1 | [15:21:04] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLServerTweaker
|
2 | [15:21:04] [main/INFO] [LaunchWrapper]: Using primary tweak class name net.minecraftforge.fml.common.launcher.FMLServerTweaker
|
3 | [15:21:04] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLServerTweaker
|
4 | [15:21:04] [main/DEBUG] [FML]: Injecting tracing printstreams for STDOUT/STDERR.
|
5 | [15:21:04] [main/INFO] [FML]: Forge Mod Loader version 14.23.5.2855 for Minecraft 1.12.2 loading
|
6 | [15:21:04] [main/INFO] [FML]: Java is OpenJDK 64-Bit Server VM, version 1.8.0_222, running on Linux:amd64:4.4.0-173-generic, installed at /usr/local/openjdk-8/jre
|
7 | [15:21:04] [main/DEBUG] [FML]: Java classpath at launch is:
|
8 | [15:21:04] [main/DEBUG] [FML]: forge.jar
|
9 | [15:21:04] [main/DEBUG] [FML]: /jolokia/jolokia.jar
|
10 | [15:21:04] [main/DEBUG] [FML]: Java library path at launch is:
|
11 | [15:21:04] [main/DEBUG] [FML]: /usr/java/packages/lib/amd64
|
12 | [15:21:04] [main/DEBUG] [FML]: /usr/lib64
|
13 | [15:21:04] [main/DEBUG] [FML]: /lib64
|
14 | [15:21:04] [main/DEBUG] [FML]: /lib
|
15 | [15:21:04] [main/DEBUG] [FML]: /usr/lib
|
16 | [15:21:04] [main/DEBUG] [FML]: Determined Minecraft Libraries Root: /server/libraries
|
17 | [15:21:04] [main/DEBUG] [FML]: Cleaning up mods folder: ./mods
|
18 | [15:21:04] [main/DEBUG] [FML]: Examining file: Blocklings 6.0.1_b - 1.12.2.jar
|
19 | [15:21:04] [main/DEBUG] [FML]: Examining file: backpacked-1.4.2-1.12.2.jar
|
20 | [15:21:04] [main/DEBUG] [FML]: Examining file: Bloodmoon-MC1.12.2-1.5.3.jar
|
21 | [15:21:04] [main/DEBUG] [FML]: Examining file: CustomMobSpawner-3.11.5.jar
|
22 | [15:21:04] [main/DEBUG] [FML]: Examining file: ironchest-1.12.2-7.0.72.847.jar
|
23 | [15:21:04] [main/DEBUG] [FML]: Examining file: EnderStorage-1.12.2-2.4.6.137-universal.jar
|
24 | [15:21:04] [main/DEBUG] [FML]: Examining file: aether_ii-1.12.2-0.3.0+build411-universal.jar
|
25 | [15:21:04] [main/DEBUG] [FML]: Found existing ContainedDep orbis-lib-1.12.2-0.2.0+build411-universal.jar(com.gildedgames:orbis-lib:1.12.2-0.2.0+build411) from /server/mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar extracted to ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar, skipping extraction
|
26 | [15:21:04] [main/DEBUG] [FML]: Examining file: orbis-lib-1.12.2-0.2.0+build411.jar
|
27 | [15:21:05] [main/DEBUG] [FML]: Found existing ContainedDep phosphor-1.12.2-0.2.6+build50-universal.jar(me.jellysquid.mods:phosphor:1.12.2-0.2.6+build50) from /server/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar extracted to ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar, skipping extraction
|
28 | [15:21:05] [main/DEBUG] [FML]: Examining file: phosphor-1.12.2-0.2.6+build50.jar
|
29 | [15:21:05] [main/DEBUG] [FML]: Examining file: CodeChickenLib-1.12.2-3.2.3.358-universal.jar
|
30 | [15:21:05] [main/DEBUG] [FML]: Examining file: Decocraft-2.6.3_1.12.2.jar
|
31 | [15:21:05] [main/DEBUG] [FML]: Examining file: DoomlikeDungeons-1.13.2-MC1.12.2.jar
|
32 | [15:21:05] [main/DEBUG] [FML]: Examining file: Schematics-1.12.2.12.jar
|
33 | [15:21:05] [main/DEBUG] [FML]: Examining file: Chisel-MC1.12.2-1.0.2.45.jar
|
34 | [15:21:05] [main/DEBUG] [FML]: Examining file: FastFurnace-1.12.2-1.3.1.jar
|
35 | [15:21:05] [main/DEBUG] [FML]: Examining file: NotEnoughItems-1.12.2-2.4.3.245-universal.jar
|
36 | [15:21:05] [main/DEBUG] [FML]: Examining file: CTM-MC1.12.2-1.0.2.31.jar
|
37 | [15:21:05] [main/DEBUG] [FML]: Examining file: Placebo-1.12.2-1.6.0.jar
|
38 | [15:21:05] [main/DEBUG] [FML]: Examining file: Schematica-1.12.2-1.8.0.169-universal.jar
|
39 | [15:21:05] [main/DEBUG] [FML]: Examining file: UndergroundBiomesConstructs-1.12-1.3.8.jar
|
40 | [15:21:05] [main/DEBUG] [FML]: Examining file: PTRLib-1.0.4.jar
|
41 | [15:21:05] [main/DEBUG] [FML]: Examining file: Netherending-Ores-1.12.2-1.4.2.jar
|
42 | [15:21:05] [main/DEBUG] [FML]: Examining file: LunatriusCore-1.12.2-1.2.0.42-universal.jar
|
43 | [15:21:05] [main/DEBUG] [FML]: Examining file: jei_1.12.2-4.16.1.302.jar
|
44 | [15:21:05] [main/DEBUG] [FML]: Examining file: AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar
|
45 | [15:21:05] [main/DEBUG] [FML]: Examining file: DrZharks MoCreatures Mod-12.0.5.jar
|
46 | [15:21:05] [main/DEBUG] [FML]: File already proccessed /server/./mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar, Skipping
|
47 | [15:21:05] [main/DEBUG] [FML]: File already proccessed /server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar, Skipping
|
48 | [15:21:05] [main/DEBUG] [FML]: Enabling runtime deobfuscation
|
49 | [15:21:05] [main/DEBUG] [FML]: Instantiating coremod class FMLCorePlugin
|
50 | [15:21:05] [main/DEBUG] [FML]: Found signing certificates for coremod FMLCorePlugin (net.minecraftforge.fml.relauncher.FMLCorePlugin)
|
51 | [15:21:05] [main/DEBUG] [FML]: Found certificate e3c3d50c7c986df74c645c0ac54639741c90a557
|
52 | [15:21:05] [main/DEBUG] [FML]: Added access transformer class net.minecraftforge.fml.common.asm.transformers.AccessTransformer to enqueued access transformers
|
53 | [15:21:05] [main/DEBUG] [FML]: Enqueued coremod FMLCorePlugin
|
54 | [15:21:05] [main/DEBUG] [FML]: Instantiating coremod class FMLForgePlugin
|
55 | [15:21:05] [main/DEBUG] [FML]: Found signing certificates for coremod FMLForgePlugin (net.minecraftforge.classloading.FMLForgePlugin)
|
56 | [15:21:05] [main/DEBUG] [FML]: Found certificate e3c3d50c7c986df74c645c0ac54639741c90a557
|
57 | [15:21:05] [main/DEBUG] [FML]: Enqueued coremod FMLForgePlugin
|
58 | [15:21:05] [main/DEBUG] [FML]: All fundamental core mods are successfully located
|
59 | [15:21:06] [main/DEBUG] [FML]: Discovering coremods
|
60 | [15:21:06] [main/INFO] [FML]: Searching /server/./mods for mods
|
61 | [15:21:06] [main/DEBUG] [FML]: Adding Blocklings 6.0.1_b - 1.12.2.jar to the mod list
|
62 | [15:21:06] [main/DEBUG] [FML]: Adding backpacked-1.4.2-1.12.2.jar to the mod list
|
63 | [15:21:06] [main/DEBUG] [FML]: Adding Bloodmoon-MC1.12.2-1.5.3.jar to the mod list
|
64 | [15:21:06] [main/DEBUG] [FML]: Adding CustomMobSpawner-3.11.5.jar to the mod list
|
65 | [15:21:06] [main/DEBUG] [FML]: Adding ironchest-1.12.2-7.0.72.847.jar to the mod list
|
66 | [15:21:06] [main/DEBUG] [FML]: Adding EnderStorage-1.12.2-2.4.6.137-universal.jar to the mod list
|
67 | [15:21:06] [main/DEBUG] [FML]: Adding aether_ii-1.12.2-0.3.0+build411-universal.jar to the mod list
|
68 | [15:21:06] [main/DEBUG] [FML]: Adding CodeChickenLib-1.12.2-3.2.3.358-universal.jar to the mod list
|
69 | [15:21:06] [main/DEBUG] [FML]: Adding Decocraft-2.6.3_1.12.2.jar to the mod list
|
70 | [15:21:06] [main/DEBUG] [FML]: Adding DoomlikeDungeons-1.13.2-MC1.12.2.jar to the mod list
|
71 | [15:21:06] [main/DEBUG] [FML]: Adding Schematics-1.12.2.12.jar to the mod list
|
72 | [15:21:06] [main/DEBUG] [FML]: Adding Chisel-MC1.12.2-1.0.2.45.jar to the mod list
|
73 | [15:21:06] [main/DEBUG] [FML]: Adding FastFurnace-1.12.2-1.3.1.jar to the mod list
|
74 | [15:21:06] [main/DEBUG] [FML]: Adding NotEnoughItems-1.12.2-2.4.3.245-universal.jar to the mod list
|
75 | [15:21:06] [main/DEBUG] [FML]: Adding CTM-MC1.12.2-1.0.2.31.jar to the mod list
|
76 | [15:21:06] [main/DEBUG] [FML]: Adding Placebo-1.12.2-1.6.0.jar to the mod list
|
77 | [15:21:06] [main/DEBUG] [FML]: Adding Schematica-1.12.2-1.8.0.169-universal.jar to the mod list
|
78 | [15:21:06] [main/DEBUG] [FML]: Adding UndergroundBiomesConstructs-1.12-1.3.8.jar to the mod list
|
79 | [15:21:06] [main/DEBUG] [FML]: Adding PTRLib-1.0.4.jar to the mod list
|
80 | [15:21:06] [main/DEBUG] [FML]: Adding Netherending-Ores-1.12.2-1.4.2.jar to the mod list
|
81 | [15:21:06] [main/DEBUG] [FML]: Adding LunatriusCore-1.12.2-1.2.0.42-universal.jar to the mod list
|
82 | [15:21:06] [main/DEBUG] [FML]: Adding jei_1.12.2-4.16.1.302.jar to the mod list
|
83 | [15:21:06] [main/DEBUG] [FML]: Adding AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar to the mod list
|
84 | [15:21:06] [main/DEBUG] [FML]: Adding DrZharks MoCreatures Mod-12.0.5.jar to the mod list
|
85 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar
|
86 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar
|
87 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy aether_ii-1.12.2-0.3.0+build411-universal.jar
|
88 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in aether_ii-1.12.2-0.3.0+build411-universal.jar
|
89 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy backpacked-1.4.2-1.12.2.jar
|
90 | [15:21:06] [main/TRACE] [FML]: Adding backpacked-1.4.2-1.12.2.jar to the list of known coremods, it will not be examined again
|
91 | [15:21:06] [main/DEBUG] [FML]: Instantiating coremod class BackpackedPlugin
|
92 | [15:21:06] [main/TRACE] [FML]: coremod named Backpacked is loading
|
93 | [15:21:06] [main/DEBUG] [FML]: The coremod com.mrcrayfish.backpacked.asm.BackpackedPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
|
94 | [15:21:06] [main/WARN] [FML]: The coremod Backpacked (com.mrcrayfish.backpacked.asm.BackpackedPlugin) is not signed!
|
95 | [15:21:06] [main/DEBUG] [FML]: Enqueued coremod Backpacked
|
96 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy Blocklings 6.0.1_b - 1.12.2.jar
|
97 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in Blocklings 6.0.1_b - 1.12.2.jar
|
98 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy Bloodmoon-MC1.12.2-1.5.3.jar
|
99 | [15:21:06] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in Bloodmoon-MC1.12.2-1.5.3.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
|
100 | [15:21:06] [main/DEBUG] [FML]: Instantiating coremod class LoadingPlugin
|
101 | [15:21:06] [main/WARN] [FML]: The coremod lumien.bloodmoon.asm.LoadingPlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft
|
102 | [15:21:06] [main/DEBUG] [FML]: Found signing certificates for coremod LoadingPlugin (lumien.bloodmoon.asm.LoadingPlugin)
|
103 | [15:21:06] [main/DEBUG] [FML]: Found certificate d72e0dd57935b3e9476212aea0c0df352dd76291
|
104 | [15:21:06] [main/DEBUG] [FML]: Enqueued coremod LoadingPlugin
|
105 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy Chisel-MC1.12.2-1.0.2.45.jar
|
106 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in Chisel-MC1.12.2-1.0.2.45.jar
|
107 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy CodeChickenLib-1.12.2-3.2.3.358-universal.jar
|
108 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in CodeChickenLib-1.12.2-3.2.3.358-universal.jar
|
109 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy CTM-MC1.12.2-1.0.2.31.jar
|
110 | [15:21:06] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in CTM-MC1.12.2-1.0.2.31.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
|
111 | [15:21:06] [main/DEBUG] [FML]: Instantiating coremod class CTMCorePlugin
|
112 | [15:21:06] [main/WARN] [FML]: The coremod team.chisel.ctm.client.asm.CTMCorePlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft
|
113 | [15:21:06] [main/WARN] [FML]: The coremod CTMCorePlugin (team.chisel.ctm.client.asm.CTMCorePlugin) is not signed!
|
114 | [15:21:06] [main/DEBUG] [FML]: Enqueued coremod CTMCorePlugin
|
115 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy CustomMobSpawner-3.11.5.jar
|
116 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in CustomMobSpawner-3.11.5.jar
|
117 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy Decocraft-2.6.3_1.12.2.jar
|
118 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in Decocraft-2.6.3_1.12.2.jar
|
119 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy DoomlikeDungeons-1.13.2-MC1.12.2.jar
|
120 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in DoomlikeDungeons-1.13.2-MC1.12.2.jar
|
121 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy DrZharks MoCreatures Mod-12.0.5.jar
|
122 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in DrZharks MoCreatures Mod-12.0.5.jar
|
123 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy EnderStorage-1.12.2-2.4.6.137-universal.jar
|
124 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in EnderStorage-1.12.2-2.4.6.137-universal.jar
|
125 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy FastFurnace-1.12.2-1.3.1.jar
|
126 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in FastFurnace-1.12.2-1.3.1.jar
|
127 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy ironchest-1.12.2-7.0.72.847.jar
|
128 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in ironchest-1.12.2-7.0.72.847.jar
|
129 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy jei_1.12.2-4.16.1.302.jar
|
130 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in jei_1.12.2-4.16.1.302.jar
|
131 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy LunatriusCore-1.12.2-1.2.0.42-universal.jar
|
132 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in LunatriusCore-1.12.2-1.2.0.42-universal.jar
|
133 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy Netherending-Ores-1.12.2-1.4.2.jar
|
134 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in Netherending-Ores-1.12.2-1.4.2.jar
|
135 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy NotEnoughItems-1.12.2-2.4.3.245-universal.jar
|
136 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in NotEnoughItems-1.12.2-2.4.3.245-universal.jar
|
137 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy Placebo-1.12.2-1.6.0.jar
|
138 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in Placebo-1.12.2-1.6.0.jar
|
139 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy PTRLib-1.0.4.jar
|
140 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in PTRLib-1.0.4.jar
|
141 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy Schematica-1.12.2-1.8.0.169-universal.jar
|
142 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in Schematica-1.12.2-1.8.0.169-universal.jar
|
143 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy Schematics-1.12.2.12.jar
|
144 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in Schematics-1.12.2.12.jar
|
145 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy UndergroundBiomesConstructs-1.12-1.3.8.jar
|
146 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in UndergroundBiomesConstructs-1.12-1.3.8.jar
|
147 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy orbis-lib-1.12.2-0.2.0+build411.jar
|
148 | [15:21:06] [main/DEBUG] [FML]: Not found coremod data in orbis-lib-1.12.2-0.2.0+build411.jar
|
149 | [15:21:06] [main/DEBUG] [FML]: Examining for coremod candidacy phosphor-1.12.2-0.2.6+build50.jar
|
150 | [15:21:07] [main/INFO] [FML]: Loading tweaker org.spongepowered.asm.launch.MixinTweaker from phosphor-1.12.2-0.2.6+build50.jar
|
151 | [15:21:07] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker
|
152 | [15:21:07] [main/INFO] [LaunchWrapper]: Loading tweak class name org.spongepowered.asm.launch.MixinTweaker
|
153 | [15:21:07] [main/DEBUG] [mixin]: MixinService [LaunchWrapper] was successfully booted in sun.misc.Launcher$AppClassLoader@18b4aac2
|
154 | [15:21:07] [main/INFO] [mixin]: SpongePowered MIXIN Subsystem Version=0.7.11 Source=file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar Service=LaunchWrapper Env=SERVER
|
155 | [15:21:07] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #1
|
156 | [15:21:07] [main/DEBUG] [mixin]: Initialising Mixin Platform Manager
|
157 | [15:21:07] [main/DEBUG] [mixin]: Mixin platform: primary container is file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
|
158 | [15:21:07] [main/DEBUG] [mixin]: Adding mixin platform agents for container file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
|
159 | [15:21:07] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentFML for file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
|
160 | [15:21:07] [main/DEBUG] [mixin]: ForceLoadAsMod was specified for phosphor-1.12.2-0.2.6+build50.jar, attempting force-load
|
161 | [15:21:07] [main/DEBUG] [mixin]: Adding phosphor-1.12.2-0.2.6+build50.jar to reparseable coremod collection
|
162 | [15:21:07] [main/DEBUG] [mixin]: phosphor-1.12.2-0.2.6+build50.jar has core plugin me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin. Injecting it into FML for co-initialisation:
|
163 | [15:21:07] [main/DEBUG] [FML]: Instantiating coremod class PhosphorFMLLoadingPlugin
|
164 | [15:21:07] [main/DEBUG] [FML]: The coremod me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
|
165 | [15:21:07] [main/DEBUG] [FML]: Found signing certificates for coremod PhosphorFMLLoadingPlugin (me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin)
|
166 | [15:21:07] [main/DEBUG] [FML]: Found certificate f0387d288626cc2d937daa504e74af570c52a2f1
|
167 | [15:21:07] [main/DEBUG] [FML]: Enqueued coremod PhosphorFMLLoadingPlugin
|
168 | [15:21:07] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentDefault for file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
|
169 | [15:21:07] [main/DEBUG] [mixin]: Scanning file:/server/forge.jar for mixin tweaker
|
170 | [15:21:07] [main/DEBUG] [mixin]: Scanning file:/jolokia/jolokia.jar for mixin tweaker
|
171 | [15:21:07] [main/DEBUG] [mixin]: Scanning file:/server/./mods/backpacked-1.4.2-1.12.2.jar for mixin tweaker
|
172 | [15:21:07] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Bloodmoon-MC1.12.2-1.5.3.jar for mixin tweaker
|
173 | [15:21:07] [main/DEBUG] [mixin]: Scanning file:/server/./mods/CTM-MC1.12.2-1.0.2.31.jar for mixin tweaker
|
174 | [15:21:07] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLDeobfTweaker
|
175 | [15:21:07] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker
|
176 | [15:21:07] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker
|
177 | [15:21:07] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
|
178 | [15:21:07] [main/DEBUG] [FML]: Injecting coremod FMLCorePlugin \{net.minecraftforge.fml.relauncher.FMLCorePlugin\} class transformers
|
179 | [15:21:07] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.SideTransformer
|
180 | [15:21:08] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[PREINIT]
|
181 | [15:21:08] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer
|
182 | [15:21:08] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer
|
183 | [15:21:08] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer
|
184 | [15:21:08] [main/DEBUG] [FML]: Injection complete
|
185 | [15:21:08] [main/DEBUG] [FML]: Running coremod plugin for FMLCorePlugin \{net.minecraftforge.fml.relauncher.FMLCorePlugin\}
|
186 | [15:21:08] [main/DEBUG] [FML]: Running coremod plugin FMLCorePlugin
|
187 | [15:21:14] [main/DEBUG] [FML]: Read 1154 binary patches
|
188 | [15:21:15] [main/DEBUG] [FML]: Loading deobfuscation resource /deobfuscation_data-1.12.2.lzma with 36076 records
|
189 | [15:21:18] [main/INFO] [FML]: Found valid fingerprint for Minecraft Forge. Certificate fingerprint e3c3d50c7c986df74c645c0ac54639741c90a557
|
190 | [15:21:18] [main/DEBUG] [FML]: Coremod plugin class FMLCorePlugin run successfully
|
191 | [15:21:18] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
|
192 | [15:21:18] [main/DEBUG] [FML]: Injecting coremod FMLForgePlugin \{net.minecraftforge.classloading.FMLForgePlugin\} class transformers
|
193 | [15:21:18] [main/DEBUG] [FML]: Injection complete
|
194 | [15:21:18] [main/DEBUG] [FML]: Running coremod plugin for FMLForgePlugin \{net.minecraftforge.classloading.FMLForgePlugin\}
|
195 | [15:21:18] [main/DEBUG] [FML]: Running coremod plugin FMLForgePlugin
|
196 | [15:21:18] [main/DEBUG] [FML]: Coremod plugin class FMLForgePlugin run successfully
|
197 | [15:21:18] [main/INFO] [LaunchWrapper]: Calling tweak class org.spongepowered.asm.launch.MixinTweaker
|
198 | [15:21:18] [main/DEBUG] [mixin]: Processing prepare() for PlatformAgent[MixinPlatformAgentFML:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
|
199 | [15:21:18] [main/DEBUG] [mixin]: Processing prepare() for PlatformAgent[MixinPlatformAgentDefault:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
|
200 | [15:21:18] [main/DEBUG] [mixin]: Processing launch tasks for PlatformAgent[MixinPlatformAgentFML:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
|
201 | [15:21:18] [main/DEBUG] [mixin]: Creating FML remapper adapter: org.spongepowered.asm.bridge.RemapperAdapterFML
|
202 | [15:21:18] [main/INFO] [mixin]: Initialised Mixin FML Remapper Adapter with net.minecraftforge.fml.common.asm.transformers.deobf.FMLDeobfuscatingRemapper@3b569985
|
203 | [15:21:18] [main/DEBUG] [mixin]: Processing launch tasks for PlatformAgent[MixinPlatformAgentDefault:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
|
204 | [15:21:18] [main/DEBUG] [mixin]: Scanning file:/server/forge.jar for mixin tweaker
|
205 | [15:21:18] [main/DEBUG] [mixin]: Scanning file:/jolokia/jolokia.jar for mixin tweaker
|
206 | [15:21:18] [main/DEBUG] [mixin]: Scanning file:/server/./mods/backpacked-1.4.2-1.12.2.jar for mixin tweaker
|
207 | [15:21:18] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Bloodmoon-MC1.12.2-1.5.3.jar for mixin tweaker
|
208 | [15:21:18] [main/DEBUG] [mixin]: Scanning file:/server/./mods/CTM-MC1.12.2-1.0.2.31.jar for mixin tweaker
|
209 | [15:21:18] [main/DEBUG] [mixin]: Scanning asmgen:/ for mixin tweaker
|
210 | [15:21:18] [main/DEBUG] [mixin]: inject() running with 1 agents
|
211 | [15:21:18] [main/DEBUG] [mixin]: Processing inject() for PlatformAgent[MixinPlatformAgentFML:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
|
212 | [15:21:18] [main/DEBUG] [mixin]: FML agent is co-initiralising coremod instance PhosphorFMLLoadingPlugin {[]} for file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
|
213 | [15:21:18] [main/DEBUG] [FML]: Injecting coremod PhosphorFMLLoadingPlugin \{me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin\} class transformers
|
214 | [15:21:18] [main/DEBUG] [FML]: Injection complete
|
215 | [15:21:18] [main/DEBUG] [FML]: Running coremod plugin for PhosphorFMLLoadingPlugin \{me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin\}
|
216 | [15:21:18] [main/DEBUG] [FML]: Running coremod plugin PhosphorFMLLoadingPlugin
|
217 | [15:21:18] [main/DEBUG] [Phosphor Forge Core]: Success! Phosphor has been called into from Forge... initializing Mixin environment and configurations
|
218 | [15:21:18] [main/INFO] [mixin]: Compatibility level set to JAVA_8
|
219 | [15:21:18] [main/DEBUG] [FML]: Coremod plugin class PhosphorFMLLoadingPlugin run successfully
|
220 | [15:21:18] [main/DEBUG] [mixin]: Processing inject() for PlatformAgent[MixinPlatformAgentDefault:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
|
221 | [15:21:18] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLDeobfTweaker
|
222 | [15:21:18] [main/DEBUG] [FML]: Loaded 215 rules from AccessTransformer config file forge_at.cfg
|
223 | [15:21:18] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file ./mods/EnderStorage-1.12.2-2.4.6.137-universal.jar!META-INF/es_at.cfg
|
224 |
|
225 | [15:21:18] [main/DEBUG] [FML]: Loaded 46 rules from AccessTransformer mod jar file ./mods/CodeChickenLib-1.12.2-3.2.3.358-universal.jar!META-INF/ccl_at.cfg
|
226 |
|
227 | [15:21:18] [main/DEBUG] [FML]: Loaded 4 rules from AccessTransformer mod jar file ./mods/DrZharks MoCreatures Mod-12.0.5.jar!META-INF/mocreatures_at.cfg
|
228 |
|
229 | [15:21:18] [main/DEBUG] [FML]: Loaded 9 rules from AccessTransformer mod jar file ./mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar!META-INF/orbis-lib_at.cfg
|
230 |
|
231 | [15:21:18] [main/DEBUG] [FML]: Loaded 8 rules from AccessTransformer mod jar file ./mods/Chisel-MC1.12.2-1.0.2.45.jar!META-INF/chisel_at.cfg
|
232 |
|
233 | [15:21:18] [main/DEBUG] [FML]: Loaded 20 rules from AccessTransformer mod jar file ./mods/NotEnoughItems-1.12.2-2.4.3.245-universal.jar!META-INF/nei_at.cfg
|
234 |
|
235 | [15:21:18] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file ./mods/FastFurnace-1.12.2-1.3.1.jar!META-INF/fastfurnace_at.cfg
|
236 |
|
237 | [15:21:18] [main/DEBUG] [FML]: Loaded 29 rules from AccessTransformer mod jar file ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar!META-INF/aether_at.cfg
|
238 |
|
239 | [15:21:18] [main/DEBUG] [FML]: Loaded 3 rules from AccessTransformer mod jar file ./mods/Bloodmoon-MC1.12.2-1.5.3.jar!META-INF/Bloodmoon_at.cfg
|
240 |
|
241 | [15:21:18] [main/DEBUG] [FML]: Loaded 4 rules from AccessTransformer mod jar file ./mods/CustomMobSpawner-3.11.5.jar!META-INF/customspawner_at.cfg
|
242 |
|
243 | [15:21:18] [main/DEBUG] [FML]: Loaded 3 rules from AccessTransformer mod jar file ./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar!META-INF/phosphor_at.cfg
|
244 |
|
245 | [15:21:18] [main/DEBUG] [FML]: Loaded 13 rules from AccessTransformer mod jar file ./mods/jei_1.12.2-4.16.1.302.jar!META-INF/jei_at.cfg
|
246 |
|
247 | [15:21:18] [main/DEBUG] [FML]: Loaded 4 rules from AccessTransformer mod jar file ./mods/Placebo-1.12.2-1.6.0.jar!META-INF/placebo_at.cfg
|
248 |
|
249 | [15:21:18] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file ./mods/Decocraft-2.6.3_1.12.2.jar!META-INF/decocraft_at.cfg
|
250 |
|
251 | [15:21:18] [main/DEBUG] [FML]: Loaded 5 rules from AccessTransformer mod jar file ./mods/CTM-MC1.12.2-1.0.2.31.jar!META-INF/ctm_at.cfg
|
252 |
|
253 | [15:21:18] [main/DEBUG] [FML]: Loaded 11 rules from AccessTransformer mod jar file ./mods/Schematica-1.12.2-1.8.0.169-universal.jar!META-INF/schematica_at.cfg
|
254 |
|
255 | [15:21:18] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #2
|
256 | [15:21:18] [main/DEBUG] [FML]: Validating minecraft
|
257 | [15:21:18] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[INIT]
|
258 | [15:21:19] [main/DEBUG] [FML]: Minecraft validated, launching...
|
259 | [15:21:19] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
|
260 | [15:21:19] [main/DEBUG] [FML]: Injecting coremod Backpacked \{com.mrcrayfish.backpacked.asm.BackpackedPlugin\} class transformers
|
261 | [15:21:19] [main/TRACE] [FML]: Registering transformer com.mrcrayfish.backpacked.asm.BackpackedTransformer
|
262 | [15:21:19] [main/DEBUG] [FML]: Injection complete
|
263 | [15:21:19] [main/DEBUG] [FML]: Running coremod plugin for Backpacked \{com.mrcrayfish.backpacked.asm.BackpackedPlugin\}
|
264 | [15:21:19] [main/DEBUG] [FML]: Running coremod plugin Backpacked
|
265 | [15:21:19] [main/DEBUG] [FML]: Coremod plugin class BackpackedPlugin run successfully
|
266 | [15:21:20] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
|
267 | [15:21:20] [main/DEBUG] [FML]: Injecting coremod LoadingPlugin \{lumien.bloodmoon.asm.LoadingPlugin\} class transformers
|
268 | [15:21:20] [main/TRACE] [FML]: Registering transformer lumien.bloodmoon.asm.ClassTransformer
|
269 | [15:21:20] [main/DEBUG] [FML]: Injection complete
|
270 | [15:21:20] [main/DEBUG] [FML]: Running coremod plugin for LoadingPlugin \{lumien.bloodmoon.asm.LoadingPlugin\}
|
271 | [15:21:20] [main/DEBUG] [FML]: Running coremod plugin LoadingPlugin
|
272 | [15:21:20] [main/DEBUG] [FML]: Coremod plugin class LoadingPlugin run successfully
|
273 | [15:21:20] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
|
274 | [15:21:20] [main/DEBUG] [FML]: Injecting coremod CTMCorePlugin \{team.chisel.ctm.client.asm.CTMCorePlugin\} class transformers
|
275 | [15:21:20] [main/TRACE] [FML]: Registering transformer team.chisel.ctm.client.asm.CTMTransformer
|
276 | [15:21:20] [main/DEBUG] [FML]: Injection complete
|
277 | [15:21:20] [main/DEBUG] [FML]: Running coremod plugin for CTMCorePlugin \{team.chisel.ctm.client.asm.CTMCorePlugin\}
|
278 | [15:21:20] [main/DEBUG] [FML]: Running coremod plugin CTMCorePlugin
|
279 | [15:21:20] [main/DEBUG] [FML]: Coremod plugin class CTMCorePlugin run successfully
|
280 | [15:21:20] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.TerminalTweaker
|
281 | [15:21:20] [main/INFO] [LaunchWrapper]: Loading tweak class name org.spongepowered.asm.mixin.EnvironmentStateTweaker
|
282 | [15:21:20] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.TerminalTweaker
|
283 | [15:21:20] [main/INFO] [LaunchWrapper]: Calling tweak class org.spongepowered.asm.mixin.EnvironmentStateTweaker
|
284 | [15:21:20] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #3
|
285 | [15:21:20] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[DEFAULT]
|
286 | [15:21:20] [main/DEBUG] [mixin]: Selecting config mixins.phosphor.json
|
287 | [15:21:20] [main/DEBUG] [Phosphor Plugin]: Loading configuration
|
288 | [15:21:20] [main/DEBUG] [mixin]: Preparing mixins.phosphor.json (9)
|
289 | [15:21:20] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
|
290 | [15:21:20] [main/DEBUG] [mixin]: Rebuilding transformer delegation list:
|
291 | [15:21:20] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
|
292 | [15:21:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PatchingTransformer
|
293 | [15:21:20] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
|
294 | [15:21:20] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SideTransformer
|
295 | [15:21:20] [main/DEBUG] [mixin]: Excluding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer
|
296 | [15:21:20] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer
|
297 | [15:21:20] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer
|
298 | [15:21:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
|
299 | [15:21:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.AccessTransformer
|
300 | [15:21:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ModAccessTransformer
|
301 | [15:21:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemStackTransformer
|
302 | [15:21:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockTransformer
|
303 | [15:21:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockSpecialTransformer
|
304 | [15:21:20] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PotionEffectTransformer
|
305 | [15:21:20] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
|
306 | [15:21:20] [main/DEBUG] [mixin]: Adding: $wrapper.com.mrcrayfish.backpacked.asm.BackpackedTransformer
|
307 | [15:21:20] [main/DEBUG] [mixin]: Adding: $wrapper.lumien.bloodmoon.asm.ClassTransformer
|
308 | [15:21:20] [main/DEBUG] [mixin]: Adding: $wrapper.team.chisel.ctm.client.asm.CTMTransformer
|
309 | [15:21:20] [main/DEBUG] [mixin]: Excluding: net.minecraftforge.fml.common.asm.transformers.TerminalTransformer
|
310 | [15:21:20] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
|
311 | [15:21:20] [main/DEBUG] [mixin]: Transformer delegation list created with 14 entries
|
312 | [15:21:20] [main/DEBUG] [Phosphor Plugin]: Disabled patch 'me.jellysquid.mods.phosphor.mixins.lighting.client.MixinMinecraft' because it targets an client-side class unavailable in the current environment
|
313 | [15:21:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/storage/AnvilChunkLoader to metadata cache
|
314 | [15:21:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/Chunk to metadata cache
|
315 | [15:21:20] [main/DEBUG] [Phosphor Plugin]: Disabled patch 'me.jellysquid.mods.phosphor.mixins.lighting.common.MixinChunk$Sponge' because we are in a standard Vanilla/Forge environment
|
316 | [15:21:21] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/gen/ChunkProviderServer to metadata cache
|
317 | [15:21:21] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/storage/ExtendedBlockStorage to metadata cache
|
318 | [15:21:21] [main/TRACE] [mixin]: Added class metadata for net/minecraft/network/play/server/SPacketChunkData to metadata cache
|
319 | [15:21:21] [main/DEBUG] [Bloodmoon]: Found World Class: net/minecraft/world/World
|
320 | [15:21:21] [main/INFO] [mixin]: A re-entrant transformer '$wrapper.lumien.bloodmoon.asm.ClassTransformer' was detected and will no longer process meta class data
|
321 | [15:21:21] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/World to metadata cache
|
322 | [15:21:21] [main/DEBUG] [mixin]: Rebuilding transformer delegation list:
|
323 | [15:21:21] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
|
324 | [15:21:21] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PatchingTransformer
|
325 | [15:21:21] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
|
326 | [15:21:21] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SideTransformer
|
327 | [15:21:21] [main/DEBUG] [mixin]: Excluding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer
|
328 | [15:21:21] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer
|
329 | [15:21:21] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer
|
330 | [15:21:21] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
|
331 | [15:21:21] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.AccessTransformer
|
332 | [15:21:21] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ModAccessTransformer
|
333 | [15:21:21] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemStackTransformer
|
334 | [15:21:21] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockTransformer
|
335 | [15:21:21] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockSpecialTransformer
|
336 | [15:21:21] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PotionEffectTransformer
|
337 | [15:21:21] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
|
338 | [15:21:21] [main/DEBUG] [mixin]: Adding: $wrapper.com.mrcrayfish.backpacked.asm.BackpackedTransformer
|
339 | [15:21:21] [main/DEBUG] [mixin]: Excluding: $wrapper.lumien.bloodmoon.asm.ClassTransformer
|
340 | [15:21:21] [main/DEBUG] [mixin]: Adding: $wrapper.team.chisel.ctm.client.asm.CTMTransformer
|
341 | [15:21:21] [main/DEBUG] [mixin]: Excluding: net.minecraftforge.fml.common.asm.transformers.TerminalTransformer
|
342 | [15:21:21] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
|
343 | [15:21:21] [main/DEBUG] [mixin]: Transformer delegation list created with 13 entries
|
344 | [15:21:21] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/Chunk$EnumCreateEntityType to metadata cache
|
345 | [15:21:21] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/EnumFacing$Plane to metadata cache
|
346 | [15:21:21] [main/DEBUG] [mixin]: Prepared 7 mixins in 1.303 sec (186.1ms avg) (6ms load, 738ms transform, 0ms plugin)
|
347 | [15:21:21] [main/DEBUG] [Bloodmoon]: Found World Class: net/minecraft/world/World
|
348 | [15:21:21] [main/DEBUG] [mixin]: Mixing common.MixinWorld from mixins.phosphor.json into net.minecraft.world.World
|
349 | [15:21:21] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/ILightingEngineProvider to metadata cache
|
350 | [15:21:21] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/mod/world/lighting/LightingEngine to metadata cache
|
351 | [15:21:21] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/ILightingEngine to metadata cache
|
352 | [15:21:22] [main/TRACE] [mixin]: Added class metadata for java/lang/Boolean to metadata cache
|
353 | [15:21:22] [main/TRACE] [mixin]: Added class metadata for java/io/Serializable to metadata cache
|
354 | [15:21:22] [main/TRACE] [mixin]: Added class metadata for java/lang/Comparable to metadata cache
|
355 | [15:21:22] [main/TRACE] [mixin]: Added class metadata for org/spongepowered/asm/mixin/injection/callback/CallbackInfoReturnable to metadata cache
|
356 | [15:21:22] [main/TRACE] [mixin]: Added class metadata for org/spongepowered/asm/mixin/injection/callback/CallbackInfo to metadata cache
|
357 | [15:21:22] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/EnumSkyBlock to metadata cache
|
358 | [15:21:22] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/math/BlockPos to metadata cache
|
359 | [15:21:22] [main/INFO] [STDOUT]: [com.mrcrayfish.backpacked.asm.BackpackedTransformer:patch:68]: [Backpacked] Starting to patch: net.minecraft.entity.player.EntityPlayer#<init>(Lnet/minecraft/world/World;Lcom/mojang/authlib/GameProfile;)V
|
360 | [15:21:22] [main/INFO] [STDOUT]: [com.mrcrayfish.backpacked.asm.BackpackedTransformer:patch:71]: [Backpacked] Successfully patched: net.minecraft.entity.player.EntityPlayer#<init>(Lnet/minecraft/world/World;Lcom/mojang/authlib/GameProfile;)V
|
361 | [15:21:23] [main/INFO] [LaunchWrapper]: Launching wrapped minecraft {net.minecraft.server.MinecraftServer}
|
362 | [15:21:24] [main/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:preTransform:230]: Transforming Class [net.minecraft.block.Block], Method [getExtendedState]
|
363 | [15:21:24] [main/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:finishTransform:242]: Transforming net.minecraft.block.Block Finished.
|
364 | [15:21:45] [main/DEBUG] [FML]: Creating vanilla freeze snapshot
|
365 | [15:21:45] [main/DEBUG] [FML]: Vanilla freeze snapshot created
|
366 | [15:21:48] [main/DEBUG] [mixin]: Mixing common.MixinAnvilChunkLoader from mixins.phosphor.json into net.minecraft.world.chunk.storage.AnvilChunkLoader
|
367 | [15:21:48] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/mod/world/lighting/LightingHooks to metadata cache
|
368 | [15:21:48] [main/TRACE] [mixin]: Added class metadata for net/minecraft/nbt/NBTTagCompound to metadata cache
|
369 | [15:21:48] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/IChunkLightingData to metadata cache
|
370 | [15:21:48] [main/TRACE] [mixin]: Added class metadata for java/lang/Exception to metadata cache
|
371 | [15:21:48] [main/TRACE] [mixin]: Added class metadata for java/lang/Throwable to metadata cache
|
372 | [15:21:48] [main/TRACE] [mixin]: Added class metadata for net/minecraft/nbt/NBTBase to metadata cache
|
373 | [15:21:49] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Starting minecraft server version 1.12.2
|
374 | [15:21:49] [Server thread/INFO] [FML]: MinecraftForge v14.23.5.2855 Initialized
|
375 | [15:21:50] [Server thread/INFO] [FML]: Starts to replace vanilla recipe ingredients with ore ingredients.
|
376 | [15:21:51] [Server thread/INFO] [FML]: Invalid recipe found with multiple oredict ingredients in the same ingredient...
|
377 | [15:21:52] [Server thread/INFO] [FML]: Replaced 1227 ore ingredients
|
378 | [15:21:53] [Server thread/DEBUG] [FML]: File /server/config/injectedDependencies.json not found. No dependencies injected
|
379 | [15:21:53] [Server thread/DEBUG] [FML]: Building injected Mod Containers [net.minecraftforge.fml.common.FMLContainer, net.minecraftforge.common.ForgeModContainer, com.mrcrayfish.backpacked.Backpacked]
|
380 | [15:21:53] [Server thread/DEBUG] [FML]: Attempting to load mods contained in the minecraft jar file and associated classes
|
381 | [15:21:53] [Server thread/DEBUG] [FML]: Found a minecraft related file at /server/forge.jar, examining for mod candidates
|
382 | [15:21:54] [Server thread/DEBUG] [FML]: Found a minecraft related file at /jolokia/jolokia.jar, examining for mod candidates
|
383 | [15:21:54] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/backpacked-1.4.2-1.12.2.jar
|
384 | [15:21:54] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/Bloodmoon-MC1.12.2-1.5.3.jar
|
385 | [15:21:54] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/CTM-MC1.12.2-1.0.2.31.jar
|
386 | [15:21:54] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
|
387 | [15:21:54] [Server thread/DEBUG] [FML]: Minecraft jar mods loaded successfully
|
388 | [15:21:54] [Server thread/INFO] [FML]: Searching /server/./mods for mods
|
389 | [15:21:54] [Server thread/DEBUG] [FML]: Adding Blocklings 6.0.1_b - 1.12.2.jar to the mod list
|
390 | [15:21:54] [Server thread/DEBUG] [FML]: Adding backpacked-1.4.2-1.12.2.jar to the mod list
|
391 | [15:21:54] [Server thread/DEBUG] [FML]: Adding Bloodmoon-MC1.12.2-1.5.3.jar to the mod list
|
392 | [15:21:54] [Server thread/DEBUG] [FML]: Adding CustomMobSpawner-3.11.5.jar to the mod list
|
393 | [15:21:54] [Server thread/DEBUG] [FML]: Adding ironchest-1.12.2-7.0.72.847.jar to the mod list
|
394 | [15:21:54] [Server thread/DEBUG] [FML]: Adding EnderStorage-1.12.2-2.4.6.137-universal.jar to the mod list
|
395 | [15:21:54] [Server thread/DEBUG] [FML]: Adding aether_ii-1.12.2-0.3.0+build411-universal.jar to the mod list
|
396 | [15:21:54] [Server thread/DEBUG] [FML]: Adding CodeChickenLib-1.12.2-3.2.3.358-universal.jar to the mod list
|
397 | [15:21:54] [Server thread/DEBUG] [FML]: Adding Decocraft-2.6.3_1.12.2.jar to the mod list
|
398 | [15:21:54] [Server thread/DEBUG] [FML]: Adding DoomlikeDungeons-1.13.2-MC1.12.2.jar to the mod list
|
399 | [15:21:54] [Server thread/DEBUG] [FML]: Adding Schematics-1.12.2.12.jar to the mod list
|
400 | [15:21:54] [Server thread/DEBUG] [FML]: Adding Chisel-MC1.12.2-1.0.2.45.jar to the mod list
|
401 | [15:21:54] [Server thread/DEBUG] [FML]: Adding FastFurnace-1.12.2-1.3.1.jar to the mod list
|
402 | [15:21:54] [Server thread/DEBUG] [FML]: Adding NotEnoughItems-1.12.2-2.4.3.245-universal.jar to the mod list
|
403 | [15:21:54] [Server thread/DEBUG] [FML]: Adding CTM-MC1.12.2-1.0.2.31.jar to the mod list
|
404 | [15:21:54] [Server thread/DEBUG] [FML]: Adding Placebo-1.12.2-1.6.0.jar to the mod list
|
405 | [15:21:54] [Server thread/DEBUG] [FML]: Adding Schematica-1.12.2-1.8.0.169-universal.jar to the mod list
|
406 | [15:21:54] [Server thread/DEBUG] [FML]: Adding UndergroundBiomesConstructs-1.12-1.3.8.jar to the mod list
|
407 | [15:21:54] [Server thread/DEBUG] [FML]: Adding PTRLib-1.0.4.jar to the mod list
|
408 | [15:21:54] [Server thread/DEBUG] [FML]: Adding Netherending-Ores-1.12.2-1.4.2.jar to the mod list
|
409 | [15:21:54] [Server thread/DEBUG] [FML]: Adding LunatriusCore-1.12.2-1.2.0.42-universal.jar to the mod list
|
410 | [15:21:54] [Server thread/DEBUG] [FML]: Adding jei_1.12.2-4.16.1.302.jar to the mod list
|
411 | [15:21:54] [Server thread/DEBUG] [FML]: Adding AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar to the mod list
|
412 | [15:21:54] [Server thread/DEBUG] [FML]: Adding DrZharks MoCreatures Mod-12.0.5.jar to the mod list
|
413 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar
|
414 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file aether_ii-1.12.2-0.3.0+build411-universal.jar
|
415 | [15:21:54] [Server thread/TRACE] [FML]: Skipping already parsed coremod or tweaker backpacked-1.4.2-1.12.2.jar
|
416 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Blocklings 6.0.1_b - 1.12.2.jar
|
417 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Bloodmoon-MC1.12.2-1.5.3.jar
|
418 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Chisel-MC1.12.2-1.0.2.45.jar
|
419 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CodeChickenLib-1.12.2-3.2.3.358-universal.jar
|
420 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CTM-MC1.12.2-1.0.2.31.jar
|
421 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CustomMobSpawner-3.11.5.jar
|
422 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Decocraft-2.6.3_1.12.2.jar
|
423 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file DoomlikeDungeons-1.13.2-MC1.12.2.jar
|
424 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file DrZharks MoCreatures Mod-12.0.5.jar
|
425 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file EnderStorage-1.12.2-2.4.6.137-universal.jar
|
426 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file FastFurnace-1.12.2-1.3.1.jar
|
427 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file ironchest-1.12.2-7.0.72.847.jar
|
428 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file jei_1.12.2-4.16.1.302.jar
|
429 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file LunatriusCore-1.12.2-1.2.0.42-universal.jar
|
430 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Netherending-Ores-1.12.2-1.4.2.jar
|
431 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file NotEnoughItems-1.12.2-2.4.3.245-universal.jar
|
432 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Placebo-1.12.2-1.6.0.jar
|
433 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file PTRLib-1.0.4.jar
|
434 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Schematica-1.12.2-1.8.0.169-universal.jar
|
435 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Schematics-1.12.2.12.jar
|
436 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file UndergroundBiomesConstructs-1.12-1.3.8.jar
|
437 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file orbis-lib-1.12.2-0.2.0+build411.jar
|
438 | [15:21:54] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file phosphor-1.12.2-0.2.6+build50.jar
|
439 | [15:21:54] [Server thread/DEBUG] [FML]: Examining file forge.jar for potential mods
|
440 | [15:21:54] [Server thread/DEBUG] [FML]: The mod container forge.jar appears to be missing an mcmod.info file
|
441 | [15:21:55] [Server thread/DEBUG] [FML]: Examining file jolokia.jar for potential mods
|
442 | [15:21:55] [Server thread/DEBUG] [FML]: The mod container jolokia.jar appears to be missing an mcmod.info file
|
443 | [15:21:56] [Server thread/DEBUG] [FML]: Examining file AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar for potential mods
|
444 | [15:21:56] [Server thread/TRACE] [FML]: Located mcmod.info file in file AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar
|
445 | [15:21:56] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.shinoow.abyssalcraft.AbyssalCraft) - loading
|
446 | [15:21:56] [Server thread/TRACE] [FML]: Parsed dependency info for abyssalcraft: Requirements: [forge@[14.23.4.2747,)] After:[forge@[14.23.4.2747,), jei@[4.11.0,)] Before:[]
|
447 | [15:21:57] [Server thread/DEBUG] [FML]: Examining file aether_ii-1.12.2-0.3.0+build411-universal.jar for potential mods
|
448 | [15:21:57] [Server thread/TRACE] [FML]: Located mcmod.info file in file aether_ii-1.12.2-0.3.0+build411-universal.jar
|
449 | [15:21:58] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.gildedgames.aether.common.AetherCore) - loading
|
450 | [15:21:58] [Server thread/TRACE] [FML]: Parsed dependency info for aether: Requirements: [orbis-lib@[0.2.0,), forge@[14.23.5.2816,)] After:[orbis-lib@[0.2.0,), forge@[14.23.5.2816,)] Before:[]
|
451 | [15:21:59] [Server thread/DEBUG] [FML]: Examining file Blocklings 6.0.1_b - 1.12.2.jar for potential mods
|
452 | [15:21:59] [Server thread/TRACE] [FML]: Located mcmod.info file in file Blocklings 6.0.1_b - 1.12.2.jar
|
453 | [15:21:59] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.blocklings.main.Blocklings) - loading
|
454 | [15:21:59] [Server thread/TRACE] [FML]: Parsed dependency info for blocklings: Requirements: [] After:[] Before:[]
|
455 | [15:21:59] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from Blocklings 6.0.1_b - 1.12.2.jar to locate a version number for mod blocklings
|
456 | [15:21:59] [Server thread/WARN] [FML]: Mod blocklings is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.0
|
457 | [15:21:59] [Server thread/DEBUG] [FML]: Examining file Bloodmoon-MC1.12.2-1.5.3.jar for potential mods
|
458 | [15:21:59] [Server thread/TRACE] [FML]: Located mcmod.info file in file Bloodmoon-MC1.12.2-1.5.3.jar
|
459 | [15:21:59] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (lumien.bloodmoon.Bloodmoon) - loading
|
460 | [15:21:59] [Server thread/TRACE] [FML]: Parsed dependency info for bloodmoon: Requirements: [] After:[] Before:[]
|
461 | [15:21:59] [Server thread/DEBUG] [FML]: Examining file Chisel-MC1.12.2-1.0.2.45.jar for potential mods
|
462 | [15:21:59] [Server thread/TRACE] [FML]: Located mcmod.info file in file Chisel-MC1.12.2-1.0.2.45.jar
|
463 | [15:21:59] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (team.chisel.Chisel) - loading
|
464 | [15:21:59] [Server thread/TRACE] [FML]: Parsed dependency info for chisel: Requirements: [forge@[14.23.5.2806,)] After:[forge@[14.23.5.2806,), jei@[4.12.0,5)] Before:[]
|
465 | [15:21:59] [Server thread/DEBUG] [FML]: Examining file CodeChickenLib-1.12.2-3.2.3.358-universal.jar for potential mods
|
466 | [15:21:59] [Server thread/TRACE] [FML]: Located mcmod.info file in file CodeChickenLib-1.12.2-3.2.3.358-universal.jar
|
467 | [15:21:59] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (codechicken.lib.CodeChickenLib) - loading
|
468 | [15:21:59] [Server thread/TRACE] [FML]: Parsed dependency info for codechickenlib: Requirements: [forge@[14.23.4.2718,)] After:[forge@[14.23.4.2718,)] Before:[]
|
469 | [15:21:59] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from CodeChickenLib-1.12.2-3.2.3.358-universal.jar to locate a version number for mod codechickenlib
|
470 | [15:21:59] [Server thread/WARN] [FML]: Mod codechickenlib is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version **.**.**.**
|
471 | [15:22:00] [Server thread/DEBUG] [FML]: Examining file CTM-MC1.12.2-1.0.2.31.jar for potential mods
|
472 | [15:22:00] [Server thread/TRACE] [FML]: Located mcmod.info file in file CTM-MC1.12.2-1.0.2.31.jar
|
473 | [15:22:00] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (team.chisel.ctm.CTM) - loading
|
474 | [15:22:00] [Server thread/INFO] [FML]: Disabling mod ctm it is client side only.
|
475 | [15:22:00] [Server thread/DEBUG] [FML]: Skipping mod team.chisel.ctm.CTM, container opted to not load.
|
476 | [15:22:00] [Server thread/DEBUG] [FML]: Examining file CustomMobSpawner-3.11.5.jar for potential mods
|
477 | [15:22:00] [Server thread/TRACE] [FML]: Located mcmod.info file in file CustomMobSpawner-3.11.5.jar
|
478 | [15:22:00] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (drzhark.customspawner.CustomSpawner) - loading
|
479 | [15:22:00] [Server thread/TRACE] [FML]: Parsed dependency info for customspawner: Requirements: [] After:[] Before:[]
|
480 | [15:22:00] [Server thread/DEBUG] [FML]: Examining file Decocraft-2.6.3_1.12.2.jar for potential mods
|
481 | [15:22:00] [Server thread/TRACE] [FML]: Located mcmod.info file in file Decocraft-2.6.3_1.12.2.jar
|
482 | [15:22:00] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mia.props.Props) - loading
|
483 | [15:22:00] [Server thread/TRACE] [FML]: Parsed dependency info for props: Requirements: [] After:[ptrmodellib] Before:[]
|
484 | [15:22:00] [Server thread/DEBUG] [FML]: Examining file DoomlikeDungeons-1.13.2-MC1.12.2.jar for potential mods
|
485 | [15:22:00] [Server thread/TRACE] [FML]: Located mcmod.info file in file DoomlikeDungeons-1.13.2-MC1.12.2.jar
|
486 | [15:22:00] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (jaredbgreat.dldungeons.DoomlikeDungeons) - loading
|
487 | [15:22:00] [Server thread/TRACE] [FML]: Parsed dependency info for dldungeonsjbg: Requirements: [] After:[] Before:[]
|
488 | [15:22:00] [Server thread/DEBUG] [FML]: Examining file DrZharks MoCreatures Mod-12.0.5.jar for potential mods
|
489 | [15:22:00] [Server thread/TRACE] [FML]: Located mcmod.info file in file DrZharks MoCreatures Mod-12.0.5.jar
|
490 | [15:22:00] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (drzhark.mocreatures.MoCreatures) - loading
|
491 | [15:22:00] [Server thread/TRACE] [FML]: Using mcmod dependency info for mocreatures: [] [CustomSpawner] []
|
492 | [15:22:00] [Server thread/DEBUG] [FML]: Examining file EnderStorage-1.12.2-2.4.6.137-universal.jar for potential mods
|
493 | [15:22:00] [Server thread/TRACE] [FML]: Located mcmod.info file in file EnderStorage-1.12.2-2.4.6.137-universal.jar
|
494 | [15:22:00] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (codechicken.enderstorage.EnderStorage) - loading
|
495 | [15:22:00] [Server thread/TRACE] [FML]: Parsed dependency info for enderstorage: Requirements: [codechickenlib@[3.2.3,), forge@[14.23.4,)] After:[forge@[14.23.4,), codechickenlib@[3.2.3,)] Before:[]
|
496 | [15:22:00] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from EnderStorage-1.12.2-2.4.6.137-universal.jar to locate a version number for mod enderstorage
|
497 | [15:22:00] [Server thread/WARN] [FML]: Mod enderstorage is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version **.**.**.**
|
498 | [15:22:00] [Server thread/DEBUG] [FML]: Examining file FastFurnace-1.12.2-1.3.1.jar for potential mods
|
499 | [15:22:00] [Server thread/TRACE] [FML]: Located mcmod.info file in file FastFurnace-1.12.2-1.3.1.jar
|
500 | [15:22:00] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (shadows.fastfurnace.FastFurnace) - loading
|
501 | [15:22:00] [Server thread/TRACE] [FML]: Parsed dependency info for fastfurnace: Requirements: [] After:[] Before:[]
|
502 | [15:22:00] [Server thread/DEBUG] [FML]: Examining file ironchest-1.12.2-7.0.72.847.jar for potential mods
|
503 | [15:22:00] [Server thread/TRACE] [FML]: Located mcmod.info file in file ironchest-1.12.2-7.0.72.847.jar
|
504 | [15:22:00] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (cpw.mods.ironchest.IronChest) - loading
|
505 | [15:22:00] [Server thread/TRACE] [FML]: Parsed dependency info for ironchest: Requirements: [forge@[14.21.0.2359,)] After:[forge@[14.21.0.2359,)] Before:[]
|
506 | [15:22:00] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from ironchest-1.12.2-7.0.72.847.jar to locate a version number for mod ironchest
|
507 | [15:22:00] [Server thread/DEBUG] [FML]: Found version null for mod ironchest in version.properties, using
|
508 | [15:22:00] [Server thread/WARN] [FML]: Mod ironchest is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.12.2-7.0.67.844
|
509 | [15:22:00] [Server thread/DEBUG] [FML]: Examining file jei_1.12.2-4.16.1.302.jar for potential mods
|
510 | [15:22:00] [Server thread/TRACE] [FML]: Located mcmod.info file in file jei_1.12.2-4.16.1.302.jar
|
511 | [15:22:00] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (mezz.jei.JustEnoughItems) - loading
|
512 | [15:22:00] [Server thread/TRACE] [FML]: Parsed dependency info for jei: Requirements: [forge@[14.23.5.2816,)] After:[forge@[14.23.5.2816,)] Before:[]
|
513 | [15:22:00] [Server thread/DEBUG] [FML]: Examining file LunatriusCore-1.12.2-1.2.0.42-universal.jar for potential mods
|
514 | [15:22:00] [Server thread/TRACE] [FML]: Located mcmod.info file in file LunatriusCore-1.12.2-1.2.0.42-universal.jar
|
515 | [15:22:00] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.github.lunatrius.core.LunatriusCore) - loading
|
516 | [15:22:00] [Server thread/TRACE] [FML]: Using mcmod dependency info for lunatriuscore: [forge@[14.23.0.2491,)] [forge@[14.23.0.2491,)] []
|
517 | [15:22:00] [Server thread/DEBUG] [FML]: Examining file Netherending-Ores-1.12.2-1.4.2.jar for potential mods
|
518 | [15:22:00] [Server thread/TRACE] [FML]: Located mcmod.info file in file Netherending-Ores-1.12.2-1.4.2.jar
|
519 | [15:22:00] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (org.icannt.netherendingores.NetherendingOres) - loading
|
520 | [15:22:00] [Server thread/TRACE] [FML]: Parsed dependency info for netherendingores: Requirements: [forge@[14.23.5.2847,)] After:[forge@[14.23.5.2847,), mantle@[1.12-1.3.1,), tconstruct@[1.12.2-2.9.1,), plustic, appliedenergistics2, mekanism@[1.12.2-9.4.13.349,), matteroverdrive, bigreactors, immersiveengineering, waila, wawla, aether, aether_legacy, projectred-exploration] Before:[]
|
521 | [15:22:00] [Server thread/DEBUG] [FML]: Examining file NotEnoughItems-1.12.2-2.4.3.245-universal.jar for potential mods
|
522 | [15:22:00] [Server thread/TRACE] [FML]: Located mcmod.info file in file NotEnoughItems-1.12.2-2.4.3.245-universal.jar
|
523 | [15:22:01] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (codechicken.nei.NotEnoughItems) - loading
|
524 | [15:22:01] [Server thread/TRACE] [FML]: Parsed dependency info for nei: Requirements: [codechickenlib@[3.2.3,), forge@[14.23.5.2768,), jei@[4.12.0.+.,)] After:[codechickenlib@[3.2.3,), jei@[4.12.0.+.,), forge@[14.23.5.2768,)] Before:[]
|
525 | [15:22:01] [Server thread/DEBUG] [FML]: Examining file Placebo-1.12.2-1.6.0.jar for potential mods
|
526 | [15:22:01] [Server thread/TRACE] [FML]: Located mcmod.info file in file Placebo-1.12.2-1.6.0.jar
|
527 | [15:22:01] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (shadows.placebo.Placebo) - loading
|
528 | [15:22:01] [Server thread/TRACE] [FML]: Parsed dependency info for placebo: Requirements: [] After:[] Before:[]
|
529 | [15:22:01] [Server thread/DEBUG] [FML]: Examining file PTRLib-1.0.4.jar for potential mods
|
530 | [15:22:01] [Server thread/TRACE] [FML]: Located mcmod.info file in file PTRLib-1.0.4.jar
|
531 | [15:22:01] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mia.craftstudio.minecraft.forge.CSLibMod) - loading
|
532 | [15:22:01] [Server thread/INFO] [FML]: Disabling mod ptrmodellib it is client side only.
|
533 | [15:22:01] [Server thread/DEBUG] [FML]: Skipping mod com.mia.craftstudio.minecraft.forge.CSLibMod, container opted to not load.
