version 1.3-32
[23:29:32] [Server thread/TRACE] [FML]: Testing mod autoreglib to verify it accepts its own version in a remote connection
[23:29:32] [Server thread/TRACE] [FML]: The mod autoreglib accepts its own version (1.3-32)
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into autoreglib
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for autoreglib
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.arl.util.ProxyRegistry for mod autoreglib
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.arl.util.ProxyRegistry
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into autoreglib for type INSTANCE
[23:29:32] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod autoreglib
[23:29:32] [Server thread/DEBUG] [FML]: Bar Step: Construction - AutoRegLib took 0.007s
[23:29:32] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod thaumcraft
[23:29:32] [Server thread/DEBUG] [forge]: Preloading CrashReport Classes
[23:29:32] [Server thread/DEBUG] [forge]: thaumcraft/client/fx/ParticleEngine$1
[23:29:32] [Server thread/DEBUG] [forge]: thaumcraft/client/fx/ParticleEngine$2
[23:29:32] [Server thread/DEBUG] [forge]: thaumcraft/client/fx/ParticleEngine$3
[23:29:32] [Server thread/DEBUG] [forge]: thaumcraft/client/fx/ParticleEngine$4
[23:29:32] [Server thread/TRACE] [FML]: Mod thaumcraft is using network checker : Accepting version 6.1.BETA26
[23:29:32] [Server thread/TRACE] [FML]: Testing mod thaumcraft to verify it accepts its own version in a remote connection
[23:29:32] [Server thread/TRACE] [FML]: The mod thaumcraft accepts its own version (6.1.BETA26)
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into thaumcraft
[23:29:32] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for thaumcraft
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for thaumcraft.common.lib.network.EventHandlerNetwork for mod thaumcraft
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class thaumcraft.common.lib.network.EventHandlerNetwork
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for thaumcraft.common.lib.events.CraftingEvents for mod thaumcraft
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class thaumcraft.common.lib.events.CraftingEvents
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for thaumcraft.common.lib.events.ChunkEvents for mod thaumcraft
[23:29:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class thaumcraft.common.lib.events.ChunkEvents
[23:29:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for thaumcraft.common.entities.construct.EntityArcaneBore for mod thaumcraft
[23:29:32] [Server thread/INFO] [Astral Core]: [AstralTransformer] Transforming pa : net.minecraft.network.NetHandlerPlayServer with 1 patches!
[23:29:32] [Server thread/INFO] [Astral Core]: [AstralTransformer] Applied patch PATCHSERVEREXTENDENTITYINTERACTREACH
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class thaumcraft.common.entities.construct.EntityArcaneBore
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for thaumcraft.common.lib.events.ToolEvents for mod thaumcraft
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class thaumcraft.common.lib.events.ToolEvents
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for thaumcraft.common.lib.events.PlayerEvents for mod thaumcraft
[23:29:33] [Server thread/INFO] [Astral Core]: [AstralTransformer] Transforming thaumcraft.common.lib.events.PlayerEvents : thaumcraft.common.lib.events.PlayerEvents with 1 patches!
[23:29:33] [Server thread/INFO] [Astral Core]: [AstralTransformer] Applied patch PATCHRUNICSHIELDINGHOOK
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class thaumcraft.common.lib.events.PlayerEvents
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for thaumcraft.Registrar for mod thaumcraft
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class thaumcraft.Registrar
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for thaumcraft.common.lib.events.EntityEvents for mod thaumcraft
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class thaumcraft.common.lib.events.EntityEvents
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for thaumcraft.common.lib.events.ServerEvents for mod thaumcraft
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class thaumcraft.common.lib.events.ServerEvents
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for thaumcraft.common.lib.events.WorldEvents for mod thaumcraft
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class thaumcraft.common.lib.events.WorldEvents
[23:29:33] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into thaumcraft for type INSTANCE
[23:29:33] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod thaumcraft
[23:29:33] [Server thread/DEBUG] [FML]: Bar Step: Construction - Thaumcraft took 0.188s
[23:29:33] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod botania
[23:29:33] [Server thread/TRACE] [FML]: Mod botania is using network checker : Accepting version r1.10-364
[23:29:33] [Server thread/TRACE] [FML]: Testing mod botania to verify it accepts its own version in a remote connection
[23:29:33] [Server thread/TRACE] [FML]: The mod botania accepts its own version (r1.10-364)
[23:29:33] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into botania
[23:29:33] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for botania
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.relic.ItemLokiRing for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.relic.ItemLokiRing
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.block.ItemBlockSpecialFlower for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.block.ItemBlockSpecialFlower
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.handler.PixieHandler for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.handler.PixieHandler
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.subtile.generating.SubTileNarslimmus for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.subtile.generating.SubTileNarslimmus
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.handler.ConfigHandler$ChangeListener for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.handler.ConfigHandler$ChangeListener
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.handler.CommonTickHandler for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.handler.CommonTickHandler
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.subtile.functional.SubTileLoonuim for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.subtile.functional.SubTileLoonuim
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.handler.SheddingHandler for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.handler.SheddingHandler
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.string.BlockRedStringInterceptor for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.string.BlockRedStringInterceptor
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.crafting.ModCraftingRecipes for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.crafting.ModCraftingRecipes
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.ModItems for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.ModItems
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.relic.ItemOdinRing for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.relic.ItemOdinRing
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.handler.SleepingHandler for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.handler.SleepingHandler
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.BlockGhostRail for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.BlockGhostRail
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.equipment.bauble.ItemBauble for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.equipment.bauble.ItemBauble
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.brew.ModPotions for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.brew.ModPotions
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.BlockFelPumpkin for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.BlockFelPumpkin
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.core.handler.ModSounds for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.core.handler.ModSounds
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.subtile.functional.SubTileVinculotus for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.subtile.functional.SubTileVinculotus
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.ModBlocks for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.ModBlocks
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.block.ModFluffBlocks for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.block.ModFluffBlocks
[23:29:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.botania.common.item.equipment.bauble.ItemGoddessCharm for mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.botania.common.item.equipment.bauble.ItemGoddessCharm
[23:29:33] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into botania for type INSTANCE
[23:29:33] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod botania
[23:29:33] [Server thread/DEBUG] [FML]: Bar Step: Construction - Botania took 0.833s
[23:29:33] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod patchouli
[23:29:33] [Server thread/DEBUG] [forge]: Preloading CrashReport Classes
[23:29:33] [Server thread/DEBUG] [forge]: vazkii/patchouli/client/handler/BookCrashHandler
[23:29:33] [Server thread/TRACE] [FML]: Mod patchouli is using network checker : Accepting version 1.0-23.6
[23:29:33] [Server thread/TRACE] [FML]: Testing mod patchouli to verify it accepts its own version in a remote connection
[23:29:33] [Server thread/TRACE] [FML]: The mod patchouli accepts its own version (1.0-23.6)
[23:29:33] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into patchouli
[23:29:33] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for patchouli
[23:29:33] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into patchouli for type INSTANCE
[23:29:33] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod patchouli
[23:29:33] [Server thread/DEBUG] [FML]: Bar Step: Construction - Patchouli took 0.053s
[23:29:33] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod betteranimalsplus
[23:29:34] [Server thread/TRACE] [FML]: Mod betteranimalsplus is using network checker : Accepting version 9.0.1
[23:29:34] [Server thread/TRACE] [FML]: Testing mod betteranimalsplus to verify it accepts its own version in a remote connection
[23:29:34] [Server thread/TRACE] [FML]: The mod betteranimalsplus accepts its own version (9.0.1)
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into betteranimalsplus
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for betteranimalsplus
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for its_meow.betteranimalsplus.common.entity.EntityFreshwaterEel for mod betteranimalsplus
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class its_meow.betteranimalsplus.common.entity.EntityFreshwaterEel
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for its_meow.betteranimalsplus.init.BetterAnimalsPlusRegistrar for mod betteranimalsplus
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class its_meow.betteranimalsplus.init.BetterAnimalsPlusRegistrar
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for its_meow.betteranimalsplus.common.CommonEventHandler for mod betteranimalsplus
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class its_meow.betteranimalsplus.common.CommonEventHandler
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for its_meow.betteranimalsplus.BetterAnimalsPlusMod for mod betteranimalsplus
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class its_meow.betteranimalsplus.BetterAnimalsPlusMod
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into betteranimalsplus for type INSTANCE
[23:29:34] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod betteranimalsplus
[23:29:34] [Server thread/DEBUG] [FML]: Bar Step: Construction - Better Animals Plus took 0.057s
[23:29:34] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod bewitchment
[23:29:34] [Server thread/TRACE] [FML]: Mod bewitchment is using network checker : Accepting version 0.22.63
[23:29:34] [Server thread/TRACE] [FML]: Testing mod bewitchment to verify it accepts its own version in a remote connection
[23:29:34] [Server thread/TRACE] [FML]: The mod bewitchment accepts its own version (0.22.63)
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into bewitchment
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for bewitchment
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.bewitchment.ModConfig$SyncConfig for mod bewitchment
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.bewitchment.ModConfig$SyncConfig
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.bewitchment.registry.ModRegistries for mod bewitchment
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.bewitchment.registry.ModRegistries
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into bewitchment for type INSTANCE
[23:29:34] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod bewitchment
[23:29:34] [Server thread/DEBUG] [FML]: Bar Step: Construction - Bewitchment took 0.115s
[23:29:34] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod bibliocraft
[23:29:34] [Server thread/TRACE] [FML]: Mod bibliocraft is using network checker : Accepting version 2.4.6
[23:29:34] [Server thread/TRACE] [FML]: Testing mod bibliocraft to verify it accepts its own version in a remote connection
[23:29:34] [Server thread/TRACE] [FML]: The mod bibliocraft accepts its own version (2.4.6)
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into bibliocraft
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for bibliocraft
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for jds.bibliocraft.BiblioCraft$RegisterTheThings for mod bibliocraft
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class jds.bibliocraft.BiblioCraft$RegisterTheThings
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into bibliocraft for type INSTANCE
[23:29:34] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod bibliocraft
[23:29:34] [Server thread/DEBUG] [FML]: Bar Step: Construction - BiblioCraft took 0.047s
[23:29:34] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod biomesoplenty
[23:29:34] [Server thread/TRACE] [FML]: Mod biomesoplenty is using network checker : Accepting version 7.0.1.2445
[23:29:34] [Server thread/TRACE] [FML]: Testing mod biomesoplenty to verify it accepts its own version in a remote connection
[23:29:34] [Server thread/TRACE] [FML]: The mod biomesoplenty accepts its own version (7.0.1.2445)
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into biomesoplenty
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for biomesoplenty
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into biomesoplenty for type INSTANCE
[23:29:34] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod biomesoplenty
[23:29:34] [Server thread/DEBUG] [FML]: Bar Step: Construction - Biomes O' Plenty took 0.014s
[23:29:34] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod guideapi
[23:29:34] [Server thread/TRACE] [FML]: Mod guideapi is using network checker : Accepting version 1.12-2.1.8-63
[23:29:34] [Server thread/TRACE] [FML]: Testing mod guideapi to verify it accepts its own version in a remote connection
[23:29:34] [Server thread/TRACE] [FML]: The mod guideapi accepts its own version (1.12-2.1.8-63)
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into guideapi
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for guideapi
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for amerifrance.guideapi.RegistrarGuideAPI for mod guideapi
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class amerifrance.guideapi.RegistrarGuideAPI
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for amerifrance.guideapi.util.EventHandler for mod guideapi
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class amerifrance.guideapi.util.EventHandler
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into guideapi for type INSTANCE
[23:29:34] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod guideapi
[23:29:34] [Server thread/DEBUG] [FML]: Bar Step: Construction - Guide-API took 0.033s
[23:29:34] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod bloodmagic
[23:29:34] [Server thread/TRACE] [FML]: Mod bloodmagic is using network checker : Accepting version 1.12.2-2.4.3-105
[23:29:34] [Server thread/TRACE] [FML]: Testing mod bloodmagic to verify it accepts its own version in a remote connection
[23:29:34] [Server thread/TRACE] [FML]: The mod bloodmagic accepts its own version (1.12.2-2.4.3-105)
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for WayofTime.bloodmagic.util.handler.event.WillHandler for mod bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class WayofTime.bloodmagic.util.handler.event.WillHandler
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for WayofTime.bloodmagic.util.handler.event.StatTrackerHandler for mod bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class WayofTime.bloodmagic.util.handler.event.StatTrackerHandler
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for WayofTime.bloodmagic.core.RegistrarBloodMagicRecipes for mod bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class WayofTime.bloodmagic.core.RegistrarBloodMagicRecipes
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks for mod bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for WayofTime.bloodmagic.ConfigHandler for mod bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class WayofTime.bloodmagic.ConfigHandler
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for WayofTime.bloodmagic.potion.PotionEventHandlers for mod bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class WayofTime.bloodmagic.potion.PotionEventHandlers
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for WayofTime.bloodmagic.core.RegistrarBloodMagic for mod bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class WayofTime.bloodmagic.core.RegistrarBloodMagic
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for WayofTime.bloodmagic.util.handler.event.GenericHandler for mod bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class WayofTime.bloodmagic.util.handler.event.GenericHandler
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for WayofTime.bloodmagic.util.handler.event.LivingArmourHandler for mod bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class WayofTime.bloodmagic.util.handler.event.LivingArmourHandler
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for WayofTime.bloodmagic.core.RegistrarBloodMagicItems for mod bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class WayofTime.bloodmagic.core.RegistrarBloodMagicItems
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for WayofTime.bloodmagic.util.handler.event.CraftingHandler for mod bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class WayofTime.bloodmagic.util.handler.event.CraftingHandler
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into bloodmagic for type INSTANCE
[23:29:34] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod bloodmagic
[23:29:34] [Server thread/DEBUG] [FML]: Bar Step: Construction - Blood Magic: Alchemical Wizardry took 0.310s
[23:29:34] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod bloodmoon
[23:29:34] [Server thread/TRACE] [FML]: Mod bloodmoon is using network checker : Accepting version 1.5.3
[23:29:34] [Server thread/TRACE] [FML]: Testing mod bloodmoon to verify it accepts its own version in a remote connection
[23:29:34] [Server thread/TRACE] [FML]: The mod bloodmoon accepts its own version (1.5.3)
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into bloodmoon
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for bloodmoon
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into bloodmoon for type INSTANCE
[23:29:34] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod bloodmoon
[23:29:34] [Server thread/DEBUG] [FML]: Bar Step: Construction - Bloodmoon took 0.035s
[23:29:34] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod codechickenlib
[23:29:34] [Server thread/TRACE] [FML]: Mod codechickenlib is using network checker : Accepting version 3.2.3.358
[23:29:34] [Server thread/TRACE] [FML]: Testing mod codechickenlib to verify it accepts its own version in a remote connection
[23:29:34] [Server thread/TRACE] [FML]: The mod codechickenlib accepts its own version (**.**.**.**)
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into codechickenlib
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for codechickenlib
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for codechicken.lib.internal.CCLLog for mod codechickenlib
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class codechicken.lib.internal.CCLLog
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for codechicken.lib.configuration.ConfigSyncManager for mod codechickenlib
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class codechicken.lib.configuration.ConfigSyncManager
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into codechickenlib for type INSTANCE
[23:29:34] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod codechickenlib
[23:29:34] [Server thread/DEBUG] [FML]: Bar Step: Construction - CodeChicken Lib took 0.272s
[23:29:34] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod redstoneflux
[23:29:34] [Server thread/ERROR] [FML]: The mod redstoneflux is expecting signature 8a6abf2cb9e141b866580d369ba6548732eff25f for source RedstoneFlux-1.12-2.1.1.1-universal.jar, however there is no signature matching that description
[23:29:34] [Server thread/TRACE] [FML]: Mod redstoneflux is using network checker : Accepting version 2.1.1
[23:29:34] [Server thread/TRACE] [FML]: Testing mod redstoneflux to verify it accepts its own version in a remote connection
[23:29:34] [Server thread/TRACE] [FML]: The mod redstoneflux accepts its own version (2.1.1)
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into redstoneflux
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for redstoneflux
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into redstoneflux for type INSTANCE
[23:29:34] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod redstoneflux
[23:29:34] [Server thread/DEBUG] [FML]: Bar Step: Construction - Redstone Flux took 0.008s
[23:29:34] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod brandonscore
[23:29:34] [Server thread/INFO] [brandonscore]: Brandon's Core online! Waiting for Draconic Evolution to join the party....
[23:29:34] [Server thread/INFO] [draconicevolution]: ...
[23:29:34] [Server thread/INFO] [brandonscore]: Aww... Im sad now...
[23:29:34] [Server thread/TRACE] [FML]: Mod brandonscore is using network checker : Accepting version 2.4.20
[23:29:34] [Server thread/TRACE] [FML]: Testing mod brandonscore to verify it accepts its own version in a remote connection
[23:29:34] [Server thread/TRACE] [FML]: The mod brandonscore accepts its own version (2.4.20)
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into brandonscore
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for brandonscore
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into brandonscore for type INSTANCE
[23:29:34] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod brandonscore
[23:29:34] [Server thread/DEBUG] [FML]: Bar Step: Construction - Brandon's Core took 0.031s
[23:29:34] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mysticalworld
[23:29:34] [Server thread/TRACE] [FML]: Mod mysticalworld is using network checker : Accepting version 1.12.2-1.11.0
[23:29:34] [Server thread/TRACE] [FML]: Testing mod mysticalworld to verify it accepts its own version in a remote connection
[23:29:34] [Server thread/TRACE] [FML]: The mod mysticalworld accepts its own version (1.12.2-1.11.0)
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into mysticalworld
[23:29:34] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for mysticalworld
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.mysticalworld.events.SquidHandler for mod mysticalworld
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.mysticalworld.events.SquidHandler
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.mysticalworld.events.LeafHandler for mod mysticalworld
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.mysticalworld.events.LeafHandler
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.mysticalworld.init.ModVillagers for mod mysticalworld
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.mysticalworld.init.ModVillagers
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.mysticalworld.events.BookHandler for mod mysticalworld
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.mysticalworld.events.BookHandler
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.mysticalworld.events.MappingHandler for mod mysticalworld
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.mysticalworld.events.MappingHandler
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.mysticalworld.modifiers.PlayerModifierRegistry for mod mysticalworld
[23:29:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.mysticalworld.modifiers.PlayerModifierRegistry
[23:29:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.mysticalworld.config.ConfigManager for mod mysticalworld
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.mysticalworld.config.ConfigManager
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.mysticalworld.events.CapabilityHandler for mod mysticalworld
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.mysticalworld.events.CapabilityHandler
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.mysticalworld.events.ShoulderHandler for mod mysticalworld
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.mysticalworld.events.ShoulderHandler
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.mysticalworld.events.DamageHandler for mod mysticalworld
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.mysticalworld.events.DamageHandler
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.mysticalworld.events.LootHandler for mod mysticalworld
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.mysticalworld.events.LootHandler
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into mysticalworld for type INSTANCE
[23:29:35] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mysticalworld
[23:29:35] [Server thread/DEBUG] [FML]: Bar Step: Construction - Mystical World took 0.167s
[23:29:35] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod chisel
[23:29:35] [Server thread/TRACE] [FML]: Mod chisel is using network checker : Accepting version MC1.12.2-1.0.2.45
[23:29:35] [Server thread/TRACE] [FML]: Testing mod chisel to verify it accepts its own version in a remote connection
[23:29:35] [Server thread/TRACE] [FML]: The mod chisel accepts its own version (MC1.12.2-1.0.2.45)
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into chisel
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for chisel
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for team.chisel.common.block.BreakSpeedHandler for mod chisel
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class team.chisel.common.block.BreakSpeedHandler
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for team.chisel.Features for mod chisel
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class team.chisel.Features
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into chisel for type INSTANCE
[23:29:35] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod chisel
[23:29:35] [Server thread/DEBUG] [FML]: Bar Step: Construction - Chisel took 0.203s
[23:29:35] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod cofhcore
[23:29:35] [Server thread/TRACE] [FML]: Mod cofhcore is using network checker : Accepting version 4.6.6
[23:29:35] [Server thread/TRACE] [FML]: Testing mod cofhcore to verify it accepts its own version in a remote connection
[23:29:35] [Server thread/TRACE] [FML]: The mod cofhcore accepts its own version (4.6.6)
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into cofhcore
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for cofhcore
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into cofhcore for type INSTANCE
[23:29:35] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod cofhcore
[23:29:35] [Server thread/DEBUG] [FML]: Bar Step: Construction - CoFH Core took 0.016s
[23:29:35] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod cofhworld
[23:29:35] [Server thread/ERROR] [FML]: The mod cofhworld is expecting signature 8a6abf2cb9e141b866580d369ba6548732eff25f for source CoFHWorld-1.12.2-1.4.0.1-universal.jar, however there is no signature matching that description
[23:29:35] [Server thread/TRACE] [FML]: Mod cofhworld is using network checker : No network checking performed
[23:29:35] [Server thread/TRACE] [FML]: Testing mod cofhworld to verify it accepts its own version in a remote connection
[23:29:35] [Server thread/TRACE] [FML]: The mod cofhworld accepts its own version (1.4.0)
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into cofhworld
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for cofhworld
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into cofhworld for type INSTANCE
[23:29:35] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod cofhworld
[23:29:35] [Server thread/DEBUG] [FML]: Bar Step: Construction - CoFH World took 0.046s
[23:29:35] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod craftstudioapi
[23:29:35] [Server thread/TRACE] [FML]: Mod craftstudioapi is using network checker : Accepting version 1.0.0
[23:29:35] [Server thread/TRACE] [FML]: Testing mod craftstudioapi to verify it accepts its own version in a remote connection
[23:29:35] [Server thread/TRACE] [FML]: The mod craftstudioapi accepts its own version (1.0.0)
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into craftstudioapi
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for craftstudioapi
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into craftstudioapi for type INSTANCE
[23:29:35] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod craftstudioapi
[23:29:35] [Server thread/DEBUG] [FML]: Bar Step: Construction - CraftStudio API took 0.012s
[23:29:35] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod customspawner
[23:29:35] [Server thread/DEBUG] [mixin]: Mixing common.MixinChunkProviderServer from mixins.phosphor.json into net.minecraft.world.gen.ChunkProviderServer
[23:29:35] [Server thread/INFO] [Quark ASM]: Transforming net.minecraft.world.WorldServer
[23:29:35] [Server thread/INFO] [Quark ASM]: Applying Transformation to method (Names [areAllPlayersAsleep, func_73056_e] Descriptor ()Z)
[23:29:35] [Server thread/INFO] [Quark ASM]: Located Method, patching...
[23:29:35] [Server thread/INFO] [Quark ASM]: Patch result: true
[23:29:35] [Server thread/INFO] [Quark ASM]: Applying Transformation to method (Names [wakeAllPlayers, func_73053_d] Descriptor ()V)
[23:29:35] [Server thread/INFO] [Quark ASM]: Located Method, patching...
[23:29:35] [Server thread/INFO] [Quark ASM]: Patch result: true
[23:29:35] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/WorldServer to metadata cache
[23:29:35] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/IChunkProvider to metadata cache
[23:29:35] [Server thread/TRACE] [FML]: Mod customspawner is using network checker : Accepting version 3.11.4
[23:29:35] [Server thread/TRACE] [FML]: Testing mod customspawner to verify it accepts its own version in a remote connection
[23:29:35] [Server thread/TRACE] [FML]: The mod customspawner accepts its own version (3.11.4)
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into customspawner
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for customspawner
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into customspawner for type INSTANCE
[23:29:35] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod customspawner
[23:29:35] [Server thread/DEBUG] [FML]: Bar Step: Construction - DrZhark's CustomSpawner took 0.060s
[23:29:35] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod props
[23:29:35] [Server thread/TRACE] [FML]: Mod props is using network checker : Accepting version 2.6.3.7
[23:29:35] [Server thread/TRACE] [FML]: Testing mod props to verify it accepts its own version in a remote connection
[23:29:35] [Server thread/TRACE] [FML]: The mod props accepts its own version (**.**.**.**)
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into props
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for props
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into props for type INSTANCE
[23:29:35] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod props
[23:29:35] [Server thread/DEBUG] [FML]: Bar Step: Construction - Decocraft took 0.024s
[23:29:35] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mocreatures
[23:29:35] [Server thread/TRACE] [FML]: Mod mocreatures is using network checker : Accepting range 12.0.5
[23:29:35] [Server thread/TRACE] [FML]: Testing mod mocreatures to verify it accepts its own version in a remote connection
[23:29:35] [Server thread/TRACE] [FML]: The mod mocreatures accepts its own version (12.0.5)
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into mocreatures
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for mocreatures
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCBlocks$RegistrationHandler for mod mocreatures
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCBlocks$RegistrationHandler
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCBiomes$RegistrationHandler for mod mocreatures
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCBiomes$RegistrationHandler
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCRecipes$RegistrationHandler for mod mocreatures
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCRecipes$RegistrationHandler
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCItems$RegistrationHandler for mod mocreatures
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCItems$RegistrationHandler
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCEntities$RegistrationHandler for mod mocreatures
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCEntities$RegistrationHandler
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCSoundEvents$RegistrationHandler for mod mocreatures
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCSoundEvents$RegistrationHandler
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into mocreatures for type INSTANCE
[23:29:35] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mocreatures
[23:29:35] [Server thread/DEBUG] [FML]: Bar Step: Construction - DrZhark's Mo'Creatures Mod took 0.069s
[23:29:35] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mantle
[23:29:35] [Server thread/DEBUG] [forge]: Preloading CrashReport Classes
[23:29:35] [Server thread/DEBUG] [forge]: slimeknights/mantle/pulsar/internal/CrashHandler
[23:29:35] [Server thread/TRACE] [FML]: Mod mantle is using network checker : Accepting version 1.12-1.3.3.55
[23:29:35] [Server thread/TRACE] [FML]: Testing mod mantle to verify it accepts its own version in a remote connection
[23:29:35] [Server thread/TRACE] [FML]: The mod mantle accepts its own version (1.12-1.3.3.55)
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into mantle
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for mantle
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into mantle for type INSTANCE
[23:29:35] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mantle
[23:29:35] [Server thread/DEBUG] [FML]: Bar Step: Construction - Mantle took 0.007s
[23:29:35] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod twilightforest
[23:29:35] [Server thread/TRACE] [FML]: Mod twilightforest is using network checker : Accepting version 3.11.1021
[23:29:35] [Server thread/TRACE] [FML]: Testing mod twilightforest to verify it accepts its own version in a remote connection
[23:29:35] [Server thread/TRACE] [FML]: The mod twilightforest accepts its own version (3.11.1021)
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into twilightforest
[23:29:35] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for twilightforest
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.block.RegisterBlockEvent for mod twilightforest
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.block.RegisterBlockEvent
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.potions.TFRegisterPotionEvent for mod twilightforest
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.potions.TFRegisterPotionEvent
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.entity.TFEntities for mod twilightforest
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.entity.TFEntities
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.TFTickHandler for mod twilightforest
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.TFTickHandler
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.recipe.TFRecipes for mod twilightforest
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.recipe.TFRecipes
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.TFSounds for mod twilightforest
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.TFSounds
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.ItemTFFieryPick for mod twilightforest
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.ItemTFFieryPick
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.TFConfig for mod twilightforest
[23:29:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.TFConfig
[23:29:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.RegisterItemEvent for mod twilightforest
[23:29:36] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.RegisterItemEvent
[23:29:36] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.biomes.RegistryBiomeEvent for mod twilightforest
[23:29:36] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.biomes.RegistryBiomeEvent
[23:29:36] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.TFEventListener for mod twilightforest
[23:29:36] [Server thread/DEBUG] [RandomThingsCore]: Found InventoryPlayer Class: net/minecraft/entity/player/InventoryPlayer
[23:29:36] [Server thread/DEBUG] [RandomThingsCore]: - Found dropAllItems (1/2)
[23:29:36] [Server thread/DEBUG] [RandomThingsCore]: - Patched dropAllItems (2/2)
[23:29:36] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.TFEventListener
[23:29:36] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.ItemTFKnightlySword for mod twilightforest
[23:29:36] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.ItemTFKnightlySword
[23:29:36] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.ItemTFMinotaurAxe for mod twilightforest
[23:29:36] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.ItemTFMinotaurAxe
[23:29:36] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into twilightforest for type INSTANCE
[23:29:36] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod twilightforest
[23:29:36] [Server thread/DEBUG] [FML]: Bar Step: Construction - The Twilight Forest took 0.623s
[23:29:36] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod tconstruct
[23:29:36] [Server thread/DEBUG] [Pulsar-tconstruct]: Attaching [PulseManager[tconstruct]] to event bus for container [FMLMod:tconstruct{1.12.2-2.13.0.183}]
[23:29:36] [Server thread/INFO] [Pulsar-tconstruct]: Skipping Pulse chiselsandbitsIntegration; missing dependency: chiselsandbits
[23:29:36] [Server thread/INFO] [Pulsar-tconstruct]: Skipping Pulse craftingtweaksIntegration; missing dependency: craftingtweaks
[23:29:36] [Server thread/INFO] [Pulsar-tconstruct]: Skipping Pulse wailaIntegration; missing dependency: waila
[23:29:36] [Server thread/INFO] [Pulsar-tconstruct]: Skipping Pulse theoneprobeIntegration; missing dependency: theoneprobe
[23:29:36] [Server thread/INFO] [tconstruct]: Preparing to take over the world
[23:29:36] [Server thread/TRACE] [FML]: Mod tconstruct is using network checker : Invoking method matchModVersions
[23:29:36] [Server thread/TRACE] [FML]: Testing mod tconstruct to verify it accepts its own version in a remote connection
[23:29:36] [Server thread/TRACE] [FML]: The mod tconstruct accepts its own version (1.12.2-2.13.0.183)
[23:29:36] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into tconstruct
[23:29:36] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for tconstruct
[23:29:36] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for slimeknights.tconstruct.tools.common.inventory.ContainerCraftingStation for mod tconstruct
[23:29:36] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class slimeknights.tconstruct.tools.common.inventory.ContainerCraftingStation
[23:29:36] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for slimeknights.tconstruct.common.Sounds for mod tconstruct
[23:29:36] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class slimeknights.tconstruct.common.Sounds
[23:29:36] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into tconstruct for type INSTANCE
[23:29:36] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod tconstruct
[23:29:36] [Server thread/DEBUG] [FML]: Bar Step: Construction - Tinkers' Construct took 0.770s
[23:29:36] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod extrautils2
[23:29:36] [Server thread/TRACE] [FML]: Mod extrautils2 is using network checker : Accepting version 1.0
[23:29:36] [Server thread/TRACE] [FML]: Testing mod extrautils2 to verify it accepts its own version in a remote connection
[23:29:36] [Server thread/TRACE] [FML]: The mod extrautils2 accepts its own version (1.0)
[23:29:36] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into extrautils2
[23:29:36] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for extrautils2
[23:29:36] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into extrautils2 for type INSTANCE
[23:29:36] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod extrautils2
[23:29:36] [Server thread/DEBUG] [FML]: Bar Step: Construction - Extra Utilities 2 took 0.053s
[23:29:36] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod natura
[23:29:36] [Server thread/DEBUG] [Pulsar-natura]: Attaching [PulseManager[natura]] to event bus for container [FMLMod:natura{1.12.2-4.3.2.69}]
[23:29:37] [Server thread/INFO] [Pulsar-natura]: Skipping Pulse craftingtweaksIntegration; missing dependency: craftingtweaks
[23:29:37] [Server thread/TRACE] [FML]: Mod natura is using network checker : Accepting version 1.12.2-4.3.2.69
[23:29:37] [Server thread/TRACE] [FML]: Testing mod natura to verify it accepts its own version in a remote connection
[23:29:37] [Server thread/TRACE] [FML]: The mod natura accepts its own version (1.12.2-4.3.2.69)
[23:29:37] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into natura
[23:29:37] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for natura
[23:29:37] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into natura for type INSTANCE
[23:29:37] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod natura
[23:29:37] [Server thread/DEBUG] [FML]: Bar Step: Construction - Natura took 0.435s
[23:29:37] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod forestry
[23:29:37] [Server thread/DEBUG] [forge]: Preloading CrashReport Classes
[23:29:37] [Server thread/DEBUG] [forge]: forestry/core/utils/ForestryModEnvWarningCallable
[23:29:37] [Server thread/TRACE] [FML]: Mod forestry is using network checker : Accepting version 5.8.2.422
[23:29:37] [Server thread/TRACE] [FML]: Testing mod forestry to verify it accepts its own version in a remote connection
[23:29:37] [Server thread/TRACE] [FML]: The mod forestry accepts its own version (**.**.**.**)
[23:29:37] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into forestry
[23:29:37] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for forestry
[23:29:37] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for forestry.core.utils.MigrationHelper for mod forestry
[23:29:37] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class forestry.core.utils.MigrationHelper
[23:29:37] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into forestry for type INSTANCE
[23:29:37] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod forestry
[23:29:37] [Server thread/DEBUG] [FML]: Bar Step: Construction - Forestry took 0.476s
[23:29:37] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod llibrary
[23:29:37] [Server thread/TRACE] [FML]: Mod llibrary is using network checker : Accepting version 1.7.20
[23:29:37] [Server thread/TRACE] [FML]: Testing mod llibrary to verify it accepts its own version in a remote connection
[23:29:37] [Server thread/TRACE] [FML]: The mod llibrary accepts its own version (1.7.20)
[23:29:37] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into llibrary
[23:29:37] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for llibrary
[23:29:37] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into llibrary for type INSTANCE
[23:29:37] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod llibrary
[23:29:37] [Server thread/DEBUG] [FML]: Bar Step: Construction - LLibrary took 0.026s
[23:29:37] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod fossil
[23:29:37] [Server thread/TRACE] [FML]: Mod fossil is using network checker : Accepting version 8.0.5
[23:29:37] [Server thread/TRACE] [FML]: Testing mod fossil to verify it accepts its own version in a remote connection
[23:29:37] [Server thread/TRACE] [FML]: The mod fossil accepts its own version (8.0.5)
[23:29:37] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into fossil
[23:29:37] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for fossil
[23:29:37] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for fossilsarcheology.client.ClientProxy for mod fossil
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class fossilsarcheology.client.ClientProxy
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for fossilsarcheology.server.ServerProxy for mod fossil
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class fossilsarcheology.server.ServerProxy
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into fossil for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod fossil
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - Fossils and Archeology Revival took 0.109s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ftblib
[23:29:38] [Server thread/TRACE] [FML]: Mod ftblib is using network checker : Invoking method checkModLists
[23:29:38] [Server thread/TRACE] [FML]: Testing mod ftblib to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod ftblib accepts its own version (**.**.**.**)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ftblib
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ftblib
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.feed_the_beast.ftblib.lib.data.Universe for mod ftblib
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.feed_the_beast.ftblib.lib.data.Universe
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.feed_the_beast.ftblib.FTBLibConfig for mod ftblib
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.feed_the_beast.ftblib.FTBLibConfig
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.feed_the_beast.ftblib.FTBLibEventHandler for mod ftblib
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.feed_the_beast.ftblib.FTBLibEventHandler
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into ftblib for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ftblib
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - FTB Library took 0.227s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod itemfilters
[23:29:38] [Server thread/TRACE] [FML]: Mod itemfilters is using network checker : Accepting version 1.0.4.2
[23:29:38] [Server thread/TRACE] [FML]: Testing mod itemfilters to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod itemfilters accepts its own version (**.**.**.**)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into itemfilters
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for itemfilters
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.latmod.mods.itemfilters.ItemFiltersEventHandler for mod itemfilters
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.latmod.mods.itemfilters.ItemFiltersEventHandler
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into itemfilters for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod itemfilters
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - Item Filters took 0.012s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ftbquests
[23:29:38] [Server thread/TRACE] [FML]: Mod ftbquests is using network checker : No network checking performed
[23:29:38] [Server thread/TRACE] [FML]: Testing mod ftbquests to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod ftbquests accepts its own version (1202.9.0.15)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ftbquests
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ftbquests
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.feed_the_beast.ftbquests.util.ServerQuestData for mod ftbquests
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.feed_the_beast.ftbquests.util.ServerQuestData
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.feed_the_beast.ftbquests.FTBQuestsEventHandler for mod ftbquests
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.feed_the_beast.ftbquests.FTBQuestsEventHandler
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.feed_the_beast.ftbquests.util.FTBQuestsWorldData for mod ftbquests
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.feed_the_beast.ftbquests.util.FTBQuestsWorldData
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into ftbquests for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ftbquests
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - FTB Quests took 0.127s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ftbmoney
[23:29:38] [Server thread/TRACE] [FML]: Mod ftbmoney is using network checker : No network checking performed
[23:29:38] [Server thread/TRACE] [FML]: Testing mod ftbmoney to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod ftbmoney accepts its own version (**.**.**.**)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ftbmoney
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ftbmoney
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.feed_the_beast.mods.money.FTBMoneyConfig for mod ftbmoney
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.feed_the_beast.mods.money.FTBMoneyConfig
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.feed_the_beast.mods.money.FTBMoneyEventHandler for mod ftbmoney
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.feed_the_beast.mods.money.FTBMoneyEventHandler
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.feed_the_beast.mods.money.FTBMoneyClientConfig for mod ftbmoney
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.feed_the_beast.mods.money.FTBMoneyClientConfig
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into ftbmoney for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ftbmoney
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - FTB Money took 0.014s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod grimoireofgaia
[23:29:38] [Server thread/TRACE] [FML]: Mod grimoireofgaia is using network checker : Accepting version 1.7.2
[23:29:38] [Server thread/TRACE] [FML]: Testing mod grimoireofgaia to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod grimoireofgaia accepts its own version (1.7.2)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into grimoireofgaia
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for grimoireofgaia
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for gaia.init.GaiaSpawning$DimensionHandler for mod grimoireofgaia
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class gaia.init.GaiaSpawning$DimensionHandler
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for gaia.GaiaConfig$EventHandler for mod grimoireofgaia
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class gaia.GaiaConfig$EventHandler
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for gaia.init.GaiaBlocks$RegistrationHandler for mod grimoireofgaia
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class gaia.init.GaiaBlocks$RegistrationHandler
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for gaia.init.GaiaEntities$RegistrationHandler for mod grimoireofgaia
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class gaia.init.GaiaEntities$RegistrationHandler
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for gaia.init.GaiaItems$RegistrationHandler for mod grimoireofgaia
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class gaia.init.GaiaItems$RegistrationHandler
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for gaia.init.GaiaSounds$RegistrationHandler for mod grimoireofgaia
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class gaia.init.GaiaSounds$RegistrationHandler
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for gaia.init.GaiaRecipes$RegistrationHandler for mod grimoireofgaia
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class gaia.init.GaiaRecipes$RegistrationHandler
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into grimoireofgaia for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod grimoireofgaia
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - Grimoire of Gaia 3 took 0.079s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ichunutil
[23:29:38] [Server thread/TRACE] [FML]: Mod ichunutil is using network checker : Accepting range 7.2.0 or above, and below 7.3.0
[23:29:38] [Server thread/TRACE] [FML]: Testing mod ichunutil to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod ichunutil accepts its own version (7.2.2)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ichunutil
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ichunutil
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into ichunutil for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ichunutil
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - iChunUtil took 0.069s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod hats
[23:29:38] [Server thread/TRACE] [FML]: Mod hats is using network checker : Accepting range 7.1.0 or above, and below 7.2.0
[23:29:38] [Server thread/TRACE] [FML]: Testing mod hats to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod hats accepts its own version (7.1.1)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into hats
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for hats
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into hats for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod hats
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - Hats took 0.035s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ironchest
[23:29:38] [Server thread/TRACE] [FML]: Mod ironchest is using network checker : Accepting version 1.12.2-7.0.67.844
[23:29:38] [Server thread/TRACE] [FML]: Testing mod ironchest to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod ironchest accepts its own version (1.12.2-7.0.67.844)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ironchest
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ironchest
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for cpw.mods.ironchest.common.core.IronChestItems$Registration for mod ironchest
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class cpw.mods.ironchest.common.core.IronChestItems$Registration
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for cpw.mods.ironchest.common.core.IronChestBlocks$Registration for mod ironchest
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class cpw.mods.ironchest.common.core.IronChestBlocks$Registration
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into ironchest for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ironchest
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - Iron Chest took 0.022s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod journeymap
[23:29:38] [Server thread/TRACE] [FML]: Mod journeymap is using network checker : Invoking method checkModLists
[23:29:38] [Server thread/TRACE] [FML]: Testing mod journeymap to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod journeymap accepts its own version (1.12.2-5.7.1)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into journeymap
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for journeymap
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into journeymap for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod journeymap
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - JourneyMap took 0.011s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod lootbagmod
[23:29:38] [Server thread/TRACE] [FML]: Mod lootbagmod is using network checker : Accepting version 1.5.2
[23:29:38] [Server thread/TRACE] [FML]: Testing mod lootbagmod to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod lootbagmod accepts its own version (1.5.2)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into lootbagmod
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for lootbagmod
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.github.trhod177.lootbagmod.LootBagDropsConfig$EventHandler for mod lootbagmod
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.github.trhod177.lootbagmod.LootBagDropsConfig$EventHandler
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.github.trhod177.lootbagmod.CommonProxy for mod lootbagmod
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.github.trhod177.lootbagmod.CommonProxy
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.github.trhod177.lootbagmod.LootBagMod$eventhandler for mod lootbagmod
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.github.trhod177.lootbagmod.LootBagMod$eventhandler
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.github.trhod177.lootbagmod.LootBagConfig$EventHandler for mod lootbagmod
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.github.trhod177.lootbagmod.LootBagConfig$EventHandler
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.github.trhod177.lootbagmod.LootBagMod$LootTables for mod lootbagmod
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.github.trhod177.lootbagmod.LootBagMod$LootTables
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into lootbagmod for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod lootbagmod
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - Loot Bag Mod took 0.019s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod morph
[23:29:38] [Server thread/TRACE] [FML]: Mod morph is using network checker : Accepting range 7.2.0 or above, and below 7.3.0
[23:29:38] [Server thread/TRACE] [FML]: Testing mod morph to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod morph accepts its own version (7.2.0)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into morph
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for morph
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into morph for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod morph
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - Morph took 0.036s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod harvestcraft
[23:29:38] [Server thread/TRACE] [FML]: Mod harvestcraft is using network checker : Accepting version 1.12.2zb
[23:29:38] [Server thread/TRACE] [FML]: Testing mod harvestcraft to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod harvestcraft accepts its own version (1.12.2zb)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into harvestcraft
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for harvestcraft
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.pam.harvestcraft.item.RecipeRemoval for mod harvestcraft
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.pam.harvestcraft.item.RecipeRemoval
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into harvestcraft for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod harvestcraft
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - Pam's HarvestCraft took 0.018s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod projectintelligence
[23:29:38] [Server thread/INFO] [projectintelligence]: Hello Minecraft!!!
