[15:05:51] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLServerTweaker
[15:05:51] [main/INFO] [LaunchWrapper]: Using primary tweak class name net.minecraftforge.fml.common.launcher.FMLServerTweaker
[15:05:51] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLServerTweaker
[15:05:51] [main/DEBUG] [FML]: Injecting tracing printstreams for STDOUT/STDERR.
[15:05:51] [main/INFO] [FML]: Forge Mod Loader version 14.23.5.2854 for Minecraft 1.12.2 loading
[15:05:51] [main/INFO] [FML]: Java is OpenJDK 64-Bit Server VM, version 1.8.0_265, running on Linux:amd64:4.15.0-117-generic, installed at /usr/local/openjdk-8/jre
[15:05:51] [main/DEBUG] [FML]: Java classpath at launch is:
[15:05:51] [main/DEBUG] [FML]: forge.jar
[15:05:51] [main/DEBUG] [FML]: /jolokia/jolokia.jar
[15:05:51] [main/DEBUG] [FML]: Java library path at launch is:
[15:05:51] [main/DEBUG] [FML]: /usr/java/packages/lib/amd64
[15:05:51] [main/DEBUG] [FML]: /usr/lib64
[15:05:51] [main/DEBUG] [FML]: /lib64
[15:05:51] [main/DEBUG] [FML]: /lib
[15:05:51] [main/DEBUG] [FML]: /usr/lib
[15:05:51] [main/DEBUG] [FML]: Determined Minecraft Libraries Root: /server/libraries
[15:05:52] [main/DEBUG] [FML]: Cleaning up mods folder: ./mods
[15:05:52] [main/DEBUG] [FML]: Examining file: NaturesCompass-1.12.2-1.8.5.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: foamflower-1.12.2-1.0.0.0-beta1.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: placeableitems-3.3.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: ldshadowlady-customcraftingtables-1.0.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: Forgelin-1.8.4.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: tropicraft-MC1.12.2-7.1.9.115.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: iceandfire-1.9.1-1.12.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: Xaeros_Minimap_21.4.1_Forge_1.12.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: CraftTweaker2-1.12-4.1.20.618.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: Patchouli-1.0-23.6.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: llibrary-1.7.20-1.12.2.jar
[15:05:52] [main/DEBUG] [FML]: Found existing ContainedDep llibrary-core-1.0.11-1.12.2.jar(net.ilexiconn:llibrary-core:1.0.11-1.12.2) from /server/mods/memory_repo/net/ilexiconn/llibrary-core/1.0.11-1.12.2/llibrary-core-1.0.11-1.12.2.jar extracted to ./mods/llibrary-1.7.20-1.12.2.jar, skipping extraction
[15:05:52] [main/DEBUG] [FML]: Examining file: llibrary-core-1.0.11-1.12.2.jar
[15:05:52] [main/DEBUG] [FML]: Making maven link for net.ilexiconn:llibrary:1.7.20-1.12.2 in memory to /server/./mods/llibrary-1.7.20-1.12.2.jar.
[15:05:52] [main/DEBUG] [FML]: Examining file: Hats-1.12.2-7.1.1.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: IvToolkit-1.3.3-1.12.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: BetterFps-1.4.8.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: iChunUtil-1.12.2-7.2.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: Quark-r1.6-179.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: extrautils2-1.12-1.9.9.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: ultimate_unicorn_mod-1.12.2-1.5.17.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: Hwyla-1.8.26-B41_1.12.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: HatStand-1.12.2-7.1.0.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: Morph-1.12.2-7.2.1.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: modtweaker-4.0.18.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: PTRLib-1.0.4.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: Atum-1.12.2-2.0.20.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: mcw-fences-1.0.0-mc1.12.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: ImprovedBackpacks-1.12.2-1.5.0.0.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: RecurrentComplex-1.4.8.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: AutoRegLib-1.3-32.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: expandedbonemeal-1.11-1.2.1.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: GooglyEyes-1.12.2-7.1.1.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: advancedcombat-1.1.2-[1.12].jar
[15:05:52] [main/DEBUG] [FML]: Examining file: vending-1.12.2-3.0.1.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: comfycozy-1.3.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: themidnight-0.3.5.jar
[15:05:52] [main/DEBUG] [FML]: Making maven link for com.mushroom:themidnight:0.3.5 in memory to /server/./mods/themidnight-0.3.5.jar.