|
534 | [15:22:01] [Server thread/DEBUG] [FML]: Examining file Schematica-1.12.2-1.8.0.169-universal.jar for potential mods
|
535 | [15:22:01] [Server thread/TRACE] [FML]: Located mcmod.info file in file Schematica-1.12.2-1.8.0.169-universal.jar
|
536 | [15:22:01] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.github.lunatrius.schematica.Schematica) - loading
|
537 | [15:22:01] [Server thread/TRACE] [FML]: Using mcmod dependency info for schematica: [forge@[14.23.0.2491,), lunatriuscore@[**.**.**.**,)] [forge@[14.23.0.2491,), lunatriuscore@[**.**.**.**,)] []
|
538 | [15:22:01] [Server thread/DEBUG] [FML]: Examining file Schematics-1.12.2.12.jar for potential mods
|
539 | [15:22:01] [Server thread/TRACE] [FML]: Located mcmod.info file in file Schematics-1.12.2.12.jar
|
540 | [15:22:01] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.dyn.schematics.SchematicMod) - loading
|
541 | [15:22:01] [Server thread/TRACE] [FML]: Parsed dependency info for schematics: Requirements: [] After:[] Before:[]
|
542 | [15:22:01] [Server thread/DEBUG] [FML]: Examining file UndergroundBiomesConstructs-1.12-1.3.8.jar for potential mods
|
543 | [15:22:01] [Server thread/TRACE] [FML]: Located mcmod.info file in file UndergroundBiomesConstructs-1.12-1.3.8.jar
|
544 | [15:22:01] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (exterminatorjeff.undergroundbiomes.core.UndergroundBiomes) - loading
|
545 | [15:22:01] [Server thread/TRACE] [FML]: Using mcmod dependency info for undergroundbiomes: [] [actuallyadditions, forestry, ic2] []
|
546 | [15:22:01] [Server thread/DEBUG] [FML]: Examining file orbis-lib-1.12.2-0.2.0+build411.jar for potential mods
|
547 | [15:22:01] [Server thread/TRACE] [FML]: Located mcmod.info file in file orbis-lib-1.12.2-0.2.0+build411.jar
|
548 | [15:22:01] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.gildedgames.orbis.lib.OrbisLib) - loading
|
549 | [15:22:01] [Server thread/TRACE] [FML]: Using mcmod dependency info for orbis-lib: [] [] []
|
550 | [15:22:02] [Server thread/DEBUG] [FML]: Examining file phosphor-1.12.2-0.2.6+build50.jar for potential mods
|
551 | [15:22:02] [Server thread/TRACE] [FML]: Located mcmod.info file in file phosphor-1.12.2-0.2.6+build50.jar
|
552 | [15:22:02] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.jellysquid.mods.phosphor.mod.PhosphorMod) - loading
|
553 | [15:22:02] [Server thread/TRACE] [FML]: Parsed dependency info for phosphor-lighting: Requirements: [] After:[neid@[**.**.**.**,), spongeforge@[1.12.2-2838-7.1.7-RC3844,)] Before:[]
|
554 | [15:22:02] [Server thread/INFO] [FML]: Forge Mod Loader has identified 28 mods to load
|
555 | [15:22:02] [Server thread/DEBUG] [FML]: Found API team.chisel.api.carving (owned by Chisel providing ChiselAPI|Carving) embedded in chisel
|
556 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.entity (owned by abyssalcraft providing AbyssalCraftAPI|Entity) embedded in abyssalcraft
|
557 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.recipe (owned by abyssalcraft providing AbyssalCraftAPI|Recipe) embedded in abyssalcraft
|
558 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.transfer (owned by abyssalcraft providing AbyssalCraftAPI|Transfer) embedded in abyssalcraft
|
559 | [15:22:02] [Server thread/DEBUG] [FML]: Found API jaredbgreat.dldungeons.api (owned by DLDungeonsJBG providing DLDungeonsAPI) embedded in dldungeonsjbg
|
560 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.block (owned by abyssalcraft providing AbyssalCraftAPI|Block) embedded in abyssalcraft
|
561 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.necronomicon.condition (owned by abyssalcraft providing AbyssalCraftAPI|Condition) embedded in abyssalcraft
|
562 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.energy (owned by abyssalcraft providing AbyssalCraftAPI|Energy) embedded in abyssalcraft
|
563 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.energy.structure (owned by abyssalcraft providing AbyssalCraftAPI|Structure) embedded in abyssalcraft
|
564 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.dimension (owned by abyssalcraft providing AbyssalCraftAPI|Dimension) embedded in abyssalcraft
|
565 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.energy.disruption (owned by abyssalcraft providing AbyssalCraftAPI|Disruption) embedded in abyssalcraft
|
566 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.transfer.caps (owned by abyssalcraft providing AbyssalCraftAPI|TransferCaps) embedded in abyssalcraft
|
567 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.github.lunatrius.schematica.api.event (owned by SchematicaAPI providing SchematicaAPI|Events) embedded in schematica
|
568 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.ritual (owned by abyssalcraft providing AbyssalCraftAPI|Ritual) embedded in abyssalcraft
|
569 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.integration (owned by abyssalcraft providing AbyssalCraftAPI|Integration) embedded in abyssalcraft
|
570 | [15:22:02] [Server thread/DEBUG] [FML]: Found API mezz.jei.api (owned by jei providing JustEnoughItemsAPI) embedded in jei
|
571 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api (owned by abyssalcraft providing AbyssalCraftAPI) embedded in abyssalcraft
|
572 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.spell (owned by abyssalcraft providing AbyssalCraftAPI|Spell) embedded in abyssalcraft
|
573 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.rending (owned by abyssalcraft providing AbyssalCraftAPI|Rending) embedded in abyssalcraft
|
574 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.github.lunatrius.schematica.api (owned by Schematica providing SchematicaAPI) embedded in schematica
|
575 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.event (owned by abyssalcraft providing AbyssalCraftAPI|Event) embedded in abyssalcraft
|
576 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.item (owned by abyssalcraft providing AbyssalCraftAPI|Item) embedded in abyssalcraft
|
577 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.internal (owned by abyssalcraft providing AbyssalCraftAPI|Internal) embedded in abyssalcraft
|
578 | [15:22:02] [Server thread/DEBUG] [FML]: Found API team.chisel.api (owned by chisel providing Chisel-API) embedded in chisel
|
579 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.necronomicon.condition.caps (owned by abyssalcraft providing AbyssalCraftAPI|Caps) embedded in abyssalcraft
|
580 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.biome (owned by abyssalcraft providing AbyssalCraftAPI|Biome) embedded in abyssalcraft
|
581 | [15:22:02] [Server thread/DEBUG] [FML]: Found API com.shinoow.abyssalcraft.api.necronomicon (owned by abyssalcraft providing AbyssalCraftAPI|Necronomicon) embedded in abyssalcraft
|
582 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Integration: owner: abyssalcraft, dependents: []
|
583 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API SchematicaAPI: owner: Schematica, dependents: [schematica]
|
584 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Caps: owner: abyssalcraft, dependents: []
|
585 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Event: owner: abyssalcraft, dependents: []
|
586 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Transfer: owner: abyssalcraft, dependents: []
|
587 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI: owner: abyssalcraft, dependents: []
|
588 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-utils: owner: ctm, dependents: []
|
589 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Recipe: owner: abyssalcraft, dependents: []
|
590 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|TransferCaps: owner: abyssalcraft, dependents: []
|
591 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Rending: owner: abyssalcraft, dependents: []
|
592 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Biome: owner: abyssalcraft, dependents: []
|
593 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Energy: owner: abyssalcraft, dependents: []
|
594 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-models: owner: ctm, dependents: []
|
595 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-textures: owner: ctm, dependents: []
|
596 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API ChiselAPI|Carving: owner: Chisel, dependents: [chisel]
|
597 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Structure: owner: abyssalcraft, dependents: []
|
598 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Necronomicon: owner: abyssalcraft, dependents: []
|
599 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Disruption: owner: abyssalcraft, dependents: []
|
600 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Block: owner: abyssalcraft, dependents: []
|
601 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API JustEnoughItemsAPI: owner: jei, dependents: []
|
602 | [15:22:02] [Server thread/TRACE] [FML]: Removing upstream parent Schematica from APIContainer{SchematicaAPI|Events:1.1}
|
603 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API SchematicaAPI|Events: owner: SchematicaAPI, dependents: [schematica]
|
604 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Ritual: owner: abyssalcraft, dependents: []
|
605 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API DLDungeonsAPI: owner: DLDungeonsJBG, dependents: [dldungeonsjbg]
|
606 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Condition: owner: abyssalcraft, dependents: []
|
607 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-events: owner: ctm, dependents: []
|
608 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Dimension: owner: abyssalcraft, dependents: []
|
609 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API Chisel-API: owner: chisel, dependents: []
|
610 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Internal: owner: abyssalcraft, dependents: []
|
611 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Spell: owner: abyssalcraft, dependents: []
|
612 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api: owner: ctm, dependents: []
|
613 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Item: owner: abyssalcraft, dependents: []
|
614 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API AbyssalCraftAPI|Entity: owner: abyssalcraft, dependents: []
|
615 | [15:22:02] [Server thread/DEBUG] [FML]: Creating API container dummy for API CSLib|API: owner: ptrmodellib, dependents: []
|
616 | [15:22:02] [Server thread/TRACE] [FML]: Received a system property request ''
|
617 | [15:22:02] [Server thread/TRACE] [FML]: System property request managing the state of 0 mods
|
618 | [15:22:02] [Server thread/DEBUG] [FML]: After merging, found state information for 0 mods
|
619 | [15:22:02] [Server thread/WARN] [FML]: Missing English translation for FML: assets/fml/lang/en_us.lang
|
620 | [15:22:02] [Server thread/DEBUG] [FML]: Enabling mod abyssalcraft
|
621 | [15:22:02] [Server thread/DEBUG] [FML]: Enabling mod aether
|
622 | [15:22:02] [Server thread/DEBUG] [FML]: Enabling mod blocklings
|
623 | [15:22:02] [Server thread/DEBUG] [FML]: Enabling mod bloodmoon
|
624 | [15:22:02] [Server thread/DEBUG] [FML]: Enabling mod chisel
|
625 | [15:22:02] [Server thread/DEBUG] [FML]: Enabling mod codechickenlib
|
626 | [15:22:02] [Server thread/WARN] [FML]: Missing English translation for codechickenlib: assets/codechickenlib/lang/en_us.lang
|
627 | [15:22:02] [Server thread/DEBUG] [FML]: Enabling mod customspawner
|
628 | [15:22:02] [Server thread/WARN] [FML]: Missing English translation for customspawner: assets/customspawner/lang/en_us.lang
|
629 | [15:22:02] [Server thread/DEBUG] [FML]: Enabling mod props
|
630 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod dldungeonsjbg
|
631 | [15:22:03] [Server thread/WARN] [FML]: Missing English translation for dldungeonsjbg: assets/dldungeonsjbg/lang/en_us.lang
|
632 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod mocreatures
|
633 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod enderstorage
|
634 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod fastfurnace
|
635 | [15:22:03] [Server thread/WARN] [FML]: Missing English translation for fastfurnace: assets/fastfurnace/lang/en_us.lang
|
636 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod ironchest
|
637 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod jei
|
638 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod lunatriuscore
|
639 | [15:22:03] [Server thread/WARN] [FML]: Missing English translation for lunatriuscore: assets/lunatriuscore/lang/en_us.lang
|
640 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod netherendingores
|
641 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod nei
|
642 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod placebo
|
643 | [15:22:03] [Server thread/WARN] [FML]: Missing English translation for placebo: assets/placebo/lang/en_us.lang
|
644 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod schematica
|
645 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod schematics
|
646 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod undergroundbiomes
|
647 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod orbis-lib
|
648 | [15:22:03] [Server thread/WARN] [FML]: Missing English translation for orbis-lib: assets/orbis-lib/lang/en_us.lang
|
649 | [15:22:03] [Server thread/DEBUG] [FML]: Enabling mod phosphor-lighting
|
650 | [15:22:03] [Server thread/WARN] [FML]: Missing English translation for phosphor-lighting: assets/phosphor-lighting/lang/en_us.lang
|
651 | [15:22:03] [Server thread/TRACE] [FML]: Verifying mod requirements are satisfied
|
652 | [15:22:03] [Server thread/TRACE] [FML]: All mod requirements are satisfied
|
653 | [15:22:03] [Server thread/TRACE] [FML]: Sorting mods into an ordered list
|
654 | [15:22:03] [Server thread/TRACE] [FML]: Mod sorting completed successfully
|
655 | [15:22:03] [Server thread/DEBUG] [FML]: Mod sorting data
|
656 | [15:22:03] [Server thread/DEBUG] [FML]: jei(Just Enough Items:**.**.**.**): jei_1.12.2-4.16.1.302.jar (required-after:forge@[14.23.5.2816,);)
|
657 | [15:22:03] [Server thread/DEBUG] [FML]: abyssalcraft(AbyssalCraft:2.0.0-ALPHA-2): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar (required-after:forge@[14.23.4.2747,);after:jei@[4.11.0,))
|
658 | [15:22:03] [Server thread/DEBUG] [FML]: orbis-lib(OrbisLib:0.2.0): orbis-lib-1.12.2-0.2.0+build411.jar ()
|
659 | [15:22:03] [Server thread/DEBUG] [FML]: aether(Aether II:0.3.0): aether_ii-1.12.2-0.3.0+build411-universal.jar (required-after:orbis-lib@[0.2.0,);required-after:forge@[14.23.5.2816,))
|
660 | [15:22:03] [Server thread/DEBUG] [FML]: blocklings(Blocklings Mod:1.0): Blocklings 6.0.1_b - 1.12.2.jar ()
|
661 | [15:22:03] [Server thread/DEBUG] [FML]: bloodmoon(Bloodmoon:1.5.3): Bloodmoon-MC1.12.2-1.5.3.jar ()
|
662 | [15:22:03] [Server thread/DEBUG] [FML]: ChiselAPI|Carving(API: ChiselAPI|Carving:0.0.1): Chisel-MC1.12.2-1.0.2.45.jar ()
|
663 | [15:22:03] [Server thread/DEBUG] [FML]: chisel(Chisel:MC1.12.2-1.0.2.45): Chisel-MC1.12.2-1.0.2.45.jar (required-after:forge@[14.23.5.2806,);required-after-client:ctm@[MC1.12.2-1.0.2.31,);after:jei@[4.12.0,5))
|
664 | [15:22:03] [Server thread/DEBUG] [FML]: codechickenlib(CodeChicken Lib:**.**.**.**): CodeChickenLib-1.12.2-3.2.3.358-universal.jar (required-after:forge@[14.23.4.2718,))
|
665 | [15:22:03] [Server thread/DEBUG] [FML]: customspawner(DrZhark's CustomSpawner:3.11.4): CustomMobSpawner-3.11.5.jar ()
|
666 | [15:22:03] [Server thread/DEBUG] [FML]: props(Decocraft:2.6.3): Decocraft-2.6.3_1.12.2.jar (required-after-client:ptrmodellib@[1.0.3,);after:ptrmodellib)
|
667 | [15:22:03] [Server thread/DEBUG] [FML]: DLDungeonsAPI(API: DLDungeonsAPI:1.1): DoomlikeDungeons-1.13.2-MC1.12.2.jar ()
|
668 | [15:22:03] [Server thread/DEBUG] [FML]: dldungeonsjbg(Doomlike Dungeons:1.13.2): DoomlikeDungeons-1.13.2-MC1.12.2.jar ()
|
669 | [15:22:03] [Server thread/DEBUG] [FML]: mocreatures(DrZhark's Mo'Creatures Mod:12.0.5): DrZharks MoCreatures Mod-12.0.5.jar ()
|
670 | [15:22:03] [Server thread/DEBUG] [FML]: enderstorage(EnderStorage:**.**.**.**): EnderStorage-1.12.2-2.4.6.137-universal.jar (required-after:forge@[14.23.4,);required-after:codechickenlib@[3.2.3,);)
|
671 | [15:22:03] [Server thread/DEBUG] [FML]: fastfurnace(FastFurnace:1.3.1): FastFurnace-1.12.2-1.3.1.jar ()
|
672 | [15:22:03] [Server thread/DEBUG] [FML]: ironchest(Iron Chest:1.12.2-7.0.67.844): ironchest-1.12.2-7.0.72.847.jar (required-after:forge@[14.21.0.2359,))
|
673 | [15:22:03] [Server thread/DEBUG] [FML]: lunatriuscore(LunatriusCore:**.**.**.**): LunatriusCore-1.12.2-1.2.0.42-universal.jar ()
|
674 | [15:22:03] [Server thread/DEBUG] [FML]: netherendingores(Netherending Ores:1.12.2-1.4.2): Netherending-Ores-1.12.2-1.4.2.jar (required-after:forge@[14.23.5.2847,);after:mantle@[1.12-1.3.1,);after:tconstruct@[1.12.2-2.9.1,);after:plustic;after:appliedenergistics2;after:mekanism@[1.12.2-9.4.13.349,);after:matteroverdrive;after:bigreactors;after:immersiveengineering;after:waila;after:wawla;after:aether;after:aether_legacy;after:projectred-exploration;)
|
675 | [15:22:03] [Server thread/DEBUG] [FML]: nei(Not Enough Items:2.4.3): NotEnoughItems-1.12.2-2.4.3.245-universal.jar (required-after:codechickenlib@[3.2.3,);;required-after:jei@[4.12.0.+.,);required-after:forge@[14.23.5.2768,))
|
676 | [15:22:03] [Server thread/DEBUG] [FML]: placebo(Placebo:1.6.0): Placebo-1.12.2-1.6.0.jar ()
|
677 | [15:22:03] [Server thread/DEBUG] [FML]: SchematicaAPI(API: SchematicaAPI:1.1): Schematica-1.12.2-1.8.0.169-universal.jar ()
|
678 | [15:22:03] [Server thread/DEBUG] [FML]: SchematicaAPI|Events(API: SchematicaAPI|Events:1.1): Schematica-1.12.2-1.8.0.169-universal.jar ()
|
679 | [15:22:03] [Server thread/DEBUG] [FML]: schematica(Schematica:**.**.**.**): Schematica-1.12.2-1.8.0.169-universal.jar ()
|
680 | [15:22:03] [Server thread/DEBUG] [FML]: schematics(Schematics:**.**.**.**): Schematics-1.12.2.12.jar ()
|
681 | [15:22:03] [Server thread/DEBUG] [FML]: undergroundbiomes(Underground Biomes:1.3.8): UndergroundBiomesConstructs-1.12-1.3.8.jar ()
|
682 | [15:22:03] [Server thread/DEBUG] [FML]: phosphor-lighting(Phosphor Lighting Engine:1.12.2-0.2.6): phosphor-1.12.2-0.2.6+build50.jar (after:neid@[**.**.**.**,);after:spongeforge@[1.12.2-2838-7.1.7-RC3844,))
|
683 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Integration(API: AbyssalCraftAPI|Integration:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
684 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Caps(API: AbyssalCraftAPI|Caps:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
685 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Event(API: AbyssalCraftAPI|Event:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
686 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Transfer(API: AbyssalCraftAPI|Transfer:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
687 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI(API: AbyssalCraftAPI:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
688 | [15:22:03] [Server thread/DEBUG] [FML]: ctm-api-utils(API: ctm-api-utils:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
|
689 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Recipe(API: AbyssalCraftAPI|Recipe:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
690 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|TransferCaps(API: AbyssalCraftAPI|TransferCaps:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
691 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Rending(API: AbyssalCraftAPI|Rending:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
692 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Biome(API: AbyssalCraftAPI|Biome:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
693 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Energy(API: AbyssalCraftAPI|Energy:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
694 | [15:22:03] [Server thread/DEBUG] [FML]: ctm-api-models(API: ctm-api-models:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
|
695 | [15:22:03] [Server thread/DEBUG] [FML]: ctm-api-textures(API: ctm-api-textures:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
|
696 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Structure(API: AbyssalCraftAPI|Structure:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
697 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Necronomicon(API: AbyssalCraftAPI|Necronomicon:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
698 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Disruption(API: AbyssalCraftAPI|Disruption:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
699 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Block(API: AbyssalCraftAPI|Block:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
700 | [15:22:03] [Server thread/DEBUG] [FML]: JustEnoughItemsAPI(API: JustEnoughItemsAPI:4.13.0): jei_1.12.2-4.16.1.302.jar ()
|
701 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Ritual(API: AbyssalCraftAPI|Ritual:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
702 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Condition(API: AbyssalCraftAPI|Condition:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
703 | [15:22:03] [Server thread/DEBUG] [FML]: ctm-api-events(API: ctm-api-events:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
|
704 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Dimension(API: AbyssalCraftAPI|Dimension:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
705 | [15:22:03] [Server thread/DEBUG] [FML]: Chisel-API(API: Chisel-API:0.0.1): Chisel-MC1.12.2-1.0.2.45.jar ()
|
706 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Internal(API: AbyssalCraftAPI|Internal:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
707 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Spell(API: AbyssalCraftAPI|Spell:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
708 | [15:22:03] [Server thread/DEBUG] [FML]: ctm-api(API: ctm-api:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
|
709 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Item(API: AbyssalCraftAPI|Item:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
710 | [15:22:03] [Server thread/DEBUG] [FML]: AbyssalCraftAPI|Entity(API: AbyssalCraftAPI|Entity:2.0.0): AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar ()
|
711 | [15:22:03] [Server thread/DEBUG] [FML]: CSLib|API(API: CSLib|API:1.0.1): PTRLib-1.0.4.jar ()
|
712 | [15:22:03] [Server thread/INFO] [FML]: FML has found a non-mod file CTM-MC1.12.2-1.0.2.31.jar in your mods directory. It will now be injected into your classpath. This could severe stability issues, it should be removed if possible.
|
713 | [15:22:03] [Server thread/INFO] [FML]: FML has found a non-mod file PTRLib-1.0.4.jar in your mods directory. It will now be injected into your classpath. This could severe stability issues, it should be removed if possible.
|
714 | [15:22:03] [Server thread/DEBUG] [FML]: Loading @Config anotation data
|
715 | [15:22:03] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod minecraft
|
716 | [15:22:03] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod minecraft
|
717 | [15:22:03] [Server thread/DEBUG] [FML]: Bar Step: Construction - Minecraft took 0.038s
|
718 | [15:22:03] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mcp
|
719 | [15:22:03] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mcp
|
720 | [15:22:03] [Server thread/DEBUG] [FML]: Bar Step: Construction - Minecraft Coder Pack took 0.002s
|
721 | [15:22:03] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod FML
|
722 | [15:22:05] [Server thread/TRACE] [FML]: Mod FML is using network checker : Invoking method checkModLists
|
723 | [15:22:05] [Server thread/TRACE] [FML]: Testing mod FML to verify it accepts its own version in a remote connection
|
724 | [15:22:05] [Server thread/TRACE] [FML]: The mod FML accepts its own version (**.**.**.**)
|
725 | [15:22:05] [Server thread/INFO] [FML]: Attempting connection with missing mods [minecraft, mcp, FML, forge, backpacked, abyssalcraft, aether, blocklings, bloodmoon, chisel, codechickenlib, customspawner, props, dldungeonsjbg, mocreatures, enderstorage, fastfurnace, ironchest, jei, lunatriuscore, netherendingores, nei, placebo, schematica, schematics, undergroundbiomes, orbis-lib, phosphor-lighting] at CLIENT
|
726 | [15:22:05] [Server thread/INFO] [FML]: Attempting connection with missing mods [minecraft, mcp, FML, forge, backpacked, abyssalcraft, aether, blocklings, bloodmoon, chisel, codechickenlib, customspawner, props, dldungeonsjbg, mocreatures, enderstorage, fastfurnace, ironchest, jei, lunatriuscore, netherendingores, nei, placebo, schematica, schematics, undergroundbiomes, orbis-lib, phosphor-lighting] at SERVER
|
727 | [15:22:06] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod FML
|
728 | [15:22:06] [Server thread/DEBUG] [FML]: Bar Step: Construction - Forge Mod Loader took 2.939s
|
729 | [15:22:06] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod forge
|
730 | [15:22:06] [Server thread/DEBUG] [forge]: Loading Vanilla annotations: null
|
731 | [15:22:06] [Server thread/DEBUG] [forge]: Preloading CrashReport Classes
|
732 | [15:22:06] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable
|
733 | [15:22:06] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Alignment
|
734 | [15:22:06] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Column
|
735 | [15:22:06] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Row
|
736 | [15:22:06] [Server thread/DEBUG] [forge]: net/minecraftforge/fml/client/SplashProgress$1
|
737 | [15:22:06] [Server thread/DEBUG] [forge]: net/minecraftforge/fml/common/FMLCommonHandler$1
|
738 | [15:22:06] [Server thread/DEBUG] [forge]: net/minecraftforge/fml/common/Loader$1
|
739 | [15:22:06] [Server thread/TRACE] [FML]: Mod forge is using network checker : No network checking performed
|
740 | [15:22:06] [Server thread/TRACE] [FML]: Testing mod forge to verify it accepts its own version in a remote connection
|
741 | [15:22:06] [Server thread/TRACE] [FML]: The mod forge accepts its own version (14.23.5.2855)
|
742 | [15:22:07] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into forge for type INSTANCE
|
743 | [15:22:07] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod forge
|
744 | [15:22:07] [Server thread/DEBUG] [FML]: Bar Step: Construction - Minecraft Forge took 0.293s
|
745 | [15:22:07] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod backpacked
|
746 | [15:22:07] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into backpacked for type INSTANCE
|
747 | [15:22:07] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod backpacked
|
748 | [15:22:07] [Server thread/DEBUG] [FML]: Bar Step: Construction - Backpacked took 0.009s
|
749 | [15:22:07] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod jei
|
750 | [15:22:07] [Server thread/TRACE] [FML]: Mod jei is using network checker : Invoking method checkModLists
|
751 | [15:22:07] [Server thread/TRACE] [FML]: Testing mod jei to verify it accepts its own version in a remote connection
|
752 | [15:22:07] [Server thread/TRACE] [FML]: The mod jei accepts its own version (**.**.**.**)
|
753 | [15:22:07] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into jei
|
754 | [15:22:07] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for jei
|
755 | [15:22:07] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into jei for type INSTANCE
|
756 | [15:22:07] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod jei
|
757 | [15:22:07] [Server thread/DEBUG] [FML]: Bar Step: Construction - Just Enough Items took 0.335s
|
758 | [15:22:07] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod abyssalcraft
|
759 | [15:22:10] [Server thread/TRACE] [FML]: Mod abyssalcraft is using network checker : Accepting version 2.0.0-ALPHA-2
|
760 | [15:22:10] [Server thread/TRACE] [FML]: Testing mod abyssalcraft to verify it accepts its own version in a remote connection
|
761 | [15:22:10] [Server thread/TRACE] [FML]: The mod abyssalcraft accepts its own version (2.0.0-ALPHA-2)
|
762 | [15:22:10] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into abyssalcraft
|
763 | [15:22:10] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for abyssalcraft
|
764 | [15:22:10] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into abyssalcraft for type INSTANCE
|
765 | [15:22:10] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod abyssalcraft
|
766 | [15:22:10] [Server thread/DEBUG] [FML]: Bar Step: Construction - AbyssalCraft took 2.551s
|
767 | [15:22:10] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod orbis-lib
|
768 | [15:22:10] [Server thread/TRACE] [FML]: Mod orbis-lib is using network checker : Accepting version 0.2.0
|
769 | [15:22:10] [Server thread/TRACE] [FML]: Testing mod orbis-lib to verify it accepts its own version in a remote connection
|
770 | [15:22:10] [Server thread/TRACE] [FML]: The mod orbis-lib accepts its own version (0.2.0)
|
771 | [15:22:10] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into orbis-lib
|
772 | [15:22:10] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for orbis-lib
|
773 | [15:22:10] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.orbis.lib.OrbisLib for mod orbis-lib
|
774 | [15:22:10] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.orbis.lib.OrbisLib
|
775 | [15:22:10] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.orbis.lib.CapabilityManagerOrbisLib for mod orbis-lib
|
776 | [15:22:10] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.orbis.lib.CapabilityManagerOrbisLib
|
777 | [15:22:10] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into orbis-lib for type INSTANCE
|
778 | [15:22:10] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod orbis-lib
|
779 | [15:22:10] [Server thread/DEBUG] [FML]: Bar Step: Construction - OrbisLib took 0.060s
|
780 | [15:22:10] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod aether
|
781 | [15:22:10] [Server thread/TRACE] [FML]: Mod aether is using network checker : Accepting version 0.3.0
|
782 | [15:22:10] [Server thread/TRACE] [FML]: Testing mod aether to verify it accepts its own version in a remote connection
|
783 | [15:22:10] [Server thread/TRACE] [FML]: The mod aether accepts its own version (0.3.0)
|
784 | [15:22:10] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into aether
|
785 | [15:22:12] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for aether
|
786 | [15:22:12] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.BlocksAetherInit for mod aether
|
787 | [15:22:12] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.BlocksAetherInit
|
788 | [15:22:12] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerTeleportListener for mod aether
|
789 | [15:22:12] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerTeleportListener
|
790 | [15:22:12] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityFallListener for mod aether
|
791 | [15:22:12] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityFallListener
|
792 | [15:22:12] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemCrossbowSpecialListener for mod aether
|
793 | [15:22:12] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemCrossbowSpecialListener
|
794 | [15:22:12] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerHealListener for mod aether
|
795 | [15:22:12] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerHealListener
|
796 | [15:22:12] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.world.preparation.PrepEventListener for mod aether
|
797 | [15:22:12] [Server thread/DEBUG] [mixin]: Mixing common.MixinChunk from mixins.phosphor.json into net.minecraft.world.chunk.Chunk
|
798 | [15:22:12] [Server thread/WARN] [mixin]: Static binding violation: PRIVATE @Overwrite method func_76615_h in mixins.phosphor.json:common.MixinChunk cannot reduce visibiliy of PUBLIC target method, visibility will be upgraded.
|
799 | [15:22:12] [Server thread/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/IChunkLighting to metadata cache
|
800 | [15:22:12] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/util/math/Vec3i to metadata cache
|
801 | [15:22:13] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/WorldProvider to metadata cache
|
802 | [15:22:13] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/profiler/Profiler to metadata cache
|
803 | [15:22:13] [Server thread/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/mod/world/WorldChunkSlice to metadata cache
|
804 | [15:22:13] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/util/EnumFacing to metadata cache
|
805 | [15:22:13] [Server thread/TRACE] [mixin]: Added class metadata for java/lang/Math to metadata cache
|
806 | [15:22:13] [Server thread/DEBUG] [mixin]: Mixing common.MixinChunk$Vanilla from mixins.phosphor.json into net.minecraft.world.chunk.Chunk
|
807 | [15:22:13] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/block/state/IBlockState to metadata cache
|
808 | [15:22:13] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/IBlockAccess to metadata cache
|
809 | [15:22:13] [Server thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:preTransform:230]: Transforming Class [net.minecraft.block.Block], Method [getExtendedState]
|
810 | [15:22:13] [Server thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:finishTransform:242]: Transforming net.minecraft.block.Block Finished.
|
811 | [15:22:13] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/block/Block to metadata cache
|
812 | [15:22:13] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.world.preparation.PrepEventListener
|
813 | [15:22:13] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemToolListener for mod aether
|
814 | [15:22:13] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemToolListener
|
815 | [15:22:13] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.BiomesAetherInit for mod aether
|
816 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.BiomesAetherInit
|
817 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.world.WorldTickListener for mod aether
|
818 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.world.WorldTickListener
|
819 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerWakeListener for mod aether
|
820 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerWakeListener
|
821 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerMovementListener for mod aether
|
822 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerMovementListener
|
823 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.items.weapons.swords.ItemSkyrootSword for mod aether
|
824 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.items.weapons.swords.ItemSkyrootSword
|
825 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemSkyrootSwordListener for mod aether
|
826 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemSkyrootSwordListener
|
827 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.ItemsAetherInit for mod aether
|
828 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.ItemsAetherInit
|
829 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityJumpListener for mod aether
|
830 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityJumpListener
|
831 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.CapabilityAttachListener for mod aether
|
832 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.CapabilityAttachListener
|
833 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerRespawnListener for mod aether
|
834 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerRespawnListener
|
835 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityXPListener for mod aether
|
836 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityXPListener
|
837 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerAetherListener for mod aether
|
838 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerAetherListener
|
839 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.trade.TradeItemPickupListener for mod aether
|
840 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.trade.TradeItemPickupListener
|
841 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityDeathListener for mod aether
|
842 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityDeathListener
|
843 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerMountListener for mod aether
|
844 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerMountListener
|
845 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.capabilities.DamageSystem for mod aether
|
846 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.capabilities.DamageSystem
|
847 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerEquipItemListener for mod aether
|
848 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerEquipItemListener
|
849 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerPlaceBlockListener for mod aether
|
850 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerPlaceBlockListener
|
851 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemAetherShieldListener for mod aether
|
852 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemAetherShieldListener
|
853 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.ServerTickListener for mod aether
|
854 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.ServerTickListener
|
855 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerEatListener for mod aether
|
856 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerEatListener
|
857 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerJoinListener for mod aether
|
858 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerJoinListener
|
859 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemBucketEventListener for mod aether
|
860 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemBucketEventListener
|
861 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerAttackListener for mod aether
|
862 | [15:22:14] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerAttackListener
|
863 | [15:22:14] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.capabilities.CapabilityManagerAether for mod aether
|
864 | [15:22:15] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.capabilities.CapabilityManagerAether
|
865 | [15:22:15] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.trade.TradeInteractListener for mod aether
|
866 | [15:22:15] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.trade.TradeInteractListener
|
867 | [15:22:15] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.world.WorldFallListener for mod aether
|
868 | [15:22:15] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.world.WorldFallListener
|
869 | [15:22:15] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.SoundsAetherInit for mod aether
|
870 | [15:22:15] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.SoundsAetherInit
|
871 | [15:22:15] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemGlovesListener for mod aether
|
872 | [15:22:15] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemGlovesListener
|
873 | [15:22:15] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.RecipesAether for mod aether
|
874 | [15:22:15] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.RecipesAether
|
875 | [15:22:15] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into aether for type INSTANCE
|
876 | [15:22:15] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod aether
|
877 | [15:22:15] [Server thread/DEBUG] [FML]: Bar Step: Construction - Aether II took 5.286s
|
878 | [15:22:15] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod blocklings
|
879 | [15:22:15] [Server thread/TRACE] [FML]: Mod blocklings is using network checker : Accepting version 1.0
|
880 | [15:22:15] [Server thread/TRACE] [FML]: Testing mod blocklings to verify it accepts its own version in a remote connection
|
881 | [15:22:15] [Server thread/TRACE] [FML]: The mod blocklings accepts its own version (1.0)
|
882 | [15:22:15] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into blocklings
|
883 | [15:22:15] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for blocklings
|
884 | [15:22:15] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.blocklings.items.BlocklingsItems for mod blocklings
|
885 | [15:22:15] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.blocklings.items.BlocklingsItems
|
886 | [15:22:15] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into blocklings for type INSTANCE
|
887 | [15:22:15] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod blocklings
|
888 | [15:22:15] [Server thread/DEBUG] [FML]: Bar Step: Construction - Blocklings Mod took 0.088s
|
889 | [15:22:15] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod bloodmoon
|
890 | [15:22:15] [Server thread/TRACE] [FML]: Mod bloodmoon is using network checker : Accepting version 1.5.3
|
891 | [15:22:15] [Server thread/TRACE] [FML]: Testing mod bloodmoon to verify it accepts its own version in a remote connection
|
892 | [15:22:15] [Server thread/TRACE] [FML]: The mod bloodmoon accepts its own version (1.5.3)
|
893 | [15:22:15] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into bloodmoon
|
894 | [15:22:15] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for bloodmoon
|
895 | [15:22:15] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into bloodmoon for type INSTANCE
|
896 | [15:22:15] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod bloodmoon
|
897 | [15:22:15] [Server thread/DEBUG] [FML]: Bar Step: Construction - Bloodmoon took 0.117s
|
898 | [15:22:15] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod chisel
|
899 | [15:22:16] [Server thread/TRACE] [FML]: Mod chisel is using network checker : Accepting version MC1.12.2-1.0.2.45
|
900 | [15:22:16] [Server thread/TRACE] [FML]: Testing mod chisel to verify it accepts its own version in a remote connection
|
901 | [15:22:16] [Server thread/TRACE] [FML]: The mod chisel accepts its own version (MC1.12.2-1.0.2.45)
|
902 | [15:22:16] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into chisel
|
903 | [15:22:16] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for chisel
|
904 | [15:22:16] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for team.chisel.common.block.BreakSpeedHandler for mod chisel
|
905 | [15:22:16] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class team.chisel.common.block.BreakSpeedHandler
|
906 | [15:22:16] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for team.chisel.Features for mod chisel
|
907 | [15:22:17] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class team.chisel.Features
|
908 | [15:22:17] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into chisel for type INSTANCE
|
909 | [15:22:17] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod chisel
|
910 | [15:22:17] [Server thread/DEBUG] [FML]: Bar Step: Construction - Chisel took 1.818s
|
911 | [15:22:17] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod codechickenlib
|
912 | [15:22:17] [Server thread/TRACE] [FML]: Mod codechickenlib is using network checker : Accepting version **.**.**.**
|
913 | [15:22:17] [Server thread/TRACE] [FML]: Testing mod codechickenlib to verify it accepts its own version in a remote connection
|
914 | [15:22:17] [Server thread/TRACE] [FML]: The mod codechickenlib accepts its own version (**.**.**.**)
|
915 | [15:22:17] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into codechickenlib
|
916 | [15:22:17] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for codechickenlib
|
917 | [15:22:17] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for codechicken.lib.configuration.ConfigSyncManager for mod codechickenlib
|
918 | [15:22:17] [Server thread/INFO] [STDOUT]: [com.mrcrayfish.backpacked.asm.BackpackedTransformer:patch:68]: [Backpacked] Starting to patch: net.minecraft.network.NetHandlerPlayServer#processCreativeInventoryAction(Lnet/minecraft/network/play/client/CPacketCreativeInventoryAction;)V
|
919 | [15:22:17] [Server thread/INFO] [STDOUT]: [com.mrcrayfish.backpacked.asm.BackpackedTransformer:patch:71]: [Backpacked] Successfully patched: net.minecraft.network.NetHandlerPlayServer#processCreativeInventoryAction(Lnet/minecraft/network/play/client/CPacketCreativeInventoryAction;)V
|
920 | [15:22:17] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class codechicken.lib.configuration.ConfigSyncManager
|
921 | [15:22:17] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for codechicken.lib.internal.CCLLog for mod codechickenlib
|
922 | [15:22:17] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class codechicken.lib.internal.CCLLog
|
923 | [15:22:17] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into codechickenlib for type INSTANCE
|
924 | [15:22:17] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod codechickenlib
|
925 | [15:22:17] [Server thread/DEBUG] [FML]: Bar Step: Construction - CodeChicken Lib took 0.469s
|
926 | [15:22:17] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod customspawner
|
927 | [15:22:17] [Server thread/DEBUG] [mixin]: Mixing common.MixinChunkProviderServer from mixins.phosphor.json into net.minecraft.world.gen.ChunkProviderServer
|
928 | [15:22:17] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/WorldServer to metadata cache
|
929 | [15:22:17] [Server thread/TRACE] [mixin]: Added class metadata for java/util/Set to metadata cache
|
930 | [15:22:18] [Server thread/TRACE] [FML]: Mod customspawner is using network checker : Accepting version 3.11.4
|
931 | [15:22:18] [Server thread/TRACE] [FML]: Testing mod customspawner to verify it accepts its own version in a remote connection
|
932 | [15:22:18] [Server thread/TRACE] [FML]: The mod customspawner accepts its own version (3.11.4)
|
933 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into customspawner
|
934 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for customspawner
|
935 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into customspawner for type INSTANCE
|
936 | [15:22:18] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod customspawner
|
937 | [15:22:18] [Server thread/DEBUG] [FML]: Bar Step: Construction - DrZhark's CustomSpawner took 0.182s
|
938 | [15:22:18] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod props
|
939 | [15:22:18] [Server thread/TRACE] [FML]: Mod props is using network checker : Accepting version 2.6.3
|
940 | [15:22:18] [Server thread/TRACE] [FML]: Testing mod props to verify it accepts its own version in a remote connection
|
941 | [15:22:18] [Server thread/TRACE] [FML]: The mod props accepts its own version (2.6.3)
|
942 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into props
|
943 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for props
|
944 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into props for type INSTANCE
|
945 | [15:22:18] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod props
|
946 | [15:22:18] [Server thread/DEBUG] [FML]: Bar Step: Construction - Decocraft took 0.061s
|
947 | [15:22:18] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod dldungeonsjbg
|
948 | [15:22:18] [Server thread/TRACE] [FML]: Mod dldungeonsjbg is using network checker : No network checking performed
|
949 | [15:22:18] [Server thread/TRACE] [FML]: Testing mod dldungeonsjbg to verify it accepts its own version in a remote connection
|
950 | [15:22:18] [Server thread/TRACE] [FML]: The mod dldungeonsjbg accepts its own version (1.13.2)
|
951 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into dldungeonsjbg
|
952 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for dldungeonsjbg
|
953 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into dldungeonsjbg for type INSTANCE
|
954 | [15:22:18] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod dldungeonsjbg
|
955 | [15:22:18] [Server thread/DEBUG] [FML]: Bar Step: Construction - Doomlike Dungeons took 0.022s
|
956 | [15:22:18] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mocreatures
|
957 | [15:22:18] [Server thread/TRACE] [FML]: Mod mocreatures is using network checker : Accepting range 12.0.5
|
958 | [15:22:18] [Server thread/TRACE] [FML]: Testing mod mocreatures to verify it accepts its own version in a remote connection
|
959 | [15:22:18] [Server thread/TRACE] [FML]: The mod mocreatures accepts its own version (12.0.5)
|
960 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into mocreatures
|
961 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for mocreatures
|
962 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCBiomes$RegistrationHandler for mod mocreatures
|
963 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCBiomes$RegistrationHandler
|
964 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCEntities$RegistrationHandler for mod mocreatures
|
965 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCEntities$RegistrationHandler
|
966 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCBlocks$RegistrationHandler for mod mocreatures
|
967 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCBlocks$RegistrationHandler
|
968 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCItems$RegistrationHandler for mod mocreatures
|
969 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCItems$RegistrationHandler
|
970 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCRecipes$RegistrationHandler for mod mocreatures
|
971 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCRecipes$RegistrationHandler
|
972 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for drzhark.mocreatures.init.MoCSoundEvents$RegistrationHandler for mod mocreatures
|
973 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class drzhark.mocreatures.init.MoCSoundEvents$RegistrationHandler
|
974 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into mocreatures for type INSTANCE
|
975 | [15:22:18] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mocreatures
|
976 | [15:22:18] [Server thread/DEBUG] [FML]: Bar Step: Construction - DrZhark's Mo'Creatures Mod took 0.178s
|
977 | [15:22:18] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod enderstorage
|
978 | [15:22:18] [Server thread/TRACE] [FML]: Mod enderstorage is using network checker : Accepting version **.**.**.**
|
979 | [15:22:18] [Server thread/TRACE] [FML]: Testing mod enderstorage to verify it accepts its own version in a remote connection
|
980 | [15:22:18] [Server thread/TRACE] [FML]: The mod enderstorage accepts its own version (**.**.**.**)
|
981 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into enderstorage
|
982 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for enderstorage
|
983 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into enderstorage for type INSTANCE
|
984 | [15:22:18] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod enderstorage
|
985 | [15:22:18] [Server thread/DEBUG] [FML]: Bar Step: Construction - EnderStorage took 0.028s
|
986 | [15:22:18] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod fastfurnace
|
987 | [15:22:18] [Server thread/TRACE] [FML]: Mod fastfurnace is using network checker : Accepting version 1.3.1
|
988 | [15:22:18] [Server thread/TRACE] [FML]: Testing mod fastfurnace to verify it accepts its own version in a remote connection
|
989 | [15:22:18] [Server thread/TRACE] [FML]: The mod fastfurnace accepts its own version (1.3.1)
|
990 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into fastfurnace
|
991 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for fastfurnace
|
992 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into fastfurnace for type INSTANCE
|
993 | [15:22:18] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod fastfurnace
|
994 | [15:22:18] [Server thread/DEBUG] [FML]: Bar Step: Construction - FastFurnace took 0.011s
|
995 | [15:22:18] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ironchest
|
996 | [15:22:18] [Server thread/TRACE] [FML]: Mod ironchest is using network checker : Accepting version 1.12.2-7.0.67.844
|
997 | [15:22:18] [Server thread/TRACE] [FML]: Testing mod ironchest to verify it accepts its own version in a remote connection
|
998 | [15:22:18] [Server thread/TRACE] [FML]: The mod ironchest accepts its own version (1.12.2-7.0.67.844)
|
999 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ironchest
|
1000 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ironchest
|
1001 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for cpw.mods.ironchest.common.core.IronChestBlocks$Registration for mod ironchest
|
1002 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class cpw.mods.ironchest.common.core.IronChestBlocks$Registration
|
1003 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for cpw.mods.ironchest.common.core.IronChestItems$Registration for mod ironchest
|
1004 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class cpw.mods.ironchest.common.core.IronChestItems$Registration
|
1005 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into ironchest for type INSTANCE
|
1006 | [15:22:18] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ironchest
|
1007 | [15:22:18] [Server thread/DEBUG] [FML]: Bar Step: Construction - Iron Chest took 0.141s
|
1008 | [15:22:18] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod lunatriuscore
|
1009 | [15:22:18] [Server thread/TRACE] [FML]: Mod lunatriuscore is using network checker : Invoking method checkModList
|
1010 | [15:22:18] [Server thread/TRACE] [FML]: Testing mod lunatriuscore to verify it accepts its own version in a remote connection
|
1011 | [15:22:18] [Server thread/TRACE] [FML]: The mod lunatriuscore accepts its own version (**.**.**.**)
|
1012 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into lunatriuscore
|
1013 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for lunatriuscore
|
1014 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into lunatriuscore for type INSTANCE
|
1015 | [15:22:18] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod lunatriuscore
|
1016 | [15:22:18] [Server thread/DEBUG] [FML]: Bar Step: Construction - LunatriusCore took 0.161s
|
1017 | [15:22:18] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod netherendingores
|
1018 | [15:22:18] [Server thread/TRACE] [FML]: Mod netherendingores is using network checker : Accepting version 1.12.2-1.4.2
|
1019 | [15:22:18] [Server thread/TRACE] [FML]: Testing mod netherendingores to verify it accepts its own version in a remote connection
|
1020 | [15:22:18] [Server thread/TRACE] [FML]: The mod netherendingores accepts its own version (1.12.2-1.4.2)
|
1021 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into netherendingores
|
1022 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for netherendingores
|
1023 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.proxy.CommonProxy for mod netherendingores
|
1024 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.proxy.CommonProxy
|
1025 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.common.registry.RegistryEvents$RegistrationHandler for mod netherendingores
|
1026 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.common.registry.RegistryEvents$RegistrationHandler
|
1027 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.integration.common.registry.RegistryIntegrationEvents$Events for mod netherendingores
|
1028 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.integration.common.registry.RegistryIntegrationEvents$Events
|
1029 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.common.registry.BlockRegistry$BlockEventHandler for mod netherendingores
|
1030 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.common.registry.BlockRegistry$BlockEventHandler
|
1031 | [15:22:18] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for org.icannt.netherendingores.common.registry.BlockRegistry$RegistrationHandler for mod netherendingores
|
1032 | [15:22:18] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class org.icannt.netherendingores.common.registry.BlockRegistry$RegistrationHandler
|
1033 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into netherendingores for type INSTANCE
|
1034 | [15:22:18] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod netherendingores
|
1035 | [15:22:18] [Server thread/DEBUG] [FML]: Bar Step: Construction - Netherending Ores took 0.135s
|
1036 | [15:22:18] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod nei
|
1037 | [15:22:18] [Server thread/TRACE] [FML]: Mod nei is using network checker : Accepting version 2.4.3
|
1038 | [15:22:18] [Server thread/TRACE] [FML]: Testing mod nei to verify it accepts its own version in a remote connection
|
1039 | [15:22:18] [Server thread/TRACE] [FML]: The mod nei accepts its own version (2.4.3)
|
1040 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into nei
|
1041 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for nei
|
1042 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into nei for type INSTANCE
|
1043 | [15:22:18] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod nei
|
1044 | [15:22:18] [Server thread/DEBUG] [FML]: Bar Step: Construction - Not Enough Items took 0.024s
|
1045 | [15:22:18] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod placebo
|
1046 | [15:22:18] [Server thread/TRACE] [FML]: Mod placebo is using network checker : No network checking performed
|
1047 | [15:22:18] [Server thread/TRACE] [FML]: Testing mod placebo to verify it accepts its own version in a remote connection
|
1048 | [15:22:18] [Server thread/TRACE] [FML]: The mod placebo accepts its own version (1.6.0)
|
1049 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into placebo
|
1050 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for placebo
|
1051 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into placebo for type INSTANCE
|
1052 | [15:22:18] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod placebo
|
1053 | [15:22:18] [Server thread/DEBUG] [FML]: Bar Step: Construction - Placebo took 0.027s
|
1054 | [15:22:18] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod schematica
|
1055 | [15:22:18] [Server thread/TRACE] [FML]: Mod schematica is using network checker : Invoking method checkModList
|
1056 | [15:22:18] [Server thread/TRACE] [FML]: Testing mod schematica to verify it accepts its own version in a remote connection
|
1057 | [15:22:18] [Server thread/TRACE] [FML]: The mod schematica accepts its own version (**.**.**.**)
|
1058 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into schematica
|
1059 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for schematica
|
1060 | [15:22:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into schematica for type INSTANCE
|
1061 | [15:22:18] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod schematica
|
1062 | [15:22:18] [Server thread/DEBUG] [FML]: Bar Step: Construction - Schematica took 0.064s
|
1063 | [15:22:18] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod schematics
|
1064 | [15:22:19] [Server thread/TRACE] [FML]: Mod schematics is using network checker : Accepting version **.**.**.**
|
1065 | [15:22:19] [Server thread/TRACE] [FML]: Testing mod schematics to verify it accepts its own version in a remote connection
|
1066 | [15:22:19] [Server thread/TRACE] [FML]: The mod schematics accepts its own version (**.**.**.**)
|
1067 | [15:22:19] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into schematics
|
1068 | [15:22:19] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for schematics
|
1069 | [15:22:19] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.dyn.schematics.registry.RegistrationHandler for mod schematics
|
1070 | [15:22:19] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.dyn.schematics.registry.RegistrationHandler
|
1071 | [15:22:19] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into schematics for type INSTANCE
|
1072 | [15:22:19] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod schematics
|
1073 | [15:22:19] [Server thread/DEBUG] [FML]: Bar Step: Construction - Schematics took 0.213s
|
1074 | [15:22:19] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod undergroundbiomes
|
1075 | [15:22:19] [Server thread/TRACE] [FML]: Mod undergroundbiomes is using network checker : Accepting version 1.3.8
|
1076 | [15:22:19] [Server thread/TRACE] [FML]: Testing mod undergroundbiomes to verify it accepts its own version in a remote connection
|
1077 | [15:22:19] [Server thread/TRACE] [FML]: The mod undergroundbiomes accepts its own version (1.3.8)
|
1078 | [15:22:19] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into undergroundbiomes
|
1079 | [15:22:19] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for undergroundbiomes
|
1080 | [15:22:19] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for exterminatorjeff.undergroundbiomes.core.UndergroundBiomes for mod undergroundbiomes
|
1081 | [15:22:19] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class exterminatorjeff.undergroundbiomes.core.UndergroundBiomes
|
1082 | [15:22:19] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into undergroundbiomes for type INSTANCE
|
1083 | [15:22:19] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod undergroundbiomes
|
1084 | [15:22:19] [Server thread/DEBUG] [FML]: Bar Step: Construction - Underground Biomes took 0.359s
|
1085 | [15:22:19] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod phosphor-lighting
|
1086 | [15:22:19] [Server thread/TRACE] [FML]: Mod phosphor-lighting is using network checker : No network checking performed
|
1087 | [15:22:19] [Server thread/TRACE] [FML]: Testing mod phosphor-lighting to verify it accepts its own version in a remote connection
|
1088 | [15:22:19] [Server thread/TRACE] [FML]: The mod phosphor-lighting accepts its own version (1.12.2-0.2.6)
|
1089 | [15:22:19] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into phosphor-lighting
|
1090 | [15:22:19] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for phosphor-lighting
|
1091 | [15:22:19] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into phosphor-lighting for type INSTANCE
|
1092 | [15:22:19] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod phosphor-lighting
|
1093 | [15:22:19] [Server thread/DEBUG] [FML]: Bar Step: Construction - Phosphor Lighting Engine took 0.013s
|
1094 | [15:22:19] [Server thread/DEBUG] [FML]: Bar Finished: Construction took 15.625s
|
1095 | [15:22:19] [Server thread/DEBUG] [FML]: Mod signature data
|
1096 | [15:22:19] [Server thread/DEBUG] [FML]: Valid Signatures:
|
1097 | [15:22:19] [Server thread/DEBUG] [FML]: (e3c3d50c7c986df74c645c0ac54639741c90a557) FML (Forge Mod Loader **.**.**.**) forge.jar
|
1098 | [15:22:19] [Server thread/DEBUG] [FML]: (e3c3d50c7c986df74c645c0ac54639741c90a557) forge (Minecraft Forge 14.23.5.2855) forge.jar
|
1099 | [15:22:19] [Server thread/DEBUG] [FML]: (220f10d3a93b3ff5fbaa7434cc629d863d6751b9) abyssalcraft (AbyssalCraft 2.0.0-ALPHA-2) AbyssalCraft-1.12.2-2.0.0-ALPHA-2.jar
|
1100 | [15:22:19] [Server thread/DEBUG] [FML]: (db341c083b1b8ce9160a769b569ef6737b3f4cdf) orbis-lib (OrbisLib 0.2.0) orbis-lib-1.12.2-0.2.0+build411.jar
|
1101 | [15:22:19] [Server thread/DEBUG] [FML]: (db341c083b1b8ce9160a769b569ef6737b3f4cdf) aether (Aether II 0.3.0) aether_ii-1.12.2-0.3.0+build411-universal.jar
|
1102 | [15:22:19] [Server thread/DEBUG] [FML]: (d72e0dd57935b3e9476212aea0c0df352dd76291) bloodmoon (Bloodmoon 1.5.3) Bloodmoon-MC1.12.2-1.5.3.jar
|
1103 | [15:22:19] [Server thread/DEBUG] [FML]: (f1850c39b2516232a2108a7bd84d1cb5df93b261) codechickenlib (CodeChicken Lib **.**.**.**) CodeChickenLib-1.12.2-3.2.3.358-universal.jar
|
1104 | [15:22:19] [Server thread/DEBUG] [FML]: (f1850c39b2516232a2108a7bd84d1cb5df93b261) enderstorage (EnderStorage **.**.**.**) EnderStorage-1.12.2-2.4.6.137-universal.jar
|
1105 | [15:22:19] [Server thread/DEBUG] [FML]: (f1850c39b2516232a2108a7bd84d1cb5df93b261) nei (Not Enough Items 2.4.3) NotEnoughItems-1.12.2-2.4.3.245-universal.jar
|
1106 | [15:22:19] [Server thread/DEBUG] [FML]: (f0387d288626cc2d937daa504e74af570c52a2f1) phosphor-lighting (Phosphor Lighting Engine 1.12.2-0.2.6) phosphor-1.12.2-0.2.6+build50.jar
|
1107 | [15:22:19] [Server thread/DEBUG] [FML]: Missing Signatures:
|
1108 | [15:22:19] [Server thread/DEBUG] [FML]: minecraft (Minecraft 1.12.2) minecraft.jar
|
1109 | [15:22:19] [Server thread/DEBUG] [FML]: mcp (Minecraft Coder Pack 9.42) minecraft.jar
|
1110 | [15:22:19] [Server thread/DEBUG] [FML]: backpacked (Backpacked 1.4.2) backpacked-1.4.2-1.12.2.jar
|
1111 | [15:22:19] [Server thread/DEBUG] [FML]: jei (Just Enough Items **.**.**.**) jei_1.12.2-4.16.1.302.jar
|
1112 | [15:22:19] [Server thread/DEBUG] [FML]: blocklings (Blocklings Mod 1.0) Blocklings 6.0.1_b - 1.12.2.jar
|
1113 | [15:22:19] [Server thread/DEBUG] [FML]: chisel (Chisel MC1.12.2-1.0.2.45) Chisel-MC1.12.2-1.0.2.45.jar
|
1114 | [15:22:19] [Server thread/DEBUG] [FML]: customspawner (DrZhark's CustomSpawner 3.11.4) CustomMobSpawner-3.11.5.jar
|
1115 | [15:22:19] [Server thread/DEBUG] [FML]: props (Decocraft 2.6.3) Decocraft-2.6.3_1.12.2.jar
|
1116 | [15:22:19] [Server thread/DEBUG] [FML]: dldungeonsjbg (Doomlike Dungeons 1.13.2) DoomlikeDungeons-1.13.2-MC1.12.2.jar
|
1117 | [15:22:19] [Server thread/DEBUG] [FML]: mocreatures (DrZhark's Mo'Creatures Mod 12.0.5) DrZharks MoCreatures Mod-12.0.5.jar
|
1118 | [15:22:19] [Server thread/DEBUG] [FML]: fastfurnace (FastFurnace 1.3.1) FastFurnace-1.12.2-1.3.1.jar
|
1119 | [15:22:19] [Server thread/DEBUG] [FML]: ironchest (Iron Chest 1.12.2-7.0.67.844) ironchest-1.12.2-7.0.72.847.jar
|
1120 | [15:22:19] [Server thread/DEBUG] [FML]: lunatriuscore (LunatriusCore **.**.**.**) LunatriusCore-1.12.2-1.2.0.42-universal.jar
|
1121 | [15:22:19] [Server thread/DEBUG] [FML]: netherendingores (Netherending Ores 1.12.2-1.4.2) Netherending-Ores-1.12.2-1.4.2.jar
|
1122 | [15:22:19] [Server thread/DEBUG] [FML]: placebo (Placebo 1.6.0) Placebo-1.12.2-1.6.0.jar
|
1123 | [15:22:19] [Server thread/DEBUG] [FML]: schematica (Schematica **.**.**.**) Schematica-1.12.2-1.8.0.169-universal.jar
|
1124 | [15:22:19] [Server thread/DEBUG] [FML]: schematics (Schematics **.**.**.**) Schematics-1.12.2.12.jar
|
1125 | [15:22:19] [Server thread/DEBUG] [FML]: undergroundbiomes (Underground Biomes 1.3.8) UndergroundBiomesConstructs-1.12-1.3.8.jar
|
1126 | [15:22:19] [Server thread/INFO] [FML]: Processing ObjectHolder annotations
|
1127 | [15:22:19] [Server thread/INFO] [FML]: Found 1861 ObjectHolder annotations
|
1128 | [15:22:20] [Server thread/INFO] [FML]: Identifying ItemStackHolder annotations
|
1129 | [15:22:20] [Server thread/INFO] [FML]: Found 1 ItemStackHolder annotations
|
1130 | [15:22:20] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod minecraft
|
1131 | [15:22:20] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod minecraft
|
1132 | [15:22:20] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Minecraft took 0.002s
|
1133 | [15:22:20] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mcp
|
1134 | [15:22:20] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mcp
|
1135 | [15:22:20] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Minecraft Coder Pack took 0.000s
|
1136 | [15:22:20] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod FML
|
1137 | [15:22:20] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod FML
|
1138 | [15:22:20] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Forge Mod Loader took 0.001s
|
1139 | [15:22:20] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod forge
|
1140 | [15:22:20] [Server thread/INFO] [FML]: Configured a dormant chunk cache size of 0
|
1141 | [15:22:20] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod forge
|
1142 | [15:22:20] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Minecraft Forge took 0.230s
|
1143 | [15:22:20] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod backpacked
|
1144 | [15:22:20] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod backpacked
|
1145 | [15:22:20] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Backpacked took 0.011s
|
1146 | [15:22:20] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod jei
|
1147 | [15:22:20] [Forge Version Check/INFO] [forge.VersionCheck]: [nei] Starting version check at http://chickenbones.net/Files/notification/version.php?query=forge&version=1.12&file=NotEnoughItems
|
1148 | [15:22:20] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod jei
|
1149 | [15:22:20] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Just Enough Items took 0.089s
|
1150 | [15:22:20] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod abyssalcraft
|
1151 | [15:22:21] [Forge Version Check/DEBUG] [forge.VersionCheck]: [nei] Received version check data:
|
1152 | {"homepage": "http://chickenbones.net/Pages/links.html","promos": {"1.12-recommended": "**.**.**.**"}}
|
1153 | [15:22:21] [Forge Version Check/INFO] [forge.VersionCheck]: [nei] Found status: BETA Target: null
|
1154 | [15:22:21] [Forge Version Check/INFO] [forge.VersionCheck]: [codechickenlib] Starting version check at http://chickenbones.net/Files/notification/version.php?query=forge&version=1.12&file=CodeChickenLib
|
1155 | [15:22:21] [Forge Version Check/DEBUG] [forge.VersionCheck]: [codechickenlib] Received version check data:
|
1156 | {"homepage": "http://chickenbones.net/Pages/links.html","promos": {"1.12-recommended": "**.**.**.**"}}
|
1157 | [15:22:21] [Forge Version Check/INFO] [forge.VersionCheck]: [codechickenlib] Found status: BETA Target: null
|
1158 | [15:22:21] [Forge Version Check/INFO] [forge.VersionCheck]: [forge] Starting version check at http://files.minecraftforge.net/maven/net/minecraftforge/forge/promotions_slim.json
|
1159 | [15:22:24] [Forge Version Check/DEBUG] [forge.VersionCheck]: [forge] Received version check data:
|
1160 | {
|
1161 | "homepage": "http://files.minecraftforge.net/maven/net/minecraftforge/forge/",
|
1162 | "promos": {
|
1163 | "1.1-latest": "**.**.**.**",
|
1164 | "1.10-latest": "12.18.0.2000",
|
1165 | "1.10.2-latest": "12.18.3.2511",
|
1166 | "1.10.2-recommended": "12.18.3.2185",
|
1167 | "1.11-latest": "13.19.1.2199",
|
1168 | "1.11-recommended": "13.19.1.2189",
|
1169 | "1.11.2-latest": "13.20.1.2588",
|
1170 | "1.11.2-recommended": "13.20.1.2386",
|
1171 | "1.12-latest": "14.21.1.2443",
|
1172 | "1.12-recommended": "14.21.1.2387",
|
1173 | "1.12.1-latest": "14.22.1.2485",
|
1174 | "1.12.1-recommended": "14.22.1.2478",
|
1175 | "1.12.2-latest": "14.23.5.2854",
|
1176 | "1.12.2-recommended": "14.23.5.2854",
|
1177 | "1.13.2-latest": "25.0.219",
|
1178 | "1.14.2-latest": "26.0.63",
|
1179 | "1.14.3-latest": "27.0.60",
|
1180 | "1.14.4-latest": "28.2.23",
|
1181 | "1.14.4-recommended": "28.2.0",
|
1182 | "1.15-latest": "29.0.4",
|
1183 | "1.15.1-latest": "30.0.51",
|
1184 | "1.15.2-latest": "31.2.49",
|
1185 | "1.15.2-recommended": "31.2.0",
|
1186 | "1.16.1-latest": "32.0.108",
|
1187 | "1.16.2-latest": "33.0.61",
|
1188 | "1.16.3-latest": "34.1.42",
|
1189 | "1.16.3-recommended": "34.1.0",
|
1190 | "1.16.4-latest": "35.1.37",
|
1191 | "1.16.4-recommended": "35.1.4",
|
1192 | "1.16.5-latest": "36.1.0",
|
1193 | "1.16.5-recommended": "36.1.0",
|
1194 | "1.5.2-latest": "**.**.**.**",
|
1195 | "1.5.2-recommended": "**.**.**.**",
|
1196 | "1.6.1-latest": "**.**.**.**",
|
1197 | "1.6.2-latest": "**.**.**.**",
|
1198 | "1.6.2-recommended": "**.**.**.**",
|
1199 | "1.6.3-latest": "**.**.**.**",
|
1200 | "1.6.4-latest": "9.11.1.1345",
|
1201 | "1.6.4-recommended": "9.11.1.1345",
|
1202 | "1.7.10-latest": "10.13.4.1614",
|
1203 | "1.7.10-latest-1.7.10": "10.13.2.1343",
|
1204 | "1.7.10-recommended": "10.13.4.1558",
|
1205 | "1.7.2-latest": "10.12.2.1147",
|
1206 | "1.7.2-recommended": "10.12.2.1121",
|
1207 | "1.8-latest": "11.14.4.1577",
|
1208 | "1.8-recommended": "11.14.4.1563",
|
1209 | "1.8.8-latest": "11.15.0.1655",
|
1210 | "1.8.9-latest": "11.15.1.2318",
|
1211 | "1.8.9-recommended": "11.15.1.1722",
|
1212 | "1.9-latest": "12.16.0.1942",
|
1213 | "1.9-recommended": "12.16.1.1887",
|
1214 | "1.9.4-latest": "12.17.0.2051",
|
1215 | "1.9.4-recommended": "12.17.0.1976",
|
1216 | "latest-1.7.10": "10.13.2.1343"
|
1217 | }
|
1218 | }
|
1219 | [15:22:24] [Forge Version Check/INFO] [forge.VersionCheck]: [forge] Found status: AHEAD Target: null
|
1220 | [15:22:24] [Forge Version Check/INFO] [forge.VersionCheck]: [abyssalcraft] Starting version check at https://raw.githubusercontent.com/Shinoow/AbyssalCraft/master/version.json
|
1221 | [15:22:25] [Forge Version Check/DEBUG] [forge.VersionCheck]: [abyssalcraft] Received version check data:
|
1222 | {
|
1223 | "homepage": "https://shinoow.github.io/AbyssalCraft/",
|
1224 | "promos": {
|
1225 | "1.12.2-latest": "2.0.0-ALPHA-2",
|
1226 | "1.12.2-recommended": "1.10.3",
|
1227 | "1.12-latest": "1.9.4-pre-4",
|
1228 | "1.12-recommended": "1.9.4-pre-4",
|
1229 | "1.11.2-latest": "**.**.**.**-FINAL",
|
1230 | "1.11.2-recommended": "**.**.**.**-FINAL",
|
1231 | "1.11-latest": "**.**.**.**",
|
1232 | "1.11-recommended": "**.**.**.**",
|
1233 | "1.10.2-latest": "**.**.**.**-FINAL",
|
1234 | "1.10.2-recommended": "**.**.**.**-FINAL",
|
1235 | "1.10-latest": "**.**.**.**",
|
1236 | "1.10-recommended": "**.**.**.**",
|
1237 | "1.9.4-latest": "**.**.**.**-FINAL",
|
1238 | "1.9.4-recommended": "**.**.**.**-FINAL",
|
1239 | "1.9-latest": "**.**.**.**-FINAL",
|
1240 | "1.9-recommended": "**.**.**.**-FINAL",
|
1241 | "1.8.9-latest": "**.**.**.**-FINAL",
|
1242 | "1.8.9-recommended": "**.**.**.**-FINAL"
|
1243 | },
|
1244 | "1.12.2": {
|
1245 | "2.0.0-ALPHA-2": "- The temple structure in Omothol no longer drops 3 Cthulhu Statues when it generates\n- Antidotes now gives you a Potion Effect that negates the plague it cures\n-Flattened more Blocks\n-Fixed a startup crash on servers",
|