[23:29:38] [Server thread/TRACE] [FML]: Mod projectintelligence is using network checker : Accepting version 1.0.9
[23:29:38] [Server thread/TRACE] [FML]: Testing mod projectintelligence to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod projectintelligence accepts its own version (1.0.9)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into projectintelligence
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for projectintelligence
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into projectintelligence for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod projectintelligence
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - Project Intelligence took 0.105s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod randomthings
[23:29:38] [Server thread/TRACE] [FML]: Mod randomthings is using network checker : Accepting version 4.2.7.4
[23:29:38] [Server thread/TRACE] [FML]: Testing mod randomthings to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod randomthings accepts its own version (**.**.**.**)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into randomthings
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for randomthings
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into randomthings for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod randomthings
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - Random Things took 0.028s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod rats
[23:29:38] [Server thread/TRACE] [FML]: Mod rats is using network checker : Accepting version 3.2.14
[23:29:38] [Server thread/TRACE] [FML]: Testing mod rats to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod rats accepts its own version (3.2.14)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into rats
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for rats
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.github.alexthe666.rats.server.CommonProxy for mod rats
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.github.alexthe666.rats.server.CommonProxy
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.github.alexthe666.rats.server.events.ServerEvents for mod rats
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.github.alexthe666.rats.server.events.ServerEvents
[23:29:38] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.github.alexthe666.rats.client.ClientProxy for mod rats
[23:29:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.github.alexthe666.rats.client.ClientProxy
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into rats for type INSTANCE
[23:29:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod rats
[23:29:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - Rats took 0.173s
[23:29:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod roots
[23:29:38] [Server thread/TRACE] [FML]: Mod roots is using network checker : Accepting version @VERSION@
[23:29:38] [Server thread/TRACE] [FML]: Testing mod roots to verify it accepts its own version in a remote connection
[23:29:38] [Server thread/TRACE] [FML]: The mod roots accepts its own version (@VERSION@)
[23:29:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into roots
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for roots
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.event.BookHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.event.BookHandler
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.handler.ConfigHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.handler.ConfigHandler
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.client.Keybinds for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.client.Keybinds
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.event.TrampleHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.event.TrampleHandler
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.event.SneakHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.event.SneakHandler
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.event.BarkHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.event.BarkHandler
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.event.MappingsEvent for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.event.MappingsEvent
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.event.ItemEventHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.event.ItemEventHandler
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.compat.OldHerbRegistry for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.compat.OldHerbRegistry
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.config.GeneralConfig for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.config.GeneralConfig
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.util.QuiverInventoryUtil for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.util.QuiverInventoryUtil
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.client.ModifierHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.client.ModifierHandler
[23:29:39] [Server thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for epicsquid.roots.event.LootHandler since it is not for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.event.SoilHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.event.SoilHandler
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.init.ModVillagers for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.init.ModVillagers
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.event.ClientTickHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.event.ClientTickHandler
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.event.DeathEventHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.event.DeathEventHandler
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.integration.botania.PetalApothecaryFiller for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.integration.botania.PetalApothecaryFiller
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.mechanics.Harvest for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.mechanics.Harvest
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.item.terrastone.ToolEvents for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.item.terrastone.ToolEvents
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.event.DropsHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.event.DropsHandler
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.EventManager for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.EventManager
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.config.EntityConfig for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.config.EntityConfig
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.event.AdvancementHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.event.AdvancementHandler
[23:29:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for epicsquid.roots.event.ServerTickHandler for mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class epicsquid.roots.event.ServerTickHandler
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into roots for type INSTANCE
[23:29:39] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod roots
[23:29:39] [Server thread/DEBUG] [FML]: Bar Step: Construction - Roots took 0.225s
[23:29:39] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod tabula
[23:29:39] [Server thread/TRACE] [FML]: Mod tabula is using network checker : Accepting range 7.1.0 or above, and below 7.2.0
[23:29:39] [Server thread/TRACE] [FML]: Testing mod tabula to verify it accepts its own version in a remote connection
[23:29:39] [Server thread/TRACE] [FML]: The mod tabula accepts its own version (7.1.0)
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into tabula
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for tabula
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into tabula for type INSTANCE
[23:29:39] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod tabula
[23:29:39] [Server thread/DEBUG] [FML]: Bar Step: Construction - Tabula took 0.010s
[23:29:39] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod thermalfoundation
[23:29:39] [Server thread/ERROR] [FML]: The mod thermalfoundation is expecting signature 8a6abf2cb9e141b866580d369ba6548732eff25f for source ThermalFoundation-1.12.2-2.6.7.1-universal.jar, however there is no signature matching that description
[23:29:39] [Server thread/TRACE] [FML]: Mod thermalfoundation is using network checker : Accepting version 2.6.7
[23:29:39] [Server thread/TRACE] [FML]: Testing mod thermalfoundation to verify it accepts its own version in a remote connection
[23:29:39] [Server thread/TRACE] [FML]: The mod thermalfoundation accepts its own version (2.6.7)
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into thermalfoundation
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for thermalfoundation
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into thermalfoundation for type INSTANCE
[23:29:39] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod thermalfoundation
[23:29:39] [Server thread/DEBUG] [FML]: Bar Step: Construction - Thermal Foundation took 0.019s
[23:29:39] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod phosphor-lighting
[23:29:39] [Server thread/TRACE] [FML]: Mod phosphor-lighting is using network checker : No network checking performed
[23:29:39] [Server thread/TRACE] [FML]: Testing mod phosphor-lighting to verify it accepts its own version in a remote connection
[23:29:39] [Server thread/TRACE] [FML]: The mod phosphor-lighting accepts its own version (1.12.2-0.2.6)
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into phosphor-lighting
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for phosphor-lighting
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into phosphor-lighting for type INSTANCE
[23:29:39] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod phosphor-lighting
[23:29:39] [Server thread/DEBUG] [FML]: Bar Step: Construction - Phosphor Lighting Engine took 0.002s
[23:29:39] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mysticallib
[23:29:39] [Server thread/TRACE] [FML]: Mod mysticallib is using network checker : Accepting version 1.12.2-1.13.0
[23:29:39] [Server thread/TRACE] [FML]: Testing mod mysticallib to verify it accepts its own version in a remote connection
[23:29:39] [Server thread/TRACE] [FML]: The mod mysticallib accepts its own version (1.12.2-1.13.0)
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into mysticallib
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for mysticallib
[23:29:39] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into mysticallib for type INSTANCE
[23:29:39] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mysticallib
[23:29:39] [Server thread/DEBUG] [FML]: Bar Step: Construction - Mystical Lib took 0.006s
[23:29:39] [Server thread/DEBUG] [FML]: Bar Finished: Construction took 9.065s
[23:29:39] [Server thread/DEBUG] [FML]: Mod signature data
[23:29:39] [Server thread/DEBUG] [FML]: Valid Signatures:
[23:29:39] [Server thread/DEBUG] [FML]: (e3c3d50c7c986df74c645c0ac54639741c90a557) FML (Forge Mod Loader **.**.**.**) forge.jar
[23:29:39] [Server thread/DEBUG] [FML]: (e3c3d50c7c986df74c645c0ac54639741c90a557) forge (Minecraft Forge 14.23.5.2860) forge.jar
[23:29:39] [Server thread/DEBUG] [FML]: (db341c083b1b8ce9160a769b569ef6737b3f4cdf) orbis-lib (OrbisLib 0.2.0) orbis-lib-1.12.2-0.2.0+build411.jar
[23:29:39] [Server thread/DEBUG] [FML]: (db341c083b1b8ce9160a769b569ef6737b3f4cdf) aether (Aether II 0.3.0) aether_ii-1.12.2-0.3.0+build411-universal.jar
[23:29:39] [Server thread/DEBUG] [FML]: (a0f0b759d895c15ceb3e3bcb5f3c2db7c582edf0) astralsorcery (Astral Sorcery 1.10.27) astralsorcery-1.12.2-1.10.27.jar
[23:29:39] [Server thread/DEBUG] [FML]: (d72e0dd57935b3e9476212aea0c0df352dd76291) bloodmoon (Bloodmoon 1.5.3) Bloodmoon-MC1.12.2-1.5.3.jar
[23:29:39] [Server thread/DEBUG] [FML]: (f1850c39b2516232a2108a7bd84d1cb5df93b261) codechickenlib (CodeChicken Lib **.**.**.**) CodeChickenLib-1.12.2-3.2.3.358-universal.jar
[23:29:39] [Server thread/DEBUG] [FML]: (b9f30a813bee3b9dd5652c460310cfcd54f6b7ec) llibrary (LLibrary 1.7.20) llibrary-1.7.20-1.12.2.jar
[23:29:39] [Server thread/DEBUG] [FML]: (4db5c2bd1b556f252a5b8b54b256d381b2a0a6b8) ichunutil (iChunUtil 7.2.2) iChunUtil-1.12.2-7.2.2.jar
[23:29:39] [Server thread/DEBUG] [FML]: (4db5c2bd1b556f252a5b8b54b256d381b2a0a6b8) hats (Hats 7.1.1) Hats-1.12.2-7.1.1.jar
[23:29:39] [Server thread/DEBUG] [FML]: (4db5c2bd1b556f252a5b8b54b256d381b2a0a6b8) morph (Morph 7.2.0) Morph-1.12.2-7.2.1.jar
[23:29:39] [Server thread/DEBUG] [FML]: (d72e0dd57935b3e9476212aea0c0df352dd76291) randomthings (Random Things **.**.**.**) RandomThings-MC1.12.2-4.2.7.4.jar
[23:29:39] [Server thread/DEBUG] [FML]: (4db5c2bd1b556f252a5b8b54b256d381b2a0a6b8) tabula (Tabula 7.1.0) Tabula-1.12.2-7.1.0.jar
[23:29:39] [Server thread/DEBUG] [FML]: (f0387d288626cc2d937daa504e74af570c52a2f1) phosphor-lighting (Phosphor Lighting Engine 1.12.2-0.2.6) phosphor-1.12.2-0.2.6+build50.jar
[23:29:39] [Server thread/DEBUG] [FML]: Missing Signatures:
[23:29:39] [Server thread/DEBUG] [FML]: minecraft (Minecraft 1.12.2) minecraft.jar
[23:29:39] [Server thread/DEBUG] [FML]: mcp (Minecraft Coder Pack 9.42) minecraft.jar
[23:29:39] [Server thread/DEBUG] [FML]: baubles (Baubles 1.5.2) Baubles-1.12-1.5.2.jar
[23:29:39] [Server thread/DEBUG] [FML]: quark (Quark r1.6-179) Quark-r1.6-179.jar
[23:29:39] [Server thread/DEBUG] [FML]: autoreglib (AutoRegLib 1.3-32) AutoRegLib-1.3-32.jar
[23:29:39] [Server thread/DEBUG] [FML]: thaumcraft (Thaumcraft 6.1.BETA26) Thaumcraft-1.12.2-6.1.BETA26.jar
[23:29:39] [Server thread/DEBUG] [FML]: botania (Botania r1.10-364) Botania r1.10-364.4.jar
[23:29:39] [Server thread/DEBUG] [FML]: patchouli (Patchouli 1.0-23.6) Patchouli-1.0-23.6.jar
[23:29:39] [Server thread/DEBUG] [FML]: betteranimalsplus (Better Animals Plus 9.0.1) betteranimalsplus-1.12.2-9.0.1.jar
[23:29:39] [Server thread/DEBUG] [FML]: bewitchment (Bewitchment 0.22.63) bewitchment-1.12.2-0.0.22.64.jar
[23:29:39] [Server thread/DEBUG] [FML]: bibliocraft (BiblioCraft 2.4.6) BiblioCraft[v2.4.6][MC1.12.2].jar
[23:29:39] [Server thread/DEBUG] [FML]: biomesoplenty (Biomes O' Plenty 7.0.1.2445) BiomesOPlenty-1.12.2-7.0.1.2445-universal.jar
[23:29:39] [Server thread/DEBUG] [FML]: guideapi (Guide-API 1.12-2.1.8-63) Guide-API-1.12-2.1.8-63.jar
[23:29:39] [Server thread/DEBUG] [FML]: bloodmagic (Blood Magic: Alchemical Wizardry 1.12.2-2.4.3-105) BloodMagic-1.12.2-2.4.3-105.jar
[23:29:39] [Server thread/DEBUG] [FML]: redstoneflux (Redstone Flux 2.1.1) RedstoneFlux-1.12-2.1.1.1-universal.jar
[23:29:39] [Server thread/DEBUG] [FML]: brandonscore (Brandon's Core 2.4.20) BrandonsCore-1.12.2-2.4.20.162-universal.jar
[23:29:39] [Server thread/DEBUG] [FML]: mysticalworld (Mystical World 1.12.2-1.11.0) mysticalworld-1.12.2-1.11.0.jar
[23:29:39] [Server thread/DEBUG] [FML]: chisel (Chisel MC1.12.2-1.0.2.45) Chisel-MC1.12.2-1.0.2.45.jar
[23:29:39] [Server thread/DEBUG] [FML]: cofhcore (CoFH Core 4.6.6) CoFHCore-1.12.2-4.6.6.1-universal.jar
[23:29:39] [Server thread/DEBUG] [FML]: cofhworld (CoFH World 1.4.0) CoFHWorld-1.12.2-1.4.0.1-universal.jar
[23:29:39] [Server thread/DEBUG] [FML]: craftstudioapi (CraftStudio API 1.0.0) CraftStudioAPI-universal-1.0.1.95-mc1.12-alpha.jar
[23:29:39] [Server thread/DEBUG] [FML]: customspawner (DrZhark's CustomSpawner 3.11.4) CustomMobSpawner-3.11.5.jar
[23:29:39] [Server thread/DEBUG] [FML]: props (Decocraft **.**.**.**) Decocraft-2.6.3.7_1.12.2.jar
[23:29:39] [Server thread/DEBUG] [FML]: mocreatures (DrZhark's Mo'Creatures Mod 12.0.5) DrZharks MoCreatures Mod-12.0.5.jar
[23:29:39] [Server thread/DEBUG] [FML]: mantle (Mantle 1.12-1.3.3.55) Mantle-1.12-1.3.3.55.jar
[23:29:39] [Server thread/DEBUG] [FML]: twilightforest (The Twilight Forest 3.11.1021) twilightforest-1.12.2-3.11.1021-universal.jar
[23:29:39] [Server thread/DEBUG] [FML]: tconstruct (Tinkers' Construct 1.12.2-2.13.0.183) TConstruct-1.12.2-2.13.0.183.jar
[23:29:39] [Server thread/DEBUG] [FML]: extrautils2 (Extra Utilities 2 1.0) extrautils2-1.12-1.9.9.jar
[23:29:39] [Server thread/DEBUG] [FML]: natura (Natura 1.12.2-4.3.2.69) natura-1.12.2-4.3.2.69.jar
[23:29:39] [Server thread/DEBUG] [FML]: forestry (Forestry **.**.**.**) forestry_1.12.2-5.8.2.422.jar
[23:29:39] [Server thread/DEBUG] [FML]: fossil (Fossils and Archeology Revival 8.0.5) fossilsarcheology-8.0.5.jar
[23:29:39] [Server thread/DEBUG] [FML]: ftblib (FTB Library **.**.**.**) FTBLib-5.4.7.2.jar
[23:29:39] [Server thread/DEBUG] [FML]: itemfilters (Item Filters **.**.**.**) ItemFilters-1.0.4.2.jar
[23:29:39] [Server thread/DEBUG] [FML]: ftbquests (FTB Quests 1202.9.0.15) FTBQuests-1202.9.0.15.jar
[23:29:39] [Server thread/DEBUG] [FML]: ftbmoney (FTB Money **.**.**.**) FTBMoney-1.2.0.47.jar
[23:29:39] [Server thread/DEBUG] [FML]: grimoireofgaia (Grimoire of Gaia 3 1.7.2) GrimoireOfGaia3-1.12.2-1.7.2.jar
[23:29:39] [Server thread/DEBUG] [FML]: ironchest (Iron Chest 1.12.2-7.0.67.844) ironchest-1.12.2-7.0.67.844.jar
[23:29:39] [Server thread/DEBUG] [FML]: journeymap (JourneyMap 1.12.2-5.7.1) journeymap-1.12.2-5.7.1.jar
[23:29:39] [Server thread/DEBUG] [FML]: lootbagmod (Loot Bag Mod 1.5.2) lootbagmod-1.12.2-1.5.2-FINAL.jar
[23:29:39] [Server thread/DEBUG] [FML]: harvestcraft (Pam's HarvestCraft 1.12.2zb) Pam's HarvestCraft 1.12.2zg.jar
[23:29:39] [Server thread/DEBUG] [FML]: projectintelligence (Project Intelligence 1.0.9) ProjectIntelligence-1.12.2-1.0.9.28-universal.jar
[23:29:39] [Server thread/DEBUG] [FML]: rats (Rats 3.2.14) rats-3.2.14-1.12.2.jar
[23:29:39] [Server thread/DEBUG] [FML]: roots (Roots @VERSION@) Roots-1.12.2-3.1.5.jar
[23:29:39] [Server thread/DEBUG] [FML]: thermalfoundation (Thermal Foundation 2.6.7) ThermalFoundation-1.12.2-2.6.7.1-universal.jar
[23:29:39] [Server thread/DEBUG] [FML]: mysticallib (Mystical Lib 1.12.2-1.13.0) mysticallib-1.12.2-1.13.0.jar
[23:29:39] [Server thread/INFO] [FML]: Processing ObjectHolder annotations
[23:29:39] [Server thread/INFO] [FML]: Found 2972 ObjectHolder annotations
[23:29:39] [Server thread/INFO] [FML]: Identifying ItemStackHolder annotations
[23:29:39] [Server thread/INFO] [FML]: Found 2 ItemStackHolder annotations
[23:29:39] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod minecraft
[23:29:39] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod minecraft
[23:29:39] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Minecraft took 0.000s
[23:29:39] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mcp
[23:29:39] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mcp
[23:29:39] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Minecraft Coder Pack took 0.000s
[23:29:39] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod FML
[23:29:39] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod FML
[23:29:39] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Forge Mod Loader took 0.000s
[23:29:39] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod forge
[23:29:39] [Server thread/INFO] [FML]: Configured a dormant chunk cache size of 0
[23:29:39] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod forge
[23:29:39] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Minecraft Forge took 0.098s
[23:29:39] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod orbis-lib
[23:29:39] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod orbis-lib
[23:29:39] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - OrbisLib took 0.000s
[23:29:39] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod aether
[23:29:39] [Forge Version Check/INFO] [forge.VersionCheck]: [forge] Starting version check at http://files.minecraftforge.net/maven/net/minecraftforge/forge/promotions_slim.json
[23:29:40] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.altar`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.holystone_furnace`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.skyroot_chest`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.skyroot_sign`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.multiblock_dummy`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.moa_egg`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.icestone_cooler`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.incubator`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.present`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.wildcard`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.masonry_bench`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.outpost_campfire`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.aether_teleporter`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.skyroot_bed`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[23:29:42] [Server thread/DEBUG] [AetherII]: 'Pre-initialize tiles' completed in 1631ms
[23:29:42] [Server thread/DEBUG] [AetherII]: 'Pre-initialize dimensions' completed in 50ms
[23:29:42] [Server thread/DEBUG] [AetherII]: 'Pre-initialize loot tables' completed in 2ms
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.aechor_plant as aether:aechor_plant
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.aerbunny as aether:aerbunny
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.carrion_sprout as aether:carrion_sprout
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.cockatrice as aether:cockatrice
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.kirrid as aether:kirrid
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.aerwhale as aether:aerwhale
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.zephyr as aether:zephyr
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.tempest as aether:tempest
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.swet as aether:swet
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.taegore as aether:taegore
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.glitterwing as aether:glitterwing
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.edison as aether:edison
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.burrukai as aether:burrukai
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.necromancer as aether:necromancer
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.josediya as aether:josediya
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.tivalier as aether:tivalier
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.glactrix as aether:glactrix
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.mysterious_figure as aether:mysterious_figure
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.varanys as aether:varanys
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.skyroot_lizard as aether:skyroot_lizard
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.sheepuff as aether:sheepuff
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.frostpine_totem as aether:frostpine_totem
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.kraisith as aether:kraisith
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.shade_of_arkenzus as aether:shade_of_arkenzus
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.ethereal_wisp as aether:ethereal_wisp
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.fleeting_wisp as aether:fleeting_wisp
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.soaring_wisp as aether:soaring_wisp
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.fangrin as aether:fangrin
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.nex_spirit as aether:nex_spirit
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.pink_baby_swet as aether:pink_baby_swet
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.floating_block as aether:floating_block
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.moving_block as aether:moving_block
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.dart as aether:dart
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.daggerfrost_snowball as aether:daggerfrost_snowball
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.bolt as aether:bolt
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.parachute as aether:parachute
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.tnt_present as aether:tnt_present
[23:29:42] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.moa as aether:moa
[23:29:42] [Server thread/DEBUG] [AetherII]: 'Pre-initialize entities' completed in 391ms
[23:29:43] [Forge Version Check/DEBUG] [forge.VersionCheck]: [forge] Received version check data:
"homepage": "https://files.minecraftforge.net/net/minecraftforge/forge/",
"1.1-latest": "**.**.**.**",
"1.2.3-latest": "**.**.**.**",
"1.2.4-latest": "**.**.**.**",
"1.2.5-latest": "**.**.**.**",
"1.3.2-latest": "**.**.**.**",
"1.4.0-latest": "**.**.**.**",
"1.4.1-latest": "**.**.**.**",
"1.4.2-latest": "**.**.**.**",
"1.4.3-latest": "**.**.**.**",
"1.4.4-latest": "**.**.**.**",
"1.4.5-latest": "**.**.**.**",
"1.4.6-latest": "**.**.**.**",
"1.4.7-latest": "**.**.**.**",
"1.5-latest": "**.**.**.**",
"1.5.1-latest": "**.**.**.**",
"1.5.2-latest": "**.**.**.**",
"1.5.2-recommended": "**.**.**.**",
"1.6.1-latest": "**.**.**.**",
"1.6.2-latest": "**.**.**.**",
"1.6.2-recommended": "**.**.**.**",
"1.6.3-latest": "**.**.**.**",
"1.6.4-latest": "9.11.1.1345",
"1.6.4-recommended": "9.11.1.1345",
"1.7.2-latest": "10.12.2.1161",
"1.7.2-recommended": "10.12.2.1161",
"1.7.10_pre4-latest": "10.12.2.1149",
"1.7.10-latest": "10.13.4.1614",
"1.7.10-recommended": "10.13.4.1614",
"1.8-latest": "11.14.4.1577",
"1.8-recommended": "11.14.4.1563",
"1.8.8-latest": "11.15.0.1655",
"1.8.9-latest": "11.15.1.2318",
"1.8.9-recommended": "11.15.1.2318",
"1.9-latest": "12.16.1.1938",
"1.9-recommended": "12.16.1.1887",
"1.9.4-latest": "12.17.0.2317",
"1.9.4-recommended": "12.17.0.2317",
"1.10-latest": "12.18.0.2000",
"1.10.2-latest": "12.18.3.2511",
"1.10.2-recommended": "12.18.3.2511",
"1.11-latest": "13.19.1.2199",
"1.11-recommended": "13.19.1.2189",
"1.11.2-latest": "13.20.1.2588",
"1.11.2-recommended": "13.20.1.2588",
"1.12-latest": "14.21.1.2443",
"1.12-recommended": "14.21.1.2387",
"1.12.1-latest": "14.22.1.2485",
"1.12.1-recommended": "14.22.1.2478",
"1.12.2-latest": "14.23.5.2860",
"1.12.2-recommended": "14.23.5.2859",
"1.13.2-latest": "25.0.223",
"1.14.2-latest": "26.0.63",
"1.14.3-latest": "27.0.60",
"1.14.4-latest": "28.2.26",
"1.14.4-recommended": "28.2.26",
"1.15.1-latest": "30.0.51",
"1.15.2-latest": "31.2.57",
"1.15.2-recommended": "31.2.57",
"1.16.1-latest": "32.0.108",
"1.16.2-latest": "33.0.61",
"1.16.3-latest": "34.1.42",
"1.16.3-recommended": "34.1.0",
"1.16.4-latest": "35.1.37",
"1.16.4-recommended": "35.1.4",
"1.16.5-latest": "36.2.35",
"1.16.5-recommended": "36.2.34",
"1.17.1-latest": "37.1.1",
"1.17.1-recommended": "37.1.1",
"1.18-latest": "38.0.17",
"1.18.1-latest": "39.1.2",
"1.18.1-recommended": "39.1.0",
"1.18.2-latest": "40.1.51",
"1.18.2-recommended": "40.1.0",
[23:29:43] [Forge Version Check/INFO] [forge.VersionCheck]: [forge] Found status: AHEAD Target: null
[23:29:43] [Forge Version Check/INFO] [forge.VersionCheck]: [codechickenlib] Starting version check at http://chickenbones.net/Files/notification/version.php?query=forge&version=1.12&file=CodeChickenLib
[23:29:43] [Server thread/INFO] [Quark ASM]: Transforming net.minecraft.inventory.ContainerWorkbench
[23:29:43] [Server thread/INFO] [Quark ASM]: Applying Transformation to method (Names [transferStackInSlot, func_82846_b] Descriptor (Lnet/minecraft/entity/player/EntityPlayer;I)Lnet/minecraft/item/ItemStack;)
[23:29:43] [Server thread/INFO] [Quark ASM]: Located Method, patching...
[23:29:43] [Server thread/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerWorkbench.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[23:29:43] [Server thread/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerWorkbench.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[23:29:43] [Server thread/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerWorkbench.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[23:29:43] [Server thread/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerWorkbench.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[23:29:43] [Server thread/INFO] [Quark ASM]: Patch result: true
[23:29:43] [Server thread/DEBUG] [AetherII]: 'Pre-initialize networking' completed in 440ms
[23:29:43] [Server thread/DEBUG] [AetherII]: 'Pre-initialize patron rewards' completed in 13ms
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/aechor_plant.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/aerbunny.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/burrukai.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/carrion_sprout.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/cockatrice.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/glactrix.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/glitterwing.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/kirrid.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/moa.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/sheepuff.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/skyroot_lizard.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/swet.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/taegore.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/tempest.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/varanys.json
[23:29:43] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/zephyr.json
[23:29:43] [Server thread/DEBUG] [AetherII]: 'Pre-initialize definitions' completed in 35ms
[23:29:43] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod aether
[23:29:43] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Aether II took 3.607s
[23:29:43] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod baubles
[23:29:43] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod baubles
[23:29:43] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Baubles took 0.022s
[23:29:43] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod astralsorcery
[23:29:43] [Forge Version Check/DEBUG] [forge.VersionCheck]: [codechickenlib] Received version check data:
{"homepage": "http://chickenbones.net/Pages/links.html","promos": {"1.12-recommended": "**.**.**.**"}}
[23:29:43] [Forge Version Check/INFO] [forge.VersionCheck]: [codechickenlib] Found status: BETA Target: null
[23:29:43] [Forge Version Check/INFO] [forge.VersionCheck]: [twilightforest] Starting version check at https://raw.githubusercontent.com/TeamTwilight/twilightforest/1.12.x/update.json
[23:29:43] [Forge Version Check/DEBUG] [forge.VersionCheck]: [twilightforest] Received version check data:
"homepage": "https://minecraft.curseforge.com/projects/the-twilight-forest",
"3.8.689": "ADDED:\n • Extra Mob transformations for Powder of Transformation!\n\nCHANGED:\n • Improved textures for Uncrafting Table, Trophy Pedestal, Block-Chain Goblins, and Hermit Crabs.\n • Shield Scepter's magic shields render fully lit now, unaffected by darkness.\n • The magic shields also render in first-person.\n\nFIXED:\n • Fix crash when parrying Naga.\n • Fix crash with Trophy Pedestals upon unexpected Moonworm.\n • Small-time optimizations and code tidying here and there!",
"3.8.654": "FIXES:\n • Hotfix: Fixed a crash that happened on dedicated servers due to the new IE shaders.",
"3.8.652": "ADDED:\n • Added a Quadraxis to the team, A great addition to the mod.\n • Added Auroralized Glass.\n • Added actual Castle Brick Stairs, literally the sequel to Jesus.\n • Cicadas can now be shot from an Immersive Engineering Railgun. You monster.\n • Added the Skylight Forest.\n • Skylight Forest is a skyblock variant of Twilight Forest with only structures generating on their own little islands and everything else as void.\n • Parrots can now mimic any and all mobs in the mod. :parrot_party:\n • Added the Scepter of Fortification\n • A new scepter dropped by the Lich that summons five (5) shields around you that each block a hit.\n • Progression advancements each grant three (3) shields that don't decay over time.\n • The Naga Can now be dazed if it rams a blocking shield with its charge attack, knocking you both backwards in the process.\n • Giant Tools now have a longer reach.\n • The uncrafting Table is now compatible with shapeless recipes. It totally didn't become twice as broken in potential!\n • It can now also cycle through multiple recipes in case of conflict.\n • Added tool shaders for Immersive Engineering with their own rarity, these include:\nTwilight, Firefly, Pinch Beetle, Snakestone, Mazestone, Underbrick, Towerwood, Carminite, Auroralized, Ironwood, Steeleaf, Knightly, Fiery, Final Castle, Cube of Annihilation, Questing Ram, Naga, Lich, Minoshroom, Hydra, Knight Phantom, Ur-Ghast, Alpha Yeti, Snow Queen.\n\nCHANGED:\n • Reworked the Druid Huts completely.\n • Druid Huts are no longer the number one fire hazard in the forest. \n • /tffeature now can locate structures and can use tab-completion for so.\n • Phantom Armor when worn is now kept on death.\n • It also cannot be enchanted with Curse of Binding and Curse of Vanishing anymore.\n • Improved handling of items displaced by a Charm of Keeping, should be more reliable now.\n • Tweaked Axe damage and speed values to better match vanilla.\n • Blacklisted surface lakes from some of the biomes.\n • Mobs like Deer, Boars, etc. are now unable to spawn on the Glacier.\n • The Minoshroom's charge attack now breaks through blocks.\n • Spiral Bricks are now in the creative menu.\n • Maze ceilings now always generated if there is no terrain.\n • Strongholds are now marked as clear on the last Knight's death.\n • Tweaked the Synergy tool trait.\n • There can now be multiple portal activations items specified in the config.\n • Twilight Saplings can now be used as Furnace fuel.\n • The Encased Firejet and Smoker now count as a wood material instead of stone.\n • Arctic Fur Blocks now break faster with shears.\n • Fiddleheads now require Shears to harvest.\n • The Lich's shields are now proper 3D models instead of two textures loosely glued together.\n • TF now registers its TEs under our own namespace, not the default. We have a datafixer that handles the transition, but once updated to this version the datafix is irreversible.\n\nFIXED:\n • Players can no longer spawn on top of the portal which would teleport them back into the overworld right away. Good lord that was annoying.\n • Improved a lot of the logic relating to the Twilight Forest portal.\n • Fixed an issue with Trophy Pedestal progression where it didn't unlock after the Lich.\n • Remeasured the sizes of goblin's feet. Their boots should render on and fit them again.\n • The Seeker Bow now actually, you know, seeks again.\n • Fixed crash related to getting localized names of saplings on servers.\n • Removed a redundant language key in the Forgotten Explorer book for Yeti Caves.\n • Fixed Minotaurs dropping Magic Map foci instead of Maze Map.\n • Fiery tool heads now correctly have the missing Twilit and Flammable traits.\n • Changed the grip on the Moonworm Queen to be more comfortable, now correctly holding it as a tool in third person view.\n • Fixed a portal generation issue where it would generate underwater.\n • Added a null-check to tile entity access, fixing a crash with Mystcraft.\n • Cleaned up Bauble handling code, fixing console spam.\n • Fixed the blockstate rotations for Castle Brick Stair variants.\n • Fixed the lighting on some of the stair blocks.\n • Fixed incorrect level cost being shown for some recrafting recipes.\n • Giant blocks now correctly tile their texture.\n • Fixed a lighting issue on Fiery Blocks.\n • Portals are now prevented from generating inside of structures.\n • Refactored Naga Courtyard code, hopefully fixes generation issues.\n • Alternate Naga Courtyard Terrace pieces now generate again. #BlameDrullkus\n • Fixed a crash with the Uncrafting Table by adding some more checks.\n • The Fiery Pickaxe now correctly smelts every item a block drops if it drops multiple.\n • Fixed a Repeater in the Dark Tower not repeating what should be repeated, with delay.\n • Giant Leaves are now correctly tinted in inventories.\n • Fixed Uberous Soil not generating at the correct height.\n • Fixed the Snow Queen marking the wrong structure conquered on death.\n • Fixed the Charm of Keeping effects.\n • Setting the game to peaceful now correctly has the Snow waifu Queen put her spawner back.\n • Snow Queen minions now correctly spawn inside of the boss room during the fight.\n • Giant Tools are now held in a more human like fashion.\n • Firefly, Moonworm, and Cicada no longer use Soul Sand as their breaking particles.\n • Fixed the texture auto generator only processing first texture in array.\n • Lampposts can now generate again after several years. Neat.\n • Large mushrooms should no longer piggyback on top of each other.\n • Seeds even with only numbers were being used as seeds to make a random number seed instead of directing being used as a random number seed. Confusing, we know!",
"3.7.424": "ADDED:\n • We split the progression into three separate lines, meaning that instead of clearing one dungeon and moving to the next in line, you now have the choice after defeating the Lich to go to the Hydra, Ur-Ghast, or Aurora Palace first.\nDefeating all three is still necessary to gain access to the Highlands.\n • Tinkers' Construct integration!\n • Added Tinker's Construct Integration with Naga Scales, Steeleaves, Fiery Ingots, Knightmetal Ingots, and Raven's Feathers to make materials & tools out of.\n • Added unique traits for each material:\n • Twilit appears on all Twilight Forest materials, meaning your tool gains +2 speed in the Twilight Forest and deals +2 damage in any other dimension.\n • Precipitate appears on Naga Scale materials, it lets you use the tool quicker with the lesser health on your Player.\n • Synergy appears on Steeleaf materials, it will passively repair the tool if you have Steeleaf in your hotbar. The more Steeleaves you have in the hotbar, the faster it repairs.\n • Stalwart appears on Knightmetal materials, it will make you more resilient in combat.\n • Veiled appears on Raven's Feather materials, it will render arrows invisible.\n • Baubles integration!\n • All charms can now be used in the off-hand and also equipped in the Baubles inventory.\n • All tiers of the Charm of Keeping will keep the Baubles Inventory.\n • Thaumcraft Compat: Live & Reloaded! All items and blocks (aside from unobtainable and some WIP items) now have aspects.\n • Added a config option to make the Portal creation lightning not cause fires, disable it if you're against pyromania derrived fun.\n • Made a new potion effect for the ice render effect from Ice Bombs, Ice Bow, etc. instead of putting it on the Slowness effect.\n • This also stops ice getting applied getting the slowness effect under certain conditions.\n • The Block and Chain now disables shields like an axe.\n • Added config option for players spawning for the first time to spawn in the Twilight Forest. Off by default.\n • Added config option to make Twilight Portals create a blocked-off portal at their destination. Toss in the activation item to unblock the portal. Off by default.\n • Added recipes where Iron armor and tools can be crafted directly into their Fiery counterparts.\n • Added Shield-Parrying for all Twilight Forest Projectiles. Installing https://minecraft.curseforge.com/projects/parry Shield Parry mod causes Twilight Forest to skip its parrying methods.\n • Updated the Japanese language file.\n • Updated the Chinese language file.\n • The Russian language file now covers everything in the mod.\nCHANGED:\n • Changed the Creative menu icon to the Miniature Portal item.\n • The advancements Past the Thorns and So Castle Very Wow now have a [NYI] tag in their names to signify they are not functional yet.\n • All tiers of the Charm of Keeping now preserve items in the off-hand slot.\n • Charm of Keeping usage now drops any items that would be overwritten by an item saved to prevent item loss if something is put in the player's inventory.\n • Code Improvements for Naga Courtyard.\nFIXED:\n • Magic Maps now properly update after switching Dimensions\n • The Zombie Scepter no longer joins its zombie kind by destroying itself at 0 durability.\n • Special leaves in Twilight Forest are now using the ore dictionary properly. (This totally wasn’t solved previously and went undocumented we swear.)\n • Ore magnet no longer checks ModID in the registry string.\n • Mazestone and its variants once again consume 16 durability from your mining tools when mined.\n • Castle Doors no longer have their texture broken.\n • Charm of Life effect upon death now uses the correct sprite.\n • Improved algorithm for the Miner's Tree, it should be less confused and stuck when trying to pull ores from the ground.\n • Fixed some blocks missing getBlockFaceShape overrides, causing glass panes, fences, walls, etc. to connect to blocks when they shouldn't.\n • Fixed the placement problems with Spiral Bricks and took off the [WIP] tag.\n • Finally fixed texture and UV problems with Knightly Armor and Phantom Armor; rejoice!\n • Ur-Ghast's tears should be visible again in Multiplayer when it's throwing a tantrum.",
"3.6.345": "FIXES:\n • Hotfix: Fixed players getting kicked from servers when near locked structures.",
"3.6.343": "FIXES:\n • Hotfix: Fixed Sponge server crashing related to packet fix last release.",
"3.6.342": "ADDED:\n • Not yet fully implemented Tinkers' Construct compatibility for some of our materials to make tools out of.\n\nFIXES:\n • Fixed our Forge minimum version dependency string being behind.\n • Fixed potential console spam related to weather rendering when the mod 'Fancy Block Particles' is present.\n • Added a message that if Sponge is installed the max bounding-box-size should be adjusted for Hydras to show up properly.\n • Removed the structure layout print debug that appears in the console, made it into the release on accident.\n • Fixed a config-related crash.\n • Fixed a generation problem with terraces being mashed together despite us telling them not do.",
"3.6.324": "ADDED:\n • The Naga Courtyard has received a complete revamp while maintaining the old style of it.\n • More things are planned at a later date for a second batch.\n • Many new blocks styled for and after the Naga including but not limited to:\n • Etched Nagastone\n • Block is available in 6 rotations. It's a block that kind of is placed like a pillar except the swirls on the block are placed dependent on the direction you placed.\n • Has 2x2 stone tiles on the end.\n • Comes in normal, mossy, and cracked variants.\n • Nagastone Pillar\n • Block is available in 3 axal rotations.\n • Works like vanilla Quartz Pillar Block.\n • Comes in normal, mossy, and cracked variants.\n • Nagastone Stairs\n • Textures like Etched Nagastone.\n • Has Left and Right facing variants dictating which way the swirls go.\n • Both Left and Right come in normal, mossy, and cracked variants.\n • Spiral Stone Bricks\n • Can be used in a 2x2 patterns to make a complete spiral.\n • The block itself is in 3D and has depth not only through shading.\n • The Uncrafting Table was added to the list of Crafting Tables for the Crafting Category in JEI.\n • Two original music tracks by MrOwltkins were added.\n • Updated our Chinese language file thanks to 3TUSK.\nCHANGED:\n • Block And Chain now appears from your left hand if used in the off-hand slot.\n • Also cleaned up the code around there.\n • shifted the Knightmetal Loop texture to the middle.\n • Block and Chain + Cube of Annihilation leave their x16 boundary to accommodate their texture.\n • Made the Block and Chain thicker when held.\n • The Block and Chain recieved a model override, the texture will change to only the loop when it is thrown.\n • Cube of Annihilation recieved a new texture for this too.\n • Optimized Cicadas, Fireflies, and Moonworms for the server side.\n • Made TF Critters not tick at all on the server side.\n • Wispy Clouds are now dropped when broken.\n • Removed unused EntityTFTinyFirefly (old version of ParticleFirefly).\n • Made Castle Doors breakable again so people can use them until the Final Castle is implemented fully, afterwards we'll prevent them from breaking until the structure is cleared.\n • Broke the fourth wall, wont fix.\nFIXES:\n • Made the player invulnerable when teleporting across dimensions, this was the issue causing players to wrongly teleport.\n • Fixed the issue when going through a portal would displace you up in the air.\n • Moved the language key for \"Underbrick Floor\" from meta 2 to meta 3 to fix lang entry collision for Underbrick.\n • Fixed a crash that happened due to the mod OpenTerrainGenerator.\n • Magic Beans once again properly grow into beanstalks on dedicated servers.\n • The vignette that appears in low light no longer randomly flickers in the Twilight Forest.\n • Fixed Root Strands being offset downwards for the second time, hopefully preventing them to sag with age.\n • Placing a giant block where it would replace a snow layer no longer crashes the client.\n • Moonworm Queen no longer breaks like a tool when it hits 0 durability.\n • Only the Moonworm Queen you're using should wiggle now instead of all of them when you have multiple.\n • Scepter of Twilight/Life Draining once again can be recharged.\n • Fixed the broken fourth wall.",
"3.5.263": "ADDED:\n • Added compatibility for many of our blocks with Chisel.\n • Crafting recipes added for Final Castle related blocks.\n • Vanilla's block to stairs ratio in crafting makes no sense, we opted for the stair recipes to give you 8 instead of the usual 4.\n\nCHANGED:\n • \"And Drullkus said; \"let portals be shapeless!\" And it was so.\"\n • Portals can now be made into any horizontal shape.\n • They still have the same requirements (water pool, plants surrounding it, etc.)\n\nFIXES:\n • Fixed a serious crash involving the Anti-Builder.\n • Fixed an issue with the Trophies interacting with other mods such as Skillable.\n • Also caught an Item Stack null.\n • All magic tree log variants now drop their respective wood properly.\n • Made sure bosses are recognised as such by the game.\n • Collected all of the Fireflies that escaped the Firefly Jar and put them back in.\n • The Firefly \"block\" also gives off its little firefly lights again.\n • Resolved some Hydra rotation issues; it should no longer track you by spinning around at the speed of sound.",
"3.4.239": "ADDED:\n • We now have loading screens when going to the Twilight Forest! \n • The Naga and Lich now have fancy incremental boss bars for the body segments and phases respectively.\n • The Block of Fiery Metal now has a fancy model.\n • Arctic armour now has lore text that makes it clear it can be dyed.\n • Also added a advancement related to dying Arctic armour.\n • Armour made from boss drops now have damage resistance, balanced relative to the progression.\n • Death Tome has a chance to drop enchanted books.\n\nCHANGED:\n • Quest Ram now pulls rewards from a loot table.\n • Uncrafting Table now returns materials directly to inventory like 1.12 vanilla Crafting Table.\n • Changing dimension ID of the TF now requires a relaunch.\n • Changing seed of your world now needs the world reloaded.\n • The 'shedding' from Death Tomes now draws from a loot table.\n • Block of Fiery Metal now stays lit when set on fire.\n • Made the boss spawner unbreakable, no more pacifist route unless on peaceful.\n • The Ore Magnet no longer moves ores if it is a tile entity.\n • Ghast Trap advancement is more specific in its wording.\n • Updated our JEI dependency to a newer version.\n\nFIXES:\n • Fixed Ironwood model.\n • Set particle Firefly size to 0 so they don't keep blinking in and out in F3+B mode.\n • Fixed a bug where all storage blocks worked as fuel.\n • Fixed Block of Fiery Metal and Block of Ironwood having parts render solid black without CTM.\n • Spruce trees in the snow biomes are no longer partially oak logs.\n • Giant blocks no longer destroy other blocks upon placement, including bedrock and the laws of physics.\n • Charm of Keeping and Charm of Life no longer conflict resulting in item loss, they now properly take turns and play nice.\n • Fiery Tears and Blood now show as interchangeable in JEI.\n • Roots no longer replace important blocks in generation.\n • Cleaned up the chunk generator some more.",
"3.3.202": "ADDED:\n • Block of Fiery Metal now deals damage when walked on.\n • Block of Arctic Fur reduces fall damage by 90%.\n • Block of Steeleaf reduces fall damage by 25%.\n • Advancement called \"Something Strange in The Towerwood\" was added.\n • Questing Ram has its own spawn egg now.\n • Questing Ram Trophy makes adorable noises now.\n • When a worn bug dies it now makes a *squish* sound.\n • The Anti-Builder now has a blacklist feature for people to prevent blocks being destroyed, a must have for mods that add graves.\n • Added proper breaking particles to Device Translucent and the Castle Doors.\n • Added names to multiple unlocalised blocks.\n\nCHANGES:\n • Made axes not terrible damage wise.\n • Buffed the Giant Sword.\n • Added proper sounds and material to the new storage blocks.\n • Tri-Bow no longer creates free arrows, only one can be picked up again when shot.\n • New storage blocks can now be used as base blocks for a beacon.\n • Magic tree cores no longer drop with Silk Touch.\n • Final Castle doors are now in the creative menu and can be pick-blocked.\n • Some advancement names and descriptions had changes.\n\nFIXES:\n • Fixed the Magic Map grinding your FPS to a halt over time, thousands of duplicate icons were hogging up all the precious memory over time.\n • The new storage blocks now show up in the creative menu.\n • Fixed the shadows of several mobs, no longer does the Alpha Yeti feel like a Beta Yeti.\n • Knightly Axe now properly deals extra damage to unarmoured targets.\n • Temporary workaround to not display the dismount message when a Pinch Beetle grabs you.\n • Fixed Magic Beans not getting consumed upon use.\n • Hydra can now rotate its body again.\n • Hydra will no longer harm itself, it enjoys life once again.\n • Unstable Ice Cores will no longer be griefing jerks with the MobGriefing gamerule being false.\n • The Hydra's mortar attack now also respects MobGriefing.\n • All mobs with a breath like attacks now have it functioning properly again.\n • Also fixed the particle rendering of the Snow Queen's icy breath.\n • Charm of Keeping should now activate before a gravestone mod can take hold of your items.\n • Fixed a transparency issue when wearing the Quest Ram Trophy.\n • The mushroom growing on the Minoshroom's head is back where it belongs.\n • Roots are no longer offset by one pixel down.\n • Swarm Spiders and Carminite Broodlings are no longer intimate with ceilings to the point of death."
"1.12.2-latest": "3.8.689",
"1.12.2-recommended": "3.8.689",
"1.7.10-latest": "2.3.7",
"1.7.10-recommended": "2.3.7"
[23:29:43] [Forge Version Check/INFO] [forge.VersionCheck]: [twilightforest] Found status: AHEAD Target: null
[23:29:43] [Forge Version Check/INFO] [forge.VersionCheck]: [llibrary] Starting version check at https://gist.githubusercontent.com/Gegy/a6639456aeb8edd92cbf7cbfcf9d65d9/raw/llibrary_updates.json
[23:29:43] [Forge Version Check/DEBUG] [forge.VersionCheck]: [llibrary] Received version check data:
"homepage": "https://minecraft.curseforge.com/projects/llibrary",
"1.7.4": "* Allow custom particles for Tabula baked models\n* Support transformations for Tabula baked models\n* If cuboid has a transparent texture, each face will be rendered both inward and outwards\n* Fix occasional jitter when rendering the LLibrary patron cube\n* Fix the LLibrary logger not printing formatted strings",
"1.7.5": "* Add support for Qubble JSON models\n* Fix baked tabula texture error on newer Forge versions\n* Deprecate update checker if favor of Forge checker",
"1.7.6": "* Implement fast-fail for untransformed RuntimePatchers\n* Implement more ASM patch predicates",
"1.7.7": "+ Add ItemTESRContext, allowing mods to retrieve context of an Item TESR such as perspective and NBT\n + View distance override event\n + ApplyRenderRotationsEvent, allowing mods to apply rotations to the player"
"1.7.4": "* Allow custom particles for Tabula baked models\n* Support transformations for Tabula baked models\n* If cuboid has a transparent texture, each face will be rendered both inward and outwards\n* Fix occasional jitter when rendering the LLibrary patron cube\n* Fix the LLibrary logger not printing formatted strings",
"1.7.5": "* Add support for Qubble JSON models\n* Fix baked tabula texture error on newer Forge versions\n* Deprecate update checker if favor of Forge checker",
"1.7.6": "* Implement fast-fail for untransformed RuntimePatchers\n* Implement more ASM patch predicates",
"1.7.7": "+ Add ItemTESRContext, allowing mods to retrieve context of an Item TESR such as perspective and NBT\n + View distance override event\n + ApplyRenderRotationsEvent, allowing mods to apply rotations to the player",
"1.7.10": "* Fix log spam related to issues with config system\n* Fix texture mirroring on Tabula models\n* Fix techne texture parsing\n* Fix crashes related to patron effect with some mods\n* Enable COMPUTE_FRAMES for RuntimePatchers, allowing for more complex transforms",
"1.7.11": "* Fix server crash"
"1.7.6": "* Initial port to 1.12",
"1.7.7": "+ Add ItemTESRContext, allowing mods to retrieve context of an Item TESR such as perspective and NBT\n + View distance override event\n + ApplyRenderRotationsEvent, allowing mods to apply rotations to the player",
"1.7.8": "* Fix LLibrary patron effect being displayed incorrectly\n* Fix TabulaModel mirror not being set",
"1.7.9": "* Fix a crash when game profile id was null\n* Fix a crash with MineLittlePony due to replacement of arm renderers\n* Fix invalid logger formatting for the TabulaModelHelper\n+ Add dispose method to Element, called when the element is no longer used"
"1.7.7": "* Initial port to 1.12.1",
"1.7.8": "* Fix LLibrary patron effect being displayed incorrectly\n* Fix TabulaModel mirror not being set",
"1.7.9": "* Fix a crash when game profile id was null\n* Fix a crash with MineLittlePony due to replacement of arm renderers\n* Fix invalid logger formatting for the TabulaModelHelper\n+ Add dispose method to Element, called when the element is no longer used"
"1.7.7": "* Initial port to 1.12.2",
"1.7.8": "* Fix LLibrary patron effect being displayed incorrectly\n* Fix TabulaModel mirror not being set",
"1.7.9": "* Fix a crash when game profile id was null\n* Fix a crash with MineLittlePony due to replacement of arm renderers\n* Fix invalid logger formatting for the TabulaModelHelper\n+ Add dispose method to Element, called when the element is no longer used",
"1.7.10": "* Fix log spam related to issues with config system\n* Fix techne texture parsing\n* Fix crashes related to patron effect with some mods\n* Enable COMPUTE_FRAMES for RuntimePatchers, allowing for more complex transforms\n* Fix mod signature",
"1.7.11": "* Fix server crash",
"1.7.12": "* Fix crash with sponge",
"1.7.13": "* Fix memory leak relating to entities not being removed from cache",
"1.7.14": "* Fix occasional crash on player death",
"1.7.15": "* Optimize entity data lookup\n* Add opacity controls to AdvancedModelRenderers (@BobMowzie)\n* Add helper methods to AdvancedModelRenderer allowing transformation of positions into world or model space",
"1.7.17": "* Fix crash on newer forge versions",
"1.7.18": "* Fix LLibrary crashing without a report in some circumstances",
"1.7.19": "* Optimize entity property tracking system (@Shadows-of-Fire)",
"1.7.20": "* Don't print a misleading crash report on failure to receive data from URL"
"1.10.2-latest": "1.7.7",
"1.10.2-recommended": "1.7.6",
"1.11.2-latest": "1.7.11",
"1.11.2-recommended": "1.7.11",
"1.12-recommended": "1.7.9",
"1.12.1-latest": "1.7.9",
"1.12.1-recommended": "1.7.9",
"1.12.2-latest": "1.7.20",
"1.12.2-recommended": "1.7.20"
[23:29:43] [Forge Version Check/INFO] [forge.VersionCheck]: [llibrary] Found status: UP_TO_DATE Target: null
[23:29:43] [Forge Version Check/INFO] [forge.VersionCheck]: [thermalfoundation] Starting version check at https://raw.github.com/cofh/version/master/thermalfoundation_update.json
[23:29:44] [Forge Version Check/DEBUG] [forge.VersionCheck]: [thermalfoundation] Received version check data:
"homepage": "http://www.teamcofh.com/downloads/",
"2.6.7": "Re-upload to fix a CurseForge issue.",
"2.6.6": "More localization.",
"2.6.3": "Localization updates, minor fixes.",
"2.6.2": "Adjustments to config behaviors, minor bugfixes.",
"2.6.1": "Minor fixes. There are always some.",
"2.6.0": "New tools - Excavators!",
"2.5.0": "Backend changes and Horse Armor.",
"2.4.1": "Minor refactors and better Ore Handling.",
"2.4.0": "Large internal refactors. New config options. Added pigments."