1246 | "2.0.0-ALPHA-1": "- Removed Plate food\n- Removed MRE\n- Removed Fried Egg\n- Removed Iron Plates\n- Removed Washcloth\n- Removed Upgrade Kits\n- Removed the Coralium and Dread Enchantments\n- Portals are now entities instead of nether portal-shaped portals\n- Added Portal Anchors (logical blocks used for linking the new portals)\n- The Gateway Keys no longer create portals by right-clicking, it instead cycles between the available dimensions to use\n- Added a ritual that creates portals\n- Changed the dimension ID wildcard for rituals (so you can add Nether-specific rituals if you want to)\n- Try naming an Abyssal Zombie \"shinoow\"\n- Added the Silver Key (final upgrade to the Gateway Key)\n- Added the Book of Many Faces (item that displays a list of dead creatures that the Dark Resurrection ritual can respawn, along with crystal sizes)\n- Reduced the amount of mobs that spawn during the Cha'garoth fight\n- Removed the config options for disabling stair and slab blocks\n- Added a config option to specify which dimension the portal to the Abyssal Wasteland is created in\n- Added a crafting recipe for turning the secondary variant of Darklands Oak Logs into planks\n- Added some new config categories, and re-organized the options in the others\n- Corrected the translation string for the description of the Teleport Home spell\n- Dreadlands Grass no longer converts Grass and Dirt into itself\n- Added a config option that toggles whether or not non-shadow mobs emit smoke particles inside the Dark Realm\n- Added config options for setting the spawn limits of Dread Spawns and Greater Dread Spawns\n- Localized some texts that previously weren't localized\n- The Staff of Rending now drops the essence on the ground if your inventory's full when it creates it\n- Flattened a plethora of Block IDs (you might notice some missing items and/or blocks if you load up an older world)\n- Removed the old portal blocks along with their fire blocks (since portals are no longer made out of blocks)\n- Added glowing parts to the textures of a bunch of mobs (including Abyssal Zombies, Depths Ghouls and Coralium Infested Squids)\n- Changed the \"Portal cooldown\" config option default to 200 (should've done this after the default option survey)\n- Added the Sequential Brewing Stand, a Brewing Stand with some additional built-in automation\n- Fixed a bug with the Materializer being unable to list all recipes when surpassing 110 registered recipes",
|
1247 | "1.10.3": "- Fixed a startup crash with Stackup\n- Fixed a world corrupting crash when a block without a proper capability implementation is \n- Added Korean translations (courtesy of hwantube)",
|
1248 | "1.10.2": "- Corrected some NBT checking when using keybinds on the Staff of The Gatekeeper, Interdimensional Cage and Spirit Tablet\n- Added a config option that sets the minimum distance two Shoggoth Lairs can generate from each \n- The Chinese, French and Spanish translations have been updated (by Determancer, PrizmaTec and Tosa13)",
|
1249 | "1.10.1": "- Fixed a server crash involving the Item Transportation System\n- The Potion Effects given from wearing various armor sets from the mod no longer display particles\n- Changed the sound of Shoggoth Ooze to slime",
|
1250 | "1.10.0": "- The ritual of Corruption now convert logs into both variants of the Darklands Oak Log (not just the ordinary without animations)\n- The ritual of Purging is now available with the Dreadlands Necronomicon, instead of the Omothol one\n- Added a ritual to cure the Dreadlands (changing the Dreadlands biome into the nearest non-dreadlands biome)\n- Fixed an exploit involving the Materializer\n- Fixed the tooltip texts on the Rending Pedestal\n- Fixed a crash when Potion AoE rituals tries to apply the potion effect to a player\n- Added a new item transportation system (more info in the Necronomicon)\n- Added the Spirit Tablet (the tool used to configure the item transportation system)\n- Added Spirit Tablet Shards (used to make the Spirit Tablet)\n- Added a spell that displays nearby routes for the item transportation system\n- Added a spell that allows you to start/stop the item transportation of nearby blocks\n- Added a configurable blacklist for the Item transportation system\n- Remnant Blacksmiths and Master Blacksmiths sell Spirit Tablet Shards\n- Overhauled random structure generation inside Omothol (no more village around the temple, random structures on islands)\n- Added a plethora of new loot tables to accompany the new buildings in Omothol\n- Added a spell that allows you to walk on air (unlocked around Omothol)\n- Added a spell that teleports you to your spawn point\n- Fixed a bug where you couldn't deal melee damage to J'zahar if Tough As Nails was installed\n- Amplifiers on Statues now last forever, instead of a minute, when applied",
|
1251 | "**.**.**.**": "- The Staff of Rending no longer stops producing items after filling up an energy type once",
|
1252 | "1.9.19": "- Changed the default values for a couple of config options (check the description of GitHub commit 69817fc for more info)\n- Changed the internals of fuel handling for the Crystallizer and Transmutator (event runs before the defaults are applied, so you can override them)\n- Added some ambient void particle rendering in Omothol and the Dark Realm\n- Added a config option that toggles whether or not Evil Animals spawn Demon Animals on death\n- Added a config option that toggles whether or not Evil Animals only spawn at night during a new moon\n- Fixed the sky color in the Darklands biome\n- Omothol Ghouls are actually immune to fire now (apparently they weren't, despite the book claiming they were)\n- The PE Stream particle (the thing you see when PE is being transferred) now respects the particle settings (lower setting = fewer particles)\n- Changed a plethora of Crystallizer recipes (added ore doubling, among others) and Transmutator recipes (reverting crystals is cost inefficient) along with removing crystals as fuels\n- Added a config option (under modules) to revert back to the old recipes and behavior\n- Crystal Clusters are now in the Ore Dictionary (as \"crystalClusterX\", where X is the element)\n- Added Calcium, Beryllium and Beryl crystals to the Ore Dictionary\n- Reworked the PE transfer logic in the statues to increase performance\n- Added an upper limit to how many PE particles can spawn at a time (should boost performance for larger PE generation and/or transportation setups)\n- Optimized the worshiping AI for Lesser Shoggoths and Remnants slightly\n- Added a config option that toggles whether or not Lesser Shoggoth eyes will glow (will save you some performance if you drop FPS while looking at them)\n- Added API support for adding your own Rendings to the Staff of Rending (currently the Rending Pedestal doesn't support custom Rendings)",
|
1253 | "1.9.18": "- Fixed a rendering-related crash with the various fire blocks added in the mod\n- If \"Ooze Expiration\" is enabled, Shoggoth Ooze blocks that aren't full will shrink in size until they perish\n- Tied some loose ends triggering log errors when some modules are disabled\n- Added a config option to toggle whether or not Anti-Players can pick up loot (you really should just blacklist them in the mob spawner/duplicator instead)\n- You can now open Necronomicons and Crystal Bags in the off hand\n- Energy draining (through rituals and spells) now both take the off hand slot into account",
|
1254 | "1.9.17": "- Fixed a bug where the Materializer GUI would crash if more than 110 recipes were available\n- The Interdimensional Cage blacklist actually works now\n- The obsidian platform that generates when Sacthoth spawns doesn't replace blocks that the explosion couldn't destroy\n- Added a config option to toggle whether or not the Night Vision buff from the Plated Coralium Helmet should be applied in all dimensions\n- Reworked the internals of the Dark Resurrection ritual to properly support having multiple dead mobs with the same name\n- Improved the code that checks if a player has a Necronomcion when interacting with a Remnant\n- Engravings no longer stack if they have lost durability\n- All offensive spells now respect PVP settings and player teams\n- Engravings can no longer be repaired\n- Added a new config section for spells (so you can disable individual spells)",
|
1255 | "1.9.16": "- The Altar of Cha'garoth now actually checks the height prior to generating the lair\n- Remnants should no longer potentially have trades where they don't sell anything\n- Made the bark of the Darklands Oak Wood texture brighter\n- Added a bunch of Materializer recipes (including stone and all parts of a tree)\n- The Materializer now uses the Ore Dictionary for finding blocks and items of the same type to materialize\n- Fixed a bug related to fetching available Materialization recipes\n- Fixed a crash that happened if you replaced a Ritual Altar with a non-Ritual Altar Tile Entity\n- You can no longer kill the bosses by having them fall out of the world (they'll just despawn)\n- Dreadlands Stalagmites no longer crash the game if they generate outside building height (only really noticeable with amplified terrain)\n- Fixed a bug where all scroll rituals always returned the Basic Scroll (might be similar instances with other rituals)\n- Lesser Shoggoth sounds and projectiles can now be customized with resource packs (courtesy of Mike-U5)\n- Statues no longer crash when generating Disruptions while affected by tick accelerators",
|
1256 | "1.9.15": "- Anti-Players now despawn (under normal circumstances)\n- If a player dies to Antimatter, the Anti-Player that spawns will have the player's name\n- If an Anti-Player kills a player, there will actually be a chance of an Anti-Player spawning\n- Air pockets no longer generate beneath shoggoth lairs\n- Spectral Dragons, Asorah, Cha'garoth, J'zahar and Sacthoth can now be killed using /kill\n- Improved the scrolling inside the Materializer GUI (also fixes a bug related to scrolling)\n- Added some more Materialization recipes (Coal Block, Redstone Block, Diamond and Diamond Ore)",
|
1257 | "1.9.14": "- Added a config option to disable the plague Enchantments\n- The Ritual Altar and Sacrificial Altar now adds the Glowing Potion Effect to its target (instead of making it emit smoke)\n- Place of Power previews now show a tooltip with the blocks used to build it when hovered over\n- All Shadow mobs now become completely invisible when it's dark enough (instead of barely visible). Bring torches with you to the Dark Realm!\n- You can no longer brew Potions of Annihilation (considering how powerful the Potion Effect is, being able to brew it was just broken OP)\n- Made the usability check in the crystal bag inventory more strict (fixes a dupe bug)\n- Added a ritual (named Mass Enchantment) that combines the Enchantments of 8 Enchanted Books, then applies them on whatever is on the altar\n- Added a config option to set the combined max level a single Enchantment can have in the Mass Enchantment ritual\n- Added a config option to toggle whether or not you can enchant books through the Mass Enchantment ritual\n- Added a Creative Tab for all registered spells\n- Fixed the rendering of the primed ODB (should've done this half a decade ago...), also changed the particle spawning\n- Also totally a 7 year anniversary update",
|
1258 | "**.**.**.**": "- Fixed a crash when any boss dialog is sent to chat on servers",
|
1259 | "1.9.13": "- Capabilities (like Embers heat) will now persist with Upgrade Kit upgrading\n- Improved the explosion code a fair bit\n- Large explosions no longer create particles (either the particles were oddly placed, or simply too many, might replace with something else in the future)\n- Added a config option for the size of an ODB explosion (also increased the default size)\n- Added a config option for the size of antimatter explosions (also increased the default size)\n- AbyssalCraft Explosions now deal more correct amounts of damage (the exposure property from the vanilla explosion damage code kinda nullified the damage)\n- The particle display from the Ritual Pedestals can now be customized for each individual ritual through a set of predefined sequences\n- Added a config option to toggle whether or not Upgrade Kits and the mechanic for them are added (courtesy of Mike-U5)\n- The ritual chant is now played on the server side instead of the client (so you'll always hear a chant when performing rituals while playing on a server)\n- Changed most of the ritual types to use the new particle displays\n- Sacthoth now wields his Soul Reaper Blade (and swings his arm)\n- Added two Enchantments for the Staff of Rending (Sapping and Multi-rend, Sapping increases the amount of energy drained by the staff, and Multi-rend drains energy from mobs near the target)\n- Moved the Potential Energy section out from the Ritual section in the Necronomicon\n- All Tile Entities with Capabilities properly indicate that they have them (so that pipes, for one, interacts with them)",
|
1260 | "1.9.12": "- Added a config option to toggle whether or not food items are added (courtesy of Mike-U5)\n- Added a config option to toggle whether or not the dimension terrain will be affected by the Amplified world type\n- Improved the generation code for the random Abyssal Wasteland structures (they're no longer height dependent, so they're more likely to generate in an amplified world)\n- Attempting to use any bonemeal-esque items in a Purged biome won't consume the item if it's not stackable\n- Added a config option to toggle whether or not statues can generate inside Shoggoth Lairs\n- The \"Dark Resurrection\" Ritual can now resurrect any named mob that has died (and any player can resurrect any named dead mob)\n- Adjusted the rotation of Remnant leg tentacles when riding something\n- Added a JSON file with previously hardcoded colors (for resource packs to override) named \"clientvars.json\"\n- Dread Spawn, Greater Dread Spawn, Lesser Dreadbeast and Spawn of Cha'garoth now have their own textures (rather than using the Dreadguard texture)",
|
1261 | "1.9.11": "- Improved the portal teleportation code (fixes the missing exp bug, hopefully also puts a more permanent end to portal looping)\n- The spawn weight for Dark Offsprings is now configurable\n- Added a config option to toggle whether or not ODBs can explode\n- The cooldown for the Lesser Shoggoth monolith building AI is now configurable\n- Added a configurable range for how many chunks the Ritual of Corruption can affect\n- Added a configurable range for how many chunks the Ritual of Cleansing can affect\n- Added a configurable range for how many chunks the Ritual of Purging can affect",
|
1262 | "1.9.10": "- All bosses are now immune to Potion Effects\n- The Materializer no longer crashes when you put a Crystal Bag in the Crystal Bag slot\n- Prevented some tooltips in other mods from revealing the text of locked items\n- Removed Abyssalnite Armor from the Village Blacksmith loot table\n- Added a config option to toggle whether or not mod items should be added to vanilla loot tables\n- Dreadlands portals can no longer spread Dreadlands around themselves\n- Added a config option to toggle whether or not Depths Ghouls should use the Biome Dictionary for finding biomes to spawn in\n- Added a config option to toggle whether or not Abyssal Zombies should use the Biome Dictionary for finding biomes to spawn in",
|
1263 | "1.9.9": "- Energy Container/Pedestal/Collector/Relay and Sacrificial Altars now behave as Items capable of holding PE in Item form (instead of only displaying the amount of energy contained)\n- However, they don't transfer/receive PE externally, so rituals won't drain from them, nor will statues charge them while in your hand or on the ground\n- The Dreadium Katana can now be enchanted properly on an enchanting table\n- Added Cha'rcoal (like Charcoal, except something's off about it...)\n- Added configurable plague immunities (you can make mobs from other mods immune and or carriers of the Coralium and Dread Plagues)\n- Added a secondary Darklands Oak Wood Block, which has the blinking spots\n- Re-added Inventory Tweaks support for Crystal Bags\n- Added a config option that toggles whether or not J'zahar can break the fourth wall\n- Added a config option that toggles whether or not Lesser Shoggoths are immune to projectile damage\n- The \"Liquid Coralium transmutation\" config option now also controls whether or not Liquid Coralium can transmute non-fluid blocks into their Abyssal Wasteland counterparts\n- Added a config option that toggles whether or not Disruptions can occur from statues or failing rituals\n- Added a config option to disable J'zahar's black hole attack\n- Reduced the amount of skins needed to upgrade the Necronomicon (3 now, previously 8)",
|
1264 | "1.9.8": "- Decorative Statue crafting recipes now use the Ore Dictionary for the dyes\n- The Interdimensional Cage ritual now requires the Dreadlands Necronomicon (it's only required in the Dreadlands for progression, and was obtainable form the start)\n- If all registered dimensions are blacklisted, J'zahar's black holes will teleport you to the Dark Realm\n- The chest in Cha'garoth's Lair now generates with treasure inside again\n- The Dreadium Katana can now be enchanted\n- The various rituals for changing biomes now change a much larger area (32x32 chunks, previously 8x8)\n- The Ritual of Corruption now changes birch and roofed forests too (rather than only oak forests)\n- Started work on optimizing the explosion code for the ODB (and ODB Core by extension)\n- Deduplicated language keys used by other mods\n- Depths Ghoul heads now work as Thaumcraft infusion crafting stabilisers again (did I forget to...? Yes, yes I did)\n- The Depths armor set now provides a vis discount again\n- Lesser Shoggoths now only build monoliths on Shoggoth Ooze blocks, preventing them from building them in the lair walls (or any inaccessible space)",
|
1265 | "1.9.7": "- Lesser Shoggoths now ignore Zombie Villagers\n- If any of the \"Shoggoth Lair Generation Chance\" options are set to 0, lairs won't generate in those areas, instead of causing a crash\n- The textures for the Dark Offspring have been tweaked to look a bit more spooky and goatish\n- Started preliminary work on optimizing worldgen features (trees, structures etc). Might not have a noticeable effect, but it's better than it was before\n- Swapped the texts on the pages for the Decorative Shub-Niggurath and Yog-Sothoth Statues\n- NecroData Chapter Page removal now reorders the remaining pages, instead of leaving blanks\n- Added a method to Chapters allowing you to insert Pages (which doesn't override existing Pages, as the method for adding Pages does)\n- Fuel registration for the Crystallizer and Transmutator are now handled through an event\n- Dark Offsprings now only spawn during night, and their spawning is dependant on the moon phase (more common during a new moon, very rare during a full moon)\n- Lowered the sound volume of the Dark Offspring\n- Added a much needed information section to spells explaining how to inscribe them, cast them, and other useful information (the amount of information is a bit limited right now)\n- Added some new Place of Power structures\n- The Great Old Ones Necronomicon section is now named \"The Great Old Ones\" again, instead of \"Pantheon\" (which is the name of the category it's part of)",
|
1266 | "1.9.6": "- Demon Animals no longer ignite if they come into contact with fire while \"Demon Animal burning\" is disabled (unless Hardcore Mode is enabled)\n- Burning Demon Animals can be extinguished by coming into contact with water, stopping the fire spread\n- Split the Shoggoth Lair Generation Chance into two options, one for rivers and one for swamps\n- Crystallizing Container Items (like filled bottles and filled buckets) leaves the container\n- The Place of Power multiblock structure block now has hardness\n- Biome transformation handling has been streamlined for easier support in JEID (courtesy of sk2048)\n- Fixed a bug where shift-clicking the second output slot of the Crystallizer dupes the output\n- Fixed the crafting recipe for turning an ODB into a Sacthoth spawn egg\n- Fixed a bug where the Crystallizer and Transmutator wouldn't re-evaluate the output if the input changed during processing\n- Remnant librarians now sell Basic, Lesser and Moderate Scrolls, and Remnant priests can upgrade Greater Scrolls into the various unique scrolls\n- AbyssalCraft bosses drop Greater Scrolls on death\n- Moved all trades for different kinds of flesh from the Remnant librarian to the Remnant priest\n- Added rituals for creating Basic, Lesser and Moderate Scrolls\n- Added Shub-Niggurath's Dark Offspring (model and texture made by Cybercat5555)\n- Spiders and Cave Spiders are now considered Shoggoth food\n- Lesser Shoggoths now attack Skeletons and Zombies (except Zombie Villagers)\n- Only a single Spectral Dragon can spawn at any time when one spawns (instead of it rarely being several at once)",
|
1267 | "**.**.**.**": "- Custom NBT added through a summoning ritual will now work for all properties that can be changed through NBT (instead of only mob-specific properties)\n- Fuzzy NBT checking is now handled properly (if Item Stack A has no NBT, but Item Stack B does, they will be equal as B \"contains\" A)",
|
1268 | "**.**.**.**": "- The plague antidotes can now be used 10 times before they run out (and the texture indicates how many uses are left)\n- The plague enchantments no longer infect other players if you hit them while PVP is disabled\n- Rituals now drain energy every second, instead of every tick (fixes rounding errors for energy amounts below 100)\n- Knowledge syncing when changing dimensions now has a configurable delay (sending the data later should reduce initial lag when loading the dimension)\n- Revamped the Lair of Cha'garoth a bit (Dreadstone Cobblestone floor, 30% of the Dreadstone Bricks are cracked)\n- You can now automatically insert items into the Energy Depositioner\n- The rotation of a Energy Relay can be changed by right-clicking it (which cycles through the possible directions)\n- Powerstone Trackers now move towards the nearest unexplored stronghold (a stronghold is considered explored if the Dreadlands Infused Powerstone has been mined)\n- Removed Oblivion Catalysts from the village blacksmith chest loot table (not sure why I added it there in the first place, nor why I didn't remove it earlier)\n- Lowered the chance of finding a Transmutation Gem in the Abyssal Stronghold and Dreadlands Mineshaft loot tables (made more sense back when they were single-use items, they're also damaged when you find them)\n- Transmutation Gems no longer display their durability tooltip if advanced tooltips (F3 + H) are shown\n- Changed the \"The Great Old Ones\" Necronomicon section name to \"Pantheon\" (as opposed to having the former appear twice)\n- All crafting recipes (except the NBT-sensitive ones) are now JSON files\n- Heavily reduced the amount of crafting recipes for the Coralium Infused Stone and the various Coralium Gem Clusters (60 of those recipes were probably never used)\n- Added a hook that allows you do add custom NBT data to a mob summoned through a summoning ritual",
|
1269 | "**.**.**.**": "- When \"Display Item Names\" is enabled, you actually see the Item names, instead of \"Lorem ipsum\"\n- The Purging ritual now ignores unbreakable blocks (so modded bedrock blocks won't get replaced)\n- Shoggoth Biomass no longer spawn anything if the doMobSpawning gamerule is set to false\n- Changed the default value for Portal Cooldown to 100 ticks (previously 10)",
|
1270 | "**.**.**.**": "- The Necronomicon GUI will no longer try to divide by zero when drawing ItemStacks\n- Darklands Oak Doors now generate in Abyssal Strongholds, instead of vanilla oak ones\n- Darklands Oak and Dreadlands Doors are now randomly picked for the buildings in Omothol that have doors",
|
1271 | "1.9.5": "- Darklands Oak Wood Slabs, Darklands Oak Wood Fence and Dreadlands Wood Fence are now registered in the Ore Dictionary\n- Added compatibility with Hardcore Darkness (if it's installed, all dimensions will be dark if the respective config options are enabled)\n- Added a configuration category for options related to mod compatiblity\n- Added configurable blacklists for Overworld structure and ore generation in other surface worlds\n- Darkstone, Abyssal Stone etc, Abyssal Sand and Abyssal Sand Glass can now be manipulated through Chisel & Bits\n- Textures for all Darkstone-based blocks, Darklands Oak Plank, Monolith Stone + Pillar, Shadow Fragment, Shadow Gem Shard and various Altar/Pedestal overlays have been revamped (courtesy of Cybercat5555)\n- Be sure to name your anti-animals, or any anti-mob for that matter!\n- Added a bunch of new spells (you can try them out by spawning in some scrolls)\n- The game should no longer crash if a tamed and named horse dies without it's owner present in the same dimension\n- Changed the damage cap on J'zahar to 20, and made it so that you can't bypass his invincibility frames\n- Added a config option to toggle whether or not portals require a player to be nearby in order to rarely spawn mobs\n- Portal blocks now have a spawn cap on how many of the rarely spawned mobs it can spawn (if enough are nearby the portal, no more spawn)\n- Dread Spawns can no longer merge into a Greater Dread Spawn if 10 of those area within 32 blocks of them\n- Greater Dread Spawns can no longer merge into a Lesser Dreadbeast of 4 of those are within 32 blocks of them, nor spawn Dread Spawns if 20 of those are within the same distance\n- Lesser Dreadbeasts can't spawn Greater Dread Spawns if 10 of those are within 32 blocks of it, nor Dread Spawns of 20 of those are within the same distance\n- The aforementioned spawn restrictions also applies for Cha'garoth when he spawns the same mobs during his fight\n- Shoggoth Biomass now checks for Lesser Shoggoths within 32 blocks of it (instead of 16) when determining if it should spawn one\n- Lesser Shoggoths can now be hurt through their main body again (instead of only their multiparts), so that blocks used to kill mobs in mob grinders hurt them again\n- Rending Pedestals can now also target multipart entities\n- Fixed a crash when a specific disruption was triggered by failing a ritual\n- Items and Blocks with subtypes that can be used in a ritual now cycles through them when shown in the Necronomicon\n- The Coralium and Dread enchantments can no longer be applied through an Anvil with an enchanted book\n- Increased the follow range of the Skeleton Goliath\n- Added doors for Darklands Oak and Dreadlands Wood (textures by Seth0067 and Cybercat5555)\n- Fixed the models for the various cobblestone walls (now every connected wall block doesn't have the wall post part)\n- Centered the MRE in its texture\n- Added a texture with a snow overlay for the Dreadlands Grass\n- Ritual Altars now check if the Necronomicon it's attempting to drain energy from during a ritual actually has energy stored before draining (in case someone has multiple books in their inventory)\n- Lesser Shoggoths no longer spawn naturally in the Overworld (only through lairs)\n- Added a configuration category for disabling things like Dreadlands spread (named \"Wet Noodle\")\n- Updated the Lesser Shoggoth picture in the Necronomicon\n- Added a config option to toggle whether or not boss dialogs display\n- Added some variations to the Shoggoth Lairs, and statues (both normal and decorative) have a chance of generating inside them\n- Changed the creature types of a few mobs (might add some more new ones to properly classify some mobs, or add some enchantments for extra damage against more stuff)\n- Evil animals now always spawn like mobs, instead of broad daylight, like normal animals\n- The disruptions that spawn random mobs from the current biome can no longer spawn Lesser Dreadbeasts\n- Added Places of Power (multiblocks capable of harvesting PE from statues without causing Disruptions)\n- Added a section with information about Places of Power in the Necronomicon (under Information in the Ritual section)\n- There is currently only one Place of Power structure, but more will be added in future updates",
|
1272 | "**.**.**.**": "- Bounding boxes for tiered Energy Relays now continue to face the correct direction after a chunk reload\n- Revamped the mob spawn placement of Disruptions that spawn mobs\n- Statues now generate particles to indicate that a ritual charm is active on them again\n- Lesser Shoggoths have a new model (courtesy of Cybercat5555)\n- The unlock condition for the Cudgel now checks for the correct mob\n- Rituals can now be locked behind obtaining knowledge (currently unused)\n- The Staff of Rending can now target multipart entities\n- Lesser Shoggoths are now multipart entities",
|
1273 | "**.**.**.**": "- Added a config option that toggles if item names should display regardless of them being locked or not\n- Cha'garoth now opens his mouth during his barf attack (courtesy of Enderman_Of_D00m)\n- Fixed the crystallizer recipes for processing Bronze\n- J'zahar has been buffed with new attacks (including shouts, earthquakes and conjuring black holes and gravity anomalies)\n- Added a dimension blacklist for the aforementioned black holes\n- I'm not gonna reveal the actual change, but it involves Creative Mode and a certain gatekeeper\n- The Dreadlands Portal now spawn Dreadlings instead of Dread Spawns\n- Energy Containers can now display values over 32767 in their GUIs\n- Doubled the time it takes for a Lesser Dreadbeast to spawn a Dread Spawn",
|
1274 | "**.**.**.**": "- Added a keybind for capturing mobs with the Interdimensional Cage\n- Added some default items to the various item pickup blacklists\n- Increased the amount of energy collected and transferred by the tiered Energy Relays\n- Made the knowledge syncing slightly more efficient\n- Fixed a server crash caused by Liquid Coralium flowing\n- Removed a dot from the Russian translation in order to stop a crash with letters exceeding the maximum allowed in a Necronomicon page",
|
1275 | "**.**.**.**": "- Dreadlands Grass can now convert Grass and Dirt into itself (no biome spread, only block transformation, can be disabled in the config)\n- The JEI plugin now loads properly again (tested with **.**.**.**)\n- If Liquid Coralium flows into the ocean while \"Oceanic Coralium Pollution\" is disabled, infinite blocks of Cobblestone no longer drops in the water\n- Optimized the Transmutator and Crystallizer (probably barely noticable, but its processing is handled more efficiently internally)\n- Shift-clicking the first output slot of the Crystallizer no longer moves the ouput to the second output slot\n- Added Advancements (a few, more will come in the next update or so) based on the Achievements in previous MC versions\n- Configuration category comments are now properly applied again\n- Added a config category (and a plethora of options) for disabling blocks\n- Creation Ritual now does a proper ItemStack comparison check when replacing the possibly existing Item placed on the ritual altar with the product Item\n- Rituals are now handled server-side (with the exception of particles), and the client is updated on completion\n- Added a event that fires off when a Ritual is failed (allows you to change the Disruption triggered, or do stuff, cancelling defaults back to random Disruption)\n- Fixed numerous instances of sentences using the wrong indefinite article in the en_us lang file (courtesy of mcBegins2Snow)\n- Crafting recipes for Darklands Oak Fence and Dreadlands Fence are no longer overriden by vanilla (Darklands Oak Button and Pressure Plates are still, however)\n- Updated the tooltip for Transmutator and Crystallizer fuel recipes in JEI\n- Added Russian translation (courtesy of AlekseiVoronin)\n- Chinese translations have been updated (courtesy of mcBegins2Snow)\n- Now runs on Forge 14.23.4.2747",
|
1276 | "**.**.**.**": "- The purging ritual now only converts biomes that are Dreadlands biomes\n- Added loot tables to all bosses (empty), Coralium Infested Squid and all Remnant types\n- Statues now have their Deity Type assigned to them again, instead of null\n- Lesser Shoggoths now have an AI for monolith construction, which makes the construction happen more frequently\n- The biome transformation of the Dread Plague only happens to those inflicted with Dread Plague II\n- If two mobs/players/whatevers close to each other both have Dread Plague I, they can infect each other with Dread Plague II\n- If the Hardcode Mode config option is enabled biome transformation will happen regardless of Dread Plague amplifier\n- The purging ritual now checks the surrounding area instead of the position of the altar for nearby Dreadlands biomes when checking if the ritual can be performed\n- The cleansing and corruptions rituals now both do the same thing as the purging when checking if the ritual can be performed\n- Reduced the luminosity of the foliage color in the Coralium Infested Swamp, making it blend better with adjacent biomes\n- Lesser Shoggoths now swim faster (and can move against flowing water)\n- Increased the range of the Corruption, Cleansing and Purging rituals to 8x8 chunks (previously 3x3)\n- Eyes (and other luminous bits) now glow on Lesser Shoggoths\n- The crafting recipe for the Transmutator now works with used Transmutation Gems again\n- Any NBT checks for crafting recipes and/or rituals are now a lot less strict (the placed item needs to contain the recipe item NBT tags)\n- Remapped the Tile Entities to use the proper prefix (stops log warnings on startup)\n- Now runs on Forge 14.23.4.2705\n- Bump to JEI **.**.**.**",
|
1277 | "**.**.**.**": "- A bunch of textures have been revamped (courtesy of Dylan4ever)\n- Lesser Shoggoths can no longer break Bedrock (or other unbreakable blocks) with their acid\n- Acid Projectiles no longer break blocks with Tile Entities when hitting Players or other mobs\n- Scaled down the model of the baby Lesser Shoggoth (to be more proportional with the hitbox, also made the eyes a bit bigger)\n- Slowed down the initial velocity of the Acid Projectile, increased the time between each projectile being fired, and made it so baby Lesser Shoggoths won't fire them\n- Added a config option for changing the frequency at which Lesser Shoggoths spit acid\n- J'zahar now respects the mobGriefing gamerule with his explosion\n- Fixed a dupe bug in the Materializer GUI\n- Mobs spawned through a summoning ritual now have their portal cooldown set to max\n- Increased the time it takes for a Greater Dread Spawn and Lesser Dreadbeast to spawn a regular Dread Spawn\n- Increased the time it takes for Cha'garoth to spawn the various things he spawns, and removed the direct physical damage dealt by his fireballs\n- Reduced the range of Cha'garoth's melee attacks\n- Fixed the pick block for Calcified Stone",
|
1278 | "**.**.**.**": "- Removed the End Abyssal Zombie\n- Remnants now also worship statues at times\n- Added a config option that toggles if knowledge should be synced to the client every time a player opens their Necronomicon\n- The lightning bolt that strikes a statue when a Disruption triggers is now only the effect\n- Added a new Disruption that generates a random amount of Shoggoth Ooze around the source\n- Added a new Disruption that spawns random mobs that normally spawn in the current biome\n- Added a new Disruption that spawns a single random mob that normally spawn in the current biome\n- Added missing null check to the Purge Event Handler, fixing a Sponge-related crash\n- Capability data is no longer lost upon leaving the End\n- Lesser Shoggoths now respect the mobGriefing Game Rule when it comes to their acid-based attacks\n- Changed the minimum Block hardness for resisting acid to 2.1 (previously 3.0)",
|
1279 | "**.**.**.**": "- Dreadguards are now regarded as undead\n- Changed the particles used in the Dreadguard/Cha'garoth barf attack (since they're not breathing fire)\n- The plagues no longer reinfect their host (effectively refreshing themselves)\n- Lesser Shoggoth acid projectiles can now be blocked with a shield (the player will still take half a heart of damage)\n- Added a config option to toggle whether or not shields can block acid projectiles\n- Statues don't trigger disruptions inside Omothol\n- If a Lesser Shoggoth has a target when it spawns an offspring, it has a 33% chance of throwing it at the target\n- Added a config option for the minimum Block Hardness required to stop Shoggoth Acid from destroying the Block\n- Abyssal Zombies now attack Villagers\n- Sacthoth no longer despawns in the Dark Realm\n- Asorah now has full knockback resistance (you're gonna need bigger arrows)",
|
1280 | "**.**.**.**": "- Shoggoth Biomass no longer randomly spawn Lesser Shoggoths client-side\n- Added some text (with pictures) to better explain the transfer range of Statues to nearby Collectors\n- Shoggoth Biomass blocks don't spawn any Lesser Shoggoths unless a player is within 32 blocks of it\n- Lesser Shoggoths can now secrete acid as a means of defending themselves (or a ranged attack) which can destroy blocks in their path\n- Lesser Shoggoths can now consume any item they run into, which is also configurable\n- Lesser Shoggoths now have a chance to locate a nearby statue and chant by it\n- Increased the hitbox size of Lesser Shoggoths (and reduced their hit range)\n- Removed the disruption that converts the surrounding chunk into Darklands (better leave the fate of their world to the player)\n- The Dread Plague Antidote now requires a Dreadlands Sapling instead of Omothol Ghoul Flesh\n- Fixed a few minor derps in some of the segments of the Remnant leg tentacles\n- Child Lesser Shoggoths now have half the health and attack damage of an adult one\n- The Temple of J'zahar has been revamped\n- Greater Dread Spawns will now deal damage with their Dread Slugs again\n- Rituals Pedestals now project bits of their placed object rather than smoke during rituals\n- Rituals that require sacrifices now requires the player performing the ritual to sacrifice the animal, rather than it being killed automatically\n- The Wooden Crate now supports capabilities for insertion and extraction\n- Fixed the secondary death message for shadow damage\n- Added a ritual to purge the Dreadlands (while also rendering the area uninhabitable)\n- Added Calcified Stone (what everything turns into when the purging ritual has been used)",
|
1281 | "**.**.**.**": "- Shadow mobs are now immune to fire, and capable of swimming\n- Changed the texture for Liquid Antimatter (darker spots within the liquid, making it a bit less milk-like)\n- Added a config option that turns antimatter explosions nuclear (off by default)\n- Dread-plagued mobs now automatically leave a lingering cloud of Dread Plague on death\n- Added a new config category for misc out of place settings\n- The amount of animals a Lesser Shoggoth has to eat in order to multiply/grow up now depends on the size of the animals it eats (1 adult cow = 3 adult chickens)\n- The advancement trigger for summoning entities now fires for nearby players when completing a Summoning Ritual",
|
1282 | "**.**.**.**": "- Applying a redstone signal to an Energy Relay pauses it\n- The Overworld biomes are always registered now, just not added to the list of biomes to generate if set not to\n- Statues can now transfer PE to dropped items (provided they can accept PE)\n- Redrafted a bunch of text inside the Necronomicon (removing redundant/incorrect information and adding new information)\n- Replaced all mob pictures in the Necronomicon with ones that look more like something drawn in the book\n- Fixed an infinite loop in the mining spell when mining upwards\n- Added a small section that explains how to obtain knowledge, unlocking information in the Necronomicon and unmasks Items and Blocks\n- Reduced the duration of fire applied to attackers when attacking someone wearing Dreaded Abyssalnite gear\n- The Coralium Plague and Dread Plague now act more like actual plagues (they spread a lot easier, can't be cured with milk)\n- Abyssalnite Golems now turn into Dreaded Abyssalnite Golems if killed by the Dread Plague\n- Portals now have a small chance of spawning a mob from their dimension\n- Shadow mobs now change their transparency based on light level (bright = visible, dark = not so visible)\n- The Dreadlands can leak out of it's portals, so keep a lookout in case too much gets out\n- Added Antidotes for the Coralium and Dread Plague (used to cure them instead of milk, which no longer cures them)\n- Increased the amount of Coralium Ore that generates in the Overworld (also made it configurable)\n- Knowledge unlock syncing is now done on a per unlock basis, rather than when opening the Necronomicon or changing dimensions\n- Asorah and Spectral Dragons now have the undead creature attribute",
|
1283 | "**.**.**.**": "- Fixed some redundancy in the FireMessage packet that's sent when hitting any of the mods fire blocks\n- Ritual ground creation is now less sensitive about surrounding blocks (as long as they aren't full cubes)\n- Spell recipes can now be displayed in the Necronomicon\n- The tooltip of Energy Relays now display the range of the block\n- Item information can now be locked, resulting in the tooltip font being replaced by the Aklo Font\n- Added a command to automatically unlock all Necronomicon knowledge\n- Leaving Omothol portals now return you to the Dreadlands, not the Abyssal Wasteland\n- Randomized the texture rotation of the Fused Abyssal Sand\n- Made the outlines of the Abyssal Stone Brick, Abyssalnite Stone Brick and Dreadstone Brick more consistent\n- Created a new texture for Dreadstone\n- Shift-clicking output slots now works in the Materializer (giving you up to a stack of the output per click)\n- Now runs on Forge 14.23.2.2611",
|
1284 | "**.**.**.**": "- Added a barfing sound to Dreadguards and Cha'garoth (instead of playing the sound for when a Ghast shoots a fireball)\n- Added Crystallized Calcium, Beryllium and Beryl\n- Materializer recipes can now be displayed in JEI\n- The biome transformation from Cha'garoth and his Dreaded Charges has been optimized (code only runs on the server, only affects non-dreadlands biomes)\n- The Rending Pedestal works on Omothol creatures again\n- Rather than crashing, an error will be logged when failing to convert an ItemStack from the Ore Dictionary into a BlockState during startup\n- Overworld structure generation now checks for the Overworld World Provider rather than Dimension ID",
|
1285 | "**.**.**.**": "- Ticking Tile Entities that don't do anything client side no longer ticks client side\n- Added a hurt sound to Anti-Players that those who played Minecraft before beta ended might recognize (props to BordListian for letting me know of it's prescence in Better With Mods)\n- Non-player entities can now use portals\n- Anti-mobs now attack their regular countepart (for more destruction and chaos) and Anti-Players has a chance of targeting any non Anti-Player\n- Mobs capable of spreading the Dread Plague no longer tries to apply it on something that's already immune to it\n- Added a new attack to Shadow Beasts and Sacthoth (credits to Enderman_of_D00M for the code)\n- The Materializer is now functional\n- Greater Dread Spawns and Lesser Dreadbeasts now swap between melee and ranged attacks\n- Added a new attack to Dreadguards (credits to Enderman_of_D00M for the code)\n- Cha'garoth's heads now move independantly, and each has attacks of their own (credits to Enderman_of_D00M for the code)\n- Loot Tables are now initialized during loading stages (instead of being initialized when something relying on one of them references it)\n- Disruption Packets now send the correct String value representation of the Deity, stopping even more error log spam\n- The beams that spawn during Asorah's death animation are now more properly colored\n- J'zahar has longer reach for his staff-whacking\n- J'zahar is now immune to fire, explosions, magic and fall damage\n- Adjusted the bounding boxes and eye heights of Remnant and Minions of The Gatekeeper\n- Spectral Dragons now only knocks mobs and players away in Hardcore Mode\n- Dreadium Samurai armor now reduces the amount of Dread damage you receive\n- Materializer recipes can now be displayed in the Necronomicon\n- Spectral Dragons now only lose health when Asorah doesn't have full health",
|
1286 | "**.**.**.**": "- The JEI plugin now properly filters out invalid Transmutator and Crystallizer fuels\n- Baby Lesser Shoggoths are 40% slower now (compared to their movement speed in previous versions)\n- The Transmutator no longer transmutes things without recipes into air",
|
1287 | "1.9.4": "- Added a configurable list of mobs to spawn Demon Animals from on death\n- The Necronomicon now saves the last page viewed before closing (doesn't persist across restarts, however)\n- Increased the spawn rate of shadow mobs in Darklands biomes\n- Shadow Creatures now have a guaranteed chance of dropping Shadow Fragments\n- Shoggoth Ooze no longer spreads on Monolith Stone\n- Greatly increased the spawn chance of Shoggoth Lairs while making it more configurable\n- If a ritual doesn't have a description, the Necronomicon won't try to display it on the ritual page\n- Item tooltips and the background gradient now displays in GUIs where you interact with inventories\n- Fixed a metadata mismatch for Dreadlands Ritual Altars/Pedestals\n- Optimized the performance of Energy Relays slightly (probably mostly noticeable in larger networks of them)\n- Disruption packets without a Deity are now properly handled, stopping the error log spam\n- Shoggoth Ooze is now corrosive, dealing durability damage to leg and foot armor while exposed to it\n- Fixed a bunch of derps regarding bounding box based Entity searching\n- The NecroData Capability now filters out things that are no longer registered on load\n- All Ethaxium blocks (dark or not) are now Ender Dragon and Wither-proof\n- Transmutator and Crystallizer fuels with container items (like filled buckets) now return the container item\n- Portal blocks now fire the EntityTravelToDimensionEvent prior to teleporting the player, making it possible to cancel teleportation between AbyssalCraft dimensions\n- Added additional buttons to the Necronomicon GUI (skip multiple pages, go back multiple pages, go back to the front page)\n- Energy Relays can now collect PE from Energy Containers too\n- Fixed the eye layer on the Anti-Spiders (now the eyes are the only bits that glow, instead of the whole spider)\n- Ritual altar sacrifices can now also be NBT sensitive\n- Added a config option to stop armor sets from applying Potion Effects or dispell other Potion Effects\n- Added scrolls (currently not usable, nor craftable)\n- Spells are close to being fully implemented, with most of the backing code done\n- Recompiled against 1.12.2\n- Now runs on Forge 14.23.0.2500"
|
1288 | },
|
1289 | "1.12": {
|
1290 | "1.9.4-pre-4": "- Ported to Minecraft 1.12\n- Removed deprecated things from the API\n- Condensed a bunch of blocks to use a single ID\n- Removed Darklands Grass"
|
1291 | },
|
1292 | "1.11.2": {
|
1293 | "**.**.**.**-FINAL": "- The purging ritual now only converts biomes that are Dreadlands biomes\n- Added loot tables to all bosses (empty), Coralium Infested Squid and all Remnant types\n- Lesser Shoggoths now have an AI for monolith construction, which makes the construction happen more frequently\n- The biome transformation of the Dread Plague only happens to those inflicted with Dread Plague II\n- If two mobs/players/whatevers close to each other both have Dread Plague I, they can infect each other with Dread Plague II\n- If the Hardcode Mode config option is enabled biome transformation will happen regardless of Dread Plague amplifier\n- The purging ritual now checks the surrounding area instead of the position of the altar for nearby Dreadlands biomes when checking if the ritual can be performed\n- The cleansing and corruptions rituals now both do the same thing as the purging when checking if the ritual can be performed\n- Reduced the luminosity of the foliage color in the Coralium Infested Swamp, making it blend better with adjacent biomes\n- Lesser Shoggoths now swim faster (and can move against flowing water)\n- Increased the range of the Corruption, Cleansing and Purging rituals to 8x8 chunks (previously 3x3)\n- Eyes (and other luminous bits) now glow on Lesser Shoggoths\n- Any NBT checks for crafting recipes and/or rituals are now a lot less strict (the placed item needs to contain the recipe item NBT tags)",
|
1294 | "**.**.**.**": "- A bunch of textures have been revamped (courtesy of Dylan4ever)\n- Lesser Shoggoths can no longer break Bedrock (or other unbreakable blocks) with their acid\n- Acid Projectiles no longer break blocks with Tile Entities when hitting Players or other mobs\n- Scaled down the model of the baby Lesser Shoggoth (to be more proportional with the hitbox, also made the eyes a bit bigger)\n- Slowed down the initial velocity of the Acid Projectile, increased the time between each projectile being fired, and made it so baby Lesser Shoggoths won't fire them\n- Added a config option for changing the frequency at which Lesser Shoggoths spit acid\n- J'zahar now respects the mobGriefing gamerule with his explosion\n- Fixed a dupe bug in the Materializer GUI\n- Mobs spawned through a summoning ritual now have their portal cooldown set to max\n- Increased the time it takes for a Greater Dread Spawn and Lesser Dreadbeast to spawn a regular Dread Spawn\n- Increased the time it takes for Cha'garoth to spawn the various things he spawns, and removed the direct physical damage dealt by his fireballs\n- Reduced the range of Cha'garoth's melee attacks\n- Fixed the pick block for Calcified Stone",
|
1295 | "**.**.**.**": "- Removed the End Abyssal Zombie\n- Remnants now also worship statues at times\n- Added a config option that toggles if knowledge should be synced to the client every time a player opens their Necronomicon\n- The lightning bolt that strikes a statue when a Disruption triggers is now only the effect\n- Added a new Disruption that generates a random amount of Shoggoth Ooze around the source\n- Added a new Disruption that spawns random mobs that normally spawn in the current biome\n- Added a new Disruption that spawns a single random mob that normally spawn in the current biome\n- Added missing null check to the Purge Event Handler, fixing a Sponge-related crash\n- Capability data is no longer lost upon leaving the End\n- Lesser Shoggoths now respect the mobGriefing Game Rule when it comes to their acid-based attacks\n- Changed the minimum Block hardness for resisting acid to 2.1 (previously 3.0)",
|
1296 | "**.**.**.**": "- Dreadguards are now regarded as undead\n- Changed the particles used in the Dreadguard/Cha'garoth barf attack (since they're not breathing fire)\n- The plagues no longer reinfect their host (effectively refreshing themselves)\n- Lesser Shoggoth acid projectiles can now be blocked with a shield (the player will still take half a heart of damage)\n- Added a config option to toggle whether or not shields can block acid projectiles\n- Statues don't trigger disruptions inside Omothol\n- If a Lesser Shoggoth has a target when it spawns an offspring, it has a 33% chance of throwing it at the target\n- Added a config option for the minimum Block Hardness required to stop Shoggoth Acid from destroying the Block\n- Abyssal Zombies now attack Villagers\n- Sacthoth no longer despawns in the Dark Realm\n- Asorah now has full knockback resistance (you're gonna need bigger arrows)",
|
1297 | "**.**.**.**": "- Shoggoth Biomass no longer randomly spawn Lesser Shoggoths client-side\n- Added some text (with pictures) to better explain the transfer range of Statues to nearby Collectors\n- Shoggoth Biomass blocks don't spawn any Lesser Shoggoths unless a player is within 32 blocks of it\n- Lesser Shoggoths can now secrete acid as a means of defending themselves (or a ranged attack) which can destroy blocks in their path\n- Lesser Shoggoths can now consume any item they run into, which is also configurable\n- Lesser Shoggoths now have a chance to locate a nearby statue and chant by it\n- Increased the hitbox size of Lesser Shoggoths (and reduced their hit range)\n- Removed the disruption that converts the surrounding chunk into Darklands (better leave the fate of their world to the player)\n- The Dread Plague Antidote now requires a Dreadlands Sapling instead of Omothol Ghoul Flesh\n- Fixed a few minor derps in some of the segments of the Remnant leg tentacles\n- Child Lesser Shoggoths now have half the health and attack damage of an adult one\n- The Temple of J'zahar has been revamped\n- Greater Dread Spawns will now deal damage with their Dread Slugs again\n- Rituals Pedestals now project bits of their placed object rather than smoke during rituals\n- Rituals that require sacrifices now requires the player performing the ritual to sacrifice the animal, rather than it being killed automatically\n- The Wooden Crate now supports capabilities for insertion and extraction\n- Fixed the secondary death message for shadow damage\n- Added a ritual to purge the Dreadlands (while also rendering the area uninhabitable)\n- Added Calcified Stone (what everything turns into when the purging ritual has been used)",
|
1298 | "**.**.**.**": "- Shadow mobs are now immune to fire, and capable of swimming\n- Changed the texture for Liquid Antimatter (darker spots within the liquid, making it a bit less milk-like)\n- Added a config option that turns antimatter explosions nuclear (off by default)\n- Dread-plagued mobs now automatically leave a lingering cloud of Dread Plague on death\n- Added a new config category for misc out of place settings\n- The amount of animals a Lesser Shoggoth has to eat in order to multiply/grow up now depends on the size of the animals it eats (1 adult cow = 3 adult chickens)",
|
1299 | "**.**.**.**": "- Applying a redstone signal to an Energy Relay pauses it\n- The Overworld biomes are always registered now, just not added to the list of biomes to generate if set not to\n- Statues can now transfer PE to dropped items (provided they can accept PE)\n- Redrafted a bunch of text inside the Necronomicon (removing redundant/incorrect information and adding new information)\n- Replaced all mob pictures in the Necronomicon with ones that look more like something drawn in the book\n- Fixed an infinite loop in the mining spell when mining upwards\n- Added a small section that explains how to obtain knowledge, unlocking information in the Necronomicon and unmasks Items and Blocks\n- Reduced the duration of fire applied to attackers when attacking someone wearing Dreaded Abyssalnite gear\n- The Coralium Plague and Dread Plague now act more like actual plagues (they spread a lot easier, can't be cured with milk)\n- Abyssalnite Golems now turn into Dreaded Abyssalnite Golems if killed by the Dread Plague\n- Portals now have a small chance of spawning a mob from their dimension\n- Shadow mobs now change their transparency based on light level (bright = visible, dark = not so visible)\n- The Dreadlands can leak out of it's portals, so keep a lookout in case too much gets out\n- Added Antidotes for the Coralium and Dread Plague (used to cure them instead of milk, which no longer cures them)\n- Increased the amount of Coralium Ore that generates in the Overworld (also made it configurable)\n- Knowledge unlock syncing is now done on a per unlock basis, rather than when opening the Necronomicon or changing dimensions\n- Asorah and Spectral Dragons now have the undead creature attribute",
|
1300 | "**.**.**.**": "- Fixed some redundancy in the FireMessage packet that's sent when hitting any of the mods fire blocks\n- Ritual ground creation is now less sensitive about surrounding blocks (as long as they aren't full cubes)\n- Spell recipes can now be displayed in the Necronomicon\n- The tooltip of Energy Relays now display the range of the block\n- Item information can now be locked, resulting in the tooltip font being replaced by the Aklo Font\n- Added a command to automatically unlock all Necronomicon knowledge\n- Leaving Omothol portals now return you to the Dreadlands, not the Abyssal Wasteland\n- Randomized the texture rotation of the Fused Abyssal Sand\n- Made the outlines of the Abyssal Stone Brick, Abyssalnite Stone Brick and Dreadstone Brick more consistent\n- Created a new texture for Dreadstone\n- Shift-clicking output slots now works in the Materializer (giving you up to a stack of the output per click)",
|
1301 | "**.**.**.**": "- Added a barfing sound to Dreadguards and Cha'garoth (instead of playing the sound for when a Ghast shoots a fireball)\n- Added Crystallized Calcium, Beryllium and Beryl\n- Materializer recipes can now be displayed in JEI\n- The biome transformation from Cha'garoth and his Dreaded Charges has been optimized (code only runs on the server, only affects non-dreadlands biomes)\n- The Rending Pedestal works on Omothol creatures again\n- Rather than crashing, an error will be logged when failing to convert an ItemStack from the Ore Dictionary into a BlockState during startup\n- Overworld structure generation now checks for the Overworld World Provider rather than Dimension ID",
|
1302 | "**.**.**.**": "- The JEI plugin no longer stops at Transmutator Fuel recipe registration\n- Ticking Tile Entities that don't do anything client side no longer ticks client side\n- Added a hurt sound to Anti-Players that those who played Minecraft before beta ended might recognize (props to BordListian for letting me know of it's prescence in Better With Mods)\n- Non-player entities can now use portals\n- Anti-mobs now attack their regular countepart (for more destruction and chaos) and Anti-Players has a chance of targeting any non Anti-Player\n- Mobs capable of spreading the Dread Plague no longer tries to apply it on something that's already immune to it\n- Added a new attack to Shadow Beasts and Sacthoth (credits to Enderman_of_D00M for the code)\n- The Materializer is now functional\n- Greater Dread Spawns and Lesser Dreadbeasts now swap between melee and ranged attacks\n- Added a new attack to Dreadguards (credits to Enderman_of_D00M for the code)\n- Cha'garoth's heads now move independantly, and each has attacks of their own (credits to Enderman_of_D00M for the code)\n- Loot Tables are now initialized during loading stages (instead of being initialized when something relying on one of them references it)\n- Disruption Packets now send the correct String value representation of the Deity, stopping even more error log spam\n- The beams that spawn during Asorah's death animation are now more properly colored\n- J'zahar has longer reach for his staff-whacking\n- J'zahar is now immune to fire, explosions, magic and fall damage\n- Adjusted the bounding boxes and eye heights of Remnant and Minions of The Gatekeeper\n- Spectral Dragons now only knocks mobs and players away in Hardcore Mode\n- Dreadium Samurai armor now reduces the amount of Dread damage you receive\n- Materializer recipes can now be displayed in the Necronomicon\n- Spectral Dragons now only lose health when Asorah doesn't have full health",
|
1303 | "**.**.**.**": "- The JEI plugin now properly filters out invalid Transmutator and Crystallizer fuels\n- Baby Lesser Shoggoths are 40% slower now (compared to their movement speed in previous versions)\n- The Transmutator no longer transmutes things without recipes into air",
|
1304 | "1.9.4": "- Added a configurable list of mobs to spawn Demon Animals from on death\n- Maps now works inside AbyssalCraft dimensions\n- The Necronomicon now saves the last page viewed before closing (doesn't persist across restarts, however)\n- Increased the spawn rate of shadow mobs in Darklands biomes\n- Shadow Creatures now have a guaranteed chance of dropping Shadow Fragments\n- Shoggoth Ooze no longer spreads on Monolith Stone\n- Greatly increased the spawn chance of Shoggoth Lairs while making it more configurable\n- If a ritual doesn't have a description, the Necronomicon won't try to display it on the ritual page\n- Optimized the performance of Energy Relays slightly (probably mostly noticeable in larger networks of them)\n- Disruption packets without a Deity are now properly handled, stopping the error log spam\n- Shoggoth Ooze is now corrosive, dealing durability damage to leg and foot armor while exposed to it\n- The NecroData Capability now filters out things that are no longer registered on load\n- All Ethaxium blocks (dark or not) are now Ender Dragon and Wither-proof\n- Transmutator and Crystallizer fuels with container items (like filled buckets) now return the container item\n- Portal blocks now fire the EntityTravelToDimensionEvent prior to teleporting the player, making it possible to cancel teleportation between AbyssalCraft dimensions\n- Added additional buttons to the Necronomicon GUI (skip multiple pages, go back multiple pages, go back to the front page)\n- Energy Relays can now collect PE from Energy Containers too\n- Fixed the eye layer on the Anti-Spiders (now the eyes are the only bits that glow, instead of the whole spider)\n- Ritual altar sacrifices can now also be NBT sensitive\n- Added a config option to stop armor sets from applying Potion Effects or dispell other Potion Effects\n- Added scrolls (currently not usable, nor craftable)\n- Spells are close to being fully implemented, with most of the backing code done",
|
1305 | "1.9.4-pre-4": "- Fixed a small derp in the Crystallizer recipe handling code\n- Improved explosion code for ODB and ODB Cores (along with some performance improvements)\n- Fixed a crash with BoP (or any other mod adding specific blocks to the OreDictionary with the wildcard value as meta)",
|
1306 | "1.9.4-pre-3": "- The Knowledge event handler shouldn't crash from trying to save the ID of an unregistered entity\n- Fixed a small client de-sync when draining energy for a ritual\n- Added a ritual that allows you to \"purge\" the Darklands, coverting areas of it into their Overworld counterparts\n- Added a ritual that allows you to \"corrupt\" Overworld biomes, converting areas of them into their Darklands counterparts\n- Added a ritual to resurrect dead companions (tamed and named)\n- Slowed down the spread of Mimic Fire (now it spreads about as fast as normal Fire)\n- Slightly more information is now locked (also overhaul of Necronomicon internals)\n- Changed the model of the Sacrificial Altar (so that it's easily distinguishable from the Ritual Altar)\n- More worldgen performance improvements in the Overworld and Dreadlands\n- Fixed a minor derp in the Gateway Key portal placement code and made it a bit more modular\n- Made some alterations to the Dread Spawn model (the \"arm\" is now composed of a independently moving tentacle, and the other bit has tendrils sprouting out of it)\n- Reduced the movement speed of Greater Dread Spawns and Lesser Dreadbeasts\n- The Crystallizer now stops trying to crystallize something when the output slots are full\n- Added Energy Depositioner (block that can generate PE by siphoning it out of Stone Tablets)\n- Added Stone Tablets (used in the Energy Depositioner, can also be used as alternate storage solution)\n- Added State Transformer (used for filling the Stone Tablets with items/energy)\n- Performance improvement to most PE blocks\n- Smoke from the pedestals during a ritual only comes from the ones that had something on them\n- The Staff of The Gatekeeper now works like a Staff of Rending and a Gateway Key combined\n- Particles from PE transfers made by statues are now synced to the transfer, instead of random\n- Highly optimized particle rendering for PE transfers\n- Changed the recipe for the Sacrificial Altar (replaced Torches with Shadow Fragments)\n- Upgrade Kit recipes can now be viewed in JEI\n- Now runs on Forge 13.20.0.2258",
|
1307 | "1.9.4-pre-2": "- Fixed crashes regarding saving NBT for the NecroData Capability (also cleaned up the saving part)\n- Fixed some small quirks with the Shoggoth Ooze blocks\n- Added a config option to toggle whether or not Demon Animals should place down Mimic Fire instead of normal Fire\n- Any Darklands Structures that generate Shoggoth Ooze should now have full blocks instead of a single layer",
|
1308 | "1.9.4-pre-1": "- Darklands Highlands and Mountains are now in the cold biome group, and snow generates in them\n- Initial Spellbook implementation (WIP, GUI and some backbone code, nothing functional yet)\n- Added a new font, used along with wharrgarbl to produce unreadable stuff\n- Remnant legs are now composed of more flexible limbs\n- Initial implementation of unlockable knowledge (WIP, only Entity information is partially locked, kill them to unlock the pages\n- The Decorative Statues now have their own recipe (Monolith Stone, Clay and a dye)\n- Added Rending Pedestals (PE powered blocks that collects essences through the use of a Staff of Rending)\n- Set harvest tool for a plethora of blocks that didn't have that set\n- The Abyssal Zombie has a new texture\n- The Abyssal Zombie now has it's own sounds\n- Improved worldgen performance (especially Overworld structures)\n- When broken or placed, the Luminous Thistle and Wasteland's Thorn now plays the correct sounds\n- You can't pick up the item placed on a altar/pedestal if your inventory is full\n- Shoggoth Ooze blocks are now made out of layers (like snow) instead of being a solid block\n- Removed the majority of the Shoggoth Ooze config options (superseded by the layered ooze blocks)\n- The skies in the dimensions are now composed of a skybox rather than a single color\n- Added a disruption that transforms surrounding animals\n- Item pages in the Necronomicon now has a frame around the displayed Item\n- Upgrade Kits are now applied at an Anvil, instead of the crafting grid\n- Improved the rendering of Items placed on altars/pedestals\n- Night Vision is no longer given from the normal armor sets, and the special ones only give it while in the Overworld\n- You shouldn't be able to repair Transmutation Gems with repairing items/blocks from other mods\n- Spectral Dragon and Asorah's hitboxes work now (huge shoutout to Vadis365 for the code that helped debugging the entity part placement)\n- Most player interactions with Necronomicons can't be completed unless the player owns the Necronomicon\n- You can now till Darklands Grass, Dreadlands Grass and Dreadlands Dirt with any hoe\n- You can now plant more things on Darklands Grass, Dreadlands Grass and Dreadlands Dirt\n- The Darklands Oak Log now has the correct textures when rotated",
|
1309 | "**.**.**.**": "- Demon Animals now starts spreading fire if they get in contact with any source of fire\n- Something happens if you use Shears on Evil Animals\n- Improved the rendering of the Visage of The Depths overlay (should fix any rendering issues regarding it)\n- A fully usable ritual formation no longer generates along with the Temple of J'zahar (you have to do the Necronomcion part)\n- Applying the Coralium and Dread enchantments through rituals works now\n- Improved cave and ravine generation in the Abyssal Wasteland and the Dreadlands\n- Caves and ravines now generate in the Dark Realm\n- Reduced the amount of smoke Shadow mobs emit while inside the Dark Realm\n- Shadow mobs (and Lesser Shadow Shoggoths) are all translucent\n- When a Lesser Shoggoth spawns a child, the child will be of the same type as the parent\n- Added a config option for setting whether or not Lesser Shoggoths should have a chance of spawning in the Overworld\n- Added Crystal Fragments (even smaller pieces of Crystallized Elements)\n- Set proper map colors for the various blocks\n- Shadow mobs now have a chance of spawning in all Darklands biomes (but they're still more common in the mountains)\n- Changed some internal code for the Essence of The Gatekeeper Item Entity (fixes crashes with Extra Utilities 2)\n- The Dreadlands Grass now has the correct bottom and particle texture\n- Mob spawning in the Dreadlands should be more frequent, while mob spawning in the Abyssal Wasteland should be a bit less frequent\n- Lesser Shoggoths no longer spread a layer of ooze below the layer they've already spread\n- Applied the correct colors for the last 8 Crystal Clusters\n- Fixed numerous crafting recipes for crystal items/blocks\n- Changed the color palette for the Darklands biomes (now uses a indigo-esque color instead of the previous purple)\n- Made the color of the various Darkstone blocks a shade bluer\n- The foliage color in the Abyssal Wasteland now matches the color of the Fused Abyssal Sand\n- Removed the random blindness from the Darklands biomes\n- Lowered the height at which Items placed on Altars/Pedestals are rendered\n- Updated a bunch of pictures in the Necronomicon (anything involving either Darkstone or the Darklands)\n- Remnants no longer say 2 insults at once, and no longer tell you they're busy when you initialize a trade with one\n- Added an API hook to enable Gateway Keys to function in any dimension registered there\n- The Darklands Oak and Dreadlands Tree are less randomized, and taller in general\n- Increased the amount of Darklands Oaks that generate in Darklands Forests\n- Replaced the Darklands Oak Log texture with a different animation and darkened both the Log and Plank textures\n- The Ritual of Fertility now also targets Rabbits\n- Added a config option to change the opacity of the overlay displayed when wearing the Visage of The Depths\n- Re-balanced armor smelting recipes to match Vanilla's (for AbyssalCraft armor)\n- Now runs on Forge 13.20.0.2223"
|
1310 | },
|
1311 | "1.11": {
|
1312 | "**.**.**.**": "- The terrain in the Dark Realm now has holes resembling the various islands in Omothol generating at the same coordinates\n- Reduced the damage of the Dreadium Katana by 5\n- Halved the durability of the Dreadium Katana and reduced the durability of the Cudgel by 500\n- Sacrificial Altars no longer target Shadow mobs\n- Fixed incorrect corner stair rotation\n- Added more Darklands structures\n- Tiered Sacrificial Altars now share the same cooldown as the regular one (instead of scaling it up unreasonably)\n- The information about Sacrificial Altars now mention the PE collection limit (a fifth of the max capacity)\n- Replaced the Obsidian pillars in the Abyssal Wasteland with giant chains of various lengths (extending downwards from the top)\n- Added additional conditions for Shoggoth Lairs to generate (prevents the derps where they generate almost entirely above ground)\n- Removed all instances of Refined Coralium from the Vanilla Loot Tables\n- The mob spawn list purging is now run in load complete (stops any mob spawn adding done in post-init)\n- It now rains in Darklands Plains and Darklands Mountains\n- Added Coralium Infested Squid\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth can now breathe under water\n- The various dimensional essences now have new textures (which resemble their dimension slightly)\n- The Iron Wall Enchantment now works\n- Added a configurable blacklist for the Interdimensional Cage\n- Liquid Coralium now transmutes Cobblestone blocks into Abyssal Cobblestone, instead of Abyssal Stone\n- Abyssal Sand now randomly turns into Fused Abyssal Sand when exposed to light levels higher than 13\n- Shoggoth Ooze now turns into more dimension-specific blocks instead of Dirt if it's set to expire\n- Spectral Dragons now apply Coralium Plague instead of dealing physical damage\n- Updated a whole bunch of pictures in the Necronomicon\n- Ritual offerings that have Container Items (Buckets, among others) will now return the Container Item instead of consuming the Item altogether\n- Increased the spawn rate and vein size of Abyssal Coralium Ore, while reducing the spawn rate and vein size of Abyssal Diamond Ore\n- Rituals required to progress through the dimensions now appear first on their individual ritual section\n- The metadata wildcard now works correctly for ritual offerings (allowing you to use the same Transmutation Gem in multiple rituals, among things)\n- Added a config option to amplify the armor-piercing damage dealt by mobs in Hardcore Mode\n- The Coralium Plague and Dread Plague damage becomes armor-piercing when Hardcore Mode is enabled\n- Set a more proper attack damage to the various axes\n- The spawner blocks now properly initialize the entities they spawn before spawning them\n- Now runs on Forge 13.19.1.2188",
|
1313 | "**.**.**.**": "- The Achievements and Rituals with Water Bottles should display Water Bottles, and nothing else\n- Switched the internal method of killing the sacrifice in rituals that requires a sacrifice (Pigs will no longer turn into Zombie Pigmen)\n- The Forge Universal Bucket is actually registered for the fluids, instead of it not being that\n- Set the correct textures for the Ritual Altars/Pedestals that didn't have the correct texture\n- All of the Ritual Altars/Pedestals now drop the correct block\n- Expanded the amount of different types of objects you can input as offerings in a Ritual\n- Made the bounding boxes for Shoggoth Ooze, Shoggoth Biomass and Solid Lava the size of a full block\n- Fixed the placement of Torches and Buttons in Abyssal Strongholds\n- Fixed the placement of Torches in Dreadlands Mineshafts\n- The Dread Spawn now plays it's sounds (instead of the Zombie ones)\n- Ported to 1.11"
|
1314 | },
|
1315 | "1.10.2": {
|
1316 | "**.**.**.**-FINAL": "- The purging ritual now only converts biomes that are Dreadlands biomes\n- Added loot tables to all bosses (empty), Coralium Infested Squid and all Remnant types\n- Lesser Shoggoths now have an AI for monolith construction, which makes the construction happen more frequently\n- The biome transformation of the Dread Plague only happens to those inflicted with Dread Plague II\n- If two mobs/players/whatevers close to each other both have Dread Plague I, they can infect each other with Dread Plague II\n- If the Hardcode Mode config option is enabled biome transformation will happen regardless of Dread Plague amplifier\n- The purging ritual now checks the surrounding area instead of the position of the altar for nearby Dreadlands biomes when checking if the ritual can be performed\n- The cleansing and corruptions rituals now both do the same thing as the purging when checking if the ritual can be performed\n- Reduced the luminosity of the foliage color in the Coralium Infested Swamp, making it blend better with adjacent biomes\n- Lesser Shoggoths now swim faster (and can move against flowing water)\n- Increased the range of the Corruption, Cleansing and Purging rituals to 8x8 chunks (previously 3x3)\n- Eyes (and other luminous bits) now glow on Lesser Shoggoths\n- Any NBT checks for crafting recipes and/or rituals are now a lot less strict (the placed item needs to contain the recipe item NBT tags)",