"2.2.5": "Final 1.11.2 release."
"2.1.5": "Final 1.10.2 release."
"1.12.2-latest": "2.6.7",
"1.12.2-recommended": "2.6.7",
"1.11.2-latest": "2.2.5",
"1.11.2-recommended": "2.2.5",
"1.10.2-latest": "2.1.5",
"1.10.2-recommended": "2.1.5"
[23:29:44] [Forge Version Check/INFO] [forge.VersionCheck]: [thermalfoundation] Found status: UP_TO_DATE Target: null
[23:29:44] [Forge Version Check/INFO] [forge.VersionCheck]: [cofhworld] Starting version check at https://raw.github.com/cofh/version/master/cofhworld_update.json
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityHighlighted as astralsorcery:entityhighlighted
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityStardust as astralsorcery:entitystardust
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityCrystal as astralsorcery:entitycrystal
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityFlare as astralsorcery:entityflare
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityStarBurst as astralsorcery:entitystarburst
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityIlluminationSpark as astralsorcery:entityilluminationspark
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityNocturnalSpark as astralsorcery:entitynocturnalspark
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityCrystalTool as astralsorcery:entitycrystaltool
[23:29:44] [Forge Version Check/DEBUG] [forge.VersionCheck]: [cofhworld] Received version check data:
"homepage": "http://www.teamcofh.com/downloads/",
"1.4.0": "Minor backend changes.",
"1.3.1": "Added new generation type - full replacement.",
"1.3.0": "More backend changes.",
"1.2.0": "Lots of backend changes and new config options. New generation logic.",
"1.1.1": "Internal refactors."
"1.12.2-latest": "1.4.0",
"1.12.2-recommended": "1.4.0"
[23:29:44] [Forge Version Check/INFO] [forge.VersionCheck]: [cofhworld] Found status: UP_TO_DATE Target: null
[23:29:44] [Forge Version Check/INFO] [forge.VersionCheck]: [cofhcore] Starting version check at https://raw.github.com/cofh/version/master/cofhcore_update.json
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityGrapplingHook as astralsorcery:entitygrapplinghook
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntitySpectralTool as astralsorcery:entityspectraltool
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityLiquidSpark as astralsorcery:entityliquidspark
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityObservatoryHelper as astralsorcery:entityobservatoryhelper
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityShootingStar as astralsorcery:entityshootingstar
[23:29:44] [Server thread/TRACE] [FML]: Automatically registered mod astralsorcery entity EntityItemDamageResistant as astralsorcery:entityitemdamageresistant
[23:29:44] [Forge Version Check/DEBUG] [forge.VersionCheck]: [cofhcore] Received version check data:
"homepage": "http://www.teamcofh.com/downloads/",
"4.6.3": "Localization update!",
"4.6.2": "QoL, minor bugfixes.",
"4.6.1": "Minor QoL update.",
"4.6.0": "Backend work and refactors.",
"4.5.3": "Update for Forge 2739+.",
"4.5.2": "Fix to possible shield blocking recursion issue.",
"4.5.1": "Fix to arrow speed for CoFH bows.",
"4.5.0": "Backend changes and optimizations.",
"4.4.1": "More internal refactors. Config option for Soulbound permanence.",
"4.4.0": "Large internal refactors. New config options."
"4.2.8": "Final 1.11.2 release."
"4.1.12": "Final 1.10.2 release."
"1.12.2-latest": "4.6.6",
"1.12.2-recommended": "4.6.6",
"1.11.2-latest": "4.2.8",
"1.11.2-recommended": "4.2.8",
"1.10.2-latest": "4.1.12",
"1.10.2-recommended": "4.1.12"
[23:29:44] [Forge Version Check/INFO] [forge.VersionCheck]: [cofhcore] Found status: UP_TO_DATE Target: null
[23:29:44] [Forge Version Check/INFO] [forge.VersionCheck]: [craftstudioapi] Starting version check at https://leviathan-studio.com/craftstudioapi/update.json
[23:29:45] [Server thread/INFO] [Astral Core]: [AstralTransformer] Transforming wh : net.minecraft.entity.ai.attributes.ModifiableAttributeInstance with 1 patches!
[23:29:45] [Server thread/INFO] [Astral Core]: [AstralTransformer] Applied patch PATCHPOSTPROCESSATTRIBUTES
[23:29:45] [Server thread/INFO] [Astral Sorcery]: Crafttweaker not found!
[23:29:45] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod astralsorcery
[23:29:45] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Astral Sorcery took 2.469s
[23:29:45] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod quark
[23:29:46] [Server thread/INFO] [Quark]: 'Ender watcher' is forcefully disabled as it's incompatible with the following loaded mods: [botania]
[23:29:46] [Server thread/INFO] [Quark]: 'Dispensers place seeds' is forcefully disabled as it's incompatible with the following loaded mods: [botania]
[23:29:46] [Server thread/INFO] [Quark]: Module tweaks is enabled
[23:29:46] [Server thread/INFO] [Quark]: Module building is enabled
[23:29:46] [Server thread/INFO] [Quark]: Module misc is enabled
[23:29:46] [Server thread/INFO] [Quark]: Module vanity is enabled
[23:29:46] [Server thread/INFO] [Quark]: Module management is enabled
[23:29:46] [Server thread/INFO] [Quark]: Module world is enabled
[23:29:46] [Server thread/INFO] [Quark]: Module experimental is enabled
[23:29:46] [Server thread/INFO] [Quark]: Module decoration is enabled
[23:29:46] [Server thread/INFO] [Quark]: Module automation is enabled
[23:29:46] [Server thread/INFO] [Quark]: Module client is enabled
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:pickarang as quark:pickarang
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:arrow_ender as quark:arrow_ender
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:arrow_explosive as quark:arrow_explosive
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:arrow_torch as quark:arrow_torch
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:dragon_breath_bottle as quark:dragon_breath_bottle
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:soul_powder as quark:soul_powder
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:parrot_egg as quark:parrot_egg
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:seat as quark:seat
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:chest_passenger as quark:chest_passenger
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:stoneling as quark:stoneling
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:archaeologist as quark:archaeologist
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:foxhound as quark:foxhound
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:dweller as quark:dweller
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:ashen as quark:ashen
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:frog as quark:frog
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:pirate as quark:pirate
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:crab as quark:crab
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:wraith as quark:wraith
[23:29:47] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:flat_item_frame as quark:flat_item_frame
[23:29:49] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:leash_knot as quark:leash_knot
[23:29:49] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:colored_item_frame as quark:colored_item_frame
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:glass_item_frame as quark:glass_item_frame
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:gravisand as quark:gravisand
[23:29:50] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod quark
[23:29:50] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Quark took 4.481s
[23:29:50] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod autoreglib
[23:29:50] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod autoreglib
[23:29:50] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - AutoRegLib took 0.004s
[23:29:50] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod thaumcraft
[23:29:50] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod thaumcraft
[23:29:50] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Thaumcraft took 0.164s
[23:29:50] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod botania
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:manaBurst as botania:mana_burst
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:signalFlare as botania:signal_flare
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:pixie as botania:pixie
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:flameRing as botania:flame_ring
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:vineBall as botania:vine_ball
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:doppleganger as botania:doppleganger
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:magicLandmine as botania:magic_landmine
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:spark as botania:spark
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:thrownItem as botania:thrown_item
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:magicMissile as botania:magic_missile
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:thornChakram as botania:thorn_chakram
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:corporeaSpark as botania:corporea_spark
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:enderAirBottle as botania:ender_air_bottle
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:poolMinecart as botania:pool_minecart
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:pinkWither as botania:pink_wither
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:playerMover as botania:player_mover
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:manaStorm as botania:mana_storm
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:babylonWeapon as botania:babylon_weapon
[23:29:50] [Server thread/TRACE] [FML]: Automatically registered mod botania entity botania:fallingStar as botania:falling_star
[23:29:51] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod botania
[23:29:51] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Botania took 0.742s
[23:29:51] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod patchouli
[23:29:51] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod patchouli
[23:29:51] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Patchouli took 0.313s
[23:29:51] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod betteranimalsplus
[23:29:51] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod betteranimalsplus
[23:29:51] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Better Animals Plus took 0.047s
[23:29:51] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod bewitchment
[23:29:51] [Server thread/INFO] [Bewitchment]: Remember when I told you how my
[23:29:51] [Server thread/INFO] [Bewitchment]: Kin is different in some ways?
[23:29:52] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod bewitchment
[23:29:52] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Bewitchment took 1.230s
[23:29:52] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod bibliocraft
[23:29:52] [Server thread/TRACE] [FML]: Automatically registered mod bibliocraft entity SeatEntity as bibliocraft:biblioseat
[23:29:52] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod bibliocraft
[23:29:52] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - BiblioCraft took 0.147s
[23:29:52] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod biomesoplenty
[23:29:53] [Server thread/TRACE] [FML]: Automatically registered mod biomesoplenty entity mudball as biomesoplenty:mudball
[23:29:53] [Server thread/TRACE] [FML]: Automatically registered mod biomesoplenty entity bop_boat as biomesoplenty:bop_boat
[23:29:53] [Server thread/TRACE] [FML]: Automatically registered mod biomesoplenty entity wasp as biomesoplenty:wasp
[23:29:54] [Server thread/DEBUG] [RandomThingsCore]: Found VillagePiece Church Class: net/minecraft/world/gen/structure/StructureVillagePieces$Church
[23:29:54] [Server thread/DEBUG] [RandomThingsCore]: - Found addComponentParts
[23:29:54] [Server thread/DEBUG] [RandomThingsCore]: - Patched addComponentParts
[23:29:54] [Server thread/DEBUG] [RandomThingsCore]: - Patched addComponentParts
[23:29:54] [Server thread/DEBUG] [RandomThingsCore]: Found MonumentCoreRoom Class: net/minecraft/world/gen/structure/StructureOceanMonumentPieces$MonumentCoreRoom
[23:29:54] [Server thread/DEBUG] [RandomThingsCore]: - Found addComponentParts
[23:29:54] [Server thread/DEBUG] [RandomThingsCore]: - Patched addComponentParts
[23:29:54] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod biomesoplenty
[23:29:54] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Biomes O' Plenty took 1.758s
[23:29:54] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod guideapi
[23:29:54] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod guideapi
[23:29:54] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Guide-API took 0.042s
[23:29:54] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod bloodmagic
[23:29:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod bloodmagic
[23:29:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Blood Magic: Alchemical Wizardry took 0.317s
[23:29:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod bloodmoon
[23:29:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod bloodmoon
[23:29:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Bloodmoon took 0.009s
[23:29:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod codechickenlib
[23:29:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod codechickenlib
[23:29:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - CodeChicken Lib took 0.059s
[23:29:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod redstoneflux
[23:29:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod redstoneflux
[23:29:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Redstone Flux took 0.005s
[23:29:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod brandonscore
[23:29:55] [Server thread/INFO] [brandonscore]: Found mod config container for mod: brandonscore
[23:29:55] [Server thread/INFO] [brandonscore]: Loading mod config for: brandonscore
[23:29:55] [Server thread/WARN] [brandonscore]: No features were detected for mod: brandonscore. This maybe an issue or maybe this mod just does not have any items or blocks.
[23:29:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod brandonscore
[23:29:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Brandon's Core took 0.084s
[23:29:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mysticalworld
[23:29:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mysticalworld
[23:29:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Mystical World took 0.094s
[23:29:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod chisel
[23:29:55] [Server thread/INFO] [FML]: Applying holder lookups
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aercloud for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aercloud. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_crafting_table for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_crafting_table. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_dirt for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_dirt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_flower for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_flower. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_grass. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_portal for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_portal. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_teleporter for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_teleporter. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_pillar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:altar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.altar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:amberoot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.amberoot_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ambrosium_ore. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_torch for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ambrosium_torch. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arctic_spikespring for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.arctic_spikespring. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_door for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.arkenium_door. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.arkenium_ore. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:barkshroom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.barkshroom. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_dark_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_dark_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_light_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_light_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_swingtip for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_swingtip. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberry_bush for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blueberry_bush. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_plant for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.brettl_plant. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.candy_cane_block. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.candy_cane_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudwool_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.cloudwool_block. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudwool_carpet for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.cloudwool_carpet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_pane for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass_pane. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_pane_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass_pane_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_blue_dark_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_blue_dark_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_blue_light_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_blue_light_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_blue_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_blue_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_beam. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_log. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_planks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_pillar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:ferrosite for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ferrosite. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:ferrosite_sand for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ferrosite_sand. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:forgotten_rose for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.forgotten_rose. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:golden_oak_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.golden_oak_log. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.gravitite_block. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.gravitite_ore. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_button. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_fence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_fence_gate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_log_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_pressure_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_sapling. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_dark_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_dark_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_light_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_light_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_swingtip for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_swingtip. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_lantern for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_lantern. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_pillar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_bush for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_bush. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_ice for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_ice. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_ice_crystal for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_ice_crystal. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_packed_ice for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_packed_ice. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_snow for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_snow. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_snow_layer for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_snow_layer. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_tulips for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_tulips. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_bookshelf for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_bookshelf. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_button. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_furnace for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_furnace. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_pillar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_pressure_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_rock for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_rock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_bricks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_bricks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_bricks_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_bricks_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_cooler for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_cooler. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_ore. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_pillar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:incubator for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.incubator. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_flower for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.irradiated_flower. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_beam. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_log. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_planks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:magnetic_shroom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.magnetic_shroom. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:masonry_bench for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.masonry_bench. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_egg for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.moa_egg. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mossy_holystone_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mossy_holystone_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mossy_holystone_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mossy_holystone_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mossy_holystone_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mossy_holystone_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:multiblock_dummy for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.multiblock_dummy. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:multiblock_dummy_half for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.multiblock_dummy_half. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mutant_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mutant_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mutant_leaves_decorated for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mutant_leaves_decorated. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:neverbloom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.neverbloom. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange_tree for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.orange_tree. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:outpost_campfire for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.outpost_campfire. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:pink_swingtip for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.pink_swingtip. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.plumproot. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:present for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.present. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:quickshoot for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quickshoot. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass_pane for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass_pane. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass_pane_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass_pane_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:rusted_ferrosite for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.rusted_ferrosite. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_pane for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_pane. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_pane_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_pane_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_door for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.secret_skyroot_door. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_trapdoor for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.secret_skyroot_trapdoor. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_decorative_lit for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_decorative_lit. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_pillar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_pillar_lit for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_pillar_lit. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_beam. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bed for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_bed. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bookshelf for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_bookshelf. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_button. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_chest for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_chest. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_door for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_door. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_fence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_fence_gate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_ladder for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_ladder. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_log. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_log_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_planks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_pressure_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_sapling. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_trapdoor for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_trapdoor. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_twigs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_twigs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:standing_skyroot_sign for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.standing_skyroot_sign. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:stoneshroom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.stoneshroom. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:tall_aether_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.tall_aether_grass. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:thera_dirt for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.thera_dirt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:thera_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.thera_grass. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_pillar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_beam. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_decorative. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_fence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_fence_gate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_log. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_log_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_planks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:unique_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.unique_sapling. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.valkyrie_grass. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wall_skyroot_sign for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wall_skyroot_sign. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wildcard for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wildcard. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_button. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_fence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_fence_gate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_log_wall. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_pressure_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_sapling. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:woven_sticks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.woven_sticks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.zanite_block. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.zanite_ore. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aechor_petal for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aechor_petal. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aerwhale_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aerwhale_music_disc. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_saddle for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aether_saddle. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:antitoxin_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.antitoxin_vial. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:antivenom_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.antivenom_vial. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_chunk for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ambrosium_chunk. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_shard for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ambrosium_shard. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_axe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_boots. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_crossbow. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_door_item. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_gloves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_helmet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_leggings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shears for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shears. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shield. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shovel. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_strip for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_strip. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:bandage for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.bandage. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.blueberries. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberry_lollipop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.blueberry_lollipop. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:bolt for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.bolt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_cane for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_cane. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_grass for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_grass. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_rope for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_rope. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_boots. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_gloves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_helmet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_leggings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_rib_cut for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_rib_cut. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_ribs for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_ribs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.candy_cane. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_corn for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.candy_corn. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloud_parachute for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cloud_parachute. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudtwine for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cloudtwine. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:cockatrice_feather for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cockatrice_feather. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:cocoatrice for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cocoatrice. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_shard for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.crude_scatterglass_shard. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:dart for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.dart. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:dart_shooter for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.dart_shooter. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:eggnog for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.eggnog. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:enchanted_blueberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.enchanted_blueberry. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:enchanted_wyndberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.enchanted_wyndberry. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:fried_moa_egg for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.fried_moa_egg. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:ginger_bread_man for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ginger_bread_man. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:golden_amber for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.golden_amber. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_axe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_boots. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_crossbow. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_gloves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_helmet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_leggings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_plate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_shield. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_shovel. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:healing_stone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.healing_stone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:healing_stone_depleted for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.healing_stone_depleted. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_axe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_crossbow. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_shield. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_shovel. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.icestone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_poprocks for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.icestone_poprocks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_armor for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_armor. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_charm for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_charm. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_chunk for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_chunk. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_dust for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_dust. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_neckwear for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_neckwear. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_ring for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_ring. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_tool for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_tool. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:jelly_plumproot for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.jelly_plumproot. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:kirrid_cutlet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.kirrid_cutlet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:kirrid_loin for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.kirrid_loin. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:labyrinth_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.labyrinth_music_disc. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_egg_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_egg_item. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feather for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feather. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed_blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed_blueberries. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed_enchanted_blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed_enchanted_blueberries. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_music_disc. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.orange. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange_lollipop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.orange_lollipop. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot_mash for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.plumproot_mash. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot_pie for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.plumproot_pie. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:rainbow_moa_egg for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.rainbow_moa_egg. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:raw_taegore_meat for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.raw_taegore_meat. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:recording_892 for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.recording_892. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.scatterglass_vial. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.secret_skyroot_door_item. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:shard_of_life for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.shard_of_life. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_axe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bed_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_bed_item. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_bucket. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_crossbow. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_door_item. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_lizard_stick for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_lizard_stick. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_lizard_stick_roasted for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_lizard_stick_roasted. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_milk_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_milk_bucket. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pinecone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_pinecone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_poison_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_poison_bucket. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_shield. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_shovel. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sign for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_sign. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_stick for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_stick. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_water_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_water_bucket. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:splint for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.splint. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:stomper_pop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.stomper_pop. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_gel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_gel. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_jelly for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_jelly. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_sugar for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_sugar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_boots. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_gloves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_helmet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_leggings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_steak for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_steak. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_music_disc. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_tea for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_tea. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_wings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_wings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:water_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.water_vial. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:winter_hat for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.winter_hat. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wrapped_chocolates for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wrapped_chocolates. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wrapping_paper for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wrapping_paper. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:wyndberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wyndberry. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:yule_log for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.yule_log. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_axe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_boots. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_crossbow. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_gemstone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_gemstone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_gloves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_helmet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_leggings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_shield. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_shovel. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_iron for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_iron. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_diamond for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_diamond. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_hitech for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_hitech. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:offsettool for public static team.chisel.common.item.ItemOffsetTool team.chisel.common.init.ChiselItems.offsettool. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:screen for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.SCREEN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:progress_detector for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.PROGRESS_DETECTOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:detector for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.DETECTOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:progress_screen for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.PROGRESS_SCREEN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:chest for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.CHEST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:loot_crate_storage for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.LOOT_CRATE_STORAGE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:loot_crate_opener for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.LOOT_CRATE_OPENER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:barrier for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.BARRIER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:reward_collector for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.REWARD_COLLECTOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:book for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.BOOK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:lootcrate for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.LOOTCRATE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:custom_icon for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.CUSTOM_ICON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:boost for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.BOOST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:whirlwind for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.WHIRLWIND. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:planar_binding for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.PLANAR_BINDING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:soul_snare for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.SOUL_SNARE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:soul_fray for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.SOUL_FRAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:fire_fuse for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.FIRE_FUSE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:constrict for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.CONSTRICT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:plant_leech for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.PLANT_LEECH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:deafness for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.DEAFNESS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:bounce for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.BOUNCE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:cling for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.CLING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sacrificial_lamb for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.SACRIFICIAL_LAMB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:flight for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.FLIGHT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:grounded for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.GROUNDED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:heavy_heart for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.HEAVY_HEART. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:suspended for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.SUSPENDED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:feathered for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.FEATHERED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:venison_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.VENISON_RAW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:venison_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.VENISON_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:hirschgeist_skull_wearable for public static its_meow.betteranimalsplus.common.item.ItemHirschgeistSkullWearable its_meow.betteranimalsplus.init.ModItems.HIRSCHGEIST_SKULL_WEARABLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:antler for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.ANTLER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:blubber for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.BLUBBER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goat_milk for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.GOAT_MILK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goat_cheese for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.GOAT_CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.PHEASANT_RAW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.PHEASANT_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:wolf_pelt_snowy for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.WOLF_PELT_SNOWY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:wolf_pelt_timber for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.WOLF_PELT_TIMBER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:wolf_pelt_black for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.WOLF_PELT_BLACK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:wolf_pelt_arctic for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.WOLF_PELT_ARCTIC. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:wolf_pelt_brown for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.WOLF_PELT_BROWN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:wolf_pelt_red for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.WOLF_PELT_RED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:bear_skin_brown for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.BEAR_SKIN_BROWN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:bear_skin_black for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.BEAR_SKIN_BLACK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:bear_skin_kermode for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.BEAR_SKIN_KERMODE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:crab_meat_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.CRAB_MEAT_RAW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:crab_meat_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.CRAB_MEAT_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:record_crab_rave for public static net.minecraft.item.ItemRecord its_meow.betteranimalsplus.init.ModItems.RECORD_CRAB_RAVE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:record_walrus for public static net.minecraft.item.ItemRecord its_meow.betteranimalsplus.init.ModItems.RECORD_WALRUS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_egg for public static its_meow.betteranimalsplus.common.item.ItemThrowableCustomEgg its_meow.betteranimalsplus.init.ModItems.PHEASANT_EGG. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:turkey_egg for public static its_meow.betteranimalsplus.common.item.ItemThrowableCustomEgg its_meow.betteranimalsplus.init.ModItems.TURKEY_EGG. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goose_egg for public static its_meow.betteranimalsplus.common.item.ItemThrowableCustomEgg its_meow.betteranimalsplus.init.ModItems.GOOSE_EGG. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:golden_goose_egg for public static its_meow.betteranimalsplus.common.item.ItemThrowableCustomEgg its_meow.betteranimalsplus.init.ModItems.GOLDEN_GOOSE_EGG. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:turkey_leg_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.TURKEY_LEG_RAW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:turkey_leg_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.TURKEY_LEG_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:eel_meat_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.EEL_MEAT_RAW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:eel_meat_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.EEL_MEAT_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:fried_egg for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.FRIED_EGG. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:altar for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.ALTAR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:blood_rune for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.BLOOD_RUNE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:ritual_controller for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.RITUAL_CONTROLLER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:ritual_stone for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.RITUAL_STONE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:blood_light for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.BLOOD_LIGHT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:teleposer for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.TELEPOSER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:alchemy_array for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.ALCHEMY_ARRAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:spectral for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.SPECTRAL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:phantom for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.PHANTOM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:soul_forge for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.SOUL_FORGE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:incense_altar for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.INCENSE_ALTAR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_crucible for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_CRUCIBLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_pylon for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_PYLON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_crystallizer for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_CRYSTALLIZER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_crystal for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_CRYSTAL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:alchemy_table for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.ALCHEMY_TABLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:life_essence for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.LIFE_ESSENCE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:decorative_brick for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DECORATIVE_BRICK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:path for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.PATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:master_routing_node for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.MASTER_ROUTING_NODE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:input_routing_node for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.INPUT_ROUTING_NODE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:output_routing_node for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.OUTPUT_ROUTING_NODE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:item_routing_node for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.ITEM_ROUTING_NODE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:dimensional_portal for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DIMENSIONAL_PORTAL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:blood_tank for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.BLOOD_TANK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:mimic for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.MIMIC. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_brick_1 for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_BRICK_1. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_brick_2 for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_BRICK_2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_extras for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_EXTRAS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_pillar_1 for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_PILLAR_1. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_pillar_2 for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_PILLAR_2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_pillar_cap_1 for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_PILLAR_CAP_1. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_pillar_cap_2 for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_PILLAR_CAP_2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_pillar_cap_3 for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_PILLAR_CAP_3. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_light for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_LIGHT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_wall_1 for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_WALL_1. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_stairs_1 for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_STAIRS_1. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_stairs_2 for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_STAIRS_2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_stairs_3 for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.DEMON_STAIRS_3. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:inversion_pillar for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.INVERSION_PILLAR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:inversion_pillar_end for public static net.minecraft.block.Block WayofTime.bloodmagic.core.RegistrarBloodMagicBlocks.INVERSION_PILLAR_END. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_cursed for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_CURSED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_headgear for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_HEADGEAR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_headgear_mob for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_HEADGEAR_MOB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_headgear_arrow for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_HEADGEAR_ARROW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_headgear_bolt for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_HEADGEAR_BOLT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_headgear_doll for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_HEADGEAR_DOLL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_headgear_ears_elf for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_HEADGEAR_EARS_ELF. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_charm_damage_iron for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_CHARM_DAMAGE_IRON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_ring_haste for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_RING_HASTE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_ring_jump for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_RING_JUMP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_ring_night for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_RING_NIGHT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_ring_speed for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_RING_SPEED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_trinket_levitation for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_TRINKET_LEVITATION. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_trinket_poison for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_TRINKET_POISON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_trinket_water_breathing for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_TRINKET_WATER_BREATHING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_trinket_wither for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_TRINKET_WITHER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box for public static net.minecraft.item.Item gaia.init.GaiaItems.BOX. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bag_arrow for public static net.minecraft.item.Item gaia.init.GaiaItems.BAG_ARROW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bag_book for public static net.minecraft.item.Item gaia.init.GaiaItems.BAG_BOOK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bag_record for public static net.minecraft.item.Item gaia.init.GaiaItems.BAG_RECORD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:book_buff for public static net.minecraft.item.Item gaia.init.GaiaItems.BOOK_BUFF. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_diamond for public static net.minecraft.item.Item gaia.init.GaiaItems.BOX_DIAMOND. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_gold for public static net.minecraft.item.Item gaia.init.GaiaItems.BOX_GOLD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_hat for public static net.minecraft.item.Item gaia.init.GaiaItems.BOX_HAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_iron for public static net.minecraft.item.Item gaia.init.GaiaItems.BOX_IRON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_old for public static net.minecraft.item.Item gaia.init.GaiaItems.BOX_OLD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:chest for public static net.minecraft.item.Item gaia.init.GaiaItems.CHEST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_item for public static net.minecraft.item.Item gaia.init.GaiaItems.DEBUG_ITEM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_weapon for public static net.minecraft.item.Item gaia.init.GaiaItems.DEBUG_WEAPON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_coalfish for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_COALFISH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_honey for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_HONEY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_mandrake for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_MANDRAKE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_meat for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_MEAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_monster_feed for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_MONSTER_FEED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_monster_feed_premium for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_MONSTER_FEED_PREMIUM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_nether_wart for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_NETHER_WART. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_pie_apple_gold for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_PIE_APPLE_GOLD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_pie_mandrake for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_PIE_MANDRAKE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_pie_meat for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_PIE_MEAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_root for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_ROOT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_rotten_heart for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_ROTTEN_HEART. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_small_apple_gold for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_SMALL_APPLE_GOLD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_wither for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_WITHER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_book for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_BOOK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_currency for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_CURRENCY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_elytra for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_ELYTRA. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_experience for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_EXPERIENCE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_fur for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_FUR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_furnace_fuel for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_FURNACE_FUEL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_giga_gear for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_GIGA_GEAR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_quill for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_QUILL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_pearl for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_PEARL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_ring for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_RING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_soul_fire for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_SOUL_FIRE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_soul_fiery for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_SOUL_FIERY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:pickup_heart for public static net.minecraft.item.Item gaia.init.GaiaItems.PICKUP_HEART. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shard for public static net.minecraft.item.Item gaia.init.GaiaItems.SHARD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shard_misc for public static net.minecraft.item.Item gaia.init.GaiaItems.SHARD_MISC. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shield_prop for public static net.minecraft.item.Item gaia.init.GaiaItems.SHIELD_PROP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_weresheep for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_WERESHEEP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_creeper_girl for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_CREEPER_GIRL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_ender_girl for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_ENDER_GIRL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_holstaurus for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_HOLSTAURUS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_slime_girl for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_SLIME_GIRL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_tame for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_TAME. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_trader for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_TRADER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_battle for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_BATTLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_buff for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_BUFF. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_ender for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_ENDER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_freezing for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_FREEZING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_hunger for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_HUNGER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_metal for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_METAL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_nature for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_NATURE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_nightmare for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_NIGHTMARE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_wither for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_WITHER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_fan for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_FAN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_fan_fire for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_FAN_FIRE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_fan_ice for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_FAN_ICE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_projectile_bomb for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROJECTILE_BOMB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_enchanted for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_ENCHANTED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_projectile_bubble for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_PROJECTILE_BUBBLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_projectile_magic for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_PROJECTILE_MAGIC. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_projectile_magic_random for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_PROJECTILE_MAGIC_RANDOM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_projectile_poison for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_PROJECTILE_POISON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_projectile_web for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_PROJECTILE_WEB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_sword_wood for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_SWORD_WOOD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_sword_stone for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_SWORD_STONE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_sword_iron for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_SWORD_IRON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_sword_gold for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_SWORD_GOLD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_axe_wood for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_AXE_WOOD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_axe_stone for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_AXE_STONE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_axe_iron for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_AXE_IRON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_axe_gold for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_AXE_GOLD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_dagger_metal for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_DAGGER_METAL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_broom for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_BROOM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_hammer_minotaur for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_HAMMER_MINOTAUR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:block_pearl for public static net.minecraft.block.Block gaia.init.GaiaBlocks.BLOCK_PEARL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bust_gorgon for public static net.minecraft.block.Block gaia.init.GaiaBlocks.BUST_GORGON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bust_sphinx for public static net.minecraft.block.Block gaia.init.GaiaBlocks.BUST_SPHINX. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bust_valkyrie for public static net.minecraft.block.Block gaia.init.GaiaBlocks.BUST_VALKYRIE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bust_vampire for public static net.minecraft.block.Block gaia.init.GaiaBlocks.BUST_VAMPIRE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:doll_creeper_girl for public static net.minecraft.block.Block gaia.init.GaiaBlocks.DOLL_CREEPER_GIRL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:doll_ender_girl for public static net.minecraft.block.Block gaia.init.GaiaBlocks.DOLL_ENDER_GIRL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:doll_slime_girl for public static net.minecraft.block.Block gaia.init.GaiaBlocks.DOLL_SLIME_GIRL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:doll_maid for public static net.minecraft.block.Block gaia.init.GaiaBlocks.DOLL_MAID. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:doll_dullahan for public static net.minecraft.block.Block gaia.init.GaiaBlocks.DOLL_DULLAHAN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:doll_mermaid for public static net.minecraft.block.Block gaia.init.GaiaBlocks.DOLL_MERMAID. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:doll_nine_tails for public static net.minecraft.block.Block gaia.init.GaiaBlocks.DOLL_NINE_TAILS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:doll_dryad for public static net.minecraft.block.Block gaia.init.GaiaBlocks.DOLL_DRYAD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:deco_garden_gnome for public static net.minecraft.block.Block gaia.init.GaiaBlocks.DECO_GARDEN_GNOME. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:deco_mandragora_pot for public static net.minecraft.block.Block gaia.init.GaiaBlocks.DECO_MANDRAGORA_POT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:deco_bust_minotaur for public static net.minecraft.block.Block gaia.init.GaiaBlocks.DECO_BUST_MINOTAUR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:deco_nest_harpy for public static net.minecraft.block.Block gaia.init.GaiaBlocks.DECO_NEST_HARPY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_guard for public static net.minecraft.block.Block gaia.init.GaiaBlocks.SPAWN_GUARD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:web_temp for public static net.minecraft.block.Block gaia.init.GaiaBlocks.WEB_TEMP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:fire_camp for public static net.minecraft.block.Block gaia.init.GaiaBlocks.FIRE_CAMP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup itemfilters:filter for public static net.minecraft.item.Item com.latmod.mods.itemfilters.item.ItemFiltersItems.FILTER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup itemfilters:missing for public static net.minecraft.item.Item com.latmod.mods.itemfilters.item.ItemFiltersItems.MISSING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:blood_orb for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BLOOD_ORB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:activation_crystal for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.ACTIVATION_CRYSTAL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:slate for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SLATE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:inscription_tool for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.INSCRIPTION_TOOL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sacrificial_dagger for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SACRIFICIAL_DAGGER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:pack_self_sacrifice for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.PACK_SELF_SACRIFICE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:pack_sacrifice for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.PACK_SACRIFICE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:dagger_of_sacrifice for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.DAGGER_OF_SACRIFICE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:ritual_diviner for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.RITUAL_DIVINER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:ritual_dismantler for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.RITUAL_DISMANTLER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:ritual_reader for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.RITUAL_READER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:lava_crystal for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.LAVA_CRYSTAL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:bound_sword for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BOUND_SWORD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:bound_pickaxe for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BOUND_PICKAXE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:bound_axe for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BOUND_AXE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:bound_shovel for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BOUND_SHOVEL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_divination for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_DIVINATION. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_air for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_AIR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_water for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_WATER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_lava for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_LAVA. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_void for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_VOID. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_green_grove for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_GREEN_GROVE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_blood_light for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_BLOOD_LIGHT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_elemental_affinity for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_ELEMENTAL_AFFINITY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_haste for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_HASTE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_magnetism for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_MAGNETISM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_suppression for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_SUPPRESSION. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_fast_miner for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_FAST_MINER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_seer for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_SEER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_ender_severance for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_ENDER_SEVERANCE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_whirlwind for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_WHIRLWIND. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_phantom_bridge for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_PHANTOM_BRIDGE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_compression for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_COMPRESSION. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_holding for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_HOLDING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_teleposition for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_TELEPOSITION. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_transposition for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_TRANSPOSITION. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_claw for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_CLAW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_bounce for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_BOUNCE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_frost for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_FROST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:component for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.COMPONENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:item_demon_crystal for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.ITEM_DEMON_CRYSTAL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:teleposition_focus for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.TELEPOSITION_FOCUS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:experience_tome for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.EXPERIENCE_TOME. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:blood_shard for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BLOOD_SHARD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:living_armour_helmet for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.LIVING_ARMOUR_HELMET. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:living_armour_chest for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.LIVING_ARMOUR_CHEST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:living_armour_leggings for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.LIVING_ARMOUR_LEGGINGS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:living_armour_boots for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.LIVING_ARMOUR_BOOTS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_armour_helmet for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_ARMOUR_HELMET. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_armour_chest for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_ARMOUR_CHEST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_armour_leggings for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_ARMOUR_LEGGINGS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_armour_boots for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_ARMOUR_BOOTS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:altar_maker for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.ALTAR_MAKER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:upgrade_tome for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.UPGRADE_TOME. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:upgrade_trainer for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.UPGRADE_TRAINER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:arcane_ashes for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.ARCANE_ASHES. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:monster_soul for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.MONSTER_SOUL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:soul_gem for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SOUL_GEM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:soul_snare for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SOUL_SNARE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_sword for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_SWORD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_bow for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_BOW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_armour_gem for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_ARMOUR_GEM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_axe for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_AXE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_pickaxe for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_PICKAXE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_shovel for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_SHOVEL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:node_router for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.NODE_ROUTER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:base_item_filter for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BASE_ITEM_FILTER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:base_fluid_filter for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BASE_FLUID_FILTER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:cutting_fluid for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.CUTTING_FLUID. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sanguine_book for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SANGUINE_BOOK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:points_upgrade for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.POINTS_UPGRADE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_will_gauge for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.DEMON_WILL_GAUGE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:potion_flask for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.POTION_FLASK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:alchemic_vial for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.ALCHEMIC_VIAL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:icarus_scroll for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.ICARUS_SCROLL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:passive_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.PASSIVE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:passive_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.PASSIVE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:passive_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.PASSIVE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:assist_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ASSIST_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:assist_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ASSIST_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:assist_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ASSIST_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:aggressive_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.AGGRESSIVE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:aggressive_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.AGGRESSIVE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:aggressive_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.AGGRESSIVE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DEBUG_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DEBUG_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DEBUG_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ant_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANT_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ant_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ant_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_male_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_MALE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_male_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_MALE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_male_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_MALE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:arachne_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ARACHNE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:arachne_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ARACHNE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:arachne_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ARACHNE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:banshee_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BANSHEE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:banshee_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BANSHEE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:banshee_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BANSHEE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:baphomet_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BAPHOMET_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:baphomet_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BAPHOMET_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:baphomet_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BAPHOMET_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bee_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bee_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bee_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:beholder_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEHOLDER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:beholder_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEHOLDER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:beholder_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEHOLDER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cecaelia_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CECAELIA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cecaelia_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CECAELIA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cecaelia_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CECAELIA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_male_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_MALE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_male_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_MALE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_male_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_MALE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cyclops_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CYCLOPS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cyclops_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CYCLOPS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cyclops_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CYCLOPS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dhampir_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DHAMPIR_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dhampir_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DHAMPIR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dhampir_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DHAMPIR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dryad_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DRYAD_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dryad_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DRYAD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dryad_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DRYAD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dullahan_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DULLAHAN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dullahan_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DULLAHAN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dullahan_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DULLAHAN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dwarf_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DWARF_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dwarf_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DWARF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dwarf_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DWARF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:goblin_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GOBLIN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:goblin_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GOBLIN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:goblin_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GOBLIN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gorgon_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GORGON_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gorgon_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GORGON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gorgon_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GORGON_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gryphon_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GRYPHON_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gryphon_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GRYPHON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gryphon_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GRYPHON_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_wizard_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_WIZARD_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_wizard_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_WIZARD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_wizard_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_WIZARD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:hunter_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HUNTER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:hunter_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HUNTER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:hunter_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HUNTER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kikimora_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KIKIMORA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kikimora_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KIKIMORA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kikimora_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KIKIMORA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kobold_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KOBOLD_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kobold_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KOBOLD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kobold_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KOBOLD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mandragora_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MANDRAGORA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mandragora_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MANDRAGORA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mandragora_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MANDRAGORA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mandragora_scream for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MANDRAGORA_SCREAM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:matango_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MATANGO_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:matango_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MATANGO_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:matango_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MATANGO_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mermaid_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MERMAID_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mermaid_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MERMAID_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mermaid_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MERMAID_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaur_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAUR_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaur_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAUR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaur_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAUR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaurus_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAURUS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaurus_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAURUS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaurus_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAURUS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mummy_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MUMMY_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mummy_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MUMMY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mummy_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MUMMY_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:naga_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NAGA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:naga_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NAGA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:naga_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NAGA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ninetails_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NINETAILS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ninetails_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NINETAILS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ninetails_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NINETAILS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:oni_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ONI_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:oni_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ONI_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:oni_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ONI_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:orc_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ORC_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:orc_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ORC_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:orc_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ORC_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:satyress_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SATYRESS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:satyress_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SATYRESS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:satyress_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SATYRESS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:selkie_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SELKIE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:selkie_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SELKIE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:selkie_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SELKIE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shaman_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHAMAN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shaman_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHAMAN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shaman_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHAMAN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sharko_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHARKO_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sharko_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHARKO_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sharko_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHARKO_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:siren_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SIREN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:siren_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SIREN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:siren_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SIREN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sludgegirl_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLUDGEGIRL_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sludgegirl_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLUDGEGIRL_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sludgegirl_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLUDGEGIRL_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sphinx_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPHINX_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sphinx_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPHINX_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sphinx_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPHINX_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spriggan_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPRIGGAN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spriggan_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPRIGGAN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spriggan_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPRIGGAN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_male_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_MALE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_male_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_MALE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_male_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_MALE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:toad_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TOAD_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:toad_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TOAD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:toad_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TOAD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:valkyrie_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VALKYRIE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:valkyrie_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VALKYRIE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:valkyrie_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VALKYRIE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:vampire_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VAMPIRE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:vampire_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VAMPIRE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:vampire_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VAMPIRE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:werecat_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERECAT_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:werecat_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERECAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:werecat_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERECAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:witch_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WITCH_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:witch_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WITCH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:witch_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WITCH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yeti_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YETI_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yeti_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YETI_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yeti_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YETI_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yukionna_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YUKIONNA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yukionna_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YUKIONNA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yukionna_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YUKIONNA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:holstaurus_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HOLSTAURUS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:holstaurus_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HOLSTAURUS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:holstaurus_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HOLSTAURUS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:trader_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TRADER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:trader_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TRADER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:trader_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TRADER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weresheep_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERESHEEP_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weresheep_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERESHEEP_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weresheep_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERESHEEP_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:creepergirl_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CREEPERGIRL_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:creepergirl_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CREEPERGIRL_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:creepergirl_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CREEPERGIRL_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:endergirl_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ENDERGIRL_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:endergirl_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ENDERGIRL_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:endergirl_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ENDERGIRL_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:slimegirl_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLIMEGIRL_SAY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:slimegirl_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLIMEGIRL_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:slimegirl_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLIMEGIRL_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:step_sandals for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.STEP_SANDALS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:step_webbed for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.STEP_WEBBED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_open_1 for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOX_OPEN_1. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_open_2 for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOX_OPEN_2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bag_open for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BAG_OPEN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:book_hit for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOOK_HIT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:none for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NONE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:screen for public static net.minecraft.block.Block com.feed_the_beast.ftbquests.block.FTBQuestsBlocks.SCREEN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:screen_part for public static net.minecraft.block.Block com.feed_the_beast.ftbquests.block.FTBQuestsBlocks.SCREEN_PART. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:progress_detector for public static net.minecraft.block.Block com.feed_the_beast.ftbquests.block.FTBQuestsBlocks.PROGRESS_DETECTOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:detector for public static net.minecraft.block.Block com.feed_the_beast.ftbquests.block.FTBQuestsBlocks.DETECTOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:progress_screen for public static net.minecraft.block.Block com.feed_the_beast.ftbquests.block.FTBQuestsBlocks.PROGRESS_SCREEN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:progress_screen_part for public static net.minecraft.block.Block com.feed_the_beast.ftbquests.block.FTBQuestsBlocks.PROGRESS_SCREEN_PART. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:chest for public static net.minecraft.block.Block com.feed_the_beast.ftbquests.block.FTBQuestsBlocks.CHEST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:loot_crate_storage for public static net.minecraft.block.Block com.feed_the_beast.ftbquests.block.FTBQuestsBlocks.LOOT_CRATE_STORAGE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:loot_crate_opener for public static net.minecraft.block.Block com.feed_the_beast.ftbquests.block.FTBQuestsBlocks.LOOT_CRATE_OPENER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:barrier for public static net.minecraft.block.Block com.feed_the_beast.ftbquests.block.FTBQuestsBlocks.BARRIER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:reward_collector for public static net.minecraft.block.Block com.feed_the_beast.ftbquests.block.FTBQuestsBlocks.REWARD_COLLECTOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:antiblock for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.antiblock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:auto_chisel for public static team.chisel.common.block.BlockAutoChisel team.chisel.common.init.ChiselBlocks.auto_chisel. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:basalt for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.basalt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:basalt1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.basalt1. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:basalt2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.basalt2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:block_charcoal2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.block_charcoal2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bloodmagic for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bloodmagic. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_spruce for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_spruce. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_birch for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_birch. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_jungle for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_jungle. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_acacia for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_acacia. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_darkoak for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_darkoak. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:brownstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.brownstone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:cloud for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.cloud. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_white for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_white. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_orange for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_orange. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_lightblue for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_lightblue. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_magenta for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_magenta. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_lime for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_lime. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_yellow for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_yellow. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_pink for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_pink. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_gray for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_gray. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_lightgray for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_lightgray. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_blue for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_blue. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_cyan for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_cyan. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_purple for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_purple. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_green for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_green. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_brown for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_brown. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_red for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_red. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_black for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_black. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:dirt for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.dirt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:factory for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.factory. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:futura for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.futura. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:glowstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.glowstone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:glowstone1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.glowstone1. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:glowstone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.glowstone2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:laboratory for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.laboratory. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:lavastone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.lavastone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:lavastone1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.lavastone1. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:lavastone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.lavastone2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:limestone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.limestone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:limestone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.limestone2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:marble for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.marble. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:marble2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.marble2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:netherrack for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.netherrack. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:paper for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.paper. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:temple for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.temple. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:tyrian for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.tyrian. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:valentines for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.valentines. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:voidstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.voidstone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstone1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstone1. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstone2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_log for public static net.minecraft.block.Block twilightforest.block.TFBlocks.twilight_log. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_leaves for public static net.minecraft.block.BlockLeaves twilightforest.block.TFBlocks.twilight_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:firefly for public static net.minecraft.block.Block twilightforest.block.TFBlocks.firefly. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_portal for public static twilightforest.block.BlockTFPortal twilightforest.block.TFBlocks.twilight_portal. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_stone for public static net.minecraft.block.Block twilightforest.block.TFBlocks.maze_stone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:hedge for public static net.minecraft.block.Block twilightforest.block.TFBlocks.hedge. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:boss_spawner for public static net.minecraft.block.Block twilightforest.block.TFBlocks.boss_spawner. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:firefly_jar for public static net.minecraft.block.Block twilightforest.block.TFBlocks.firefly_jar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_plant for public static net.minecraft.block.Block twilightforest.block.TFBlocks.twilight_plant. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cicada for public static net.minecraft.block.Block twilightforest.block.TFBlocks.cicada. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:root for public static net.minecraft.block.Block twilightforest.block.TFBlocks.root. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:uncrafting_table for public static net.minecraft.block.Block twilightforest.block.TFBlocks.uncrafting_table. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fire_jet for public static net.minecraft.block.Block twilightforest.block.TFBlocks.fire_jet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:naga_stone for public static net.minecraft.block.Block twilightforest.block.TFBlocks.naga_stone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_sapling for public static net.minecraft.block.BlockBush twilightforest.block.TFBlocks.twilight_sapling. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_log for public static net.minecraft.block.Block twilightforest.block.TFBlocks.magic_log. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_log_core for public static net.minecraft.block.Block twilightforest.block.TFBlocks.magic_log_core. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_leaves for public static net.minecraft.block.BlockLeaves twilightforest.block.TFBlocks.magic_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:moonworm for public static net.minecraft.block.Block twilightforest.block.TFBlocks.moonworm. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:tower_wood for public static net.minecraft.block.Block twilightforest.block.TFBlocks.tower_wood. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:tower_device for public static twilightforest.block.BlockTFTowerDevice twilightforest.block.TFBlocks.tower_device. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:tower_translucent for public static net.minecraft.block.Block twilightforest.block.TFBlocks.tower_translucent. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trophy for public static net.minecraft.block.Block twilightforest.block.TFBlocks.trophy. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:stronghold_shield for public static net.minecraft.block.Block twilightforest.block.TFBlocks.stronghold_shield. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trophy_pedestal for public static net.minecraft.block.Block twilightforest.block.TFBlocks.trophy_pedestal. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:aurora_block for public static net.minecraft.block.Block twilightforest.block.TFBlocks.aurora_block. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:underbrick for public static net.minecraft.block.Block twilightforest.block.TFBlocks.underbrick. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:thorns for public static net.minecraft.block.Block twilightforest.block.TFBlocks.thorns. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:burnt_thorns for public static net.minecraft.block.Block twilightforest.block.TFBlocks.burnt_thorns. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:thorn_rose for public static net.minecraft.block.Block twilightforest.block.TFBlocks.thorn_rose. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_leaves_3 for public static net.minecraft.block.BlockLeaves twilightforest.block.TFBlocks.twilight_leaves_3. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:deadrock for public static net.minecraft.block.Block twilightforest.block.TFBlocks.deadrock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_leaves for public static net.minecraft.block.Block twilightforest.block.TFBlocks.dark_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:aurora_pillar for public static net.minecraft.block.Block twilightforest.block.TFBlocks.aurora_pillar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:aurora_slab for public static net.minecraft.block.BlockSlab twilightforest.block.TFBlocks.aurora_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:double_aurora_slab for public static net.minecraft.block.BlockSlab twilightforest.block.TFBlocks.double_aurora_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trollsteinn for public static net.minecraft.block.Block twilightforest.block.TFBlocks.trollsteinn. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:wispy_cloud for public static net.minecraft.block.Block twilightforest.block.TFBlocks.wispy_cloud. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fluffy_cloud for public static net.minecraft.block.Block twilightforest.block.TFBlocks.fluffy_cloud. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_cobblestone for public static net.minecraft.block.Block twilightforest.block.TFBlocks.giant_cobblestone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_log for public static net.minecraft.block.Block twilightforest.block.TFBlocks.giant_log. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_leaves for public static net.minecraft.block.Block twilightforest.block.TFBlocks.giant_leaves. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_obsidian for public static net.minecraft.block.Block twilightforest.block.TFBlocks.giant_obsidian. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:uberous_soil for public static net.minecraft.block.Block twilightforest.block.TFBlocks.uberous_soil. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:huge_stalk for public static net.minecraft.block.Block twilightforest.block.TFBlocks.huge_stalk. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:huge_mushgloom for public static net.minecraft.block.Block twilightforest.block.TFBlocks.huge_mushgloom. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trollvidr for public static net.minecraft.block.Block twilightforest.block.TFBlocks.trollvidr. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:unripe_trollber for public static net.minecraft.block.Block twilightforest.block.TFBlocks.unripe_trollber. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trollber for public static net.minecraft.block.Block twilightforest.block.TFBlocks.trollber. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_block for public static net.minecraft.block.Block twilightforest.block.TFBlocks.knightmetal_block. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:huge_lilypad for public static net.minecraft.block.Block twilightforest.block.TFBlocks.huge_lilypad. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:huge_waterlily for public static net.minecraft.block.Block twilightforest.block.TFBlocks.huge_waterlily. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:slider for public static net.minecraft.block.Block twilightforest.block.TFBlocks.slider. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_brick for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_brick. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_stairs for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_pillar for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_pillar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_rune_brick for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_rune_brick. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:force_field for public static net.minecraft.block.Block twilightforest.block.TFBlocks.force_field. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cinder_furnace for public static net.minecraft.block.Block twilightforest.block.TFBlocks.cinder_furnace. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cinder_furnace_lit for public static net.minecraft.block.Block twilightforest.block.TFBlocks.cinder_furnace_lit. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cinder_log for public static net.minecraft.block.Block twilightforest.block.TFBlocks.cinder_log. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_door for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_door. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_door_vanished for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_door_vanished. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:experiment_115 for public static net.minecraft.block.Block twilightforest.block.TFBlocks.experiment_115. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:miniature_structure for public static net.minecraft.block.Block twilightforest.block.TFBlocks.miniature_structure. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:block_storage for public static net.minecraft.block.Block twilightforest.block.TFBlocks.block_storage. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:spiral_bricks for public static net.minecraft.block.Block twilightforest.block.TFBlocks.spiral_bricks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:etched_nagastone for public static net.minecraft.block.Block twilightforest.block.TFBlocks.etched_nagastone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:nagastone_pillar for public static net.minecraft.block.Block twilightforest.block.TFBlocks.nagastone_pillar. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:nagastone_stairs for public static net.minecraft.block.Block twilightforest.block.TFBlocks.nagastone_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:etched_nagastone_mossy for public static net.minecraft.block.Block twilightforest.block.TFBlocks.etched_nagastone_mossy. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:nagastone_pillar_mossy for public static net.minecraft.block.Block twilightforest.block.TFBlocks.nagastone_pillar_mossy. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:nagastone_stairs_mossy for public static net.minecraft.block.Block twilightforest.block.TFBlocks.nagastone_stairs_mossy. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:etched_nagastone_weathered for public static net.minecraft.block.Block twilightforest.block.TFBlocks.etched_nagastone_weathered. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:nagastone_pillar_weathered for public static net.minecraft.block.Block twilightforest.block.TFBlocks.nagastone_pillar_weathered. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:nagastone_stairs_weathered for public static net.minecraft.block.Block twilightforest.block.TFBlocks.nagastone_stairs_weathered. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:auroralized_glass for public static net.minecraft.block.Block twilightforest.block.TFBlocks.auroralized_glass. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_stairs_brick for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_stairs_brick. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_stairs_cracked for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_stairs_cracked. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_stairs_worn for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_stairs_worn. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_stairs_mossy for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_stairs_mossy. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:iron_ladder for public static twilightforest.block.BlockTFLadderBars twilightforest.block.TFBlocks.iron_ladder. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:terrorcotta_circle for public static net.minecraft.block.Block twilightforest.block.TFBlocks.terrorcotta_circle. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:terrorcotta_diagonal for public static net.minecraft.block.Block twilightforest.block.TFBlocks.terrorcotta_diagonal. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:stone_twist for public static net.minecraft.block.Block twilightforest.block.TFBlocks.stone_twist. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:stone_twist_thin for public static net.minecraft.block.Block twilightforest.block.TFBlocks.stone_twist_thin. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.twilight_oak_planks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.twilight_oak_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.twilight_oak_doubleslab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.twilight_oak_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.twilight_oak_button. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.twilight_oak_fence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.twilight_oak_gate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.twilight_oak_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.canopy_planks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.canopy_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.canopy_doubleslab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.canopy_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.canopy_button. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.canopy_fence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.canopy_gate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.canopy_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.mangrove_planks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.mangrove_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.mangrove_doubleslab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.mangrove_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.mangrove_button. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.mangrove_fence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.mangrove_gate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.mangrove_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.dark_planks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.dark_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.dark_doubleslab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.dark_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.dark_button. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.dark_fence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.dark_gate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.dark_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.time_planks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.time_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.time_doubleslab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.time_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.time_button. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.time_fence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.time_gate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.time_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.trans_planks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.trans_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.trans_doubleslab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.trans_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.trans_button. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.trans_fence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.trans_gate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.trans_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.mine_planks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.mine_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.mine_doubleslab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.mine_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.mine_button. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.mine_fence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.mine_gate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.mine_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.sort_planks. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.sort_stairs. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.sort_doubleslab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.sort_slab. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.sort_button. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.sort_fence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.sort_gate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.sort_plate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_warrior for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_WARRIOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_ingot for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_ingot. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_disenchanter for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_DISENCHANTER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_flute for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_FLUTE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:ancient_sawblade for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.ANCIENT_SAWBLADE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:piper_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PIPER_HAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_DIE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_tile for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_TILE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_ambient. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_poop for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_POOP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks for public static fossilsarcheology.server.block.FossilPlanksBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_leaves for public static fossilsarcheology.server.block.FossilLeavesBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_LEAVES. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:gem_of_ratlantis for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.GEM_OF_RATLANTIS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_keeping_2 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_keeping_2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_boots. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:kylix_vase for public static fossilsarcheology.server.block.KylixVaseBlock fossilsarcheology.server.block.FABlockRegistry.KYLIX_VASE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:potion_effect_begin for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.POTION_EFFECT_BEGIN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_tears for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_tears. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:token_fragment for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.TOKEN_FRAGMENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_combined_creative for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_COMBINED_CREATIVE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_flute for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_FLUTE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_plague for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_PLAGUE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup quark:color_slime for public static net.minecraft.block.Block slimeknights.tconstruct.plugin.quark.QuarkPlugin.colorSlime. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_cage for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RAT_CAGE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:licopodiophyta for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.LICOPODIOPHYTA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_stream for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.stream. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:frosted for public static net.minecraft.potion.Potion twilightforest.potions.TFPotions.frosty. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_magenta for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxMagentaItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_fisherman for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_FISHERMAN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ender_bow for public static net.minecraft.item.Item twilightforest.item.TFItems.ender_bow. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_map_focus for public static net.minecraft.item.Item twilightforest.item.TFItems.magic_map_focus. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_damage_protection for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_DAMAGE_PROTECTION. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:apprentice for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_APPRENTICE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volcanic_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.VOLCANIC_SINGLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_leggings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:auto_curdler for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.AUTO_CURDLER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_cage_breeding_lantern for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RAT_CAGE_BREEDING_LANTERN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:trillium for public static its_meow.betteranimalsplus.common.item.ItemBlockSimple its_meow.betteranimalsplus.init.ModItems.TRILLIUM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ice_bomb for public static net.minecraft.item.Item twilightforest.item.TFItems.ice_bomb. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_leggings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sarcophagus for public static fossilsarcheology.server.block.SarcophagusBlock fossilsarcheology.server.block.FABlockRegistry.SARCOPHAGUS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratglove_flower for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RATGLOVE_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:potato_pancake for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.POTATO_PANCAKE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_blood for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_blood. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:raw_meef for public static net.minecraft.item.Item twilightforest.item.TFItems.raw_meef. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_black for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlackItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:radius_stick for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RADIUS_STICK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_glacier for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.glacier. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:deep_mushroom_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.deepMushrooms. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_hurt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_life_1 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_life_1. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.light for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_light. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_voodoo for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_VOODOO. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_brick_slab_double for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_BRICK_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:dictyophyllum for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.DICTYOPHYLLUM_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:upgrade_combiner for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.UPGRADE_COMBINER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:transformation_powder for public static net.minecraft.item.Item twilightforest.item.TFItems.transformation_powder. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_ambient. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_pink for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPinkBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_fence for public static fossilsarcheology.server.block.FossilFenceBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_FENCE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup itemfilters:missing for public static net.minecraft.item.Item com.feed_the_beast.ftblib.lib.util.InvUtils.missingItem. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volcanic_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.VOLCANIC_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:permafrost for public static fossilsarcheology.server.block.PermafrostBlock fossilsarcheology.server.block.FABlockRegistry.PERMAFROST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.hum for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_hum. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:upgrade_separator for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.UPGRADE_SEPARATOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_sapling for public static fossilsarcheology.server.block.FossilSaplingBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_SAPLING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:feral_bagh_nakhs for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.FERAL_BAGH_NAKHS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_spirit_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_SPIRIT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volcanic_brick for public static fossilsarcheology.server.block.VolcanicAshBlock fossilsarcheology.server.block.FABlockRegistry.VOLCANIC_BRICK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_leech for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_LEECH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:home_portal for public static fossilsarcheology.server.block.HomePortalBlock fossilsarcheology.server.block.FABlockRegistry.HOME_PORTAL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.moa for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_moa. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:triple_bow for public static net.minecraft.item.Item twilightforest.item.TFItems.triple_bow. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_bricks for public static fossilsarcheology.server.block.AncientStonebrickBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_BRICK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_stew for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_STEW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_miner for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_MINER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_leggings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_blue for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlueBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_nonbeliever for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_NONBELIEVER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_hurt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:fish_barrel for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.FISH_BARREL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_extreme_energy for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_EXTREME_ENERGY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mazebreaker_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.mazebreaker_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:carminite for public static net.minecraft.item.Item twilightforest.item.TFItems.carminite. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:time_machine for public static fossilsarcheology.server.block.TimeMachineBlock fossilsarcheology.server.block.FABlockRegistry.TIME_MACHINE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trophy for public static net.minecraft.item.Item twilightforest.item.TFItems.trophy. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_hurt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_hurt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_white for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxWhiteItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:raw_plastic for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAW_PLASTIC. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_orange for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxOrangeItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_flame for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RATLANTEAN_FLAME. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_shears for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_SHEARS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_diamond for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_DIAMOND. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_capture_net for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_CAPTURE_NET. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_automaton_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_AUTOMATON_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:miniature_structure for public static net.minecraft.item.Item twilightforest.item.TFItems.miniature_structure. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:skull for public static fossilsarcheology.server.block.SkullBlock fossilsarcheology.server.block.FABlockRegistry.SKULL_BLOCK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratglove_petals for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RATGLOVE_PETALS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup natura:nether_green_large_glowshroom for private static net.minecraft.block.Block forestry.plugins.PluginNatura.greenLargeGlowshroomBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:crumble_horn for public static net.minecraft.item.Item twilightforest.item.TFItems.crumble_horn. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_silver for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxSilverBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_keeping_3 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_keeping_3. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:worktable_active for public static fossilsarcheology.server.block.WorktableBlock fossilsarcheology.server.block.FABlockRegistry.WORKTABLE_ACTIVE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_boots. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:jack_o_ratern for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.JACK_O_RATERN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:phantom_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.phantom_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_green for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGreenItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:tiny_coin for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.TINY_COIN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_summon for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_SUMMON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_placer for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_PLACER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_seed_bowl for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_SEED_BOWL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:dipteris for public static fossilsarcheology.server.block.TallFlowerBlock fossilsarcheology.server.block.FABlockRegistry.DIPTERIS_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.giant_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_wood_pillar for public static fossilsarcheology.server.block.AncientWoodPillarBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_WOOD_PILLAR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:tar for public static fossilsarcheology.server.block.TarBlock fossilsarcheology.server.block.FABlockRegistry.TAR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_armor for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ARMOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:feral_rat_claw for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.FERAL_RAT_CLAW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_door for public static fossilsarcheology.server.block.FossilDoorBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_DOOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:herb_bundle for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.HERB_BUNDLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:pirat_cutlass for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PIRAT_CUTLASS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_arctic_peaks for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.ARCTIC_PEAKS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_log for public static fossilsarcheology.server.block.FossilLogBlock fossilsarcheology.server.block.FABlockRegistry.PALM_LOG. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_ambient. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_ambient. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ependra for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.EPENDRA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_chest for public static fossilsarcheology.server.block.AncientChestBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_CHEST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_enchanter for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ENCHANTER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_chef for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_CHEF. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_door for public static fossilsarcheology.server.block.FossilDoorBlock fossilsarcheology.server.block.FABlockRegistry.PALM_DOOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_buccaneer for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BUCCANEER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.darkForest. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_ore_doubling for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ORE_DOUBLING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_log for public static fossilsarcheology.server.block.FossilLogBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_LOG. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:yeti_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.yeti_leggings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_tome for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_TOME. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.snow.wind for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_snow_wind. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_crafting_table for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RAT_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_death. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_trap for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RAT_TRAP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_magenta for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxMagentaBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_SINGLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_door for public static fossilsarcheology.server.block.FossilDoorBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_DOOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_lime for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLimeItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_automaton_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_AUTOMATON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_ingot for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_ingot. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_orange for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxOrangeBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_axe for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_axe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dungeon.container.smash for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.break_labyrinth_container. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_ambient. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_brown for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBrownItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:culture_vat_idle for public static fossilsarcheology.server.block.CultivateBlock fossilsarcheology.server.block.FABlockRegistry.CULTIVATE_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_shovel for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_shovel. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:naga_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.naga_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_god for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_GOD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ice_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.ice_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:block.aercloud.bounce for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aercloud_bounce. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_cage_decorated for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RAT_CAGE_DECORATED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:little_black_squash_balls for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.LITTLE_BLACK_SQUASH_BALLS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_boots. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:creative_cheese for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CREATIVE_CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:armor_shard for public static net.minecraft.item.Item twilightforest.item.TFItems.armor_shard. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:bennettitales_large for public static fossilsarcheology.server.block.TallFlowerBlock fossilsarcheology.server.block.FABlockRegistry.BENNETTITALES_LARGE_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_door for public static net.minecraft.item.Item twilightforest.item.TFItems.castle_door. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.lift for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_lift. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_death. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:brain_block for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.BRAIN_BLOCK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:hydra_chop for public static net.minecraft.item.Item twilightforest.item.TFItems.hydra_chop. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_light_blue for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLightBlueItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:mice_on_venus for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.MICE_ON_VENUS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_lime for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLimeBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_fence_gate for public static fossilsarcheology.server.block.FossilFenceGateBlock fossilsarcheology.server.block.FABlockRegistry.PALM_FENCE_GATE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:black_death_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.BLACK_DEATH_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ore_map_empty for public static net.minecraft.item.Item twilightforest.item.TFItems.ore_map_empty. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:shield_scepter for public static net.minecraft.item.Item twilightforest.item.TFItems.shield_scepter. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:vial_of_sentience for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.VIAL_OF_SENTIENCE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_advanced_energy for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ADVANCED_ENERGY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:token_piece for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.TOKEN_PIECE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_wood_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_WOOD_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:custom_icon for public static net.minecraft.item.Item com.feed_the_beast.ftblib.FTBLib.CUSTOM_ICON_ITEM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_archeologist for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ARCHEOLOGIST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_blacklist for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BLACKLIST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:experiment_115 for public static net.minecraft.item.Item twilightforest.item.TFItems.experiment_115. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:zombie_scepter for public static net.minecraft.item.Item twilightforest.item.TFItems.zombie_scepter. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks for public static fossilsarcheology.server.block.FossilPlanksBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_chiseled for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_CHISELED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_death. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.angry for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_angry. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sagenopteris for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.SAGENOPTERIS_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_brick for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_BRICK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_fence for public static fossilsarcheology.server.block.FossilFenceBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_FENCE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_SINGLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:anubite_statue for public static fossilsarcheology.server.block.AnubiteStatueBlock fossilsarcheology.server.block.FABlockRegistry.ANUBITE_STATUE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_gemcutter for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_GEMCUTTER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volcanic_rock for public static fossilsarcheology.server.block.VolcanicAshBlock fossilsarcheology.server.block.FABlockRegistry.VOLCANIC_ROCK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_hurt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ferns for public static fossilsarcheology.server.block.FernsBlock fossilsarcheology.server.block.FABlockRegistry.FERNS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_tnt for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_TNT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:transcendent for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_TRANSCENDENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_blue for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlueItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:minotaur_axe for public static net.minecraft.item.Item twilightforest.item.TFItems.minotaur_axe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:liveroot for public static net.minecraft.item.Item twilightforest.item.TFItems.liveroot. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_death. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_sapling for public static fossilsarcheology.server.block.FossilSaplingBlock fossilsarcheology.server.block.FABlockRegistry.PALM_SAPLING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:culture_vat_active for public static fossilsarcheology.server.block.CultivateBlock fossilsarcheology.server.block.FABlockRegistry.CULTIVATE_ACTIVEE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:block_storage for public static net.minecraft.item.Item twilightforest.item.TFItems.block_storage. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.electric_shock for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_electric_shock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_brick_cracked for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_BRICK_CRACKED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_trapdoor for public static fossilsarcheology.server.block.FossilTrapdoorBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_TRAPDOOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_trapdoor for public static fossilsarcheology.server.block.FossilTrapdoorBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_TRAPDOOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_flute_no_funny for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_FLUTE_NO_FUNNY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:block_and_chain for public static net.minecraft.item.Item twilightforest.item.TFItems.block_and_chain. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_doctor_mask for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_DOCTOR_MASK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:little_black_worm for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.LITTLE_BLACK_WORM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sifter_active for public static fossilsarcheology.server.block.SifterBlock fossilsarcheology.server.block.FABlockRegistry.SIFTER_ACTIVE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:black_death_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.BLACK_DEATH_DIE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_purple for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPurpleBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_water_bottle for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_WATER_BOTTLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_sapling for public static fossilsarcheology.server.block.FossilSaplingBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_SAPLING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_fence_gate for public static fossilsarcheology.server.block.FossilFenceGateBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_FENCE_GATE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:compressed_rat for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.COMPRESSED_RAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup natura:nether_purple_large_glowshroom for private static net.minecraft.block.Block forestry.plugins.PluginNatura.purpleLargeGlowshroomBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_trapdoor for public static fossilsarcheology.server.block.FossilTrapdoorBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_TRAPDOOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_map for public static net.minecraft.item.Item twilightforest.item.TFItems.maze_map. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:dillhoffia for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.DILLHOFFIA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:osmunda for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.OSMUNDA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_scythe for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_SCYTHE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_dragon for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_DRAGON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:peacock_fan for public static net.minecraft.item.Item twilightforest.item.TFItems.peacock_fan. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_yellow for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxYellowItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:skull_lantern for public static fossilsarcheology.server.block.SkullBlock fossilsarcheology.server.block.FABlockRegistry.SKULL_LANTERN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:anu_portal for public static fossilsarcheology.server.block.AnuPortalBlock fossilsarcheology.server.block.FABlockRegistry.ANU_PORTAL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_basic for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BASIC. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_map_empty for public static net.minecraft.item.Item twilightforest.item.TFItems.magic_map_empty. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:tempskya for public static fossilsarcheology.server.block.FourTallFlowerBlock fossilsarcheology.server.block.FABlockRegistry.TEMPSKYA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_gray for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGrayBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_aquatic for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_AQUATIC. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:seeker_bow for public static net.minecraft.item.Item twilightforest.item.TFItems.seeker_bow. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:cheese_stick for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CHEESE_STICK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:yeti_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.yeti_boots. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:centipede for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CENTIPEDE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:plastic_waste for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLASTIC_WASTE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_chest for public static net.minecraft.item.Item cpw.mods.ironchest.common.core.IronChestBlocks.ironChestItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_whitelist for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_WHITELIST. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_forest_center for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.darkForestCenter. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:iced_stone for public static fossilsarcheology.server.block.IcedStoneBlock fossilsarcheology.server.block.FABlockRegistry.ICED_STONE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_DIE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:minotaur_axe_gold for public static net.minecraft.item.Item twilightforest.item.TFItems.minotaur_axe_gold. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cyathea for public static fossilsarcheology.server.block.FourTallFlowerBlock fossilsarcheology.server.block.FABlockRegistry.CYATHEA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_map for public static net.minecraft.item.Item twilightforest.item.TFItems.magic_map. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_wood_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_WOOD_SINGLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:handoffate for public static its_meow.betteranimalsplus.common.item.ItemBlockSimple its_meow.betteranimalsplus.init.ModItems.HAND_OF_FATE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:bennettitales_small for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.BENNETTITALES_SMALL_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_ender for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ENDER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_asbestos for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ASBESTOS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_fur for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_fur. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:chef_toque for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CHEF_TOQUE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:dragon_wing for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.DRAGON_WING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_brown for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBrownBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:oak_savannah for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.oakSavanna. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:horsetail_large for public static fossilsarcheology.server.block.TallFlowerBlock fossilsarcheology.server.block.FABlockRegistry.HORSETAIL_LARGE_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.twilightForest. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:raw_rat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAW_RAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:master for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_MASTER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_keeping_1 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_keeping_1. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:archmage for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_ARCHMAGE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_axe for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_axe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ore_map for public static net.minecraft.item.Item twilightforest.item.TFItems.ore_map. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_brick_stairs for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_BRICK_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cephalotaxus for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.CEPHALOTAXUS_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_burger for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_BURGER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_helmet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_loop for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_LOOP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_ambient. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:crataegus for public static fossilsarcheology.server.block.TallFlowerBlock fossilsarcheology.server.block.FABlockRegistry.CRATAEGUS_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_arrow for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_ARROW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_irradiated_forests for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.IRRADIATED_FORESTS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:duisbergia for public static fossilsarcheology.server.block.TallFlowerBlock fossilsarcheology.server.block.FABlockRegistry.DUISBERGIA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_santa for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_SANTA. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cube_of_annihilation for public static net.minecraft.item.Item twilightforest.item.TFItems.cube_of_annihilation. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_ambient. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_sack for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_SACK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_leggings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_spirit_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_SPIRIT_DIE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_map_empty for public static net.minecraft.item.Item twilightforest.item.TFItems.maze_map_empty. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_slab_double for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.trigger for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_trigger. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:psionic_rat_brain for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PSIONIC_RAT_BRAIN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:vaccinium for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.VACCINIUM_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_SINGLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:top_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.TOP_HAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_nugget for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_NUGGET. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:charged_creeper_chunk for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CHARGED_CREEPER_CHUNK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_breeder for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BREEDER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_helmet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_swamp for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.tfSwamp. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.labyrinth_totem.drone for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.labyrinth_totem_drone. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_magnetic_hills for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.MAGNETIC_HILLS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_hurt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_strength for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_STRENGTH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_hurt. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:cheese_cauldron for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.CHEESE_CAULDRON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_fragment for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_FRAGMENT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:alpha_fur for public static net.minecraft.item.Item twilightforest.item.TFItems.alpha_fur. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_pink for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPinkItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_combined for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_COMBINED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:black_death_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.BLACK_DEATH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup lootbagmod:lootbag for public static com.github.trhod177.lootbagmod.ItemBasicRewardBag com.github.trhod177.lootbagmod.ItemInit.lootbag. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_slab for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_SLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_shield for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_shield. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_green for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGreenBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_platter for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_PLATTER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cooked_meef for public static net.minecraft.item.Item twilightforest.item.TFItems.cooked_meef. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cooked_venison for public static net.minecraft.item.Item twilightforest.item.TFItems.cooked_venison. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup baubles:ring for public static net.minecraft.item.Item baubles.common.items.ItemRing.RING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:borer_essence for public static net.minecraft.item.Item twilightforest.item.TFItems.borer_essence. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_door for public static fossilsarcheology.server.block.FossilDoorBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_DOOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:snowy_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.snowy_forest. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_attack. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_wafer for public static net.minecraft.item.Item twilightforest.item.TFItems.maze_wafer. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.travel for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_travel. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:archeologist_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.ARCHEOLOGIST_HAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:feeder for public static fossilsarcheology.server.block.FeederBlock fossilsarcheology.server.block.FABlockRegistry.FEEDER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_helmet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:weak for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_WEAK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_chest for public static cpw.mods.ironchest.common.blocks.chest.BlockIronChest cpw.mods.ironchest.common.core.IronChestBlocks.ironChestBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_cyan for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxCyanItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_underwater for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_UNDERWATER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:pirat_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PIRAT_HAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:fossil for public static fossilsarcheology.server.block.FossilBlock fossilsarcheology.server.block.FABlockRegistry.FOSSIL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_dig for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_DIG. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_poison for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_POISON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:magician for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_MAGICIAN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_dirt for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_DIRT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_automaton_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_AUTOMATON_DIE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:analyzer_idle for public static fossilsarcheology.server.block.AnalyzerBlock fossilsarcheology.server.block.FABlockRegistry.ANALYZER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.puff for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_puff. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fire_swamp for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.fireSwamp. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_ring for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_ring. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_life_2 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_life_2. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_light_blue for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLightBlueBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup natura:nether_blue_large_glowshroom for private static net.minecraft.block.Block forestry.plugins.PluginNatura.blueLargeGlowshroomBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_basic_energy for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BASIC_ENERGY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:arcane_technology for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.ARCANE_TECHNOLOGY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_christmas for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_CHRISTMAS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:torchberries for public static net.minecraft.item.Item twilightforest.item.TFItems.torchberries. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_brick_slab for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_BRICK_SLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_trapdoor for public static fossilsarcheology.server.block.FossilTrapdoorBlock fossilsarcheology.server.block.FABlockRegistry.PALM_TRAPDOOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:farmer_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.FARMER_HAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:zamites for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.ZAMITES_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_red for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxRedItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_basic_ratlantean for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BASIC_RATLANTEAN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:cooked_rat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.COOKED_RAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_stairs for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_aristocrat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ARISTOCRAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_fence_gate for public static fossilsarcheology.server.block.FossilFenceGateBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_FENCE_GATE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:spooky_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.spookyForest. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup thaumcraft:goggles for private static net.minecraft.item.Item vazkii.botania.common.crafting.recipe.HelmRevealingRecipe.goggles. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.generic.wings.flap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.generic_wing_flap. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_sapling for public static fossilsarcheology.server.block.FossilSaplingBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_SAPLING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:music_disc_living_mice for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.MUSIC_DISC_LIVING_MICE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_highlands for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.highlands. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_grass for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_GRASS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:moonworm_queen for public static net.minecraft.item.Item twilightforest.item.TFItems.moonworm_queen. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_lake for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.tfLake. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:assorted_vegetables for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.ASSORTED_VEGETABLES. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_pelt for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_PELT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_clearing for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.clearing. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_void for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.VOID. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_forgotten_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.FORGOTTEN_HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:treacle for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.TREACLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_boots. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.aerwhale for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_aerwhale. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:fisherman_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.FISHERMAN_HAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantis_portal for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RATLANTIS_PORTAL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_SINGLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:yeti_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.yeti_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dart_shooter.fire for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.dart_shooter_fire. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:idol_of_ratlantis for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.IDOL_OF_RATLANTIS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_toga for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_TOGA. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:firefly_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.fireflyForest. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:amber_ore for public static fossilsarcheology.server.block.AmberOreBlock fossilsarcheology.server.block.FABlockRegistry.AMBER_ORE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_creative for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_CREATIVE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:piper_loop for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.PIPER_LOOP. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_rat_head for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_RAT_HEAD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volcanic_ash for public static fossilsarcheology.server.block.VolcanicAshBlock fossilsarcheology.server.block.FABlockRegistry.VOLCANIC_ASH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_nugget_ore for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_NUGGET_ORE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:armor_shard_cluster for public static net.minecraft.item.Item twilightforest.item.TFItems.armor_shard_cluster. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_psychic for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_PSYCHIC. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_ambient. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volcanic_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.VOLCANIC_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:lamp_of_cinders for public static net.minecraft.item.Item twilightforest.item.TFItems.lamp_of_cinders. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:fake_obsidian for public static fossilsarcheology.server.block.FakeObsidianBlock fossilsarcheology.server.block.FABlockRegistry.FAKE_OBSIDIAN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_scepter for public static net.minecraft.item.Item twilightforest.item.TFItems.twilight_scepter. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.labyrinth for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_labyrinth. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:block_of_cheese for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.BLOCK_OF_CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_leaves for public static fossilsarcheology.server.block.FossilLeavesBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_LEAVES. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_log for public static fossilsarcheology.server.block.FossilLogBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_LOG. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:analyzer_active for public static fossilsarcheology.server.block.AnalyzerBlock fossilsarcheology.server.block.FABlockRegistry.ANALYZER_ACTIVE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_leaves for public static fossilsarcheology.server.block.FossilLeavesBlock fossilsarcheology.server.block.FABlockRegistry.PALM_LEAVES. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_breeding_lantern for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_BREEDING_LANTERN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:welwitschia for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.WELWITSCHIA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:cheese_cannonball for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CHEESE_CANNONBALL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_SINGLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:amphora_vase for public static fossilsarcheology.server.block.AmphoraVaseBlock fossilsarcheology.server.block.FABlockRegistry.AMPHORA_VASE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_axe for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_axe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks for public static fossilsarcheology.server.block.FossilPlanksBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:milk_cauldron for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MILK_CAULDRON. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:slime_trail for public static fossilsarcheology.server.block.SlimeTrailBlock fossilsarcheology.server.block.FABlockRegistry.SLIME_TRAIL. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:living_mice for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.LIVING_MICE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:music_disc_mice_on_venus for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.MUSIC_DISC_MICE_ON_VENUS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_pillar for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_PILLAR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_lumberjack for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_LUMBERJACK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_fence for public static fossilsarcheology.server.block.FossilFenceBlock fossilsarcheology.server.block.FABlockRegistry.PALM_FENCE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mushroom_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.mushrooms. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_milker for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_MILKER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:turkey_cooked for public static its_meow.betteranimalsplus.common.item.ItemBlockSimple its_meow.betteranimalsplus.init.ModItems.TURKEY_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:worktable_idle for public static fossilsarcheology.server.block.WorktableBlock fossilsarcheology.server.block.FABlockRegistry.WORKTABLE_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_essence for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_ESSENCE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_ratinator for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_RATINATOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_no_flute for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_NO_FLUTE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sifter_idle for public static fossilsarcheology.server.block.SifterBlock fossilsarcheology.server.block.FABlockRegistry.SIFTER_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_gray for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGrayItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_ingot for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_ingot. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_leaves for public static fossilsarcheology.server.block.FossilLeavesBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_LEAVES. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_shovel for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_shovel. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_white for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxWhiteBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.heavy for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_heavy. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:garbage_pile for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.GARBAGE_PILE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_farmer for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_FARMER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ore_meter for public static net.minecraft.item.Item twilightforest.item.TFItems.ore_meter. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_hole for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RAT_HOLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:anu_statue for public static fossilsarcheology.server.block.AnuStatueBlock fossilsarcheology.server.block.FABlockRegistry.ANU_STATUE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_wood for public static fossilsarcheology.server.block.AncientWoodBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_WOOD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_brick_chiseled for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_BRICK_CHISELED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_glass for public static fossilsarcheology.server.block.AncientGlassBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_GLASS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:meef_stroganoff for public static net.minecraft.item.Item twilightforest.item.TFItems.meef_stroganoff. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_yellow for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxYellowBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:mutant_plant for public static fossilsarcheology.server.block.TallFlowerBlock fossilsarcheology.server.block.FABlockRegistry.MUTANT_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:figurine for public static fossilsarcheology.server.block.FigurineBlock fossilsarcheology.server.block.FABlockRegistry.FIGURINE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_bucket for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BUCKET. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:tower_key for public static net.minecraft.item.Item twilightforest.item.TFItems.tower_key. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_brick_mossy for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_BRICK_MOSSY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_silver for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxSilverItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:potato_kinishes for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.POTATO_KNISHES. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_purple for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPurpleItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_cyan for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxCyanBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_replanter for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_REPLANTER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_raw for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_RAW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:raven_feather for public static net.minecraft.item.Item twilightforest.item.TFItems.raven_feather. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:drum for public static fossilsarcheology.server.block.DrumBlock fossilsarcheology.server.block.FABlockRegistry.DRUM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:naga_scale for public static net.minecraft.item.Item twilightforest.item.TFItems.naga_scale. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_doctorate for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_DOCTORATE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_crafting for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_CRAFTING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volute_vase for public static fossilsarcheology.server.block.VoluteVaseBlock fossilsarcheology.server.block.FABlockRegistry.VOLUTE_VASE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_attack. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_tnt_survivor for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_TNT_SURVIVOR. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_fez for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_FEZ. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.recording_892 for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_recording_892. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:highlands_center for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.highlandsCenter. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:instanced_zone for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.INSTANCED_ZONE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_black for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlackBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.valkyrie for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_valkyrie. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.giant_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:potion_effect_end for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.POTION_EFFECT_END. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sarracenia for public static fossilsarcheology.server.block.TallFlowerBlock fossilsarcheology.server.block.FABlockRegistry.SARRACENIA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_death. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:contaminated_food for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CONTAMINATED_FOOD. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dense_twilight_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.denseTwilightForest. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:enchanted_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.enchantedForest. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_health for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_HEALTH. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:thornlands for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.thornlands. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_fence for public static fossilsarcheology.server.block.FossilFenceBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_FENCE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_beans for public static net.minecraft.item.Item twilightforest.item.TFItems.magic_beans. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:turkey_raw for public static its_meow.betteranimalsplus.common.item.ItemBlockSimple its_meow.betteranimalsplus.init.ModItems.TURKEY_RAW. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_laser for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.LASER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:lifedrain_scepter for public static net.minecraft.item.Item twilightforest.item.TFItems.lifedrain_scepter. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cube_talisman for public static net.minecraft.item.Item twilightforest.item.TFItems.cube_talisman. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_helmet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:purifying_liquid for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PURIFYING_LIQUID. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_wood_plate for public static fossilsarcheology.server.block.AncientWoodPlateBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_WOOD_PLATE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_fence_gate for public static fossilsarcheology.server.block.FossilFenceGateBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_FENCE_GATE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:naga_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.naga_leggings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:dense_sand for public static fossilsarcheology.server.block.DenseSandBlock fossilsarcheology.server.block.FABlockRegistry.DENSE_SAND. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:glass_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.glass_sword. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:bubble_machine for public static fossilsarcheology.server.block.BubbleBlowerBlock fossilsarcheology.server.block.FABlockRegistry.BUBBLE_MACHINE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_speed for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_SPEED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:confit_byaldi for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CONFIT_BYALDI. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_flight for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_FLIGHT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.present_unwrap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.present_unwrap. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:chunky_cheese_token for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CHUNKY_CHEESE_TOKEN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:obsidian_spikes for public static fossilsarcheology.server.block.ObsidianSpikesBlock fossilsarcheology.server.block.FABlockRegistry.OBSIDIAN_SPIKES. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:blood_orb for private static net.minecraft.item.Item WayofTime.bloodmagic.core.registry.OrbRegistry.ORB_ITEM. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:raw_venison for public static net.minecraft.item.Item twilightforest.item.TFItems.raw_venison. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_spirit_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_SPIRIT_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_elite_energy for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ELITE_ENERGY. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks for public static fossilsarcheology.server.block.FossilPlanksBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:feathery_wing for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.FEATHERY_WING. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:black_death_mask for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.BLACK_DEATH_MASK. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_hoe for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_hoe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_leggings. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:strong_glass for public static fossilsarcheology.server.block.StrongGlassBlock fossilsarcheology.server.block.FABlockRegistry.STRONG_GLASS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_lantern for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RAT_LANTERN. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:yeti_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.yeti_helmet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_hoe for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_hoe. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:foozia for public static fossilsarcheology.server.block.TallFlowerBlock fossilsarcheology.server.block.FABlockRegistry.FOOZIA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_log for public static fossilsarcheology.server.block.FossilLogBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_LOG. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_ambient. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone for public static fossilsarcheology.server.block.AncientStoneBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:cheese for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_map_focus for public static net.minecraft.item.Item twilightforest.item.TFItems.maze_map_focus. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_death. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_boots. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:marbled_cheese_golem_core for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MARBLED_CHEESE_GOLEM_CORE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_jury_rigged for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_JURY_RIGGED. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_raw for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_raw. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:phantom_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.phantom_helmet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_death. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:florissantia for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.FLORISSANTIA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_wood_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_WOOD_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_feral_bite for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_FERAL_BITE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ice_bow for public static net.minecraft.item.Item twilightforest.item.TFItems.ice_bow. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:santa_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.SANTA_HAT. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:string_cheese for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.STRING_CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup fossil:horsetail_small for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.HORSETAIL_SMALL_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_big_bucket for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BIG_BUCKET. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_red for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxRedBlock. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_helmet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ore_magnet for public static net.minecraft.item.Item twilightforest.item.TFItems.ore_magnet. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_ingot for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_ingot. This means the object wasn't registered. It's likely just mod options.
[23:29:55] [Server thread/INFO] [FML]: Holder lookups applied
[23:29:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod chisel
[23:29:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Chisel took 0.084s
[23:29:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod cofhcore
[23:29:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod cofhcore
[23:29:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - CoFH Core took 0.198s
[23:29:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod cofhworld
[23:29:55] [Server thread/INFO] [CoFH World]: Registering default Feature Templates...
[23:29:55] [Server thread/INFO] [CoFH World]: Registering default World Generators...
[23:29:55] [Server thread/INFO] [CoFH World]: Verifying or creating base world generation directory...
[23:29:55] [Server thread/INFO] [CoFH World]: Complete.
[23:29:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod cofhworld
[23:29:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - CoFH World took 0.101s
[23:29:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod craftstudioapi
[23:29:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod craftstudioapi
[23:29:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - CraftStudio API took 0.007s
[23:29:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod customspawner
[23:29:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod customspawner
[23:29:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - DrZhark's CustomSpawner took 0.129s
[23:29:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod props
[23:29:55] [Server thread/TRACE] [FML]: Automatically registered mod props entity FakeChairEntity as props:chair
[23:29:55] [Server thread/INFO] [com.mia.craftstudio.CSPack]: Original locale was en, switching to Locale.US
[23:29:55] [Server thread/INFO] [com.mia.craftstudio.CSPack]: Locale is now en_US
[23:29:55] [Server thread/INFO] [com.mia.craftstudio.CSPack]: Locale was restored to en
[23:29:58] [Server thread/DEBUG] [FML]: Bar Finished: Loading models took 2.628s
[23:29:58] [Server thread/DEBUG] [FML]: Bar Finished: Loading models took 2.629s
[23:30:11] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod props
[23:30:11] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Decocraft took 15.567s
[23:30:11] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mocreatures
[23:30:11] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mocreatures
[23:30:11] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - DrZhark's Mo'Creatures Mod took 0.047s
[23:30:11] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mantle
[23:30:11] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mantle
[23:30:11] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Mantle took 0.000s
[23:30:11] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod twilightforest
[23:30:12] [Server thread/DEBUG] [twilightforest]: There are 21 entries in TFFeature enum. Maximum structure size is 4
[23:30:12] [Server thread/INFO] [twilightforest]: Loaded compatibility for mod Baubles.
[23:30:12] [Server thread/INFO] [twilightforest]: Loaded compatibility for mod Chisel.
[23:30:12] [Server thread/INFO] [twilightforest]: Loaded compatibility for mod Forestry.
[23:30:12] [Server thread/INFO] [twilightforest]: Skipped compatibility for mod Immersive Engineering.
[23:30:12] [Server thread/INFO] [twilightforest]: Skipped compatibility for mod Just Enough Items.
[23:30:12] [Server thread/INFO] [twilightforest]: Loaded compatibility for mod Tinkers' Construct.
[23:30:12] [Server thread/INFO] [twilightforest]: Loaded compatibility for mod Thaumcraft.