|
1317 | "**.**.**.**": "- A bunch of textures have been revamped (courtesy of Dylan4ever)\n- Lesser Shoggoths can no longer break Bedrock (or other unbreakable blocks) with their acid\n- Acid Projectiles no longer break blocks with Tile Entities when hitting Players or other mobs\n- Scaled down the model of the baby Lesser Shoggoth (to be more proportional with the hitbox, also made the eyes a bit bigger)\n- Slowed down the initial velocity of the Acid Projectile, increased the time between each projectile being fired, and made it so baby Lesser Shoggoths won't fire them\n- Added a config option for changing the frequency at which Lesser Shoggoths spit acid\n- J'zahar now respects the mobGriefing gamerule with his explosion\n- Fixed a dupe bug in the Materializer GUI\n- Mobs spawned through a summoning ritual now have their portal cooldown set to max\n- Increased the time it takes for a Greater Dread Spawn and Lesser Dreadbeast to spawn a regular Dread Spawn\n- Increased the time it takes for Cha'garoth to spawn the various things he spawns, and removed the direct physical damage dealt by his fireballs\n- Reduced the range of Cha'garoth's melee attacks\n- Fixed the pick block for Calcified Stone",
|
1318 | "**.**.**.**": "- Removed the End Abyssal Zombie\n- Remnants now also worship statues at times\n- Added a config option that toggles if knowledge should be synced to the client every time a player opens their Necronomicon\n- The lightning bolt that strikes a statue when a Disruption triggers is now only the effect\n- Added a new Disruption that generates a random amount of Shoggoth Ooze around the source\n- Added a new Disruption that spawns random mobs that normally spawn in the current biome\n- Added a new Disruption that spawns a single random mob that normally spawn in the current biome\n- Added missing null check to the Purge Event Handler, fixing a Sponge-related crash\n- Capability data is no longer lost upon leaving the End\n- Lesser Shoggoths now respect the mobGriefing Game Rule when it comes to their acid-based attacks\n- Changed the minimum Block hardness for resisting acid to 2.1 (previously 3.0)",
|
1319 | "**.**.**.**": "- Dreadguards are now regarded as undead\n- Changed the particles used in the Dreadguard/Cha'garoth barf attack (since they're not breathing fire)\n- The plagues no longer reinfect their host (effectively refreshing themselves)\n- Lesser Shoggoth acid projectiles can now be blocked with a shield (the player will still take half a heart of damage)\n- Added a config option to toggle whether or not shields can block acid projectiles\n- Statues don't trigger disruptions inside Omothol\n- If a Lesser Shoggoth has a target when it spawns an offspring, it has a 33% chance of throwing it at the target\n- Added a config option for the minimum Block Hardness required to stop Shoggoth Acid from destroying the Block\n- Abyssal Zombies now attack Villagers\n- Sacthoth no longer despawns in the Dark Realm\n- Asorah now has full knockback resistance (you're gonna need bigger arrows)\n- Fixed NPE in the Lesser Shoggoth acid spraying attack",
|
1320 | "**.**.**.**": "- Shoggoth Biomass no longer randomly spawn Lesser Shoggoths client-side\n- Added some text (with pictures) to better explain the transfer range of Statues to nearby Collectors\n- Shoggoth Biomass blocks don't spawn any Lesser Shoggoths unless a player is within 32 blocks of it\n- Lesser Shoggoths can now secrete acid as a means of defending themselves (or a ranged attack) which can destroy blocks in their path\n- Lesser Shoggoths can now consume any item they run into, which is also configurable\n- Lesser Shoggoths now have a chance to locate a nearby statue and chant by it\n- Increased the hitbox size of Lesser Shoggoths (and reduced their hit range)\n- Removed the disruption that converts the surrounding chunk into Darklands (better leave the fate of their world to the player)\n- The Dread Plague Antidote now requires a Dreadlands Sapling instead of Omothol Ghoul Flesh\n- Child Lesser Shoggoths now have half the health and attack damage of an adult one\n- The Temple of J'zahar has been revamped\n- Greater Dread Spawns will now deal damage with their Dread Slugs again\n- Rituals Pedestals now project bits of their placed object rather than smoke during rituals\n- Rituals that require sacrifices now requires the player performing the ritual to sacrifice the animal, rather than it being killed automatically\n- The Wooden Crate now supports capabilities for insertion and extraction\n- Fixed the secondary death message for shadow damage\n- Added a ritual to purge the Dreadlands (while also rendering the area uninhabitable)\n- Added Calcified Stone (what everything turns into when the purging ritual has been used)",
|
1321 | "**.**.**.**": "- Shadow mobs are now immune to fire, and capable of swimming\n- Changed the texture for Liquid Antimatter (darker spots within the liquid, making it a bit less milk-like)\n- Added a config option that turns antimatter explosions nuclear (off by default)\n- Dread-plagued mobs now automatically leave a lingering cloud of Dread Plague on death\n- Added a new config category for misc out of place settings\n- The amount of animals a Lesser Shoggoth has to eat in order to multiply/grow up now depends on the size of the animals it eats (1 adult cow = 3 adult chickens)",
|
1322 | "**.**.**.**": "- Applying a redstone signal to an Energy Relay pauses it\n- The Overworld biomes are always registered now, just not added to the list of biomes to generate if set not to\n- Statues can now transfer PE to dropped items (provided they can accept PE)\n- Redrafted a bunch of text inside the Necronomicon (removing redundant/incorrect information and adding new information)\n- Replaced all mob pictures in the Necronomicon with ones that look more like something drawn in the book\n- Fixed an infinite loop in the mining spell when mining upwards\n- Added a small section that explains how to obtain knowledge, unlocking information in the Necronomicon and unmasks Items and Blocks\n- Reduced the duration of fire applied to attackers when attacking someone wearing Dreaded Abyssalnite gear\n- The Coralium Plague and Dread Plague now act more like actual plagues (they spread a lot easier, can't be cured with milk)\n- Abyssalnite Golems now turn into Dreaded Abyssalnite Golems if killed by the Dread Plague\n- Portals now have a small chance of spawning a mob from their dimension\n- Shadow mobs now change their transparency based on light level (bright = visible, dark = not so visible)\n- The Dreadlands can leak out of it's portals, so keep a lookout in case too much gets out\n- Added Antidotes for the Coralium and Dread Plague (used to cure them instead of milk, which no longer cures them)\n- Increased the amount of Coralium Ore that generates in the Overworld (also made it configurable)\n- Knowledge unlock syncing is now done on a per unlock basis, rather than when opening the Necronomicon or changing dimensions\n- Asorah and Spectral Dragons now have the undead creature attribute",
|
1323 | "**.**.**.**": "- Fixed some redundancy in the FireMessage packet that's sent when hitting any of the mods fire blocks\n- Ritual ground creation is now less sensitive about surrounding blocks (as long as they aren't full cubes)\n- Spell recipes can now be displayed in the Necronomicon\n- The tooltip of Energy Relays now display the range of the block\n- Item information can now be locked, resulting in the tooltip font being replaced by the Aklo Font\n- Added a command to automatically unlock all Necronomicon knowledge\n- Leaving Omothol portals now return you to the Dreadlands, not the Abyssal Wasteland\n- Randomized the texture rotation of the Fused Abyssal Sand\n- Made the outlines of the Abyssal Stone Brick, Abyssalnite Stone Brick and Dreadstone Brick more consistent\n- Created a new texture for Dreadstone\n- Shift-clicking output slots now works in the Materializer (giving you up to a stack of the output per click)",
|
1324 | "**.**.**.**": "- Added a barfing sound to Dreadguards and Cha'garoth (instead of playing the sound for when a Ghast shoots a fireball)\n- Added Crystallized Calcium, Beryllium and Beryl\n- Materializer recipes can now be displayed in JEI\n- The biome transformation from Cha'garoth and his Dreaded Charges has been optimized (code only runs on the server, only affects non-dreadlands biomes)\n- The Rending Pedestal works on Omothol creatures again\n- Rather than crashing, an error will be logged when failing to convert an ItemStack from the Ore Dictionary into a BlockState during startup\n- Overworld structure generation now checks for the Overworld World Provider rather than Dimension ID",
|
1325 | "**.**.**.**": "- The JEI plugin no longer stops at Transmutator Fuel recipe registration\n- The State Transformer's extraction mechanic now works\n- Ticking Tile Entities that don't do anything client side no longer ticks client side\n- Added a hurt sound to Anti-Players that those who played Minecraft before beta ended might recognize (props to BordListian for letting me know of it's prescence in Better With Mods)\n- Non-player entities can now use portals\n- Anti-mobs now attack their regular countepart (for more destruction and chaos) and Anti-Players has a chance of targeting any non Anti-Player\n- Mobs capable of spreading the Dread Plague no longer tries to apply it on something that's already immune to it\n- Added a new attack to Shadow Beasts and Sacthoth (credits to Enderman_of_D00M for the code)\n- The Materializer is now functional\n- Greater Dread Spawns and Lesser Dreadbeasts now swap between melee and ranged attacks\n- Added a new attack to Dreadguards (credits to Enderman_of_D00M for the code)\n- Cha'garoth's heads now move independantly, and each has attacks of their own (credits to Enderman_of_D00M for the code)\n- Loot Tables are now initialized during loading stages (instead of being initialized when something relying on one of them references it)\n- Disruption Packets now send the correct String value representation of the Deity, stopping even more error log spam\n- The beams that spawn during Asorah's death animation are now more properly colored\n- J'zahar has longer reach for his staff-whacking\n- J'zahar is now immune to fire, explosions, magic and fall damage\n- Adjusted the bounding boxes and eye heights of Remnant and Minions of The Gatekeeper\n- Spectral Dragons now only knocks mobs and players away in Hardcore Mode\n- Dreadium Samurai armor now reduces the amount of Dread damage you receive\n- Materializer recipes can now be displayed in the Necronomicon\n- Spectral Dragons now only lose health when Asorah doesn't have full health",
|
1326 | "**.**.**.**": "- The JEI plugin now properly filters out invalid Transmutator and Crystallizer fuels\n- Baby Lesser Shoggoths are 40% slower now (compared to their movement speed in previous versions)",
|
1327 | "1.9.4": "- Added a configurable list of mobs to spawn Demon Animals from on death\n- Maps now works inside AbyssalCraft dimensions\n- The Necronomicon now saves the last page viewed before closing (doesn't persist across restarts, however)\n- Increased the spawn rate of shadow mobs in Darklands biomes\n- Shadow Creatures now have a guaranteed chance of dropping Shadow Fragments\n- Shoggoth Ooze no longer spreads on Monolith Stone\n- Greatly increased the spawn chance of Shoggoth Lairs while making it more configurable\n- If a ritual doesn't have a description, the Necronomicon won't try to display it on the ritual page\n- Optimized the performance of Energy Relays slightly (probably mostly noticeable in larger networks of them)\n- Disruption packets without a Deity are now properly handled, stopping the error log spam\n- Shoggoth Ooze is now corrosive, dealing durability damage to leg and foot armor while exposed to it\n- The NecroData Capability now filters out things that are no longer registered on load\n- All Ethaxium blocks (dark or not) are now Ender Dragon and Wither-proof\n- Portal blocks now fire the EntityTravelToDimensionEvent prior to teleporting the player, making it possible to cancel teleportation between AbyssalCraft dimensions\n- Added additional buttons to the Necronomicon GUI (skip multiple pages, go back multiple pages, go back to the front page)\n- Energy Relays can now collect PE from Energy Containers too\n- Fixed the eye layer on the Anti-Spiders (now the eyes are the only bits that glow, instead of the whole spider)\n- Ritual altar sacrifices can now also be NBT sensitive\n- Added a config option to stop armor sets from applying Potion Effects or dispell other Potion Effects\n- Added scrolls (currently not usable, nor craftable)\n- Spells are close to being fully implemented, with most of the backing code done",
|
1328 | "1.9.4-pre-4": "- Changed the ritual for the Staff of The Gatekeeper to require Cha'garoth's R'lyehian Gateway Key\n- Fixed a small derp in the Crystallizer recipe handling code\n- Improved explosion code for ODB and ODB Cores (along with some performance improvements)\n- Fixed a crash with BoP (or any other mod adding specific blocks to the OreDictionary with the wildcard value as meta)",
|
1329 | "1.9.4-pre-3": "- The Knowledge event handler shouldn't crash from trying to save the ID of an unregistered entity\n- Fixed a small client de-sync when draining energy for a ritual\n- Added a ritual that allows you to \"purge\" the Darklands, coverting areas of it into their Overworld counterparts\n- Added a ritual that allows you to \"corrupt\" Overworld biomes, converting areas of them into their Darklands counterparts\n- Added a ritual to resurrect dead companions (tamed and named)\n- Slowed down the spread of Mimic Fire (now it spreads about as fast as normal Fire)\n- Slightly more information is now locked (also overhaul of Necronomicon internals)\n- Changed the model of the Sacrificial Altar (so that it's easily distinguishable from the Ritual Altar)\n- More worldgen performance improvements in the Overworld and Dreadlands\n- Fixed a minor derp in the Gateway Key portal placement code and made it a bit more modular\n- Made some alterations to the Dread Spawn model (the \"arm\" is now composed of a independently moving tentacle, and the other bit has tendrils sprouting out of it)\n- Reduced the movement speed of Greater Dread Spawns and Lesser Dreadbeasts\n- The Crystallizer now stops trying to crystallize something when the output slots are full\n- Added Energy Depositioner (block that can generate PE by siphoning it out of Stone Tablets)\n- Added Stone Tablets (used in the Energy Depositioner, can also be used as alternate storage solution)\n- Added State Transformer (used for filling the Stone Tablets with items/energy)\n- Performance improvement to most PE blocks\n- Smoke from the pedestals during a ritual only comes from the ones that had something on them\n- The Staff of The Gatekeeper now works like a Staff of Rending and a Gateway Key combined\n- Particles from PE transfers made by statues are now synced to the transfer, instead of random\n- Highly optimized particle rendering for PE transfers\n- Changed the recipe for the Sacrificial Altar (replaced Torches with Shadow Fragments)\n- Upgrade Kit recipes can now be viewed in JEI",
|
1330 | "1.9.4-pre-2": "- Fixed crashes regarding saving NBT for the NecroData Capability (also cleaned up the saving part)\n- Fixed some small quirks with the Shoggoth Ooze blocks\n- Added a config option to toggle whether or not Demon Animals should place down Mimic Fire instead of normal Fire",
|
1331 | "1.9.4-pre-1": "- Darklands Highlands and Mountains are now in the cold biome group, and snow generates in them\n- Initial Spellbook implementation (WIP, GUI and some backbone code, nothing functional yet)\n- Added a new font, used along with wharrgarbl to produce unreadable stuff\n- Remnant legs are now composed of more flexible limbs\n- Initial implementation of unlockable knowledge (WIP, only Entity information is partially locked, kill them to unlock the pages\n- The Decorative Statues now have their own recipe (Monolith Stone, Clay and a dye)\n- Added Rending Pedestals (PE powered blocks that collects essences through the use of a Staff of Rending)\n- Set harvest tool for a plethora of blocks that didn't have that set\n- The Abyssal Zombie has a new texture\n- The Abyssal Zombie now has it's own sounds\n- Improved worldgen performance (especially Overworld structures)\n- When broken or placed, the Luminous Thistle and Wasteland's Thorn now plays the correct sounds\n- You can't pick up the item placed on a altar/pedestal if your inventory is full\n- Shoggoth Ooze blocks are now made out of layers (like snow) instead of being a solid block\n- Removed the majority of the Shoggoth Ooze config options (superseded by the layered ooze blocks)\n- The skies in the dimensions are now composed of a skybox rather than a single color\n- Added a disruption that transforms surrounding animals\n- Item pages in the Necronomicon now has a frame around the displayed Item\n- Upgrade Kits are now applied at an Anvil, instead of the crafting grid\n- Improved the rendering of Items placed on altars/pedestals\n- Night Vision is no longer given from the normal armor sets, and the special ones only give it while in the Overworld\n- You shouldn't be able to repair Transmutation Gems with repairing items/blocks from other mods\n- Spectral Dragon and Asorah's hitboxes work now (huge shoutout to Vadis365 for the code that helped debugging the entity part placement)\n- Most player interactions with Necronomicons can't be completed unless the player owns the Necronomicon\n- You can now till Darklands Grass, Dreadlands Grass and Dreadlands Dirt with any hoe\n- You can now plant more things on Darklands Grass, Dreadlands Grass and Dreadlands Dirt",
|
1332 | "**.**.**.**": "- Demon Animals now starts spreading fire if they get in contact with any source of fire\n- Something happens if you use Shears on Evil Animals\n- Improved the rendering of the Visage of The Depths overlay (should fix any rendering issues regarding it)\n- A fully usable ritual formation no longer generates along with the Temple of J'zahar (you have to do the Necronomcion part)\n- Applying the Coralium and Dread enchantments through rituals works now\n- Improved cave and ravine generation in the Abyssal Wasteland and the Dreadlands\n- Caves and ravines now generate in the Dark Realm\n- Reduced the amount of smoke Shadow mobs emit while inside the Dark Realm\n- Shadow mobs (and Lesser Shadow Shoggoths) are all translucent\n- When a Lesser Shoggoth spawns a child, the child will be of the same type as the parent\n- Added a config option for setting whether or not Lesser Shoggoths should have a chance of spawning in the Overworld\n- Added Crystal Fragments (even smaller pieces of Crystallized Elements)\n- Set proper map colors for the various blocks\n- Shadow mobs now have a chance of spawning in all Darklands biomes (but they're still more common in the mountains)\n- Changed some internal code for the Essence of The Gatekeeper Item Entity (fixes crashes with Extra Utilities 2)\n- The Dreadlands Grass now has the correct bottom and particle texture\n- Mob spawning in the Dreadlands should be more frequent, while mob spawning in the Abyssal Wasteland should be a bit less frequent\n- Lesser Shoggoths no longer spread a layer of ooze below the layer they've already spread\n- Applied the correct colors for the last 8 Crystal Clusters\n- Fixed numerous crafting recipes for crystal items/blocks\n- Changed the color palette for the Darklands biomes (now uses a indigo-esque color instead of the previous purple)\n- Made the color of the various Darkstone blocks a shade bluer\n- The foliage color in the Abyssal Wasteland now matches the color of the Fused Abyssal Sand\n- Removed the random blindness from the Darklands biomes\n- Lowered the height at which Items placed on Altars/Pedestals are rendered\n- Updated a bunch of pictures in the Necronomicon (anything involving either Darkstone or the Darklands)\n- Remnants no longer say 2 insults at once, and no longer tell you they're busy when you initialize a trade with one\n- Added an API hook to enable Gateway Keys to function in any dimension registered there\n- The Darklands Oak and Dreadlands Tree are less randomized, and taller in general\n- Increased the amount of Darklands Oaks that generate in Darklands Forests\n- Replaced the Darklands Oak Log texture with a different animation and darkened both the Log and Plank textures\n- The Ritual of Fertility now also targets Rabbits\n- Added a config option to change the opacity of the overlay displayed when wearing the Visage of The Depths",
|
1333 | "**.**.**.**": "- The terrain in the Dark Realm now has holes resembling the various islands in Omothol generating at the same coordinates\n- Reduced the damage of the Dreadium Katana by 5\n- Halved the durability of the Dreadium Katana and reduced the durability of the Cudgel by 500\n- Sacrificial Altars no longer target Shadow mobs\n- Fixed incorrect corner stair rotation\n- Added more Darklands structures\n- Tiered Sacrificial Altars now share the same cooldown as the regular one (instead of scaling it up unreasonably)\n- The information about Sacrificial Altars now mention the PE collection limit (a fifth of the max capacity)\n- Replaced the Obsidian pillars in the Abyssal Wasteland with giant chains of various lengths (extending downwards from the top)\n- Added additional conditions for Shoggoth Lairs to generate (prevents the derps where they generate almost entirely above ground)\n- Removed all instances of Refined Coralium from the Vanilla Loot Tables\n- The mob spawn list purging is now run in load complete (stops any mob spawn adding done in post-init)\n- It now rains in Darklands Plains and Darklands Mountains\n- Added Coralium Infested Squid\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth can now breathe under water\n- The various dimensional essences now have new textures (which resemble their dimension slightly)\n- The Iron Wall Enchantment now works\n- Added a configurable blacklist for the Interdimensional Cage\n- Liquid Coralium now transmutes Cobblestone blocks into Abyssal Cobblestone, instead of Abyssal Stone\n- Abyssal Sand now randomly turns into Fused Abyssal Sand when exposed to light levels higher than 13\n- Shoggoth Ooze now turns into more dimension-specific blocks instead of Dirt if it's set to expire\n- Spectral Dragons now apply Coralium Plague instead of dealing physical damage\n- Updated a whole bunch of pictures in the Necronomicon\n- Ritual offerings that have Container Items (Buckets, among others) will now return the Container Item instead of consuming the Item altogether\n- Increased the spawn rate and vein size of Abyssal Coralium Ore, while reducing the spawn rate and vein size of Abyssal Diamond Ore\n- Rituals required to progress through the dimensions now appear first on their individual ritual section\n- The metadata wildcard now works correctly for ritual offerings (allowing you to use the same Transmutation Gem in multiple rituals, among things)\n- Added a config option to amplify the armor-piercing damage dealt by mobs in Hardcore Mode\n- The Coralium Plague and Dread Plague damage becomes armor-piercing when Hardcore Mode is enabled\n- Set a more proper attack damage to the various axes\n- The spawner blocks now properly initialize the entities they spawn before spawning them\n- Now runs on Forge 12.18.3.2185",
|
1334 | "**.**.**.**": "- The Achievements and Rituals with Water Bottles should display Water Bottles, and nothing else\n- Switched the internal method of killing the sacrifice in rituals that requires a sacrifice (Pigs will no longer turn into Zombie Pigmen)\n- The Forge Universal Bucket is actually registered for the fluids, instead of it not being that\n- Set the correct textures for the Ritual Altars/Pedestals that didn't have the correct texture\n- All of the Ritual Altars/Pedestals now drop the correct block\n- Expanded the amount of different types of objects you can input as offerings in a Ritual\n- Made the bounding boxes for Shoggoth Ooze, Shoggoth Biomass and Solid Lava the size of a full block\n- Fixed the placement of Torches and Buttons in Abyssal Strongholds\n- Fixed the placement of Torches in Dreadlands Mineshafts\n- The Dread Spawn now plays it's sounds (instead of the Zombie ones)",
|
1335 | "**.**.**.**": "- Fixed crashes related to opening the Achievements page\n- Dreadlands Trees won't turn Dreadlands Dirt into regular Dirt if grown on it\n- Dreadlands Grass now reverts into Dreadlands Dirt when a block is placed on it, instead of regular Dirt",
|
1336 | "**.**.**.**": "- Added missing client-side check when fetching the Patreon data\n- Added Luminous Thistle\n- Added Wasteland's Thorn\n- Replaced the mushroom generation in the Abyssal Wastelands with the aforementioned plants",
|
1337 | "**.**.**.**": "- Asorah and Spectral Dragons are now immune to fire\n- Reduced the amount of smoke particles during a ritual\n- Ritual Altar creation now has more visual effects\n- Loading stages are no longer logged\n- A few Item textures have been updated\n- Patron Necronomicon info is now fetched from a remote file (has a local version if something goes wrong)\n- A Necronomicon Page object can now specify a URL that points to an image, which will then be displayed (if the image can be located)\n- Any JSON file added to the \"abyssalcraft\" folder in the config directory that's properly formatted will be injected into the \"Other Information\" section of the Necronomicon\n- The \"AbyssalCraft Tools\" Creative Tab now has a Interdimensional Cage filled with PE alongside the normal empty one\n- Fixed the Item name colors on the Gateway Keys\n- Replaced half of the Darklands structures\n- Added API hooks for generating Darklands structures\n- Added config option to force the dimension biomes to reset the mob spawning lists in order to stop mobs from other mods from populating the lists\n- Made the teal tint on the Depths Helmet overlay A LOT more transparent\n- Added Abyssal Sand\n- Added Fused Abyssal Sand\n- Added Abyssal Sand Glass\n- The terrain in the Abyssal Wasteland now has a top layer of Fused Abyssal Sand, with patches of Abyssal Stone\n- Added Dreadlands Dirt\n- Updated the textures on Dreadstone, Abyssalnite Stone and their brick counterparts\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone Stairs, Slabs and Walls\n- Changed the ritual formation blocks to use the Cobblestone blocks instead of Bricks where applicable\n- Updated the information about statues to mention them needing an open sky to operate\n- Fixed the bug where the random blindness from Darklands biomes would stay when it's reached 0\n- Replaced the Darkstone Cobblestone in Abyssal Strongholds with Abyssal Cobblestone\n- Rituals can now be NBT sensitive (pedestal offerings must have identical NBT tags to the ones in the ritual recipe)\n- You can no longer process Liquid Antimatter or Liquid Coralium Buckets in Furnaces, Transmutators or Crystallizers\n- Removed the crafting recipe for a Liquid Antimatter Bucket\n- Changed some of the Potion Effects added by the various armor sets\n- Now runs on Java 8\n- Deprecated the Liquid Coralium and Liquid Antimatter Buckets, they're now handled by the Forge Universal Bucket\n- Fixed a bug with Potion brewing\n- Fixed crashes with GregTech 5 Unofficial",
|
1338 | "**.**.**.**": "- The staff of Rending upgrades are now set to require the correct Necronomicons\n- Added config option to disable armor smelting recipes\n- More entities now has a chance to spawn wearing random armor\n- Fixed crashes regarding the Halloween easter egg",
|
1339 | "**.**.**.**": "- Fixed crashes on World load from particles",
|
1340 | "**.**.**.**": "- The Abyssal Stone Bricks in the Abyssal Stronghold now occasionally generate as their cracked version\n- Updated the pictures in the Potential Energy section (took new ones on regular Grass, instead of Darklands Grass)\n- Fixed crashes (or just log errors) from Disruptions being triggered after failing to complete a ritual\n- Replaced the smoke from various PE blocks with a particle meant to represent PE\n- Energy Pedestals can now harvest PE from statues again\n- You can now use Energy Relays on Energy Pedestals and Sacrificial Altars",
|
1341 | "**.**.**.**": "- Fixed crashes from completing Infusion Rituals",
|
1342 | "1.9.3": "- You can now configure the chance of a Shoggoth Lair generating in the Overworld\n- The Fire Rain Disruption will now fire a random amount of fireballs (so possibly not 8 at once)\n- Sacthoth now turns day into night when he spawns through a ODB explosion\n- Added Energy Collector\n- Added Energy Relay\n- Energy Pedestals no longer passively generate PE\n- Disruptions triggered from Ritual Altars now only fire server-side (apparently forgot to make that adjustement there)\n- Collected PE now persist when you break a block that can hold it, and the tooltip displays how much is contained\n- You can now have NBT tags persist through Infusion Rituals\n- Gateway Keys will now display a line of text in their tooltip when you can't use them\n- The Dreaded Abyssalnite Chestplate and Plated Coralium Chestplate's aura is now replaced with the effect being applied to attackers on hit\n- Added Energy Container\n- The Ethaxium Boots now applies a Speed boost like the other boots\n- The upgraded Gateway Keys can now place the previous key's portal in it's dimension\n- Added Interdimensional Cage (item that can capture entities)\n- Updated the information in the Ritual Information section\n- Fixed a performance hit caused by viewing pages that had pictures on them (in specifc cases)\n- Fixed the derp where the \"next turn-up\" button disappeared in the Machines section\n- Added a config option to make Shoggoth Ooze turn into dirt after being exposed to light for a random period of time\n- Added Tiered Energy Collectors\n- Added Tiered Energy Relays\n- Added Tiered Energy Containers\n- Changed the defaults to lower numbers for a couple of config options (biome spawn weights, entity spawn weights)\n- Min and max and default values for numerical config options are now provided in the comments (in favor of those not using the config GUI)\n- Updated nearly all of the pictures in the Necronomicon\n- The Abyssalnite Golem and Dreaded Abyssalnite Golem have new skins\n- Spiced up Hardcore Mode a bit\n- Anti-Ghouls now swing their arms when attacking\n- The Ritual of Fertility no longer has a chance of spawning Lesser Shoggoths\n- Remove the \"Shoggoth infestation\" Achievement, since that event no longer triggers\n- The Transmutation Gem now consumes durability when used for crafting, instead of being consumed directly\n- The \"AbyssalCraft Items\" Creative Tab now has each Necronomicon filled with PE alongside the normal empty one\n- The Staff of Rending and Staff of The Gatekeeper now raytrace properly\n- The Staff of Rending can now be upgraded to increase the amount of energy collected\n- A lot of items now have new textures (courtesy of Tiktalik)\n- The JEI integration now displays information regarding things created with the Staff of Rending\n- Darkened the sky color in the Abyssal Wasteland\n- Statues refuse to transport any PE if they're not under a clear sky\n- Statues now have a tolerance value, which increases the more you harvest PE from them, which eventually triggers a Disruption\n- Players no longer emit smoke inside the Dark Realm, only other entities\n- Sounds now play again in a few instances where they didn't\n- Fixed crashes regarding the Anti-Spider loot table",
|
1343 | "1.9.3-pre-1": "- Removed the hurt sounds for the Pete Depths Ghoul variant\n- The Pete, Mr. Wilson and Dr. Orange Depths Ghoul variants now have 3 individual idle sounds, mixed with the regular\n- Added Evil Sheep\n- Added Demon Sheep\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth now have their own set of sounds\n- Villages no longer generate in Darklands Highland and Mountain biomes\n- The large Obsidian pillars now generate in the Abyssal Wasteland again\n- Added Enchantment descriptions (can be seen using WAWLA, among others)\n- Getting killed by either plague shouldn't be able to result in entities spawning indefinitely in the death screen\n- Statues now fire disruptions in a more balanced matter (very rare in a normal state, more common when amplified)\n- Removed the Monolith Disruption (will re-add it when there's a lot more disruptions, or not)\n- Added a Disruption that has a chance to completely drain nearby PE Collectors\n- Disruptions are now properly synced between client and server\n- Did some changes to Overworld worldgen: Less Darkstone generation, slightly reduced Shoggoth Lair generation, heavily reduced Liquid Antimatter pool generation\n- The alternate Depths Ghoul variants no longer have different stats\n- The chance of a Depths Ghoul spawning as one of the variants is now 20%\n- Fixed a typo in the Lesser Shoggoth loot tables\n- Added subtitles to all sounds added by the mod\n- All Crystal Clusters should now have correct names\n- Now runs on Forge 12.18.1.2073",
|
1344 | "**.**.**.**": "- Added chiseled variants to the Brick types that didn't previously have one\n- Made more crafting recipes depend on the Ore Dictionary\n- Added a cracked variant to all the Brick types\n- Added configurable Item Blacklists for Entities that can pick up item\n- Removed the config option for Abyssal Zombies picking up rotten flesh (superseded by the above)\n- Remnants now have their own yes/no sounds when trading\n- A random chant will now play when performing a ritual\n- Remnant priests will randomly chant\n- Added a ritual that allows you to change the weather in the Biome you're currently at (if possible)\n- The Dreadium Katana and Sacthoth's Soul Reaper Blade now swing like regular swords",
|
1345 | "**.**.**.**": "- Statues now refuse to transfer PE if there's adjacent Statues on any side\n- Demon Animals now use the BiomeDictionary entry NETHER instead of the Nether Biome for Biomes to spawn in\n- All entities (except the bosses) now have their own loot tables\n- Now runs on Forge 12.18.1.2046\n- Split the Crystal Clusters into 2 blocks (solves the startup crashes with Forge 2044+)",
|
1346 | "**.**.**.**": "- Fixed crashes with placing double slab blocks\n- Darklands Oaks and Dreadlands Trees will now burn\n- Spectral Dragons can no longer fly through portal blocks (they bounce off)\n- Spectral Dragons now fly a bit slower, and are more suspectible to damage",
|
1347 | "**.**.**.**": "- Fixed crashes relating to statues transferring PE to Players\n- Fixed a slight derp in the Sacrificial Altar\n- Replaced a couple of textures\n- Added configuration category comments in the config file",
|
1348 | "**.**.**.**": "- Each boss' death ticks variable is now saved to NBT (fixes oddities in regards to world unloads during death animations)\n- Added hooks for registering armor textures for Ghoul armor rendering\n- If any Ghoul entity holds an item, it now renders in it's hand\n- Omothol Ghouls now have a chance to pick up items\n- Armor and held items should now render on Abyssal Anti-Zombies\n- Armor now renders on Ghoul entities (with a default texture if there isn't one assigned)\n- Armor Stands are no longer regarded as proper sacrifices for the Sacrificial Altar\n- Statues can now transfer PE to blocks in all directions (and any range boost increases the transfer range)\n- The Depths Ghoul heads are now back in the decorative block tab\n- The spawn weight for Demon Animals in the Nether is now configurable\n- Fixed crashes related to being teleported to the Dark Realm\n- Fixed a mathematical mishap in the Coralium Gem Cluster recipes\n- Added initial Capability support\n- You can now configure whether or not Abyssal Zombies should pick up Rotten Flesh\n- Removed the Biome ID configuration category (hasn't been used since moving past 1.9)\n- Corrected a few cases where TileEntity NBT data wouldn't sync properly\n- You should now sink into Shoggoth Ooze, Shoggoth Biomass and Solid Lava again\n- Removed duplicate diamond entry in the Dreadlands Mineshaft loot table\n- Fixes crashes regarding Ethaxium Pillars\n- Statues should now transfer PE to nearby players again\n- Asorah's GUI health bar will now decrement when his health decreases\n- Now runs on Forge 12.18.0.2007\n- Updated to 1.10.2"
|
1349 | },
|
1350 | "1.10": {
|
1351 | "**.**.**.**": "- Ported to 1.10"
|
1352 | },
|
1353 | "1.9.4": {
|
1354 | "**.**.**.**-FINAL": "- Demon Animals now starts spreading fire if they get in contact with any source of fire\n- Something happens if you use Shears on Evil Animals\n- Improved the rendering of the Visage of The Depths overlay (should fix any rendering issues regarding it)\n- A fully usable ritual formation no longer generates along with the Temple of J'zahar (you have to do the Necronomcion part)\n- Applying the Coralium and Dread enchantments through rituals works now\n- Improved cave and ravine generation in the Abyssal Wasteland and the Dreadlands\n- Caves and ravines now generate in the Dark Realm\n- Reduced the amount of smoke Shadow mobs emit while inside the Dark Realm\n- Shadow mobs (and Lesser Shadow Shoggoths) are all translucent\n- When a Lesser Shoggoth spawns a child, the child will be of the same type as the parent\n- Added a config option for setting whether or not Lesser Shoggoths should have a chance of spawning in the Overworld\n- Added Crystal Fragments (even smaller pieces of Crystallized Elements)\n- Set proper map colors for the various blocks\n- Shadow mobs now have a chance of spawning in all Darklands biomes (but they're still more common in the mountains)\n- Changed some internal code for the Essence of The Gatekeeper Item Entity (fixes crashes with Extra Utilities 2)\n- The Dreadlands Grass now has the correct bottom and particle texture\n- Mob spawning in the Dreadlands should be more frequent, while mob spawning in the Abyssal Wasteland should be a bit less frequent\n- Lesser Shoggoths no longer spread a layer of ooze below the layer they've already spread\n- Changed the color palette for the Darklands biomes (now uses a indigo-esque color instead of the previous purple)\n- Made the color of the various Darkstone blocks a shade bluer\n- The foliage color in the Abyssal Wasteland now matches the color of the Fused Abyssal Sand\n- Removed the random blindness from the Darklands biomes\n- Lowered the height at which Items placed on Altars/Pedestals are rendered\n- Updated a bunch of pictures in the Necronomicon (anything involving either Darkstone or the Darklands)\n- Remnants no longer say 2 insults at once, and no longer tell you they're busy when you initialize a trade with one\n- Added an API hook to enable Gateway Keys to function in any dimension registered there\n- The Darklands Oak and Dreadlands Tree are less randomized, and taller in general\n- Increased the amount of Darklands Oaks that generate in Darklands Forests\n- Replaced the Darklands Oak Log texture with a different animation and darkened both the Log and Plank textures\n- The Ritual of Fertility now also targets Rabbits\n- Added a config option to change the opacity of the overlay displayed when wearing the Visage of The Depths",
|
1355 | "**.**.**.**-FINAL": "- The terrain in the Dark Realm now has holes resembling the various islands in Omothol generating at the same coordinates\n- Reduced the damage of the Dreadium Katana by 5\n- Halved the durability of the Dreadium Katana and reduced the durability of the Cudgel by 500\n- Sacrificial Altars no longer target Shadow mobs\n- Fixed incorrect corner stair rotation\n- Added more Darklands structures\n- Tiered Sacrificial Altars now share the same cooldown as the regular one (instead of scaling it up unreasonably)\n- The information about Sacrificial Altars now mention the PE collection limit (a fifth of the max capacity)\n- Replaced the Obsidian pillars in the Abyssal Wasteland with giant chains of various lengths (extending downwards from the top)\n- Added additional conditions for Shoggoth Lairs to generate (prevents the derps where they generate almost entirely above ground)\n- Removed all instances of Refined Coralium from the Vanilla Loot Tables\n- The mob spawn list purging is now run in load complete (stops any mob spawn adding done in post-init)\n- It now rains in Darklands Plains and Darklands Mountains\n- Added Coralium Infested Squid\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth can now breathe under water\n- The various dimensional essences now have new textures (which resemble their dimension slightly)\n- The Iron Wall Enchantment now works\n- Added a configurable blacklist for the Interdimensional Cage\n- Liquid Coralium now transmutes Cobblestone blocks into Abyssal Cobblestone, instead of Abyssal Stone\n- Abyssal Sand now randomly turns into Fused Abyssal Sand when exposed to light levels higher than 13\n- Shoggoth Ooze now turns into more dimension-specific blocks instead of Dirt if it's set to expire\n- Spectral Dragons now apply Coralium Plague instead of dealing physical damage\n- Updated a whole bunch of pictures in the Necronomicon\n- Ritual offerings that have Container Items (Buckets, among others) will now return the Container Item instead of consuming the Item altogether\n- Increased the spawn rate and vein size of Abyssal Coralium Ore, while reducing the spawn rate and vein size of Abyssal Diamond Ore\n- Rituals required to progress through the dimensions now appear first on their individual ritual section\n- The metadata wildcard now works correctly for ritual offerings (allowing you to use the same Transmutation Gem in multiple rituals, among things)\n- Added a config option to amplify the armor-piercing damage dealt by mobs in Hardcore Mode\n- The Coralium Plague and Dread Plague damage becomes armor-piercing when Hardcore Mode is enabled\n- Set a more proper attack damage to the various axes\n- The spawner blocks now properly initialize the entities they spawn before spawning them\n- Now runs on Forge 12.17.0.2051",
|
1356 | "**.**.**.**-FINAL": "- The Achievements and Rituals with Water Bottles should display Water Bottles, and nothing else\n- Switched the internal method of killing the sacrifice in rituals that requires a sacrifice (Pigs will no longer turn into Zombie Pigmen)\n- The Forge Universal Bucket is actually registered for the fluids, instead of it not being that\n- Set the correct textures for the Ritual Altars/Pedestals that didn't have the correct texture\n- All of the Ritual Altars/Pedestals now drop the correct block\n- Expanded the amount of different types of objects you can input as offerings in a Ritual\n- Made the bounding boxes for Shoggoth Ooze, Shoggoth Biomass and Solid Lava the size of a full block\n- Fixed the placement of Torches and Buttons in Abyssal Strongholds\n- Fixed the placement of Torches in Dreadlands Mineshafts",
|
1357 | "**.**.**.**-FINAL": "- Fixed crashes related to opening the Achievements page\n- Dreadlands Trees won't turn Dreadlands Dirt into regular Dirt if grown on it\n- Dreadlands Grass now reverts into Dreadlands Dirt when a block is placed on it, instead of regular Dirt",
|
1358 | "**.**.**.**-FINAL": "- Added missing client-side check when fetching the Patreon data\n- Added Luminous Thistle\n- Added Wasteland's Thorn\n- Replaced the mushroom generation in the Abyssal Wastelands with the aforementioned plants",
|
1359 | "**.**.**.**-FINAL": "- Asorah and Spectral Dragons are now immune to fire\n- Reduced the amount of smoke particles during a ritual\n- Ritual Altar creation now has more visual effects\n- Loading stages are no longer logged\n- A few Item textures have been updated\n- Patron Necronomicon info is now fetched from a remote file (has a local version if something goes wrong)\n- A Necronomicon Page object can now specify a URL that points to an image, which will then be displayed (if the image can be located)\n- Any JSON file added to the \"abyssalcraft\" folder in the config directory that's properly formatted will be injected into the \"Other Information\" section of the Necronomicon\n- The \"AbyssalCraft Tools\" Creative Tab now has a Interdimensional Cage filled with PE alongside the normal empty one\n- Fixed the Item name colors on the Gateway Keys\n- Replaced half of the Darklands structures\n- Added API hooks for generating Darklands structures\n- Added config option to force the dimension biomes to reset the mob spawning lists in order to stop mobs from other mods from populating the lists\n- Made the teal tint on the Depths Helmet overlay A LOT more transparent\n- Added Abyssal Sand\n- Added Fused Abyssal Sand\n- Added Abyssal Sand Glass\n- The terrain in the Abyssal Wasteland now has a top layer of Fused Abyssal Sand, with patches of Abyssal Stone\n- Added Dreadlands Dirt\n- Updated the textures on Dreadstone, Abyssalnite Stone and their brick counterparts\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone Stairs, Slabs and Walls\n- Changed the ritual formation blocks to use the Cobblestone blocks instead of Bricks where applicable\n- Updated the information about statues to mention them needing an open sky to operate\n- Fixed the bug where the random blindness from Darklands biomes would stay when it's reached 0\n- Replaced the Darkstone Cobblestone in Abyssal Strongholds with Abyssal Cobblestone\n- Rituals can now be NBT sensitive (pedestal offerings must have identical NBT tags to the ones in the ritual recipe)\n- You can no longer process Liquid Antimatter or Liquid Coralium Buckets in Furnaces, Transmutators or Crystallizers\n- Removed the crafting recipe for a Liquid Antimatter Bucket\n- Changed some of the Potion Effects added by the various armor sets\n- Now runs on Java 8\n- Deprecated the Liquid Coralium and Liquid Antimatter Buckets, they're now handled by the Forge Universal Bucket\n- Fixed a bug with Potion brewing",
|
1360 | "**.**.**.**": "- The staff of Rending upgrades are now set to require the correct Necronomicons\n- Added config option to disable armor smelting recipes\n- More entities now has a chance to spawn wearing random armor\n- Fixed crashes regarding the Halloween easter egg",
|
1361 | "**.**.**.**": "- Fixed crashes on World load from particles",
|
1362 | "**.**.**.**": "- The Abyssal Stone Bricks in the Abyssal Stronghold now occasionally generate as their cracked version\n- Updated the pictures in the Potential Energy section (took new ones on regular Grass, instead of Darklands Grass)\n- Fixed crashes (or just log errors) from Disruptions being triggered after failing to complete a ritual\n- Replaced the smoke from various PE blocks with a particle meant to represent PE\n- Energy Pedestals can now harvest PE from statues again\n- You can now use Energy Relays on Energy Pedestals and Sacrificial Altars",
|
1363 | "**.**.**.**": "- Fixed crashes from completing Infusion Rituals",
|
1364 | "1.9.3": "- You can now configure the chance of a Shoggoth Lair generating in the Overworld\n- The Fire Rain Disruption will now fire a random amount of fireballs (so possibly not 8 at once)\n- Sacthoth now turns day into night when he spawns through a ODB explosion\n- Added Energy Collector\n- Added Energy Relay\n- Energy Pedestals no longer passively generate PE\n- Disruptions triggered from Ritual Altars now only fire server-side (apparently forgot to make that adjustement there)\n- Collected PE now persist when you break a block that can hold it, and the tooltip displays how much is contained\n- You can now have NBT tags persist through Infusion Rituals\n- Gateway Keys will now display a line of text in their tooltip when you can't use them\n- The Dreaded Abyssalnite Chestplate and Plated Coralium Chestplate's aura is now replaced with the effect being applied to attackers on hit\n- Added Energy Container\n- The Ethaxium Boots now applies a Speed boost like the other boots\n- The upgraded Gateway Keys can now place the previous key's portal in it's dimension\n- Added Interdimensional Cage (item that can capture entities)\n- Updated the information in the Ritual Information section\n- Fixed a performance hit caused by viewing pages that had pictures on them (in specifc cases)\n- Fixed the derp where the \"next turn-up\" button disappeared in the Machines section\n- Added a config option to make Shoggoth Ooze turn into dirt after being exposed to light for a random period of time\n- Added Tiered Energy Collectors\n- Added Tiered Energy Relays\n- Added Tiered Energy Containers\n- Changed the defaults to lower numbers for a couple of config options (biome spawn weights, entity spawn weights)\n- Min and max and default values for numerical config options are now provided in the comments (in favor of those not using the config GUI)\n- Updated nearly all of the pictures in the Necronomicon\n- The Abyssalnite Golem and Dreaded Abyssalnite Golem have new skins\n- Spiced up Hardcore Mode a bit\n- Anti-Ghouls now swing their arms when attacking\n- The Ritual of Fertility no longer has a chance of spawning Lesser Shoggoths\n- Remove the \"Shoggoth infestation\" Achievement, since that event no longer triggers\n- The Transmutation Gem now consumes durability when used for crafting, instead of being consumed directly\n- The \"AbyssalCraft Items\" Creative Tab now has each Necronomicon filled with PE alongside the normal empty one\n- The Staff of Rending and Staff of The Gatekeeper now raytrace properly\n- The Staff of Rending can now be upgraded to increase the amount of energy collected\n- A lot of items now have new textures (courtesy of Tiktalik)\n- The JEI integration now displays information regarding things created with the Staff of Rending\n- Darkened the sky color in the Abyssal Wasteland\n- Statues refuse to transport any PE if they're not under a clear sky\n- Statues now have a tolerance value, which increases the more you harvest PE from them, which eventually triggers a Disruption\n- Players no longer emit smoke inside the Dark Realm, only other entities\n- Sounds now play again in a few instances where they didn't\n- Fixed crashes regarding the Anti-Spider loot table",
|
1365 | "1.9.3-pre-1": "- Removed the hurt sounds for the Pete Depths Ghoul variant\n- The Pete, Mr. Wilson and Dr. Orange Depths Ghoul variants now have 3 individual idle sounds, mixed with the regular\n- Added Evil Sheep\n- Added Demon Sheep\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth now have their own set of sounds\n- Villages no longer generate in Darklands Highland and Mountain biomes\n- The large Obsidian pillars now generate in the Abyssal Wasteland again\n- Added Enchantment descriptions (can be seen using WAWLA, among others)\n- Getting killed by either plague shouldn't be able to result in entities spawning indefinitely in the death screen\n- Statues now fire disruptions in a more balanced matter (very rare in a normal state, more common when amplified)\n- Removed the Monolith Disruption (will re-add it when there's a lot more disruptions, or not)\n- Added a Disruption that has a chance to completely drain nearby PE Collectors\n- Disruptions are now properly synced between client and server\n- Did some changes to Overworld worldgen: Less Darkstone generation, slightly reduced Shoggoth Lair generation, heavily reduced Liquid Antimatter pool generation\n- The alternate Depths Ghoul variants no longer have different stats\n- The chance of a Depths Ghoul spawning as one of the variants is now 20%\n- Fixed a typo in the Lesser Shoggoth loot tables\n- Added subtitles to all sounds added by the mod",
|
1366 | "**.**.**.**": "- Added chiseled variants to the Brick types that didn't previously have one\n- Made more crafting recipes depend on the Ore Dictionary\n- Added a cracked variant to all the Brick types\n- Added configurable Item Blacklists for Entities that can pick up item\n- Removed the config option for Abyssal Zombies picking up rotten flesh (superseded by the above)\n- Remnants now have their own yes/no sounds when trading\n- A random chant will now play when performing a ritual\n- Remnant priests will randomly chant\n- Added a ritual that allows you to change the weather in the Biome you're currently at (if possible)\n- The Dreadium Katana and Sacthoth's Soul Reaper Blade now swing like regular swords\n- Statues now transfer PE to players again",
|
1367 | "**.**.**.**": "- Statues now refuse to transfer PE if there's adjacent Statues on any side\n- Demon Animals now use the BiomeDictionary entry NETHER instead of the Nether Biome for Biomes to spawn in\n- All entities (except the bosses) now have their own loot tables",
|
1368 | "**.**.**.**": "- Really fixed that slight derp in the Sacrificial Altar (was fixed in the tiered one, but not the normal)\n- Fixed crashes with placing double slab blocks\n- Darklands Oaks and Dreadlands Trees will now burn\n- Spectral Dragons can no longer fly through portal blocks (they bounce off)\n- Spectral Dragons now fly a bit slower, and are more suspectible to damage",
|
1369 | "**.**.**.**": "- Fixed crashes relating to statues transferring PE to Players\n- Fixed a slight derp in the Sacrificial Altar\n- Replaced a couple of textures\n- Added configuration category comments in the config file",
|
1370 | "**.**.**.**": "- Each boss' death ticks variable is now saved to NBT (fixes oddities in regards to world unloads during death animations)\n- You should no longer hear random Ghast sounds around Anti-Bats\n- Added hooks for registering armor textures for Ghoul armor rendering\n- If any Ghoul entity holds an item, it now renders in it's hand\n- Omothol Ghouls now have a chance to pick up items\n- Armor and held items should now render on Abyssal Anti-Zombies\n- Armor now renders on Ghoul entities (with a default texture if there isn't one assigned)\n- Armor Stands are no longer regarded as proper sacrifices for the Sacrificial Altar\n- Statues can now transfer PE to blocks in all directions (and any range boost increases the transfer range)\n- The Depths Ghoul heads are now back in the decorative block tab\n- The spawn weight for Demon Animals in the Nether is now configurable\n- Fixed crashes related to being teleported to the Dark Realm\n- Fixed a mathematical mishap in the Coralium Gem Cluster recipes\n- Added initial Capability support\n- You can now configure whether or not Abyssal Zombies should pick up Rotten Flesh\n- Removed the Biome ID configuration category (hasn't been used since moving past 1.9)\n- Corrected a few cases where TileEntity NBT data wouldn't sync properly\n- You should now sink into Shoggoth Ooze, Shoggoth Biomass and Solid Lava again\n- Removed duplicate diamond entry in the Dreadlands Mineshaft loot table\n- Fixes crashes regarding Ethaxium Pillars\n- Statues should now transfer PE to nearby players again\n- Asorah's GUI health bar will now decrement when his health decreases\n- Now runs on Forge 12.17.0.1976",
|
1371 | "**.**.**.**": "- Fixed the missing texture for the Staff of The Gatekeeper\n- The sacrificial mechanic should work now (some old code still present broke it)",
|
1372 | "1.9.2": "- Fixed a couple of achievement icons looking weird\n- If you for some reason manage to exceed the max energy values, the Staff of Rending will reset the value and give you a essence\n- Adjusted the colors of the Abyssalnite and Dreadium crystals\n- Fixed custom particle color\n- Tweaked the FOV modification for the Coralium Longbow (should fix a crash with Blood Magic)\n- Added Spanish translation (thanks Moichrocks)\n- Added decorative versions of the statues (they're just blocks, no disruptions or anything)\n- The message that should appear in chat when the \"Ritual of reversed time\" is performed will now display\n- The death animation for J'zahar has been changed slightly (including a new sound effect, courtesy of Funwayguy)\n- Boss messages shouldn't display twice while in multiplayer\n- The Staff of The Gatekeeper, Dreadium Katana and Cudgel have their 3D models back!\n- Added Crystal Clusters (storage blocks for Crystals)\n- Things added to the crystal list are now properly regarded as crystals\n- Slightly re-balanced fuel values for Crystal-based fuels\n- Added a event that fires before Disruptions are triggered (can be cancelled)\n- Added a event that fires before a Lesser Shoggoth places down a Ooze block (allowing you to replace the Ooze block, or cancel the event)\n- Reduced the follow range on a couple of mobs\n- Ethaxium/Dark Ethaxium Pillars can now be rotated when placed (like Quartz Pillars)\n- Failing to complete a ritual now triggers a Disruption\n- It should be impossible to enchant the Dreadium Katana, Cudgel and Sacthoth's Soul Reaper Blade now (not even possible by anvil now)\n- Added Enchantment Rituals (allows you to enchant an item through a ritual)\n- The leaves on AbyssalCraft trees should now decay when there isn't any nearby log\n- The Altar of Cha'garoth is now created through rituals (instead of crafting)\n- The Coralium and Dread enchantments are now applied through rituals\n- Improved the custom explosion code a bit\n- You can now brew AbyssalCraft potions again\n- All things regarding Shoggoth food has now been moved over to EntityUtil\n- Implemented the sacrifice mechanic for rituals (some rituals will require you to present a living entity as an additional offering)\n- AbyssalCraft loot has been added to the vanilla loot tables\n- The spawn weight of End Abyssal Zombies is now configurable (replaces the previous config option to stop them from spawning)\n- Renamed the config option \"Evil Animal spawn rate\" to \"Evil Animal spawn weight\"\n- The fire rain disruption has been reduced to 8 fireballs (previously 20)\n- Some rituals now require a sacrifice (and the statue rituals can be performed anywhere)\n- Portal teleportation in survival mode should work normally again\n- You can now configure the portal cooldown (time it takes before you can use a portal again)\n- Now runs on Forge 12.17.0.1962",
|
1373 | "**.**.**.**": "- Ported to Minecraft 1.9.4\n- All armor sets currently uses the Diamond Armor Material (due to a small bug in Forge)"
|
1374 | },
|
1375 | "1.9": {
|
1376 | "**.**.**.**-FINAL": "- Demon Animals now starts spreading fire if they get in contact with any source of fire\n- Something happens if you use Shears on Evil Animals\n- Improved the rendering of the Visage of The Depths overlay (should fix any rendering issues regarding it)\n- A fully usable ritual formation no longer generates along with the Temple of J'zahar (you have to do the Necronomcion part)\n- Applying the Coralium and Dread enchantments through rituals works now\n- Improved cave and ravine generation in the Abyssal Wasteland and the Dreadlands\n- Caves and ravines now generate in the Dark Realm\n- Reduced the amount of smoke Shadow mobs emit while inside the Dark Realm\n- Shadow mobs (and Lesser Shadow Shoggoths) are all translucent\n- When a Lesser Shoggoth spawns a child, the child will be of the same type as the parent\n- Added a config option for setting whether or not Lesser Shoggoths should have a chance of spawning in the Overworld\n- Added Crystal Fragments (even smaller pieces of Crystallized Elements)\n- Set proper map colors for the various blocks\n- Shadow mobs now have a chance of spawning in all Darklands biomes (but they're still more common in the mountains)\n- Changed some internal code for the Essence of The Gatekeeper Item Entity (fixes crashes with Extra Utilities 2)\n- The Dreadlands Grass now has the correct bottom and particle texture\n- Mob spawning in the Dreadlands should be more frequent, while mob spawning in the Abyssal Wasteland should be a bit less frequent\n- Lesser Shoggoths no longer spread a layer of ooze below the layer they've already spread\n- Changed the color palette for the Darklands biomes (now uses a indigo-esque color instead of the previous purple)\n- Made the color of the various Darkstone blocks a shade bluer\n- The foliage color in the Abyssal Wasteland now matches the color of the Fused Abyssal Sand\n- Removed the random blindness from the Darklands biomes\n- Lowered the height at which Items placed on Altars/Pedestals are rendered\n- Updated a bunch of pictures in the Necronomicon (anything involving either Darkstone or the Darklands)\n- Remnants no longer say 2 insults at once, and no longer tell you they're busy when you initialize a trade with one\n- Added an API hook to enable Gateway Keys to function in any dimension registered there\n- The Darklands Oak and Dreadlands Tree are less randomized, and taller in general\n- Increased the amount of Darklands Oaks that generate in Darklands Forests\n- Replaced the Darklands Oak Log texture with a different animation and darkened both the Log and Plank textures\n- The Ritual of Fertility now also targets Rabbits\n- Added a config option to change the opacity of the overlay displayed when wearing the Visage of The Depths",
|
1377 | "**.**.**.**-FINAL": "- The terrain in the Dark Realm now has holes resembling the various islands in Omothol generating at the same coordinates\n- Reduced the damage of the Dreadium Katana by 5\n- Halved the durability of the Dreadium Katana and reduced the durability of the Cudgel by 500\n- Sacrificial Altars no longer target Shadow mobs\n- Fixed incorrect corner stair rotation\n- Added more Darklands structures\n- Tiered Sacrificial Altars now share the same cooldown as the regular one (instead of scaling it up unreasonably)\n- The information about Sacrificial Altars now mention the PE collection limit (a fifth of the max capacity)\n- Replaced the Obsidian pillars in the Abyssal Wasteland with giant chains of various lengths (extending downwards from the top)\n- Added additional conditions for Shoggoth Lairs to generate (prevents the derps where they generate almost entirely above ground)\n- Removed all instances of Refined Coralium from the Vanilla Loot Tables\n- The mob spawn list purging is now run in load complete (stops any mob spawn adding done in post-init)\n- It now rains in Darklands Plains and Darklands Mountains\n- Added Coralium Infested Squid\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth can now breathe under water\n- The various dimensional essences now have new textures (which resemble their dimension slightly)\n- The Iron Wall Enchantment now works\n- Added a configurable blacklist for the Interdimensional Cage\n- Liquid Coralium now transmutes Cobblestone blocks into Abyssal Cobblestone, instead of Abyssal Stone\n- Abyssal Sand now randomly turns into Fused Abyssal Sand when exposed to light levels higher than 13\n- Shoggoth Ooze now turns into more dimension-specific blocks instead of Dirt if it's set to expire\n- Spectral Dragons now apply Coralium Plague instead of dealing physical damage\n- Updated a whole bunch of pictures in the Necronomicon\n- Ritual offerings that have Container Items (Buckets, among others) will now return the Container Item instead of consuming the Item altogether\n- Increased the spawn rate and vein size of Abyssal Coralium Ore, while reducing the spawn rate and vein size of Abyssal Diamond Ore\n- Rituals required to progress through the dimensions now appear first on their individual ritual section\n- The metadata wildcard now works correctly for ritual offerings (allowing you to use the same Transmutation Gem in multiple rituals, among things)\n- Added a config option to amplify the armor-piercing damage dealt by mobs in Hardcore Mode\n- The Coralium Plague and Dread Plague damage becomes armor-piercing when Hardcore Mode is enabled\n- Set a more proper attack damage to the various axes\n- The spawner blocks now properly initialize the entities they spawn before spawning them",
|
1378 | "**.**.**.**-FINAL": "- The Achievements and Rituals with Water Bottles should display Water Bottles, and nothing else\n- Switched the internal method of killing the sacrifice in rituals that requires a sacrifice (Pigs will no longer turn into Zombie Pigmen)\n- All of the Ritual Altars/Pedestals now drop the correct block\n- Expanded the amount of different types of objects you can input as offerings in a Ritual\n- Fixed the placement of Torches and Buttons in Abyssal Strongholds\n- Fixed the placement of Torches in Dreadlands Mineshafts",
|
1379 | "**.**.**.**-FINAL": "- Fixed crashes related to opening the Achievements page\n- Dreadlands Trees won't turn Dreadlands Dirt into regular Dirt if grown on it",
|
1380 | "**.**.**.**-FINAL": "- Added missing client-side check when fetching the Patreon data\n- Added Luminous Thistle\n- Added Wasteland's Thorn\n- Replaced the mushroom generation in the Abyssal Wastelands with the aforementioned plants",
|
1381 | "**.**.**.**-FINAL": "- Asorah and Spectral Dragons are now immune to fire\n- Reduced the amount of smoke particles during a ritual\n- Ritual Altar creation now has more visual effects\n- Loading stages are no longer logged\n- A few Item textures have been updated\n- Patron Necronomicon info is now fetched from a remote file (has a local version if something goes wrong)\n- A Necronomicon Page object can now specify a URL that points to an image, which will then be displayed (if the image can be located)\n- Any JSON file added to the \"abyssalcraft\" folder in the config directory that's properly formatted will be injected into the \"Other Information\" section of the Necronomicon\n- The \"AbyssalCraft Tools\" Creative Tab now has a Interdimensional Cage filled with PE alongside the normal empty one\n- Fixed the Item name colors on the Gateway Keys\n- Replaced half of the Darklands structures\n- Added API hooks for generating Darklands structures\n- Added config option to force the dimension biomes to reset the mob spawning lists in order to stop mobs from other mods from populating the lists\n- Made the teal tint on the Depths Helmet overlay A LOT more transparent\n- Added Abyssal Sand\n- Added Fused Abyssal Sand\n- Added Abyssal Sand Glass\n- The terrain in the Abyssal Wasteland now has a top layer of Fused Abyssal Sand, with patches of Abyssal Stone\n- Added Dreadlands Dirt\n- Updated the textures on Dreadstone, Abyssalnite Stone and their brick counterparts\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone Stairs, Slabs and Walls\n- Changed the ritual formation blocks to use the Cobblestone blocks instead of Bricks where applicable\n- Updated the information about statues to mention them needing an open sky to operate\n- Fixed the bug where the random blindness from Darklands biomes would stay when it's reached 0\n- Replaced the Darkstone Cobblestone in Abyssal Strongholds with Abyssal Cobblestone\n- Rituals can now be NBT sensitive (pedestal offerings must have identical NBT tags to the ones in the ritual recipe)\n- You can no longer process Liquid Antimatter or Liquid Coralium Buckets in Furnaces, Transmutators or Crystallizers\n- Removed the crafting recipe for a Liquid Antimatter Bucket\n- Changed some of the Potion Effects added by the various armor sets\n- Now runs on Java 8\n- Wooden Pressure Plates in Darklands villages is now replaced with Darklands Oak Pressure Plates\n- Deprecated the Liquid Coralium and Liquid Antimatter Buckets, they're now handled by the Forge Universal Bucket\n- Fixed a bug with Potion brewing",
|
1382 | "**.**.**.**": "- The staff of Rending upgrades are now set to require the correct Necronomicons\n- Added config option to disable armor smelting recipes\n- More entities now has a chance to spawn wearing random armor\n- Fixed crashes regarding the Halloween easter egg",
|
1383 | "**.**.**.**": "- Fixed crashes on World load from particles",
|
1384 | "**.**.**.**": "- The Abyssal Stone Bricks in the Abyssal Stronghold now occasionally generate as their cracked version\n- Updated the pictures in the Potential Energy section (took new ones on regular Grass, instead of Darklands Grass)\n- Fixed crashes (or just log errors) from Disruptions being triggered after failing to complete a ritual\n- Replaced the smoke from various PE blocks with a particle meant to represent PE\n- Energy Pedestals can now harvest PE from statues again\n- You can now use Energy Relays on Energy Pedestals and Sacrificial Altars",
|
1385 | "**.**.**.**": "- Fixed crashes from completing Infusion Rituals",
|
1386 | "1.9.3": "- You can now configure the chance of a Shoggoth Lair generating in the Overworld\n- The Fire Rain Disruption will now fire a random amount of fireballs (so possibly not 8 at once)\n- Sacthoth now turns day into night when he spawns through a ODB explosion\n- Added Energy Collector\n- Added Energy Relay\n- Energy Pedestals no longer passively generate PE\n- Disruptions triggered from Ritual Altars now only fire server-side (apparently forgot to make that adjustement there)\n- Collected PE now persist when you break a block that can hold it, and the tooltip displays how much is contained\n- You can now have NBT tags persist through Infusion Rituals\n- Gateway Keys will now display a line of text in their tooltip when you can't use them\n- The Dreaded Abyssalnite Chestplate and Plated Coralium Chestplate's aura is now replaced with the effect being applied to attackers on hit\n- Added Energy Container\n- The Ethaxium Boots now applies a Speed boost like the other boots\n- The upgraded Gateway Keys can now place the previous key's portal in it's dimension\n- Added Interdimensional Cage (item that can capture entities)\n- Updated the information in the Ritual Information section\n- Fixed a performance hit caused by viewing pages that had pictures on them (in specifc cases)\n- Fixed the derp where the \"next turn-up\" button disappeared in the Machines section\n- Added a config option to make Shoggoth Ooze turn into dirt after being exposed to light for a random period of time\n- Added Tiered Energy Collectors\n- Added Tiered Energy Relays\n- Added Tiered Energy Containers\n- Changed the defaults to lower numbers for a couple of config options (biome spawn weights, entity spawn weights)\n- Min and max and default values for numerical config options are now provided in the comments (in favor of those not using the config GUI)\n- Updated nearly all of the pictures in the Necronomicon\n- The Abyssalnite Golem and Dreaded Abyssalnite Golem have new skins\n- Spiced up Hardcore Mode a bit\n- Anti-Ghouls now swing their arms when attacking\n- The Ritual of Fertility no longer has a chance of spawning Lesser Shoggoths\n- Remove the \"Shoggoth infestation\" Achievement, since that event no longer triggers\n- The Transmutation Gem now consumes durability when used for crafting, instead of being consumed directly\n- The \"AbyssalCraft Items\" Creative Tab now has each Necronomicon filled with PE alongside the normal empty one\n- The Staff of Rending and Staff of The Gatekeeper now raytrace properly\n- The Staff of Rending can now be upgraded to increase the amount of energy collected\n- A lot of items now have new textures (courtesy of Tiktalik)\n- The JEI integration now displays information regarding things created with the Staff of Rending\n- Darkened the sky color in the Abyssal Wasteland\n- Statues refuse to transport any PE if they're not under a clear sky\n- Statues now have a tolerance value, which increases the more you harvest PE from them, which eventually triggers a Disruption\n- Players no longer emit smoke inside the Dark Realm, only other entities\n- Sounds now play again in a few instances where they didn't\n- Fixed crashes regarding the Anti-Spider loot table",
|
1387 | "1.9.3-pre-1": "- Removed the hurt sounds for the Pete Depths Ghoul variant\n- The Pete, Mr. Wilson and Dr. Orange Depths Ghoul variants now have 3 individual idle sounds, mixed with the regular\n- Added Evil Sheep\n- Added Demon Sheep\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth now have their own set of sounds\n- Villages no longer generate in Darklands Highland and Mountain biomes\n- The large Obsidian pillars now generate in the Abyssal Wasteland again\n- Added Enchantment descriptions (can be seen using WAWLA, among others)\n- Getting killed by either plague shouldn't be able to result in entities spawning indefinitely in the death screen\n- Statues now fire disruptions in a more balanced matter (very rare in a normal state, more common when amplified)\n- Removed the Monolith Disruption (will re-add it when there's a lot more disruptions, or not)\n- Added a Disruption that has a chance to completely drain nearby PE Collectors\n- Disruptions are now properly synced between client and server\n- Did some changes to Overworld worldgen: Less Darkstone generation, slightly reduced Shoggoth Lair generation, heavily reduced Liquid Antimatter pool generation\n- The alternate Depths Ghoul variants no longer have different stats\n- The chance of a Depths Ghoul spawning as one of the variants is now 20%\n- Fixed a typo in the Lesser Shoggoth loot tables\n- Added subtitles to all sounds added by the mod",
|
1388 | "**.**.**.**": "- Added chiseled variants to the Brick types that didn't previously have one\n- Made more crafting recipes depend on the Ore Dictionary\n- Added a cracked variant to all the Brick types\n- Added configurable Item Blacklists for Entities that can pick up item\n- Removed the config option for Abyssal Zombies picking up rotten flesh (superseded by the above)\n- Remnants now have their own yes/no sounds when trading\n- A random chant will now play when performing a ritual\n- Remnant priests will randomly chant\n- Added a ritual that allows you to change the weather in the Biome you're currently at (if possible)\n- The Dreadium Katana and Sacthoth's Soul Reaper Blade now swing like regular swords",