[23:30:12] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod twilightforest
[23:30:12] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - The Twilight Forest took 0.743s
[23:30:12] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod tconstruct
[23:30:12] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod tconstruct
[23:30:12] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Tinkers' Construct took 0.062s
[23:30:12] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod extrautils2
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: Network Handler Static Init
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: Register Packet
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketAngelRingNotifier with discriminator: 0
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketBiomeChange with discriminator: 1
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketBlueArrow with discriminator: 2
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketCrashLog with discriminator: 3
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketEditScreen with discriminator: 4
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketEntityChunkData with discriminator: 5
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketEntityIsEvil with discriminator: 6
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketFlightData with discriminator: 7
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketGUIData with discriminator: 8
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketGUIInput with discriminator: 9
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketLawSwordNotifier with discriminator: 10
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketOpenGui with discriminator: 11
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketParticleGeneric with discriminator: 12
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketParticleSplineCurve with discriminator: 13
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketParticleSplosion with discriminator: 14
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketPing with discriminator: 15
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketPong with discriminator: 16
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketPower with discriminator: 17
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketPowerInfo with discriminator: 18
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketProxyFlow with discriminator: 19
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketSendLeftClick with discriminator: 20
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketSetGhost with discriminator: 21
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketUseItemAlt with discriminator: 22
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class SpecialChat with discriminator: 23
[23:30:12] [Server thread/DEBUG] [extrautils2]: Registering Packet class TimeHandlerPacket with discriminator: 24
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: CreatePacketHandler Server
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: Network Init
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: Start {CLIENT=[id: 0xembedded, L:embedded - R:embedded], SERVER=[id: 0xembedded, L:embedded - R:embedded]}
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: Start Side: CLIENT
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: Start Channel Handler: (CLIENT)(0) fml:outbound - net.minecraftforge.fml.common.network.FMLOutboundHandler@ec9071a
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: Start Channel Handler: (CLIENT)(1) PacketCodec#0 - com.rwtema.extrautils2.network.PacketCodec@767c9ab3
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: Start Channel Handler: (CLIENT)(2) PacketHandler#0 - com.rwtema.extrautils2.network.PacketHandler@3aabbd74
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: Start Side: SERVER
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: Start Channel Handler: (SERVER)(0) fml:outbound - net.minecraftforge.fml.common.network.FMLOutboundHandler@6477fd11
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: Start Channel Handler: (SERVER)(1) PacketCodec#0 - com.rwtema.extrautils2.network.PacketCodec@767c9ab3
[23:30:12] [Server thread/DEBUG] [extrautils2]: OTL: Start Channel Handler: (SERVER)(2) PacketHandler#0 - com.rwtema.extrautils2.network.PacketHandler@3aabbd74
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:furnace from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:crusher from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:enchanter from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_survival from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_culinary from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_lava from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_redstone from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_ender from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_potion from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_pink from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_overclock from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_tnt from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_netherstar from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_dragonsbreath from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_ice from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_death from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_enchant from FMLMod:extrautils2{1.0}
[23:30:15] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_slime from FMLMod:extrautils2{1.0}
[23:30:16] [Server thread/TRACE] [FML]: Automatically registered mod extrautils2 entity boomerang as extrautils2:boomerang
[23:30:16] [Server thread/TRACE] [FML]: Automatically registered mod extrautils2 entity chunkdata as extrautils2:chunkdata
[23:30:16] [Server thread/DEBUG] [extrautils2]: OTL: Key Alt Register
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `xutesrtile`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [tconstruct-API]: Itemstack 1xitem.null@17 cannot represent material xu_evil_metal since it is not associated with the material!
[23:30:16] [Server thread/WARN] [tconstruct-API]: Itemstack 1xitem.null@12 cannot represent material xu_enchanted_metal since it is not associated with the material!
[23:30:16] [Server thread/WARN] [tconstruct-API]: Itemstack 1xitem.null@11 cannot represent material xu_demonic_metal since it is not associated with the material!
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilesoundmuffler`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tiletrashcan`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tiletrashcanfluids`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tiletrashcanenergy`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilepassivegenerator`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilepowerhandcrank`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilesupermobspawner`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilepoweroverload`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileresonator`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilespotlight`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilescreen`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tiletransferholder`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileplayerchest`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilechunkloader`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileindexer`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilecrafter`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilescanner`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilemine`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileuse`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tank16`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tank256`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tank4096`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tank65536`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tankinf`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilemachineprovider`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilemachinereceiver`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileteleporter`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilepowertransmitter`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilepowerbattery`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilequarryproxy`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilequarry`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilelargishchest`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileminchest`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilerainbowgenerator`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilecreativechest`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilecreativeenergy`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilecreativeharvest`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileterraformer`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileterraformerclimograph`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tiletrashchest`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileanalogcrafter`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileinteractionproxy`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:16] [Server thread/DEBUG] [extrautils2]: Registering XUShapelessRecipe to RecipeSorter
[23:30:16] [Server thread/DEBUG] [extrautils2]: Registering XUShapedRecipe to RecipeSorter
[23:30:16] [Server thread/DEBUG] [extrautils2]: Registering UnstableIngotRecipe to RecipeSorter
[23:30:16] [Server thread/DEBUG] [extrautils2]: Registering EnchantRecipe to RecipeSorter
[23:30:16] [Server thread/DEBUG] [extrautils2]: Registering UpgradeRecipe to RecipeSorter
[23:30:16] [Server thread/DEBUG] [extrautils2]: Registering XUShapelessRecipeClearNBT to RecipeSorter
[23:30:16] [Server thread/DEBUG] [extrautils2]: Registering AnvilRecipe to RecipeSorter
[23:30:17] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod extrautils2
[23:30:17] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Extra Utilities 2 took 4.813s
[23:30:17] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod natura
[23:30:17] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod natura
[23:30:17] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Natura took 0.004s
[23:30:17] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod forestry
[23:30:18] [Server thread/INFO] [forestry]: Module AgriCraft Module failed to load: AgriCraft not found
[23:30:18] [Server thread/DEBUG] [forestry]: Could not find core module for the module container: forestry_compat
[23:30:18] [Server thread/INFO] [forestry]: Module EnderIO Module failed to load: EnderIO not found
[23:30:18] [Server thread/INFO] [forestry]: Module IndustrialCraft2 Module failed to load: IndustrialCraft2 not found
[23:30:18] [Server thread/INFO] [forestry]: Module BuildCraft 6 Fuels Module failed to load: Compatible BuildCraftAPI|fuels version not found
[23:30:18] [Server thread/INFO] [forestry]: Module Better With Mods Module failed to load: Better With Mods not found
[23:30:18] [Server thread/INFO] [forestry]: Module TechReborn Module failed to load: TechReborn not found
[23:30:18] [Server thread/INFO] [forestry]: Module ImmersiveEngineering Module failed to load: ImmersiveEngineering not found
[23:30:18] [Server thread/INFO] [forestry]: Module BuildCraft 6 Transport Module failed to load: buildcrafttransport not found
[23:30:18] [Server thread/INFO] [forestry]: Module BuildCraft 6 Recipes Module failed to load: Compatible BuildCraftAPI|recipes version not found
[23:30:18] [Server thread/INFO] [forestry]: Module Mystical Agriculture Module failed to load: Mystical Agriculture not found
[23:30:18] [Server thread/INFO] [forestry]: Module Actually Additions Module failed to load: Actually Additions not found
[23:30:18] [Server thread/INFO] [forestry]: Module BuildCraft 6 Statements Module failed to load: Compatible BuildCraftAPI|statements version not found
[23:30:18] [Server thread/INFO] [forestry]: Module rustic Module failed to load: Rustic not found
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Core Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Core Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Climatology Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Climatology Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Backpack Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Backpack Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Apiculture Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Apiculture Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Database Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Database Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Energy Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Energy Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Greenhouse Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Greenhouse Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Farming Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Farming Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Crate Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Crate Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Cultivation Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Cultivation Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Worktable Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Worktable Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Book Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Book Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Fluids Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Fluids Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Food Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Food Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Factory Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Factory Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Charcoal Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Charcoal Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Sorting Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Sorting Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Arboriculture Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Arboriculture Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Lepidopterology Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Lepidopterology Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Mail Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Mail Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Natura Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Natura Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Roots Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Roots Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: Extra Utilities Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: Extra Utilities Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: BiomesOPlenty Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: BiomesOPlenty Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Start: HarvestCraft Module
[23:30:18] [Server thread/DEBUG] [forestry]: Setup API Complete: HarvestCraft Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: AgriCraft Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: AgriCraft Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: EnderIO Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: EnderIO Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: IndustrialCraft2 Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: IndustrialCraft2 Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: BuildCraft 6 Fuels Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: BuildCraft 6 Fuels Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: Better With Mods Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: Better With Mods Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: TechReborn Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: TechReborn Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: ImmersiveEngineering Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: ImmersiveEngineering Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: BuildCraft 6 Transport Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: BuildCraft 6 Transport Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: BuildCraft 6 Recipes Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: BuildCraft 6 Recipes Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: Mystical Agriculture Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: Mystical Agriculture Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: Actually Additions Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: Actually Additions Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: BuildCraft 6 Statements Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: BuildCraft 6 Statements Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Start: rustic Module
[23:30:18] [Server thread/DEBUG] [forestry]: Disabled-Setup Complete: rustic Module
[23:30:18] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Core Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Core Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Climatology Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Climatology Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Backpack Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Backpack Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Apiculture Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Apiculture Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Database Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Database Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Energy Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Energy Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Greenhouse Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Greenhouse Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Farming Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Farming Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Crate Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Crate Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Cultivation Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Cultivation Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Worktable Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Worktable Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Book Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Book Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Fluids Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Fluids Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Food Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Food Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Factory Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Factory Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Charcoal Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Charcoal Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Sorting Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Sorting Module
[23:30:19] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Arboriculture Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Arboriculture Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Lepidopterology Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Lepidopterology Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Mail Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Mail Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Natura Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Natura Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Roots Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Roots Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: Extra Utilities Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: Extra Utilities Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: BiomesOPlenty Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: BiomesOPlenty Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Start: HarvestCraft Module
[23:30:21] [Server thread/DEBUG] [forestry]: Register Items and Blocks Complete: HarvestCraft Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Core Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Core Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Core Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Climatology Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Climatology Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Climatology Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Backpack Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Backpack Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Backpack Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Apiculture Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Apiculture Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Apiculture Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Database Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Database Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Database Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Energy Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Energy Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Energy Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Greenhouse Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Greenhouse Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Greenhouse Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Farming Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Farming Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Farming Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Crate Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Crate Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Crate Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Cultivation Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Cultivation Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Cultivation Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Worktable Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Worktable Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Worktable Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Book Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Book Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Book Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Fluids Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Fluids Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Fluids Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Food Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Food Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Food Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Factory Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Factory Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Factory Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Charcoal Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Charcoal Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Charcoal Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Sorting Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Sorting Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Sorting Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Arboriculture Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Arboriculture Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Arboriculture Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Lepidopterology Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Lepidopterology Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Lepidopterology Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Mail Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Mail Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Mail Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Natura Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Natura Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Natura Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Roots Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Roots Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Roots Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: Extra Utilities Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: Extra Utilities Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: Extra Utilities Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: BiomesOPlenty Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: BiomesOPlenty Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: BiomesOPlenty Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Start: HarvestCraft Module
[23:30:21] [Server thread/DEBUG] [forestry]: Registering Handlers for Module: HarvestCraft Module
[23:30:21] [Server thread/DEBUG] [forestry]: Pre-Init Complete: HarvestCraft Module
[23:30:21] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod forestry
[23:30:21] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Forestry took 4.860s
[23:30:21] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod llibrary
[23:30:21] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod llibrary
[23:30:21] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - LLibrary took 0.107s
[23:30:21] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod fossil
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.nautilus as fossil:fossil.nautilus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.coelacanth as fossil:fossil.coelacanth
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.alligator_gar as fossil:fossil.alligator_gar
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.sturgeon as fossil:fossil.sturgeon
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.triceratops as fossil:fossil.triceratops
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.velociraptor as fossil:fossil.velociraptor
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.tyrannosaurus as fossil:fossil.tyrannosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.pterosaur as fossil:fossil.pterosaur
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.plesiosaur as fossil:fossil.plesiosaur
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.mosasaurus as fossil:fossil.mosasaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.stegosaurus as fossil:fossil.stegosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.dilophosaurus as fossil:fossil.dilophosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.brachiosaurus as fossil:fossil.brachiosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.spinosaurus as fossil:fossil.spinosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.compsognathus as fossil:fossil.compsognathus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.ankylosaurus as fossil:fossil.ankylosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.pachycephalosaurus as fossil:fossil.pachycephalosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.deinonychus as fossil:fossil.deinonychus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.gallimimus as fossil:fossil.gallimimus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.liopleurodon as fossil:fossil.liopleurodon
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.allosaurus as fossil:fossil.allosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.sarcosuchus as fossil:fossil.sarcosuchus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.ceratosaurus as fossil:fossil.ceratosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.dryosaurus as fossil:fossil.dryosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.therizinosaurus as fossil:fossil.therizinosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.parasaurolophus as fossil:fossil.parasaurolophus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.citipati as fossil:fossil.citipati
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.diplodocus as fossil:fossil.diplodocus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.ornitholestes as fossil:fossil.ornitholestes
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.henodus as fossil:fossil.henodus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.icthyosaurus as fossil:fossil.icthyosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.meganeura as fossil:fossil.meganeura
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.megalograptus as fossil:fossil.megalograptus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.confuciusornis as fossil:fossil.confuciusornis
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.dodo as fossil:fossil.dodo
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.gastornis as fossil:fossil.gastornis
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.kelenken as fossil:fossil.kelenken
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.phorusrhacos as fossil:fossil.phorusrhacos
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.titanis as fossil:fossil.titanis
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.mammoth as fossil:fossil.mammoth
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.smilodon as fossil:fossil.smilodon
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.quagga as fossil:fossil.quagga
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.elasmotherium as fossil:fossil.elasmotherium
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.megaloceros as fossil:fossil.megaloceros
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.megalania as fossil:fossil.megalania
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.megalodon as fossil:fossil.megalodon
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.platybelodon as fossil:fossil.platybelodon
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.tiktaalik as fossil:fossil.tiktaalik
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.crassigyrinus as fossil:fossil.crassigyrinus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.diplocaulus as fossil:fossil.diplocaulus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.edaphosaurus as fossil:fossil.edaphosaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.arthropleura as fossil:fossil.arthropleura
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.javelin as fossil:fossil.javelin
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.ancient_javelin as fossil:fossil.ancient_javelin
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.stone_tablet as fossil:fossil.stone_tablet
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.failuresaurus as fossil:fossil.failuresaurus
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.dinoegg as fossil:fossil.dinoegg
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.birdegg as fossil:fossil.birdegg
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.friendlypigzombie as fossil:fossil.friendlypigzombie
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.anueffect as fossil:fossil.anueffect
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.anudead as fossil:fossil.anudead
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.tarslime as fossil:fossil.tarslime
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.sentrypigman as fossil:fossil.sentrypigman
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.anubite as fossil:fossil.anubite
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.anu as fossil:fossil.anu
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.debugtest as fossil:fossil.debugtest
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.debugtest_2 as fossil:fossil.debugtest_2
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.toyball as fossil:fossil.toyball
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.toytetheredlog as fossil:fossil.toytetheredlog
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod fossil entity fossil.toyscratchingpost as fossil:fossil.toyscratchingpost
[23:30:24] [Server thread/INFO] [fossils]: Started Tinkers integration for FossilsArcheology
[23:30:24] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `tconstruct` for name `enderference`, expected `fossil`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:24] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `tconstruct` for name `insatiable`, expected `fossil`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:24] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `tconstruct` for name `magnetic`, expected `fossil`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:24] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `tconstruct` for name `momentum`, expected `fossil`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:24] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `tconstruct` for name `dot`, expected `fossil`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:24] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `tconstruct` for name `splinter`, expected `fossil`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:24] [Server thread/INFO] [fossils]: Archaean horizon
[23:30:24] [Server thread/INFO] [fossils]: The first sunrise
[23:30:24] [Server thread/INFO] [fossils]: On a pristine Gaea
[23:30:24] [Server thread/INFO] [fossils]: Opus perfectum
[23:30:24] [Server thread/INFO] [fossils]: Somewhere there, us sleeping
[23:30:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod fossil
[23:30:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Fossils and Archeology Revival took 2.615s
[23:30:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod ftblib
[23:30:24] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into ftblib for type INSTANCE
[23:30:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod ftblib
[23:30:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - FTB Library took 0.063s
[23:30:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod itemfilters
[23:30:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod itemfilters
[23:30:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Item Filters took 0.040s
[23:30:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod ftbquests
[23:30:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod ftbquests
[23:30:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - FTB Quests took 0.046s
[23:30:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod ftbmoney
[23:30:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod ftbmoney
[23:30:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - FTB Money took 0.008s
[23:30:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod grimoireofgaia
[23:30:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod grimoireofgaia
[23:30:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Grimoire of Gaia 3 took 0.010s
[23:30:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod ichunutil
[23:30:24] [Server thread/TRACE] [FML]: Automatically registered mod ichunutil entity EntityBlock as ichunutil:entity_block
[23:30:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod ichunutil
[23:30:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - iChunUtil took 0.064s
[23:30:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod hats
[23:30:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod hats
[23:30:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Hats took 0.090s
[23:30:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod ironchest
[23:30:24] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from ironchest-1.12.2-7.0.67.844.jar to locate a version number for mod ironchest
[23:30:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod ironchest
[23:30:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Iron Chest took 0.010s
[23:30:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod journeymap
[23:30:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod journeymap
[23:30:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - JourneyMap took 0.000s
[23:30:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod lootbagmod
[23:30:24] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod lootbagmod
[23:30:24] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Loot Bag Mod took 0.000s
[23:30:24] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod morph
[23:30:24] [Server thread/WARN] [iChunUtil]: Config property enableFlight from mod Morph may not be localized!
[23:30:24] [Hats Download/Read Hats Thread/INFO] [Hats]: [7.1.1] Extracted 198 hats from archive
[23:30:25] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod morph
[23:30:25] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Morph took 0.094s
[23:30:25] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod harvestcraft
[23:30:26] [Hats Mod Mob Support Thread/INFO] [STDERR]: [me.ichun.mods.hats.common.thread.ThreadGetModMobSupport:run:90]: java.io.FileNotFoundException: https://raw.githubusercontent.com/iChun/Hats/master/src/main/resources/assets/hats/mod/HatModMobSupport.json
[23:30:26] [Hats Mod Mob Support Thread/INFO] [STDERR]: [me.ichun.mods.hats.common.thread.ThreadGetModMobSupport:run:90]: at sun.net.www.protocol.http.HttpURLConnection.getInputStream0(HttpURLConnection.java:1893)
[23:30:26] [Hats Mod Mob Support Thread/INFO] [STDERR]: [me.ichun.mods.hats.common.thread.ThreadGetModMobSupport:run:90]: at sun.net.www.protocol.http.HttpURLConnection.access$200(HttpURLConnection.java:92)
[23:30:26] [Hats Mod Mob Support Thread/INFO] [STDERR]: [me.ichun.mods.hats.common.thread.ThreadGetModMobSupport:run:90]: at sun.net.www.protocol.http.HttpURLConnection$9.run(HttpURLConnection.java:1487)
[23:30:26] [Hats Mod Mob Support Thread/INFO] [STDERR]: [me.ichun.mods.hats.common.thread.ThreadGetModMobSupport:run:90]: at sun.net.www.protocol.http.HttpURLConnection$9.run(HttpURLConnection.java:1485)
[23:30:26] [Hats Mod Mob Support Thread/INFO] [STDERR]: [me.ichun.mods.hats.common.thread.ThreadGetModMobSupport:run:90]: at java.security.AccessController.doPrivileged(Native Method)
[23:30:26] [Hats Mod Mob Support Thread/INFO] [STDERR]: [me.ichun.mods.hats.common.thread.ThreadGetModMobSupport:run:90]: at java.security.AccessController.doPrivilegedWithCombiner(AccessController.java:784)
[23:30:26] [Hats Mod Mob Support Thread/INFO] [STDERR]: [me.ichun.mods.hats.common.thread.ThreadGetModMobSupport:run:90]: at sun.net.www.protocol.http.HttpURLConnection.getInputStream(HttpURLConnection.java:1484)
[23:30:26] [Hats Mod Mob Support Thread/INFO] [STDERR]: [me.ichun.mods.hats.common.thread.ThreadGetModMobSupport:run:90]: at sun.net.www.protocol.https.HttpsURLConnectionImpl.getInputStream(HttpsURLConnectionImpl.java:268)
[23:30:26] [Hats Mod Mob Support Thread/INFO] [STDERR]: [me.ichun.mods.hats.common.thread.ThreadGetModMobSupport:run:90]: at java.net.URL.openStream(URL.java:1093)
[23:30:26] [Hats Mod Mob Support Thread/INFO] [STDERR]: [me.ichun.mods.hats.common.thread.ThreadGetModMobSupport:run:90]: at me.ichun.mods.hats.common.thread.ThreadGetModMobSupport.run(ThreadGetModMobSupport.java:41)
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `apple`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `wheat`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `potato`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `carrot`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `beetroot`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `melon`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `beef`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cooked_beef`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `chicken`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cooked_chicken`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `porkchop`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cooked_porkchop`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rabbit`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cooked_rabbit`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `mutton`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cooked_mutton`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cod`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cooked_cod`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `salmon`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cooked_salmon`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `clownfish`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pufferfish`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `mushroom_stew`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `bread`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cookie`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `baked_potato`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pumpkin_pie`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rabbit_stew`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `beetroot_soup`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:26] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod harvestcraft
[23:30:26] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Pam's HarvestCraft took 1.545s
[23:30:26] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod projectintelligence
[23:30:26] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod projectintelligence
[23:30:26] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Project Intelligence took 0.001s
[23:30:26] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod randomthings
[23:30:29] [Hats Download/Read Hats Thread/INFO] [Hats]: [7.1.1] Loaded 198 hats. 68 are contributor hats.
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity playerSoul as randomthings:playersoul
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity reviveCircle as randomthings:revivecircle
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity spirit as randomthings:spirit
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity artificialEndPortal as randomthings:artificialendportal
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity projectedItem as randomthings:projecteditem
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity flooFirePlace as randomthings:floofireplace
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity fallingBlockSpecial as randomthings:fallingblockspecial
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity goldenChicken as randomthings:goldenchicken
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity goldenEgg as randomthings:goldenegg
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity thrownWeatherEgg as randomthings:thrownweatheregg
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity weatherCloud as randomthings:weathercloud
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity timeAccelerator as randomthings:timeaccelerator
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity spectreIlluminator as randomthings:spectreilluminator
[23:30:32] [Server thread/TRACE] [FML]: Automatically registered mod randomthings entity eclipsedClock as randomthings:eclipsedclock
[23:30:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod randomthings
[23:30:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Random Things took 5.931s
[23:30:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod rats
[23:30:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod rats
[23:30:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Rats took 0.042s
[23:30:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod roots
[23:30:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod roots
[23:30:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Roots took 0.289s
[23:30:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod tabula
[23:30:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod tabula
[23:30:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Tabula took 0.029s
[23:30:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod thermalfoundation
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod thermalfoundation entity thermalfoundation.blizz as thermalfoundation:blizz
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod thermalfoundation entity thermalfoundation.blitz as thermalfoundation:blitz
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod thermalfoundation entity thermalfoundation.basalz as thermalfoundation:basalz
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod thermalfoundation entity thermalfoundation.blizz_bolt as thermalfoundation:blizz_bolt
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod thermalfoundation entity thermalfoundation.blitz_bolt as thermalfoundation:blitz_bolt
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod thermalfoundation entity thermalfoundation.basalz_bolt as thermalfoundation:basalz_bolt
[23:30:34] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod thermalfoundation
[23:30:34] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Thermal Foundation took 1.610s
[23:30:34] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod phosphor-lighting
[23:30:34] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod phosphor-lighting
[23:30:34] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Phosphor Lighting Engine took 0.000s
[23:30:34] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mysticallib
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_fox as mysticalworld:entity_fox
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_frog as mysticalworld:entity_frog
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_beetle as mysticalworld:entity_beetle
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_sprout as mysticalworld:entity_sprout
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_hell_sprout as mysticalworld:entity_hell_sprout
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_deer as mysticalworld:entity_deer
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_endermini as mysticalworld:entity_endermini
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_owl as mysticalworld:entity_owl
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_lava_cat as mysticalworld:entity_lava_cat
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_silkworm as mysticalworld:entity_silkworm
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_clam as mysticalworld:entity_clam
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_fire_jet as roots:entity_fire_jet
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_thorn_trap as roots:entity_thorn_trap
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_time_stop as roots:entity_time_stop
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_boost as roots:entity_boost
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_flare as roots:entity_flare
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_icicle as roots:entity_icicle
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_animal_harvest as roots:entity_ritual_animal_harvest
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_divine_protection as roots:entity_ritual_divine_protection
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_fire_storm as roots:entity_ritual_fire_storm
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_flower_growth as roots:entity_ritual_flower_growth
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_frost_lands as roots:entity_ritual_frost_lands
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_gathering as roots:entity_ritual_gathering
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_germination as roots:entity_ritual_germination
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_healing_aura as roots:entity_ritual_healing_aura
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_heavy_storms as roots:entity_ritual_heavy_storms
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_overgrowth as roots:entity_ritual_overgrowth
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_purity as roots:entity_ritual_purity
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_spreading_forest as roots:entity_ritual_spreading_forest
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_transmutation as roots:entity_ritual_transmutation
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_warding_protection as roots:entity_ritual_warding_protection
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_wildroot_growth as roots:entity_ritual_wildroot_growth
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_windwall as roots:entity_ritual_windwall
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_ritual_summon_creatures as roots:entity_ritual_summon_creatures
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_husk_slave as roots:entity_husk_slave
[23:30:34] [Server thread/TRACE] [FML]: Automatically registered mod mysticallib entity entity_zombie_slave as roots:entity_zombie_slave
[23:30:35] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mysticallib
[23:30:35] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Mystical Lib took 0.584s
[23:30:35] [Server thread/DEBUG] [FML]: Bar Finished: PreInitialization took 55.488s
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `bookcase`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `shelf`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `markerpole`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `clipboard`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `bibliolight`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `furniturepaneler`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `potionshelf`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `toolrack`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `label`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `desk`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `table`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `seat`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `fancysign`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `fancyworkbench`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `framedchest`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `mapframe`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `case`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `clock`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `paintingframeborderless`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `paintingframefancy`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `paintingframeflat`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `paintingframemiddle`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `paintingframesimple`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `paintingpress`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `armorstand`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `typesettingtable`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `printingpress`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cookiejar`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `dinnerplate`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `discrack`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `swordpedestal`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `bell`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `typewriter`, expected `bibliocraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:43] [Server thread/INFO] [Chisel]: Loading blocks...
[23:30:43] [Server thread/INFO] [Chisel]: Skipping feature certus as its required mod appliedenergistics2 was missing.
[23:30:44] [Server thread/INFO] [Chisel]: 74 Feature's blocks loaded.
[23:30:44] [Server thread/INFO] [Chisel]: Loading Tile Entities...
[23:30:44] [Server thread/INFO] [Chisel]: Tile Entities loaded.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.table`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.craftingstation`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.stenciltable`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.partbuilder`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.patternchest`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.partchest`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.toolstation`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.toolforge`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.smeltery_controller`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.smeltery_component`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.tank`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.faucet`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.channel`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.casting_table`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.casting_basin`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.smeltery_drain`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.seared_furnace`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.tinker_tank`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:48] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.item_rack`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:48] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.drying_rack`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:48] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.wooden_hopper`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:48] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tconstruct.slime_channel`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `natura.netherrack_furnace`, expected `natura`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/INFO] [grimoireofgaia]: Registering blocks...
[23:30:50] [Server thread/INFO] [grimoireofgaia]: Block registration complete.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.iron`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.gold`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.diamond`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.copper`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.silver`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.crystal`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.obsidian`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.dirtchest9000`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.iron`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.gold`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.diamond`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.copper`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.silver`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.crystal`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.obsidian`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rats.cauldron_milk`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rats.rat_hole`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:50] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rats.rat_trap`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:51] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rats.rat_cage_decorated`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:54] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rats.rat_cage_breeding_lantern`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:54] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rats.rat_crafting_table`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:54] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rats.auto_curdler`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:54] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rats.ratlantis_portal`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:54] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rats.upgrade_combiner`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:54] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rats.upgrade_separator`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:57] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:30:58] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:01] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:06] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:09] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:12] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:14] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:17] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:20] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:24] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:27] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:32] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:38] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:41] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `rat_tube`, expected `rats`. This could be a intended override, but in most cases indicates a broken mod.
[23:31:48] [Server thread/INFO] [FML]: Applying holder lookups
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:aechor_petal for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aechor_petal. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:aerwhale_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aerwhale_music_disc. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_saddle for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aether_saddle. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:antitoxin_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.antitoxin_vial. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:antivenom_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.antivenom_vial. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_chunk for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ambrosium_chunk. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_shard for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ambrosium_shard. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_axe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_boots. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_crossbow. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_door_item. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_gloves. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_helmet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_leggings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shears for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shears. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shield. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shovel. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_strip for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_strip. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:bandage for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.bandage. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.blueberries. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberry_lollipop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.blueberry_lollipop. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:bolt for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.bolt. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_cane for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_cane. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_grass for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_grass. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_rope for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_rope. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_boots. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_gloves. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_helmet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_leggings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_rib_cut for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_rib_cut. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_ribs for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_ribs. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.candy_cane. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_corn for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.candy_corn. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloud_parachute for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cloud_parachute. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudtwine for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cloudtwine. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:cockatrice_feather for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cockatrice_feather. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:cocoatrice for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cocoatrice. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_shard for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.crude_scatterglass_shard. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:dart for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.dart. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:dart_shooter for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.dart_shooter. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:eggnog for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.eggnog. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:enchanted_blueberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.enchanted_blueberry. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:enchanted_wyndberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.enchanted_wyndberry. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:fried_moa_egg for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.fried_moa_egg. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:ginger_bread_man for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ginger_bread_man. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:golden_amber for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.golden_amber. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_axe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_boots. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_crossbow. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_gloves. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_helmet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_leggings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_plate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_plate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_shield. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_shovel. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:healing_stone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.healing_stone. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:healing_stone_depleted for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.healing_stone_depleted. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_axe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_crossbow. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_shield. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_shovel. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.icestone. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_poprocks for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.icestone_poprocks. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_armor for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_armor. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_charm for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_charm. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_chunk for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_chunk. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_dust for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_dust. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_neckwear for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_neckwear. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_ring for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_ring. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_tool for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_tool. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:jelly_plumproot for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.jelly_plumproot. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:kirrid_cutlet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.kirrid_cutlet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:kirrid_loin for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.kirrid_loin. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:labyrinth_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.labyrinth_music_disc. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_egg_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_egg_item. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feather for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feather. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed_blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed_blueberries. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed_enchanted_blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed_enchanted_blueberries. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_music_disc. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.orange. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange_lollipop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.orange_lollipop. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot_mash for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.plumproot_mash. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot_pie for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.plumproot_pie. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:rainbow_moa_egg for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.rainbow_moa_egg. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:raw_taegore_meat for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.raw_taegore_meat. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:recording_892 for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.recording_892. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.scatterglass_vial. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.secret_skyroot_door_item. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:shard_of_life for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.shard_of_life. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_axe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bed_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_bed_item. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_bucket. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_crossbow. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_door_item. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_lizard_stick for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_lizard_stick. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_lizard_stick_roasted for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_lizard_stick_roasted. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_milk_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_milk_bucket. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pinecone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_pinecone. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_poison_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_poison_bucket. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_shield. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_shovel. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sign for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_sign. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_stick for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_stick. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_water_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_water_bucket. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:splint for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.splint. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:stomper_pop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.stomper_pop. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_gel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_gel. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_jelly for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_jelly. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_sugar for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_sugar. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_boots. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_gloves. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_helmet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_leggings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_steak for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_steak. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_music_disc. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_tea for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_tea. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_wings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_wings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:water_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.water_vial. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:winter_hat for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.winter_hat. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:wrapped_chocolates for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wrapped_chocolates. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:wrapping_paper for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wrapping_paper. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:wyndberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wyndberry. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:yule_log for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.yule_log. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_axe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_boots. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_crossbow. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_gemstone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_gemstone. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_gloves. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_helmet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_leggings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_shield. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_shovel. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_iron for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_iron. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_diamond for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_diamond. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_hitech for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_hitech. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup chisel:offsettool for public static team.chisel.common.item.ItemOffsetTool team.chisel.common.init.ChiselItems.offsettool. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:screen for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.SCREEN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:progress_detector for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.PROGRESS_DETECTOR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:detector for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.DETECTOR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:progress_screen for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.PROGRESS_SCREEN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:chest for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.CHEST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:loot_crate_storage for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.LOOT_CRATE_STORAGE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:loot_crate_opener for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.LOOT_CRATE_OPENER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:barrier for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.BARRIER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:reward_collector for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.REWARD_COLLECTOR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:book for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.BOOK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:lootcrate for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.LOOTCRATE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:custom_icon for public static net.minecraft.item.Item com.feed_the_beast.ftbquests.item.FTBQuestsItems.CUSTOM_ICON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:boost for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.BOOST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:whirlwind for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.WHIRLWIND. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:planar_binding for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.PLANAR_BINDING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:soul_snare for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.SOUL_SNARE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:soul_fray for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.SOUL_FRAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:fire_fuse for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.FIRE_FUSE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:constrict for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.CONSTRICT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:plant_leech for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.PLANT_LEECH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:deafness for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.DEAFNESS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:bounce for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.BOUNCE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:cling for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.CLING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sacrificial_lamb for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.SACRIFICIAL_LAMB. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:flight for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.FLIGHT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:grounded for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.GROUNDED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:heavy_heart for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.HEAVY_HEART. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:suspended for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.SUSPENDED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:feathered for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.FEATHERED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:venison_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.VENISON_RAW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:venison_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.VENISON_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:hirschgeist_skull_wearable for public static its_meow.betteranimalsplus.common.item.ItemHirschgeistSkullWearable its_meow.betteranimalsplus.init.ModItems.HIRSCHGEIST_SKULL_WEARABLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:antler for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.ANTLER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:blubber for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.BLUBBER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goat_milk for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.GOAT_MILK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goat_cheese for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.GOAT_CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.PHEASANT_RAW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.PHEASANT_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:wolf_pelt_snowy for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.WOLF_PELT_SNOWY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:wolf_pelt_timber for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.WOLF_PELT_TIMBER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:wolf_pelt_black for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.WOLF_PELT_BLACK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:wolf_pelt_arctic for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.WOLF_PELT_ARCTIC. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:wolf_pelt_brown for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.WOLF_PELT_BROWN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:wolf_pelt_red for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.WOLF_PELT_RED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:bear_skin_brown for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.BEAR_SKIN_BROWN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:bear_skin_black for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.BEAR_SKIN_BLACK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:bear_skin_kermode for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.BEAR_SKIN_KERMODE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:crab_meat_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.CRAB_MEAT_RAW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:crab_meat_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.CRAB_MEAT_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:record_crab_rave for public static net.minecraft.item.ItemRecord its_meow.betteranimalsplus.init.ModItems.RECORD_CRAB_RAVE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:record_walrus for public static net.minecraft.item.ItemRecord its_meow.betteranimalsplus.init.ModItems.RECORD_WALRUS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_egg for public static its_meow.betteranimalsplus.common.item.ItemThrowableCustomEgg its_meow.betteranimalsplus.init.ModItems.PHEASANT_EGG. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:turkey_egg for public static its_meow.betteranimalsplus.common.item.ItemThrowableCustomEgg its_meow.betteranimalsplus.init.ModItems.TURKEY_EGG. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goose_egg for public static its_meow.betteranimalsplus.common.item.ItemThrowableCustomEgg its_meow.betteranimalsplus.init.ModItems.GOOSE_EGG. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:golden_goose_egg for public static its_meow.betteranimalsplus.common.item.ItemThrowableCustomEgg its_meow.betteranimalsplus.init.ModItems.GOLDEN_GOOSE_EGG. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:turkey_leg_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.TURKEY_LEG_RAW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:turkey_leg_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.TURKEY_LEG_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:eel_meat_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.EEL_MEAT_RAW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:eel_meat_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.EEL_MEAT_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:fried_egg for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.FRIED_EGG. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_cursed for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_CURSED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_headgear for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_HEADGEAR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_headgear_mob for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_HEADGEAR_MOB. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_headgear_arrow for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_HEADGEAR_ARROW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_headgear_bolt for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_HEADGEAR_BOLT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_headgear_doll for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_HEADGEAR_DOLL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_headgear_ears_elf for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_HEADGEAR_EARS_ELF. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_charm_damage_iron for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_CHARM_DAMAGE_IRON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_ring_haste for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_RING_HASTE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_ring_jump for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_RING_JUMP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_ring_night for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_RING_NIGHT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_ring_speed for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_RING_SPEED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_trinket_levitation for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_TRINKET_LEVITATION. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_trinket_poison for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_TRINKET_POISON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_trinket_water_breathing for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_TRINKET_WATER_BREATHING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:accessory_trinket_wither for public static net.minecraft.item.Item gaia.init.GaiaItems.ACCESSORY_TRINKET_WITHER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box for public static net.minecraft.item.Item gaia.init.GaiaItems.BOX. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bag_arrow for public static net.minecraft.item.Item gaia.init.GaiaItems.BAG_ARROW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bag_book for public static net.minecraft.item.Item gaia.init.GaiaItems.BAG_BOOK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bag_record for public static net.minecraft.item.Item gaia.init.GaiaItems.BAG_RECORD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:book_buff for public static net.minecraft.item.Item gaia.init.GaiaItems.BOOK_BUFF. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_diamond for public static net.minecraft.item.Item gaia.init.GaiaItems.BOX_DIAMOND. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_gold for public static net.minecraft.item.Item gaia.init.GaiaItems.BOX_GOLD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_hat for public static net.minecraft.item.Item gaia.init.GaiaItems.BOX_HAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_iron for public static net.minecraft.item.Item gaia.init.GaiaItems.BOX_IRON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_old for public static net.minecraft.item.Item gaia.init.GaiaItems.BOX_OLD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:chest for public static net.minecraft.item.Item gaia.init.GaiaItems.CHEST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_item for public static net.minecraft.item.Item gaia.init.GaiaItems.DEBUG_ITEM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_weapon for public static net.minecraft.item.Item gaia.init.GaiaItems.DEBUG_WEAPON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_coalfish for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_COALFISH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_honey for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_HONEY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_mandrake for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_MANDRAKE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_meat for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_MEAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_monster_feed for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_MONSTER_FEED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_monster_feed_premium for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_MONSTER_FEED_PREMIUM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_nether_wart for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_NETHER_WART. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_pie_apple_gold for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_PIE_APPLE_GOLD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_pie_mandrake for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_PIE_MANDRAKE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_pie_meat for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_PIE_MEAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_root for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_ROOT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_rotten_heart for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_ROTTEN_HEART. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_small_apple_gold for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_SMALL_APPLE_GOLD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:food_wither for public static net.minecraft.item.Item gaia.init.GaiaItems.FOOD_WITHER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_book for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_BOOK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_currency for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_CURRENCY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_elytra for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_ELYTRA. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_experience for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_EXPERIENCE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_fur for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_FUR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_furnace_fuel for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_FURNACE_FUEL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_giga_gear for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_GIGA_GEAR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_quill for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_QUILL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_pearl for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_PEARL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_ring for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_RING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_soul_fire for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_SOUL_FIRE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:misc_soul_fiery for public static net.minecraft.item.Item gaia.init.GaiaItems.MISC_SOUL_FIERY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:pickup_heart for public static net.minecraft.item.Item gaia.init.GaiaItems.PICKUP_HEART. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shard for public static net.minecraft.item.Item gaia.init.GaiaItems.SHARD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shard_misc for public static net.minecraft.item.Item gaia.init.GaiaItems.SHARD_MISC. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shield_prop for public static net.minecraft.item.Item gaia.init.GaiaItems.SHIELD_PROP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_weresheep for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_WERESHEEP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_creeper_girl for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_CREEPER_GIRL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_ender_girl for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_ENDER_GIRL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_holstaurus for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_HOLSTAURUS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_slime_girl for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_SLIME_GIRL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_tame for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_TAME. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spawn_trader for public static net.minecraft.item.Item gaia.init.GaiaItems.SPAWN_TRADER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_battle for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_BATTLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_buff for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_BUFF. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_ender for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_ENDER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_freezing for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_FREEZING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_hunger for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_HUNGER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_metal for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_METAL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_nature for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_NATURE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_nightmare for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_NIGHTMARE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_book_wither for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_BOOK_WITHER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_fan for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_FAN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_fan_fire for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_FAN_FIRE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_fan_ice for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_FAN_ICE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_projectile_bomb for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROJECTILE_BOMB. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_enchanted for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_ENCHANTED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_projectile_bubble for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_PROJECTILE_BUBBLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_projectile_magic for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_PROJECTILE_MAGIC. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_projectile_magic_random for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_PROJECTILE_MAGIC_RANDOM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_projectile_poison for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_PROJECTILE_POISON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_projectile_web for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_PROJECTILE_WEB. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_sword_wood for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_SWORD_WOOD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_sword_stone for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_SWORD_STONE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_sword_iron for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_SWORD_IRON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_sword_gold for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_SWORD_GOLD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_axe_wood for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_AXE_WOOD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_axe_stone for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_AXE_STONE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_axe_iron for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_AXE_IRON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_axe_gold for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_AXE_GOLD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_dagger_metal for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_DAGGER_METAL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_broom for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_BROOM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weapon_prop_hammer_minotaur for public static net.minecraft.item.Item gaia.init.GaiaItems.WEAPON_PROP_HAMMER_MINOTAUR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup itemfilters:filter for public static net.minecraft.item.Item com.latmod.mods.itemfilters.item.ItemFiltersItems.FILTER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup itemfilters:missing for public static net.minecraft.item.Item com.latmod.mods.itemfilters.item.ItemFiltersItems.MISSING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:blood_orb for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BLOOD_ORB. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:activation_crystal for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.ACTIVATION_CRYSTAL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:slate for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SLATE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:inscription_tool for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.INSCRIPTION_TOOL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sacrificial_dagger for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SACRIFICIAL_DAGGER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:pack_self_sacrifice for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.PACK_SELF_SACRIFICE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:pack_sacrifice for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.PACK_SACRIFICE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:dagger_of_sacrifice for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.DAGGER_OF_SACRIFICE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:ritual_diviner for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.RITUAL_DIVINER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:ritual_dismantler for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.RITUAL_DISMANTLER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:ritual_reader for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.RITUAL_READER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:lava_crystal for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.LAVA_CRYSTAL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:bound_sword for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BOUND_SWORD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:bound_pickaxe for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BOUND_PICKAXE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:bound_axe for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BOUND_AXE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:bound_shovel for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BOUND_SHOVEL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_divination for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_DIVINATION. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_air for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_AIR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_water for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_WATER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_lava for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_LAVA. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_void for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_VOID. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_green_grove for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_GREEN_GROVE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_blood_light for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_BLOOD_LIGHT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_elemental_affinity for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_ELEMENTAL_AFFINITY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_haste for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_HASTE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_magnetism for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_MAGNETISM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_suppression for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_SUPPRESSION. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_fast_miner for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_FAST_MINER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_seer for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_SEER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_ender_severance for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_ENDER_SEVERANCE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_whirlwind for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_WHIRLWIND. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_phantom_bridge for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_PHANTOM_BRIDGE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_compression for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_COMPRESSION. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_holding for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_HOLDING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_teleposition for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_TELEPOSITION. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_transposition for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_TRANSPOSITION. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_claw for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_CLAW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_bounce for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_BOUNCE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sigil_frost for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SIGIL_FROST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:component for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.COMPONENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:item_demon_crystal for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.ITEM_DEMON_CRYSTAL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:teleposition_focus for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.TELEPOSITION_FOCUS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:experience_tome for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.EXPERIENCE_TOME. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:blood_shard for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BLOOD_SHARD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:living_armour_helmet for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.LIVING_ARMOUR_HELMET. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:living_armour_chest for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.LIVING_ARMOUR_CHEST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:living_armour_leggings for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.LIVING_ARMOUR_LEGGINGS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:living_armour_boots for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.LIVING_ARMOUR_BOOTS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_armour_helmet for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_ARMOUR_HELMET. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_armour_chest for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_ARMOUR_CHEST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_armour_leggings for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_ARMOUR_LEGGINGS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_armour_boots for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_ARMOUR_BOOTS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:altar_maker for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.ALTAR_MAKER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:upgrade_tome for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.UPGRADE_TOME. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:upgrade_trainer for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.UPGRADE_TRAINER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:arcane_ashes for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.ARCANE_ASHES. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:monster_soul for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.MONSTER_SOUL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:soul_gem for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SOUL_GEM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:soul_snare for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SOUL_SNARE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_sword for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_SWORD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_bow for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_BOW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_armour_gem for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_ARMOUR_GEM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_axe for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_AXE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_pickaxe for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_PICKAXE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sentient_shovel for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SENTIENT_SHOVEL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:node_router for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.NODE_ROUTER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:base_item_filter for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BASE_ITEM_FILTER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:base_fluid_filter for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.BASE_FLUID_FILTER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:cutting_fluid for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.CUTTING_FLUID. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sanguine_book for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.SANGUINE_BOOK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:points_upgrade for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.POINTS_UPGRADE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:demon_will_gauge for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.DEMON_WILL_GAUGE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:potion_flask for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.POTION_FLASK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:alchemic_vial for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.ALCHEMIC_VIAL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:icarus_scroll for public static net.minecraft.item.Item WayofTime.bloodmagic.core.RegistrarBloodMagicItems.ICARUS_SCROLL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:passive_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.PASSIVE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:passive_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.PASSIVE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:passive_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.PASSIVE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:assist_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ASSIST_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:assist_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ASSIST_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:assist_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ASSIST_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:aggressive_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.AGGRESSIVE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:aggressive_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.AGGRESSIVE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:aggressive_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.AGGRESSIVE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DEBUG_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DEBUG_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DEBUG_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ant_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANT_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ant_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ant_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_male_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_MALE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_male_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_MALE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_male_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_MALE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:arachne_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ARACHNE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:arachne_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ARACHNE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:arachne_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ARACHNE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:banshee_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BANSHEE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:banshee_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BANSHEE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:banshee_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BANSHEE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:baphomet_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BAPHOMET_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:baphomet_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BAPHOMET_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:baphomet_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BAPHOMET_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bee_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bee_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bee_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:beholder_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEHOLDER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:beholder_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEHOLDER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:beholder_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEHOLDER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cecaelia_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CECAELIA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cecaelia_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CECAELIA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cecaelia_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CECAELIA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_male_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_MALE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_male_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_MALE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_male_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_MALE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cyclops_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CYCLOPS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cyclops_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CYCLOPS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cyclops_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CYCLOPS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dhampir_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DHAMPIR_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dhampir_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DHAMPIR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dhampir_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DHAMPIR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dryad_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DRYAD_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dryad_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DRYAD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dryad_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DRYAD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dullahan_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DULLAHAN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dullahan_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DULLAHAN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dullahan_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DULLAHAN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dwarf_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DWARF_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dwarf_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DWARF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dwarf_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DWARF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:goblin_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GOBLIN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:goblin_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GOBLIN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:goblin_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GOBLIN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gorgon_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GORGON_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gorgon_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GORGON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gorgon_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GORGON_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gryphon_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GRYPHON_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gryphon_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GRYPHON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gryphon_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GRYPHON_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_wizard_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_WIZARD_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_wizard_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_WIZARD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_wizard_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_WIZARD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:hunter_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HUNTER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:hunter_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HUNTER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:hunter_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HUNTER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kikimora_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KIKIMORA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kikimora_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KIKIMORA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kikimora_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KIKIMORA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kobold_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KOBOLD_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kobold_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KOBOLD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kobold_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KOBOLD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mandragora_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MANDRAGORA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mandragora_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MANDRAGORA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mandragora_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MANDRAGORA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mandragora_scream for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MANDRAGORA_SCREAM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:matango_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MATANGO_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:matango_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MATANGO_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:matango_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MATANGO_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mermaid_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MERMAID_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mermaid_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MERMAID_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mermaid_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MERMAID_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaur_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAUR_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaur_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAUR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaur_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAUR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaurus_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAURUS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaurus_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAURUS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaurus_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAURUS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mummy_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MUMMY_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mummy_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MUMMY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mummy_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MUMMY_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:naga_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NAGA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:naga_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NAGA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:naga_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NAGA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ninetails_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NINETAILS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ninetails_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NINETAILS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ninetails_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NINETAILS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:oni_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ONI_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:oni_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ONI_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:oni_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ONI_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:orc_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ORC_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:orc_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ORC_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:orc_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ORC_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:satyress_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SATYRESS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:satyress_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SATYRESS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:satyress_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SATYRESS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:selkie_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SELKIE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:selkie_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SELKIE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:selkie_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SELKIE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shaman_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHAMAN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shaman_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHAMAN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shaman_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHAMAN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sharko_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHARKO_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sharko_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHARKO_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sharko_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHARKO_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:siren_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SIREN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:siren_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SIREN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:siren_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SIREN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sludgegirl_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLUDGEGIRL_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sludgegirl_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLUDGEGIRL_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sludgegirl_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLUDGEGIRL_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sphinx_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPHINX_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sphinx_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPHINX_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sphinx_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPHINX_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spriggan_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPRIGGAN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spriggan_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPRIGGAN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spriggan_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPRIGGAN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_male_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_MALE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_male_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_MALE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_male_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_MALE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:toad_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TOAD_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:toad_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TOAD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:toad_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TOAD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:valkyrie_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VALKYRIE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:valkyrie_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VALKYRIE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:valkyrie_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VALKYRIE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:vampire_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VAMPIRE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:vampire_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VAMPIRE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:vampire_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VAMPIRE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:werecat_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERECAT_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:werecat_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERECAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:werecat_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERECAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:witch_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WITCH_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:witch_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WITCH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:witch_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WITCH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yeti_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YETI_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yeti_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YETI_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yeti_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YETI_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yukionna_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YUKIONNA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yukionna_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YUKIONNA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yukionna_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YUKIONNA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:holstaurus_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HOLSTAURUS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:holstaurus_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HOLSTAURUS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:holstaurus_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HOLSTAURUS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:trader_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TRADER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:trader_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TRADER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:trader_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TRADER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weresheep_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERESHEEP_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weresheep_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERESHEEP_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weresheep_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERESHEEP_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:creepergirl_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CREEPERGIRL_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:creepergirl_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CREEPERGIRL_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:creepergirl_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CREEPERGIRL_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:endergirl_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ENDERGIRL_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:endergirl_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ENDERGIRL_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:endergirl_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ENDERGIRL_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:slimegirl_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLIMEGIRL_SAY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:slimegirl_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLIMEGIRL_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:slimegirl_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLIMEGIRL_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:step_sandals for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.STEP_SANDALS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:step_webbed for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.STEP_WEBBED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_open_1 for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOX_OPEN_1. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_open_2 for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOX_OPEN_2. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bag_open for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BAG_OPEN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:book_hit for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOOK_HIT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:none for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NONE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_warrior for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_WARRIOR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_ingot for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_ingot. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_disenchanter for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_DISENCHANTER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_flute for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_FLUTE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:ancient_sawblade for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.ANCIENT_SAWBLADE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:piper_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PIPER_HAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_DIE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_ambient. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_poop for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_POOP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:gem_of_ratlantis for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.GEM_OF_RATLANTIS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_keeping_2 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_keeping_2. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_boots. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:kylix_vase for public static fossilsarcheology.server.block.KylixVaseBlock fossilsarcheology.server.block.FABlockRegistry.KYLIX_VASE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:potion_effect_begin for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.POTION_EFFECT_BEGIN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_tears for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_tears. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:token_fragment for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.TOKEN_FRAGMENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_combined_creative for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_COMBINED_CREATIVE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_flute for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_FLUTE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_plague for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_PLAGUE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_stream for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.stream. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:frosted for public static net.minecraft.potion.Potion twilightforest.potions.TFPotions.frosty. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_magenta for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxMagentaItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_fisherman for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_FISHERMAN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ender_bow for public static net.minecraft.item.Item twilightforest.item.TFItems.ender_bow. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_map_focus for public static net.minecraft.item.Item twilightforest.item.TFItems.magic_map_focus. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_damage_protection for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_DAMAGE_PROTECTION. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:apprentice for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_APPRENTICE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_leggings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:trillium for public static its_meow.betteranimalsplus.common.item.ItemBlockSimple its_meow.betteranimalsplus.init.ModItems.TRILLIUM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ice_bomb for public static net.minecraft.item.Item twilightforest.item.TFItems.ice_bomb. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_leggings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:potato_pancake for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.POTATO_PANCAKE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_blood for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_blood. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:raw_meef for public static net.minecraft.item.Item twilightforest.item.TFItems.raw_meef. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_black for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlackItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:radius_stick for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RADIUS_STICK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_glacier for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.glacier. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:deep_mushroom_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.deepMushrooms. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_hurt. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_life_1 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_life_1. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.light for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_light. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_voodoo for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_VOODOO. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:transformation_powder for public static net.minecraft.item.Item twilightforest.item.TFItems.transformation_powder. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_ambient. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup itemfilters:missing for public static net.minecraft.item.Item com.feed_the_beast.ftblib.lib.util.InvUtils.missingItem. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volcanic_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.VOLCANIC_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.hum for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_hum. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:feral_bagh_nakhs for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.FERAL_BAGH_NAKHS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_spirit_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_SPIRIT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_leech for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_LEECH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.moa for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_moa. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:triple_bow for public static net.minecraft.item.Item twilightforest.item.TFItems.triple_bow. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_bricks for public static fossilsarcheology.server.block.AncientStonebrickBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_BRICK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_stew for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_STEW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_miner for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_MINER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_leggings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_nonbeliever for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_NONBELIEVER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_hurt. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_extreme_energy for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_EXTREME_ENERGY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mazebreaker_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.mazebreaker_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:carminite for public static net.minecraft.item.Item twilightforest.item.TFItems.carminite. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trophy for public static net.minecraft.item.Item twilightforest.item.TFItems.trophy. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_hurt. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_hurt. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_white for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxWhiteItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:raw_plastic for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAW_PLASTIC. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_orange for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxOrangeItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_flame for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RATLANTEAN_FLAME. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_shears for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_SHEARS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_diamond for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_DIAMOND. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_capture_net for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_CAPTURE_NET. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_automaton_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_AUTOMATON_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:miniature_structure for public static net.minecraft.item.Item twilightforest.item.TFItems.miniature_structure. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:skull for public static fossilsarcheology.server.block.SkullBlock fossilsarcheology.server.block.FABlockRegistry.SKULL_BLOCK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratglove_petals for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RATGLOVE_PETALS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:crumble_horn for public static net.minecraft.item.Item twilightforest.item.TFItems.crumble_horn. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_keeping_3 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_keeping_3. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_boots. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:phantom_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.phantom_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_green for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGreenItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:tiny_coin for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.TINY_COIN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_summon for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_SUMMON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_placer for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_PLACER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_seed_bowl for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_SEED_BOWL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.giant_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_armor for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ARMOR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:feral_rat_claw for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.FERAL_RAT_CLAW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:herb_bundle for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.HERB_BUNDLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:pirat_cutlass for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PIRAT_CUTLASS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_arctic_peaks for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.ARCTIC_PEAKS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_ambient. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_ambient. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_enchanter for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ENCHANTER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_chef for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_CHEF. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_buccaneer for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BUCCANEER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.darkForest. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_ore_doubling for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ORE_DOUBLING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:yeti_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.yeti_leggings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_tome for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_TOME. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.snow.wind for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_snow_wind. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_death. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_trap for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RAT_TRAP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_lime for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLimeItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_automaton_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_AUTOMATON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_ingot for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_ingot. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_axe for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_axe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dungeon.container.smash for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.break_labyrinth_container. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_ambient. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_brown for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBrownItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:culture_vat_idle for public static fossilsarcheology.server.block.CultivateBlock fossilsarcheology.server.block.FABlockRegistry.CULTIVATE_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_shovel for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_shovel. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:naga_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.naga_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_god for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_GOD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ice_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.ice_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:block.aercloud.bounce for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aercloud_bounce. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:little_black_squash_balls for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.LITTLE_BLACK_SQUASH_BALLS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_boots. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:creative_cheese for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CREATIVE_CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:armor_shard for public static net.minecraft.item.Item twilightforest.item.TFItems.armor_shard. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_door for public static net.minecraft.item.Item twilightforest.item.TFItems.castle_door. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.lift for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_lift. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_death. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:hydra_chop for public static net.minecraft.item.Item twilightforest.item.TFItems.hydra_chop. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_light_blue for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLightBlueItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:mice_on_venus for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.MICE_ON_VENUS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:black_death_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.BLACK_DEATH_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ore_map_empty for public static net.minecraft.item.Item twilightforest.item.TFItems.ore_map_empty. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:shield_scepter for public static net.minecraft.item.Item twilightforest.item.TFItems.shield_scepter. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:vial_of_sentience for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.VIAL_OF_SENTIENCE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_advanced_energy for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ADVANCED_ENERGY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:token_piece for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.TOKEN_PIECE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ftbquests:custom_icon for public static net.minecraft.item.Item com.feed_the_beast.ftblib.FTBLib.CUSTOM_ICON_ITEM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_archeologist for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ARCHEOLOGIST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_blacklist for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BLACKLIST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:experiment_115 for public static net.minecraft.item.Item twilightforest.item.TFItems.experiment_115. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:zombie_scepter for public static net.minecraft.item.Item twilightforest.item.TFItems.zombie_scepter. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_death. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.angry for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_angry. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_gemcutter for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_GEMCUTTER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_hurt. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ferns for public static fossilsarcheology.server.block.FernsBlock fossilsarcheology.server.block.FABlockRegistry.FERNS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_tnt for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_TNT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:transcendent for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_TRANSCENDENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_blue for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlueItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:minotaur_axe for public static net.minecraft.item.Item twilightforest.item.TFItems.minotaur_axe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:liveroot for public static net.minecraft.item.Item twilightforest.item.TFItems.liveroot. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_death. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:culture_vat_active for public static fossilsarcheology.server.block.CultivateBlock fossilsarcheology.server.block.FABlockRegistry.CULTIVATE_ACTIVEE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:block_storage for public static net.minecraft.item.Item twilightforest.item.TFItems.block_storage. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.electric_shock for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_electric_shock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_flute_no_funny for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_FLUTE_NO_FUNNY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:block_and_chain for public static net.minecraft.item.Item twilightforest.item.TFItems.block_and_chain. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_doctor_mask for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_DOCTOR_MASK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:little_black_worm for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.LITTLE_BLACK_WORM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:black_death_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.BLACK_DEATH_DIE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_water_bottle for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_WATER_BOTTLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_map for public static net.minecraft.item.Item twilightforest.item.TFItems.maze_map. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:dillhoffia for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.DILLHOFFIA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_scythe for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_SCYTHE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_dragon for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_DRAGON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:peacock_fan for public static net.minecraft.item.Item twilightforest.item.TFItems.peacock_fan. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_yellow for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxYellowItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_basic for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BASIC. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_map_empty for public static net.minecraft.item.Item twilightforest.item.TFItems.magic_map_empty. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_aquatic for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_AQUATIC. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:seeker_bow for public static net.minecraft.item.Item twilightforest.item.TFItems.seeker_bow. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:cheese_stick for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CHEESE_STICK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:yeti_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.yeti_boots. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:centipede for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CENTIPEDE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:plastic_waste for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLASTIC_WASTE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_chest for public static net.minecraft.item.Item cpw.mods.ironchest.common.core.IronChestBlocks.ironChestItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_whitelist for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_WHITELIST. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_forest_center for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.darkForestCenter. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_DIE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:minotaur_axe_gold for public static net.minecraft.item.Item twilightforest.item.TFItems.minotaur_axe_gold. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_map for public static net.minecraft.item.Item twilightforest.item.TFItems.magic_map. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:handoffate for public static its_meow.betteranimalsplus.common.item.ItemBlockSimple its_meow.betteranimalsplus.init.ModItems.HAND_OF_FATE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_ender for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ENDER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_asbestos for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ASBESTOS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_fur for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_fur. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:chef_toque for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CHEF_TOQUE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:dragon_wing for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.DRAGON_WING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:oak_savannah for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.oakSavanna. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.twilightForest. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:raw_rat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAW_RAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:master for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_MASTER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_keeping_1 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_keeping_1. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:archmage for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_ARCHMAGE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_axe for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_axe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ore_map for public static net.minecraft.item.Item twilightforest.item.TFItems.ore_map. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_burger for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_BURGER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_helmet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_loop for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_LOOP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_ambient. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_arrow for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_ARROW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_irradiated_forests for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.IRRADIATED_FORESTS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_santa for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_SANTA. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cube_of_annihilation for public static net.minecraft.item.Item twilightforest.item.TFItems.cube_of_annihilation. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_ambient. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_sack for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_SACK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_leggings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_spirit_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_SPIRIT_DIE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_map_empty for public static net.minecraft.item.Item twilightforest.item.TFItems.maze_map_empty. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.trigger for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_trigger. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:psionic_rat_brain for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PSIONIC_RAT_BRAIN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:top_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.TOP_HAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_nugget for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_NUGGET. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:charged_creeper_chunk for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CHARGED_CREEPER_CHUNK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_breeder for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BREEDER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_helmet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_swamp for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.tfSwamp. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.labyrinth_totem.drone for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.labyrinth_totem_drone. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_magnetic_hills for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.MAGNETIC_HILLS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_hurt. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_strength for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_STRENGTH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_hurt. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:cheese_cauldron for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.CHEESE_CAULDRON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_fragment for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_FRAGMENT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:alpha_fur for public static net.minecraft.item.Item twilightforest.item.TFItems.alpha_fur. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_pink for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPinkItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_combined for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_COMBINED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:black_death_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.BLACK_DEATH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup lootbagmod:lootbag for public static com.github.trhod177.lootbagmod.ItemBasicRewardBag com.github.trhod177.lootbagmod.ItemInit.lootbag. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_shield for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_shield. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_platter for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_PLATTER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cooked_meef for public static net.minecraft.item.Item twilightforest.item.TFItems.cooked_meef. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cooked_venison for public static net.minecraft.item.Item twilightforest.item.TFItems.cooked_venison. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup baubles:ring for public static net.minecraft.item.Item baubles.common.items.ItemRing.RING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:borer_essence for public static net.minecraft.item.Item twilightforest.item.TFItems.borer_essence. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:snowy_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.snowy_forest. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_attack. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_wafer for public static net.minecraft.item.Item twilightforest.item.TFItems.maze_wafer. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.travel for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_travel. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:archeologist_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.ARCHEOLOGIST_HAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_helmet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:weak for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_WEAK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_cyan for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxCyanItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_underwater for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_UNDERWATER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:pirat_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PIRAT_HAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_dig for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_DIG. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_poison for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_POISON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:magician for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_MAGICIAN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_automaton_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_AUTOMATON_DIE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:analyzer_idle for public static fossilsarcheology.server.block.AnalyzerBlock fossilsarcheology.server.block.FABlockRegistry.ANALYZER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.puff for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_puff. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fire_swamp for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.fireSwamp. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_ring for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_ring. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_life_2 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_life_2. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_basic_energy for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BASIC_ENERGY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:arcane_technology for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.ARCANE_TECHNOLOGY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_christmas for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_CHRISTMAS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:torchberries for public static net.minecraft.item.Item twilightforest.item.TFItems.torchberries. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:farmer_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.FARMER_HAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_red for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxRedItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_basic_ratlantean for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BASIC_RATLANTEAN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:cooked_rat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.COOKED_RAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_aristocrat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ARISTOCRAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:spooky_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.spookyForest. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup thaumcraft:goggles for private static net.minecraft.item.Item vazkii.botania.common.crafting.recipe.HelmRevealingRecipe.goggles. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.generic.wings.flap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.generic_wing_flap. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:music_disc_living_mice for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.MUSIC_DISC_LIVING_MICE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_highlands for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.highlands. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:moonworm_queen for public static net.minecraft.item.Item twilightforest.item.TFItems.moonworm_queen. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_lake for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.tfLake. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:assorted_vegetables for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.ASSORTED_VEGETABLES. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_pelt for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_PELT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_clearing for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.clearing. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_void for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.VOID. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_forgotten_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.FORGOTTEN_HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:treacle for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.TREACLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_boots. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.aerwhale for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_aerwhale. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:fisherman_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.FISHERMAN_HAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:yeti_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.yeti_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dart_shooter.fire for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.dart_shooter_fire. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:idol_of_ratlantis for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.IDOL_OF_RATLANTIS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_toga for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_TOGA. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:firefly_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.fireflyForest. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_creative for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_CREATIVE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:piper_loop for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.PIPER_LOOP. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_nugget_ore for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_NUGGET_ORE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:armor_shard_cluster for public static net.minecraft.item.Item twilightforest.item.TFItems.armor_shard_cluster. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_psychic for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_PSYCHIC. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_ambient. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:lamp_of_cinders for public static net.minecraft.item.Item twilightforest.item.TFItems.lamp_of_cinders. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_scepter for public static net.minecraft.item.Item twilightforest.item.TFItems.twilight_scepter. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.labyrinth for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_labyrinth. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_breeding_lantern for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_BREEDING_LANTERN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:cheese_cannonball for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CHEESE_CANNONBALL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:amphora_vase for public static fossilsarcheology.server.block.AmphoraVaseBlock fossilsarcheology.server.block.FABlockRegistry.AMPHORA_VASE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_axe for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_axe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:milk_cauldron for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MILK_CAULDRON. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:slime_trail for public static fossilsarcheology.server.block.SlimeTrailBlock fossilsarcheology.server.block.FABlockRegistry.SLIME_TRAIL. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:living_mice for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.LIVING_MICE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:music_disc_mice_on_venus for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.MUSIC_DISC_MICE_ON_VENUS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_lumberjack for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_LUMBERJACK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mushroom_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.mushrooms. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_milker for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_MILKER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:turkey_cooked for public static its_meow.betteranimalsplus.common.item.ItemBlockSimple its_meow.betteranimalsplus.init.ModItems.TURKEY_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:worktable_idle for public static fossilsarcheology.server.block.WorktableBlock fossilsarcheology.server.block.FABlockRegistry.WORKTABLE_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_essence for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_ESSENCE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_ratinator for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_RATINATOR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_no_flute for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_NO_FLUTE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sifter_idle for public static fossilsarcheology.server.block.SifterBlock fossilsarcheology.server.block.FABlockRegistry.SIFTER_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_gray for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGrayItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_ingot for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_ingot. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_shovel for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_shovel. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.heavy for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_heavy. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_farmer for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_FARMER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ore_meter for public static net.minecraft.item.Item twilightforest.item.TFItems.ore_meter. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:meef_stroganoff for public static net.minecraft.item.Item twilightforest.item.TFItems.meef_stroganoff. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_bucket for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BUCKET. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:tower_key for public static net.minecraft.item.Item twilightforest.item.TFItems.tower_key. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_silver for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxSilverItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:potato_kinishes for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.POTATO_KNISHES. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_purple for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPurpleItemBlock. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_replanter for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_REPLANTER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:raven_feather for public static net.minecraft.item.Item twilightforest.item.TFItems.raven_feather. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:naga_scale for public static net.minecraft.item.Item twilightforest.item.TFItems.naga_scale. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:plague_doctorate for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PLAGUE_DOCTORATE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_crafting for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_CRAFTING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volute_vase for public static fossilsarcheology.server.block.VoluteVaseBlock fossilsarcheology.server.block.FABlockRegistry.VOLUTE_VASE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_attack. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_tnt_survivor for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_TNT_SURVIVOR. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_fez for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_FEZ. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.recording_892 for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_recording_892. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:highlands_center for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.highlandsCenter. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:instanced_zone for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.INSTANCED_ZONE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.valkyrie for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_valkyrie. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.giant_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:potion_effect_end for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.POTION_EFFECT_END. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_death. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:contaminated_food for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CONTAMINATED_FOOD. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dense_twilight_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.denseTwilightForest. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_pickaxe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:enchanted_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.enchantedForest. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_health for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_HEALTH. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:thornlands for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.thornlands. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_beans for public static net.minecraft.item.Item twilightforest.item.TFItems.magic_beans. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:turkey_raw for public static its_meow.betteranimalsplus.common.item.ItemBlockSimple its_meow.betteranimalsplus.init.ModItems.TURKEY_RAW. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_laser for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.LASER. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:lifedrain_scepter for public static net.minecraft.item.Item twilightforest.item.TFItems.lifedrain_scepter. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cube_talisman for public static net.minecraft.item.Item twilightforest.item.TFItems.cube_talisman. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_helmet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:purifying_liquid for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.PURIFYING_LIQUID. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:naga_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.naga_leggings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:glass_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.glass_sword. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:bubble_machine for public static fossilsarcheology.server.block.BubbleBlowerBlock fossilsarcheology.server.block.FABlockRegistry.BUBBLE_MACHINE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_speed for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_SPEED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:confit_byaldi for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CONFIT_BYALDI. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_flight for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_FLIGHT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.present_unwrap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.present_unwrap. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:chunky_cheese_token for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CHUNKY_CHEESE_TOKEN. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:blood_orb for private static net.minecraft.item.Item WayofTime.bloodmagic.core.registry.OrbRegistry.ORB_ITEM. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:raw_venison for public static net.minecraft.item.Item twilightforest.item.TFItems.raw_venison. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_spirit_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_SPIRIT_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_elite_energy for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_ELITE_ENERGY. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:feathery_wing for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.FEATHERY_WING. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:black_death_mask for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.BLACK_DEATH_MASK. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_hoe for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_hoe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_leggings. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:yeti_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.yeti_helmet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_hoe for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_hoe. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_ambient. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:cheese for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_map_focus for public static net.minecraft.item.Item twilightforest.item.TFItems.maze_map_focus. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_death. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_boots. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_chestplate. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_jury_rigged for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_JURY_RIGGED. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_raw for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_raw. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:phantom_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.phantom_helmet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_death. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_wood_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_WOOD_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_feral_bite for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_FERAL_BITE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ice_bow for public static net.minecraft.item.Item twilightforest.item.TFItems.ice_bow. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:santa_hat for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.SANTA_HAT. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:string_cheese for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.STRING_CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_upgrade_big_bucket for public static net.minecraft.item.Item com.github.alexthe666.rats.server.items.RatsItemRegistry.RAT_UPGRADE_BIG_BUCKET. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_helmet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ore_magnet for public static net.minecraft.item.Item twilightforest.item.TFItems.ore_magnet. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_ingot for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_ingot. This means the object wasn't registered. It's likely just mod options.
[23:31:48] [Server thread/INFO] [FML]: Holder lookups applied
[23:31:56] [Forge Version Check/DEBUG] [forge.VersionCheck]: Failed to process update information
java.net.ConnectException: Connection timed out (Connection timed out)
at java.net.PlainSocketImpl.socketConnect(Native Method) ~[?:1.8.0_312]
at java.net.AbstractPlainSocketImpl.doConnect(AbstractPlainSocketImpl.java:350) ~[?:1.8.0_312]
at java.net.AbstractPlainSocketImpl.connectToAddress(AbstractPlainSocketImpl.java:206) ~[?:1.8.0_312]
at java.net.AbstractPlainSocketImpl.connect(AbstractPlainSocketImpl.java:188) ~[?:1.8.0_312]
at java.net.SocksSocketImpl.connect(SocksSocketImpl.java:392) ~[?:1.8.0_312]
at java.net.Socket.connect(Socket.java:607) ~[?:1.8.0_312]
at sun.security.ssl.SSLSocketImpl.connect(SSLSocketImpl.java:288) ~[?:1.8.0_312]
at sun.security.ssl.BaseSSLSocketImpl.connect(BaseSSLSocketImpl.java:173) ~[?:1.8.0_312]
at sun.net.NetworkClient.doConnect(NetworkClient.java:180) ~[?:1.8.0_312]
at sun.net.www.http.HttpClient.openServer(HttpClient.java:463) ~[?:1.8.0_312]
at sun.net.www.http.HttpClient.openServer(HttpClient.java:558) ~[?:1.8.0_312]
at sun.net.www.protocol.https.HttpsClient.<init>(HttpsClient.java:264) ~[?:1.8.0_312]
at sun.net.www.protocol.https.HttpsClient.New(HttpsClient.java:367) ~[?:1.8.0_312]
at sun.net.www.protocol.https.AbstractDelegateHttpsURLConnection.getNewHttpClient(AbstractDelegateHttpsURLConnection.java:203) ~[?:1.8.0_312]
at sun.net.www.protocol.http.HttpURLConnection.plainConnect0(HttpURLConnection.java:1162) ~[?:1.8.0_312]
at sun.net.www.protocol.http.HttpURLConnection$6.run(HttpURLConnection.java:1046) ~[?:1.8.0_312]
at sun.net.www.protocol.http.HttpURLConnection$6.run(HttpURLConnection.java:1044) ~[?:1.8.0_312]
at java.security.AccessController.doPrivileged(Native Method) ~[?:1.8.0_312]
at java.security.AccessController.doPrivilegedWithCombiner(AccessController.java:784) ~[?:1.8.0_312]
at sun.net.www.protocol.http.HttpURLConnection.plainConnect(HttpURLConnection.java:1043) ~[?:1.8.0_312]
at sun.net.www.protocol.https.AbstractDelegateHttpsURLConnection.connect(AbstractDelegateHttpsURLConnection.java:189) ~[?:1.8.0_312]
at sun.net.www.protocol.http.HttpURLConnection.getInputStream0(HttpURLConnection.java:1567) ~[?:1.8.0_312]
at sun.net.www.protocol.http.HttpURLConnection.access$200(HttpURLConnection.java:92) ~[?:1.8.0_312]
at sun.net.www.protocol.http.HttpURLConnection$9.run(HttpURLConnection.java:1487) ~[?:1.8.0_312]
at sun.net.www.protocol.http.HttpURLConnection$9.run(HttpURLConnection.java:1485) ~[?:1.8.0_312]
at java.security.AccessController.doPrivileged(Native Method) ~[?:1.8.0_312]
at java.security.AccessController.doPrivilegedWithCombiner(AccessController.java:784) ~[?:1.8.0_312]
at sun.net.www.protocol.http.HttpURLConnection.getInputStream(HttpURLConnection.java:1484) ~[?:1.8.0_312]
at java.net.HttpURLConnection.getResponseCode(HttpURLConnection.java:480) ~[?:1.8.0_312]
at sun.net.www.protocol.https.HttpsURLConnectionImpl.getResponseCode(HttpsURLConnectionImpl.java:352) ~[?:1.8.0_312]
at net.minecraftforge.common.ForgeVersion$1.openUrlStream(ForgeVersion.java:223) ~[ForgeVersion$1.class:14.23.5.2860]
at net.minecraftforge.common.ForgeVersion$1.process(ForgeVersion.java:252) [ForgeVersion$1.class:14.23.5.2860]
at net.minecraftforge.common.ForgeVersion$1.run(ForgeVersion.java:201) [ForgeVersion$1.class:14.23.5.2860]
[23:31:56] [Server thread/INFO] [Chisel]: Loading items...
[23:31:56] [Server thread/INFO] [Chisel]: Skipping feature certus as its required mod appliedenergistics2 was missing.
[23:31:56] [Server thread/INFO] [Chisel]: 74 Feature's items loaded.
[23:32:01] [Server thread/INFO] [grimoireofgaia]: Registering item blocks...
[23:32:01] [Server thread/INFO] [grimoireofgaia]: Item block registration complete.
[23:32:01] [Server thread/INFO] [grimoireofgaia]: Registering items...
[23:32:04] [Server thread/INFO] [grimoireofgaia]: Item registration complete.
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.materials.barley' to list of materials
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.materials.barley_flour' to list of materials
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.materials.wheat_flour' to list of materials
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.materials.cotton' to list of materials
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.materials.sulfur_powder' to list of materials
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.materials.ghostwood_fletching' to list of materials
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.materials.imp_leather' to list of materials
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.materials.flame_string' to list of materials
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.materials.blue_dye' to list of materials
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.edibles.impmeat_raw' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.edibles.impmeat_cooked' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.edibles.raspberry' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.edibles.blueberry' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.edibles.blackberry' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.edibles.maloberry' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.edibles.blightberry' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.edibles.duskberry' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.edibles.skyberry' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.edibles.stingberry' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.edibles.potashapple' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.edibles.cactusjuice' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.soups.ghostwood_mushroomstew' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.soups.bloodwood_mushroomstew' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.soups.darkwood_mushroomstew' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.soups.fusewood_mushroomstew' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.soups.vanilla_glowshroomstew' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.soups.ghostwood_glowshroomstew' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.soups.bloodwood_glowshroomstew' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.soups.darkwood_glowshroomstew' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.soups.fusewood_glowshroomstew' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.soups.berry_medley' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_logs.maple' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_logs.silverbell' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_logs.amaranth' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_logs.tiger' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_logs2.willow' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_logs2.eucalyptus' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_logs2.hopseed' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_logs2.sakura' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.redwood_logs.bark' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.redwood_logs.heart' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.redwood_logs.root' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_sapling.maple' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_sapling.silverbell' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_sapling.amaranth' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_sapling.tiger' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_sapling2.willow' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_sapling2.eucalyptus' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_sapling2.hopseed' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.overworld_sapling2.sakura' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.redwood_sapling.redwood' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.barley_crop' to list of cropBlocks
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.cotton_crop' to list of cropBlocks
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.overworld_seeds.barley_seeds' to list of seeds
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.overworld_seeds.cotton_seeds' to list of seeds
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'item.natura.saguaro_fruit_item' to list of edibles
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.nether_logs.ghostwood' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.nether_logs.darkwood' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.nether_logs.fusewood' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.nether_logs2' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.nether_logs2' to list of logs
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.nether_sapling.ghostwood' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.nether_sapling.fusewood' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.nether_sapling.darkwood' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.nether_sapling2.bloodwood' to list of saplings
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.nether_glowshroom.green' to list of shrooms
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.nether_glowshroom.blue' to list of shrooms
[23:32:04] [Server thread/INFO] [forestry]: [PluginNatura] Adding 'tile.natura.nether_glowshroom.purple' to list of shrooms
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Core Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Core Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Core Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Core Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Climatology Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Climatology Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Climatology Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Climatology Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Backpack Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Backpack Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Backpack Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Backpack Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Apiculture Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Apiculture Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Apiculture Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Apiculture Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Database Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Database Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Database Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Database Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Energy Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Energy Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Energy Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Energy Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Greenhouse Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Greenhouse Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Greenhouse Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Greenhouse Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Farming Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Farming Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Farming Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Farming Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Crate Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Crate Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Crate Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Crate Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Cultivation Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Cultivation Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Cultivation Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Cultivation Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Worktable Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Worktable Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Worktable Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Worktable Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Book Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Book Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Book Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Book Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Fluids Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Fluids Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Fluids Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Fluids Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Food Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Food Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Food Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Food Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Factory Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Factory Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Factory Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Factory Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Charcoal Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Charcoal Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Charcoal Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Charcoal Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Sorting Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Sorting Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Sorting Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Sorting Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Arboriculture Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Arboriculture Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Arboriculture Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Arboriculture Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Lepidopterology Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Lepidopterology Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Lepidopterology Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Lepidopterology Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Mail Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Mail Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Mail Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Mail Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Natura Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Natura Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Natura Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Natura Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Roots Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Roots Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Roots Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Roots Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: Extra Utilities Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: Extra Utilities Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: Extra Utilities Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: Extra Utilities Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: BiomesOPlenty Module
[23:32:04] [Server thread/DEBUG] [forestry]: Could not find block biomesoplenty:sandstone
[23:32:04] [Server thread/WARN] [forestry]: Missing block: sandstone
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: BiomesOPlenty Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: BiomesOPlenty Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: BiomesOPlenty Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Start: HarvestCraft Module
[23:32:04] [Server thread/DEBUG] [forestry]: Backpacks Complete: HarvestCraft Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Start: HarvestCraft Module
[23:32:04] [Server thread/DEBUG] [forestry]: Crates Complete: HarvestCraft Module
[23:32:04] [Server thread/INFO] [FML]: Applying holder lookups
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:boost for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.BOOST. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:whirlwind for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.WHIRLWIND. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:planar_binding for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.PLANAR_BINDING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:soul_snare for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.SOUL_SNARE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:soul_fray for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.SOUL_FRAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:fire_fuse for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.FIRE_FUSE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:constrict for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.CONSTRICT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:plant_leech for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.PLANT_LEECH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:deafness for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.DEAFNESS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:bounce for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.BOUNCE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:cling for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.CLING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:sacrificial_lamb for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.SACRIFICIAL_LAMB. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:flight for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.FLIGHT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:grounded for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.GROUNDED. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:heavy_heart for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.HEAVY_HEART. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:suspended for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.SUSPENDED. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:feathered for public static net.minecraft.potion.Potion WayofTime.bloodmagic.core.RegistrarBloodMagic.FEATHERED. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:venison_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.VENISON_RAW. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:venison_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.VENISON_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:hirschgeist_skull_wearable for public static its_meow.betteranimalsplus.common.item.ItemHirschgeistSkullWearable its_meow.betteranimalsplus.init.ModItems.HIRSCHGEIST_SKULL_WEARABLE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goat_milk for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.GOAT_MILK. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goat_cheese for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.GOAT_CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.PHEASANT_RAW. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.PHEASANT_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:book_buff for public static net.minecraft.item.Item gaia.init.GaiaItems.BOOK_BUFF. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_item for public static net.minecraft.item.Item gaia.init.GaiaItems.DEBUG_ITEM. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_weapon for public static net.minecraft.item.Item gaia.init.GaiaItems.DEBUG_WEAPON. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:passive_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.PASSIVE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:passive_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.PASSIVE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:passive_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.PASSIVE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:assist_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ASSIST_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:assist_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ASSIST_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:assist_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ASSIST_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:aggressive_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.AGGRESSIVE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:aggressive_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.AGGRESSIVE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:aggressive_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.AGGRESSIVE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DEBUG_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DEBUG_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DEBUG_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ant_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANT_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ant_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ant_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_male_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_MALE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_male_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_MALE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:anubis_male_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANUBIS_MALE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:arachne_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ARACHNE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:arachne_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ARACHNE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:arachne_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ARACHNE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:banshee_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BANSHEE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:banshee_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BANSHEE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:banshee_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BANSHEE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:baphomet_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BAPHOMET_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:baphomet_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BAPHOMET_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:baphomet_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BAPHOMET_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bee_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bee_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bee_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:beholder_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEHOLDER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:beholder_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEHOLDER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:beholder_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BEHOLDER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cecaelia_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CECAELIA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cecaelia_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CECAELIA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cecaelia_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CECAELIA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_male_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_MALE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_male_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_MALE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:centaur_male_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CENTAUR_MALE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cyclops_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CYCLOPS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cyclops_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CYCLOPS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:cyclops_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CYCLOPS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dhampir_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DHAMPIR_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dhampir_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DHAMPIR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dhampir_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DHAMPIR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dryad_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DRYAD_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dryad_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DRYAD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dryad_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DRYAD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dullahan_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DULLAHAN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dullahan_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DULLAHAN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dullahan_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DULLAHAN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dwarf_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DWARF_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dwarf_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DWARF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:dwarf_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.DWARF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:goblin_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GOBLIN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:goblin_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GOBLIN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:goblin_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GOBLIN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gorgon_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GORGON_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gorgon_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GORGON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gorgon_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GORGON_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gryphon_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GRYPHON_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gryphon_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GRYPHON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:gryphon_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.GRYPHON_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_wizard_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_WIZARD_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_wizard_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_WIZARD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:harpy_wizard_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HARPY_WIZARD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:hunter_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HUNTER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:hunter_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HUNTER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:hunter_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HUNTER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kikimora_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KIKIMORA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kikimora_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KIKIMORA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kikimora_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KIKIMORA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kobold_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KOBOLD_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kobold_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KOBOLD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:kobold_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.KOBOLD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mandragora_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MANDRAGORA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mandragora_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MANDRAGORA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mandragora_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MANDRAGORA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mandragora_scream for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MANDRAGORA_SCREAM. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:matango_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MATANGO_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:matango_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MATANGO_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:matango_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MATANGO_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mermaid_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MERMAID_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mermaid_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MERMAID_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mermaid_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MERMAID_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaur_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAUR_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaur_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAUR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaur_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAUR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaurus_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAURUS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaurus_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAURUS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:minotaurus_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MINOTAURUS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mummy_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MUMMY_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mummy_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MUMMY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:mummy_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.MUMMY_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:naga_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NAGA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:naga_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NAGA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:naga_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NAGA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ninetails_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NINETAILS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ninetails_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NINETAILS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:ninetails_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NINETAILS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:oni_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ONI_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:oni_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ONI_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:oni_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ONI_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:orc_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ORC_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:orc_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ORC_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:orc_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ORC_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:satyress_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SATYRESS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:satyress_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SATYRESS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:satyress_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SATYRESS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:selkie_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SELKIE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:selkie_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SELKIE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:selkie_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SELKIE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shaman_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHAMAN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shaman_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHAMAN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:shaman_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHAMAN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sharko_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHARKO_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sharko_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHARKO_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sharko_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SHARKO_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:siren_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SIREN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:siren_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SIREN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:siren_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SIREN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sludgegirl_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLUDGEGIRL_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sludgegirl_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLUDGEGIRL_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sludgegirl_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLUDGEGIRL_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sphinx_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPHINX_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sphinx_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPHINX_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:sphinx_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPHINX_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spriggan_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPRIGGAN_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spriggan_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPRIGGAN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:spriggan_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SPRIGGAN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_male_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_MALE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_male_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_MALE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:succubus_male_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SUCCUBUS_MALE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:toad_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TOAD_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:toad_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TOAD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:toad_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TOAD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:valkyrie_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VALKYRIE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:valkyrie_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VALKYRIE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:valkyrie_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VALKYRIE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:vampire_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VAMPIRE_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:vampire_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VAMPIRE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:vampire_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.VAMPIRE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:werecat_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERECAT_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:werecat_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERECAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:werecat_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERECAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:witch_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WITCH_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:witch_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WITCH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:witch_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WITCH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yeti_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YETI_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yeti_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YETI_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yeti_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YETI_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yukionna_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YUKIONNA_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yukionna_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YUKIONNA_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:yukionna_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.YUKIONNA_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:holstaurus_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HOLSTAURUS_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:holstaurus_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HOLSTAURUS_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:holstaurus_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.HOLSTAURUS_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:trader_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TRADER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:trader_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TRADER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:trader_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.TRADER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weresheep_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERESHEEP_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weresheep_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERESHEEP_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:weresheep_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.WERESHEEP_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:creepergirl_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CREEPERGIRL_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:creepergirl_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CREEPERGIRL_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:creepergirl_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.CREEPERGIRL_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:endergirl_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ENDERGIRL_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:endergirl_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ENDERGIRL_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:endergirl_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ENDERGIRL_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:slimegirl_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLIMEGIRL_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:slimegirl_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLIMEGIRL_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:slimegirl_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.SLIMEGIRL_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:step_sandals for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.STEP_SANDALS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:step_webbed for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.STEP_WEBBED. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_open_1 for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOX_OPEN_1. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_open_2 for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOX_OPEN_2. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:bag_open for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BAG_OPEN. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:book_hit for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOOK_HIT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:none for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.NONE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_DIE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_ambient. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_poop for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_POOP. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:kylix_vase for public static fossilsarcheology.server.block.KylixVaseBlock fossilsarcheology.server.block.FABlockRegistry.KYLIX_VASE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:potion_effect_begin for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.POTION_EFFECT_BEGIN. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_flute for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_FLUTE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_plague for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_PLAGUE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_stream for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.stream. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:frosted for public static net.minecraft.potion.Potion twilightforest.potions.TFPotions.frosty. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:apprentice for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_APPRENTICE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_glacier for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.glacier. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:deep_mushroom_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.deepMushrooms. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_hurt. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.light for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_light. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_ambient. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volcanic_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.VOLCANIC_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.hum for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_hum. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_spirit_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_SPIRIT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.moa for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_moa. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_bricks for public static fossilsarcheology.server.block.AncientStonebrickBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_BRICK. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_hurt. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_hurt. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_hurt. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_automaton_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_AUTOMATON_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:skull for public static fossilsarcheology.server.block.SkullBlock fossilsarcheology.server.block.FABlockRegistry.SKULL_BLOCK. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_summon for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_SUMMON. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_arctic_peaks for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.ARCTIC_PEAKS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_ambient. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_ambient. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.darkForest. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.snow.wind for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_snow_wind. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_death. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_trap for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RAT_TRAP. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_automaton_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_AUTOMATON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dungeon.container.smash for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.break_labyrinth_container. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_ambient. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:culture_vat_idle for public static fossilsarcheology.server.block.CultivateBlock fossilsarcheology.server.block.FABlockRegistry.CULTIVATE_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:block.aercloud.bounce for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aercloud_bounce. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.lift for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_lift. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_death. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:mice_on_venus for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.MICE_ON_VENUS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:black_death_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.BLACK_DEATH_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_death. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.angry for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_angry. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_hurt. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ferns for public static fossilsarcheology.server.block.FernsBlock fossilsarcheology.server.block.FABlockRegistry.FERNS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:transcendent for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_TRANSCENDENT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_death. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:culture_vat_active for public static fossilsarcheology.server.block.CultivateBlock fossilsarcheology.server.block.FABlockRegistry.CULTIVATE_ACTIVEE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.electric_shock for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_electric_shock. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_flute_no_funny for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_FLUTE_NO_FUNNY. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:black_death_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.BLACK_DEATH_DIE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:dillhoffia for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.DILLHOFFIA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_forest_center for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.darkForestCenter. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_DIE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:oak_savannah for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.oakSavanna. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.twilightForest. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:master for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_MASTER. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:archmage for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_ARCHMAGE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:neoratlantean_loop for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.NEORATLANTEAN_LOOP. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_ambient. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_irradiated_forests for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.IRRADIATED_FORESTS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_santa for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_SANTA. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_ambient. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_spirit_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_SPIRIT_DIE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.trigger for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_trigger. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_swamp for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.tfSwamp. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.labyrinth_totem.drone for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.labyrinth_totem_drone. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_magnetic_hills for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.MAGNETIC_HILLS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_hurt. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_hurt. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:cheese_cauldron for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.CHEESE_CAULDRON. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:black_death_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.BLACK_DEATH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:snowy_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.snowy_forest. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_attack. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.travel for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_travel. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:weak for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_WEAK. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_dig for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_DIG. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:magician for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_MAGICIAN. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_automaton_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_AUTOMATON_DIE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:analyzer_idle for public static fossilsarcheology.server.block.AnalyzerBlock fossilsarcheology.server.block.FABlockRegistry.ANALYZER. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.puff for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_puff. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fire_swamp for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.fireSwamp. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:spooky_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.spookyForest. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.generic.wings.flap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.generic_wing_flap. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_highlands for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.highlands. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_lake for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.tfLake. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_clearing for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.clearing. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_void for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.VOID. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_forgotten_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.FORGOTTEN_HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.aerwhale for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_aerwhale. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dart_shooter.fire for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.dart_shooter_fire. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:firefly_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.fireflyForest. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:piper_loop for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.PIPER_LOOP. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_ambient. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.labyrinth for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_labyrinth. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:amphora_vase for public static fossilsarcheology.server.block.AmphoraVaseBlock fossilsarcheology.server.block.FABlockRegistry.AMPHORA_VASE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:milk_cauldron for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MILK_CAULDRON. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:slime_trail for public static fossilsarcheology.server.block.SlimeTrailBlock fossilsarcheology.server.block.FABlockRegistry.SLIME_TRAIL. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:living_mice for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.LIVING_MICE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mushroom_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.mushrooms. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:worktable_idle for public static fossilsarcheology.server.block.WorktableBlock fossilsarcheology.server.block.FABlockRegistry.WORKTABLE_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sifter_idle for public static fossilsarcheology.server.block.SifterBlock fossilsarcheology.server.block.FABlockRegistry.SIFTER_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.heavy for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_heavy. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volute_vase for public static fossilsarcheology.server.block.VoluteVaseBlock fossilsarcheology.server.block.FABlockRegistry.VOLUTE_VASE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_attack. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.recording_892 for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_recording_892. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:highlands_center for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.highlandsCenter. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:instanced_zone for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.INSTANCED_ZONE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.valkyrie for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_valkyrie. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:potion_effect_end for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.POTION_EFFECT_END. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_death. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dense_twilight_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.denseTwilightForest. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:enchanted_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.enchantedForest. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:thornlands for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.thornlands. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_laser for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.LASER. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:bubble_machine for public static fossilsarcheology.server.block.BubbleBlowerBlock fossilsarcheology.server.block.FABlockRegistry.BUBBLE_MACHINE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.present_unwrap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.present_unwrap. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup rats:ratlantean_spirit_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.rats.server.misc.RatsSoundRegistry.RATLANTEAN_SPIRIT_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_ambient. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_death. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_death. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_wood_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_WOOD_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:04] [Server thread/INFO] [FML]: Holder lookups applied
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity CultistPortalGreater as thaumcraft:cultistportalgreater
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity CultistPortalLesser as thaumcraft:cultistportallesser
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity FluxRift as thaumcraft:fluxrift
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity SpecialItem as thaumcraft:specialitem
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity FollowItem as thaumcraft:followitem
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity FallingTaint as thaumcraft:fallingtaint
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity Alumentum as thaumcraft:alumentum
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity GolemDart as thaumcraft:golemdart
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity EldritchOrb as thaumcraft:eldritchorb
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity BottleTaint as thaumcraft:bottletaint
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity GolemOrb as thaumcraft:golemorb
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity Grapple as thaumcraft:grapple
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity CausalityCollapser as thaumcraft:causalitycollapser
[23:32:12] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity FocusProjectile as thaumcraft:focusprojectile
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity FocusCloud as thaumcraft:focuscloud
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity Focusmine as thaumcraft:focusmine
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity TurretBasic as thaumcraft:turretbasic
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity TurretAdvanced as thaumcraft:turretadvanced
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity ArcaneBore as thaumcraft:arcanebore
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity Golem as thaumcraft:golem
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity EldritchWarden as thaumcraft:eldritchwarden
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity EldritchGolem as thaumcraft:eldritchgolem
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity CultistLeader as thaumcraft:cultistleader
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity TaintacleGiant as thaumcraft:taintaclegiant
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity BrainyZombie as thaumcraft:brainyzombie
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity GiantBrainyZombie as thaumcraft:giantbrainyzombie
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity Wisp as thaumcraft:wisp
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity Firebat as thaumcraft:firebat
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity Spellbat as thaumcraft:spellbat
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity Pech as thaumcraft:pech
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity MindSpider as thaumcraft:mindspider
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity EldritchGuardian as thaumcraft:eldritchguardian
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity CultistKnight as thaumcraft:cultistknight
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity CultistCleric as thaumcraft:cultistcleric
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity EldritchCrab as thaumcraft:eldritchcrab
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity InhabitedZombie as thaumcraft:inhabitedzombie
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity ThaumSlime as thaumcraft:thaumslime
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity TaintCrawler as thaumcraft:taintcrawler
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity Taintacle as thaumcraft:taintacle
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity TaintacleTiny as thaumcraft:taintacletiny
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity TaintSwarm as thaumcraft:taintswarm
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity TaintSeed as thaumcraft:taintseed
[23:32:13] [Server thread/TRACE] [FML]: Automatically registered mod thaumcraft entity TaintSeedPrime as thaumcraft:taintseedprime
[23:32:15] [Server thread/INFO] [mocreatures]: Registering entities...