|
1389 | "**.**.**.**": "- Statues now refuse to transfer PE if there's adjacent Statues on any side\n- Demon Animals now use the BiomeDictionary entry NETHER instead of the Nether Biome for Biomes to spawn in\n- All entities (except the bosses) now have their own loot tables",
|
1390 | "**.**.**.**": "- Fixed crashes with placing double slab blocks\n- Darklands Oaks and Dreadlands Trees will now burn\n- Spectral Dragons can no longer fly through portal blocks (they bounce off)\n- Spectral Dragons now fly a bit slower, and are more suspectible to damage",
|
1391 | "**.**.**.**": "- Fixed crashes relating to statues transferring PE to Players\n- Fixed a slight derp in the Sacrificial Altar\n- Replaced a couple of textures\n- Added configuration category comments in the config file",
|
1392 | "**.**.**.**": "- Each boss' death ticks variable is now saved to NBT (fixes oddities in regards to world unloads during death animations)\n- You should no longer hear random Ghast sounds around Anti-Bats\n- Added hooks for registering armor textures for Ghoul armor rendering\n- If any Ghoul entity holds an item, it now renders in it's hand\n- Omothol Ghouls now have a chance to pick up items\n- Armor and held items should now render on Abyssal Anti-Zombies\n- Armor now renders on Ghoul entities (with a default texture if there isn't one assigned)\n- Armor Stands are no longer regarded as proper sacrifices for the Sacrificial Altar\n- Statues can now transfer PE to blocks in all directions (and any range boost increases the transfer range)\n- The Depths Ghoul heads are now back in the decorative block tab\n- The spawn weight for Demon Animals in the Nether is now configurable\n- Fixed crashes related to being teleported to the Dark Realm\n- Fixed a mathematical mishap in the Coralium Gem Cluster recipes\n- Added initial Capability support\n- You can now configure whether or not Abyssal Zombies should pick up Rotten Flesh\n- Removed the Biome ID configuration category (hasn't been used since moving past 1.9)\n- Corrected a few cases where TileEntity NBT data wouldn't sync properly\n- Removed duplicate diamond entry in the Dreadlands Mineshaft loot table\n- Fixes crashes regarding Ethaxium Pillars\n- Statues should now transfer PE to nearby players again\n- Asorah's GUI health bar will now decrement when his health decreases",
|
1393 | "**.**.**.**": "- Fixed the missing texture for the Staff of The Gatekeeper\n- The sacrificial mechanic should work now (some old code still present broke it)",
|
1394 | "1.9.2": "- Fixed a couple of achievement icons looking weird\n- If you for some reason manage to exceed the max energy values, the Staff of Rending will reset the value and give you a essence\n- Adjusted the colors of the Abyssalnite and Dreadium crystals\n- Fixed custom particle color\n- Added Spanish translation (thanks Moichrocks)\n- Tweaked the FOV modification for the Coralium Longbow (should fix a crash with Blood Magic)\n- Added decorative versions of the statues (they're just blocks, no disruptions or anything)\n- The message that should appear in chat when the \"Ritual of reversed time\" is performed will now display\n- The death animation for J'zahar has been changed slightly (including a new sound effect, courtesy of Funwayguy)\n- Boss messages shouldn't display twice while in multiplayer\n- The Staff of The Gatekeeper, Dreadium Katana and Cudgel have their 3D models back!\n- Added Crystal Clusters (storage blocks for Crystals)\n- Things added to the crystal list are now properly regarded as crystals\n- Slightly re-balanced fuel values for Crystal-based fuels\n- Added a event that fires before Disruptions are triggered (can be cancelled)\n- Added a event that fires before a Lesser Shoggoth places down a Ooze block (allowing you to replace the Ooze block, or cancel the event)\n- Reduced the follow range on a couple of mobs\n- Ethaxium/Dark Ethaxium Pillars can now be rotated when placed (like Quartz Pillars)\n- Failing to complete a ritual now triggers a Disruption\n- It should be impossible to enchant the Dreadium Katana, Cudgel and Sacthoth's Soul Reaper Blade now (not even possible by anvil now)\n- Added Enchantment Rituals (allows you to enchant an item through a ritual)\n- The leaves on AbyssalCraft trees should now decay when there isn't any nearby log\n- The Altar of Cha'garoth is now created through rituals (instead of crafting)\n- The Coralium and Dread enchantments are now applied through rituals\n- Improved the custom explosion code a bit\n- You can now brew AbyssalCraft potions again\n- All things regarding Shoggoth food has now been moved over to EntityUtil\n- Implemented the sacrifice mechanic for rituals (some rituals will require you to present a living entity as an additional offering)\n- AbyssalCraft loot has been added to the vanilla loot tables\n- The spawn weight of End Abyssal Zombies is now configurable (replaces the previous config option to stop them from spawning)\n- Renamed the config option \"Evil Animal spawn rate\" to \"Evil Animal spawn weight\"\n- The fire rain disruption has been reduced to 8 fireballs (previously 20)\n- Some rituals now require a sacrifice (and the statue rituals can be performed anywhere)\n- Portal teleportation in survival mode should work normally again\n- You can now configure the portal cooldown (time it takes before you can use a portal again)\n- Now runs on Forge 12.16.1.1938",
|
1395 | "**.**.**.**": "- Shoggoth Ooze should no longer spread onto Monolith Stone\n- Changed the picture for the Shoggoth Infestation page\n- Fixed a duplication bug with Ritual Altars and the like\n- When naturally grown into trees, Darklands Oaks and Dreadlands Trees should not turn into regular Oaks",
|
1396 | "**.**.**.**": "- Actually fix the client-side crashes exposed in the previous versions\n- Now runs on Forge 12.16.1.1887\n- Recipe categories in the JEI integration now shows what's used for what recipe (like how the Furnace is shown for smelting)\n- Altar/Pedestal interaction now sync between players again\n- There is no longer a limit on how many rituals can be displayed per section\n- You can now add infinite pages to a Necronomicon Category\n- The Darklands Oak and Dreadlands Tree now have a new design\n- Darklands Grass can now sustain Flowers, Tall Grass and Mushrooms again\n- Rebranded all API packages (now named \"AbyssalCraftAPI\" instead of \"AbyssalCraftAPI|Core\" for instance)\n- Replaced the Necronomicon \"missing texture\" with one that has a more fitting color scheme\n- If the Necronomicon GUI is unable to load an image, it will substitute to it's own \"missing texture\" (instead of the vanilla one)",
|
1397 | "**.**.**.**": "- Fixed crash at server startup",
|
1398 | "**.**.**.**": "- Leaf blocks now look correct when using fast graphics (thanks to vadis365)\n- Fixed random crashes occurring when hitting entities from certain angles\n- Added information regarding Shoggoth infestations to the Potential Energy section of Ritual Information",
|
1399 | "**.**.**.**": "- Fixed any crashes related to ClassCastExceptions regarding strongholds or mineshafts\n- The \"AbyssalCraft Items\" Creative Tab now has a Necronomicon as tab icon\n- Implemented loot tables (Abyssal Strongholds and Dreadlands Mineshafts have their own loot)\n- The Antimatter Potion Effect should no longer continue to spawn Anti-Players while the death screen is displaying\n- The AbyssalCraft biomes can now be accessed in the API (and you can create Darklands and Dreadlands biomes)\n- Any Fire block added by AbyssalCraft can now be exstinghished by hand like vanilla Fire\n- Displacement disruptions now properly move players around (along with other entities)",
|
1400 | "**.**.**.**": "- Recipes involving wooden planks should work with all types of planks now",
|
1401 | "1.9.1": "- Depths Ghouls now have their own hurt sound\n- Lesser Shoggoths now have their own living/hurt/death sounds\n- The ritual for respawning J'zahar will appear before the various Charms in the Omothol ritual section\n- Increased the PE requirement for a few rituals\n- Now runs on Forge 12.16.0.1851\n- Biome ID config options have been removed (as they are assigned automatically)\n- Nerfed the various tool materials a bit (reduced efficiency and durability)\n- A lot of API related things have been refactored\n- Right-clicking with a bucket should no longer crash the game\n- Inventory syncing for when the Staff of Rending gives you a essence/shadow gem should be a lot better now",
|
1402 | "1.9.1-pre-2": "- Now runs on Forge 12.16.0.1811\n- InventoryTweaks integration is back (you can sort crystal bag content again)\n- The Dreadium Samurai armor now animates correctly again (but the swing animation still de-syncs a bit)\n- Oblivion Deathbombs and ODB Cores now animate like TNT when primed\n- The death animation time for J'zahar has been increased to 40 seconds (so you can keep up with his speech)\n- The dialogues shown upon Asorah's and Cha'garoth's deaths now display each sentence with a 3 second pause between them\n- Added information about Enchantments to the Misc Information section\n- Added a ritual that allows you to respawn J'zahar (can only be performed at his temple)\n- Fixed a lot of issues related to tracking entities within close proximity of a block",
|
1403 | "1.9.1-pre-1": "- Demon Animals now have a 50% chance of not burning when spawning in the Nether\n- Added a mimic fire (exstinguishes after 6 seconds, can't be sustained by netherrack)\n- Integrations no longer need to be registered (added a plugin annotation that allows for 100% soft dependencies)\n- Fixed animations for the Dreadium Samurai Armor (arms should move correctly, and armor renders correctly on Armor Stands)\n- Improved the buttons in the Necronomicon GUI (they don't overlay anymore, and a transparent gradient displays on a button when hovered over)\n- Fixed potential crashes related to CraftingStacks where the recipe uses the OreDictionary\n- Automatically fetched crafting recipes will now also fetch the output quantity from the recipe\n- Sacthoth no longer spawns in the Dark Realm\n- Added a Misc Information section to the Necronomicon (displays things not mentioned anywhere else, among them crafting recipes)\n- The range from J'zahar in which you need to be in order for him to drop his essence has been increased to 32 blocks (previously 10)\n- Ported to Minecraft 1.9 (there may be bugs left from the port)\n- All boss health bars now uses the new system (and they also change color depending on how much health the boss has)"
|
1404 | },
|
1405 | "1.8.9": {
|
1406 | "**.**.**.**-FINAL": "- Demon Animals now starts spreading fire if they get in contact with any source of fire\n- Something happens if you use Shears on Evil Animals\n- Improved the rendering of the Visage of The Depths overlay (should fix any rendering issues regarding it)\n- A fully usable ritual formation no longer generates along with the Temple of J'zahar (you have to do the Necronomcion part)\n- Applying the Coralium and Dread enchantments through rituals works now\n- Improved cave and ravine generation in the Abyssal Wasteland and the Dreadlands\n- Caves and ravines now generate in the Dark Realm\n- Reduced the amount of smoke Shadow mobs emit while inside the Dark Realm\n- Shadow mobs (and Lesser Shadow Shoggoths) are all translucent\n- When a Lesser Shoggoth spawns a child, the child will be of the same type as the parent\n- Added a config option for setting whether or not Lesser Shoggoths should have a chance of spawning in the Overworld\n- Added Crystal Fragments (even smaller pieces of Crystallized Elements)\n- Set proper map colors for the various blocks\n- Shadow mobs now have a chance of spawning in all Darklands biomes (but they're still more common in the mountains)\n- Mob spawning in the Dreadlands should be more frequent, while mob spawning in the Abyssal Wasteland should be a bit less frequent\n- Lesser Shoggoths no longer spread a layer of ooze below the layer they've already spread\n- Changed the color palette for the Darklands biomes (now uses a indigo-esque color instead of the previous purple)\n- Made the color of the various Darkstone blocks a shade bluer\n- The foliage color in the Abyssal Wasteland now matches the color of the Fused Abyssal Sand\n- Removed the random blindness from the Darklands biomes\n- Lowered the height at which Items placed on Altars/Pedestals are rendered\n- Updated a bunch of pictures in the Necronomicon (anything involving either Darkstone or the Darklands)\n- Added an API hook to enable Gateway Keys to function in any dimension registered there\n- The Darklands Oak and Dreadlands Tree are less randomized, and taller in general\n- Increased the amount of Darklands Oaks that generate in Darklands Forests\n- Replaced the Darklands Oak Log texture with a different animation and darkened both the Log and Plank textures\n- The Ritual of Fertility now also targets Rabbits\n- Added a config option to change the opacity of the overlay displayed when wearing the Visage of The Depths",
|
1407 | "**.**.**.**-FINAL": "- The terrain in the Dark Realm now has holes resembling the various islands in Omothol generating at the same coordinates\n- Reduced the damage of the Dreadium Katana by 5\n- Halved the durability of the Dreadium Katana and reduced the durability of the Cudgel by 500\n- Sacrificial Altars no longer target Shadow mobs\n- Added more Darklands structures\n- Tiered Sacrificial Altars now share the same cooldown as the regular one (instead of scaling it up unreasonably)\n- The information about Sacrificial Altars now mention the PE collection limit (a fifth of the max capacity)\n- Replaced the Obsidian pillars in the Abyssal Wasteland with giant chains of various lengths (extending downwards from the top)\n- Added additional conditions for Shoggoth Lairs to generate (prevents the derps where they generate almost entirely above ground)\n- Removed all instances of Refined Coralium from the Vanilla Loot Tables\n- The mob spawn list purging is now run in load complete (stops any mob spawn adding done in post-init)\n- It now rains in Darklands Plains and Darklands Mountains\n- Added Coralium Infested Squid\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth can now breathe under water\n- The various dimensional essences now have new textures (which resemble their dimension slightly)\n- The Iron Wall Enchantment now works\n- Added a configurable blacklist for the Interdimensional Cage\n- Liquid Coralium now transmutes Cobblestone blocks into Abyssal Cobblestone, instead of Abyssal Stone\n- Abyssal Sand now randomly turns into Fused Abyssal Sand when exposed to light levels higher than 13\n- Shoggoth Ooze now turns into more dimension-specific blocks instead of Dirt if it's set to expire\n- Spectral Dragons now apply Coralium Plague instead of dealing physical damage\n- Updated a whole bunch of pictures in the Necronomicon\n- Ritual offerings that have Container Items (Buckets, among others) will now return the Container Item instead of consuming the Item altogether\n- Increased the spawn rate and vein size of Abyssal Coralium Ore, while reducing the spawn rate and vein size of Abyssal Diamond Ore\n- Rituals required to progress through the dimensions now appear first on their individual ritual section\n- The metadata wildcard now works correctly for ritual offerings (allowing you to use the same Transmutation Gem in multiple rituals, among things)\n- Added a config option to amplify the armor-piercing damage dealt by mobs in Hardcore Mode\n- The Coralium Plague and Dread Plague damage becomes armor-piercing when Hardcore Mode is enabled\n- The spawner blocks now properly initialize the entities they spawn before spawning them",
|
1408 | "**.**.**.**-FINAL": "- Switched the internal method of killing the sacrifice in rituals that requires a sacrifice (Pigs will no longer turn into Zombie Pigmen)\n- All of the Ritual Altars/Pedestals now drop the correct block\n- Expanded the amount of different types of objects you can input as offerings in a Ritual",
|
1409 | "**.**.**.**-FINAL": "- Fixed crashes related to opening the Achievements page\n- Dreadlands Trees won't turn Dreadlands Dirt into regular Dirt if grown on it",
|
1410 | "**.**.**.**-FINAL": "- Added missing client-side check when fetching the Patreon data\n- Added Luminous Thistle\n- Added Wasteland's Thorn\n- Replaced the mushroom generation in the Abyssal Wastelands with the aforementioned plants",
|
1411 | "**.**.**.**-FINAL": "- Asorah and Spectral Dragons are now immune to fire\n- Reduced the amount of smoke particles during a ritual\n- Ritual Altar creation now has more visual effects\n- Loading stages are no longer logged\n- A few Item textures have been updated\n- Patron Necronomicon info is now fetched from a remote file (has a local version if something goes wrong)\n- A Necronomicon Page object can now specify a URL that points to an image, which will then be displayed (if the image can be located)\n- Any JSON file added to the \"abyssalcraft\" folder in the config directory that's properly formatted will be injected into the \"Other Information\" section of the Necronomicon\n- The \"AbyssalCraft Tools\" Creative Tab now has a Interdimensional Cage filled with PE alongside the normal empty one\n- Fixed the Item name colors on the Gateway Keys\n- Replaced half of the Darklands structures\n- Added API hooks for generating Darklands structures\n- Added config option to force the dimension biomes to reset the mob spawning lists in order to stop mobs from other mods from populating the lists\n- Made the teal tint on the Depths Helmet overlay A LOT more transparent\n- Added Abyssal Sand\n- Added Fused Abyssal Sand\n- Added Abyssal Sand Glass\n- The terrain in the Abyssal Wasteland now has a top layer of Fused Abyssal Sand, with patches of Abyssal Stone\n- Added Dreadlands Dirt\n- Updated the textures on Dreadstone, Abyssalnite Stone and their brick counterparts\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone\n- Added Abyssal Cobblestone, Dreadstone Cobblestone, Abyssalnite Cobblestone and Coralium Cobblestone Stairs, Slabs and Walls\n- Changed the ritual formation blocks to use the Cobblestone blocks instead of Bricks where applicable\n- Updated the information about statues to mention them needing an open sky to operate\n- Fixed the bug where the random blindness from Darklands biomes would stay when it's reached 0\n- Replaced the Darkstone Cobblestone in Abyssal Strongholds with Abyssal Cobblestone\n- Rituals can now be NBT sensitive (pedestal offerings must have identical NBT tags to the ones in the ritual recipe)\n- You can no longer process Liquid Antimatter or Liquid Coralium Buckets in Furnaces, Transmutators or Crystallizers\n- Removed the crafting recipe for a Liquid Antimatter Bucket\n- Changed some of the Potion Effects added by the various armor sets\n- Now runs on Java 8",
|
1412 | "**.**.**.**": "- The staff of Rending upgrades are now set to require the correct Necronomicons\n- Added config option to disable armor smelting recipes\n- More entities now has a chance to spawn wearing random armor",
|
1413 | "**.**.**.**": "- Fixed crashes on World load from particles",
|
1414 | "**.**.**.**": "- The Abyssal Stone Bricks in the Abyssal Stronghold now occasionally generate as their cracked version\n- Updated the pictures in the Potential Energy section (took new ones on regular Grass, instead of Darklands Grass)\n- Fixed crashes (or just log errors) from Disruptions being triggered after failing to complete a ritual\n- Replaced the smoke from various PE blocks with a particle meant to represent PE",
|
1415 | "**.**.**.**": "- Fixed crashes from completing Infusion Rituals",
|
1416 | "1.9.3": "- You can now configure the chance of a Shoggoth Lair generating in the Overworld\n- The Fire Rain Disruption will now fire a random amount of fireballs (so possibly not 8 at once)\n- Sacthoth now turns day into night when he spawns through a ODB explosion\n- Added Energy Collector\n- Added Energy Relay\n- Energy Pedestals no longer passively generate PE\n- Disruptions triggered from Ritual Altars now only fire server-side (apparently forgot to make that adjustement there)\n- Collected PE now persist when you break a block that can hold it, and the tooltip displays how much is contained\n- You can now have NBT tags persist through Infusion Rituals\n- Gateway Keys will now display a line of text in their tooltip when you can't use them\n- The Dreaded Abyssalnite Chestplate and Plated Coralium Chestplate's aura is now replaced with the effect being applied to attackers on hit\n- Added Energy Container\n- The Ethaxium Boots now applies a Speed boost like the other boots\n- The upgraded Gateway Keys can now place the previous key's portal in it's dimension\n- Added Interdimensional Cage (item that can capture entities)\n- Updated the information in the Ritual Information section\n- Fixed a performance hit caused by viewing pages that had pictures on them (in specifc cases)\n- Fixed the derp where the \"next turn-up\" button disappeared in the Machines section\n- Added a config option to make Shoggoth Ooze turn into dirt after being exposed to light for a random period of time\n- Added Tiered Energy Collectors\n- Added Tiered Energy Relays\n- Added Tiered Energy Containers\n- Changed the defaults to lower numbers for a couple of config options (biome spawn weights, entity spawn weights)\n- Min and max and default values for numerical config options are now provided in the comments (in favor of those not using the config GUI)\n- The Demon Sheep's name is now localized\n- Updated nearly all of the pictures in the Necronomicon\n- The Abyssalnite Golem and Dreaded Abyssalnite Golem have new skins\n- Spiced up Hardcore Mode a bit\n- Depths Ghouls no longer spread the Dread Plague (that's apparently been a thing since 1.9.2)\n- Anti-Ghouls now swing their arms when attacking\n- The Ritual of Fertility no longer has a chance of spawning Lesser Shoggoths\n- Remove the \"Shoggoth infestation\" Achievement, since that event no longer triggers\n- The Transmutation Gem now consumes durability when used for crafting, instead of being consumed directly\n- The \"AbyssalCraft Items\" Creative Tab now has each Necronomicon filled with PE alongside the normal empty one\n- The Staff of Rending and Staff of The Gatekeeper now raytrace properly\n- The Staff of Rending can now be upgraded to increase the amount of energy collected\n- A lot of items now have new textures (courtesy of Tiktalik)\n- The JEI integration now displays information regarding things created with the Staff of Rending\n- Darkened the sky color in the Abyssal Wasteland\n- Statues refuse to transport any PE if they're not under a clear sky\n- Statues now have a tolerance value, which increases the more you harvest PE from them, which eventually triggers a Disruption\n- Players no longer emit smoke inside the Dark Realm, only other entities",
|
1417 | "1.9.3-pre-1": "- Removed the hurt sounds for the Pete Depths Ghoul variant\n- The Pete, Mr. Wilson and Dr. Orange Depths Ghoul variants now have 3 individual idle sounds, mixed with the regular\n- Added Evil Sheep\n- Added Demon Sheep\n- Dread Spawns, Greater Dread Spawns, Lesser Dreadbeasts and Spawns of Cha'garoth now have their own set of sounds\n- Villages no longer generate in Darklands Highland and Mountain biomes\n- The large Obsidian pillars now generate in the Abyssal Wasteland again\n- Added Enchantment descriptions (can be seen using WAWLA, among others)\n- Getting killed by either plague shouldn't be able to result in entities spawning indefinitely in the death screen\n- Statues now fire disruptions in a more balanced matter (very rare in a normal state, more common when amplified)\n- Removed the Monolith Disruption (will re-add it when there's a lot more disruptions, or not)\n- Added a Disruption that has a chance to completely drain nearby PE Collectors\n- Disruptions are now properly synced between client and server\n- Did some changes to Overworld worldgen: Less Darkstone generation, slightly reduced Shoggoth Lair generation, heavily reduced Liquid Antimatter pool generation\n- The alternate Depths Ghoul variants no longer have different stats\n- The chance of a Depths Ghoul spawning as one of the variants is now 20%",
|
1418 | "**.**.**.**": "- Added chiseled variants to the Brick types that didn't previously have one\n- Made more crafting recipes depend on the Ore Dictionary\n- Added a cracked variant to all the Brick types\n- Added configurable Item Blacklists for Entities that can pick up item\n- Removed the config option for Abyssal Zombies picking up rotten flesh (superseded by the above)\n- Remnants now have their own yes/no sounds when trading\n- A random chant will now play when performing a ritual\n- Remnant priests will randomly chant\n- Added a ritual that allows you to change the weather in the Biome you're currently at (if possible)",
|
1419 | "**.**.**.**": "- Statues now refuse to transfer PE if there's adjacent Statues on any side\n-Demon Animals now use the BiomeDictionary entry NETHER instead of the Nether Biome for Biomes to spawn in",
|
1420 | "**.**.**.**": "- Fixed crashes with placing double slab blocks\n- Darklands Oaks and Dreadlands Trees will now burn\n- Spectral Dragons can no longer fly through portal blocks (they bounce off)\n- Spectral Dragons now fly a bit slower, and are more suspectible to damage",
|
1421 | "**.**.**.**": "- Increased the amount of Abyssal Strongholds generating in the Abyssal Wasteland\n- Fixed a slight derp in the Sacrificial Altar\n- Replaced a couple of textures\n- Crates can now be opened again\n- Added configuration category comments in the config file",
|
1422 | "**.**.**.**": "- Each boss' death ticks variable is now saved to NBT (fixes oddities in regards to world unloads during death animations)\n- Added hooks for registering armor textures for Ghoul armor rendering\n- If any Ghoul entity holds an item, it now renders in it's hand\n- Omothol Ghouls now have a chance to pick up items\n- Armor and held items should now render on Abyssal Anti-Zombies\n- Armor now renders on Ghoul entities (with a default texture if there isn't one assigned)\n- Armor Stands are no longer regarded as proper sacrifices for the Sacrificial Altar\n- Statues can now transfer PE to blocks in all directions (and any range boost increases the transfer range)\n- The Depths Ghoul heads are now back in the decorative block tab\n- The spawn weight for Demon Animals in the Nether is now configurable\n- Fixed crashes related to being teleported to the Dark Realm\n- Fixed a mathematical mishap in the Coralium Gem Cluster recipes\n- Added initial Capability support\n- You can now configure whether or not Abyssal Zombies should pick up Rotten Flesh\n- Fixed bug where the Coralium Longbow would turn into a missing texture block when pulling",
|
1423 | "**.**.**.**": "- Fixed the missing texture for the Staff of The Gatekeeper",
|
1424 | "1.9.2": "- The Staff of Rending should now sync better when reaching the max energy values\n- If you for some reason manage to exceed the max energy values, the Staff of Rending will reset the value and give you a essence\n- Adjusted the colors of the Abyssalnite and Dreadium crystals\n- Fixed custom particle color\n- Tweaked the FOV modification for the Coralium Longbow (should fix a crash with Blood Magic)\n- Added Spanish translation (thanks Moichrocks)\n- Added decorative versions of the statues (they're just blocks, no disruptions or anything)\n- The message that should appear in chat when the \"Ritual of reversed time\" is performed will now display\n- The death animation for J'zahar has been changed slightly (including a new sound effect, courtesy of Funwayguy)\n- Boss messages shouldn't display twice while in multiplayer\n- The Staff of The Gatekeeper, Dreadium Katana and Cudgel have their 3D models back!\n- Added Crystal Clusters (storage blocks for Crystals)\n- Things added to the crystal list are now properly regarded as crystals\n- Slightly re-balanced fuel values for Crystal-based fuels\n- Added a event that fires before Disruptions are triggered (can be cancelled)\n- Added a event that fires before a Lesser Shoggoth places down a Ooze block (allowing you to replace the Ooze block, or cancel the event)\n- Reduced the follow range on a couple of mobs\n- Ethaxium/Dark Ethaxium Pillars can now be rotated when placed (like Quartz Pillars)\n- Failing to complete a ritual now triggers a Disruption\n- It should be impossible to enchant the Dreadium Katana, Cudgel and Sacthoth's Soul Reaper Blade now (not even possible by anvil now)\n- Added Enchantment Rituals (allows you to enchant an item through a ritual)\n- The leaves on AbyssalCraft trees should now decay when there isn't any nearby log\n- The Altar of Cha'garoth is now created through rituals (instead of crafting)\n- The Coralium and Dread enchantments are now applied through rituals\n- Improved the custom explosion code a bit\n- You can no longer brew any AbyssalCraft potions\n- All things regarding Shoggoth food has now been moved over to EntityUtil\n- Implemented the sacrifice mechanic for rituals (some rituals will require you to present a living entity as an additional offering)\n- The spawn weight of End Abyssal Zombies is now configurable (replaces the previous config option to stop them from spawning)\n- Renamed the config option \"Evil Animal spawn rate\" to \"Evil Animal spawn weight\"\n- The fire rain disruption has been reduced to 8 fireballs (previously 20)\n- Some rituals now require a sacrifice (and the statue rituals can be performed anywhere)\n- You can now configure the portal cooldown (time it takes before you can use a portal again)",
|
1425 | "**.**.**.**": "- Shoggoth Ooze should no longer spread onto Monolith Stone\n- Changed the picture for the Shoggoth Infestation page\n- When naturally grown into trees, Darklands Oaks and Dreadlands Trees should not turn into regular Oaks",
|
1426 | "**.**.**.**": "- Actually fix the client-side crashes exposed in the previous versions\n- Now runs on Forge 11.15.1.1875\n- There is no longer a limit on how many rituals can be displayed per section\n- You can now add infinite pages to a Necronomicon Category\n- The Darklands Oak and Dreadlands Tree now have a new design\n- Darklands Grass can now sustain Flowers, Tall Grass and Mushrooms again\n- Rebranded all API packages (now named \"AbyssalCraftAPI\" instead of \"AbyssalCraftAPI|Core\" for instance)\n- Replaced the Necronomicon \"missing texture\" with one that has a more fitting color scheme\n- If the Necronomicon GUI is unable to load an image, it will substitute to it's own \"missing texture\" (instead of the vanilla one)",
|
1427 | "**.**.**.**": "- Fixed crash at server startup",
|
1428 | "**.**.**.**": "- Leaf blocks now look correct when using fast graphics (thanks to vadis365)\n- Fixed random crashes occurring when hitting entities from certain angles\n- Added information regarding Shoggoth infestations to the Potential Energy section of Ritual Information",
|
1429 | "**.**.**.**": "- Fixed any crashes related to ClassCastExceptions regarding strongholds or mineshafts\n- The \"AbyssalCraft Items\" Creative Tab now has a Necronomicon as tab icon\n- The AbyssalCraft biomes can now be accessed in the API (and you can create Darklands and Dreadlands biomes)\n- Any Fire block added by AbyssalCraft can now be exstinghished by hand like vanilla Fire\n- Displacement disruptions now properly move players around (along with other entities)",
|
1430 | "**.**.**.**": "- Recipes involving wooden planks should work with all types of planks now",
|
1431 | "1.9.1": "- Demon Animals now have a 50% chance of not burning when spawning in the Nether\n- Added a mimic fire (exstinguishes after 6 seconds, can't be sustained by netherrack)\n- Integrations no longer need to be registered (added a plugin annotation that allows for 100% soft dependencies)\n- Fixed animations for the Dreadium Samurai Armor (arms should move correctly, and armor renders correctly on Armor Stands)\n- Improved the buttons in the Necronomicon GUI (they don't overlay anymore, and a transparent gradient displays on a button when hovered over)\n- Fixed potential crashes related to CraftingStacks where the recipe uses the OreDictionary\n- Automatically fetched crafting recipes will now also fetch the output quantity from the recipe\n- Sacthoth no longer spawns in the Dark Realm\n- Added a Misc Information section to the Necronomicon (displays things not mentioned anywhere else, among them crafting recipes)\n- The range from J'zahar in which you need to be in order for him to drop his essence has been increased to 32 blocks (previously 10)\n- Oblivion Deathbombs and ODB Cores now animate like TNT when primed\n- The death animation time for J'zahar has been increased to 40 seconds (so you can keep up with his speech)\n- The dialogues shown upon Asorah's and Cha'garoth's deaths now display each sentence with a 3 second pause between them\n- Added a ritual that allows you to respawn J'zahar (can only be performed at his temple)\n- Depths Ghouls now have their own hurt sound\n- Lesser Shoggoths now have their own living/hurt/death sounds\n- Increased the PE requirement for a few rituals\n- Nerfed the various tool materials a bit (reduced efficiency and durability)\n- A lot of API related things have been refactored\n- Inventory syncing for when the Staff of Rending gives you a essence/shadow gem should be a lot better now\n- Now runs on Forge 11.15.1.1847\n- Fixed any remaining issues related to tracking entities within close proximity of a block",
|
1432 | "1.9.0": "- Added missing page to the Potential Energy section of Ritual Information (mentions how monoliths are created)\n- Darklands Villages should now have Darklands Oak Pressure Plates and Darkstone Double slabs (instead of the vanilla equivalents)\n- Anti-Spiders are now hostile during night again\n- Fixed the third person rendering of some blocks (large upside-down models when held in third person)\n- The Dreadlands Infused Powerstone now has a model (semi-temp if I can get the OBj one to work, otherwise permanent)\n- Fixed the Abyssal Stone Slab and Darklands Oak Slab not rendering correctly when placed\n- Depths Ghouls, Abyssal Zombies and Lesser Shoggoths should no longer spawn at Mushroom Island Shores\n- It's possible to enter Cha'garoth's lair again (minor derp in the code)\n- Fixed some Necronomicon Pages with the wrong text\n- Added a config option that allows you to change how Evil Animals spawn\n- Disabled any test code in the Materializer that could trigger a crash (since it's incomplete)\n- Fixed bug related to crafting recipes involving upgrading Necronomicons/Crystal Bags and using Upgrade Kits\n- Lesser Shoggoths outside of the Overworld should drop the correct item when killed now (applying metadata to the dropped item)\n- Spectral Dragons should now be easier to hit without getting hit from them\n- Spectral Dragon spawn rate has been reduced to the lowest possible (encountering one now should be very rare, unless another mod tweaks the spawn rate)\n- Darklands Oak Slabs are no longer treated as stone\n- Added a config option allowing you to toggle whether or not Liquid Antimatter should disintegrate any item dropped into it\n- Crystallizer and Transmutator automation works correctly again (output slot is depleted from the bottom)\n- Leaves, Saplings and Logs should be treated as such by other mods now\n- Liquid Coralium shouldn't spread into ocean biomes when told not to\n- Remnants should now stop attacking whatever angered them when the anger timer runs out (and they don't slow the game down while they're angry)\n- The Crate now renders when placed\n- Replaced the Fist of Cha'garoth spawner block with a J'zahar spawner block\n- J'zahar has increased in size\n- If a Spectral Dragon dies while Asorah is draining it, Asorah won't take explosion damage\n- Any item placed on a Ritual/Sacrificial Altar or Ritual/Energy Pedestal will also render for other players\n- The smoke projected when a ritual is performed also renders for other players\n- Shoggoth Lairs should now longer spawn in biomes registered to the BiomeDictionary as the \"WATER\" type\n- The Staff of Rending will now continue to drain energy when the right mouse button is pressed\n- Shadow Fragments/Shards/Gems now spawn in dungeon/mineshaft/pyramid/stronghold chests\n- The Shard of Oblivion now requires 4 Shadow Gems (previously 8)\n- Remnants can now open doors\n- Added the Temple of J'zahar (generates in Omothol)\n- Added the City of Omothol\n- Updated the Omothol Progression section of the Necronomicon\n- Added Essence of The Gatekeeper (replacement for the Oblivion Catalyst in the Abyssalnomicon recipe, dropped by J'zahar)\n- Staff of The Gatekeeper is now created through a ritual (instead of dropped by J'zahar)\n- Added a Minion of The Gatekeeper spawner block\n- Potion of Annihilation and Potion of Dread Plague can now be brewed again\n- Remnants and Minions of The Gatekeeper no longer despawn\n- Spawn rate of Remnants and Minions of The Gatekeeper has been heavily reduced (quite rare now)\n- Minions of The Gatekeeper now has a 10% chance of dropping Ethaxium Ingots (while Eldritch Scales are the regular drop)\n- Now runs on Forge 11.15.1.1764",
|
1433 | "1.9.0-pre-4": "- Adjusted a few things in the JEI integration (fuel categories, method for fetching fuels)\n- The bounding box on Depths Ghoul/Anti-Ghoul/Omothol Ghoul has been reduced (the width was far off)\n- Lesser Shoggoths should now be possible to hit without them landing a couple of hits on you\n- Baby versions of all AbyssalCraft mobs (that has a baby version) now has a bounding box half the size of the adult one\n- Crafting recipes displayed in the Necronomicon are now automatically fetched (eg. a MineTweaked recipe will display)\n- Added a new config category: Worldgen\n- Nearly all structure generation and all ore generation can now be disabled in the config\n- You can now add/edit/remove pages in the Necronomicon (MineTweaker support in next ACI release)\n- The second Yog-Sothoth page now displays the correct text (eg. not the same as the first one)\n- Fixed the Ethaxium Hoe texture (file name derp)\n- Fixed the Plated Coralium Armor piece names being way off\n- Fixed Plate Coralium and Dreadium Samurai Armor textures missing\n- Fixed crashes when trying to equip Plated Coralium and Dreaded Abyssalnite Chestplates\n- Now runs on Forge 11.15.1.1741",
|
1434 | "1.9.0-pre-3": "- Removed all Transmutator/Crystallizer recipes involving Water of Lava (in block forms)\n- Fixed bug where some text in the Necronomicon didn't display\n- All explosives explode again\n- Fixed the third person rendering on all tools and weapons (swords are held by the hilt etc)\n- Fixed crashes related to missing classes (file paths to come Thaumcraft interfaces have changed, and I was checking for the old path)\n- The Depths Helmet overlay is displaying again\n- Fixed a glitch where walking into blocks that aren't full cubes would cause entities to suffocate\n- Monolith Disruptions shouldn't crash the game (and they work a bit better now)\n- All custom block and item models are now used (but the Staff of The Gatekeeper, the Cudgel and the Dreadlands Infused Powerstone currently has no models)\n- Added a JEI (Just Enough Items) integration (does exactly everything the NEI integration did)"
|
1435 | }
|
1436 | }
|
1437 |
|
1438 | [15:22:25] [Forge Version Check/INFO] [forge.VersionCheck]: [abyssalcraft] Found status: AHEAD Target: null
|
1439 | [15:22:25] [Forge Version Check/INFO] [forge.VersionCheck]: [enderstorage] Starting version check at http://chickenbones.net/Files/notification/version.php?query=forge&version=1.12&file=EnderStorage
|
1440 | [15:22:25] [Forge Version Check/DEBUG] [forge.VersionCheck]: [enderstorage] Received version check data:
|
1441 | {"homepage": "http://chickenbones.net/Pages/links.html","promos": {"1.12-recommended": "**.**.**.**"}}
|
1442 | [15:22:25] [Forge Version Check/INFO] [forge.VersionCheck]: [enderstorage] Found status: BETA Target: null
|
1443 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.depthsghoul as abyssalcraft:depthsghoul
|
1444 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.evilpig as abyssalcraft:evilpig
|
1445 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.abyssalzombie as abyssalcraft:abyssalzombie
|
1446 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity Primed ODB as abyssalcraft:primedodb
|
1447 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.Jzahar as abyssalcraft:jzahar
|
1448 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.abygolem as abyssalcraft:abygolem
|
1449 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.dreadgolem as abyssalcraft:dreadgolem
|
1450 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.dreadguard as abyssalcraft:dreadguard
|
1451 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity PowerstoneTracker as abyssalcraft:powerstonetracker
|
1452 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.dragonminion as abyssalcraft:dragonminion
|
1453 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.dragonboss as abyssalcraft:dragonboss
|
1454 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity Primed ODB Core as abyssalcraft:primedodbcore
|
1455 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.shadowcreature as abyssalcraft:shadowcreature
|
1456 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.shadowmonster as abyssalcraft:shadowmonster
|
1457 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.dreadling as abyssalcraft:dreadling
|
1458 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.dreadspawn as abyssalcraft:dreadspawn
|
1459 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.demonpig as abyssalcraft:demonpig
|
1460 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.gskeleton as abyssalcraft:gskeleton
|
1461 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.chagarothspawn as abyssalcraft:chagarothspawn
|
1462 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.chagarothfist as abyssalcraft:chagarothfist
|
1463 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.chagaroth as abyssalcraft:chagaroth
|
1464 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.shadowbeast as abyssalcraft:shadowbeast
|
1465 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.shadowboss as abyssalcraft:shadowboss
|
1466 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antiabyssalzombie as abyssalcraft:antiabyssalzombie
|
1467 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antibat as abyssalcraft:antibat
|
1468 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antichicken as abyssalcraft:antichicken
|
1469 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.anticow as abyssalcraft:anticow
|
1470 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.anticreeper as abyssalcraft:anticreeper
|
1471 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antighoul as abyssalcraft:antighoul
|
1472 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antipig as abyssalcraft:antipig
|
1473 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antiplayer as abyssalcraft:antiplayer
|
1474 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antiskeleton as abyssalcraft:antiskeleton
|
1475 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antispider as abyssalcraft:antispider
|
1476 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.antizombie as abyssalcraft:antizombie
|
1477 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.remnant as abyssalcraft:remnant
|
1478 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.omotholghoul as abyssalcraft:omotholghoul
|
1479 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity CoraliumArrow as abyssalcraft:coraliumarrow
|
1480 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.jzaharminion as abyssalcraft:jzaharminion
|
1481 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.greaterdreadspawn as abyssalcraft:greaterdreadspawn
|
1482 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.lesserdreadbeast as abyssalcraft:lesserdreadbeast
|
1483 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity DreadSlug as abyssalcraft:dreadslug
|
1484 | [15:22:31] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.lessershoggoth as abyssalcraft:lessershoggoth
|
1485 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.evilcow as abyssalcraft:evilcow
|
1486 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.evilchicken as abyssalcraft:evilchicken
|
1487 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.demoncow as abyssalcraft:demoncow
|
1488 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.demonchicken as abyssalcraft:demonchicken
|
1489 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity GatekeeperEssence as abyssalcraft:gatekeeperessence
|
1490 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.evilsheep as abyssalcraft:evilsheep
|
1491 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.demonsheep as abyssalcraft:demonsheep
|
1492 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.coraliumsquid as abyssalcraft:coraliumsquid
|
1493 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity inkprojectile as abyssalcraft:inkprojectile
|
1494 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity dreadedcharge as abyssalcraft:dreadedcharge
|
1495 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity acidprojectile as abyssalcraft:acidprojectile
|
1496 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity blackhole as abyssalcraft:blackhole
|
1497 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity implosion as abyssalcraft:implosion
|
1498 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity abyssalcraft.shuboffspring as abyssalcraft:shuboffspring
|
1499 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity spirititem as abyssalcraft:spirititem
|
1500 | [15:22:32] [Server thread/TRACE] [FML]: Automatically registered mod abyssalcraft entity portal as abyssalcraft:portal
|
1501 | [15:22:32] [Server thread/INFO] [AbyssalCraft]: Starting the Integration Handler.
|
1502 | [15:22:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod abyssalcraft
|
1503 | [15:22:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - AbyssalCraft took 11.766s
|
1504 | [15:22:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod orbis-lib
|
1505 | [15:22:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod orbis-lib
|
1506 | [15:22:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - OrbisLib took 0.001s
|
1507 | [15:22:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod aether
|
1508 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.altar`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1509 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.holystone_furnace`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1510 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.skyroot_chest`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1511 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.skyroot_sign`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1512 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.multiblock_dummy`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1513 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.moa_egg`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1514 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.icestone_cooler`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1515 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.incubator`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1516 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.present`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1517 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.wildcard`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1518 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.masonry_bench`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1519 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.outpost_campfire`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1520 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.aether_teleporter`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1521 | [15:22:34] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.skyroot_bed`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
|
1522 | [15:22:34] [Server thread/DEBUG] [AetherII]: 'Pre-initialize tiles' completed in 169ms
|
1523 | [15:22:34] [Server thread/DEBUG] [AetherII]: 'Pre-initialize dimensions' completed in 16ms
|
1524 | [15:22:34] [Server thread/DEBUG] [AetherII]: 'Pre-initialize loot tables' completed in 0ms
|
1525 | [15:22:34] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.aechor_plant as aether:aechor_plant
|
1526 | [15:22:34] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.aerbunny as aether:aerbunny
|
1527 | [15:22:34] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.carrion_sprout as aether:carrion_sprout
|
1528 | [15:22:34] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.cockatrice as aether:cockatrice
|
1529 | [15:22:35] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.kirrid as aether:kirrid
|
1530 | [15:22:35] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.aerwhale as aether:aerwhale
|
1531 | [15:22:35] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.zephyr as aether:zephyr
|
1532 | [15:22:35] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.tempest as aether:tempest
|
1533 | [15:22:35] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.swet as aether:swet
|
1534 | [15:22:35] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.taegore as aether:taegore
|
1535 | [15:22:35] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.glitterwing as aether:glitterwing
|
1536 | [15:22:35] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.edison as aether:edison
|
1537 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.burrukai as aether:burrukai
|
1538 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.necromancer as aether:necromancer
|
1539 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.josediya as aether:josediya
|
1540 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.tivalier as aether:tivalier
|
1541 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.glactrix as aether:glactrix
|
1542 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.mysterious_figure as aether:mysterious_figure
|
1543 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.varanys as aether:varanys
|
1544 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.skyroot_lizard as aether:skyroot_lizard
|
1545 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.sheepuff as aether:sheepuff
|
1546 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.frostpine_totem as aether:frostpine_totem
|
1547 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.kraisith as aether:kraisith
|
1548 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.shade_of_arkenzus as aether:shade_of_arkenzus
|
1549 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.ethereal_wisp as aether:ethereal_wisp
|
1550 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.fleeting_wisp as aether:fleeting_wisp
|
1551 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.soaring_wisp as aether:soaring_wisp
|
1552 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.fangrin as aether:fangrin
|
1553 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.nex_spirit as aether:nex_spirit
|
1554 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.pink_baby_swet as aether:pink_baby_swet
|
1555 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.floating_block as aether:floating_block
|
1556 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.moving_block as aether:moving_block
|
1557 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.dart as aether:dart
|
1558 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.daggerfrost_snowball as aether:daggerfrost_snowball
|
1559 | [15:22:36] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.bolt as aether:bolt
|
1560 | [15:22:37] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.parachute as aether:parachute
|
1561 | [15:22:37] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.tnt_present as aether:tnt_present
|
1562 | [15:22:37] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.moa as aether:moa
|
1563 | [15:22:37] [Server thread/DEBUG] [AetherII]: 'Pre-initialize entities' completed in 2931ms
|
1564 | [15:22:39] [Server thread/DEBUG] [AetherII]: 'Pre-initialize networking' completed in 2375ms
|
1565 | [15:22:39] [Server thread/DEBUG] [AetherII]: 'Pre-initialize patron rewards' completed in 26ms
|
1566 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/aechor_plant.json
|
1567 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/aerbunny.json
|
1568 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/burrukai.json
|
1569 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/carrion_sprout.json
|
1570 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/cockatrice.json
|
1571 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/glactrix.json
|
1572 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/glitterwing.json
|
1573 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/kirrid.json
|
1574 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/moa.json
|
1575 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/sheepuff.json
|
1576 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/skyroot_lizard.json
|
1577 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/swet.json
|
1578 | [15:22:39] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/taegore.json
|
1579 | [15:22:40] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/tempest.json
|
1580 | [15:22:40] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/varanys.json
|
1581 | [15:22:40] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/zephyr.json
|
1582 | [15:22:40] [Server thread/DEBUG] [AetherII]: 'Pre-initialize definitions' completed in 202ms
|
1583 | [15:22:40] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod aether
|
1584 | [15:22:40] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Aether II took 7.877s
|
1585 | [15:22:40] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod blocklings
|
1586 | [15:22:40] [Server thread/TRACE] [FML]: Automatically registered mod blocklings entity blockling as blocklings:entity_blockling
|
1587 | [15:22:40] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod blocklings
|
1588 | [15:22:40] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Blocklings Mod took 0.242s
|
1589 | [15:22:40] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod bloodmoon
|
1590 | [15:22:40] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod bloodmoon
|
1591 | [15:22:40] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Bloodmoon took 0.018s
|
1592 | [15:22:40] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod chisel
|
1593 | [15:22:40] [Server thread/INFO] [FML]: Applying holder lookups
|
1594 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1595 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1596 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
|
1597 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1598 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
|
1599 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
|
1600 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
|
1601 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
|
1602 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
|
1603 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
|
1604 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
|
1605 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1606 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
|
1607 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1608 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
|
1609 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1610 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1611 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
|
1612 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
|
1613 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
|
1614 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
|
1615 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
1616 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1617 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1618 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
|
1619 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1620 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
|
1621 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1622 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
|
1623 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1624 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1625 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
|
1626 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1627 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
1628 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1629 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1630 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
|
1631 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1632 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1633 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
|
1634 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1635 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1636 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1637 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
|
1638 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
|
1639 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
|
1640 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
|
1641 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
1642 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
|
1643 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
|
1644 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
|
1645 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
1646 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
|
1647 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
|
1648 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
|
1649 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
1650 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1651 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
1652 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
|
1653 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1654 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
|
1655 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
|
1656 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
1657 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
|
1658 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1659 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
|
1660 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
|
1661 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
|
1662 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
|
1663 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
|
1664 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
|
1665 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
|
1666 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1667 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
1668 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
1669 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
1670 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
|
1671 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
1672 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1673 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
1674 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
|
1675 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
1676 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
1677 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
1678 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
1679 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
1680 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
1681 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1682 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
1683 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
1684 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1685 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
1686 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
1687 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
|
1688 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
|
1689 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
|
1690 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
1691 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
|
1692 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
|
1693 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
|
1694 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
|
1695 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
|
1696 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1697 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
1698 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1699 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
1700 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
|
1701 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
1702 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1703 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1704 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
1705 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1706 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1707 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
|
1708 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1709 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
1710 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1711 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
|
1712 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1713 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
|
1714 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
|
1715 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1716 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1717 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
|
1718 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1719 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1720 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
1721 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1722 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
|
1723 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1724 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
|
1725 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
|
1726 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1727 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
1728 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1729 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
|
1730 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
|
1731 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
|
1732 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
|
1733 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1734 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
|
1735 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1736 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
1737 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1738 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
|
1739 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
|
1740 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1741 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
1742 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1743 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
1744 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
1745 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
1746 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
1747 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1748 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1749 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1750 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
1751 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1752 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
|
1753 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
1754 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
1755 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
|
1756 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
1757 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
|
1758 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aechor_petal for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aechor_petal. This means the object wasn't registered. It's likely just mod options.
|
1759 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aerwhale_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aerwhale_music_disc. This means the object wasn't registered. It's likely just mod options.
|
1760 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_saddle for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aether_saddle. This means the object wasn't registered. It's likely just mod options.
|
1761 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:antitoxin_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.antitoxin_vial. This means the object wasn't registered. It's likely just mod options.
|
1762 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:antivenom_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.antivenom_vial. This means the object wasn't registered. It's likely just mod options.
|
1763 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_chunk for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ambrosium_chunk. This means the object wasn't registered. It's likely just mod options.
|
1764 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_shard for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ambrosium_shard. This means the object wasn't registered. It's likely just mod options.
|
1765 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium. This means the object wasn't registered. It's likely just mod options.
|
1766 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_axe. This means the object wasn't registered. It's likely just mod options.
|
1767 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_boots. This means the object wasn't registered. It's likely just mod options.
|
1768 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_chestplate. This means the object wasn't registered. It's likely just mod options.
|
1769 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_crossbow. This means the object wasn't registered. It's likely just mod options.
|
1770 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_door_item. This means the object wasn't registered. It's likely just mod options.
|
1771 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_gloves. This means the object wasn't registered. It's likely just mod options.
|
1772 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_helmet. This means the object wasn't registered. It's likely just mod options.
|
1773 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_leggings. This means the object wasn't registered. It's likely just mod options.
|
1774 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
1775 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shears for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shears. This means the object wasn't registered. It's likely just mod options.
|
1776 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shield. This means the object wasn't registered. It's likely just mod options.
|
1777 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shovel. This means the object wasn't registered. It's likely just mod options.
|
1778 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_strip for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_strip. This means the object wasn't registered. It's likely just mod options.
|
1779 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_sword. This means the object wasn't registered. It's likely just mod options.
|
1780 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:bandage for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.bandage. This means the object wasn't registered. It's likely just mod options.
|
1781 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.blueberries. This means the object wasn't registered. It's likely just mod options.
|
1782 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberry_lollipop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.blueberry_lollipop. This means the object wasn't registered. It's likely just mod options.
|
1783 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:bolt for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.bolt. This means the object wasn't registered. It's likely just mod options.
|
1784 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_cane for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_cane. This means the object wasn't registered. It's likely just mod options.
|
1785 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_grass for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_grass. This means the object wasn't registered. It's likely just mod options.
|
1786 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_rope for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_rope. This means the object wasn't registered. It's likely just mod options.
|
1787 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt. This means the object wasn't registered. It's likely just mod options.
|
1788 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_boots. This means the object wasn't registered. It's likely just mod options.
|
1789 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_chestplate. This means the object wasn't registered. It's likely just mod options.
|
1790 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_gloves. This means the object wasn't registered. It's likely just mod options.
|
1791 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_helmet. This means the object wasn't registered. It's likely just mod options.
|
1792 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_leggings. This means the object wasn't registered. It's likely just mod options.
|
1793 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_rib_cut for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_rib_cut. This means the object wasn't registered. It's likely just mod options.
|
1794 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_ribs for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_ribs. This means the object wasn't registered. It's likely just mod options.
|
1795 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.candy_cane. This means the object wasn't registered. It's likely just mod options.
|
1796 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_corn for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.candy_corn. This means the object wasn't registered. It's likely just mod options.
|
1797 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloud_parachute for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cloud_parachute. This means the object wasn't registered. It's likely just mod options.
|
1798 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudtwine for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cloudtwine. This means the object wasn't registered. It's likely just mod options.
|
1799 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:cockatrice_feather for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cockatrice_feather. This means the object wasn't registered. It's likely just mod options.
|
1800 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:cocoatrice for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cocoatrice. This means the object wasn't registered. It's likely just mod options.
|
1801 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_shard for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.crude_scatterglass_shard. This means the object wasn't registered. It's likely just mod options.
|
1802 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:dart for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.dart. This means the object wasn't registered. It's likely just mod options.
|
1803 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:dart_shooter for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.dart_shooter. This means the object wasn't registered. It's likely just mod options.
|
1804 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:eggnog for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.eggnog. This means the object wasn't registered. It's likely just mod options.
|
1805 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:enchanted_blueberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.enchanted_blueberry. This means the object wasn't registered. It's likely just mod options.
|
1806 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:enchanted_wyndberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.enchanted_wyndberry. This means the object wasn't registered. It's likely just mod options.
|
1807 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:fried_moa_egg for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.fried_moa_egg. This means the object wasn't registered. It's likely just mod options.
|
1808 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:ginger_bread_man for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ginger_bread_man. This means the object wasn't registered. It's likely just mod options.
|
1809 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:golden_amber for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.golden_amber. This means the object wasn't registered. It's likely just mod options.
|
1810 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_axe. This means the object wasn't registered. It's likely just mod options.
|
1811 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_boots. This means the object wasn't registered. It's likely just mod options.
|
1812 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_chestplate. This means the object wasn't registered. It's likely just mod options.
|
1813 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_crossbow. This means the object wasn't registered. It's likely just mod options.
|
1814 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_gloves. This means the object wasn't registered. It's likely just mod options.
|
1815 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_helmet. This means the object wasn't registered. It's likely just mod options.
|
1816 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_leggings. This means the object wasn't registered. It's likely just mod options.
|
1817 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
1818 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_plate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_plate. This means the object wasn't registered. It's likely just mod options.
|
1819 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_shield. This means the object wasn't registered. It's likely just mod options.
|
1820 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_shovel. This means the object wasn't registered. It's likely just mod options.
|
1821 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_sword. This means the object wasn't registered. It's likely just mod options.
|
1822 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:healing_stone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.healing_stone. This means the object wasn't registered. It's likely just mod options.
|
1823 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:healing_stone_depleted for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.healing_stone_depleted. This means the object wasn't registered. It's likely just mod options.
|
1824 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_axe. This means the object wasn't registered. It's likely just mod options.
|
1825 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_crossbow. This means the object wasn't registered. It's likely just mod options.
|
1826 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
1827 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_shield. This means the object wasn't registered. It's likely just mod options.
|
1828 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_shovel. This means the object wasn't registered. It's likely just mod options.
|
1829 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_sword. This means the object wasn't registered. It's likely just mod options.
|
1830 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.icestone. This means the object wasn't registered. It's likely just mod options.
|
1831 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_poprocks for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.icestone_poprocks. This means the object wasn't registered. It's likely just mod options.
|
1832 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_armor for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_armor. This means the object wasn't registered. It's likely just mod options.
|
1833 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_charm for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_charm. This means the object wasn't registered. It's likely just mod options.
|
1834 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_chunk for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_chunk. This means the object wasn't registered. It's likely just mod options.
|
1835 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_dust for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_dust. This means the object wasn't registered. It's likely just mod options.
|
1836 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_neckwear for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_neckwear. This means the object wasn't registered. It's likely just mod options.
|
1837 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_ring for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_ring. This means the object wasn't registered. It's likely just mod options.
|
1838 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_sword. This means the object wasn't registered. It's likely just mod options.
|
1839 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_tool for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_tool. This means the object wasn't registered. It's likely just mod options.
|
1840 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:jelly_plumproot for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.jelly_plumproot. This means the object wasn't registered. It's likely just mod options.
|
1841 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:kirrid_cutlet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.kirrid_cutlet. This means the object wasn't registered. It's likely just mod options.
|
1842 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:kirrid_loin for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.kirrid_loin. This means the object wasn't registered. It's likely just mod options.
|
1843 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:labyrinth_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.labyrinth_music_disc. This means the object wasn't registered. It's likely just mod options.
|
1844 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_egg_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_egg_item. This means the object wasn't registered. It's likely just mod options.
|
1845 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feather for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feather. This means the object wasn't registered. It's likely just mod options.
|
1846 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed. This means the object wasn't registered. It's likely just mod options.
|
1847 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed_blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed_blueberries. This means the object wasn't registered. It's likely just mod options.
|
1848 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed_enchanted_blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed_enchanted_blueberries. This means the object wasn't registered. It's likely just mod options.
|
1849 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_music_disc. This means the object wasn't registered. It's likely just mod options.
|
1850 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.orange. This means the object wasn't registered. It's likely just mod options.
|
1851 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange_lollipop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.orange_lollipop. This means the object wasn't registered. It's likely just mod options.
|
1852 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot_mash for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.plumproot_mash. This means the object wasn't registered. It's likely just mod options.
|
1853 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot_pie for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.plumproot_pie. This means the object wasn't registered. It's likely just mod options.
|
1854 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:rainbow_moa_egg for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.rainbow_moa_egg. This means the object wasn't registered. It's likely just mod options.
|
1855 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:raw_taegore_meat for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.raw_taegore_meat. This means the object wasn't registered. It's likely just mod options.
|
1856 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:recording_892 for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.recording_892. This means the object wasn't registered. It's likely just mod options.
|
1857 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.scatterglass_vial. This means the object wasn't registered. It's likely just mod options.
|
1858 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.secret_skyroot_door_item. This means the object wasn't registered. It's likely just mod options.
|
1859 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:shard_of_life for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.shard_of_life. This means the object wasn't registered. It's likely just mod options.
|
1860 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_axe. This means the object wasn't registered. It's likely just mod options.
|
1861 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bed_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_bed_item. This means the object wasn't registered. It's likely just mod options.
|
1862 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_bucket. This means the object wasn't registered. It's likely just mod options.
|
1863 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_crossbow. This means the object wasn't registered. It's likely just mod options.
|
1864 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_door_item. This means the object wasn't registered. It's likely just mod options.
|
1865 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_lizard_stick for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_lizard_stick. This means the object wasn't registered. It's likely just mod options.
|
1866 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_lizard_stick_roasted for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_lizard_stick_roasted. This means the object wasn't registered. It's likely just mod options.
|
1867 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_milk_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_milk_bucket. This means the object wasn't registered. It's likely just mod options.
|
1868 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
1869 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pinecone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_pinecone. This means the object wasn't registered. It's likely just mod options.
|
1870 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_poison_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_poison_bucket. This means the object wasn't registered. It's likely just mod options.
|
1871 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_shield. This means the object wasn't registered. It's likely just mod options.
|
1872 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_shovel. This means the object wasn't registered. It's likely just mod options.
|
1873 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sign for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_sign. This means the object wasn't registered. It's likely just mod options.
|
1874 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_stick for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_stick. This means the object wasn't registered. It's likely just mod options.
|
1875 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_sword. This means the object wasn't registered. It's likely just mod options.
|
1876 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_water_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_water_bucket. This means the object wasn't registered. It's likely just mod options.
|
1877 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:splint for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.splint. This means the object wasn't registered. It's likely just mod options.
|
1878 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:stomper_pop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.stomper_pop. This means the object wasn't registered. It's likely just mod options.
|
1879 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_gel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_gel. This means the object wasn't registered. It's likely just mod options.
|
1880 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_jelly for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_jelly. This means the object wasn't registered. It's likely just mod options.
|
1881 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_sugar for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_sugar. This means the object wasn't registered. It's likely just mod options.
|
1882 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide. This means the object wasn't registered. It's likely just mod options.
|
1883 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_boots. This means the object wasn't registered. It's likely just mod options.
|
1884 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_chestplate. This means the object wasn't registered. It's likely just mod options.
|
1885 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_gloves. This means the object wasn't registered. It's likely just mod options.
|
1886 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_helmet. This means the object wasn't registered. It's likely just mod options.
|
1887 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_leggings. This means the object wasn't registered. It's likely just mod options.
|
1888 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_steak for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_steak. This means the object wasn't registered. It's likely just mod options.
|
1889 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_music_disc. This means the object wasn't registered. It's likely just mod options.
|
1890 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_tea for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_tea. This means the object wasn't registered. It's likely just mod options.
|
1891 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_wings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_wings. This means the object wasn't registered. It's likely just mod options.
|
1892 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:water_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.water_vial. This means the object wasn't registered. It's likely just mod options.
|
1893 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:winter_hat for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.winter_hat. This means the object wasn't registered. It's likely just mod options.
|
1894 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wrapped_chocolates for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wrapped_chocolates. This means the object wasn't registered. It's likely just mod options.
|
1895 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wrapping_paper for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wrapping_paper. This means the object wasn't registered. It's likely just mod options.
|
1896 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wyndberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wyndberry. This means the object wasn't registered. It's likely just mod options.
|
1897 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:yule_log for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.yule_log. This means the object wasn't registered. It's likely just mod options.
|
1898 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_axe. This means the object wasn't registered. It's likely just mod options.
|
1899 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_boots. This means the object wasn't registered. It's likely just mod options.
|
1900 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_chestplate. This means the object wasn't registered. It's likely just mod options.
|
1901 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_crossbow. This means the object wasn't registered. It's likely just mod options.
|
1902 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_gemstone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_gemstone. This means the object wasn't registered. It's likely just mod options.
|
1903 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_gloves. This means the object wasn't registered. It's likely just mod options.
|
1904 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_helmet. This means the object wasn't registered. It's likely just mod options.
|
1905 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_leggings. This means the object wasn't registered. It's likely just mod options.
|
1906 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
1907 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_shield. This means the object wasn't registered. It's likely just mod options.
|
1908 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_shovel. This means the object wasn't registered. It's likely just mod options.
|
1909 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_sword. This means the object wasn't registered. It's likely just mod options.
|
1910 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_iron for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_iron. This means the object wasn't registered. It's likely just mod options.
|
1911 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_diamond for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_diamond. This means the object wasn't registered. It's likely just mod options.
|
1912 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_hitech for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_hitech. This means the object wasn't registered. It's likely just mod options.
|
1913 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:offsettool for public static team.chisel.common.item.ItemOffsetTool team.chisel.common.init.ChiselItems.offsettool. This means the object wasn't registered. It's likely just mod options.
|
1914 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:antiblock for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.antiblock. This means the object wasn't registered. It's likely just mod options.
|
1915 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:auto_chisel for public static team.chisel.common.block.BlockAutoChisel team.chisel.common.init.ChiselBlocks.auto_chisel. This means the object wasn't registered. It's likely just mod options.
|
1916 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:basalt for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.basalt. This means the object wasn't registered. It's likely just mod options.
|
1917 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:basalt1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.basalt1. This means the object wasn't registered. It's likely just mod options.
|
1918 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:basalt2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.basalt2. This means the object wasn't registered. It's likely just mod options.
|
1919 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:block_charcoal2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.block_charcoal2. This means the object wasn't registered. It's likely just mod options.
|
1920 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bloodmagic for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bloodmagic. This means the object wasn't registered. It's likely just mod options.
|
1921 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_spruce for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_spruce. This means the object wasn't registered. It's likely just mod options.
|
1922 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_birch for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_birch. This means the object wasn't registered. It's likely just mod options.
|
1923 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_jungle for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_jungle. This means the object wasn't registered. It's likely just mod options.
|
1924 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_acacia for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_acacia. This means the object wasn't registered. It's likely just mod options.
|
1925 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_darkoak for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_darkoak. This means the object wasn't registered. It's likely just mod options.
|
1926 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:brownstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.brownstone. This means the object wasn't registered. It's likely just mod options.
|
1927 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
|
1928 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:cloud for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.cloud. This means the object wasn't registered. It's likely just mod options.
|
1929 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
|
1930 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_white for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_white. This means the object wasn't registered. It's likely just mod options.
|
1931 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_orange for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_orange. This means the object wasn't registered. It's likely just mod options.
|
1932 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_lightblue for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_lightblue. This means the object wasn't registered. It's likely just mod options.
|
1933 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_magenta for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_magenta. This means the object wasn't registered. It's likely just mod options.
|
1934 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_lime for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_lime. This means the object wasn't registered. It's likely just mod options.
|
1935 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_yellow for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_yellow. This means the object wasn't registered. It's likely just mod options.
|
1936 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_pink for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_pink. This means the object wasn't registered. It's likely just mod options.
|
1937 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_gray for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_gray. This means the object wasn't registered. It's likely just mod options.
|
1938 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_lightgray for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_lightgray. This means the object wasn't registered. It's likely just mod options.
|
1939 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_blue for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_blue. This means the object wasn't registered. It's likely just mod options.
|
1940 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_cyan for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_cyan. This means the object wasn't registered. It's likely just mod options.
|
1941 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_purple for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_purple. This means the object wasn't registered. It's likely just mod options.
|
1942 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_green for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_green. This means the object wasn't registered. It's likely just mod options.
|
1943 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_brown for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_brown. This means the object wasn't registered. It's likely just mod options.
|
1944 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_red for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_red. This means the object wasn't registered. It's likely just mod options.
|
1945 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_black for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_black. This means the object wasn't registered. It's likely just mod options.
|
1946 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
|
1947 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:dirt for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.dirt. This means the object wasn't registered. It's likely just mod options.
|
1948 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:factory for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.factory. This means the object wasn't registered. It's likely just mod options.
|
1949 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:futura for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.futura. This means the object wasn't registered. It's likely just mod options.
|
1950 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:glowstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.glowstone. This means the object wasn't registered. It's likely just mod options.
|
1951 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:glowstone1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.glowstone1. This means the object wasn't registered. It's likely just mod options.
|
1952 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:glowstone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.glowstone2. This means the object wasn't registered. It's likely just mod options.
|
1953 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:laboratory for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.laboratory. This means the object wasn't registered. It's likely just mod options.
|
1954 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:lavastone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.lavastone. This means the object wasn't registered. It's likely just mod options.
|
1955 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:lavastone1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.lavastone1. This means the object wasn't registered. It's likely just mod options.
|
1956 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:lavastone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.lavastone2. This means the object wasn't registered. It's likely just mod options.
|
1957 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:limestone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.limestone. This means the object wasn't registered. It's likely just mod options.
|
1958 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:limestone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.limestone2. This means the object wasn't registered. It's likely just mod options.
|
1959 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:marble for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.marble. This means the object wasn't registered. It's likely just mod options.
|
1960 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:marble2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.marble2. This means the object wasn't registered. It's likely just mod options.
|
1961 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:netherrack for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.netherrack. This means the object wasn't registered. It's likely just mod options.
|
1962 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:paper for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.paper. This means the object wasn't registered. It's likely just mod options.
|
1963 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:temple for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.temple. This means the object wasn't registered. It's likely just mod options.
|
1964 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:tyrian for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.tyrian. This means the object wasn't registered. It's likely just mod options.
|
1965 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:valentines for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.valentines. This means the object wasn't registered. It's likely just mod options.
|
1966 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:voidstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.voidstone. This means the object wasn't registered. It's likely just mod options.
|
1967 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstone. This means the object wasn't registered. It's likely just mod options.
|
1968 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstone1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstone1. This means the object wasn't registered. It's likely just mod options.
|
1969 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstone2. This means the object wasn't registered. It's likely just mod options.
|
1970 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
|
1971 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aercloud for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aercloud. This means the object wasn't registered. It's likely just mod options.
|
1972 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_crafting_table for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_crafting_table. This means the object wasn't registered. It's likely just mod options.
|
1973 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_dirt for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_dirt. This means the object wasn't registered. It's likely just mod options.
|
1974 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_flower for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_flower. This means the object wasn't registered. It's likely just mod options.
|
1975 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_grass. This means the object wasn't registered. It's likely just mod options.
|
1976 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_portal for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_portal. This means the object wasn't registered. It's likely just mod options.
|
1977 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_teleporter for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_teleporter. This means the object wasn't registered. It's likely just mod options.
|
1978 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite. This means the object wasn't registered. It's likely just mod options.
|
1979 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick. This means the object wasn't registered. It's likely just mod options.
|
1980 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_decorative. This means the object wasn't registered. It's likely just mod options.
|
1981 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_slab. This means the object wasn't registered. It's likely just mod options.
|
1982 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
1983 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_wall. This means the object wasn't registered. It's likely just mod options.
|
1984 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_pillar. This means the object wasn't registered. It's likely just mod options.
|
1985 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_slab. This means the object wasn't registered. It's likely just mod options.
|
1986 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_stairs. This means the object wasn't registered. It's likely just mod options.
|
1987 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_wall. This means the object wasn't registered. It's likely just mod options.
|
1988 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:altar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.altar. This means the object wasn't registered. It's likely just mod options.
|
1989 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:amberoot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.amberoot_leaves. This means the object wasn't registered. It's likely just mod options.
|
1990 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ambrosium_ore. This means the object wasn't registered. It's likely just mod options.
|
1991 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_torch for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ambrosium_torch. This means the object wasn't registered. It's likely just mod options.
|
1992 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arctic_spikespring for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.arctic_spikespring. This means the object wasn't registered. It's likely just mod options.
|
1993 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_door for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.arkenium_door. This means the object wasn't registered. It's likely just mod options.
|
1994 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.arkenium_ore. This means the object wasn't registered. It's likely just mod options.
|
1995 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:barkshroom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.barkshroom. This means the object wasn't registered. It's likely just mod options.
|
1996 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_dark_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_dark_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
1997 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_light_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_light_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
1998 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
1999 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_swingtip for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_swingtip. This means the object wasn't registered. It's likely just mod options.
|
2000 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberry_bush for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blueberry_bush. This means the object wasn't registered. It's likely just mod options.
|
2001 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_plant for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.brettl_plant. This means the object wasn't registered. It's likely just mod options.
|
2002 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.candy_cane_block. This means the object wasn't registered. It's likely just mod options.
|
2003 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.candy_cane_wall. This means the object wasn't registered. It's likely just mod options.
|
2004 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudwool_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.cloudwool_block. This means the object wasn't registered. It's likely just mod options.
|
2005 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudwool_carpet for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.cloudwool_carpet. This means the object wasn't registered. It's likely just mod options.
|
2006 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass. This means the object wasn't registered. It's likely just mod options.
|
2007 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass_decorative. This means the object wasn't registered. It's likely just mod options.
|
2008 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_pane for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass_pane. This means the object wasn't registered. It's likely just mod options.
|
2009 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_pane_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass_pane_decorative. This means the object wasn't registered. It's likely just mod options.
|
2010 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_blue_dark_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_blue_dark_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
2011 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_blue_light_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_blue_light_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
2012 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_blue_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_blue_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
2013 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_beam. This means the object wasn't registered. It's likely just mod options.
|
2014 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_decorative. This means the object wasn't registered. It's likely just mod options.
|
2015 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_log. This means the object wasn't registered. It's likely just mod options.
|
2016 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_planks. This means the object wasn't registered. It's likely just mod options.
|
2017 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick. This means the object wasn't registered. It's likely just mod options.
|
2018 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
|
2019 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_slab. This means the object wasn't registered. It's likely just mod options.
|
2020 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
2021 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_pillar. This means the object wasn't registered. It's likely just mod options.
|
2022 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_wall. This means the object wasn't registered. It's likely just mod options.
|
2023 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:ferrosite for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ferrosite. This means the object wasn't registered. It's likely just mod options.
|
2024 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:ferrosite_sand for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ferrosite_sand. This means the object wasn't registered. It's likely just mod options.
|
2025 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:forgotten_rose for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.forgotten_rose. This means the object wasn't registered. It's likely just mod options.
|
2026 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:golden_oak_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.golden_oak_log. This means the object wasn't registered. It's likely just mod options.
|
2027 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.gravitite_block. This means the object wasn't registered. It's likely just mod options.
|
2028 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.gravitite_ore. This means the object wasn't registered. It's likely just mod options.
|
2029 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_button. This means the object wasn't registered. It's likely just mod options.
|
2030 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_fence. This means the object wasn't registered. It's likely just mod options.
|
2031 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_fence_gate. This means the object wasn't registered. It's likely just mod options.
|
2032 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_log_wall. This means the object wasn't registered. It's likely just mod options.
|
2033 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_pressure_plate. This means the object wasn't registered. It's likely just mod options.
|
2034 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_sapling. This means the object wasn't registered. It's likely just mod options.
|
2035 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_slab. This means the object wasn't registered. It's likely just mod options.
|
2036 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_stairs. This means the object wasn't registered. It's likely just mod options.
|
2037 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_dark_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_dark_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
2038 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_light_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_light_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
2039 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
|
2040 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_swingtip for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_swingtip. This means the object wasn't registered. It's likely just mod options.
|
2041 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick. This means the object wasn't registered. It's likely just mod options.
|
2042 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
|
2043 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_slab. This means the object wasn't registered. It's likely just mod options.
|
2044 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
2045 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_wall. This means the object wasn't registered. It's likely just mod options.
|
2046 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_lantern for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_lantern. This means the object wasn't registered. It's likely just mod options.
|
2047 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_pillar. This means the object wasn't registered. It's likely just mod options.
|
2048 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_bush for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_bush. This means the object wasn't registered. It's likely just mod options.
|
2049 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_ice for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_ice. This means the object wasn't registered. It's likely just mod options.
|
2050 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_ice_crystal for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_ice_crystal. This means the object wasn't registered. It's likely just mod options.
|
2051 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_packed_ice for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_packed_ice. This means the object wasn't registered. It's likely just mod options.
|
2052 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_snow for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_snow. This means the object wasn't registered. It's likely just mod options.
|
2053 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_snow_layer for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_snow_layer. This means the object wasn't registered. It's likely just mod options.
|
2054 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_tulips for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_tulips. This means the object wasn't registered. It's likely just mod options.
|
2055 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone. This means the object wasn't registered. It's likely just mod options.
|
2056 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_bookshelf for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_bookshelf. This means the object wasn't registered. It's likely just mod options.
|
2057 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick. This means the object wasn't registered. It's likely just mod options.
|
2058 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
|
2059 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_slab. This means the object wasn't registered. It's likely just mod options.
|
2060 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
2061 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_wall. This means the object wasn't registered. It's likely just mod options.
|
2062 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_button. This means the object wasn't registered. It's likely just mod options.
|
2063 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_furnace for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_furnace. This means the object wasn't registered. It's likely just mod options.
|
2064 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_pillar. This means the object wasn't registered. It's likely just mod options.
|
2065 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_pressure_plate. This means the object wasn't registered. It's likely just mod options.
|
2066 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_rock for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_rock. This means the object wasn't registered. It's likely just mod options.
|
2067 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_slab. This means the object wasn't registered. It's likely just mod options.
|
2068 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_stairs. This means the object wasn't registered. It's likely just mod options.
|
2069 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_wall. This means the object wasn't registered. It's likely just mod options.
|
2070 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
2071 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_bricks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_bricks. This means the object wasn't registered. It's likely just mod options.
|
2072 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_bricks_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_bricks_decorative. This means the object wasn't registered. It's likely just mod options.
|
2073 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_cooler for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_cooler. This means the object wasn't registered. It's likely just mod options.
|
2074 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_ore. This means the object wasn't registered. It's likely just mod options.
|
2075 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_pillar. This means the object wasn't registered. It's likely just mod options.
|
2076 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_slab. This means the object wasn't registered. It's likely just mod options.
|
2077 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_wall. This means the object wasn't registered. It's likely just mod options.
|
2078 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:incubator for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.incubator. This means the object wasn't registered. It's likely just mod options.
|
2079 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_flower for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.irradiated_flower. This means the object wasn't registered. It's likely just mod options.
|
2080 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_beam. This means the object wasn't registered. It's likely just mod options.
|
2081 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_decorative. This means the object wasn't registered. It's likely just mod options.
|
2082 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_log. This means the object wasn't registered. It's likely just mod options.
|
2083 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_planks. This means the object wasn't registered. It's likely just mod options.
|
2084 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:magnetic_shroom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.magnetic_shroom. This means the object wasn't registered. It's likely just mod options.
|
2085 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:masonry_bench for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.masonry_bench. This means the object wasn't registered. It's likely just mod options.
|
2086 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_egg for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.moa_egg. This means the object wasn't registered. It's likely just mod options.
|
2087 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mossy_holystone_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mossy_holystone_slab. This means the object wasn't registered. It's likely just mod options.
|
2088 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mossy_holystone_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mossy_holystone_stairs. This means the object wasn't registered. It's likely just mod options.
|
2089 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mossy_holystone_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mossy_holystone_wall. This means the object wasn't registered. It's likely just mod options.
|
2090 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:multiblock_dummy for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.multiblock_dummy. This means the object wasn't registered. It's likely just mod options.
|
2091 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:multiblock_dummy_half for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.multiblock_dummy_half. This means the object wasn't registered. It's likely just mod options.
|
2092 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mutant_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mutant_leaves. This means the object wasn't registered. It's likely just mod options.
|
2093 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mutant_leaves_decorated for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mutant_leaves_decorated. This means the object wasn't registered. It's likely just mod options.
|
2094 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:neverbloom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.neverbloom. This means the object wasn't registered. It's likely just mod options.
|
2095 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange_tree for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.orange_tree. This means the object wasn't registered. It's likely just mod options.
|
2096 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:outpost_campfire for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.outpost_campfire. This means the object wasn't registered. It's likely just mod options.
|
2097 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:pink_swingtip for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.pink_swingtip. This means the object wasn't registered. It's likely just mod options.
|
2098 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.plumproot. This means the object wasn't registered. It's likely just mod options.
|
2099 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:present for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.present. This means the object wasn't registered. It's likely just mod options.
|
2100 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:quickshoot for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quickshoot. This means the object wasn't registered. It's likely just mod options.
|
2101 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil. This means the object wasn't registered. It's likely just mod options.
|
2102 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass. This means the object wasn't registered. It's likely just mod options.
|
2103 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass_decorative. This means the object wasn't registered. It's likely just mod options.
|
2104 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass_pane for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass_pane. This means the object wasn't registered. It's likely just mod options.
|
2105 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass_pane_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass_pane_decorative. This means the object wasn't registered. It's likely just mod options.
|
2106 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:rusted_ferrosite for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.rusted_ferrosite. This means the object wasn't registered. It's likely just mod options.
|
2107 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass. This means the object wasn't registered. It's likely just mod options.
|
2108 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_decorative. This means the object wasn't registered. It's likely just mod options.
|
2109 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_pane for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_pane. This means the object wasn't registered. It's likely just mod options.
|
2110 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_pane_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_pane_decorative. This means the object wasn't registered. It's likely just mod options.
|
2111 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_slab. This means the object wasn't registered. It's likely just mod options.
|
2112 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_stairs. This means the object wasn't registered. It's likely just mod options.
|
2113 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_wall. This means the object wasn't registered. It's likely just mod options.
|
2114 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_door for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.secret_skyroot_door. This means the object wasn't registered. It's likely just mod options.
|
2115 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_trapdoor for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.secret_skyroot_trapdoor. This means the object wasn't registered. It's likely just mod options.
|
2116 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick. This means the object wasn't registered. It's likely just mod options.
|
2117 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
|
2118 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_decorative_lit for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_decorative_lit. This means the object wasn't registered. It's likely just mod options.
|
2119 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_slab. This means the object wasn't registered. It's likely just mod options.
|
2120 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
2121 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_wall. This means the object wasn't registered. It's likely just mod options.
|
2122 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_pillar. This means the object wasn't registered. It's likely just mod options.
|
2123 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_pillar_lit for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_pillar_lit. This means the object wasn't registered. It's likely just mod options.
|
2124 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_beam. This means the object wasn't registered. It's likely just mod options.
|
2125 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bed for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_bed. This means the object wasn't registered. It's likely just mod options.
|
2126 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bookshelf for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_bookshelf. This means the object wasn't registered. It's likely just mod options.
|
2127 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_button. This means the object wasn't registered. It's likely just mod options.
|
2128 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_chest for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_chest. This means the object wasn't registered. It's likely just mod options.
|
2129 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_decorative. This means the object wasn't registered. It's likely just mod options.
|
2130 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_door for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_door. This means the object wasn't registered. It's likely just mod options.
|
2131 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_fence. This means the object wasn't registered. It's likely just mod options.
|
2132 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_fence_gate. This means the object wasn't registered. It's likely just mod options.
|
2133 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_ladder for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_ladder. This means the object wasn't registered. It's likely just mod options.
|
2134 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_log. This means the object wasn't registered. It's likely just mod options.
|
2135 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_log_wall. This means the object wasn't registered. It's likely just mod options.
|
2136 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_planks. This means the object wasn't registered. It's likely just mod options.
|
2137 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_pressure_plate. This means the object wasn't registered. It's likely just mod options.
|
2138 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_sapling. This means the object wasn't registered. It's likely just mod options.
|
2139 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_slab. This means the object wasn't registered. It's likely just mod options.
|
2140 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_stairs. This means the object wasn't registered. It's likely just mod options.
|
2141 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_trapdoor for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_trapdoor. This means the object wasn't registered. It's likely just mod options.
|
2142 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_twigs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_twigs. This means the object wasn't registered. It's likely just mod options.
|
2143 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:standing_skyroot_sign for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.standing_skyroot_sign. This means the object wasn't registered. It's likely just mod options.
|
2144 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:stoneshroom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.stoneshroom. This means the object wasn't registered. It's likely just mod options.
|
2145 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:tall_aether_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.tall_aether_grass. This means the object wasn't registered. It's likely just mod options.
|
2146 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:thera_dirt for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.thera_dirt. This means the object wasn't registered. It's likely just mod options.
|
2147 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:thera_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.thera_grass. This means the object wasn't registered. It's likely just mod options.
|
2148 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick. This means the object wasn't registered. It's likely just mod options.
|
2149 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
|
2150 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_slab. This means the object wasn't registered. It's likely just mod options.
|
2151 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
|
2152 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_wall. This means the object wasn't registered. It's likely just mod options.
|
2153 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_pillar. This means the object wasn't registered. It's likely just mod options.
|
2154 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_beam. This means the object wasn't registered. It's likely just mod options.
|
2155 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_decorative. This means the object wasn't registered. It's likely just mod options.
|
2156 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_fence. This means the object wasn't registered. It's likely just mod options.
|
2157 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_fence_gate. This means the object wasn't registered. It's likely just mod options.
|
2158 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_leaves. This means the object wasn't registered. It's likely just mod options.
|
2159 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_log. This means the object wasn't registered. It's likely just mod options.
|
2160 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_log_wall. This means the object wasn't registered. It's likely just mod options.
|
2161 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_planks. This means the object wasn't registered. It's likely just mod options.
|
2162 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_slab. This means the object wasn't registered. It's likely just mod options.
|
2163 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_stairs. This means the object wasn't registered. It's likely just mod options.
|
2164 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:unique_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.unique_sapling. This means the object wasn't registered. It's likely just mod options.
|
2165 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.valkyrie_grass. This means the object wasn't registered. It's likely just mod options.
|
2166 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wall_skyroot_sign for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wall_skyroot_sign. This means the object wasn't registered. It's likely just mod options.
|
2167 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wildcard for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wildcard. This means the object wasn't registered. It's likely just mod options.
|
2168 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_button. This means the object wasn't registered. It's likely just mod options.
|
2169 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_fence. This means the object wasn't registered. It's likely just mod options.
|
2170 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_fence_gate. This means the object wasn't registered. It's likely just mod options.
|
2171 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_log_wall. This means the object wasn't registered. It's likely just mod options.
|
2172 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_pressure_plate. This means the object wasn't registered. It's likely just mod options.
|
2173 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_sapling. This means the object wasn't registered. It's likely just mod options.
|
2174 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_slab. This means the object wasn't registered. It's likely just mod options.
|
2175 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_stairs. This means the object wasn't registered. It's likely just mod options.
|
2176 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:woven_sticks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.woven_sticks. This means the object wasn't registered. It's likely just mod options.
|
2177 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.zanite_block. This means the object wasn't registered. It's likely just mod options.
|
2178 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.zanite_ore. This means the object wasn't registered. It's likely just mod options.
|
2179 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_green for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGreenItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2180 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_hurt. This means the object wasn't registered. It's likely just mod options.
|
2181 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_nether_vanilla for public static org.icannt.netherendingores.common.block.blocks.BlockOreNetherVanilla org.icannt.netherendingores.common.registry.BlockRegistry.ORE_NETHER_VANILLA. This means the object wasn't registered. It's likely just mod options.
|
2182 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.trigger for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_trigger. This means the object wasn't registered. It's likely just mod options.
|
2183 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_lime for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLimeItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2184 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.labyrinth_totem.drone for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.labyrinth_totem_drone. This means the object wasn't registered. It's likely just mod options.
|
2185 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.valkyrie for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_valkyrie. This means the object wasn't registered. It's likely just mod options.
|
2186 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.puff for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_puff. This means the object wasn't registered. It's likely just mod options.
|
2187 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_end_modded_2 for public static org.icannt.netherendingores.common.block.blocks.BlockOreEndModded2 org.icannt.netherendingores.common.registry.BlockRegistry.ORE_END_MODDED_2. This means the object wasn't registered. It's likely just mod options.
|
2188 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:instanced_zone for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.INSTANCED_ZONE. This means the object wasn't registered. It's likely just mod options.
|
2189 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_nether_modded_1 for public static org.icannt.netherendingores.common.block.blocks.BlockOreNetherModded1 org.icannt.netherendingores.common.registry.BlockRegistry.ORE_NETHER_MODDED_1. This means the object wasn't registered. It's likely just mod options.
|
2190 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_blue for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlueItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2191 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_light_blue for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLightBlueBlock. This means the object wasn't registered. It's likely just mod options.
|
2192 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:block_nether_netherfish for public static org.icannt.netherendingores.common.block.blocks.BlockMonsterNetherNetherfish org.icannt.netherendingores.common.registry.BlockRegistry.BLOCK_NETHER_NETHERFISH. This means the object wasn't registered. It's likely just mod options.
|
2193 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.lift for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_lift. This means the object wasn't registered. It's likely just mod options.
|
2194 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_hurt. This means the object wasn't registered. It's likely just mod options.
|
2195 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_green for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGreenBlock. This means the object wasn't registered. It's likely just mod options.
|
2196 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_silver for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxSilverItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2197 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_death. This means the object wasn't registered. It's likely just mod options.
|
2198 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.heavy for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_heavy. This means the object wasn't registered. It's likely just mod options.
|
2199 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.aerwhale for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_aerwhale. This means the object wasn't registered. It's likely just mod options.
|
2200 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_ambient. This means the object wasn't registered. It's likely just mod options.
|
2201 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_arctic_peaks for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.ARCTIC_PEAKS. This means the object wasn't registered. It's likely just mod options.
|
2202 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_hurt. This means the object wasn't registered. It's likely just mod options.
|
2203 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:creative_tab for public static org.icannt.netherendingores.common.block.blocks.BlockCreativeTab org.icannt.netherendingores.common.registry.BlockRegistry.CREATIVE_TAB. This means the object wasn't registered. It's likely just mod options.
|
2204 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_magenta for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxMagentaItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2205 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_magenta for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxMagentaBlock. This means the object wasn't registered. It's likely just mod options.
|
2206 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_brown for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBrownBlock. This means the object wasn't registered. It's likely just mod options.
|
2207 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_death. This means the object wasn't registered. It's likely just mod options.
|
2208 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_blue for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlueBlock. This means the object wasn't registered. It's likely just mod options.
|
2209 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_black for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlackItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2210 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_forgotten_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.FORGOTTEN_HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
|
2211 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.recording_892 for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_recording_892. This means the object wasn't registered. It's likely just mod options.
|
2212 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:entity.netherfish.hurt for public static net.minecraft.util.SoundEvent org.icannt.netherendingores.common.registry.RegistryEvents.ENTITY_NETHERFISH_HURT. This means the object wasn't registered. It's likely just mod options.
|
2213 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_red for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxRedBlock. This means the object wasn't registered. It's likely just mod options.
|
2214 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_purple for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPurpleItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2215 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_white for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxWhiteItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2216 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_nether_modded_2 for public static org.icannt.netherendingores.common.block.blocks.BlockOreNetherModded2 org.icannt.netherendingores.common.registry.BlockRegistry.ORE_NETHER_MODDED_2. This means the object wasn't registered. It's likely just mod options.
|
2217 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:entity.netherfish.ambient for public static net.minecraft.util.SoundEvent org.icannt.netherendingores.common.registry.RegistryEvents.ENTITY_NETHERFISH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2218 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.electric_shock for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_electric_shock. This means the object wasn't registered. It's likely just mod options.
|
2219 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_yellow for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxYellowBlock. This means the object wasn't registered. It's likely just mod options.
|
2220 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_ambient. This means the object wasn't registered. It's likely just mod options.
|
2221 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_death. This means the object wasn't registered. It's likely just mod options.
|
2222 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_attack. This means the object wasn't registered. It's likely just mod options.
|
2223 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_death. This means the object wasn't registered. It's likely just mod options.
|
2224 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_silver for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxSilverBlock. This means the object wasn't registered. It's likely just mod options.
|
2225 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_ambient. This means the object wasn't registered. It's likely just mod options.
|
2226 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_pink for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPinkBlock. This means the object wasn't registered. It's likely just mod options.
|
2227 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_cyan for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxCyanItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2228 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_attack. This means the object wasn't registered. It's likely just mod options.
|
2229 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_lime for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLimeBlock. This means the object wasn't registered. It's likely just mod options.
|
2230 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_death. This means the object wasn't registered. It's likely just mod options.
|
2231 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_chest for public static cpw.mods.ironchest.common.blocks.chest.BlockIronChest cpw.mods.ironchest.common.core.IronChestBlocks.ironChestBlock. This means the object wasn't registered. It's likely just mod options.
|
2232 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_end_modded_1 for public static org.icannt.netherendingores.common.block.blocks.BlockOreEndModded1 org.icannt.netherendingores.common.registry.BlockRegistry.ORE_END_MODDED_1. This means the object wasn't registered. It's likely just mod options.
|
2233 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
|
2234 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.snow.wind for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_snow_wind. This means the object wasn't registered. It's likely just mod options.
|
2235 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_magnetic_hills for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.MAGNETIC_HILLS. This means the object wasn't registered. It's likely just mod options.
|
2236 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.labyrinth for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_labyrinth. This means the object wasn't registered. It's likely just mod options.
|
2237 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_red for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxRedItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2238 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_death. This means the object wasn't registered. It's likely just mod options.
|
2239 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_ambient. This means the object wasn't registered. It's likely just mod options.
|
2240 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_white for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxWhiteBlock. This means the object wasn't registered. It's likely just mod options.
|
2241 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.travel for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_travel. This means the object wasn't registered. It's likely just mod options.
|
2242 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_brown for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBrownItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2243 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_pink for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPinkItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2244 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_cyan for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxCyanBlock. This means the object wasn't registered. It's likely just mod options.
|
2245 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.light for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_light. This means the object wasn't registered. It's likely just mod options.
|
2246 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_irradiated_forests for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.IRRADIATED_FORESTS. This means the object wasn't registered. It's likely just mod options.
|
2247 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_ambient. This means the object wasn't registered. It's likely just mod options.
|
2248 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_end_vanilla for public static org.icannt.netherendingores.common.block.blocks.BlockOreEndVanilla org.icannt.netherendingores.common.registry.BlockRegistry.ORE_END_VANILLA. This means the object wasn't registered. It's likely just mod options.
|
2249 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.present_unwrap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.present_unwrap. This means the object wasn't registered. It's likely just mod options.
|
2250 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_hurt. This means the object wasn't registered. It's likely just mod options.
|
2251 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_hurt. This means the object wasn't registered. It's likely just mod options.
|
2252 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dungeon.container.smash for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.break_labyrinth_container. This means the object wasn't registered. It's likely just mod options.
|
2253 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:block.aercloud.bounce for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aercloud_bounce. This means the object wasn't registered. It's likely just mod options.
|
2254 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_gray for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGrayItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2255 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:entity.netherfish.death for public static net.minecraft.util.SoundEvent org.icannt.netherendingores.common.registry.RegistryEvents.ENTITY_NETHERFISH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2256 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_ambient. This means the object wasn't registered. It's likely just mod options.
|
2257 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_orange for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxOrangeBlock. This means the object wasn't registered. It's likely just mod options.
|
2258 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_void for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.VOID. This means the object wasn't registered. It's likely just mod options.
|
2259 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_hurt. This means the object wasn't registered. It's likely just mod options.
|
2260 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_ambient. This means the object wasn't registered. It's likely just mod options.
|
2261 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.angry for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_angry. This means the object wasn't registered. It's likely just mod options.
|
2262 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.moa for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_moa. This means the object wasn't registered. It's likely just mod options.
|
2263 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:ore_other_1 for public static org.icannt.netherendingores.common.block.blocks.BlockOreOther1 org.icannt.netherendingores.common.registry.BlockRegistry.ORE_OTHER_1. This means the object wasn't registered. It's likely just mod options.
|
2264 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_orange for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxOrangeItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2265 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_chest for public static net.minecraft.item.Item cpw.mods.ironchest.common.core.IronChestBlocks.ironChestItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2266 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_black for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlackBlock. This means the object wasn't registered. It's likely just mod options.
|
2267 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.generic.wings.flap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.generic_wing_flap. This means the object wasn't registered. It's likely just mod options.
|
2268 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_gray for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGrayBlock. This means the object wasn't registered. It's likely just mod options.
|
2269 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.hum for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_hum. This means the object wasn't registered. It's likely just mod options.
|
2270 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_yellow for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxYellowItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2271 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_light_blue for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLightBlueItemBlock. This means the object wasn't registered. It's likely just mod options.
|
2272 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dart_shooter.fire for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.dart_shooter_fire. This means the object wasn't registered. It's likely just mod options.
|
2273 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_hurt. This means the object wasn't registered. It's likely just mod options.
|
2274 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:block_end_endermite for public static org.icannt.netherendingores.common.block.blocks.BlockMonsterEndEndermite org.icannt.netherendingores.common.registry.BlockRegistry.BLOCK_END_ENDERMITE. This means the object wasn't registered. It's likely just mod options.
|
2275 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_ambient. This means the object wasn't registered. It's likely just mod options.
|
2276 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_purple for public static cpw.mods.ironchest.common.blocks.shulker.BlockIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPurpleBlock. This means the object wasn't registered. It's likely just mod options.
|
2277 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_ambient. This means the object wasn't registered. It's likely just mod options.
|
2278 | [15:22:40] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_death. This means the object wasn't registered. It's likely just mod options.
|
2279 | [15:22:40] [Server thread/INFO] [FML]: Holder lookups applied
|
2280 | [15:22:40] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod chisel
|
2281 | [15:22:40] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Chisel took 0.265s
|
2282 | [15:22:40] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod codechickenlib
|
2283 | [15:22:40] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod codechickenlib
|
2284 | [15:22:40] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - CodeChicken Lib took 0.191s
|
2285 | [15:22:40] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod customspawner
|
2286 | [15:22:41] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod customspawner
|
2287 | [15:22:41] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - DrZhark's CustomSpawner took 0.555s
|
2288 | [15:22:41] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod props
|
2289 | [15:22:41] [Server thread/TRACE] [FML]: Automatically registered mod props entity FakeChairEntity as props:chair
|
2290 | [15:22:41] [Server thread/INFO] [com.mia.craftstudio.CSPack]: Original locale was en, switching to Locale.US
|
2291 | [15:22:41] [Server thread/INFO] [com.mia.craftstudio.CSPack]: Locale is now en_US
|
2292 | [15:22:41] [Server thread/INFO] [com.mia.craftstudio.CSPack]: Locale was restored to en
|
2293 | [15:22:51] [Server thread/DEBUG] [FML]: Bar Finished: Loading models took 9.400s
|
2294 | [15:22:51] [Server thread/DEBUG] [FML]: Bar Finished: Loading models took 9.401s
|
2295 | [15:23:31] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod props
|
2296 | [15:23:31] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Decocraft took 50.265s
|
2297 | [15:23:31] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod dldungeonsjbg
|
2298 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Doomlike Dungeons is in preInit, should now load config.
|
2299 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: themesdir is /server/config/DLDungeonsJBG
|
2300 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Frequency Scaling Factor Set To: 8
|
2301 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Minimum X Factor Set To: 16
|
2302 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Difficulty set to: Normal difficulty.
|
2303 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Will spawn dungeons in with world generation? true
|
2304 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Will spawn dungeons even with structures disabled? false
|
2305 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Will export item, block, and mob lists? false
|
2306 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Will announce use of OP/cheat commands? true
|
2307 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Will dungeons be easy to find? true
|
2308 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Will dungeon all have single entrances? true
|
2309 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Will themes be automatically install if themes folder is empty? true
|
2310 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Can themes be (re)installed by command? true
|
2311 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: adding END to excusion list
|
2312 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Will use API? true
|
2313 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Will allow API base mob change? true
|
2314 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Will self-profile? false
|
2315 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: themesdir will be set to /server/config/DLDungeonsJBG/themes/
|
2316 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: themesdir File is be set to /server/config/DLDungeonsJBG/themes
|
2317 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: themesdir is /server/config/DLDungeonsJBG/themes
|
2318 | [15:23:31] [Server thread/INFO] [STDOUT]: [jaredbgreat.dldungeons.setup.Externalizer:makeChestCfg:206]: [DLDUNGEONS] Installing files /server/config/DLDungeonsJBG/chests.cfg
|
2319 | [15:23:31] [Server thread/INFO] [DLDUNGEONS]: Config should now be loaded.
|
2320 | [15:23:31] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod dldungeonsjbg
|
2321 | [15:23:31] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Doomlike Dungeons took 0.271s
|
2322 | [15:23:31] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mocreatures
|
2323 | [15:23:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mocreatures
|
2324 | [15:23:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - DrZhark's Mo'Creatures Mod took 0.210s
|
2325 | [15:23:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod enderstorage
|
2326 | [15:23:32] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ender chest`, expected `enderstorage`. This could be a intended override, but in most cases indicates a broken mod.
|
2327 | [15:23:32] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ender tank`, expected `enderstorage`. This could be a intended override, but in most cases indicates a broken mod.
|
2328 | [15:23:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod enderstorage
|
2329 | [15:23:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - EnderStorage took 0.580s
|
2330 | [15:23:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod fastfurnace
|
2331 | [15:23:32] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `furnace`, expected `fastfurnace`. This could be a intended override, but in most cases indicates a broken mod.
|
2332 | [15:23:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod fastfurnace
|
2333 | [15:23:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - FastFurnace took 0.009s
|
2334 | [15:23:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod ironchest
|
2335 | [15:23:32] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from ironchest-1.12.2-7.0.72.847.jar to locate a version number for mod ironchest
|
2336 | [15:23:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod ironchest
|
2337 | [15:23:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Iron Chest took 0.048s
|
2338 | [15:23:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod lunatriuscore
|
2339 | [15:23:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod lunatriuscore
|
2340 | [15:23:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - LunatriusCore took 0.005s
|
2341 | [15:23:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod netherendingores
|
2342 | [15:23:32] [Server thread/TRACE] [FML]: Automatically registered mod netherendingores entity netherfish as netherendingores:netherfish
|
2343 | [15:23:32] [Server thread/TRACE] [FML]: Automatically registered mod netherendingores entity primedOre as netherendingores:primedore
|
2344 | [15:23:32] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod netherendingores
|
2345 | [15:23:32] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Netherending Ores took 0.149s
|
2346 | [15:23:32] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod nei
|
2347 | [15:23:33] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod nei
|
2348 | [15:23:33] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Not Enough Items took 0.139s
|
2349 | [15:23:33] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod placebo
|
2350 | [15:23:33] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod placebo
|
2351 | [15:23:33] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Placebo took 0.027s
|
2352 | [15:23:33] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod schematica
|
2353 | [15:23:33] [Server thread/DEBUG] [schematica]: Schematic path: /server/schematics
|
2354 | [15:23:33] [Server thread/DEBUG] [schematica]: Data path: /server
|
2355 | [15:23:33] [Server thread/DEBUG] [schematica]: New schematic path: ./schematics
|
2356 | [15:23:33] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod schematica
|
2357 | [15:23:33] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Schematica took 0.111s
|
2358 | [15:23:33] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod schematics
|
2359 | [15:23:33] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod schematics
|
2360 | [15:23:33] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Schematics took 0.127s
|
2361 | [15:23:33] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod undergroundbiomes
|
2362 | [15:23:33] [Server thread/INFO] [undergroundbiomes]: [UndergroundBiomes] Start Pre-init!
|
2363 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [CommonProxy] Start preInit
|
2364 | [15:23:33] [Server thread/INFO] [undergroundbiomes]: [UBConfig] Loading configuration
|
2365 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property CrashOnProblems initialized with value false
|
2366 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Realistic initialized with value false
|
2367 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyRecipes initialized with value true
|
2368 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyOres initialized with value true
|
2369 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property RegularStoneCrafting initialized with value 4
|
2370 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property HarnessModifier initialized with value 1.0
|
2371 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ResistanceModifier initialized with value 1.0
|
2372 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property BiomeSize initialized with value 4
|
2373 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property GenerationHeight initialized with value 256
|
2374 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property RegularStoneBiomes initialized with value false
|
2375 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property HarmoniousStrata initialized with value false
|
2376 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property IncludedDimensions initialized with value *
|
2377 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ExcludedDimensions initialized with value -1,1
|
2378 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DimensionSpecificSeeds initialized with value false
|
2379 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyVillages initialized with value true
|
2380 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceCobblestone initialized with value true
|
2381 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceMonsterStone initialized with value true
|
2382 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceOvergrown initialized with value true
|
2383 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceMossyCobble initialized with value true
|
2384 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceQuarkSpeleothems initialized with value true
|
2385 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceGravel initialized with value true
|
2386 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSand initialized with value true
|
2387 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSandstone initialized with value true
|
2388 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceClay initialized with value true
|
2389 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSandExcludedBiomes initialized with value minecraft:beaches,minecraft:desert,minecraft:cold_beach,minecraft:desert_hills,biomesoplenty:oasis
|
2390 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceGravelExcludedBiomes initialized with value biomesoplenty:cold_desert
|
2391 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceClayExcludedBiomes initialized with value
|
2392 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property PlainSlabTextures initialized with value false
|
2393 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtons initialized with value true
|
2394 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtonsTypes initialized with value 7
|
2395 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtonsStyles initialized with value 3
|
2396 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairs initialized with value true
|
2397 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairsTypes initialized with value 7
|
2398 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairsStyles initialized with value 7
|
2399 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWalls initialized with value true
|
2400 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWallsTypes initialized with value 7
|
2401 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWallsStyles initialized with value 7
|
2402 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ChangeButtonRecipe initialized with value 8
|
2403 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DisableVanillaStoneVariants initialized with value false
|
2404 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DisplayOriginalModInOreTooltip initialized with value true
|
2405 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextBefore initialized with value Ore from
|
2406 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextBeforeFormatting initialized with value gray
|
2407 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipOreModNameFormatting initialized with value gold italic
|
2408 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextAfter initialized with value
|
2409 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextAfterFormatting initialized with value gray
|
2410 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property CustomOreHardness initialized with value null
|
2411 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 0, limestone initialized with value true
|
2412 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 1, chalk initialized with value true
|
2413 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 2, shale initialized with value true
|
2414 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 3, siltstone initialized with value true
|
2415 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 4, lignite initialized with value true
|
2416 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 5, dolomite initialized with value true
|
2417 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 6, greywacke initialized with value true
|
2418 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 7, chert initialized with value true
|
2419 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 0, red_granite initialized with value true
|
2420 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 1, black_granite initialized with value true
|
2421 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 2, rhyolite initialized with value true
|
2422 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 3, andesite initialized with value true
|
2423 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 4, gabbro initialized with value true
|
2424 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 5, basalt initialized with value true
|
2425 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 6, komatiite initialized with value true
|
2426 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 7, dacite initialized with value true
|
2427 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.stone, metadata 0 initialized with value true
|
2428 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 0, gneiss initialized with value true
|
2429 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 1, eclogite initialized with value true
|
2430 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 2, marble initialized with value true
|
2431 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 3, quartzite initialized with value true
|
2432 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 4, blueschist initialized with value true
|
2433 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 5, greenschist initialized with value true
|
2434 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 6, soapstone initialized with value true
|
2435 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 7, migmatite initialized with value true
|
2436 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.sand, metadata 0 initialized with value true
|
2437 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.sandStone, metadata 0 initialized with value true
|
2438 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
2439 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesWallsStyles = 2
|
2440 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
2441 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesButtonsStyles = 1
|
2442 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
2443 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesStairsStyles = 6
|
2444 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
2445 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> DisableVanillaStoneVariants = true
|
2446 | [15:23:33] [Server thread/INFO] [undergroundbiomes]: [UBConfig] Loading configuration
|
2447 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property CrashOnProblems initialized with value false
|
2448 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Realistic initialized with value false
|
2449 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyRecipes initialized with value true
|
2450 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyOres initialized with value true
|
2451 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property RegularStoneCrafting initialized with value 4
|
2452 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property HarnessModifier initialized with value 1.0
|
2453 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ResistanceModifier initialized with value 1.0
|
2454 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property BiomeSize initialized with value 4
|
2455 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property GenerationHeight initialized with value 256
|
2456 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property RegularStoneBiomes initialized with value false
|
2457 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property HarmoniousStrata initialized with value false
|
2458 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property IncludedDimensions initialized with value *
|
2459 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ExcludedDimensions initialized with value -1,1
|
2460 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DimensionSpecificSeeds initialized with value false
|
2461 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyVillages initialized with value true
|
2462 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceCobblestone initialized with value true
|
2463 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceMonsterStone initialized with value true
|
2464 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceOvergrown initialized with value true
|
2465 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceMossyCobble initialized with value true
|
2466 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceQuarkSpeleothems initialized with value true
|
2467 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceGravel initialized with value true
|
2468 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSand initialized with value true
|
2469 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSandstone initialized with value true
|
2470 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceClay initialized with value true
|
2471 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSandExcludedBiomes initialized with value minecraft:beaches,minecraft:desert,minecraft:cold_beach,minecraft:desert_hills,biomesoplenty:oasis
|
2472 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceGravelExcludedBiomes initialized with value biomesoplenty:cold_desert
|
2473 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceClayExcludedBiomes initialized with value
|
2474 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property PlainSlabTextures initialized with value false
|
2475 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtons initialized with value true
|
2476 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtonsTypes initialized with value 7
|
2477 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtonsStyles initialized with value 3
|
2478 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairs initialized with value true
|
2479 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairsTypes initialized with value 7
|
2480 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairsStyles initialized with value 7
|
2481 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWalls initialized with value true
|
2482 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWallsTypes initialized with value 7
|
2483 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWallsStyles initialized with value 7
|
2484 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ChangeButtonRecipe initialized with value 8
|
2485 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DisableVanillaStoneVariants initialized with value false
|
2486 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DisplayOriginalModInOreTooltip initialized with value true
|
2487 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextBefore initialized with value Ore from
|
2488 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextBeforeFormatting initialized with value gray
|
2489 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipOreModNameFormatting initialized with value gold italic
|
2490 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextAfter initialized with value
|
2491 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextAfterFormatting initialized with value gray
|
2492 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property CustomOreHardness initialized with value null
|
2493 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.sand, metadata 0 initialized with value true
|
2494 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.stone, metadata 0 initialized with value true
|
2495 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 0, limestone initialized with value true
|
2496 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 1, chalk initialized with value true
|
2497 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 2, shale initialized with value true
|
2498 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 3, siltstone initialized with value true
|
2499 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 4, lignite initialized with value true
|
2500 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 5, dolomite initialized with value true
|
2501 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 6, greywacke initialized with value true
|
2502 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 7, chert initialized with value true
|
2503 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 0, red_granite initialized with value true
|
2504 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 1, black_granite initialized with value true
|
2505 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 2, rhyolite initialized with value true
|
2506 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 3, andesite initialized with value true
|
2507 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 4, gabbro initialized with value true
|
2508 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 5, basalt initialized with value true
|
2509 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 6, komatiite initialized with value true
|
2510 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 7, dacite initialized with value true
|
2511 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 0, gneiss initialized with value true
|
2512 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 1, eclogite initialized with value true
|
2513 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 2, marble initialized with value true
|
2514 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 3, quartzite initialized with value true
|
2515 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 4, blueschist initialized with value true
|
2516 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 5, greenschist initialized with value true
|
2517 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 6, soapstone initialized with value true
|
2518 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 7, migmatite initialized with value true
|
2519 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.sandStone, metadata 0 initialized with value true
|
2520 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
2521 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesWallsStyles = 2
|
2522 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
2523 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesButtonsStyles = 1
|
2524 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
2525 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesStairsStyles = 6
|
2526 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
2527 | [15:23:33] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> DisableVanillaStoneVariants = true
|
2528 | [15:23:34] [Server thread/INFO] [undergroundbiomes]: [UndergroundBiomes] Pre-init done!
|
2529 | [15:23:34] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod undergroundbiomes
|
2530 | [15:23:34] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Underground Biomes took 0.803s
|
2531 | [15:23:34] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod phosphor-lighting
|
2532 | [15:23:34] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod phosphor-lighting
|
2533 | [15:23:34] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Phosphor Lighting Engine took 0.000s
|
2534 | [15:23:34] [Server thread/DEBUG] [FML]: Bar Finished: PreInitialization took 73.992s
|
2535 | [15:23:53] [Server thread/INFO] [Chisel]: Loading blocks...
|
2536 | [15:23:53] [Server thread/INFO] [Chisel]: Skipping feature arcaneStone as its required mod thaumcraft was missing.
|
2537 | [15:23:53] [Server thread/INFO] [Chisel]: Skipping feature bloodMagic as its required mod bloodmagic was missing.
|
2538 | [15:23:53] [Server thread/INFO] [Chisel]: Skipping feature certus as its required mod appliedenergistics2 was missing.
|
2539 | [15:24:03] [Server thread/INFO] [Chisel]: 72 Feature's blocks loaded.
|
2540 | [15:24:03] [Server thread/INFO] [Chisel]: Loading Tile Entities...
|
2541 | [15:24:03] [Server thread/INFO] [Chisel]: Tile Entities loaded.
|
2542 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.iron`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2543 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.gold`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2544 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.diamond`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2545 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.copper`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2546 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.silver`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2547 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.crystal`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2548 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.obsidian`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2549 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironchest.dirtchest9000`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2550 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.iron`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2551 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.gold`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2552 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.diamond`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2553 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.copper`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2554 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.silver`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2555 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.crystal`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2556 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ironshulkerbox.obsidian`, expected `ironchest`. This could be a intended override, but in most cases indicates a broken mod.
|
2557 | [15:24:03] [Server thread/DEBUG] [Netherending Ores]: Registering Blocks
|
2558 | [15:24:03] [Server thread/INFO] [Netherending Ores]: Registered Blocks
|
2559 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `schem_block_te`, expected `schematics`. This could be a intended override, but in most cases indicates a broken mod.
|
2560 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `furnace`, expected `fastfurnace`. This could be a intended override, but in most cases indicates a broken mod.
|
2561 | [15:24:03] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `lit_furnace`, expected `fastfurnace`. This could be a intended override, but in most cases indicates a broken mod.
|
2562 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [OresRegistry] Request for 'minecraft:coal_ore:-1' to be UBfied added.
|
2563 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [OresRegistry] Request for 'minecraft:iron_ore:-1' to be UBfied added.
|
2564 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [OresRegistry] Request for 'minecraft:diamond_ore:-1' to be UBfied added.
|
2565 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [OresRegistry] Request for 'minecraft:emerald_ore:-1' to be UBfied added.
|
2566 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [OresRegistry] Request for 'minecraft:gold_ore:-1' to be UBfied added.
|
2567 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [OresRegistry] Request for 'minecraft:lapis_ore:-1' to be UBfied added.
|
2568 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [OresRegistry] Request for 'minecraft:redstone_ore:-1' to be UBfied added.