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:manticorepet as mocreatures:manticorepet
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:petscorpion as mocreatures:petscorpion
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:egg as mocreatures:egg
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:kittybed as mocreatures:kittybed
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:litterbox as mocreatures:litterbox
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:trock as mocreatures:trock
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:bird as mocreatures:bird
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:blackbear as mocreatures:blackbear
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:boar as mocreatures:boar
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:bunny as mocreatures:bunny
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:crocodile as mocreatures:crocodile
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:duck as mocreatures:duck
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:deer as mocreatures:deer
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:elephant as mocreatures:elephant
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:ent as mocreatures:ent
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:fox as mocreatures:fox
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:goat as mocreatures:goat
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:grizzlybear as mocreatures:grizzlybear
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:kitty as mocreatures:kitty
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:komododragon as mocreatures:komododragon
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:leoger as mocreatures:leoger
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:leopard as mocreatures:leopard
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:liard as mocreatures:liard
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:lion as mocreatures:lion
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:liger as mocreatures:liger
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:lither as mocreatures:lither
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:mole as mocreatures:mole
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:mouse as mocreatures:mouse
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:ostrich as mocreatures:ostrich
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:pandabear as mocreatures:pandabear
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:panthard as mocreatures:panthard
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:panther as mocreatures:panther
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:panthger as mocreatures:panthger
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:wildpolarbear as mocreatures:wildpolarbear
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:raccoon as mocreatures:raccoon
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:snake as mocreatures:snake
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:tiger as mocreatures:tiger
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:turtle as mocreatures:turtle
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:turkey as mocreatures:turkey
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:wildhorse as mocreatures:wildhorse
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:wyvern as mocreatures:wyvern
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:caveogre as mocreatures:caveogre
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:flamewraith as mocreatures:flamewraith
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:fireogre as mocreatures:fireogre
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:greenogre as mocreatures:greenogre
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:biggolem as mocreatures:biggolem
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:horsemob as mocreatures:horsemob
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:hellrat as mocreatures:hellrat
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:manticore as mocreatures:manticore
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:minigolem as mocreatures:minigolem
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:rat as mocreatures:rat
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:silverskeleton as mocreatures:silverskeleton
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:scorpion as mocreatures:scorpion
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:werewolf as mocreatures:werewolf
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:wraith as mocreatures:wraith
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:wwolf as mocreatures:wwolf
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:anchovy as mocreatures:anchovy
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:angelfish as mocreatures:angelfish
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:angler as mocreatures:angler
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:bass as mocreatures:bass
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:clownfish as mocreatures:clownfish
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:cod as mocreatures:cod
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:dolphin as mocreatures:dolphin
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:fishy as mocreatures:fishy
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:goldfish as mocreatures:goldfish
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:hippotang as mocreatures:hippotang
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:jellyfish as mocreatures:jellyfish
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:manderin as mocreatures:manderin
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:piranha as mocreatures:piranha
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:salmon as mocreatures:salmon
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:mantaray as mocreatures:mantaray
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:shark as mocreatures:shark
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:stingray as mocreatures:stingray
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:ant as mocreatures:ant
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:bee as mocreatures:bee
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:butterfly as mocreatures:butterfly
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:crab as mocreatures:crab
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:cricket as mocreatures:cricket
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:dragonfly as mocreatures:dragonfly
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:firefly as mocreatures:firefly
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:fly as mocreatures:fly
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:maggot as mocreatures:maggot
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:snail as mocreatures:snail
[23:32:18] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:roach as mocreatures:roach
[23:32:18] [Server thread/INFO] [mocreatures]: Entity registration complete.
[23:32:21] [Server thread/TRACE] [FML]: Automatically registered mod tconstruct entity tconstruct.blueslime as tconstruct:blueslime
[23:32:21] [Server thread/TRACE] [FML]: Automatically registered mod tconstruct entity Indestructible Item as tconstruct:indestructible
[23:32:21] [Server thread/TRACE] [FML]: Automatically registered mod tconstruct entity arrow as tconstruct:arrow
[23:32:21] [Server thread/TRACE] [FML]: Automatically registered mod tconstruct entity bolt as tconstruct:bolt
[23:32:21] [Server thread/TRACE] [FML]: Automatically registered mod tconstruct entity shuriken as tconstruct:shuriken
[23:32:21] [Server thread/TRACE] [FML]: Automatically registered mod tconstruct entity Fancy Item Frame as tconstruct:fancy_frame
[23:32:21] [Server thread/TRACE] [FML]: Automatically registered mod tconstruct entity Throwball as tconstruct:throwball
[23:32:21] [Server thread/TRACE] [FML]: Automatically registered mod natura entity imp as natura:imp
[23:32:21] [Server thread/TRACE] [FML]: Automatically registered mod natura entity nitrocreeper as natura:nitrocreeper
[23:32:21] [Server thread/INFO] [grimoireofgaia]: Registering entities...
[23:32:24] [Server thread/INFO] [grimoireofgaia]: Entity registration complete.
[23:32:27] [Server thread/INFO] [grimoireofgaia]: Registering Sounds
[23:32:27] [Server thread/INFO] [grimoireofgaia]: Sounds Finished
[23:32:29] [Server thread/INFO] [FML]: Applying holder lookups
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:venison_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.VENISON_RAW. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:venison_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.VENISON_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:hirschgeist_skull_wearable for public static its_meow.betteranimalsplus.common.item.ItemHirschgeistSkullWearable its_meow.betteranimalsplus.init.ModItems.HIRSCHGEIST_SKULL_WEARABLE. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goat_milk for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.GOAT_MILK. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goat_cheese for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.GOAT_CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.PHEASANT_RAW. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.PHEASANT_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:book_buff for public static net.minecraft.item.Item gaia.init.GaiaItems.BOOK_BUFF. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_item for public static net.minecraft.item.Item gaia.init.GaiaItems.DEBUG_ITEM. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_weapon for public static net.minecraft.item.Item gaia.init.GaiaItems.DEBUG_WEAPON. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_open_1 for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOX_OPEN_1. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_open_2 for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOX_OPEN_2. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup fossil:kylix_vase for public static fossilsarcheology.server.block.KylixVaseBlock fossilsarcheology.server.block.FABlockRegistry.KYLIX_VASE. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:29] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volcanic_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.VOLCANIC_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_bricks for public static fossilsarcheology.server.block.AncientStonebrickBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_BRICK. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:skull for public static fossilsarcheology.server.block.SkullBlock fossilsarcheology.server.block.FABlockRegistry.SKULL_BLOCK. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_trap for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RAT_TRAP. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:culture_vat_idle for public static fossilsarcheology.server.block.CultivateBlock fossilsarcheology.server.block.FABlockRegistry.CULTIVATE_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ferns for public static fossilsarcheology.server.block.FernsBlock fossilsarcheology.server.block.FABlockRegistry.FERNS. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:transcendent for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_TRANSCENDENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:culture_vat_active for public static fossilsarcheology.server.block.CultivateBlock fossilsarcheology.server.block.FABlockRegistry.CULTIVATE_ACTIVEE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:dillhoffia for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.DILLHOFFIA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup rats:cheese_cauldron for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.CHEESE_CAULDRON. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:analyzer_idle for public static fossilsarcheology.server.block.AnalyzerBlock fossilsarcheology.server.block.FABlockRegistry.ANALYZER. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:amphora_vase for public static fossilsarcheology.server.block.AmphoraVaseBlock fossilsarcheology.server.block.FABlockRegistry.AMPHORA_VASE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup rats:milk_cauldron for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MILK_CAULDRON. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:slime_trail for public static fossilsarcheology.server.block.SlimeTrailBlock fossilsarcheology.server.block.FABlockRegistry.SLIME_TRAIL. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:worktable_idle for public static fossilsarcheology.server.block.WorktableBlock fossilsarcheology.server.block.FABlockRegistry.WORKTABLE_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sifter_idle for public static fossilsarcheology.server.block.SifterBlock fossilsarcheology.server.block.FABlockRegistry.SIFTER_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volute_vase for public static fossilsarcheology.server.block.VoluteVaseBlock fossilsarcheology.server.block.FABlockRegistry.VOLUTE_VASE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:bubble_machine for public static fossilsarcheology.server.block.BubbleBlowerBlock fossilsarcheology.server.block.FABlockRegistry.BUBBLE_MACHINE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_wood_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_WOOD_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/INFO] [FML]: Holder lookups applied
[23:32:30] [Server thread/INFO] [FML]: Applying holder lookups
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:venison_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.VENISON_RAW. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:venison_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.VENISON_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:hirschgeist_skull_wearable for public static its_meow.betteranimalsplus.common.item.ItemHirschgeistSkullWearable its_meow.betteranimalsplus.init.ModItems.HIRSCHGEIST_SKULL_WEARABLE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goat_milk for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.GOAT_MILK. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goat_cheese for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.GOAT_CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.PHEASANT_RAW. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.PHEASANT_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:book_buff for public static net.minecraft.item.Item gaia.init.GaiaItems.BOOK_BUFF. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_item for public static net.minecraft.item.Item gaia.init.GaiaItems.DEBUG_ITEM. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_weapon for public static net.minecraft.item.Item gaia.init.GaiaItems.DEBUG_WEAPON. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_open_1 for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOX_OPEN_1. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_open_2 for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOX_OPEN_2. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:kylix_vase for public static fossilsarcheology.server.block.KylixVaseBlock fossilsarcheology.server.block.FABlockRegistry.KYLIX_VASE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volcanic_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.VOLCANIC_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_bricks for public static fossilsarcheology.server.block.AncientStonebrickBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_BRICK. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:skull for public static fossilsarcheology.server.block.SkullBlock fossilsarcheology.server.block.FABlockRegistry.SKULL_BLOCK. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_trap for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RAT_TRAP. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:culture_vat_idle for public static fossilsarcheology.server.block.CultivateBlock fossilsarcheology.server.block.FABlockRegistry.CULTIVATE_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ferns for public static fossilsarcheology.server.block.FernsBlock fossilsarcheology.server.block.FABlockRegistry.FERNS. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:transcendent for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_TRANSCENDENT. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:culture_vat_active for public static fossilsarcheology.server.block.CultivateBlock fossilsarcheology.server.block.FABlockRegistry.CULTIVATE_ACTIVEE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:dillhoffia for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.DILLHOFFIA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup rats:cheese_cauldron for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.CHEESE_CAULDRON. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:analyzer_idle for public static fossilsarcheology.server.block.AnalyzerBlock fossilsarcheology.server.block.FABlockRegistry.ANALYZER. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:amphora_vase for public static fossilsarcheology.server.block.AmphoraVaseBlock fossilsarcheology.server.block.FABlockRegistry.AMPHORA_VASE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup rats:milk_cauldron for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MILK_CAULDRON. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:slime_trail for public static fossilsarcheology.server.block.SlimeTrailBlock fossilsarcheology.server.block.FABlockRegistry.SLIME_TRAIL. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:worktable_idle for public static fossilsarcheology.server.block.WorktableBlock fossilsarcheology.server.block.FABlockRegistry.WORKTABLE_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sifter_idle for public static fossilsarcheology.server.block.SifterBlock fossilsarcheology.server.block.FABlockRegistry.SIFTER_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volute_vase for public static fossilsarcheology.server.block.VoluteVaseBlock fossilsarcheology.server.block.FABlockRegistry.VOLUTE_VASE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:bubble_machine for public static fossilsarcheology.server.block.BubbleBlowerBlock fossilsarcheology.server.block.FABlockRegistry.BUBBLE_MACHINE. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_wood_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_WOOD_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:32:30] [Server thread/INFO] [FML]: Holder lookups applied
[23:32:30] [Server thread/INFO] [FML]: Injecting itemstacks
[23:32:30] [Server thread/TRACE] [FML]: Unable to find item with name techreborn:rubber_sapling
[23:32:30] [Server thread/TRACE] [FML]: Unable to find item with name techreborn:rubber_log
[23:32:30] [Server thread/INFO] [FML]: Itemstack injection complete
[23:32:30] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Loading properties
[23:32:30] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Default game type: SURVIVAL
[23:32:30] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Generating keypair
[23:32:30] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Starting Minecraft server on *:12944
[23:32:30] [Server thread/INFO] [net.minecraft.network.NetworkSystem]: Using epoll channel type
[23:32:30] [Server thread/WARN] [net.minecraft.server.dedicated.DedicatedServer]: **** SERVER IS RUNNING IN OFFLINE/INSECURE MODE!
[23:32:30] [Server thread/WARN] [net.minecraft.server.dedicated.DedicatedServer]: The server will make no attempt to authenticate usernames. Beware.
[23:32:30] [Server thread/WARN] [net.minecraft.server.dedicated.DedicatedServer]: While this makes the game possible to play without internet access, it also opens up the ability for hackers to connect with any username they choose.
[23:32:30] [Server thread/WARN] [net.minecraft.server.dedicated.DedicatedServer]: To change this, set "online-mode" to "true" in the server.properties file.
[23:32:30] [Server thread/DEBUG] [RandomThingsCore]: Found PlayerInteractionManager Class: net/minecraft/server/management/PlayerInteractionManager
[23:32:30] [Server thread/DEBUG] [RandomThingsCore]: - Found tryHarvestBlock
[23:32:37] [Server thread/ERROR] [FML]: Parsing error loading recipe bibliocraft:markerpole
com.google.gson.JsonSyntaxException: Invalid pattern: empty pattern not allowed
at net.minecraftforge.common.crafting.CraftingHelper.lambda$init$14(CraftingHelper.java:488) ~[CraftingHelper.class:?]
at net.minecraftforge.common.crafting.CraftingHelper.getRecipe(CraftingHelper.java:416) ~[CraftingHelper.class:?]
at net.minecraftforge.common.crafting.CraftingHelper.lambda$loadRecipes$22(CraftingHelper.java:723) ~[CraftingHelper.class:?]
at net.minecraftforge.common.crafting.CraftingHelper.findFiles(CraftingHelper.java:833) ~[CraftingHelper.class:?]
at net.minecraftforge.common.crafting.CraftingHelper.loadRecipes(CraftingHelper.java:688) ~[CraftingHelper.class:?]
at java.util.ArrayList.forEach(ArrayList.java:1259) [?:1.8.0_312]
at net.minecraftforge.common.crafting.CraftingHelper.loadRecipes(CraftingHelper.java:633) [CraftingHelper.class:?]
at net.minecraftforge.fml.common.Loader.initializeMods(Loader.java:747) [Loader.class:?]
at net.minecraftforge.fml.server.FMLServerHandler.finishServerLoading(FMLServerHandler.java:108) [FMLServerHandler.class:?]
at net.minecraftforge.fml.common.FMLCommonHandler.onServerStarted(FMLCommonHandler.java:338) [FMLCommonHandler.class:?]
at net.minecraft.server.dedicated.DedicatedServer.func_71197_b(DedicatedServer.java:219) [nz.class:?]
at net.minecraft.server.MinecraftServer.run(MinecraftServer.java:486) [MinecraftServer.class:?]
at java.lang.Thread.run(Thread.java:748) [?:1.8.0_312]
[23:32:37] [Server thread/ERROR] [FML]: Parsing error loading recipe bibliocraft:clipboard
com.google.gson.JsonSyntaxException: Invalid pattern: empty pattern not allowed
at net.minecraftforge.common.crafting.CraftingHelper.lambda$init$14(CraftingHelper.java:488) ~[CraftingHelper.class:?]
at net.minecraftforge.common.crafting.CraftingHelper.getRecipe(CraftingHelper.java:416) ~[CraftingHelper.class:?]
at net.minecraftforge.common.crafting.CraftingHelper.lambda$loadRecipes$22(CraftingHelper.java:723) ~[CraftingHelper.class:?]
at net.minecraftforge.common.crafting.CraftingHelper.findFiles(CraftingHelper.java:833) ~[CraftingHelper.class:?]
at net.minecraftforge.common.crafting.CraftingHelper.loadRecipes(CraftingHelper.java:688) ~[CraftingHelper.class:?]
at java.util.ArrayList.forEach(ArrayList.java:1259) [?:1.8.0_312]
at net.minecraftforge.common.crafting.CraftingHelper.loadRecipes(CraftingHelper.java:633) [CraftingHelper.class:?]
at net.minecraftforge.fml.common.Loader.initializeMods(Loader.java:747) [Loader.class:?]
at net.minecraftforge.fml.server.FMLServerHandler.finishServerLoading(FMLServerHandler.java:108) [FMLServerHandler.class:?]
at net.minecraftforge.fml.common.FMLCommonHandler.onServerStarted(FMLCommonHandler.java:338) [FMLCommonHandler.class:?]
at net.minecraft.server.dedicated.DedicatedServer.func_71197_b(DedicatedServer.java:219) [nz.class:?]
at net.minecraft.server.MinecraftServer.run(MinecraftServer.java:486) [MinecraftServer.class:?]
at java.lang.Thread.run(Thread.java:748) [?:1.8.0_312]
[23:32:51] [Server thread/INFO] [THAUMCRAFT]: Checking for mod & oredict compatibilities
[23:32:51] [Server thread/INFO] [THAUMCRAFT]: Adding entities to MFR safari net blacklist.
[23:32:55] [Server thread/INFO] [Chisel]: Loading recipes...
[23:32:55] [Server thread/INFO] [Chisel]: Skipping feature certus as its required mod appliedenergistics2 was missing.
[23:32:55] [Server thread/INFO] [Chisel]: 74 Feature's recipes loaded.
[23:32:55] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `slime`, expected `tconstruct`. This could be a intended override, but in most cases indicates a broken mod.
[23:32:55] [Server thread/DEBUG] [tconstruct-IMC]: Added integration smelting for Platinum from thermalfoundation
[23:32:55] [Server thread/DEBUG] [tconstruct-IMC]: Added integration smelting for Iridium from thermalfoundation
[23:32:55] [Server thread/DEBUG] [tconstruct-IMC]: Added integration smelting for Invar from thermalfoundation
[23:32:55] [Server thread/DEBUG] [tconstruct-IMC]: Added integration smelting for Constantan from thermalfoundation
[23:32:55] [Server thread/DEBUG] [tconstruct-IMC]: Added integration smelting for Signalum from thermalfoundation
[23:32:55] [Server thread/DEBUG] [tconstruct-IMC]: Added integration smelting for Lumium from thermalfoundation
[23:32:55] [Server thread/DEBUG] [tconstruct-IMC]: Added integration smelting for Enderium from thermalfoundation
[23:32:55] [Server thread/INFO] [grimoireofgaia]: Registering recipes...
[23:32:55] [Server thread/INFO] [grimoireofgaia]: Recipe registration complete.
[23:32:55] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `bread`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:32:55] [Server thread/WARN] [FML]: Unable to find recipe for minecraft:rabbit_stew
[23:32:55] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `beetroot_soup`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:32:55] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `mushroom_stew`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:32:55] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cookie`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:32:57] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pumpkin_pie`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:32:57] [Server thread/WARN] [FML]: Unable to find recipe for minecraft:baked_potato
[23:33:06] [Server thread/INFO] [FML]: Applying holder lookups
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:venison_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.VENISON_RAW. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:venison_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.VENISON_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:hirschgeist_skull_wearable for public static its_meow.betteranimalsplus.common.item.ItemHirschgeistSkullWearable its_meow.betteranimalsplus.init.ModItems.HIRSCHGEIST_SKULL_WEARABLE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goat_milk for public static net.minecraft.item.Item its_meow.betteranimalsplus.init.ModItems.GOAT_MILK. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:goat_cheese for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.GOAT_CHEESE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_raw for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.PHEASANT_RAW. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup betteranimalsplus:pheasant_cooked for public static its_meow.betteranimalsplus.common.item.ItemBetterFood its_meow.betteranimalsplus.init.ModItems.PHEASANT_COOKED. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:book_buff for public static net.minecraft.item.Item gaia.init.GaiaItems.BOOK_BUFF. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_item for public static net.minecraft.item.Item gaia.init.GaiaItems.DEBUG_ITEM. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:debug_weapon for public static net.minecraft.item.Item gaia.init.GaiaItems.DEBUG_WEAPON. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_say for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_SAY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_hurt for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:antranger_death for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.ANTRANGER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_open_1 for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOX_OPEN_1. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup grimoireofgaia:box_open_2 for public static net.minecraft.util.SoundEvent gaia.init.GaiaSounds.BOX_OPEN_2. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:kylix_vase for public static fossilsarcheology.server.block.KylixVaseBlock fossilsarcheology.server.block.FABlockRegistry.KYLIX_VASE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volcanic_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.VOLCANIC_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_bricks for public static fossilsarcheology.server.block.AncientStonebrickBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_BRICK. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:skull for public static fossilsarcheology.server.block.SkullBlock fossilsarcheology.server.block.FABlockRegistry.SKULL_BLOCK. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup rats:rat_trap for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.RAT_TRAP. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:culture_vat_idle for public static fossilsarcheology.server.block.CultivateBlock fossilsarcheology.server.block.FABlockRegistry.CULTIVATE_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ferns for public static fossilsarcheology.server.block.FernsBlock fossilsarcheology.server.block.FABlockRegistry.FERNS. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup bloodmagic:transcendent for public static WayofTime.bloodmagic.orb.BloodOrb WayofTime.bloodmagic.core.RegistrarBloodMagic.ORB_TRANSCENDENT. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:culture_vat_active for public static fossilsarcheology.server.block.CultivateBlock fossilsarcheology.server.block.FABlockRegistry.CULTIVATE_ACTIVEE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:dillhoffia for public static fossilsarcheology.server.block.ShortFlowerBlock fossilsarcheology.server.block.FABlockRegistry.DILLHOFFIA_FLOWER. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup rats:cheese_cauldron for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.CHEESE_CAULDRON. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:analyzer_idle for public static fossilsarcheology.server.block.AnalyzerBlock fossilsarcheology.server.block.FABlockRegistry.ANALYZER. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:amphora_vase for public static fossilsarcheology.server.block.AmphoraVaseBlock fossilsarcheology.server.block.FABlockRegistry.AMPHORA_VASE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup rats:milk_cauldron for public static net.minecraft.block.Block com.github.alexthe666.rats.server.blocks.RatsBlockRegistry.MILK_CAULDRON. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:slime_trail for public static fossilsarcheology.server.block.SlimeTrailBlock fossilsarcheology.server.block.FABlockRegistry.SLIME_TRAIL. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sigillaria_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.SIGILLARIA_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:worktable_idle for public static fossilsarcheology.server.block.WorktableBlock fossilsarcheology.server.block.FABlockRegistry.WORKTABLE_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:sifter_idle for public static fossilsarcheology.server.block.SifterBlock fossilsarcheology.server.block.FABlockRegistry.SIFTER_IDLE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:volute_vase for public static fossilsarcheology.server.block.VoluteVaseBlock fossilsarcheology.server.block.FABlockRegistry.VOLUTE_VASE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:bubble_machine for public static fossilsarcheology.server.block.BubbleBlowerBlock fossilsarcheology.server.block.FABlockRegistry.BUBBLE_MACHINE. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:cordaites_planks_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.CORDAITES_PLANKS_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:calamites_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.CALAMITES_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:palm_planks_stairs for public static fossilsarcheology.server.block.FossilStairsBlock fossilsarcheology.server.block.FABlockRegistry.PALM_PLANKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_wood_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_WOOD_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/DEBUG] [FML]: Unable to lookup fossil:ancient_stone_double_slab for public static fossilsarcheology.server.block.FossilSlabBlock fossilsarcheology.server.block.FABlockRegistry.ANCIENT_STONE_DOUBLESLAB. This means the object wasn't registered. It's likely just mod options.
[23:33:06] [Server thread/INFO] [FML]: Holder lookups applied
[23:33:06] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod minecraft
[23:33:06] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod minecraft
[23:33:06] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Minecraft took 0.000s
[23:33:06] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod mcp
[23:33:06] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod mcp
[23:33:06] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Minecraft Coder Pack took 0.000s
[23:33:06] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod FML
[23:33:06] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod FML
[23:33:06] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Forge Mod Loader took 0.000s
[23:33:06] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod forge
[23:33:06] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod forge
[23:33:06] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Minecraft Forge took 0.000s
[23:33:06] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod orbis-lib
[23:33:06] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod orbis-lib
[23:33:06] [Server thread/DEBUG] [FML]: Bar Step: Initialization - OrbisLib took 0.010s
[23:33:06] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod aether
[23:33:06] [Server thread/DEBUG] [AetherII]: 'Initialize blocks' completed in 0ms
[23:33:09] [Server thread/DEBUG] [AetherII]: 'Initialize equipment' completed in 2612ms
[23:33:09] [Server thread/DEBUG] [AetherII]: 'Initialize capabilities' completed in 74ms
[23:33:11] [Server thread/DEBUG] [AetherII]: 'Initialize templates' completed in 2538ms
[23:33:11] [Server thread/DEBUG] [AetherII]: 'Initialize recipes' completed in 20ms
[23:33:11] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod aether
[23:33:11] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Aether II took 5.302s
[23:33:11] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod baubles
[23:33:11] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod baubles
[23:33:11] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Baubles took 0.000s
[23:33:11] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod astralsorcery
[23:33:11] [Server thread/INFO] [Astral Sorcery]: Ignoring fluid crystaloil for rarity registry - it doesn't exist in the current environment
[23:33:11] [Server thread/INFO] [Astral Sorcery]: Ignoring fluid empoweredoil for rarity registry - it doesn't exist in the current environment
[23:33:11] [Server thread/INFO] [Astral Sorcery]: Ignoring fluid fluidoil for rarity registry - it doesn't exist in the current environment
[23:33:11] [Server thread/INFO] [Astral Sorcery]: Ignoring fluid fluidnitrodiesel for rarity registry - it doesn't exist in the current environment
[23:33:11] [Server thread/INFO] [Astral Sorcery]: Ignoring fluid ic2uu_matter for rarity registry - it doesn't exist in the current environment
[23:33:11] [Server thread/INFO] [Astral Sorcery]: Ignoring fluid ic2biomass for rarity registry - it doesn't exist in the current environment
[23:33:11] [Server thread/INFO] [Astral Sorcery]: Ignoring fluid ic2biogas for rarity registry - it doesn't exist in the current environment
[23:33:11] [Server thread/INFO] [Astral Sorcery]: Ignoring fluid nacre for rarity registry - it doesn't exist in the current environment
[23:33:11] [Server thread/INFO] [Astral Sorcery]: Ignoring amulet enchantment 'cofhcore:holding' as it's prone to cause issues.
[23:33:21] [AstralSorcery Patreon Effect Loader/WARN] [Astral Sorcery]: Skipped 4 patreon effects during loading due to malformed data!
[23:33:21] [AstralSorcery Patreon Effect Loader/INFO] [Astral Sorcery]: Patreon effect loading finished.
[23:33:24] [Server thread/INFO] [Astral Sorcery]: Loaded OAK of minecraft into tree registry.
[23:33:24] [Server thread/INFO] [Astral Sorcery]: Loaded SPRUCE of minecraft into tree registry.
[23:33:24] [Server thread/INFO] [Astral Sorcery]: Loaded BIRCH of minecraft into tree registry.
[23:33:24] [Server thread/INFO] [Astral Sorcery]: Loaded JUNGLE of minecraft into tree registry.
[23:33:24] [Server thread/INFO] [Astral Sorcery]: Loaded ACACIA of minecraft into tree registry.
[23:33:24] [Server thread/INFO] [Astral Sorcery]: Loaded DARK_OAK of minecraft into tree registry.
[23:33:24] [Server thread/INFO] [Astral Sorcery]: Loaded SLIME of tconstruct into tree registry.
[23:33:24] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod astralsorcery
[23:33:24] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Astral Sorcery took 12.559s
[23:33:24] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod quark
[23:33:24] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod quark
[23:33:24] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Quark took 0.059s
[23:33:24] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod autoreglib
[23:33:24] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod autoreglib
[23:33:24] [Server thread/DEBUG] [FML]: Bar Step: Initialization - AutoRegLib took 0.000s
[23:33:24] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod thaumcraft
[23:33:26] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into thaumcraft for type INSTANCE
[23:33:26] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod thaumcraft
[23:33:26] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Thaumcraft took 2.532s
[23:33:26] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod botania
[23:33:29] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod botania
[23:33:29] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Botania took 2.851s
[23:33:29] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod patchouli
[23:33:32] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod patchouli
[23:33:32] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Patchouli took 2.781s
[23:33:32] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod betteranimalsplus
[23:33:32] [Server thread/INFO] [FML]: Ignored smelting recipe with conflicting input: 1xitem.egg@0 = 1xitem.betteranimalsplus.fried_egg@0
[23:33:32] [Server thread/INFO] [betteranimalsplus]: Overspawning lammergeiers...
[23:33:32] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod betteranimalsplus
[23:33:32] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Better Animals Plus took 0.031s
[23:33:32] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod bewitchment
[23:33:32] [Server thread/INFO] [Bewitchment]: It's a fact, she is exactly that!
[23:33:32] [Server thread/INFO] [Bewitchment]: A harbinger of death from the world of witchcraft,
[23:33:32] [Server thread/INFO] [Bewitchment]: And she's feeding them cakes and her ale to this innocent boy,
[23:33:32] [Server thread/INFO] [Bewitchment]: And her magic brings dismay!
[23:33:32] [Server thread/INFO] [Bewitchment]: I hear her in the wind, the bane of our town
[23:33:32] [Server thread/INFO] [Bewitchment]: Come with me, father, I'm to expose a heathen
[23:33:32] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `tippedarrow`, expected `bewitchment`. This could be a intended override, but in most cases indicates a broken mod.
[23:33:32] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod bewitchment
[23:33:32] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Bewitchment took 0.067s
[23:33:32] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod bibliocraft
[23:33:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod bibliocraft
[23:33:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - BiblioCraft took 2.522s
[23:33:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod biomesoplenty
[23:33:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod biomesoplenty
[23:33:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Biomes O' Plenty took 0.000s
[23:33:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod guideapi
[23:33:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod guideapi
[23:33:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Guide-API took 0.000s
[23:33:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod bloodmagic
[23:33:37] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod bloodmagic
[23:33:37] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Blood Magic: Alchemical Wizardry took 2.587s
[23:33:37] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod bloodmoon
[23:33:37] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod bloodmoon
[23:33:37] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Bloodmoon took 0.000s
[23:33:37] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod codechickenlib
[23:33:37] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod codechickenlib
[23:33:37] [Server thread/DEBUG] [FML]: Bar Step: Initialization - CodeChicken Lib took 0.000s
[23:33:37] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod redstoneflux
[23:33:37] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod redstoneflux
[23:33:37] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Redstone Flux took 0.000s
[23:33:37] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod brandonscore
[23:33:37] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod brandonscore
[23:33:37] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Brandon's Core took 0.000s
[23:33:37] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod mysticalworld
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod mysticalworld
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Mystical World took 2.340s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod chisel
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod chisel
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Chisel took 0.002s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod cofhcore
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod cofhcore
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - CoFH Core took 0.002s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod cofhworld
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod cofhworld
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - CoFH World took 0.000s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod craftstudioapi
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod craftstudioapi
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - CraftStudio API took 0.000s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod customspawner
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod customspawner
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - DrZhark's CustomSpawner took 0.003s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod props
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod props
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Decocraft took 0.005s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod mocreatures
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod mocreatures
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - DrZhark's Mo'Creatures Mod took 0.002s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod mantle
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod mantle
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Mantle took 0.000s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod twilightforest
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod twilightforest
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - The Twilight Forest took 0.062s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod tconstruct
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod tconstruct
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Tinkers' Construct took 0.010s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod extrautils2
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod extrautils2
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Extra Utilities 2 took 0.013s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod natura
[23:33:40] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod natura
[23:33:40] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Natura took 0.001s
[23:33:40] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod forestry
[23:33:40] [Server thread/DEBUG] [forestry]: Init Start: Core Module
[23:33:40] [Server thread/DEBUG] [forestry]: Init Complete: Core Module
[23:33:40] [Server thread/DEBUG] [forestry]: Init Start: Climatology Module
[23:33:40] [Server thread/DEBUG] [forestry]: Init Complete: Climatology Module
[23:33:40] [Server thread/DEBUG] [forestry]: Init Start: Backpack Module
[23:33:40] [Server thread/DEBUG] [forestry]: Init Complete: Backpack Module
[23:33:40] [Server thread/DEBUG] [forestry]: Init Start: Apiculture Module
[23:33:40] [Server thread/DEBUG] [forestry]: Beekeeping mode read from config: NORMAL
[23:33:42] [Server thread/TRACE] [FML]: Automatically registered mod forestry entity cart.beehouse as forestry:cart.beehouse
[23:33:42] [Server thread/DEBUG] [forestry]: Registered entity cart.beehouse (class forestry.apiculture.entities.EntityMinecartBeehouse) with id 1.
[23:33:42] [Server thread/TRACE] [FML]: Automatically registered mod forestry entity cart.apiary as forestry:cart.apiary
[23:33:42] [Server thread/DEBUG] [forestry]: Registered entity cart.apiary (class forestry.apiculture.entities.EntityMinecartApiary) with id 2.
[23:33:45] [Server thread/DEBUG] [forestry]: Init Complete: Apiculture Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Start: Database Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Complete: Database Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Start: Energy Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Complete: Energy Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Start: Greenhouse Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Complete: Greenhouse Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Start: Farming Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Complete: Farming Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Start: Crate Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Complete: Crate Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Start: Cultivation Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Complete: Cultivation Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Start: Worktable Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Complete: Worktable Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Start: Book Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Complete: Book Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Start: Fluids Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Complete: Fluids Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Start: Food Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Complete: Food Module
[23:33:45] [Server thread/DEBUG] [forestry]: Init Start: Factory Module
[23:33:49] [Server thread/DEBUG] [forestry]: Init Complete: Factory Module
[23:33:49] [Server thread/DEBUG] [forestry]: Init Start: Charcoal Module
[23:33:49] [Server thread/DEBUG] [forestry]: Init Complete: Charcoal Module
[23:33:49] [Server thread/DEBUG] [forestry]: Init Start: Sorting Module
[23:33:49] [Server thread/DEBUG] [forestry]: Init Complete: Sorting Module
[23:33:49] [Server thread/DEBUG] [forestry]: Init Start: Arboriculture Module
[23:33:51] [Server thread/DEBUG] [forestry]: Init Complete: Arboriculture Module
[23:33:51] [Server thread/DEBUG] [forestry]: Init Start: Lepidopterology Module
[23:33:51] [Server thread/TRACE] [FML]: Automatically registered mod forestry entity butterflyGE as forestry:butterflyge
[23:33:51] [Server thread/DEBUG] [forestry]: Registered entity butterflyGE (class forestry.lepidopterology.entities.EntityButterfly) with id 0.