|
2569 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [CommonProxy] Start registering blocks
|
2570 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2571 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2572 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_stone' for entry 'igneous_stone'
|
2573 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2574 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2575 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_monster_stone' for entry 'igneous_monster_stone'
|
2576 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2577 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2578 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_cobble' for entry 'igneous_cobble'
|
2579 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2580 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2581 | [15:24:03] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_brick' for entry 'igneous_brick'
|
2582 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2583 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2584 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_overgrown' for entry 'igneous_overgrown'
|
2585 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2586 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2587 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_overgrown_snowed' for entry 'igneous_overgrown_snowed'
|
2588 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2589 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2590 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_cobble_mossy' for entry 'igneous_cobble_mossy'
|
2591 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2592 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2593 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_stone' for entry 'metamorphic_stone'
|
2594 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2595 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2596 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_monster_stone' for entry 'metamorphic_monster_stone'
|
2597 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2598 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2599 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_cobble' for entry 'metamorphic_cobble'
|
2600 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2601 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2602 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_brick' for entry 'metamorphic_brick'
|
2603 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2604 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2605 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_overgrown' for entry 'metamorphic_overgrown'
|
2606 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2607 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2608 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_overgrown_snowed' for entry 'metamorphic_overgrown_snowed'
|
2609 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2610 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2611 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_cobble_mossy' for entry 'metamorphic_cobble_mossy'
|
2612 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2613 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2614 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_stone' for entry 'sedimentary_stone'
|
2615 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2616 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2617 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_monster_stone' for entry 'sedimentary_monster_stone'
|
2618 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2619 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2620 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_overgrown' for entry 'sedimentary_overgrown'
|
2621 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2622 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2623 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_overgrown_snowed' for entry 'sedimentary_overgrown_snowed'
|
2624 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2625 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2626 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_stone_mossy' for entry 'sedimentary_stone_mossy'
|
2627 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2628 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2629 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_gravel' for entry 'igneous_gravel'
|
2630 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2631 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2632 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_gravel' for entry 'metamorphic_gravel'
|
2633 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2634 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2635 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_gravel' for entry 'sedimentary_gravel'
|
2636 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2637 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2638 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_sand' for entry 'igneous_sand'
|
2639 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2640 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2641 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_sand' for entry 'metamorphic_sand'
|
2642 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2643 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2644 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_sand' for entry 'sedimentary_sand'
|
2645 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2646 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2647 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_sandstone' for entry 'igneous_sandstone'
|
2648 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2649 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2650 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_sandstone' for entry 'metamorphic_sandstone'
|
2651 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2652 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2653 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_sandstone' for entry 'sedimentary_sandstone'
|
2654 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2655 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2656 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_sandstone_smooth' for entry 'igneous_sandstone_smooth'
|
2657 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2658 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2659 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_sandstone_smooth' for entry 'metamorphic_sandstone_smooth'
|
2660 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2661 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2662 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_sandstone_smooth' for entry 'sedimentary_sandstone_smooth'
|
2663 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2664 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2665 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_sandstone_chiseled' for entry 'igneous_sandstone_chiseled'
|
2666 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2667 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2668 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_sandstone_chiseled' for entry 'metamorphic_sandstone_chiseled'
|
2669 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2670 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2671 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_sandstone_chiseled' for entry 'sedimentary_sandstone_chiseled'
|
2672 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2673 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2674 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_clay' for entry 'igneous_clay'
|
2675 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2676 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2677 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_clay' for entry 'metamorphic_clay'
|
2678 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property HarnessModifier
|
2679 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ResistanceModifier
|
2680 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_clay' for entry 'sedimentary_clay'
|
2681 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'igneous_brick'
|
2682 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'metamorphic_brick'
|
2683 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'igneous_stone'
|
2684 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'metamorphic_stone'
|
2685 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'igneous_cobble'
|
2686 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'metamorphic_cobble'
|
2687 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'sedimentary_stone'
|
2688 | [15:24:04] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_stone_button' for entry 'igneous_stone_button'
|
2689 | [15:24:05] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_cobble_button' for entry 'igneous_cobble_button'
|
2690 | [15:24:05] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_stone_button' for entry 'metamorphic_stone_button'
|
2691 | [15:24:05] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_cobble_button' for entry 'metamorphic_cobble_button'
|
2692 | [15:24:05] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_stone_button' for entry 'sedimentary_stone_button'
|
2693 | [15:24:05] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_stone_wall' for entry 'igneous_stone_wall'
|
2694 | [15:24:05] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_cobble_wall' for entry 'igneous_cobble_wall'
|
2695 | [15:24:05] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_brick_wall' for entry 'igneous_brick_wall'
|
2696 | [15:24:05] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_stone_wall' for entry 'metamorphic_stone_wall'
|
2697 | [15:24:06] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_cobble_wall' for entry 'metamorphic_cobble_wall'
|
2698 | [15:24:06] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_brick_wall' for entry 'metamorphic_brick_wall'
|
2699 | [15:24:06] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_stone_wall' for entry 'sedimentary_stone_wall'
|
2700 | [15:24:17] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'igneous_stone_stairs'
|
2701 | [15:24:18] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'igneous_cobble_stairs'
|
2702 | [15:24:18] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'igneous_brick_stairs'
|
2703 | [15:24:19] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'metamorphic_stone_stairs'
|
2704 | [15:24:19] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'metamorphic_cobble_stairs'
|
2705 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'metamorphic_brick_stairs'
|
2706 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'null' for entry 'sedimentary_stone_stairs'
|
2707 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_stone_coal_ore' for entry 'igneous_stone_coal_ore'
|
2708 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_stone_coal_ore' for entry 'metamorphic_stone_coal_ore'
|
2709 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_stone_coal_ore' for entry 'sedimentary_stone_coal_ore'
|
2710 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_stone_diamond_ore' for entry 'igneous_stone_diamond_ore'
|
2711 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_stone_diamond_ore' for entry 'metamorphic_stone_diamond_ore'
|
2712 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_stone_diamond_ore' for entry 'sedimentary_stone_diamond_ore'
|
2713 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_stone_emerald_ore' for entry 'igneous_stone_emerald_ore'
|
2714 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_stone_emerald_ore' for entry 'metamorphic_stone_emerald_ore'
|
2715 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_stone_emerald_ore' for entry 'sedimentary_stone_emerald_ore'
|
2716 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_stone_gold_ore' for entry 'igneous_stone_gold_ore'
|
2717 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_stone_gold_ore' for entry 'metamorphic_stone_gold_ore'
|
2718 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_stone_gold_ore' for entry 'sedimentary_stone_gold_ore'
|
2719 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_stone_redstone_ore' for entry 'igneous_stone_redstone_ore'
|
2720 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_stone_redstone_ore' for entry 'metamorphic_stone_redstone_ore'
|
2721 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_stone_redstone_ore' for entry 'sedimentary_stone_redstone_ore'
|
2722 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_stone_lapis_ore' for entry 'igneous_stone_lapis_ore'
|
2723 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_stone_lapis_ore' for entry 'metamorphic_stone_lapis_ore'
|
2724 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_stone_lapis_ore' for entry 'sedimentary_stone_lapis_ore'
|
2725 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:igneous_stone_iron_ore' for entry 'igneous_stone_iron_ore'
|
2726 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:metamorphic_stone_iron_ore' for entry 'metamorphic_stone_iron_ore'
|
2727 | [15:24:20] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering 'undergroundbiomes:sedimentary_stone_iron_ore' for entry 'sedimentary_stone_iron_ore'
|
2728 | [15:24:20] [Server thread/INFO] [FML]: Applying holder lookups
|
2729 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2730 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2731 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
|
2732 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2733 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
|
2734 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
|
2735 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
|
2736 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
|
2737 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
|
2738 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
|
2739 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
|
2740 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2741 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
|
2742 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2743 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
|
2744 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2745 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2746 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
|
2747 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
|
2748 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
|
2749 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
|
2750 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
2751 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2752 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2753 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
|
2754 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2755 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
|
2756 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2757 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
|
2758 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2759 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2760 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
|
2761 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2762 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
2763 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2764 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2765 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
|
2766 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2767 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2768 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
|
2769 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2770 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2771 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2772 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
|
2773 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
|
2774 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
|
2775 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
|
2776 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
2777 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
|
2778 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
|
2779 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
|
2780 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
2781 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
|
2782 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
|
2783 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
|
2784 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
2785 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2786 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
2787 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
|
2788 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2789 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
|
2790 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
|
2791 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
2792 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
|
2793 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2794 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
|
2795 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
|
2796 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
|
2797 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
|
2798 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
|
2799 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
|
2800 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
|
2801 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2802 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
2803 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
2804 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
2805 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
|
2806 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
2807 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2808 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
2809 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
|
2810 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
2811 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
2812 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
2813 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
2814 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
2815 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
2816 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2817 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
2818 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
2819 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2820 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
2821 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
2822 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
|
2823 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
|
2824 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
|
2825 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
2826 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
|
2827 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
|
2828 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
|
2829 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
|
2830 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
|
2831 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2832 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
2833 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2834 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
2835 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
|
2836 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
2837 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2838 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2839 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
2840 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2841 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2842 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
|
2843 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2844 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
2845 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2846 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
|
2847 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2848 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
|
2849 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
|
2850 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2851 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2852 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
|
2853 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2854 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2855 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
2856 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2857 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
|
2858 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2859 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
|
2860 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
|
2861 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2862 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
2863 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2864 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
|
2865 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
|
2866 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
|
2867 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
|
2868 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2869 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
|
2870 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2871 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
2872 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2873 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
|
2874 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
|
2875 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2876 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
2877 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2878 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
2879 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
2880 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
2881 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
2882 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2883 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2884 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2885 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
2886 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2887 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
|
2888 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
2889 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
2890 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
|
2891 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
2892 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
|
2893 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:aechor_petal for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aechor_petal. This means the object wasn't registered. It's likely just mod options.
|
2894 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:aerwhale_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aerwhale_music_disc. This means the object wasn't registered. It's likely just mod options.
|
2895 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_saddle for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aether_saddle. This means the object wasn't registered. It's likely just mod options.
|
2896 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:antitoxin_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.antitoxin_vial. This means the object wasn't registered. It's likely just mod options.
|
2897 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:antivenom_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.antivenom_vial. This means the object wasn't registered. It's likely just mod options.
|
2898 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_chunk for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ambrosium_chunk. This means the object wasn't registered. It's likely just mod options.
|
2899 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_shard for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ambrosium_shard. This means the object wasn't registered. It's likely just mod options.
|
2900 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium. This means the object wasn't registered. It's likely just mod options.
|
2901 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_axe. This means the object wasn't registered. It's likely just mod options.
|
2902 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_boots. This means the object wasn't registered. It's likely just mod options.
|
2903 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_chestplate. This means the object wasn't registered. It's likely just mod options.
|
2904 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_crossbow. This means the object wasn't registered. It's likely just mod options.
|
2905 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_door_item. This means the object wasn't registered. It's likely just mod options.
|
2906 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_gloves. This means the object wasn't registered. It's likely just mod options.
|
2907 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_helmet. This means the object wasn't registered. It's likely just mod options.
|
2908 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_leggings. This means the object wasn't registered. It's likely just mod options.
|
2909 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
2910 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shears for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shears. This means the object wasn't registered. It's likely just mod options.
|
2911 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shield. This means the object wasn't registered. It's likely just mod options.
|
2912 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shovel. This means the object wasn't registered. It's likely just mod options.
|
2913 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_strip for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_strip. This means the object wasn't registered. It's likely just mod options.
|
2914 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_sword. This means the object wasn't registered. It's likely just mod options.
|
2915 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:bandage for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.bandage. This means the object wasn't registered. It's likely just mod options.
|
2916 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.blueberries. This means the object wasn't registered. It's likely just mod options.
|
2917 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberry_lollipop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.blueberry_lollipop. This means the object wasn't registered. It's likely just mod options.
|
2918 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:bolt for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.bolt. This means the object wasn't registered. It's likely just mod options.
|
2919 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_cane for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_cane. This means the object wasn't registered. It's likely just mod options.
|
2920 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_grass for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_grass. This means the object wasn't registered. It's likely just mod options.
|
2921 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_rope for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_rope. This means the object wasn't registered. It's likely just mod options.
|
2922 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt. This means the object wasn't registered. It's likely just mod options.
|
2923 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_boots. This means the object wasn't registered. It's likely just mod options.
|
2924 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_chestplate. This means the object wasn't registered. It's likely just mod options.
|
2925 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_gloves. This means the object wasn't registered. It's likely just mod options.
|
2926 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_helmet. This means the object wasn't registered. It's likely just mod options.
|
2927 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_leggings. This means the object wasn't registered. It's likely just mod options.
|
2928 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_rib_cut for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_rib_cut. This means the object wasn't registered. It's likely just mod options.
|
2929 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_ribs for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_ribs. This means the object wasn't registered. It's likely just mod options.
|
2930 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.candy_cane. This means the object wasn't registered. It's likely just mod options.
|
2931 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_corn for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.candy_corn. This means the object wasn't registered. It's likely just mod options.
|
2932 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloud_parachute for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cloud_parachute. This means the object wasn't registered. It's likely just mod options.
|
2933 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudtwine for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cloudtwine. This means the object wasn't registered. It's likely just mod options.
|
2934 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:cockatrice_feather for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cockatrice_feather. This means the object wasn't registered. It's likely just mod options.
|
2935 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:cocoatrice for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cocoatrice. This means the object wasn't registered. It's likely just mod options.
|
2936 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_shard for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.crude_scatterglass_shard. This means the object wasn't registered. It's likely just mod options.
|
2937 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:dart for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.dart. This means the object wasn't registered. It's likely just mod options.
|
2938 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:dart_shooter for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.dart_shooter. This means the object wasn't registered. It's likely just mod options.
|
2939 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:eggnog for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.eggnog. This means the object wasn't registered. It's likely just mod options.
|
2940 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:enchanted_blueberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.enchanted_blueberry. This means the object wasn't registered. It's likely just mod options.
|
2941 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:enchanted_wyndberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.enchanted_wyndberry. This means the object wasn't registered. It's likely just mod options.
|
2942 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:fried_moa_egg for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.fried_moa_egg. This means the object wasn't registered. It's likely just mod options.
|
2943 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:ginger_bread_man for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ginger_bread_man. This means the object wasn't registered. It's likely just mod options.
|
2944 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:golden_amber for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.golden_amber. This means the object wasn't registered. It's likely just mod options.
|
2945 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_axe. This means the object wasn't registered. It's likely just mod options.
|
2946 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_boots. This means the object wasn't registered. It's likely just mod options.
|
2947 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_chestplate. This means the object wasn't registered. It's likely just mod options.
|
2948 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_crossbow. This means the object wasn't registered. It's likely just mod options.
|
2949 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_gloves. This means the object wasn't registered. It's likely just mod options.
|
2950 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_helmet. This means the object wasn't registered. It's likely just mod options.
|
2951 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_leggings. This means the object wasn't registered. It's likely just mod options.
|
2952 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
2953 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_plate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_plate. This means the object wasn't registered. It's likely just mod options.
|
2954 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_shield. This means the object wasn't registered. It's likely just mod options.
|
2955 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_shovel. This means the object wasn't registered. It's likely just mod options.
|
2956 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_sword. This means the object wasn't registered. It's likely just mod options.
|
2957 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:healing_stone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.healing_stone. This means the object wasn't registered. It's likely just mod options.
|
2958 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:healing_stone_depleted for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.healing_stone_depleted. This means the object wasn't registered. It's likely just mod options.
|
2959 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_axe. This means the object wasn't registered. It's likely just mod options.
|
2960 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_crossbow. This means the object wasn't registered. It's likely just mod options.
|
2961 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
2962 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_shield. This means the object wasn't registered. It's likely just mod options.
|
2963 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_shovel. This means the object wasn't registered. It's likely just mod options.
|
2964 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_sword. This means the object wasn't registered. It's likely just mod options.
|
2965 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.icestone. This means the object wasn't registered. It's likely just mod options.
|
2966 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_poprocks for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.icestone_poprocks. This means the object wasn't registered. It's likely just mod options.
|
2967 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_armor for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_armor. This means the object wasn't registered. It's likely just mod options.
|
2968 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_charm for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_charm. This means the object wasn't registered. It's likely just mod options.
|
2969 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_chunk for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_chunk. This means the object wasn't registered. It's likely just mod options.
|
2970 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_dust for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_dust. This means the object wasn't registered. It's likely just mod options.
|
2971 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_neckwear for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_neckwear. This means the object wasn't registered. It's likely just mod options.
|
2972 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_ring for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_ring. This means the object wasn't registered. It's likely just mod options.
|
2973 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_sword. This means the object wasn't registered. It's likely just mod options.
|
2974 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_tool for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_tool. This means the object wasn't registered. It's likely just mod options.
|
2975 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:jelly_plumproot for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.jelly_plumproot. This means the object wasn't registered. It's likely just mod options.
|
2976 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:kirrid_cutlet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.kirrid_cutlet. This means the object wasn't registered. It's likely just mod options.
|
2977 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:kirrid_loin for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.kirrid_loin. This means the object wasn't registered. It's likely just mod options.
|
2978 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:labyrinth_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.labyrinth_music_disc. This means the object wasn't registered. It's likely just mod options.
|
2979 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_egg_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_egg_item. This means the object wasn't registered. It's likely just mod options.
|
2980 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feather for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feather. This means the object wasn't registered. It's likely just mod options.
|
2981 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed. This means the object wasn't registered. It's likely just mod options.
|
2982 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed_blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed_blueberries. This means the object wasn't registered. It's likely just mod options.
|
2983 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed_enchanted_blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed_enchanted_blueberries. This means the object wasn't registered. It's likely just mod options.
|
2984 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_music_disc. This means the object wasn't registered. It's likely just mod options.
|
2985 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.orange. This means the object wasn't registered. It's likely just mod options.
|
2986 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange_lollipop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.orange_lollipop. This means the object wasn't registered. It's likely just mod options.
|
2987 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot_mash for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.plumproot_mash. This means the object wasn't registered. It's likely just mod options.
|
2988 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot_pie for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.plumproot_pie. This means the object wasn't registered. It's likely just mod options.
|
2989 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:rainbow_moa_egg for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.rainbow_moa_egg. This means the object wasn't registered. It's likely just mod options.
|
2990 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:raw_taegore_meat for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.raw_taegore_meat. This means the object wasn't registered. It's likely just mod options.
|
2991 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:recording_892 for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.recording_892. This means the object wasn't registered. It's likely just mod options.
|
2992 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.scatterglass_vial. This means the object wasn't registered. It's likely just mod options.
|
2993 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.secret_skyroot_door_item. This means the object wasn't registered. It's likely just mod options.
|
2994 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:shard_of_life for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.shard_of_life. This means the object wasn't registered. It's likely just mod options.
|
2995 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_axe. This means the object wasn't registered. It's likely just mod options.
|
2996 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bed_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_bed_item. This means the object wasn't registered. It's likely just mod options.
|
2997 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_bucket. This means the object wasn't registered. It's likely just mod options.
|
2998 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_crossbow. This means the object wasn't registered. It's likely just mod options.
|
2999 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_door_item. This means the object wasn't registered. It's likely just mod options.
|
3000 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_lizard_stick for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_lizard_stick. This means the object wasn't registered. It's likely just mod options.
|
3001 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_lizard_stick_roasted for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_lizard_stick_roasted. This means the object wasn't registered. It's likely just mod options.
|
3002 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_milk_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_milk_bucket. This means the object wasn't registered. It's likely just mod options.
|
3003 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
3004 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pinecone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_pinecone. This means the object wasn't registered. It's likely just mod options.
|
3005 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_poison_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_poison_bucket. This means the object wasn't registered. It's likely just mod options.
|
3006 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_shield. This means the object wasn't registered. It's likely just mod options.
|
3007 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_shovel. This means the object wasn't registered. It's likely just mod options.
|
3008 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sign for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_sign. This means the object wasn't registered. It's likely just mod options.
|
3009 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_stick for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_stick. This means the object wasn't registered. It's likely just mod options.
|
3010 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_sword. This means the object wasn't registered. It's likely just mod options.
|
3011 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_water_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_water_bucket. This means the object wasn't registered. It's likely just mod options.
|
3012 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:splint for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.splint. This means the object wasn't registered. It's likely just mod options.
|
3013 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:stomper_pop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.stomper_pop. This means the object wasn't registered. It's likely just mod options.
|
3014 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_gel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_gel. This means the object wasn't registered. It's likely just mod options.
|
3015 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_jelly for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_jelly. This means the object wasn't registered. It's likely just mod options.
|
3016 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_sugar for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_sugar. This means the object wasn't registered. It's likely just mod options.
|
3017 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide. This means the object wasn't registered. It's likely just mod options.
|
3018 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_boots. This means the object wasn't registered. It's likely just mod options.
|
3019 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_chestplate. This means the object wasn't registered. It's likely just mod options.
|
3020 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_gloves. This means the object wasn't registered. It's likely just mod options.
|
3021 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_helmet. This means the object wasn't registered. It's likely just mod options.
|
3022 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_leggings. This means the object wasn't registered. It's likely just mod options.
|
3023 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_steak for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_steak. This means the object wasn't registered. It's likely just mod options.
|
3024 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_music_disc. This means the object wasn't registered. It's likely just mod options.
|
3025 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_tea for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_tea. This means the object wasn't registered. It's likely just mod options.
|
3026 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_wings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_wings. This means the object wasn't registered. It's likely just mod options.
|
3027 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:water_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.water_vial. This means the object wasn't registered. It's likely just mod options.
|
3028 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:winter_hat for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.winter_hat. This means the object wasn't registered. It's likely just mod options.
|
3029 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:wrapped_chocolates for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wrapped_chocolates. This means the object wasn't registered. It's likely just mod options.
|
3030 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:wrapping_paper for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wrapping_paper. This means the object wasn't registered. It's likely just mod options.
|
3031 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:wyndberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wyndberry. This means the object wasn't registered. It's likely just mod options.
|
3032 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:yule_log for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.yule_log. This means the object wasn't registered. It's likely just mod options.
|
3033 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_axe. This means the object wasn't registered. It's likely just mod options.
|
3034 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_boots. This means the object wasn't registered. It's likely just mod options.
|
3035 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_chestplate. This means the object wasn't registered. It's likely just mod options.
|
3036 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_crossbow. This means the object wasn't registered. It's likely just mod options.
|
3037 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_gemstone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_gemstone. This means the object wasn't registered. It's likely just mod options.
|
3038 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_gloves. This means the object wasn't registered. It's likely just mod options.
|
3039 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_helmet. This means the object wasn't registered. It's likely just mod options.
|
3040 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_leggings. This means the object wasn't registered. It's likely just mod options.
|
3041 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_pickaxe. This means the object wasn't registered. It's likely just mod options.
|
3042 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_shield. This means the object wasn't registered. It's likely just mod options.
|
3043 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_shovel. This means the object wasn't registered. It's likely just mod options.
|
3044 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_sword. This means the object wasn't registered. It's likely just mod options.
|
3045 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_iron for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_iron. This means the object wasn't registered. It's likely just mod options.
|
3046 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_diamond for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_diamond. This means the object wasn't registered. It's likely just mod options.
|
3047 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_hitech for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_hitech. This means the object wasn't registered. It's likely just mod options.
|
3048 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup chisel:offsettool for public static team.chisel.common.item.ItemOffsetTool team.chisel.common.init.ChiselItems.offsettool. This means the object wasn't registered. It's likely just mod options.
|
3049 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bloodmagic for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bloodmagic. This means the object wasn't registered. It's likely just mod options.
|
3050 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
|
3051 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
|
3052 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
|
3053 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
|
3054 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_green for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGreenItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3055 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_hurt. This means the object wasn't registered. It's likely just mod options.
|
3056 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.trigger for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_trigger. This means the object wasn't registered. It's likely just mod options.
|
3057 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_lime for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLimeItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3058 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.labyrinth_totem.drone for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.labyrinth_totem_drone. This means the object wasn't registered. It's likely just mod options.
|
3059 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.valkyrie for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_valkyrie. This means the object wasn't registered. It's likely just mod options.
|
3060 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.puff for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_puff. This means the object wasn't registered. It's likely just mod options.
|
3061 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:instanced_zone for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.INSTANCED_ZONE. This means the object wasn't registered. It's likely just mod options.
|
3062 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_blue for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlueItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3063 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.lift for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_lift. This means the object wasn't registered. It's likely just mod options.
|
3064 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_hurt. This means the object wasn't registered. It's likely just mod options.
|
3065 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_silver for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxSilverItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3066 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_death. This means the object wasn't registered. It's likely just mod options.
|
3067 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.heavy for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_heavy. This means the object wasn't registered. It's likely just mod options.
|
3068 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.aerwhale for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_aerwhale. This means the object wasn't registered. It's likely just mod options.
|
3069 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_ambient. This means the object wasn't registered. It's likely just mod options.
|
3070 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_arctic_peaks for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.ARCTIC_PEAKS. This means the object wasn't registered. It's likely just mod options.
|
3071 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_hurt. This means the object wasn't registered. It's likely just mod options.
|
3072 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_magenta for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxMagentaItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3073 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_death. This means the object wasn't registered. It's likely just mod options.
|
3074 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_black for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBlackItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3075 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_forgotten_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.FORGOTTEN_HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
|
3076 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.recording_892 for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_recording_892. This means the object wasn't registered. It's likely just mod options.
|
3077 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:entity.netherfish.hurt for public static net.minecraft.util.SoundEvent org.icannt.netherendingores.common.registry.RegistryEvents.ENTITY_NETHERFISH_HURT. This means the object wasn't registered. It's likely just mod options.
|
3078 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_purple for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPurpleItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3079 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_white for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxWhiteItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3080 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:entity.netherfish.ambient for public static net.minecraft.util.SoundEvent org.icannt.netherendingores.common.registry.RegistryEvents.ENTITY_NETHERFISH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3081 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.electric_shock for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_electric_shock. This means the object wasn't registered. It's likely just mod options.
|
3082 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_ambient. This means the object wasn't registered. It's likely just mod options.
|
3083 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_death. This means the object wasn't registered. It's likely just mod options.
|
3084 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_attack. This means the object wasn't registered. It's likely just mod options.
|
3085 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_death. This means the object wasn't registered. It's likely just mod options.
|
3086 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_ambient. This means the object wasn't registered. It's likely just mod options.
|
3087 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_cyan for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxCyanItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3088 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_attack. This means the object wasn't registered. It's likely just mod options.
|
3089 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_death. This means the object wasn't registered. It's likely just mod options.
|
3090 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
|
3091 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.snow.wind for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_snow_wind. This means the object wasn't registered. It's likely just mod options.
|
3092 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_magnetic_hills for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.MAGNETIC_HILLS. This means the object wasn't registered. It's likely just mod options.
|
3093 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.labyrinth for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_labyrinth. This means the object wasn't registered. It's likely just mod options.
|
3094 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_red for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxRedItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3095 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_death. This means the object wasn't registered. It's likely just mod options.
|
3096 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_ambient. This means the object wasn't registered. It's likely just mod options.
|
3097 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.travel for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_travel. This means the object wasn't registered. It's likely just mod options.
|
3098 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_brown for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxBrownItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3099 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_pink for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxPinkItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3100 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.light for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_light. This means the object wasn't registered. It's likely just mod options.
|
3101 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_irradiated_forests for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.IRRADIATED_FORESTS. This means the object wasn't registered. It's likely just mod options.
|
3102 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_ambient. This means the object wasn't registered. It's likely just mod options.
|
3103 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.present_unwrap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.present_unwrap. This means the object wasn't registered. It's likely just mod options.
|
3104 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_hurt. This means the object wasn't registered. It's likely just mod options.
|
3105 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_hurt. This means the object wasn't registered. It's likely just mod options.
|
3106 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dungeon.container.smash for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.break_labyrinth_container. This means the object wasn't registered. It's likely just mod options.
|
3107 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:block.aercloud.bounce for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aercloud_bounce. This means the object wasn't registered. It's likely just mod options.
|
3108 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_gray for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxGrayItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3109 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:entity.netherfish.death for public static net.minecraft.util.SoundEvent org.icannt.netherendingores.common.registry.RegistryEvents.ENTITY_NETHERFISH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3110 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_ambient. This means the object wasn't registered. It's likely just mod options.
|
3111 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_void for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.VOID. This means the object wasn't registered. It's likely just mod options.
|
3112 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_hurt. This means the object wasn't registered. It's likely just mod options.
|
3113 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_ambient. This means the object wasn't registered. It's likely just mod options.
|
3114 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.angry for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_angry. This means the object wasn't registered. It's likely just mod options.
|
3115 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.moa for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_moa. This means the object wasn't registered. It's likely just mod options.
|
3116 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_orange for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxOrangeItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3117 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_chest for public static net.minecraft.item.Item cpw.mods.ironchest.common.core.IronChestBlocks.ironChestItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3118 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.generic.wings.flap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.generic_wing_flap. This means the object wasn't registered. It's likely just mod options.
|
3119 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.hum for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_hum. This means the object wasn't registered. It's likely just mod options.
|
3120 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_yellow for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxYellowItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3121 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup ironchest:iron_shulker_box_light_blue for public static cpw.mods.ironchest.common.items.shulker.ItemIronShulkerBox cpw.mods.ironchest.common.core.IronChestBlocks.ironShulkerBoxLightBlueItemBlock. This means the object wasn't registered. It's likely just mod options.
|
3122 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dart_shooter.fire for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.dart_shooter_fire. This means the object wasn't registered. It's likely just mod options.
|
3123 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_hurt. This means the object wasn't registered. It's likely just mod options.
|
3124 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_ambient. This means the object wasn't registered. It's likely just mod options.
|
3125 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_ambient. This means the object wasn't registered. It's likely just mod options.
|
3126 | [15:24:20] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_death. This means the object wasn't registered. It's likely just mod options.
|
3127 | [15:24:20] [Server thread/INFO] [FML]: Holder lookups applied
|
3128 | [15:24:34] [Server thread/INFO] [Chisel]: Loading items...
|
3129 | [15:24:34] [Server thread/INFO] [Chisel]: Skipping feature arcaneStone as its required mod thaumcraft was missing.
|
3130 | [15:24:34] [Server thread/INFO] [Chisel]: Skipping feature bloodMagic as its required mod bloodmagic was missing.
|
3131 | [15:24:34] [Server thread/INFO] [Chisel]: Skipping feature certus as its required mod appliedenergistics2 was missing.
|
3132 | [15:24:34] [Server thread/INFO] [Chisel]: 72 Feature's items loaded.
|
3133 | [15:24:35] [Server thread/DEBUG] [Netherending Ores]: Registering ItemBlocks
|
3134 | [15:24:35] [Server thread/INFO] [Netherending Ores]: Registered ItemBlocks
|
3135 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [CommonProxy] Start registering items
|
3136 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:lignite_coal' for entry 'lignite_coal'
|
3137 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:fossil_piece' for entry 'fossil_piece'
|
3138 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_stone_halfslab' for entry 'igneous_stone'
|
3139 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_stone_halfslab' for entry 'metamorphic_stone'
|
3140 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_cobble_halfslab' for entry 'igneous_cobble'
|
3141 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_cobble_halfslab' for entry 'metamorphic_cobble'
|
3142 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:sedimentary_stone_halfslab' for entry 'sedimentary_stone'
|
3143 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_brick_halfslab' for entry 'igneous_brick'
|
3144 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_brick_halfslab' for entry 'metamorphic_brick'
|
3145 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_stone_wall' for entry 'igneous_stone_wall'
|
3146 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_cobble_wall' for entry 'igneous_cobble_wall'
|
3147 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_brick_wall' for entry 'igneous_brick_wall'
|
3148 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_stone_wall' for entry 'metamorphic_stone_wall'
|
3149 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_cobble_wall' for entry 'metamorphic_cobble_wall'
|
3150 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_brick_wall' for entry 'metamorphic_brick_wall'
|
3151 | [15:24:35] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:sedimentary_stone_wall' for entry 'sedimentary_stone_wall'
|
3152 | [15:24:44] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_stone_stairs' for entry 'igneous_stone_stairs'
|
3153 | [15:24:45] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_cobble_stairs' for entry 'igneous_cobble_stairs'
|
3154 | [15:24:45] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_brick_stairs' for entry 'igneous_brick_stairs'
|
3155 | [15:24:46] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_stone_stairs' for entry 'metamorphic_stone_stairs'
|
3156 | [15:24:46] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_cobble_stairs' for entry 'metamorphic_cobble_stairs'
|
3157 | [15:24:46] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_brick_stairs' for entry 'metamorphic_brick_stairs'
|
3158 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:sedimentary_stone_stairs' for entry 'sedimentary_stone_stairs'
|
3159 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_stone_coal_ore' for entry 'igneous_stone_coal_ore'
|
3160 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_stone_coal_ore' for entry 'metamorphic_stone_coal_ore'
|
3161 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:sedimentary_stone_coal_ore' for entry 'sedimentary_stone_coal_ore'
|
3162 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_stone_diamond_ore' for entry 'igneous_stone_diamond_ore'
|
3163 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_stone_diamond_ore' for entry 'metamorphic_stone_diamond_ore'
|
3164 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:sedimentary_stone_diamond_ore' for entry 'sedimentary_stone_diamond_ore'
|
3165 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_stone_emerald_ore' for entry 'igneous_stone_emerald_ore'
|
3166 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_stone_emerald_ore' for entry 'metamorphic_stone_emerald_ore'
|
3167 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:sedimentary_stone_emerald_ore' for entry 'sedimentary_stone_emerald_ore'
|
3168 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_stone_gold_ore' for entry 'igneous_stone_gold_ore'
|
3169 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_stone_gold_ore' for entry 'metamorphic_stone_gold_ore'
|
3170 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:sedimentary_stone_gold_ore' for entry 'sedimentary_stone_gold_ore'
|
3171 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_stone_redstone_ore' for entry 'igneous_stone_redstone_ore'
|
3172 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_stone_redstone_ore' for entry 'metamorphic_stone_redstone_ore'
|
3173 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:sedimentary_stone_redstone_ore' for entry 'sedimentary_stone_redstone_ore'
|
3174 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_stone_lapis_ore' for entry 'igneous_stone_lapis_ore'
|
3175 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_stone_lapis_ore' for entry 'metamorphic_stone_lapis_ore'
|
3176 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:sedimentary_stone_lapis_ore' for entry 'sedimentary_stone_lapis_ore'
|
3177 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:igneous_stone_iron_ore' for entry 'igneous_stone_iron_ore'
|
3178 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:metamorphic_stone_iron_ore' for entry 'metamorphic_stone_iron_ore'
|
3179 | [15:24:47] [Server thread/DEBUG] [undergroundbiomes]: [Entry] Registering item 'undergroundbiomes:sedimentary_stone_iron_ore' for entry 'sedimentary_stone_iron_ore'
|
3180 | [15:24:47] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `furnace`, expected `fastfurnace`. This could be a intended override, but in most cases indicates a broken mod.
|
3181 | [15:24:47] [Server thread/INFO] [FML]: Applying holder lookups
|
3182 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3183 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3184 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
|
3185 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3186 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
|
3187 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
|
3188 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
|
3189 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
|
3190 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
|
3191 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
|
3192 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
|
3193 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3194 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
|
3195 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3196 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
|
3197 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3198 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3199 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3200 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
|
3201 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
|
3202 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
|
3203 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3204 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3205 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3206 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
|
3207 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3208 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
|
3209 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3210 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
|
3211 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3212 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3213 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
|
3214 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3215 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3216 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3217 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3218 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3219 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3220 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3221 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3222 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3223 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3224 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3225 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
|
3226 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
|
3227 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
|
3228 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
|
3229 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
3230 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
|
3231 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
|
3232 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
|
3233 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
3234 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
|
3235 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
|
3236 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
|
3237 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
3238 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3239 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3240 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
|
3241 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3242 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
|
3243 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
|
3244 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3245 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
|
3246 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3247 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
|
3248 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
|
3249 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
|
3250 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
|
3251 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
|
3252 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
|
3253 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
|
3254 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3255 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3256 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3257 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
3258 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3259 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3260 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3261 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
3262 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3263 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3264 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3265 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
3266 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3267 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3268 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
3269 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3270 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3271 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
3272 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3273 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
3274 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
3275 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
|
3276 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
|
3277 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
|
3278 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3279 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
|
3280 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
|
3281 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
|
3282 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
|
3283 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
|
3284 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3285 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3286 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3287 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
3288 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
|
3289 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3290 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3291 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3292 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3293 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3294 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3295 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3296 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3297 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3298 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3299 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
|
3300 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3301 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3302 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
|
3303 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3304 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3305 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
|
3306 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3307 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3308 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3309 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3310 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
|
3311 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3312 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
|
3313 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
|
3314 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3315 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
3316 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3317 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3318 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
|
3319 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
|
3320 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
|
3321 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3322 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
|
3323 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3324 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
3325 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3326 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
|
3327 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3328 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3329 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
3330 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3331 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
3332 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
3333 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
3334 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
3335 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3336 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3337 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3338 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
3339 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3340 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
|
3341 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3342 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3343 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
|
3344 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
3345 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
|
3346 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bloodmagic for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bloodmagic. This means the object wasn't registered. It's likely just mod options.
|
3347 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
|
3348 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
|
3349 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
|
3350 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
|
3351 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_hurt. This means the object wasn't registered. It's likely just mod options.
|
3352 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.trigger for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_trigger. This means the object wasn't registered. It's likely just mod options.
|
3353 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.labyrinth_totem.drone for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.labyrinth_totem_drone. This means the object wasn't registered. It's likely just mod options.
|
3354 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.valkyrie for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_valkyrie. This means the object wasn't registered. It's likely just mod options.
|
3355 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.puff for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_puff. This means the object wasn't registered. It's likely just mod options.
|
3356 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:instanced_zone for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.INSTANCED_ZONE. This means the object wasn't registered. It's likely just mod options.
|
3357 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.lift for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_lift. This means the object wasn't registered. It's likely just mod options.
|
3358 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_hurt. This means the object wasn't registered. It's likely just mod options.
|
3359 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_death. This means the object wasn't registered. It's likely just mod options.
|
3360 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.heavy for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_heavy. This means the object wasn't registered. It's likely just mod options.
|
3361 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.aerwhale for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_aerwhale. This means the object wasn't registered. It's likely just mod options.
|
3362 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_ambient. This means the object wasn't registered. It's likely just mod options.
|
3363 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_arctic_peaks for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.ARCTIC_PEAKS. This means the object wasn't registered. It's likely just mod options.
|
3364 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_hurt. This means the object wasn't registered. It's likely just mod options.
|
3365 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_death. This means the object wasn't registered. It's likely just mod options.
|
3366 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_forgotten_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.FORGOTTEN_HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
|
3367 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.recording_892 for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_recording_892. This means the object wasn't registered. It's likely just mod options.
|
3368 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:entity.netherfish.hurt for public static net.minecraft.util.SoundEvent org.icannt.netherendingores.common.registry.RegistryEvents.ENTITY_NETHERFISH_HURT. This means the object wasn't registered. It's likely just mod options.
|
3369 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:entity.netherfish.ambient for public static net.minecraft.util.SoundEvent org.icannt.netherendingores.common.registry.RegistryEvents.ENTITY_NETHERFISH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3370 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.electric_shock for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_electric_shock. This means the object wasn't registered. It's likely just mod options.
|
3371 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_ambient. This means the object wasn't registered. It's likely just mod options.
|
3372 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_death. This means the object wasn't registered. It's likely just mod options.
|
3373 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_attack. This means the object wasn't registered. It's likely just mod options.
|
3374 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_death. This means the object wasn't registered. It's likely just mod options.
|
3375 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_ambient. This means the object wasn't registered. It's likely just mod options.
|
3376 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_attack. This means the object wasn't registered. It's likely just mod options.
|
3377 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_death. This means the object wasn't registered. It's likely just mod options.
|
3378 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
|
3379 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.snow.wind for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_snow_wind. This means the object wasn't registered. It's likely just mod options.
|
3380 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_magnetic_hills for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.MAGNETIC_HILLS. This means the object wasn't registered. It's likely just mod options.
|
3381 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.labyrinth for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_labyrinth. This means the object wasn't registered. It's likely just mod options.
|
3382 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_death. This means the object wasn't registered. It's likely just mod options.
|
3383 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_ambient. This means the object wasn't registered. It's likely just mod options.
|
3384 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.travel for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_travel. This means the object wasn't registered. It's likely just mod options.
|
3385 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.light for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_light. This means the object wasn't registered. It's likely just mod options.
|
3386 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_irradiated_forests for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.IRRADIATED_FORESTS. This means the object wasn't registered. It's likely just mod options.
|
3387 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_ambient. This means the object wasn't registered. It's likely just mod options.
|
3388 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.present_unwrap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.present_unwrap. This means the object wasn't registered. It's likely just mod options.
|
3389 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_hurt. This means the object wasn't registered. It's likely just mod options.
|
3390 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_hurt. This means the object wasn't registered. It's likely just mod options.
|
3391 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dungeon.container.smash for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.break_labyrinth_container. This means the object wasn't registered. It's likely just mod options.
|
3392 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:block.aercloud.bounce for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aercloud_bounce. This means the object wasn't registered. It's likely just mod options.
|
3393 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup netherendingores:entity.netherfish.death for public static net.minecraft.util.SoundEvent org.icannt.netherendingores.common.registry.RegistryEvents.ENTITY_NETHERFISH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3394 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_ambient. This means the object wasn't registered. It's likely just mod options.
|
3395 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_void for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.VOID. This means the object wasn't registered. It's likely just mod options.
|
3396 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_hurt. This means the object wasn't registered. It's likely just mod options.
|
3397 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_ambient. This means the object wasn't registered. It's likely just mod options.
|
3398 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.angry for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_angry. This means the object wasn't registered. It's likely just mod options.
|
3399 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.moa for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_moa. This means the object wasn't registered. It's likely just mod options.
|
3400 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.generic.wings.flap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.generic_wing_flap. This means the object wasn't registered. It's likely just mod options.
|
3401 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.hum for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_hum. This means the object wasn't registered. It's likely just mod options.
|
3402 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dart_shooter.fire for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.dart_shooter_fire. This means the object wasn't registered. It's likely just mod options.
|
3403 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_hurt. This means the object wasn't registered. It's likely just mod options.
|
3404 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_ambient. This means the object wasn't registered. It's likely just mod options.
|
3405 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_ambient. This means the object wasn't registered. It's likely just mod options.
|
3406 | [15:24:47] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_death. This means the object wasn't registered. It's likely just mod options.
|
3407 | [15:24:47] [Server thread/INFO] [FML]: Holder lookups applied
|
3408 | [15:24:58] [Server thread/DEBUG] [Netherending Ores]: Registering Ore Dictionary Entries
|
3409 | [15:24:58] [Server thread/INFO] [Netherending Ores]: Registered Ore Dictionary Entries
|
3410 | [15:24:58] [Server thread/INFO] [mocreatures]: Registering entities...
|
3411 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:manticorepet as mocreatures:manticorepet
|
3412 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:petscorpion as mocreatures:petscorpion
|
3413 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:egg as mocreatures:egg
|
3414 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:kittybed as mocreatures:kittybed
|
3415 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:litterbox as mocreatures:litterbox
|
3416 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:trock as mocreatures:trock
|
3417 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:bird as mocreatures:bird
|
3418 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:blackbear as mocreatures:blackbear
|
3419 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:boar as mocreatures:boar
|
3420 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:bunny as mocreatures:bunny
|
3421 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:crocodile as mocreatures:crocodile
|
3422 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:duck as mocreatures:duck
|
3423 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:deer as mocreatures:deer
|
3424 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:elephant as mocreatures:elephant
|
3425 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:ent as mocreatures:ent
|
3426 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:fox as mocreatures:fox
|
3427 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:goat as mocreatures:goat
|
3428 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:grizzlybear as mocreatures:grizzlybear
|
3429 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:kitty as mocreatures:kitty
|
3430 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:komododragon as mocreatures:komododragon
|
3431 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:leoger as mocreatures:leoger
|
3432 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:leopard as mocreatures:leopard
|
3433 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:liard as mocreatures:liard
|
3434 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:lion as mocreatures:lion
|
3435 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:liger as mocreatures:liger
|
3436 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:lither as mocreatures:lither
|
3437 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:mole as mocreatures:mole
|
3438 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:mouse as mocreatures:mouse
|
3439 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:ostrich as mocreatures:ostrich
|
3440 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:pandabear as mocreatures:pandabear
|
3441 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:panthard as mocreatures:panthard
|
3442 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:panther as mocreatures:panther
|
3443 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:panthger as mocreatures:panthger
|
3444 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:wildpolarbear as mocreatures:wildpolarbear
|
3445 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:raccoon as mocreatures:raccoon
|
3446 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:snake as mocreatures:snake
|
3447 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:tiger as mocreatures:tiger
|
3448 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:turtle as mocreatures:turtle
|
3449 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:turkey as mocreatures:turkey
|
3450 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:wildhorse as mocreatures:wildhorse
|
3451 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:wyvern as mocreatures:wyvern
|
3452 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:caveogre as mocreatures:caveogre
|
3453 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:flamewraith as mocreatures:flamewraith
|
3454 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:fireogre as mocreatures:fireogre
|
3455 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:greenogre as mocreatures:greenogre
|
3456 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:biggolem as mocreatures:biggolem
|
3457 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:horsemob as mocreatures:horsemob
|
3458 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:hellrat as mocreatures:hellrat
|
3459 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:manticore as mocreatures:manticore
|
3460 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:minigolem as mocreatures:minigolem
|
3461 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:rat as mocreatures:rat
|
3462 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:silverskeleton as mocreatures:silverskeleton
|
3463 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:scorpion as mocreatures:scorpion
|
3464 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:werewolf as mocreatures:werewolf
|
3465 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:wraith as mocreatures:wraith
|
3466 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:wwolf as mocreatures:wwolf
|
3467 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:anchovy as mocreatures:anchovy
|
3468 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:angelfish as mocreatures:angelfish
|
3469 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:angler as mocreatures:angler
|
3470 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:bass as mocreatures:bass
|
3471 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:clownfish as mocreatures:clownfish
|
3472 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:cod as mocreatures:cod
|
3473 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:dolphin as mocreatures:dolphin
|
3474 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:fishy as mocreatures:fishy
|
3475 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:goldfish as mocreatures:goldfish
|
3476 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:hippotang as mocreatures:hippotang
|
3477 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:jellyfish as mocreatures:jellyfish
|
3478 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:manderin as mocreatures:manderin
|
3479 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:piranha as mocreatures:piranha
|
3480 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:salmon as mocreatures:salmon
|
3481 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:mantaray as mocreatures:mantaray
|
3482 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:shark as mocreatures:shark
|
3483 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:stingray as mocreatures:stingray
|
3484 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:ant as mocreatures:ant
|
3485 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:bee as mocreatures:bee
|
3486 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:butterfly as mocreatures:butterfly
|
3487 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:crab as mocreatures:crab
|
3488 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:cricket as mocreatures:cricket
|
3489 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:dragonfly as mocreatures:dragonfly
|
3490 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:firefly as mocreatures:firefly
|
3491 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:fly as mocreatures:fly
|
3492 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:maggot as mocreatures:maggot
|
3493 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:snail as mocreatures:snail
|
3494 | [15:24:59] [Server thread/TRACE] [FML]: Automatically registered mod mocreatures entity mocreatures:roach as mocreatures:roach
|
3495 | [15:24:59] [Server thread/INFO] [mocreatures]: Entity registration complete.
|
3496 | [15:24:59] [Server thread/INFO] [FML]: Applying holder lookups
|
3497 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3498 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3499 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
|
3500 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3501 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
|
3502 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
|
3503 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
|
3504 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
|
3505 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
|
3506 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
|
3507 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
|
3508 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3509 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
|
3510 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3511 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
|
3512 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3513 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3514 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3515 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
|
3516 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
|
3517 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
|
3518 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3519 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3520 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3521 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
|
3522 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3523 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
|
3524 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3525 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
|
3526 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3527 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3528 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
|
3529 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3530 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3531 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3532 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3533 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3534 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3535 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3536 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3537 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3538 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3539 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3540 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
|
3541 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
|
3542 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
|
3543 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
|
3544 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
3545 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
|
3546 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
|
3547 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
|
3548 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
3549 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
|
3550 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
|
3551 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
|
3552 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
3553 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3554 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3555 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
|
3556 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3557 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
|
3558 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
|
3559 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3560 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
|
3561 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3562 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
|
3563 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
|
3564 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
|
3565 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
|
3566 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
|
3567 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
|
3568 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
|
3569 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3570 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3571 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3572 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
3573 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3574 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3575 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3576 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
3577 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3578 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3579 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3580 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
3581 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3582 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3583 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
3584 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3585 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3586 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
3587 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3588 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
3589 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
3590 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
|
3591 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
|
3592 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
|
3593 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3594 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
|
3595 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
|
3596 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
|
3597 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
|
3598 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
|
3599 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3600 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3601 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3602 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
3603 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
|
3604 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3605 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3606 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3607 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3608 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3609 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3610 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3611 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3612 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3613 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3614 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
|
3615 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3616 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3617 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
|
3618 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3619 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3620 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
|
3621 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3622 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3623 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3624 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3625 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
|
3626 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3627 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
|
3628 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
|
3629 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3630 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
3631 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3632 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3633 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
|
3634 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
|
3635 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
|
3636 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3637 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
|
3638 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3639 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
3640 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3641 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
|
3642 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3643 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3644 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
3645 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3646 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
3647 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
3648 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
3649 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
3650 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3651 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3652 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3653 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
3654 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3655 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
|
3656 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3657 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3658 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
|
3659 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
3660 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
|
3661 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bloodmagic for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bloodmagic. This means the object wasn't registered. It's likely just mod options.
|
3662 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
|
3663 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
|
3664 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
|
3665 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
|
3666 | [15:24:59] [Server thread/INFO] [FML]: Holder lookups applied
|
3667 | [15:24:59] [Server thread/INFO] [FML]: Applying holder lookups
|
3668 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3669 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3670 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
|
3671 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3672 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
|
3673 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
|
3674 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
|
3675 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
|
3676 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
|
3677 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
|
3678 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
|
3679 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3680 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
|
3681 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3682 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
|
3683 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3684 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3685 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3686 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
|
3687 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
|
3688 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
|
3689 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3690 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3691 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3692 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
|
3693 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3694 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
|
3695 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3696 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
|
3697 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3698 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3699 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
|
3700 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3701 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3702 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3703 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3704 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3705 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3706 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3707 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3708 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3709 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3710 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3711 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
|
3712 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
|
3713 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
|
3714 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
|
3715 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
3716 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
|
3717 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
|
3718 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
|
3719 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
3720 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
|
3721 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
|
3722 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
|
3723 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
3724 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3725 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3726 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
|
3727 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3728 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
|
3729 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
|
3730 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3731 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
|
3732 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3733 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
|
3734 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
|
3735 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
|
3736 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
|
3737 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
|
3738 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
|
3739 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
|
3740 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3741 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3742 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3743 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
3744 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3745 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3746 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3747 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
3748 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3749 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3750 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3751 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
3752 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3753 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3754 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
3755 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3756 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3757 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
3758 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3759 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
3760 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
3761 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
|
3762 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
|
3763 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
|
3764 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3765 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
|
3766 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
|
3767 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
|
3768 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
|
3769 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
|
3770 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3771 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3772 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3773 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
3774 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
|
3775 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3776 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3777 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3778 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3779 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3780 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3781 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3782 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3783 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3784 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3785 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
|
3786 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3787 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3788 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
|
3789 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3790 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3791 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
|
3792 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3793 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3794 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3795 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3796 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
|
3797 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3798 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
|
3799 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
|
3800 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3801 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
3802 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3803 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3804 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
|
3805 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
|
3806 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
|
3807 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3808 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
|
3809 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3810 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
3811 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3812 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
|
3813 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3814 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3815 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
3816 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3817 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
3818 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
3819 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
3820 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
3821 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3822 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3823 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3824 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
3825 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3826 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
|
3827 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3828 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3829 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
|
3830 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
3831 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
|
3832 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bloodmagic for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bloodmagic. This means the object wasn't registered. It's likely just mod options.
|
3833 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
|
3834 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
|
3835 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
|
3836 | [15:24:59] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
|
3837 | [15:24:59] [Server thread/INFO] [FML]: Holder lookups applied
|
3838 | [15:24:59] [Server thread/INFO] [FML]: Injecting itemstacks
|
3839 | [15:24:59] [Server thread/INFO] [FML]: Itemstack injection complete
|
3840 | [15:24:59] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Loading properties
|
3841 | [15:24:59] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Default game type: SURVIVAL
|
3842 | [15:24:59] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Generating keypair
|
3843 | [15:25:00] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Starting Minecraft server on *:26929
|
3844 | [15:25:00] [Server thread/INFO] [net.minecraft.network.NetworkSystem]: Using epoll channel type
|
3845 | [15:25:12] [Server thread/ERROR] [FML]: Parsing error loading recipe undergroundbiomes:grout
|
3846 | com.google.gson.JsonSyntaxException: Unknown item 'tconstruct:soil'
|
3847 | at net.minecraftforge.common.crafting.CraftingHelper.getItemStack(CraftingHelper.java:214) ~[CraftingHelper.class:?]
|
3848 | at net.minecraftforge.oredict.ShapelessOreRecipe.factory(ShapelessOreRecipe.java:157) ~[ShapelessOreRecipe.class:?]
|
3849 | at net.minecraftforge.common.crafting.CraftingHelper.getRecipe(CraftingHelper.java:416) ~[CraftingHelper.class:?]
|
3850 | at net.minecraftforge.common.crafting.CraftingHelper.lambda$loadRecipes$22(CraftingHelper.java:723) ~[CraftingHelper.class:?]
|
3851 | at net.minecraftforge.common.crafting.CraftingHelper.findFiles(CraftingHelper.java:833) ~[CraftingHelper.class:?]
|
3852 | at net.minecraftforge.common.crafting.CraftingHelper.loadRecipes(CraftingHelper.java:688) ~[CraftingHelper.class:?]
|
3853 | at java.util.ArrayList.forEach(ArrayList.java:1257) [?:1.8.0_222]
|
3854 | at net.minecraftforge.common.crafting.CraftingHelper.loadRecipes(CraftingHelper.java:633) [CraftingHelper.class:?]
|
3855 | at net.minecraftforge.fml.common.Loader.initializeMods(Loader.java:747) [Loader.class:?]
|
3856 | at net.minecraftforge.fml.server.FMLServerHandler.finishServerLoading(FMLServerHandler.java:108) [FMLServerHandler.class:?]
|
3857 | at net.minecraftforge.fml.common.FMLCommonHandler.onServerStarted(FMLCommonHandler.java:338) [FMLCommonHandler.class:?]
|
3858 | at net.minecraft.server.dedicated.DedicatedServer.func_71197_b(DedicatedServer.java:219) [nz.class:?]
|
3859 | at net.minecraft.server.MinecraftServer.run(MinecraftServer.java:486) [MinecraftServer.class:?]
|
3860 | at java.lang.Thread.run(Thread.java:748) [?:1.8.0_222]
|
3861 | [15:25:12] [Server thread/INFO] [Chisel]: Loading recipes...
|
3862 | [15:25:12] [Server thread/INFO] [Chisel]: Skipping feature arcaneStone as its required mod thaumcraft was missing.
|
3863 | [15:25:12] [Server thread/INFO] [Chisel]: Skipping feature bloodMagic as its required mod bloodmagic was missing.
|
3864 | [15:25:12] [Server thread/INFO] [Chisel]: Skipping feature certus as its required mod appliedenergistics2 was missing.
|
3865 | [15:25:12] [Server thread/INFO] [Chisel]: 72 Feature's recipes loaded.
|
3866 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property RegularStoneCrafting
|
3867 | [15:25:12] [Server thread/INFO] [undergroundbiomes]: [RegularStoneRecipe] Choosing regular stone recipe n°4
|
3868 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [RegularStoneRecipe] recipe outputCobblestone
|
3869 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding tracker to property ChangeButtonRecipe
|
3870 | [15:25:12] [Server thread/INFO] [undergroundbiomes]: [ButtonRecipe] Modifying buttons recipes to output 8 buttons
|
3871 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'minecraft:wooden_button' modified
|
3872 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'abyssalcraft:dsbutton' modified
|
3873 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'abyssalcraft:dltbutton' modified
|
3874 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'abyssalcraft:cstonebutton' modified
|
3875 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'abyssalcraft:abybutton' modified
|
3876 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedOreRecipe for 'aether:wisproot_button' modified
|
3877 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedOreRecipe for 'aether:skyroot_button' modified
|
3878 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedOreRecipe for 'aether:holystone_button' modified
|
3879 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedOreRecipe for 'aether:greatroot_button' modified
|
3880 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_stone_button' modified
|
3881 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_cobble_button' modified
|
3882 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_cobble_button' modified
|
3883 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_stone_button' modified
|
3884 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_stone_button' modified
|
3885 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:sedimentary_stone_button' modified
|
3886 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_stone_button' modified
|
3887 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:sedimentary_stone_button' modified
|
3888 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_stone_button' modified
|
3889 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_cobble_button' modified
|
3890 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_cobble_button' modified
|
3891 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_stone_button' modified
|
3892 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_stone_button' modified
|
3893 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_cobble_button' modified
|
3894 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_cobble_button' modified
|
3895 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:sedimentary_stone_button' modified
|
3896 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_cobble_button' modified
|
3897 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_stone_button' modified
|
3898 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:sedimentary_stone_button' modified
|
3899 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_stone_button' modified
|
3900 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_cobble_button' modified
|
3901 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_cobble_button' modified
|
3902 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:sedimentary_stone_button' modified
|
3903 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_stone_button' modified
|
3904 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:sedimentary_stone_button' modified
|
3905 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:sedimentary_stone_button' modified
|
3906 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_stone_button' modified
|
3907 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_stone_button' modified
|
3908 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_cobble_button' modified
|
3909 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_stone_button' modified
|
3910 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_stone_button' modified
|
3911 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_cobble_button' modified
|
3912 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:sedimentary_stone_button' modified
|
3913 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_stone_button' modified
|
3914 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_cobble_button' modified
|
3915 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_cobble_button' modified
|
3916 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:metamorphic_cobble_button' modified
|
3917 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_stone_button' modified
|
3918 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_cobble_button' modified
|
3919 | [15:25:12] [Server thread/DEBUG] [undergroundbiomes]: [ButtonRecipe] ShapedRecipes for 'undergroundbiomes:igneous_cobble_button' modified
|
3920 | [15:25:12] [Server thread/INFO] [FML]: Applying holder lookups
|
3921 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3922 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3923 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bear_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEAR_HURT. This means the object wasn't registered. It's likely just mod options.
|
3924 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3925 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bee_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BEE_UPSET. This means the object wasn't registered. It's likely just mod options.
|
3926 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_black for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLACK. This means the object wasn't registered. It's likely just mod options.
|
3927 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_blue for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_BLUE. This means the object wasn't registered. It's likely just mod options.
|
3928 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_green for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_GREEN. This means the object wasn't registered. It's likely just mod options.
|
3929 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_red for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_RED. This means the object wasn't registered. It's likely just mod options.
|
3930 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_white for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_WHITE. This means the object wasn't registered. It's likely just mod options.
|
3931 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_ambient_yellow for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_AMBIENT_YELLOW. This means the object wasn't registered. It's likely just mod options.
|
3932 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3933 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_bird_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
|
3934 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3935 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_cricket_fly for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CRICKET_FLY. This means the object wasn't registered. It's likely just mod options.
|
3936 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3937 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3938 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_HURT. This means the object wasn't registered. It's likely just mod options.
|
3939 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_jawsnap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_JAWSNAP. This means the object wasn't registered. It's likely just mod options.
|
3940 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_resting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_RESTING. This means the object wasn't registered. It's likely just mod options.
|
3941 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_crocodile_roll for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_CROCODILE_ROLL. This means the object wasn't registered. It's likely just mod options.
|
3942 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3943 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3944 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3945 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_deer_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DEER_HURT. This means the object wasn't registered. It's likely just mod options.
|
3946 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3947 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_HURT. This means the object wasn't registered. It's likely just mod options.
|
3948 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3949 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dolphin_upset for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DOLPHIN_UPSET. This means the object wasn't registered. It's likely just mod options.
|
3950 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3951 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3952 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_duck_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DUCK_HURT. This means the object wasn't registered. It's likely just mod options.
|
3953 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_dragonfly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_DRAGONFLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3954 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3955 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3956 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3957 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_elephant_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ELEPHANT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3958 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3959 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3960 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ent_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_ENT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3961 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fly_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FLY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3962 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3963 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3964 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_fox_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_FOX_HURT. This means the object wasn't registered. It's likely just mod options.
|
3965 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_on for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_ON. This means the object wasn't registered. It's likely just mod options.
|
3966 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_armor_off for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ARMOR_OFF. This means the object wasn't registered. It's likely just mod options.
|
3967 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_destroy for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DESTROY. This means the object wasn't registered. It's likely just mod options.
|
3968 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
3969 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_EATING. This means the object wasn't registered. It's likely just mod options.
|
3970 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_magic_appear for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_MAGIC_APPEAR. This means the object wasn't registered. It's likely just mod options.
|
3971 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_roping for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_ROPING. This means the object wasn't registered. It's likely just mod options.
|
3972 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
3973 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_tud for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_TUD. This means the object wasn't registered. It's likely just mod options.
|
3974 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_vanish for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_VANISH. This means the object wasn't registered. It's likely just mod options.
|
3975 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_whip for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WHIP. This means the object wasn't registered. It's likely just mod options.
|
3976 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_generic_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GENERIC_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
3977 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3978 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
3979 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_ambient_female for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_AMBIENT_FEMALE. This means the object wasn't registered. It's likely just mod options.
|
3980 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
3981 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_digg for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_DIGG. This means the object wasn't registered. It's likely just mod options.
|
3982 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_EATING. This means the object wasn't registered. It's likely just mod options.
|
3983 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
3984 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_goat_smack for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOAT_SMACK. This means the object wasn't registered. It's likely just mod options.
|
3985 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3986 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_attach for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_ATTACH. This means the object wasn't registered. It's likely just mod options.
|
3987 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_dying for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_DYING. This means the object wasn't registered. It's likely just mod options.
|
3988 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_explode for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_EXPLODE. This means the object wasn't registered. It's likely just mod options.
|
3989 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_HURT. This means the object wasn't registered. It's likely just mod options.
|
3990 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_shoot for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_SHOOT. This means the object wasn't registered. It's likely just mod options.
|
3991 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_golem_walk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_GOLEM_WALK. This means the object wasn't registered. It's likely just mod options.
|
3992 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_mad for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_MAD. This means the object wasn't registered. It's likely just mod options.
|
3993 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
3994 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3995 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3996 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_ambient_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_AMBIENT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
3997 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_GHOST. This means the object wasn't registered. It's likely just mod options.
|
3998 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_angry_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_ANGRY_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
3999 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4000 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
4001 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_GHOST. This means the object wasn't registered. It's likely just mod options.
|
4002 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_death_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_DEATH_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
4003 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
4004 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_donkey for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_DONKEY. This means the object wasn't registered. It's likely just mod options.
|
4005 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_ghost for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_GHOST. This means the object wasn't registered. It's likely just mod options.
|
4006 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_undead for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_UNDEAD. This means the object wasn't registered. It's likely just mod options.
|
4007 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_horse_hurt_zebra for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_HORSE_HURT_ZEBRA. This means the object wasn't registered. It's likely just mod options.
|
4008 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4009 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
4010 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
4011 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4012 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
4013 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_drinking for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_DRINKING. This means the object wasn't registered. It's likely just mod options.
|
4014 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_EATING. This means the object wasn't registered. It's likely just mod options.
|
4015 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hungry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HUNGRY. This means the object wasn't registered. It's likely just mod options.
|
4016 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT. This means the object wasn't registered. It's likely just mod options.
|
4017 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
4018 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_litter for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_LITTER. This means the object wasn't registered. It's likely just mod options.
|
4019 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_purr for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_PURR. This means the object wasn't registered. It's likely just mod options.
|
4020 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kitty_trapped for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTY_TRAPPED. This means the object wasn't registered. It's likely just mod options.
|
4021 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringmilk for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGMILK. This means the object wasn't registered. It's likely just mod options.
|
4022 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_kittybed_pouringfood for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_KITTYBED_POURINGFOOD. This means the object wasn't registered. It's likely just mod options.
|
4023 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4024 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
4025 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4026 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_death_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_DEATH_BABY. This means the object wasn't registered. It's likely just mod options.
|
4027 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT. This means the object wasn't registered. It's likely just mod options.
|
4028 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_lion_hurt_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_LION_HURT_BABY. This means the object wasn't registered. It's likely just mod options.
|
4029 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4030 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4031 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_mouse_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_MOUSE_HURT. This means the object wasn't registered. It's likely just mod options.
|
4032 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4033 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4034 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ogre_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OGRE_HURT. This means the object wasn't registered. It's likely just mod options.
|
4035 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4036 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_ambient_baby for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_AMBIENT_BABY. This means the object wasn't registered. It's likely just mod options.
|
4037 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4038 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_ostrich_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_OSTRICH_HURT. This means the object wasn't registered. It's likely just mod options.
|
4039 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4040 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_HURT. This means the object wasn't registered. It's likely just mod options.
|
4041 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rabbit_lift for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RABBIT_LIFT. This means the object wasn't registered. It's likely just mod options.
|
4042 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4043 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4044 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_raccoon_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RACCOON_HURT. This means the object wasn't registered. It's likely just mod options.
|
4045 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4046 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4047 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_rat_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_RAT_HURT. This means the object wasn't registered. It's likely just mod options.
|
4048 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4049 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_claw for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_CLAW. This means the object wasn't registered. It's likely just mod options.
|
4050 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4051 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_HURT. This means the object wasn't registered. It's likely just mod options.
|
4052 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_scorpion_sting for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SCORPION_STING. This means the object wasn't registered. It's likely just mod options.
|
4053 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4054 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
4055 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4056 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_HURT. This means the object wasn't registered. It's likely just mod options.
|
4057 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_rattle for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_RATTLE. This means the object wasn't registered. It's likely just mod options.
|
4058 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_snap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SNAP. This means the object wasn't registered. It's likely just mod options.
|
4059 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_snake_swim for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_SNAKE_SWIM. This means the object wasn't registered. It's likely just mod options.
|
4060 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4061 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turkey_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURKEY_HURT. This means the object wasn't registered. It's likely just mod options.
|
4062 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4063 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_angry for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_ANGRY. This means the object wasn't registered. It's likely just mod options.
|
4064 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4065 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_eating for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_EATING. This means the object wasn't registered. It's likely just mod options.
|
4066 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_turtle_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_TURTLE_HURT. This means the object wasn't registered. It's likely just mod options.
|
4067 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4068 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_ambient_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_AMBIENT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
4069 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4070 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_death_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_DEATH_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
4071 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt_human for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT_HUMAN. This means the object wasn't registered. It's likely just mod options.
|
4072 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
4073 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_werewolf_transform for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WEREWOLF_TRANSFORM. This means the object wasn't registered. It's likely just mod options.
|
4074 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4075 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4076 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4077 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wolf_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WOLF_HURT. This means the object wasn't registered. It's likely just mod options.
|
4078 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4079 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wraith_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WRAITH_HURT. This means the object wasn't registered. It's likely just mod options.
|
4080 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_ambient for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_AMBIENT. This means the object wasn't registered. It's likely just mod options.
|
4081 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_death for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_DEATH. This means the object wasn't registered. It's likely just mod options.
|
4082 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_hurt for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_HURT. This means the object wasn't registered. It's likely just mod options.
|
4083 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:entity_wyvern_wingflap for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ENTITY_WYVERN_WINGFLAP. This means the object wasn't registered. It's likely just mod options.
|
4084 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup mocreatures:item_record_shuffling for public static net.minecraft.util.SoundEvent drzhark.mocreatures.init.MoCSoundEvents.ITEM_RECORD_SHUFFLING. This means the object wasn't registered. It's likely just mod options.
|
4085 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bloodmagic for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bloodmagic. This means the object wasn't registered. It's likely just mod options.
|
4086 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
|
4087 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
|
4088 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
|
4089 | [15:25:12] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
|
4090 | [15:25:12] [Server thread/INFO] [FML]: Holder lookups applied
|
4091 | [15:25:12] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod minecraft
|
4092 | [15:25:12] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod minecraft
|
4093 | [15:25:12] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Minecraft took 0.000s
|
4094 | [15:25:12] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod mcp
|
4095 | [15:25:12] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod mcp
|
4096 | [15:25:12] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Minecraft Coder Pack took 0.001s
|
4097 | [15:25:12] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod FML
|
4098 | [15:25:12] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod FML
|
4099 | [15:25:12] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Forge Mod Loader took 0.000s
|
4100 | [15:25:12] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod forge
|
4101 | [15:25:12] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod forge
|
4102 | [15:25:12] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Minecraft Forge took 0.000s
|
4103 | [15:25:12] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod backpacked
|
4104 | [15:25:12] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod backpacked
|
4105 | [15:25:12] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Backpacked took 0.013s
|
4106 | [15:25:12] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod jei
|
4107 | [15:25:12] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod jei
|
4108 | [15:25:12] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Just Enough Items took 0.001s
|
4109 | [15:25:12] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod abyssalcraft
|
4110 | [15:25:24] [Server thread/INFO] [AbyssalCraft]: Just Enough Items is present, initializing informative stuff.
|
4111 | [15:25:24] [Server thread/INFO] [AbyssalCraft]: Mod integrations found: [Just Enough Items]
|
4112 | [15:25:24] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod abyssalcraft
|
4113 | [15:25:24] [Server thread/DEBUG] [FML]: Bar Step: Initialization - AbyssalCraft took 11.312s
|
4114 | [15:25:24] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod orbis-lib
|
4115 | [15:25:24] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod orbis-lib
|
4116 | [15:25:24] [Server thread/DEBUG] [FML]: Bar Step: Initialization - OrbisLib took 0.025s
|
4117 | [15:25:24] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod aether
|
4118 | [15:25:24] [Server thread/DEBUG] [AetherII]: 'Initialize blocks' completed in 1ms
|
4119 | [15:25:34] [Server thread/DEBUG] [AetherII]: 'Initialize equipment' completed in 9978ms
|
4120 | [15:25:34] [Server thread/DEBUG] [AetherII]: 'Initialize capabilities' completed in 262ms
|
4121 | [15:25:34] [Server thread/DEBUG] [AetherII]: 'Initialize templates' completed in 266ms
|
4122 | [15:25:35] [Server thread/DEBUG] [AetherII]: 'Initialize recipes' completed in 156ms
|
4123 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod aether
|
4124 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Aether II took 10.989s
|
4125 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod blocklings
|
4126 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod blocklings
|
4127 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Blocklings Mod took 0.001s
|
4128 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod bloodmoon
|
4129 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod bloodmoon
|
4130 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Bloodmoon took 0.000s
|
4131 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod chisel
|
4132 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod chisel
|
4133 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Chisel took 0.003s
|
4134 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod codechickenlib
|
4135 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod codechickenlib
|
4136 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - CodeChicken Lib took 0.000s
|
4137 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod customspawner
|
4138 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod customspawner
|
4139 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - DrZhark's CustomSpawner took 0.020s
|
4140 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod props
|
4141 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod props
|
4142 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Decocraft took 0.019s
|
4143 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod dldungeonsjbg
|
4144 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod dldungeonsjbg
|
4145 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Doomlike Dungeons took 0.088s
|
4146 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod mocreatures
|
4147 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod mocreatures
|
4148 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - DrZhark's Mo'Creatures Mod took 0.007s
|
4149 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod enderstorage
|
4150 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod enderstorage
|
4151 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - EnderStorage took 0.044s
|
4152 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod fastfurnace
|
4153 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod fastfurnace
|
4154 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - FastFurnace took 0.000s
|
4155 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod ironchest
|
4156 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod ironchest
|
4157 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Iron Chest took 0.062s
|
4158 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod lunatriuscore
|
4159 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod lunatriuscore
|
4160 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - LunatriusCore took 0.002s
|
4161 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod netherendingores
|
4162 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Registering Vanilla Recipes
|
4163 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_aluminum_ore", output "oreAluminium" not found.
|
4164 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_aluminum_ore", output "oreAluminum" not found.
|
4165 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_iridium_ore", output "oreIridium" not found.
|
4166 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_lead_ore", output "oreLead" not found.
|
4167 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_mithril_ore", output "oreMithril" not found.
|
4168 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_nickel_ore", output "oreNickel" not found.
|
4169 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_platinum_ore", output "orePlatinum" not found.
|
4170 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_silver_ore", output "oreSilver" not found.
|
4171 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_certus_quartz_ore", output "oreCertusQuartz" not found.
|
4172 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_charged_certus_quartz_ore", output "oreChargedCertusQuartz" not found.
|
4173 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_osmium_ore", output "oreOsmium" not found.
|
4174 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_uranium_ore", output "oreUranium" not found.
|
4175 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_yellorite_ore", output "oreYellorium" not found.
|
4176 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_yellorite_ore", output "oreYellorite" not found.
|
4177 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_dilithium_ore", output "oreDilithium" not found.
|
4178 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_tritanium_ore", output "oreTritanium" not found.
|
4179 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_zinc_ore", output "oreZinc" not found.
|
4180 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_ruby_ore", output "oreRuby" not found.
|
4181 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_sapphire_ore", output "oreSapphire" not found.
|
4182 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_peridot_ore", output "orePeridot" not found.
|
4183 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_electrotine_ore", output "oreElectrotine" not found.
|
4184 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_aluminum_ore", output "oreAluminium" not found.
|
4185 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_aluminum_ore", output "oreAluminum" not found.
|
4186 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_iridium_ore", output "oreIridium" not found.
|
4187 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_lead_ore", output "oreLead" not found.
|
4188 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_mithril_ore", output "oreMithril" not found.
|
4189 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_nickel_ore", output "oreNickel" not found.
|
4190 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_platinum_ore", output "orePlatinum" not found.
|
4191 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_silver_ore", output "oreSilver" not found.
|
4192 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_certus_quartz_ore", output "oreCertusQuartz" not found.
|
4193 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_charged_certus_quartz_ore", output "oreChargedCertusQuartz" not found.
|
4194 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_osmium_ore", output "oreOsmium" not found.
|
4195 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_uranium_ore", output "oreUranium" not found.
|
4196 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_yellorite_ore", output "oreYellorium" not found.
|
4197 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_yellorite_ore", output "oreYellorite" not found.
|
4198 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_dilithium_ore", output "oreDilithium" not found.
|
4199 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_tritanium_ore", output "oreTritanium" not found.
|
4200 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_zinc_ore", output "oreZinc" not found.
|
4201 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_ruby_ore", output "oreRuby" not found.
|
4202 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_sapphire_ore", output "oreSapphire" not found.
|
4203 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_peridot_ore", output "orePeridot" not found.
|
4204 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "nether_electrotine_ore", output "oreElectrotine" not found.
|
4205 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "overworld_cobalt_ore", output "ingotCobalt" not found.
|
4206 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "end_cobalt_ore", output "ingotCobalt" not found.
|
4207 | [15:25:35] [Server thread/DEBUG] [Netherending Ores]: Unable to register furnace input for "overworld_gravitite_ore", output "ingotGravitite" not found.
|
4208 | [15:25:35] [Server thread/INFO] [Netherending Ores]: Registered Vanilla Recipes
|
4209 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod netherendingores
|
4210 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Netherending Ores took 0.043s
|
4211 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod nei
|
4212 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod nei
|
4213 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Not Enough Items took 0.057s
|
4214 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod placebo
|
4215 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod placebo
|
4216 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Placebo took 0.000s
|
4217 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod schematica
|
4218 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod schematica
|
4219 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Schematica took 0.108s
|
4220 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod schematics
|
4221 | [15:25:35] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into schematics for type INSTANCE
|
4222 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod schematics
|
4223 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Schematics took 0.014s
|
4224 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod undergroundbiomes
|
4225 | [15:25:35] [Server thread/INFO] [undergroundbiomes]: [UndergroundBiomes] Init done!
|
4226 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod undergroundbiomes
|
4227 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Underground Biomes took 0.037s
|
4228 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLInitializationEvent to mod phosphor-lighting
|
4229 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLInitializationEvent to mod phosphor-lighting
|
4230 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: Initialization - Phosphor Lighting Engine took 0.001s
|
4231 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Finished: Initialization took 22.849s
|
4232 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod minecraft
|
4233 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod minecraft
|
4234 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod minecraft
|
4235 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Minecraft took 0.003s
|
4236 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod mcp
|
4237 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod mcp
|
4238 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod mcp
|
4239 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Minecraft Coder Pack took 0.004s
|
4240 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod FML
|
4241 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod FML
|
4242 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod FML
|
4243 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Forge Mod Loader took 0.000s
|
4244 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod forge
|
4245 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod forge
|
4246 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod forge
|
4247 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Minecraft Forge took 0.000s
|
4248 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod backpacked
|
4249 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod backpacked
|
4250 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod backpacked
|
4251 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Backpacked took 0.000s
|
4252 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod jei
|
4253 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod jei
|
4254 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod jei
|
4255 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Just Enough Items took 0.000s
|
4256 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod abyssalcraft
|
4257 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod abyssalcraft
|
4258 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod abyssalcraft
|
4259 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - AbyssalCraft took 0.018s
|
4260 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod orbis-lib
|
4261 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod orbis-lib
|
4262 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod orbis-lib
|
4263 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - OrbisLib took 0.003s
|
4264 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod aether
|
4265 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod aether
|
4266 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod aether
|
4267 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Aether II took 0.000s
|
4268 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod blocklings
|
4269 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod blocklings
|
4270 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod blocklings
|
4271 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Blocklings Mod took 0.013s
|
4272 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod bloodmoon
|
4273 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod bloodmoon
|
4274 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod bloodmoon
|
4275 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Bloodmoon took 0.003s
|
4276 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod chisel
|
4277 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod chisel
|
4278 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod chisel
|
4279 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Chisel took 0.089s
|
4280 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod codechickenlib
|
4281 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod codechickenlib
|
4282 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod codechickenlib
|
4283 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - CodeChicken Lib took 0.000s
|
4284 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod customspawner
|
4285 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod customspawner
|
4286 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod customspawner
|
4287 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - DrZhark's CustomSpawner took 0.008s
|
4288 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod props
|
4289 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod props
|
4290 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod props
|
4291 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Decocraft took 0.000s
|
4292 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod dldungeonsjbg
|
4293 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod dldungeonsjbg
|
4294 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod dldungeonsjbg
|
4295 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Doomlike Dungeons took 0.000s
|
4296 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod mocreatures
|
4297 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod mocreatures
|
4298 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod mocreatures
|
4299 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - DrZhark's Mo'Creatures Mod took 0.000s
|
4300 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod enderstorage
|
4301 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod enderstorage
|
4302 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod enderstorage
|
4303 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - EnderStorage took 0.001s
|
4304 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod fastfurnace
|
4305 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod fastfurnace
|
4306 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod fastfurnace
|
4307 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - FastFurnace took 0.000s
|
4308 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod ironchest
|
4309 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod ironchest
|
4310 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod ironchest
|
4311 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Iron Chest took 0.001s
|
4312 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 1 IMC messages to mod lunatriuscore
|
4313 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod lunatriuscore
|
4314 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod lunatriuscore
|
4315 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - LunatriusCore took 0.012s
|
4316 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod netherendingores
|
4317 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod netherendingores
|
4318 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod netherendingores
|
4319 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Netherending Ores took 0.003s
|
4320 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod nei
|
4321 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod nei
|
4322 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod nei
|
4323 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Not Enough Items took 0.000s
|
4324 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod placebo
|
4325 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod placebo
|
4326 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod placebo
|
4327 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Placebo took 0.014s
|
4328 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod schematica
|
4329 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod schematica
|
4330 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod schematica
|
4331 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Schematica took 0.003s
|
4332 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod schematics
|
4333 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod schematics
|
4334 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod schematics
|
4335 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Schematics took 0.001s
|
4336 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod undergroundbiomes
|
4337 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod undergroundbiomes
|
4338 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod undergroundbiomes
|
4339 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Underground Biomes took 0.000s
|
4340 | [15:25:35] [Server thread/TRACE] [FML]: Attempting to deliver 0 IMC messages to mod phosphor-lighting
|
4341 | [15:25:35] [Server thread/TRACE] [FML]: Sending event IMCEvent to mod phosphor-lighting
|
4342 | [15:25:35] [Server thread/TRACE] [FML]: Sent event IMCEvent to mod phosphor-lighting
|
4343 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: InterModComms$IMC - Phosphor Lighting Engine took 0.000s
|
4344 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Finished: InterModComms$IMC took 0.179s
|
4345 | [15:25:35] [Server thread/INFO] [FML]: Injecting itemstacks
|
4346 | [15:25:35] [Server thread/INFO] [FML]: Itemstack injection complete
|
4347 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod minecraft
|
4348 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod minecraft
|
4349 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Minecraft took 0.002s
|
4350 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod mcp
|
4351 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod mcp
|
4352 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Minecraft Coder Pack took 0.000s
|
4353 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod FML
|
4354 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod FML
|
4355 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Forge Mod Loader took 0.000s
|
4356 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod forge
|
4357 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod forge
|
4358 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Minecraft Forge took 0.005s
|
4359 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod backpacked
|
4360 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod backpacked
|
4361 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Backpacked took 0.000s
|
4362 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod jei
|
4363 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod jei
|
4364 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Just Enough Items took 0.000s
|
4365 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod abyssalcraft
|
4366 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod abyssalcraft
|
4367 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - AbyssalCraft took 0.127s
|
4368 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod orbis-lib
|
4369 | [15:25:35] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod orbis-lib
|
4370 | [15:25:35] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - OrbisLib took 0.001s
|
4371 | [15:25:35] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod aether
|
4372 | [15:25:36] [Server thread/DEBUG] [AetherII]: 'Register instances' completed in 37ms
|
4373 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod aether
|
4374 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Aether II took 0.149s
|
4375 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod blocklings
|
4376 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod blocklings
|
4377 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Blocklings Mod took 0.000s
|
4378 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod bloodmoon
|
4379 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod bloodmoon
|
4380 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Bloodmoon took 0.008s
|
4381 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod chisel
|
4382 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod chisel
|
4383 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Chisel took 0.000s
|
4384 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod codechickenlib
|
4385 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod codechickenlib
|
4386 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - CodeChicken Lib took 0.000s
|
4387 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod customspawner
|
4388 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod customspawner
|
4389 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - DrZhark's CustomSpawner took 0.007s
|
4390 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod props
|
4391 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod props
|
4392 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Decocraft took 0.001s
|
4393 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod dldungeonsjbg
|
4394 | [15:25:36] [Server thread/INFO] [DLDUNGEONS]: Loading custom NBT tags (nbt.cfg)
|
4395 | [15:25:36] [Server thread/INFO] [DLDUNGEONS]: Loading chest loot file (chests.cfg)
|
4396 | [15:25:36] [Server thread/INFO] [DLDUNGEONS]: Found 1 special chest configs.
|
4397 | [15:25:36] [Server thread/INFO] [DLDUNGEONS]: Loading chest loot file (oceanic_chests.cfg)
|
4398 | [15:25:36] [Server thread/INFO] [DLDUNGEONS]: Found 6 block family configs.
|
4399 | [15:25:36] [Server thread/INFO] [DLDUNGEONS]: Found 12 themes.
|
4400 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod dldungeonsjbg
|
4401 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Doomlike Dungeons took 0.426s
|
4402 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod mocreatures
|
4403 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod mocreatures
|
4404 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - DrZhark's Mo'Creatures Mod took 0.000s
|
4405 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod enderstorage
|
4406 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod enderstorage
|
4407 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - EnderStorage took 0.000s
|
4408 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod fastfurnace
|
4409 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod fastfurnace
|
4410 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - FastFurnace took 0.000s
|
4411 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod ironchest
|
4412 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod ironchest
|
4413 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Iron Chest took 0.000s
|
4414 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod lunatriuscore
|
4415 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod lunatriuscore
|
4416 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - LunatriusCore took 0.026s
|
4417 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod netherendingores
|
4418 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod netherendingores
|
4419 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Netherending Ores took 0.001s
|
4420 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod nei
|
4421 | [15:25:36] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod nei
|
4422 | [15:25:36] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Not Enough Items took 0.001s
|
4423 | [15:25:36] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod placebo
|
4424 | [15:25:36] [Server thread/INFO] [placebo]: Beginning replacement of all shapeless recipes...
|
4425 | [15:25:36] [Server thread/INFO] [placebo]: Expect log spam from FML!
|
4426 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `yellow_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4427 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `yellow_dye_from_sunflower`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4428 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `yellow_dye_from_dandelion`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4429 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `yellow_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4430 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `yellow_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4431 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `writable_book`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4432 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `white_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4433 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `trapped_chest`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4434 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `red_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4435 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `red_dye_from_tulip`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4436 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `red_dye_from_rose_bush`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4437 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `red_dye_from_poppy`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4438 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `red_dye_from_beetroot`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4439 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `red_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4440 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `red_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4441 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `purple_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4442 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `purple_dye`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4443 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `purple_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4444 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `purple_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4445 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pumpkin_pie`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4446 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pink_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4447 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pink_dye_from_red_bonemeal`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4448 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pink_dye_from_pink_tulip`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4449 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pink_dye_from_peony`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4450 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pink_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4451 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pink_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4452 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `orange_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4453 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `orange_dye_from_red_yellow`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4454 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `orange_dye_from_orange_tulip`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4455 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `orange_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4456 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `orange_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4457 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `mushroom_stew`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4458 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `mossy_stonebrick`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4459 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `magma_cream`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4460 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `magenta_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4461 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `magenta_dye_from_purple_and_pink`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4462 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `magenta_dye_from_lilac`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4463 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `magenta_dye_from_lapis_red_pink`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4464 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `magenta_dye_from_lapis_ink_bonemeal`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4465 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `magenta_dye_from_allium`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4466 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `magenta_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4467 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `magenta_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4468 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `lime_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4469 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `lime_dye`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4470 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `lime_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4471 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `lime_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4472 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_gray_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4473 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_gray_dye_from_white_tulip`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4474 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_gray_dye_from_oxeye_daisy`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4475 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_gray_dye_from_ink_bonemeal`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4476 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_gray_dye_from_gray_bonemeal`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4477 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_gray_dye_from_azure_bluet`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4478 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_gray_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4479 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_gray_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4480 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_blue_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4481 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_blue_dye_from_lapis_bonemeal`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4482 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_blue_dye_from_blue_orchid`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4483 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_blue_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4484 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `light_blue_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4485 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `green_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4486 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `green_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4487 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `green_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4488 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `gray_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4489 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `gray_dye`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4490 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `gray_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4491 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `gray_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4492 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `granite`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4493 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `flint_and_steel`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4494 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `fire_charge`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4495 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `fermented_spider_eye`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4496 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ender_eye`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4497 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cyan_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4498 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cyan_dye`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4499 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cyan_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4500 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `cyan_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4501 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `brown_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4502 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `brown_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4503 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `brown_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4504 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `book`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4505 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `bone_meal_from_bone`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4506 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `bone_meal_from_block`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4507 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `blue_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4508 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `blue_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4509 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `blue_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4510 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `blaze_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4511 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `black_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4512 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `black_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4513 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `black_bed_from_white_bed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4514 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `andesite`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4515 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `lifecrystal`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4516 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `fire_charge`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4517 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `engraving_azathoth`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4518 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `decorativestatue_6`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4519 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `decorativestatue_5`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4520 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `decorativestatue_4`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4521 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `decorativestatue_3`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4522 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `decorativestatue_2`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4523 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `decorativestatue_1`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4524 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `decorativestatue_0`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4525 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster9_alt_alt`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4526 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster9_alt`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4527 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster9`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4528 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster8_alt_alt`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4529 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster8_alt`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4530 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster8`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4531 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster7_alt`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4532 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster7`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4533 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster6_alt_alt`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4534 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster6_alt`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4535 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster6`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4536 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster5_alt`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4537 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster5`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4538 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster4_alt`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4539 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster4`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4540 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster3_alt`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4541 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster3`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4542 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `ccluster2`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4543 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `antidote_1`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4544 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `abyssalcraft` for name `antidote_0`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4545 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `aether` for name `misc/moa_feed_enchanted_blueberries`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4546 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `aether` for name `misc/moa_feed_blueberries`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4547 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `aether` for name `misc/moa_feed`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4548 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `aether` for name `consumables/splint`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4549 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `aether` for name `consumables/purple_swet_jelly`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4550 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `aether` for name `consumables/plumproot_pie`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4551 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `aether` for name `consumables/plumproot_mash`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4552 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `aether` for name `consumables/green_swet_jelly`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4553 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `aether` for name `consumables/blue_swet_jelly`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4554 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `aether` for name `consumables/bandage`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4555 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `aether` for name `consumables/antivenom_vial`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4556 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `aether` for name `consumables/antitoxin_vial`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4557 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `props` for name `clay_red`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4558 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `props` for name `clay_green`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4559 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `props` for name `clay_blue`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4560 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `wyvern_lair_planks`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4561 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `vanilla_wool`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4562 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `vanilla_leather`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4563 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `vanilla_bone_meal`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4564 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `turtle_soup`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4565 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `scroll_of_sale`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4566 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `scroll_of_freedom_1`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4567 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `scroll_of_freedom`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4568 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `scorp_sword_nether`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4569 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `scorp_sword_frost`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4570 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `scorp_sword_dirt`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4571 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `scorp_sword_cave`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4572 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `pet_food`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4573 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `mocreatures` for name `ogre_lair_planks`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4574 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `orange_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4575 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `purple_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4576 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `pink_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4577 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `light_blue_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4578 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `blue_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4579 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `brown_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4580 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `cyan_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4581 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `green_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4582 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `white_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4583 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `light_gray_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4584 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `red_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4585 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `yellow_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4586 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `black_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4587 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `lime_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4588 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `magenta_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4589 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `undergroundbiomes` for name `gray_concrete_powder`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4590 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `chisel` for name `chisel_hitech`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4591 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `netherendingores` for name `overworld_quartz_ore_to_ore_quartz`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4592 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `netherendingores` for name `end_quartz_ore_to_ore_quartz`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4593 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `netherendingores` for name `overworld_ambrosium_ore_to_ore_ambrosium`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4594 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `netherendingores` for name `overworld_gravitite_ore_to_ore_gravitite`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4595 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `netherendingores` for name `overworld_zanite_ore_to_ore_zanite`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4596 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `netherendingores` for name `overworld_arkenium_ore_to_ore_arkenium`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4597 | [15:25:36] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `netherendingores` for name `overworld_icestone_ore_to_ore_icestone`, expected `placebo`. This could be a intended override, but in most cases indicates a broken mod.
|
4598 | [15:25:36] [Server thread/INFO] [placebo]: Successfully replaced 172 recipes with fast recipes.
|
4599 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod placebo
|
4600 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Placebo took 0.425s
|
4601 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod schematica
|
4602 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod schematica
|
4603 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Schematica took 0.000s
|
4604 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod schematics
|
4605 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod schematics
|
4606 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Schematics took 0.000s
|
4607 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod undergroundbiomes
|
4608 | [15:25:37] [Server thread/INFO] [undergroundbiomes]: [UndergroundBiomes] Post-init done!
|
4609 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod undergroundbiomes
|
4610 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Underground Biomes took 0.097s
|
4611 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLPostInitializationEvent to mod phosphor-lighting
|
4612 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLPostInitializationEvent to mod phosphor-lighting
|
4613 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: PostInitialization - Phosphor Lighting Engine took 0.005s
|
4614 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Finished: PostInitialization took 1.286s
|
4615 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod minecraft
|
4616 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod minecraft
|
4617 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Minecraft took 0.000s
|
4618 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod mcp
|
4619 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod mcp
|
4620 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Minecraft Coder Pack took 0.000s
|
4621 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod FML
|
4622 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod FML
|
4623 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Forge Mod Loader took 0.000s
|
4624 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod forge
|
4625 | [15:25:37] [Server thread/DEBUG] [FML]: Forge RecipeSorter Baking:
|
4626 | [15:25:37] [Server thread/DEBUG] [FML]: 16: RecipeEntry("Before", UNKNOWN, )
|
4627 | [15:25:37] [Server thread/DEBUG] [FML]: 15: RecipeEntry("minecraft:shaped", SHAPED, net.minecraft.item.crafting.ShapedRecipes) Before: minecraft:shapeless
|
4628 | [15:25:37] [Server thread/DEBUG] [FML]: 14: RecipeEntry("forge:shapedore", SHAPED, net.minecraftforge.oredict.ShapedOreRecipe) Before: minecraft:shapeless After: minecraft:shaped
|
4629 | [15:25:37] [Server thread/DEBUG] [FML]: 13: RecipeEntry("minecraft:mapextending", SHAPED, net.minecraft.item.crafting.RecipesMapExtending) Before: minecraft:shapeless After: minecraft:shaped
|
4630 | [15:25:37] [Server thread/DEBUG] [FML]: 12: RecipeEntry("minecraft:shapeless", SHAPELESS, net.minecraft.item.crafting.ShapelessRecipes) After: minecraft:shaped
|
4631 | [15:25:37] [Server thread/DEBUG] [FML]: 11: RecipeEntry("minecraft:repair", SHAPELESS, net.minecraft.item.crafting.RecipeRepairItem) After: minecraft:shapeless
|
4632 | [15:25:37] [Server thread/DEBUG] [FML]: 10: RecipeEntry("minecraft:shield_deco", SHAPELESS, net.minecraft.item.crafting.ShieldRecipes$Decoration) After: minecraft:shapeless
|
4633 | [15:25:37] [Server thread/DEBUG] [FML]: 9: RecipeEntry("minecraft:armordyes", SHAPELESS, net.minecraft.item.crafting.RecipesArmorDyes) After: minecraft:shapeless
|
4634 | [15:25:37] [Server thread/DEBUG] [FML]: 8: RecipeEntry("minecraft:fireworks", SHAPELESS, net.minecraft.item.crafting.RecipeFireworks) After: minecraft:shapeless
|
4635 | [15:25:37] [Server thread/DEBUG] [FML]: 7: RecipeEntry("minecraft:pattern_dupe", SHAPELESS, net.minecraft.item.crafting.RecipesBanners$RecipeDuplicatePattern) After: minecraft:shapeless
|
4636 | [15:25:37] [Server thread/DEBUG] [FML]: 6: RecipeEntry("minecraft:tippedarrow", SHAPELESS, net.minecraft.item.crafting.RecipeTippedArrow) After: minecraft:shapeless
|
4637 | [15:25:37] [Server thread/DEBUG] [FML]: 5: RecipeEntry("minecraft:mapcloning", SHAPELESS, net.minecraft.item.crafting.RecipesMapCloning) After: minecraft:shapeless
|
4638 | [15:25:37] [Server thread/DEBUG] [FML]: 4: RecipeEntry("forge:shapelessore", SHAPELESS, net.minecraftforge.oredict.ShapelessOreRecipe) After: minecraft:shapeless
|
4639 | [15:25:37] [Server thread/DEBUG] [FML]: 3: RecipeEntry("minecraft:pattern_add", SHAPELESS, net.minecraft.item.crafting.RecipesBanners$RecipeAddPattern) After: minecraft:shapeless
|
4640 | [15:25:37] [Server thread/DEBUG] [FML]: 2: RecipeEntry("minecraft:bookcloning", SHAPELESS, net.minecraft.item.crafting.RecipeBookCloning) After: minecraft:shapeless
|
4641 | [15:25:37] [Server thread/DEBUG] [FML]: 1: RecipeEntry("After", UNKNOWN, )
|
4642 | [15:25:37] [Server thread/DEBUG] [FML]: Sorting recipes
|
4643 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod forge
|
4644 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Minecraft Forge took 0.032s
|
4645 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod backpacked
|
4646 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod backpacked
|
4647 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Backpacked took 0.000s
|
4648 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod jei
|
4649 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod jei
|
4650 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Just Enough Items took 0.001s
|
4651 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod abyssalcraft
|
4652 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod abyssalcraft
|
4653 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - AbyssalCraft took 0.001s
|
4654 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod orbis-lib
|
4655 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod orbis-lib
|
4656 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - OrbisLib took 0.000s
|
4657 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod aether
|
4658 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod aether
|
4659 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Aether II took 0.000s
|
4660 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod blocklings
|
4661 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod blocklings
|
4662 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Blocklings Mod took 0.000s
|
4663 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod bloodmoon
|
4664 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod bloodmoon
|
4665 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Bloodmoon took 0.000s
|
4666 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod chisel
|
4667 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod chisel
|
4668 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Chisel took 0.000s
|
4669 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod codechickenlib
|
4670 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod codechickenlib
|
4671 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - CodeChicken Lib took 0.000s
|
4672 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod customspawner
|
4673 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod customspawner
|
4674 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - DrZhark's CustomSpawner took 0.000s
|
4675 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod props
|
4676 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod props
|
4677 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Decocraft took 0.004s
|
4678 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod dldungeonsjbg
|
4679 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod dldungeonsjbg
|
4680 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Doomlike Dungeons took 0.000s
|
4681 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod mocreatures
|
4682 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod mocreatures
|
4683 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - DrZhark's Mo'Creatures Mod took 0.000s
|
4684 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod enderstorage
|
4685 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod enderstorage
|
4686 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - EnderStorage took 0.000s
|
4687 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod fastfurnace
|
4688 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod fastfurnace
|
4689 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - FastFurnace took 0.000s
|
4690 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod ironchest
|
4691 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod ironchest
|
4692 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Iron Chest took 0.000s
|
4693 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod lunatriuscore
|
4694 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod lunatriuscore
|
4695 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - LunatriusCore took 0.002s
|
4696 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod netherendingores
|
4697 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod netherendingores
|
4698 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Netherending Ores took 0.000s
|
4699 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod nei
|
4700 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod nei
|
4701 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Not Enough Items took 0.001s
|
4702 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod placebo
|
4703 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod placebo
|
4704 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Placebo took 0.000s
|
4705 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod schematica
|
4706 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod schematica
|
4707 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Schematica took 0.003s
|
4708 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod schematics
|
4709 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod schematics
|
4710 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Schematics took 0.000s
|
4711 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod undergroundbiomes
|
4712 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod undergroundbiomes
|
4713 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Underground Biomes took 0.000s
|
4714 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLLoadCompleteEvent to mod phosphor-lighting
|
4715 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLLoadCompleteEvent to mod phosphor-lighting
|
4716 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: LoadComplete - Phosphor Lighting Engine took 0.000s
|
4717 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Finished: LoadComplete took 0.050s
|
4718 | [15:25:37] [Server thread/DEBUG] [FML]: Freezing registries
|
4719 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod minecraft
|
4720 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod minecraft
|
4721 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Minecraft took 0.001s
|
4722 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod mcp
|
4723 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod mcp
|
4724 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Minecraft Coder Pack took 0.000s
|
4725 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod FML
|
4726 | [15:25:37] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod FML
|
4727 | [15:25:37] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Forge Mod Loader took 0.002s
|
4728 | [15:25:37] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod forge
|
4729 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod forge
|
4730 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Minecraft Forge took 8.716s
|
4731 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod backpacked
|
4732 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod backpacked
|
4733 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Backpacked took 0.000s
|
4734 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod jei
|
4735 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod jei
|
4736 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Just Enough Items took 0.000s
|
4737 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod abyssalcraft
|
4738 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod abyssalcraft
|
4739 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - AbyssalCraft took 0.000s
|
4740 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod orbis-lib
|
4741 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod orbis-lib
|
4742 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - OrbisLib took 0.000s
|
4743 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod aether
|
4744 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod aether
|
4745 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Aether II took 0.000s
|
4746 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod blocklings
|
4747 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod blocklings
|
4748 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Blocklings Mod took 0.000s
|
4749 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod bloodmoon
|
4750 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod bloodmoon
|
4751 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Bloodmoon took 0.000s
|
4752 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod chisel
|
4753 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod chisel
|
4754 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Chisel took 0.000s
|
4755 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod codechickenlib
|
4756 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod codechickenlib
|
4757 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - CodeChicken Lib took 0.000s
|
4758 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod customspawner
|
4759 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod customspawner
|
4760 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - DrZhark's CustomSpawner took 0.000s
|
4761 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod props
|
4762 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod props
|
4763 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Decocraft took 0.000s
|
4764 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod dldungeonsjbg
|
4765 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod dldungeonsjbg
|
4766 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Doomlike Dungeons took 0.000s
|
4767 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod mocreatures
|
4768 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod mocreatures
|
4769 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - DrZhark's Mo'Creatures Mod took 0.000s
|
4770 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod enderstorage
|
4771 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod enderstorage
|
4772 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - EnderStorage took 0.000s
|
4773 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod fastfurnace
|
4774 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod fastfurnace
|
4775 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - FastFurnace took 0.000s
|
4776 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod ironchest
|
4777 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod ironchest
|
4778 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Iron Chest took 0.000s
|
4779 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod lunatriuscore
|
4780 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod lunatriuscore
|
4781 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - LunatriusCore took 0.000s
|
4782 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod netherendingores
|
4783 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod netherendingores
|
4784 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Netherending Ores took 0.000s
|
4785 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod nei
|
4786 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod nei
|
4787 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Not Enough Items took 0.000s
|
4788 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod placebo
|
4789 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod placebo
|
4790 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Placebo took 0.000s
|
4791 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod schematica
|
4792 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod schematica
|
4793 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Schematica took 0.000s
|
4794 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod schematics
|
4795 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod schematics
|
4796 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Schematics took 0.000s
|
4797 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod undergroundbiomes
|
4798 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod undergroundbiomes
|
4799 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Underground Biomes took 0.000s
|
4800 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLModIdMappingEvent to mod phosphor-lighting
|
4801 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLModIdMappingEvent to mod phosphor-lighting
|
4802 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ModIdMapping - Phosphor Lighting Engine took 0.000s
|
4803 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Finished: ModIdMapping took 8.725s
|
4804 | [15:25:46] [Server thread/DEBUG] [FML]: All registries frozen
|
4805 | [15:25:46] [Server thread/INFO] [FML]: Forge Mod Loader has successfully loaded 28 mods
|
4806 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod minecraft
|
4807 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod minecraft
|
4808 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Minecraft took 0.006s
|
4809 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod mcp
|
4810 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod mcp
|
4811 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Minecraft Coder Pack took 0.000s
|
4812 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod FML
|
4813 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod FML
|
4814 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Forge Mod Loader took 0.000s
|
4815 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod forge
|
4816 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod forge
|
4817 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Minecraft Forge took 0.000s
|
4818 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod backpacked
|
4819 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod backpacked
|
4820 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Backpacked took 0.000s
|
4821 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod jei
|
4822 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod jei
|
4823 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Just Enough Items took 0.000s
|
4824 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod abyssalcraft
|
4825 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod abyssalcraft
|
4826 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - AbyssalCraft took 0.002s
|
4827 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod orbis-lib
|
4828 | [15:25:46] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod orbis-lib
|
4829 | [15:25:46] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - OrbisLib took 0.000s
|
4830 | [15:25:46] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod aether
|
4831 | [15:25:48] [Server thread/ERROR] [OrbisLib]: WARNING: A mod data file (trees\skyroot\mutated_tree - eb6b4fd4-1cf4-4fff-901f-d7ed6eeb1716:31dae1da-5d8a-4a6c-833d-0296367f5326:Player155) has a different identifier assigned after loading (Old identifier: 02afc608-3e90-4589-8fe6-ce03a0e68b0e:8e954611-5766-484a-8ca1-a17ad4861184:OscarPayn). This usually means the original identifier has a null UUID data id or the identifier itself is null. Please reimport this data into your project OUTSIDE of the development workspace and let it assign itself the correct metadata.
|
4832 | [15:25:48] [Server thread/DEBUG] [AetherII]: 'Verify Orbis project manager' completed in 2321ms
|
4833 | [15:25:49] [Server thread/DEBUG] [AetherII]: 'Load generation' completed in 199ms
|
4834 | [15:25:49] [Server thread/DEBUG] [AetherII]: 'Register SeeEntityEvents' completed in 1ms
|
4835 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod aether
|
4836 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Aether II took 2.582s
|
4837 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod blocklings
|
4838 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod blocklings
|
4839 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Blocklings Mod took 0.001s
|
4840 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod bloodmoon
|
4841 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod bloodmoon
|
4842 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Bloodmoon took 0.000s
|
4843 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod chisel
|
4844 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod chisel
|
4845 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Chisel took 0.000s
|
4846 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod codechickenlib
|
4847 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod codechickenlib
|
4848 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - CodeChicken Lib took 0.001s
|
4849 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod customspawner
|
4850 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod customspawner
|
4851 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - DrZhark's CustomSpawner took 0.001s
|
4852 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod props
|
4853 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod props
|
4854 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Decocraft took 0.000s
|
4855 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod dldungeonsjbg
|
4856 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod dldungeonsjbg
|
4857 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Doomlike Dungeons took 0.000s
|
4858 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod mocreatures
|
4859 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod mocreatures
|
4860 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - DrZhark's Mo'Creatures Mod took 0.001s
|
4861 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod enderstorage
|
4862 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod enderstorage
|
4863 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - EnderStorage took 0.000s
|
4864 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod fastfurnace
|
4865 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod fastfurnace
|
4866 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - FastFurnace took 0.000s
|
4867 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod ironchest
|
4868 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod ironchest
|
4869 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Iron Chest took 0.000s
|
4870 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod lunatriuscore
|
4871 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod lunatriuscore
|
4872 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - LunatriusCore took 0.000s
|
4873 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod netherendingores
|
4874 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod netherendingores
|
4875 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Netherending Ores took 0.000s
|
4876 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod nei
|
4877 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod nei
|
4878 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Not Enough Items took 0.000s
|
4879 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod placebo
|
4880 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod placebo
|
4881 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Placebo took 0.000s
|
4882 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod schematica
|
4883 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod schematica
|
4884 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Schematica took 0.000s
|
4885 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod schematics
|
4886 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod schematics
|
4887 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Schematics took 0.000s
|
4888 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod undergroundbiomes
|
4889 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod undergroundbiomes
|
4890 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Underground Biomes took 0.001s
|
4891 | [15:25:49] [Server thread/TRACE] [FML]: Sending event FMLServerAboutToStartEvent to mod phosphor-lighting
|
4892 | [15:25:49] [Server thread/TRACE] [FML]: Sent event FMLServerAboutToStartEvent to mod phosphor-lighting
|
4893 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Step: ServerAboutToStart - Phosphor Lighting Engine took 0.000s
|
4894 | [15:25:49] [Server thread/DEBUG] [FML]: Bar Finished: ServerAboutToStart took 2.599s
|
4895 | [15:25:49] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Preparing level "world"
|
4896 | [15:26:01] [Server thread/WARN] [net.minecraft.network.datasync.EntityDataManager]: defineId called for: class com.shinoow.abyssalcraft.common.entity.EntityDreadSpawn from class com.shinoow.abyssalcraft.common.entity.EntityChagarothSpawn
|
4897 | [15:26:02] [Server thread/WARN] [net.minecraft.network.datasync.EntityDataManager]: defineId called for: class com.shinoow.abyssalcraft.common.entity.EntityGreaterDreadSpawn from class com.shinoow.abyssalcraft.common.entity.EntityLesserDreadbeast
|
4898 | [15:26:02] [Server thread/INFO] [AetherII]: Loading shop definition from file /assets/aether/shop/edison.json
|
4899 | [15:26:02] [Server thread/INFO] [AetherII]: Loading shop definition from file /assets/aether/shop/edison_holiday.json
|
4900 | [15:26:02] [Server thread/INFO] [AetherII]: Loading shop definition from file /assets/aether/shop/mysterious_figure.json
|
4901 | [15:26:03] [Server thread/WARN] [net.minecraft.network.datasync.EntityDataManager]: defineId called for: class net.minecraft.entity.EntityCreature from class drzhark.mocreatures.entity.MoCEntityMob
|
4902 | [15:26:03] [Server thread/WARN] [net.minecraft.network.datasync.EntityDataManager]: defineId called for: class net.minecraft.entity.EntityCreature from class drzhark.mocreatures.entity.MoCEntityMob
|
4903 | [15:26:03] [Server thread/WARN] [net.minecraft.network.datasync.EntityDataManager]: defineId called for: class net.minecraft.entity.EntityCreature from class drzhark.mocreatures.entity.MoCEntityMob
|
4904 | [15:26:03] [Server thread/WARN] [net.minecraft.network.datasync.EntityDataManager]: defineId called for: class net.minecraft.entity.EntityCreature from class drzhark.mocreatures.entity.MoCEntityMob
|
4905 | [15:26:21] [Server thread/INFO] [FML]: Loading dimension 0 (world) (net.minecraft.server.dedicated.DedicatedServer@4335f016)
|
4906 | [15:26:22] [Server thread/ERROR] [net.minecraft.advancements.AdvancementManager]: Parsing error loading built-in advancement minecraft:recipes/redstone/stone_button
|
4907 | com.google.gson.JsonSyntaxException: Unknown recipe 'minecraft:stone_button'
|
4908 | at net.minecraft.advancements.AdvancementRewards$Deserializer.deserialize(AdvancementRewards.java:171) ~[l$a.class:?]
|
4909 | at net.minecraft.advancements.AdvancementRewards$Deserializer.deserialize(AdvancementRewards.java:147) ~[l$a.class:?]
|
4910 | at com.google.gson.internal.bind.TreeTypeAdapter.read(TreeTypeAdapter.java:69) ~[TreeTypeAdapter.class:?]
|
4911 | at com.google.gson.Gson.fromJson(Gson.java:887) ~[Gson.class:?]
|
4912 | at com.google.gson.Gson.fromJson(Gson.java:952) ~[Gson.class:?]
|
4913 | at com.google.gson.internal.bind.TreeTypeAdapter$GsonContextImpl.deserialize(TreeTypeAdapter.java:162) ~[TreeTypeAdapter$GsonContextImpl.class:?]
|
4914 | at net.minecraft.util.JsonUtils.func_188179_a(SourceFile:439) ~[rc.class:?]
|
4915 | at net.minecraft.util.JsonUtils.func_188177_a(SourceFile:455) ~[rc.class:?]
|
4916 | at net.minecraft.advancements.Advancement$Builder.func_192059_a(SourceFile:203) ~[i$a.class:?]
|
4917 | at net.minecraft.advancements.AdvancementManager$1.deserialize(AdvancementManager.java:50) ~[ns$1.class:?]
|
4918 | at net.minecraft.advancements.AdvancementManager$1.deserialize(AdvancementManager.java:46) ~[ns$1.class:?]
|
4919 | at com.google.gson.internal.bind.TreeTypeAdapter.read(TreeTypeAdapter.java:69) ~[TreeTypeAdapter.class:?]
|
4920 | at net.minecraft.util.JsonUtils.func_188173_a(SourceFile:492) ~[rc.class:?]
|
4921 | at net.minecraft.util.JsonUtils.func_193839_a(SourceFile:532) ~[rc.class:?]
|
4922 | at net.minecraft.advancements.AdvancementManager.func_192777_a(AdvancementManager.java:184) [ns.class:?]
|
4923 | at net.minecraft.advancements.AdvancementManager.func_192779_a(AdvancementManager.java:68) [ns.class:?]
|
4924 | at net.minecraft.advancements.AdvancementManager.<init>(AdvancementManager.java:60) [ns.class:?]
|
4925 | at net.minecraft.world.WorldServer.func_175643_b(WorldServer.java:156) [oo.class:?]
|
4926 | at net.minecraft.server.MinecraftServer.func_71247_a(MinecraftServer.java:298) [MinecraftServer.class:?]
|
4927 | at net.minecraft.server.dedicated.DedicatedServer.func_71197_b(DedicatedServer.java:270) [nz.class:?]
|
4928 | at net.minecraft.server.MinecraftServer.run(MinecraftServer.java:486) [MinecraftServer.class:?]
|
4929 | at java.lang.Thread.run(Thread.java:748) [?:1.8.0_222]
|
4930 | [15:26:22] [Server thread/ERROR] [net.minecraft.advancements.AdvancementManager]: Parsing error loading built-in advancement minecraft:recipes/building_blocks/sandstone
|
4931 | com.google.gson.JsonSyntaxException: Unknown recipe 'minecraft:sandstone'
|
4932 | at net.minecraft.advancements.AdvancementRewards$Deserializer.deserialize(AdvancementRewards.java:171) ~[l$a.class:?]
|
4933 | at net.minecraft.advancements.AdvancementRewards$Deserializer.deserialize(AdvancementRewards.java:147) ~[l$a.class:?]
|
4934 | at com.google.gson.internal.bind.TreeTypeAdapter.read(TreeTypeAdapter.java:69) ~[TreeTypeAdapter.class:?]
|
4935 | at com.google.gson.Gson.fromJson(Gson.java:887) ~[Gson.class:?]
|
4936 | at com.google.gson.Gson.fromJson(Gson.java:952) ~[Gson.class:?]
|
4937 | at com.google.gson.internal.bind.TreeTypeAdapter$GsonContextImpl.deserialize(TreeTypeAdapter.java:162) ~[TreeTypeAdapter$GsonContextImpl.class:?]
|
4938 | at net.minecraft.util.JsonUtils.func_188179_a(SourceFile:439) ~[rc.class:?]
|
4939 | at net.minecraft.util.JsonUtils.func_188177_a(SourceFile:455) ~[rc.class:?]
|
4940 | at net.minecraft.advancements.Advancement$Builder.func_192059_a(SourceFile:203) ~[i$a.class:?]
|
4941 | at net.minecraft.advancements.AdvancementManager$1.deserialize(AdvancementManager.java:50) ~[ns$1.class:?]
|
4942 | at net.minecraft.advancements.AdvancementManager$1.deserialize(AdvancementManager.java:46) ~[ns$1.class:?]
|
4943 | at com.google.gson.internal.bind.TreeTypeAdapter.read(TreeTypeAdapter.java:69) ~[TreeTypeAdapter.class:?]
|
4944 | at net.minecraft.util.JsonUtils.func_188173_a(SourceFile:492) ~[rc.class:?]
|
4945 | at net.minecraft.util.JsonUtils.func_193839_a(SourceFile:532) ~[rc.class:?]
|
4946 | at net.minecraft.advancements.AdvancementManager.func_192777_a(AdvancementManager.java:184) [ns.class:?]
|
4947 | at net.minecraft.advancements.AdvancementManager.func_192779_a(AdvancementManager.java:68) [ns.class:?]
|
4948 | at net.minecraft.advancements.AdvancementManager.<init>(AdvancementManager.java:60) [ns.class:?]
|
4949 | at net.minecraft.world.WorldServer.func_175643_b(WorldServer.java:156) [oo.class:?]
|
4950 | at net.minecraft.server.MinecraftServer.func_71247_a(MinecraftServer.java:298) [MinecraftServer.class:?]
|
4951 | at net.minecraft.server.dedicated.DedicatedServer.func_71197_b(DedicatedServer.java:270) [nz.class:?]
|
4952 | at net.minecraft.server.MinecraftServer.run(MinecraftServer.java:486) [MinecraftServer.class:?]
|
4953 | at java.lang.Thread.run(Thread.java:748) [?:1.8.0_222]
|
4954 | [15:26:22] [Server thread/ERROR] [net.minecraft.advancements.AdvancementManager]: Parsing error loading built-in advancement minecraft:recipes/building_blocks/mossy_cobblestone
|
4955 | com.google.gson.JsonSyntaxException: Unknown recipe 'minecraft:mossy_cobblestone'
|
4956 | at net.minecraft.advancements.AdvancementRewards$Deserializer.deserialize(AdvancementRewards.java:171) ~[l$a.class:?]
|
4957 | at net.minecraft.advancements.AdvancementRewards$Deserializer.deserialize(AdvancementRewards.java:147) ~[l$a.class:?]
|
4958 | at com.google.gson.internal.bind.TreeTypeAdapter.read(TreeTypeAdapter.java:69) ~[TreeTypeAdapter.class:?]
|
4959 | at com.google.gson.Gson.fromJson(Gson.java:887) ~[Gson.class:?]
|
4960 | at com.google.gson.Gson.fromJson(Gson.java:952) ~[Gson.class:?]
|
4961 | at com.google.gson.internal.bind.TreeTypeAdapter$GsonContextImpl.deserialize(TreeTypeAdapter.java:162) ~[TreeTypeAdapter$GsonContextImpl.class:?]
|
4962 | at net.minecraft.util.JsonUtils.func_188179_a(SourceFile:439) ~[rc.class:?]
|
4963 | at net.minecraft.util.JsonUtils.func_188177_a(SourceFile:455) ~[rc.class:?]
|
4964 | at net.minecraft.advancements.Advancement$Builder.func_192059_a(SourceFile:203) ~[i$a.class:?]
|
4965 | at net.minecraft.advancements.AdvancementManager$1.deserialize(AdvancementManager.java:50) ~[ns$1.class:?]
|
4966 | at net.minecraft.advancements.AdvancementManager$1.deserialize(AdvancementManager.java:46) ~[ns$1.class:?]
|
4967 | at com.google.gson.internal.bind.TreeTypeAdapter.read(TreeTypeAdapter.java:69) ~[TreeTypeAdapter.class:?]
|
4968 | at net.minecraft.util.JsonUtils.func_188173_a(SourceFile:492) ~[rc.class:?]
|
4969 | at net.minecraft.util.JsonUtils.func_193839_a(SourceFile:532) ~[rc.class:?]
|
4970 | at net.minecraft.advancements.AdvancementManager.func_192777_a(AdvancementManager.java:184) [ns.class:?]
|
4971 | at net.minecraft.advancements.AdvancementManager.func_192779_a(AdvancementManager.java:68) [ns.class:?]
|
4972 | at net.minecraft.advancements.AdvancementManager.<init>(AdvancementManager.java:60) [ns.class:?]
|
4973 | at net.minecraft.world.WorldServer.func_175643_b(WorldServer.java:156) [oo.class:?]
|
4974 | at net.minecraft.server.MinecraftServer.func_71247_a(MinecraftServer.java:298) [MinecraftServer.class:?]
|
4975 | at net.minecraft.server.dedicated.DedicatedServer.func_71197_b(DedicatedServer.java:270) [nz.class:?]
|
4976 | at net.minecraft.server.MinecraftServer.run(MinecraftServer.java:486) [MinecraftServer.class:?]
|
4977 | at java.lang.Thread.run(Thread.java:748) [?:1.8.0_222]
|
4978 | [15:26:23] [Server thread/INFO] [net.minecraft.advancements.AdvancementList]: Loaded 494 advancements
|
4979 | [15:26:25] [Server thread/DEBUG] [mixin]: Mixing common.MixinExtendedBlockStorage from mixins.phosphor.json into net.minecraft.world.chunk.storage.ExtendedBlockStorage
|
4980 | [15:26:25] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/NibbleArray to metadata cache
|
4981 | [15:26:36] [Server thread/DEBUG] [NotEnoughItems]: Loading NEI Server
|
4982 | [15:26:36] [Server thread/INFO] [undergroundbiomes]: [UBConfig] Loading configuration
|
4983 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property CrashOnProblems initialized with value false
|
4984 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Realistic initialized with value false
|
4985 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyRecipes initialized with value true
|
4986 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyOres initialized with value true
|
4987 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property RegularStoneCrafting initialized with value 4
|
4988 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property HarnessModifier initialized with value 1.0
|
4989 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ResistanceModifier initialized with value 1.0
|
4990 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property BiomeSize initialized with value 4
|
4991 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property GenerationHeight initialized with value 256
|
4992 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property RegularStoneBiomes initialized with value false
|
4993 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property HarmoniousStrata initialized with value false
|
4994 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property IncludedDimensions initialized with value *
|
4995 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ExcludedDimensions initialized with value -1,1
|
4996 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DimensionSpecificSeeds initialized with value false
|
4997 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyVillages initialized with value true
|
4998 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceCobblestone initialized with value true
|
4999 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceMonsterStone initialized with value true
|
5000 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceOvergrown initialized with value true
|
5001 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceMossyCobble initialized with value true
|
5002 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceQuarkSpeleothems initialized with value true
|
5003 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceGravel initialized with value true
|
5004 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSand initialized with value true
|
5005 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSandstone initialized with value true
|
5006 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceClay initialized with value true
|
5007 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSandExcludedBiomes initialized with value minecraft:beaches,minecraft:desert,minecraft:cold_beach,minecraft:desert_hills,biomesoplenty:oasis
|
5008 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceGravelExcludedBiomes initialized with value biomesoplenty:cold_desert
|
5009 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceClayExcludedBiomes initialized with value
|
5010 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property PlainSlabTextures initialized with value false
|
5011 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtons initialized with value true
|
5012 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtonsTypes initialized with value 7
|
5013 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtonsStyles initialized with value 3
|
5014 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairs initialized with value true
|
5015 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairsTypes initialized with value 7
|
5016 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairsStyles initialized with value 7
|
5017 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWalls initialized with value true
|
5018 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWallsTypes initialized with value 7
|
5019 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWallsStyles initialized with value 7
|
5020 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ChangeButtonRecipe initialized with value 8
|
5021 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DisableVanillaStoneVariants initialized with value false
|
5022 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DisplayOriginalModInOreTooltip initialized with value true
|
5023 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextBefore initialized with value Ore from
|
5024 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextBeforeFormatting initialized with value gray
|
5025 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipOreModNameFormatting initialized with value gold italic
|
5026 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextAfter initialized with value
|
5027 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextAfterFormatting initialized with value gray
|
5028 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property CustomOreHardness initialized with value null
|
5029 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.sand, metadata 0 initialized with value true
|
5030 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.stone, metadata 0 initialized with value true
|
5031 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 0, limestone initialized with value true
|
5032 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 1, chalk initialized with value true
|
5033 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 2, shale initialized with value true
|
5034 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 3, siltstone initialized with value true
|
5035 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 4, lignite initialized with value true
|
5036 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 5, dolomite initialized with value true
|
5037 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 6, greywacke initialized with value true
|
5038 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 7, chert initialized with value true
|
5039 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 0, red_granite initialized with value true
|
5040 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 1, black_granite initialized with value true
|
5041 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 2, rhyolite initialized with value true
|
5042 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 3, andesite initialized with value true
|
5043 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 4, gabbro initialized with value true
|
5044 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 5, basalt initialized with value true
|
5045 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 6, komatiite initialized with value true
|
5046 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 7, dacite initialized with value true
|
5047 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 0, gneiss initialized with value true
|
5048 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 1, eclogite initialized with value true
|
5049 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 2, marble initialized with value true
|
5050 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 3, quartzite initialized with value true
|
5051 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 4, blueschist initialized with value true
|
5052 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 5, greenschist initialized with value true
|
5053 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 6, soapstone initialized with value true
|
5054 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 7, migmatite initialized with value true
|
5055 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.sandStone, metadata 0 initialized with value true
|
5056 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
5057 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesWallsStyles = 2
|
5058 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
5059 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesButtonsStyles = 1
|
5060 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
5061 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesStairsStyles = 6
|
5062 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
5063 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> DisableVanillaStoneVariants = true
|
5064 | [15:26:36] [Server thread/INFO] [undergroundbiomes]: [UBConfig] Loading configuration
|
5065 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property CrashOnProblems initialized with value false
|
5066 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Realistic initialized with value false
|
5067 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyRecipes initialized with value true
|
5068 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyOres initialized with value true
|
5069 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property RegularStoneCrafting initialized with value 4
|
5070 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property HarnessModifier initialized with value 1.0
|
5071 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ResistanceModifier initialized with value 1.0
|
5072 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property BiomeSize initialized with value 4
|
5073 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property GenerationHeight initialized with value 256
|
5074 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property RegularStoneBiomes initialized with value false
|
5075 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property HarmoniousStrata initialized with value false
|
5076 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property IncludedDimensions initialized with value *
|
5077 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ExcludedDimensions initialized with value -1,1
|
5078 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DimensionSpecificSeeds initialized with value false
|
5079 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UBifyVillages initialized with value true
|
5080 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceCobblestone initialized with value true
|
5081 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceMonsterStone initialized with value true
|
5082 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceOvergrown initialized with value true
|
5083 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceMossyCobble initialized with value true
|
5084 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceQuarkSpeleothems initialized with value true
|
5085 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceGravel initialized with value true
|
5086 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSand initialized with value true
|
5087 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSandstone initialized with value true
|
5088 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceClay initialized with value true
|
5089 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceSandExcludedBiomes initialized with value minecraft:beaches,minecraft:desert,minecraft:cold_beach,minecraft:desert_hills,biomesoplenty:oasis
|
5090 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceGravelExcludedBiomes initialized with value biomesoplenty:cold_desert
|
5091 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ReplaceClayExcludedBiomes initialized with value
|
5092 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property PlainSlabTextures initialized with value false
|
5093 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtons initialized with value true
|
5094 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtonsTypes initialized with value 7
|
5095 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesButtonsStyles initialized with value 3
|
5096 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairs initialized with value true
|
5097 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairsTypes initialized with value 7
|
5098 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesStairsStyles initialized with value 7
|
5099 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWalls initialized with value true
|
5100 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWallsTypes initialized with value 7
|
5101 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property UndergroundBiomesWallsStyles initialized with value 7
|
5102 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property ChangeButtonRecipe initialized with value 8
|
5103 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DisableVanillaStoneVariants initialized with value false
|
5104 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property DisplayOriginalModInOreTooltip initialized with value true
|
5105 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextBefore initialized with value Ore from
|
5106 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextBeforeFormatting initialized with value gray
|
5107 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipOreModNameFormatting initialized with value gold italic
|
5108 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextAfter initialized with value
|
5109 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property OreTooltipTextAfterFormatting initialized with value gray
|
5110 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property CustomOreHardness initialized with value null
|
5111 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.sand, metadata 0 initialized with value true
|
5112 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 0, limestone initialized with value true
|
5113 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 1, chalk initialized with value true
|
5114 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 2, shale initialized with value true
|
5115 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 3, siltstone initialized with value true
|
5116 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 4, lignite initialized with value true
|
5117 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 5, dolomite initialized with value true
|
5118 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 6, greywacke initialized with value true
|
5119 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate sedimentary stone metadata 7, chert initialized with value true
|
5120 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 0, red_granite initialized with value true
|
5121 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 1, black_granite initialized with value true
|
5122 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 2, rhyolite initialized with value true
|
5123 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 3, andesite initialized with value true
|
5124 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 4, gabbro initialized with value true
|
5125 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 5, basalt initialized with value true
|
5126 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 6, komatiite initialized with value true
|
5127 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate igneous stone metadata 7, dacite initialized with value true
|
5128 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 0, gneiss initialized with value true
|
5129 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 1, eclogite initialized with value true
|
5130 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 2, marble initialized with value true
|
5131 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 3, quartzite initialized with value true
|
5132 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 4, blueschist initialized with value true
|
5133 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 5, greenschist initialized with value true
|
5134 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 6, soapstone initialized with value true
|
5135 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate metamorphic stone metadata 7, migmatite initialized with value true
|
5136 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.sandStone, metadata 0 initialized with value true
|
5137 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Property Generate tile.stone, metadata 0 initialized with value true
|
5138 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
5139 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesWallsStyles = 2
|
5140 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
5141 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesButtonsStyles = 1
|
5142 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
5143 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesStairsStyles = 6
|
5144 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
5145 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> DisableVanillaStoneVariants = true
|
5146 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
5147 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesWallsStyles = 2
|
5148 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
5149 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesButtonsStyles = 1
|
5150 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
5151 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> UndergroundBiomesStairsStyles = 6
|
5152 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] Adding override to property Realistic
|
5153 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [UBConfig] If value == true -> DisableVanillaStoneVariants = true
|
5154 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [class exterminatorjeff.undergroundbiomes.world.WorldGenManager 0] Dimension 0 will be UBified
|
5155 | [15:26:36] [Server thread/DEBUG] [undergroundbiomes]: [class exterminatorjeff.undergroundbiomes.world.WorldGenManager 0] Dimension 0 loaded
|
5156 | [15:27:10] [Server thread/INFO] [FML]: Loading dimension -1 (world) (net.minecraft.server.dedicated.DedicatedServer@4335f016)
|
5157 | [15:27:10] [Server thread/INFO] [FML]: Loading dimension 1 (world) (net.minecraft.server.dedicated.DedicatedServer@4335f016)
|
5158 | [15:27:29] [Server thread/INFO] [FML]: Loading dimension 50 (world) (net.minecraft.server.dedicated.DedicatedServer@4335f016)
|
5159 | [15:27:37] [Server thread/INFO] [FML]: Loading dimension 51 (world) (net.minecraft.server.dedicated.DedicatedServer@4335f016)
|
5160 | [15:27:58] [Server thread/INFO] [FML]: Loading dimension 52 (world) (net.minecraft.server.dedicated.DedicatedServer@4335f016)
|
5161 | [15:28:17] [Server thread/INFO] [FML]: Loading dimension 53 (world) (net.minecraft.server.dedicated.DedicatedServer@4335f016)
|
5162 | [15:28:45] [Server thread/INFO] [FML]: Loading dimension 3 (world) (net.minecraft.server.dedicated.DedicatedServer@4335f016)
|
5163 | [15:28:57] [Server thread/INFO] [FML]: Loading dimension -17 (world) (net.minecraft.server.dedicated.DedicatedServer@4335f016)
|
5164 | [15:29:21] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing start region for level 0
|
5165 | [15:29:22] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 1%
|
5166 | [15:29:23] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 2%
|
5167 | [15:29:25] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 4%
|
5168 | [15:29:26] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 4%
|
5169 | [15:29:27] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 5%
|
5170 | [15:29:41] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 5%
|
5171 | [15:29:42] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 6%
|
5172 | [15:29:43] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 7%
|
5173 | [15:29:45] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 7%
|
5174 | [15:29:54] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 8%
|
5175 | [15:29:56] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 9%
|
5176 | [15:29:57] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 9%
|
5177 | [15:29:58] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 10%
|
5178 | [15:30:07] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 10%
|
5179 | [15:30:09] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 11%
|
5180 | [15:30:10] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 12%
|
5181 | [15:30:11] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 13%
|
5182 | [15:30:22] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 14%
|
5183 | [15:30:23] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 15%
|
5184 | [15:30:25] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 15%
|
5185 | [15:30:26] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 17%
|
5186 | [15:30:35] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 17%
|
5187 | [15:30:36] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 18%
|
5188 | [15:30:37] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 20%
|
5189 | [15:30:47] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 20%
|
5190 | [15:30:48] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 21%
|
5191 | [15:30:49] [Server Shutdown Thread/INFO] [net.minecraft.server.MinecraftServer]: Stopping server
|
5192 | [15:30:49] [Server Shutdown Thread/INFO] [net.minecraft.server.MinecraftServer]: Saving players
|
5193 | [15:30:49] [Server Shutdown Thread/INFO] [net.minecraft.server.MinecraftServer]: Saving worlds
|
5194 | [15:30:49] [Server Shutdown Thread/INFO] [net.minecraft.server.MinecraftServer]: Saving chunks for level 'world'/overworld
|
5195 | [15:30:49] [Server Shutdown Thread/DEBUG] [FML]: Gathering id map for writing to world save world
|
5196 | [15:30:49] [Server thread/INFO] [net.minecraft.server.MinecraftServer]: Preparing spawn area: 22%
|
5197 | [15:31:02] [Aternos System/ERROR] [LOG]: Server was stopped because it took too long to start. Try reducing the load to avoid this in the future.
|