[23:33:51] [Server thread/DEBUG] [forestry]: Init Complete: Lepidopterology Module
[23:33:51] [Server thread/DEBUG] [forestry]: Init Start: Mail Module
[23:33:51] [Server thread/DEBUG] [forestry]: Init Complete: Mail Module
[23:33:51] [Server thread/DEBUG] [forestry]: Init Start: Natura Module
[23:33:51] [Server thread/INFO] [forestry]: [PluginNatura] Addding crop '1xtile.natura.barley_crop@0'
[23:33:51] [Server thread/INFO] [forestry]: [PluginNatura] Addding crop '1xtile.natura.cotton_crop@0'
[23:33:51] [Server thread/DEBUG] [forestry]: Init Complete: Natura Module
[23:33:51] [Server thread/DEBUG] [forestry]: Init Start: Roots Module
[23:33:51] [Server thread/DEBUG] [forestry]: Could not find item roots:moontinged_seed
[23:33:51] [Server thread/DEBUG] [forestry]: Could not find block roots:moonglow
[23:33:51] [Server thread/DEBUG] [forestry]: Could not find item roots:terra_moss_spore
[23:33:51] [Server thread/DEBUG] [forestry]: Could not find block roots:terra_moss
[23:33:51] [Server thread/DEBUG] [forestry]: Could not find item roots:terra_moss_ball
[23:33:51] [Server thread/DEBUG] [forestry]: Could not find item roots:aubergine_seeds
[23:33:51] [Server thread/DEBUG] [forestry]: Could not find block roots:aubergine
[23:33:51] [Server thread/DEBUG] [forestry]: Could not find item roots:aubergine_item
[23:33:51] [Server thread/DEBUG] [forestry]: Init Complete: Roots Module
[23:33:51] [Server thread/DEBUG] [forestry]: Init Start: Extra Utilities Module
[23:33:51] [Server thread/DEBUG] [forestry]: Init Complete: Extra Utilities Module
[23:33:51] [Server thread/DEBUG] [forestry]: Init Start: BiomesOPlenty Module
[23:33:51] [Server thread/DEBUG] [forestry]: Could not find item biomesoplenty:persommon
[23:33:51] [Server thread/DEBUG] [forestry]: Init Complete: BiomesOPlenty Module
[23:33:51] [Server thread/DEBUG] [forestry]: Init Start: HarvestCraft Module
[23:33:51] [Server thread/DEBUG] [forestry]: Init Complete: HarvestCraft Module
[23:33:51] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod forestry
[23:33:51] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Forestry took 11.610s
[23:33:51] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod llibrary
[23:33:51] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod llibrary
[23:33:51] [Server thread/DEBUG] [FML]: Bar Step: Initialization - LLibrary took 0.000s
[23:33:51] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod fossil
[23:33:54] [Server thread/INFO] [FML]: Ignored smelting recipe with conflicting input: 1xitem.egg@32767 = 1xitem.cooked_egg@0
[23:33:54] [Server thread/INFO] [fossils]: After a billion years
[23:33:54] [Server thread/INFO] [fossils]: The show is still here
[23:33:54] [Server thread/INFO] [fossils]: Not a single one of your fathers died young
[23:33:54] [Server thread/INFO] [fossils]: The handy travelers out of Africa
[23:33:54] [Server thread/INFO] [fossils]: Little Lucy of the Afar
[23:33:54] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod fossil
[23:33:54] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Fossils and Archeology Revival took 2.369s
[23:33:54] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod ftblib
[23:33:54] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod ftblib
[23:33:54] [Server thread/DEBUG] [FML]: Bar Step: Initialization - FTB Library took 0.000s
[23:33:54] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod itemfilters
[23:33:54] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod itemfilters
[23:33:54] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Item Filters took 0.000s
[23:33:54] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod ftbquests
[23:33:54] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod ftbquests
[23:33:54] [Server thread/DEBUG] [FML]: Bar Step: Initialization - FTB Quests took 0.000s
[23:33:54] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod ftbmoney
[23:33:54] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod ftbmoney
[23:33:54] [Server thread/DEBUG] [FML]: Bar Step: Initialization - FTB Money took 0.000s
[23:33:54] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod grimoireofgaia
[23:33:54] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod grimoireofgaia
[23:33:54] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Grimoire of Gaia 3 took 0.009s
[23:33:54] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod ichunutil
[23:33:54] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod ichunutil
[23:33:54] [Server thread/DEBUG] [FML]: Bar Step: Initialization - iChunUtil took 0.002s
[23:33:54] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod hats
[23:33:54] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod hats
[23:33:54] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Hats took 0.000s
[23:33:54] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod ironchest
[23:33:54] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod ironchest
[23:33:54] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Iron Chest took 0.014s
[23:33:54] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod journeymap
[23:33:56] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod journeymap
[23:33:56] [Server thread/DEBUG] [FML]: Bar Step: Initialization - JourneyMap took 2.768s
[23:33:56] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod lootbagmod
[23:33:56] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod lootbagmod
[23:33:56] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Loot Bag Mod took 0.001s
[23:33:56] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod morph
[23:33:56] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod morph
[23:33:56] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Morph took 0.000s
[23:33:56] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod harvestcraft
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:ocean;OCEAN;0.5;false;false;false;[WATER, OCEAN]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:plains;MEDIUM;0.8;false;false;false;[PLAINS]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:desert;WARM;2.0;false;false;false;[DRY, SANDY, HOT]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:extreme_hills;MEDIUM;0.2;false;false;false;[HILLS, MOUNTAIN]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:forest;MEDIUM;0.7;false;false;false;[FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:taiga;MEDIUM;0.25;false;false;false;[COLD, CONIFEROUS, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:swampland;MEDIUM;0.8;true;false;false;[WET, SWAMP]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:river;MEDIUM;0.5;false;false;false;[WATER, RIVER]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:hell;WARM;2.0;false;false;false;[DRY, HOT, NETHER]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:sky;MEDIUM;0.5;false;false;false;[DRY, COLD, END]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:frozen_ocean;OCEAN;0.0;false;false;true;[COLD, WATER, OCEAN, SNOWY]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:frozen_river;COLD;0.0;false;false;true;[COLD, WATER, RIVER, SNOWY]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:ice_flats;COLD;0.0;false;false;true;[COLD, SNOWY, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:ice_mountains;COLD;0.0;false;false;true;[MOUNTAIN, COLD, SNOWY]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mushroom_island;MEDIUM;0.9;true;false;false;[MUSHROOM, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mushroom_island_shore;MEDIUM;0.9;true;false;false;[BEACH, MUSHROOM, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:beaches;MEDIUM;0.8;false;false;false;[BEACH]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:desert_hills;WARM;2.0;false;false;false;[DRY, HILLS, SANDY, HOT]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:forest_hills;MEDIUM;0.7;false;false;false;[HILLS, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:taiga_hills;MEDIUM;0.25;false;false;false;[HILLS, COLD, CONIFEROUS, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:smaller_extreme_hills;MEDIUM;0.2;false;false;false;[MOUNTAIN]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:jungle;MEDIUM;0.95;true;false;false;[WET, HOT, JUNGLE, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:jungle_hills;MEDIUM;0.95;true;false;false;[HILLS, WET, HOT, JUNGLE, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:jungle_edge;MEDIUM;0.95;false;false;false;[WET, HOT, JUNGLE, RARE, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:deep_ocean;OCEAN;0.5;false;false;false;[WATER, OCEAN]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:stone_beach;MEDIUM;0.2;false;false;false;[BEACH]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:cold_beach;COLD;0.05;false;false;true;[BEACH, COLD, SNOWY]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:birch_forest;MEDIUM;0.6;false;false;false;[FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:birch_forest_hills;MEDIUM;0.6;false;false;false;[HILLS, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:roofed_forest;MEDIUM;0.7;false;false;false;[SPOOKY, DENSE, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:taiga_cold;COLD;-0.5;false;false;true;[COLD, CONIFEROUS, SNOWY, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:taiga_cold_hills;COLD;-0.5;false;false;true;[HILLS, COLD, CONIFEROUS, SNOWY, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:redwood_taiga;MEDIUM;0.3;false;false;false;[COLD, CONIFEROUS, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:redwood_taiga_hills;MEDIUM;0.3;false;false;false;[HILLS, COLD, CONIFEROUS, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:extreme_hills_with_trees;MEDIUM;0.2;false;false;false;[MOUNTAIN, SPARSE, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:savanna;WARM;1.2;false;false;false;[SAVANNA, HOT, SPARSE, PLAINS]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:savanna_rock;WARM;1.0;false;false;false;[SAVANNA, HOT, SPARSE, PLAINS, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mesa;WARM;2.0;false;false;false;[DRY, SANDY, MESA]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mesa_rock;WARM;2.0;false;false;false;[DRY, SANDY, SPARSE, MESA]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mesa_clear_rock;WARM;2.0;false;false;false;[DRY, SANDY, MESA]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:void;MEDIUM;0.5;false;false;false;[VOID]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_plains;MEDIUM;0.8;false;true;false;[PLAINS, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_desert;WARM;2.0;false;true;false;[DRY, SANDY, HOT, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_extreme_hills;MEDIUM;0.2;false;true;false;[MOUNTAIN, SPARSE, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_forest;MEDIUM;0.7;false;true;false;[HILLS, RARE, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_taiga;MEDIUM;0.25;false;true;false;[MOUNTAIN, COLD, CONIFEROUS, RARE, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_swampland;MEDIUM;0.8;true;true;false;[HILLS, WET, RARE, SWAMP]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_ice_flats;COLD;0.0;false;true;true;[HILLS, COLD, RARE, SNOWY]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_jungle;MEDIUM;0.95;true;true;false;[MOUNTAIN, WET, HOT, JUNGLE, RARE, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_jungle_edge;MEDIUM;0.95;false;true;false;[HILLS, HOT, SPARSE, JUNGLE, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_birch_forest;MEDIUM;0.6;false;true;false;[HILLS, RARE, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_birch_forest_hills;MEDIUM;0.6;false;true;false;[MOUNTAIN, RARE, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_roofed_forest;MEDIUM;0.7;false;true;false;[SPOOKY, MOUNTAIN, RARE, DENSE, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_taiga_cold;COLD;-0.5;false;true;true;[MOUNTAIN, COLD, CONIFEROUS, RARE, SNOWY, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_redwood_taiga;MEDIUM;0.25;false;true;false;[RARE, DENSE, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_redwood_taiga_hills;MEDIUM;0.25;false;true;false;[HILLS, RARE, DENSE, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_extreme_hills_with_trees;MEDIUM;0.2;false;true;false;[MOUNTAIN, SPARSE, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_savanna;WARM;1.1;false;true;false;[DRY, SAVANNA, MOUNTAIN, HOT, SPARSE, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_savanna_rock;WARM;1.0;false;true;false;[DRY, SAVANNA, HILLS, HOT, SPARSE, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_mesa;WARM;2.0;false;true;false;[DRY, MOUNTAIN, HOT, SPARSE, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_mesa_rock;WARM;2.0;false;true;false;[DRY, HILLS, HOT, SPARSE, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: minecraft:mutated_mesa_clear_rock;WARM;2.0;false;true;false;[DRY, MOUNTAIN, HOT, SPARSE, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:gravel_beach;MEDIUM;0.6;false;false;false;[BEACH]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:white_beach;WARM;1.0;true;false;false;[BEACH]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:origin_beach;MEDIUM;0.6;false;false;false;[BEACH, RARE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:alps;COLD;-0.25;false;false;true;[DRY, MOUNTAIN, COLD, SNOWY]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:bamboo_forest;MEDIUM;0.9;false;false;false;[WET, JUNGLE, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:bayou;MEDIUM;0.95;true;false;false;[WET, HOT, SWAMP, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:bog;MEDIUM;0.5;true;false;false;[COLD, WET, SWAMP, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:boreal_forest;MEDIUM;0.3;false;false;false;[HILLS, COLD, CONIFEROUS, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:brushland;WARM;1.5;false;false;false;[SAVANNA, DRY, HOT, SPARSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:chaparral;MEDIUM;0.8;false;false;false;[DRY, PLAINS]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:cherry_blossom_grove;MEDIUM;0.55;false;false;false;[LUSH, WET, MAGICAL, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:cold_desert;MEDIUM;0.2;false;false;false;[DRY, COLD, SNOWY]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:coniferous_forest;MEDIUM;0.45;false;false;false;[COLD, CONIFEROUS, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:crag;MEDIUM;0.5;false;false;false;[DRY, HILLS, MOUNTAIN, COLD, MAGICAL, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:dead_forest;MEDIUM;0.3;false;false;false;[DRY, COLD, SPARSE, DEAD, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:dead_swamp;MEDIUM;0.6;true;false;false;[SPOOKY, COLD, WET, SPARSE, DEAD, SWAMP]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:eucalyptus_forest;MEDIUM;0.95;true;false;false;[LUSH, WET, JUNGLE, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:fen;MEDIUM;0.4;false;false;false;[COLD, WET, DEAD, SWAMP, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:flower_field;MEDIUM;0.7;false;false;false;[LUSH, PLAINS]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:grassland;MEDIUM;0.6;false;false;false;[HILLS, WET, PLAINS]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:grove;MEDIUM;0.6;false;false;false;[LUSH, WET, SPARSE, PLAINS, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:highland;MEDIUM;0.6;false;false;false;[HILLS, MOUNTAIN, WET]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:land_of_lakes;MEDIUM;0.5;true;false;false;[WET, SWAMP, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:lavender_fields;MEDIUM;0.7;false;false;false;[LUSH, PLAINS, MAGICAL]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:lush_desert;WARM;1.2;false;false;false;[SAVANNA, DRY, SANDY, LUSH, HOT, SPARSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:lush_swamp;MEDIUM;0.7;true;false;false;[LUSH, WET, SWAMP, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:mangrove;MEDIUM;0.85;false;false;false;[LUSH, WATER, WET, SWAMP, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:maple_woods;MEDIUM;0.25;false;false;false;[COLD, CONIFEROUS, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:marsh;MEDIUM;0.6;false;false;false;[LUSH, WET]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:meadow;MEDIUM;0.4;false;false;false;[LUSH, COLD, WET, SPARSE, PLAINS, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:moor;MEDIUM;0.6;true;false;false;[HILLS, WET, SWAMP]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:mountain;MEDIUM;0.5;false;false;false;[DRY, MOUNTAIN, SPARSE, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:mystic_grove;MEDIUM;0.7;false;false;false;[LUSH, WET, MAGICAL, RARE, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:ominous_woods;MEDIUM;0.6;false;false;false;[SPOOKY, WET, DEAD, MAGICAL, RARE, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:orchard;MEDIUM;0.7;false;false;false;[LUSH, PLAINS, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:outback;WARM;2.0;false;false;false;[SAVANNA, DRY, SANDY, HOT, SPARSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:overgrown_cliffs;MEDIUM;0.95;false;false;false;[HILLS, MOUNTAIN, LUSH, WET, JUNGLE, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:prairie;MEDIUM;0.8;false;false;false;[DRY, SPARSE, PLAINS]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:quagmire;MEDIUM;0.6;true;false;false;[WET, DEAD, SWAMP, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:rainforest;MEDIUM;0.95;true;false;false;[HILLS, LUSH, WET, JUNGLE, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:redwood_forest;MEDIUM;0.7;false;false;false;[FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:sacred_springs;MEDIUM;0.85;true;false;false;[LUSH, WET, MAGICAL, JUNGLE, RARE, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:seasonal_forest;MEDIUM;0.4;false;false;false;[COLD, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:shield;MEDIUM;0.4;false;false;false;[COLD, WET, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:shrubland;MEDIUM;0.6;false;false;false;[DRY, SPARSE, PLAINS]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:snowy_coniferous_forest;COLD;-0.25;false;false;true;[COLD, CONIFEROUS, SNOWY, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:snowy_forest;COLD;-0.25;false;false;true;[COLD, WET, SPARSE, SNOWY, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:steppe;MEDIUM;0.75;false;false;false;[DRY, SANDY, PLAINS]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:temperate_rainforest;MEDIUM;0.75;true;false;false;[LUSH, WET, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:tropical_rainforest;WARM;1.0;true;false;false;[LUSH, WET, HOT, JUNGLE, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:tundra;MEDIUM;0.2;false;false;false;[COLD, WET, SPARSE, DEAD, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:wasteland;WARM;2.0;false;false;false;[DRY, SPARSE, DEAD, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:wetland;MEDIUM;0.6;false;false;false;[LUSH, WET, SWAMP, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:woodland;MEDIUM;0.7;false;false;false;[DRY, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:xeric_shrubland;WARM;1.75;false;false;false;[SAVANNA, DRY, SANDY, LUSH, HOT, SPARSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:alps_foothills;COLD;-0.25;false;false;true;[DRY, MOUNTAIN, COLD, SPARSE, SNOWY, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:mountain_foothills;MEDIUM;0.5;false;false;false;[DRY, HILLS, MOUNTAIN, SPARSE, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:redwood_forest_edge;MEDIUM;0.7;false;false;false;[FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:pasture;MEDIUM;0.8;false;false;false;[DRY, SPARSE, PLAINS]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:glacier;COLD;-0.5;false;false;false;[COLD, SNOWY, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:oasis;WARM;2.0;false;false;false;[SANDY, LUSH, WET, HOT, SPARSE, JUNGLE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:snowy_tundra;COLD;0.0;false;false;false;[COLD, WET, SPARSE, DEAD, SNOWY, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:coral_reef;MEDIUM;0.5;false;false;false;[WATER, OCEAN]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:kelp_forest;MEDIUM;0.5;false;false;false;[WATER, OCEAN]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:origin_island;MEDIUM;0.6;false;false;false;[WATER, RARE, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:tropical_island;MEDIUM;0.95;true;false;false;[LUSH, WATER, WET, JUNGLE, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:volcanic_island;WARM;1.2;false;false;false;[DRY, MOUNTAIN, WATER, HOT, DEAD, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:flower_island;MEDIUM;0.8;false;false;false;[LUSH, WATER, PLAINS, MAGICAL, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:corrupted_sands;WARM;2.0;false;false;false;[DRY, SANDY, HOT, NETHER, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:fungi_forest;WARM;2.0;false;false;false;[MUSHROOM, HOT, NETHER, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:phantasmagoric_inferno;WARM;2.0;false;false;false;[DRY, SPOOKY, HOT, NETHER, MAGICAL, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:undergarden;WARM;2.0;false;false;false;[LUSH, HOT, NETHER]
[23:33:56] [Server thread/INFO] [harvestcraft]: biomesoplenty:visceral_heap;WARM;2.0;false;false;false;[WET, HOT, NETHER]
[23:33:56] [Server thread/INFO] [harvestcraft]: randomthings:spectral;MEDIUM;0.2;false;false;false;[MAGICAL]
[23:33:56] [Server thread/INFO] [harvestcraft]: aether:aether_highlands;MEDIUM;0.5;false;false;false;[PLAINS]
[23:33:56] [Server thread/INFO] [harvestcraft]: aether:aether_magnetic_hills;MEDIUM;0.5;false;false;false;[HILLS, HOT, SPARSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: aether:aether_arctic_peaks;COLD;0.0;false;false;true;[MOUNTAIN, COLD, SNOWY, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: aether:aether_forgotten_highlands;COLD;0.0;false;false;false;[DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: aether:aether_irradiated_forests;COLD;0.0;false;false;false;[HOT, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: aether:aether_void;MEDIUM;0.5;false;false;false;[VOID]
[23:33:56] [Server thread/INFO] [harvestcraft]: aether:instanced_zone;MEDIUM;0.5;false;false;false;[VOID]
[23:33:56] [Server thread/INFO] [harvestcraft]: thaumcraft:magical_forest;MEDIUM;0.8;false;false;false;[MAGICAL, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: thaumcraft:eerie;MEDIUM;0.8;false;false;false;[SPOOKY, MAGICAL]
[23:33:56] [Server thread/INFO] [harvestcraft]: thaumcraft:eldritch;MEDIUM;0.8;false;false;false;[SPOOKY, MAGICAL, END]
[23:33:56] [Server thread/INFO] [harvestcraft]: mocreatures:wyvernbiome;MEDIUM;0.5;false;false;false;[END, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:twilight_lake;MEDIUM;0.66;true;false;false;[WATER, OCEAN, TWILIGHT]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:twilight_forest;MEDIUM;0.5;false;false;false;[TWILIGHT, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:dense_twilight_forest;MEDIUM;0.7;false;false;false;[TWILIGHT, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:twilight_highlands;MEDIUM;0.4;false;false;false;[MOUNTAIN, CONIFEROUS, TWILIGHT, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:mushroom_forest;MEDIUM;0.8;false;false;false;[MUSHROOM, TWILIGHT, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:twilight_swamp;MEDIUM;0.8;true;false;false;[WET, SWAMP, TWILIGHT]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:twilight_stream;MEDIUM;0.5;false;false;false;[WATER, RIVER, TWILIGHT]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:snowy_forest;COLD;0.09;true;false;false;[COLD, CONIFEROUS, SNOWY, TWILIGHT, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:twilight_glacier;COLD;0.0;false;false;false;[COLD, SNOWY, TWILIGHT, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:twilight_clearing;MEDIUM;0.8;false;false;false;[SPARSE, PLAINS, TWILIGHT]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:oak_savannah;MEDIUM;0.9;false;false;false;[SPARSE, TWILIGHT, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:firefly_forest;MEDIUM;0.5;true;false;false;[LUSH, TWILIGHT, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:deep_mushroom_forest;MEDIUM;0.8;true;false;false;[MUSHROOM, TWILIGHT, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:dark_forest;MEDIUM;0.7;true;false;false;[SPOOKY, TWILIGHT, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:enchanted_forest;MEDIUM;0.5;false;false;false;[MAGICAL, TWILIGHT, FOREST]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:fire_swamp;WARM;1.0;false;false;false;[HOT, SWAMP, TWILIGHT, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:dark_forest_center;MEDIUM;0.5;true;false;false;[SPOOKY, MAGICAL, TWILIGHT, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:highlands_center;MEDIUM;0.3;false;false;false;[DRY, DEAD, MESA, TWILIGHT, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:thornlands;MEDIUM;0.3;false;false;false;[DRY, HILLS, DEAD, TWILIGHT, WASTELAND]
[23:33:56] [Server thread/INFO] [harvestcraft]: twilightforest:spooky_forest;MEDIUM;0.5;true;false;false;[SPOOKY, DEAD, TWILIGHT, FOREST, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: fossil:lair of darkness;WARM;2.0;false;false;false;[VOID, NETHER]
[23:33:56] [Server thread/INFO] [harvestcraft]: fossil:treasure;WARM;2.0;false;false;false;[VOID]
[23:33:56] [Server thread/INFO] [harvestcraft]: fossil:volcano;WARM;2.0;false;false;false;[DRY, HOT, DEAD, WASTELAND]
[23:33:56] [Server thread/WARN] [FML]: No types have been added to Biome rats:ratlantis, types have been assigned on a best-effort guess: [WET, HOT, JUNGLE, DENSE]
[23:33:56] [Server thread/INFO] [harvestcraft]: rats:ratlantis;MEDIUM;0.95;true;false;false;[WET, HOT, JUNGLE, DENSE]
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [iChunUtil Online Resource Thread/WARN] [iChunUtil]: Error retrieving mods versions list.
[23:33:56] [iChunUtil Online Resource Thread/INFO] [STDERR]: [me.ichun.mods.ichunutil.common.thread.ThreadGetResources:run:77]: java.io.FileNotFoundException: https://raw.githubusercontent.com/iChun/iChunUtil/master/src/main/resources/assets/ichunutil/mod/versions.json
[23:33:56] [iChunUtil Online Resource Thread/INFO] [STDERR]: [me.ichun.mods.ichunutil.common.thread.ThreadGetResources:run:77]: at sun.net.www.protocol.http.HttpURLConnection.getInputStream0(HttpURLConnection.java:1893)
[23:33:56] [iChunUtil Online Resource Thread/INFO] [STDERR]: [me.ichun.mods.ichunutil.common.thread.ThreadGetResources:run:77]: at sun.net.www.protocol.http.HttpURLConnection.access$200(HttpURLConnection.java:92)
[23:33:56] [iChunUtil Online Resource Thread/INFO] [STDERR]: [me.ichun.mods.ichunutil.common.thread.ThreadGetResources:run:77]: at sun.net.www.protocol.http.HttpURLConnection$9.run(HttpURLConnection.java:1487)
[23:33:56] [iChunUtil Online Resource Thread/INFO] [STDERR]: [me.ichun.mods.ichunutil.common.thread.ThreadGetResources:run:77]: at sun.net.www.protocol.http.HttpURLConnection$9.run(HttpURLConnection.java:1485)
[23:33:56] [iChunUtil Online Resource Thread/INFO] [STDERR]: [me.ichun.mods.ichunutil.common.thread.ThreadGetResources:run:77]: at java.security.AccessController.doPrivileged(Native Method)
[23:33:56] [iChunUtil Online Resource Thread/INFO] [STDERR]: [me.ichun.mods.ichunutil.common.thread.ThreadGetResources:run:77]: at java.security.AccessController.doPrivilegedWithCombiner(AccessController.java:784)
[23:33:56] [iChunUtil Online Resource Thread/INFO] [STDERR]: [me.ichun.mods.ichunutil.common.thread.ThreadGetResources:run:77]: at sun.net.www.protocol.http.HttpURLConnection.getInputStream(HttpURLConnection.java:1484)
[23:33:56] [iChunUtil Online Resource Thread/INFO] [STDERR]: [me.ichun.mods.ichunutil.common.thread.ThreadGetResources:run:77]: at sun.net.www.protocol.https.HttpsURLConnectionImpl.getInputStream(HttpsURLConnectionImpl.java:268)
[23:33:56] [iChunUtil Online Resource Thread/INFO] [STDERR]: [me.ichun.mods.ichunutil.common.thread.ThreadGetResources:run:77]: at java.net.URL.openStream(URL.java:1093)
[23:33:56] [iChunUtil Online Resource Thread/INFO] [STDERR]: [me.ichun.mods.ichunutil.common.thread.ThreadGetResources:run:77]: at me.ichun.mods.ichunutil.common.thread.ThreadGetResources.run(ThreadGetResources.java:67)
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:taiga_cold
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:taiga_cold_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_taiga_cold
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:snowy_coniferous_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:snowy_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:alps_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:taiga
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:taiga_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:coniferous_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:maple_woods
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:river
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_birch_forest_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_roofed_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:boreal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:brushland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:grove
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:land_of_lakes
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:lush_swamp
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:orchard
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:overgrown_cliffs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:seasonal_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:temperate_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:wetland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:woodland
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:mountain_foothills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:savanna
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_hills
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:minecraft:mutated_jungle_edge
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:chaparral
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:sacred_springs
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:bamboo_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:eucalyptus_forest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:prairie
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_rainforest
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:oasis
[23:33:56] [Server thread/TRACE] [harvestcraft]: biome added:biomesoplenty:tropical_island
[23:33:56] [Server thread/INFO] [harvestcraft]: Registering drops for shadedGarden.
[23:33:56] [Server thread/INFO] [harvestcraft]: Registering drops for tropicalGarden.
[23:33:56] [Server thread/INFO] [harvestcraft]: Registering drops for windyGarden.
[23:33:56] [Server thread/INFO] [harvestcraft]: Registering drops for frostGarden.
[23:33:56] [Server thread/TRACE] [FML]: Unable to find item with name harvestcraft:juniperitem
[23:33:56] [Server thread/INFO] [harvestcraft]: Registering drops for aridGarden.
[23:33:56] [Server thread/INFO] [harvestcraft]: Registering drops for soggyGarden.
[23:33:57] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pamapiary`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:33:57] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pammarket`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:33:57] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pamshippingbin`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:33:57] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pampresser`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:33:57] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pamgroundtrap`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:33:57] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pamwatertrap`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:33:57] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pamwaterfilter`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:33:57] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pamgrinder`, expected `harvestcraft`. This could be a intended override, but in most cases indicates a broken mod.
[23:33:57] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod harvestcraft
[23:33:57] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Pam's HarvestCraft took 0.107s
[23:33:57] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod projectintelligence
[23:33:57] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod projectintelligence
[23:33:57] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Project Intelligence took 0.001s
[23:33:57] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod randomthings
[23:33:59] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod randomthings
[23:33:59] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Random Things took 2.523s
[23:33:59] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod rats
[23:33:59] [Server thread/INFO] [rats]: Rats is initializing
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod rats
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Rats took 2.504s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod roots
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod roots
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Roots took 0.033s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod tabula
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod tabula
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Tabula took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod thermalfoundation
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod thermalfoundation
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Thermal Foundation took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod phosphor-lighting
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod phosphor-lighting
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Phosphor Lighting Engine took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod mysticallib
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod mysticallib
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Mystical Lib took 0.000s
[23:34:02] [Server thread/DEBUG] [FML]: Bar Finished: Initialization took 55.688s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod minecraft
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod minecraft
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod minecraft
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Minecraft took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod mcp
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod mcp
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod mcp
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Minecraft Coder Pack took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod FML
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod FML
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod FML
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Forge Mod Loader took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod forge
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod forge
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod forge
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Minecraft Forge took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod orbis-lib
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod orbis-lib
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod orbis-lib
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - OrbisLib took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod aether
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod aether
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod aether
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Aether II took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod baubles
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod baubles
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod baubles
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Baubles took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod astralsorcery
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod astralsorcery
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod astralsorcery
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Astral Sorcery took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod quark
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod quark
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod quark
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Quark took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod autoreglib
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod autoreglib
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod autoreglib
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - AutoRegLib took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod thaumcraft
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod thaumcraft
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod thaumcraft
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Thaumcraft took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod botania
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod botania
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod botania
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Botania took 0.001s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod patchouli
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod patchouli
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod patchouli
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Patchouli took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod betteranimalsplus
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod betteranimalsplus
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod betteranimalsplus
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Better Animals Plus took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod bewitchment
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod bewitchment
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod bewitchment
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Bewitchment took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod bibliocraft
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod bibliocraft
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod bibliocraft
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - BiblioCraft took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod biomesoplenty
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod biomesoplenty
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod biomesoplenty
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Biomes O' Plenty took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod guideapi
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod guideapi
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod guideapi
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Guide-API took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 15 IMC messages to mod bloodmagic
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod bloodmagic
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod bloodmagic
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Blood Magic: Alchemical Wizardry took 0.001s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod bloodmoon
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod bloodmoon
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod bloodmoon
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Bloodmoon took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod codechickenlib
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod codechickenlib
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod codechickenlib
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - CodeChicken Lib took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod redstoneflux
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod redstoneflux
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod redstoneflux
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Redstone Flux took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod brandonscore
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod brandonscore
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod brandonscore
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Brandon's Core took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod mysticalworld
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod mysticalworld
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod mysticalworld
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Mystical World took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 118 IMC messages to mod chisel
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod chisel
[23:34:02] [Server thread/INFO] [Chisel]: Received 18 IMC messages from mod quark.
[23:34:02] [Server thread/INFO] [Chisel]: Received 14 IMC messages from mod astralsorcery.
[23:34:02] [Server thread/INFO] [Chisel]: Received 52 IMC messages from mod twilightforest.
[23:34:02] [Server thread/INFO] [Chisel]: Received 22 IMC messages from mod tconstruct.
[23:34:02] [Server thread/INFO] [Chisel]: Received 12 IMC messages from mod roots.
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod chisel
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Chisel took 0.011s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod cofhcore
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod cofhcore
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod cofhcore
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - CoFH Core took 0.041s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod cofhworld
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod cofhworld
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod cofhworld
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - CoFH World took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod craftstudioapi
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod craftstudioapi
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod craftstudioapi
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - CraftStudio API took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod customspawner
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod customspawner
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod customspawner
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - DrZhark's CustomSpawner took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod props
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod props
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod props
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Decocraft took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod mocreatures
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod mocreatures
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod mocreatures
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - DrZhark's Mo'Creatures Mod took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod mantle
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod mantle
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod mantle
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Mantle took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod twilightforest
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod twilightforest
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod twilightforest
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - The Twilight Forest took 0.004s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod tconstruct
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod tconstruct
[23:34:02] [Server thread/DEBUG] [tconstruct-IMC]: Added integration alloy: Molten Invar
[23:34:02] [Server thread/DEBUG] [tconstruct-IMC]: Added integration alloy: Molten Constantan
[23:34:02] [Server thread/DEBUG] [tconstruct-IMC]: Added integration alloy: Molten Signalum
[23:34:02] [Server thread/DEBUG] [tconstruct-IMC]: Added integration alloy: Molten Lumium
[23:34:02] [Server thread/DEBUG] [tconstruct-IMC]: Added integration alloy: Molten Enderium
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod tconstruct
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Tinkers' Construct took 0.003s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod extrautils2
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod extrautils2
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod extrautils2
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Extra Utilities 2 took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod natura
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod natura
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod natura
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Natura took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod forestry
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod forestry
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod forestry
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Forestry took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod llibrary
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod llibrary
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod llibrary
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - LLibrary took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod fossil
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod fossil
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod fossil
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Fossils and Archeology Revival took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod ftblib
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod ftblib
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod ftblib
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - FTB Library took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod itemfilters
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod itemfilters
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod itemfilters
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Item Filters took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod ftbquests
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod ftbquests
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod ftbquests
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - FTB Quests took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod ftbmoney
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod ftbmoney
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod ftbmoney
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - FTB Money took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod grimoireofgaia
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod grimoireofgaia
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod grimoireofgaia
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Grimoire of Gaia 3 took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod ichunutil
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod ichunutil
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod ichunutil
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - iChunUtil took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod hats
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod hats
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod hats
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Hats took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod ironchest
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod ironchest
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod ironchest
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Iron Chest took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod journeymap
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod journeymap
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod journeymap
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - JourneyMap took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod lootbagmod
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod lootbagmod
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod lootbagmod
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Loot Bag Mod took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod morph
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod morph
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod morph
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Morph took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod harvestcraft
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod harvestcraft
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod harvestcraft
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Pam's HarvestCraft took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod projectintelligence
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod projectintelligence
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod projectintelligence
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Project Intelligence took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod randomthings
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod randomthings
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod randomthings
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Random Things took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod rats
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod rats
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod rats
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Rats took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod roots
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod roots
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod roots
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Roots took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod tabula
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod tabula
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod tabula
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Tabula took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod thermalfoundation
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod thermalfoundation
[23:34:02] [Server thread/INFO] [thermalfoundation]: Thermal Foundation: Tinkers' Construct Plugin Enabled.
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod thermalfoundation
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Thermal Foundation took 0.003s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod phosphor-lighting
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod phosphor-lighting
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod phosphor-lighting
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Phosphor Lighting Engine took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod mysticallib
[23:34:02] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod mysticallib
[23:34:02] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod mysticallib
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Mystical Lib took 0.000s
[23:34:02] [Server thread/DEBUG] [FML]: Bar Finished: InterModComms$IMC took 0.071s
[23:34:02] [Server thread/INFO] [FML]: Injecting itemstacks
[23:34:02] [Server thread/TRACE] [FML]: Unable to find item with name techreborn:rubber_sapling
[23:34:02] [Server thread/TRACE] [FML]: Unable to find item with name techreborn:rubber_log
[23:34:02] [Server thread/INFO] [FML]: Itemstack injection complete
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod minecraft
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod minecraft
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Minecraft took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod mcp
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod mcp
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Minecraft Coder Pack took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod FML
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod FML
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Forge Mod Loader took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod forge
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod forge
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Minecraft Forge took 0.012s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod orbis-lib
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod orbis-lib
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - OrbisLib took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod aether
[23:34:02] [Server thread/DEBUG] [AetherII]: 'Register instances' completed in 7ms
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod aether
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Aether II took 0.013s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod baubles
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod baubles
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Baubles took 0.000s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod astralsorcery
[23:34:02] [Server thread/INFO] [Astral Sorcery]: Post compile recipes
[23:34:02] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod astralsorcery
[23:34:02] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Astral Sorcery took 0.014s
[23:34:02] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod quark
[23:34:09] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod quark
[23:34:09] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Quark took 6.906s
[23:34:09] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod autoreglib
[23:34:09] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod autoreglib
[23:34:09] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - AutoRegLib took 0.000s
[23:34:09] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod thaumcraft
[23:34:09] [Server thread/INFO] [Astral Core]: [AstralTransformer] Transforming alm : net.minecraft.enchantment.EnchantmentHelper with 1 patches!
[23:34:09] [Server thread/INFO] [Astral Core]: [AstralTransformer] Applied patch PATCHMODIFYENCHANTMENTLEVELS
[23:34:09] [Server thread/INFO] [Quark ASM]: Transforming net.minecraft.enchantment.EnchantmentHelper
[23:34:09] [Server thread/INFO] [Quark ASM]: Applying Transformation to method (Names [getEnchantments, func_82781_a] Descriptor (Lnet/minecraft/item/ItemStack;)Ljava/util/Map;)
[23:34:09] [Server thread/INFO] [Quark ASM]: Located Method, patching...
[23:34:09] [Server thread/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/item/ItemStack.func_77986_q ()Lnet/minecraft/nbt/NBTTagList;
[23:34:09] [Server thread/INFO] [Quark ASM]: Patch result: true
[23:34:24] [Server thread/DEBUG] [twilightforest]: Attempting to register Thaumcraft Aspects for Twilight Forest items!
[23:34:24] [Server thread/INFO] [grimoireofgaia]: Registering Item Aspects
[23:34:24] [Server thread/INFO] [grimoireofgaia]: Registering Entity Aspects
[23:34:30] [Server thread/INFO] [THAUMCRAFT]: Loaded 22 research entries from thaumcraft:research/alchemy
[23:34:30] [Server thread/INFO] [THAUMCRAFT]: Loaded 5 research entries from thaumcraft:research/eldritch
[23:34:30] [Server thread/INFO] [THAUMCRAFT]: Loaded 20 research entries from thaumcraft:research/basics
[23:34:30] [Server thread/INFO] [THAUMCRAFT]: Loaded 23 research entries from thaumcraft:research/auromancy
[23:34:30] [Server thread/INFO] [THAUMCRAFT]: Loaded 12 research entries from thaumcraft:research/scans
[23:34:30] [Server thread/INFO] [THAUMCRAFT]: Loaded 20 research entries from thaumcraft:research/artifice
[23:34:30] [Server thread/INFO] [THAUMCRAFT]: Loaded 17 research entries from thaumcraft:research/infusion
[23:34:30] [Server thread/INFO] [THAUMCRAFT]: Loaded 29 research entries from thaumcraft:research/golemancy
[23:34:30] [Server thread/INFO] [THAUMCRAFT]: Loaded 3 research entries from bewitchment:tc/research/bewitchment
[23:34:30] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod thaumcraft
[23:34:30] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Thaumcraft took 21.024s
[23:34:30] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod botania
[23:34:32] [Server thread/INFO] [botania]: The Lexica Botania has 26916 words.
[23:34:32] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod botania
[23:34:32] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Botania took 2.593s
[23:34:32] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod patchouli
[23:34:32] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod patchouli
[23:34:32] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Patchouli took 0.001s
[23:34:32] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod betteranimalsplus
[23:34:32] [Server thread/INFO] [betteranimalsplus]: Crazy bird creation complete.
[23:34:32] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod betteranimalsplus
[23:34:32] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Better Animals Plus took 0.001s
[23:34:32] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod bewitchment
[23:34:32] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod bewitchment
[23:34:32] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Bewitchment took 0.014s
[23:34:32] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod bibliocraft
[23:34:32] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod bibliocraft
[23:34:32] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - BiblioCraft took 0.000s
[23:34:32] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod biomesoplenty
[23:34:32] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod biomesoplenty
[23:34:32] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Biomes O' Plenty took 0.006s
[23:34:32] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod guideapi
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod guideapi
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Guide-API took 2.693s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod bloodmagic
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod bloodmagic
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Blood Magic: Alchemical Wizardry took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod bloodmoon
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod bloodmoon
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Bloodmoon took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod codechickenlib
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod codechickenlib
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - CodeChicken Lib took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod redstoneflux
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod redstoneflux
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Redstone Flux took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod brandonscore
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod brandonscore
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Brandon's Core took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod mysticalworld
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod mysticalworld
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Mystical World took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod chisel
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod chisel
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Chisel took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod cofhcore
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod cofhcore
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - CoFH Core took 0.006s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod cofhworld
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod cofhworld
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - CoFH World took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod craftstudioapi
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod craftstudioapi
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - CraftStudio API took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod customspawner
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod customspawner
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - DrZhark's CustomSpawner took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod props
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod props
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Decocraft took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod mocreatures
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod mocreatures
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - DrZhark's Mo'Creatures Mod took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod mantle
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod mantle
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Mantle took 0.000s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod twilightforest
[23:34:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod twilightforest
[23:34:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - The Twilight Forest took 0.020s
[23:34:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod tconstruct
[23:34:41] [Server thread/INFO] [tconstruct-TinkerSmeltery]: Started adding oredict melting recipes
[23:34:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.tripWireSource@0 (72 iron)
[23:34:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.shield@0 (144 iron)
[23:34:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.shears@0 (288 iron)
[23:34:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.minecart@0 (720 iron)
[23:34:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.weightedPlate_light@0 (288 gold)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.ironTrapdoor@0 (576 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.swordIron@0 (288 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.shovelIron@0 (144 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.pickaxeIron@0 (432 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.leggingsIron@0 (1008 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.hoeIron@0 (288 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.helmetIron@0 (720 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.doorIron@0 (288 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.chestplateIron@0 (1152 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bootsIron@0 (576 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.fenceIron@0 (54 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.hatchetIron@0 (432 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.hopper@0 (720 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.weightedPlate_heavy@0 (288 iron)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.swordGold@0 (288 gold)
[23:34:51] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.shovelGold@0 (144 gold)
[23:34:54] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.pickaxeGold@0 (432 gold)
[23:34:54] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.leggingsGold@0 (1008 gold)
[23:34:54] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.hoeGold@0 (288 gold)
[23:34:54] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.helmetGold@0 (720 gold)
[23:34:54] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.chestplateGold@0 (1152 gold)
[23:34:54] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bootsGold@0 (576 gold)
[23:34:54] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.hatchetGold@0 (432 gold)
[23:34:54] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.glassBottle@0 (1000 glass)
[23:34:54] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.compass@0 (576 iron)
[23:34:57] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.clock@0 (576 gold)
[23:34:57] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.cauldron@0 (1008 iron)
[23:34:57] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bucket@0 (432 iron)
[23:34:57] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.anvil@0 (4464 iron)
[23:35:00] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.extrautils2:glasscutter@0 (432 iron)
[23:35:03] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.extrautils2:sickle_iron@0 (720 iron)
[23:35:03] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.extrautils2:sickle_gold@0 (720 gold)
[23:35:06] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.extrautils2:machine@0 (144 iron)
[23:35:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bewitchment.unfired_jar@0 (144 clay)
[23:35:53] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.bewitchment.goblet@0 (96 iron)
[23:35:53] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bewitchment.silver_sword@0 (288 silver)
[23:35:53] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bewitchment.silver_shovel@0 (144 silver)
[23:35:53] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bewitchment.silver_pickaxe@0 (432 silver)
[23:35:53] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bewitchment.silver_hoe@0 (288 silver)
[23:35:53] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bewitchment.silver_axe@0 (432 silver)
[23:35:53] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bewitchment.silver_leggings@0 (1008 silver)
[23:35:53] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bewitchment.silver_helmet@0 (720 silver)
[23:35:53] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bewitchment.silver_chestplate@0 (1152 silver)
[23:35:53] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bewitchment.silver_boots@0 (576 silver)
[23:35:58] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.PlumbLine@0 (144 gold)
[23:36:01] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.maptool@0 (432 iron)
[23:36:04] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.FramingSaw@0 (432 iron)
[23:36:13] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.jar_empty@0 (2333 glass)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.bloodmagic.soulSnare.@0 (144 iron)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.silver_sword@0 (288 silver)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.silver_shovel@0 (144 silver)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.silver_pickaxe@0 (432 silver)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.silver_leggings@0 (1008 silver)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.silver_knife@0 (288 silver)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.silver_hoe@0 (288 silver)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.silver_helmet@0 (720 silver)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.silver_dust_tiny@0 (16 silver)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.silver_chestplate@0 (1152 silver)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.silver_boots@0 (576 silver)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.silver_axe@0 (432 silver)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.leash@0 (72 clay)
[23:36:18] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.iron_dust_tiny@0 (16 iron)
[23:36:19] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.gold_dust_tiny@0 (16 gold)
[23:36:19] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.copper_sword@0 (288 copper)
[23:36:19] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.copper_shovel@0 (144 copper)
[23:36:19] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.copper_pickaxe@0 (432 copper)
[23:36:19] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.copper_leggings@0 (1008 copper)
[23:36:19] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.copper_knife@0 (288 copper)
[23:36:19] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.copper_hoe@0 (288 copper)
[23:36:19] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.copper_helmet@0 (720 copper)
[23:36:19] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.copper_dust_tiny@0 (16 copper)
[23:36:19] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.copper_chestplate@0 (1152 copper)
[23:36:19] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.copper_boots@0 (576 copper)
[23:36:19] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.copper_axe@0 (432 copper)
[23:36:23] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.twilightforest.knightmetalRing@0 (576 knightmetal)
[23:36:23] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.twilightforest.knightlyPlate@0 (1152 knightmetal)
[23:36:23] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.twilightforest.knightlySword@0 (288 knightmetal)
[23:36:23] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.twilightforest.knightlyAxe@0 (432 knightmetal)
[23:36:23] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.twilightforest.fieryHelm@0 (720 fierymetal)
[23:36:25] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.twilightforest.fieryPlate@0 (1152 fierymetal)
[23:36:25] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.twilightforest.fieryBoots@0 (576 fierymetal)
[23:36:25] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.twilightforest.knightlyHelm@0 (720 knightmetal)
[23:36:25] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.twilightforest.fieryLegs@0 (1008 fierymetal)
[23:36:25] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.twilightforest.knightlyPick@0 (432 knightmetal)
[23:36:25] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.twilightforest.knightlyBoots@0 (576 knightmetal)
[23:36:25] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.twilightforest.knightlyLegs@0 (1008 knightmetal)
[23:36:29] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.tconstruct.fancy_frame@6 (2500 glass)
[23:36:32] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.tconstruct.materials@15 (144 gold)
[23:36:43] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.ironchest.chest.wood_iron@0 (1152 iron)
[23:36:43] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.ironchest.chest.wood_copper@0 (1152 copper)
[23:37:04] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.IronChest@0 (1152 iron)
[23:37:04] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.IronChest@3 (1152 copper)
[23:37:52] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.lightRedirector@0 (4000 glass)
[23:37:52] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.ironDropper@0 (1008 iron)
[23:37:54] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.advancedRedstoneTorch_on@0 (144 iron)
[23:38:01] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.iron_knife@0 (288 iron)
[23:38:01] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.gold_knife@0 (288 gold)
[23:38:07] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.iron_plate@0 (48 iron)
[23:38:09] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.trowel@0 (288 iron)
[23:38:11] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.minecartChest@0 (720 iron)
[23:38:11] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.horse_whistle@0 (16 iron)
[23:38:14] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.iron_ladder@0 (63 iron)
[23:38:16] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.chain@0 (112 iron)
[23:38:22] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.baubles@0 (144 brass)
[23:38:22] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.baubles@1 (128 brass)
[23:38:27] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.jar_brace@0 (32 brass)
[23:38:27] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.filter@0 (144 gold)
[23:38:29] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xtile.inlay@0 (72 gold)
[23:38:31] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.chisel.chisel_iron@0 (144 iron)
[23:38:35] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.material@17 (74 emerald)
[23:38:35] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.material@27 (2664 emerald)
[23:38:38] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.material@512 (144 iron)
[23:38:38] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.material@513 (144 gold)
[23:38:38] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.material@514 (144 silver)
[23:38:38] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.material@515 (144 electrum)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.copperHelmet@0 (720 copper)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.copperChestplate@0 (1152 copper)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.copperLegs@0 (1008 copper)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.copperBoots@0 (576 copper)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.tinHelmet@0 (720 tin)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.tinChestplate@0 (1152 tin)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.tinLegs@0 (1008 tin)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.tinBoots@0 (576 tin)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.silverHelmet@0 (720 silver)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.silverChestplate@0 (1152 silver)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.silverLegs@0 (1008 silver)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.silverBoots@0 (576 silver)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.leadHelmet@0 (720 lead)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.leadChestplate@0 (1152 lead)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.leadLegs@0 (1008 lead)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.leadBoots@0 (576 lead)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.aluminumHelmet@0 (720 aluminum)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.aluminumChestplate@0 (1152 aluminum)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.aluminumLegs@0 (1008 aluminum)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.aluminumBoots@0 (576 aluminum)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.nickelHelmet@0 (720 nickel)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.nickelChestplate@0 (1152 nickel)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.nickelLegs@0 (1008 nickel)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.nickelBoots@0 (576 nickel)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.platinumHelmet@0 (720 platinum)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.platinumChestplate@0 (1152 platinum)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.platinumLegs@0 (1008 platinum)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.platinumBoots@0 (576 platinum)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.steelHelmet@0 (720 steel)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.steelChestplate@0 (1152 steel)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.steelLegs@0 (1008 steel)
[23:38:41] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.steelBoots@0 (576 steel)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.electrumHelmet@0 (720 electrum)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.electrumChestplate@0 (1152 electrum)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.electrumLegs@0 (1008 electrum)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.electrumBoots@0 (576 electrum)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.invarHelmet@0 (720 invar)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.invarChestplate@0 (1152 invar)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.invarLegs@0 (1008 invar)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.invarBoots@0 (576 invar)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.bronzeHelmet@0 (720 bronze)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.bronzeChestplate@0 (1152 bronze)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.bronzeLegs@0 (1008 bronze)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.bronzeBoots@0 (576 bronze)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.constantanHelmet@0 (720 constantan)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.constantanChestplate@0 (1152 constantan)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.constantanLegs@0 (1008 constantan)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.armor.constantanBoots@0 (576 constantan)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.copperSword@0 (288 copper)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.copperShovel@0 (144 copper)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.copperPickaxe@0 (432 copper)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.copperAxe@0 (432 copper)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.copperHoe@0 (288 copper)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.copperBow@0 (288 copper)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.copperFishingRod@0 (288 copper)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.copperShears@0 (288 copper)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.copperSickle@0 (432 copper)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.copperHammer@0 (720 copper)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.copperExcavator@0 (432 copper)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.tinSword@0 (288 tin)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.tinShovel@0 (144 tin)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.tinPickaxe@0 (432 tin)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.tinAxe@0 (432 tin)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.tinHoe@0 (288 tin)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.tinBow@0 (288 tin)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.tinFishingRod@0 (288 tin)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.tinShears@0 (288 tin)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.tinSickle@0 (432 tin)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.tinHammer@0 (720 tin)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.tinExcavator@0 (432 tin)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.silverSword@0 (288 silver)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.silverShovel@0 (144 silver)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.silverPickaxe@0 (432 silver)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.silverAxe@0 (432 silver)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.silverHoe@0 (288 silver)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.silverBow@0 (288 silver)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.silverFishingRod@0 (288 silver)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.silverShears@0 (288 silver)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.silverSickle@0 (432 silver)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.silverHammer@0 (720 silver)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.silverExcavator@0 (432 silver)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.leadSword@0 (288 lead)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.leadShovel@0 (144 lead)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.leadPickaxe@0 (432 lead)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.leadAxe@0 (432 lead)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.leadHoe@0 (288 lead)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.leadBow@0 (288 lead)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.leadFishingRod@0 (288 lead)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.leadShears@0 (288 lead)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.leadSickle@0 (432 lead)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.leadHammer@0 (720 lead)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.leadExcavator@0 (432 lead)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.aluminumSword@0 (288 aluminum)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.aluminumShovel@0 (144 aluminum)
[23:38:44] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.aluminumPickaxe@0 (432 aluminum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.aluminumAxe@0 (432 aluminum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.aluminumHoe@0 (288 aluminum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.aluminumBow@0 (288 aluminum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.aluminumFishingRod@0 (288 aluminum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.aluminumShears@0 (288 aluminum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.aluminumSickle@0 (432 aluminum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.aluminumHammer@0 (720 aluminum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.aluminumExcavator@0 (432 aluminum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.nickelSword@0 (288 nickel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.nickelShovel@0 (144 nickel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.nickelPickaxe@0 (432 nickel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.nickelAxe@0 (432 nickel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.nickelHoe@0 (288 nickel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.nickelBow@0 (288 nickel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.nickelFishingRod@0 (288 nickel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.nickelShears@0 (288 nickel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.nickelSickle@0 (432 nickel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.nickelHammer@0 (720 nickel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.nickelExcavator@0 (432 nickel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.platinumSword@0 (288 platinum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.platinumShovel@0 (144 platinum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.platinumPickaxe@0 (432 platinum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.platinumAxe@0 (432 platinum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.platinumHoe@0 (288 platinum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.platinumBow@0 (288 platinum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.platinumFishingRod@0 (288 platinum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.platinumShears@0 (288 platinum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.platinumSickle@0 (432 platinum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.platinumHammer@0 (720 platinum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.platinumExcavator@0 (432 platinum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.steelSword@0 (288 steel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.steelShovel@0 (144 steel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.steelPickaxe@0 (432 steel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.steelAxe@0 (432 steel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.steelHoe@0 (288 steel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.steelBow@0 (288 steel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.steelFishingRod@0 (288 steel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.steelShears@0 (288 steel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.steelSickle@0 (432 steel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.steelHammer@0 (720 steel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.steelExcavator@0 (432 steel)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.electrumSword@0 (288 electrum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.electrumShovel@0 (144 electrum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.electrumPickaxe@0 (432 electrum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.electrumAxe@0 (432 electrum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.electrumHoe@0 (288 electrum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.electrumBow@0 (288 electrum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.electrumFishingRod@0 (288 electrum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.electrumShears@0 (288 electrum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.electrumSickle@0 (432 electrum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.electrumHammer@0 (720 electrum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.electrumExcavator@0 (432 electrum)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.invarSword@0 (288 invar)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.invarShovel@0 (144 invar)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.invarPickaxe@0 (432 invar)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.invarAxe@0 (432 invar)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.invarHoe@0 (288 invar)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.invarBow@0 (288 invar)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.invarFishingRod@0 (288 invar)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.invarShears@0 (288 invar)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.invarSickle@0 (432 invar)
[23:38:47] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.invarHammer@0 (720 invar)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.invarExcavator@0 (432 invar)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.bronzeSword@0 (288 bronze)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.bronzeShovel@0 (144 bronze)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.bronzePickaxe@0 (432 bronze)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.bronzeAxe@0 (432 bronze)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.bronzeHoe@0 (288 bronze)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.bronzeBow@0 (288 bronze)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.bronzeFishingRod@0 (288 bronze)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.bronzeShears@0 (288 bronze)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.bronzeSickle@0 (432 bronze)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.bronzeHammer@0 (720 bronze)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.bronzeExcavator@0 (432 bronze)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.constantanSword@0 (288 constantan)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.constantanShovel@0 (144 constantan)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.constantanPickaxe@0 (432 constantan)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.constantanAxe@0 (432 constantan)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.constantanHoe@0 (288 constantan)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.constantanBow@0 (288 constantan)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.constantanFishingRod@0 (288 constantan)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.constantanShears@0 (288 constantan)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.constantanSickle@0 (432 constantan)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.constantanHammer@0 (720 constantan)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.constantanExcavator@0 (432 constantan)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.ironBow@0 (288 iron)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.ironFishingRod@0 (288 iron)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.ironSickle@0 (432 iron)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.ironHammer@0 (720 iron)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.ironExcavator@0 (432 iron)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.goldBow@0 (288 gold)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.goldFishingRod@0 (288 gold)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.goldShears@0 (288 gold)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.goldSickle@0 (432 gold)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.goldHammer@0 (720 gold)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.thermalfoundation.tool.goldExcavator@0 (432 gold)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.for.sturdy_machine@0 (1152 bronze)
[23:38:49] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.for.can@0 (36 tin)
[23:38:52] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.for.bronze_pickaxe@0 (432 bronze)
[23:38:52] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.for.bronze_shovel@0 (144 bronze)
[23:38:52] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.for.wrench@0 (576 bronze)
[23:38:52] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.for.habitat_locator@0 (576 bronze)
[23:39:13] [Server thread/TRACE] [tconstruct-TinkerSmeltery]: Added automatic melting recipe for 1xitem.for.grafter@0 (144 bronze)
[23:39:13] [Server Shutdown Thread/INFO] [net.minecraft.server.MinecraftServer]: Stopping server
[23:39:13] [Server Shutdown Thread/INFO] [net.minecraft.server.MinecraftServer]: Saving worlds
[23:39:19] [Aternos System/ERROR] [LOG]: Server was stopped because it took too long to start. Try reducing the load to avoid this in the future.