[15:05:52] [main/DEBUG] [FML]: Examining file: Decocraft-2.6.3_1.12.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: FriendshipBracelet-1.1.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: MoreLootStuff-1.12.2-0.0.5.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: Chisel-MC1.12.2-1.0.2.45.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: PattysMoreStuff-stable-1.1.8.5.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: fairylights-2.2.0-1.12.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: Clumps-3.1.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: BiblioCraft[v2.4.5][MC1.12.2].jar
[15:05:52] [main/DEBUG] [FML]: Examining file: BabyMobs-1.12-1.5.5.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: wings-1.1.6-1.12.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: jei_1.12.2-4.16.1.301.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: outfox-0.1.5-mc1.12.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: CTM-MC1.12.2-1.0.2.31.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: gravestone-1.10.3.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: Baubles-1.12-1.5.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: twilightforest-1.12.2-3.11.1021-universal.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: Floocraft 1.12.2-1.9.6.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: inventorypets-1.12-2.0.12.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: Skye's Bakery 2.1.1 for MC1.12.2.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: BiomesOPlenty-1.12.2-7.0.1.2293-universal.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: MTLib-3.0.6.jar
[15:05:52] [main/DEBUG] [FML]: Examining file: aether_ii-1.12.2-0.3.0+build411-universal.jar
[15:05:53] [main/DEBUG] [FML]: Found existing ContainedDep orbis-lib-1.12.2-0.2.0+build411-universal.jar(com.gildedgames:orbis-lib:1.12.2-0.2.0+build411) from /server/mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar extracted to ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar, skipping extraction
[15:05:53] [main/DEBUG] [FML]: Examining file: orbis-lib-1.12.2-0.2.0+build411.jar
[15:05:53] [main/DEBUG] [FML]: Found existing ContainedDep phosphor-1.12.2-0.2.6+build50-universal.jar(me.jellysquid.mods:phosphor:1.12.2-0.2.6+build50) from /server/mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar extracted to ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar, skipping extraction
[15:05:53] [main/DEBUG] [FML]: Examining file: phosphor-1.12.2-0.2.6+build50.jar
[15:05:53] [main/DEBUG] [FML]: Examining file: RoguelikeDungeons-1.12.2-1.8.0.jar
[15:05:53] [main/DEBUG] [FML]: Examining file: Craftable Saddles[1.12]-1.3.jar
[15:05:53] [main/DEBUG] [FML]: Examining file: furniture-6.3.1-1.12.2.jar
[15:05:53] [main/DEBUG] [FML]: Examining file: mcw-bridges-1.0.4-mc1.12.2.jar
[15:05:53] [main/DEBUG] [FML]: Examining file: JRFTL[1.12.2]-1.1.jar
[15:05:53] [main/DEBUG] [FML]: File already proccessed /server/./mods/memory_repo/net/ilexiconn/llibrary-core/1.0.11-1.12.2/llibrary-core-1.0.11-1.12.2.jar, Skipping
[15:05:53] [main/DEBUG] [FML]: File already proccessed /server/./mods/llibrary-1.7.20-1.12.2.jar, Skipping
[15:05:53] [main/DEBUG] [FML]: File already proccessed /server/./mods/themidnight-0.3.5.jar, Skipping
[15:05:53] [main/DEBUG] [FML]: File already proccessed /server/./mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar, Skipping
[15:05:53] [main/DEBUG] [FML]: File already proccessed /server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar, Skipping
[15:05:53] [main/DEBUG] [FML]: Enabling runtime deobfuscation
[15:05:53] [main/DEBUG] [FML]: Instantiating coremod class FMLCorePlugin
[15:05:53] [main/DEBUG] [FML]: Found signing certificates for coremod FMLCorePlugin (net.minecraftforge.fml.relauncher.FMLCorePlugin)
[15:05:53] [main/DEBUG] [FML]: Found certificate e3c3d50c7c986df74c645c0ac54639741c90a557
[15:05:53] [main/DEBUG] [FML]: Added access transformer class net.minecraftforge.fml.common.asm.transformers.AccessTransformer to enqueued access transformers
[15:05:53] [main/DEBUG] [FML]: Enqueued coremod FMLCorePlugin
[15:05:53] [main/DEBUG] [FML]: Instantiating coremod class FMLForgePlugin
[15:05:53] [main/DEBUG] [FML]: Found signing certificates for coremod FMLForgePlugin (net.minecraftforge.classloading.FMLForgePlugin)
[15:05:53] [main/DEBUG] [FML]: Found certificate e3c3d50c7c986df74c645c0ac54639741c90a557
[15:05:53] [main/DEBUG] [FML]: Enqueued coremod FMLForgePlugin
[15:05:53] [main/DEBUG] [FML]: All fundamental core mods are successfully located
[15:05:54] [main/DEBUG] [FML]: Discovering coremods
[15:05:54] [main/INFO] [FML]: Searching /server/./mods for mods
[15:05:54] [main/DEBUG] [FML]: Adding NaturesCompass-1.12.2-1.8.5.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding foamflower-1.12.2-1.0.0.0-beta1.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding placeableitems-3.3.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding ldshadowlady-customcraftingtables-1.0.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Forgelin-1.8.4.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding tropicraft-MC1.12.2-7.1.9.115.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding iceandfire-1.9.1-1.12.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Xaeros_Minimap_21.4.1_Forge_1.12.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding CraftTweaker2-1.12-4.1.20.618.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Patchouli-1.0-23.6.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding llibrary-1.7.20-1.12.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Hats-1.12.2-7.1.1.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding IvToolkit-1.3.3-1.12.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding BetterFps-1.4.8.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding iChunUtil-1.12.2-7.2.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Quark-r1.6-179.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding extrautils2-1.12-1.9.9.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding ultimate_unicorn_mod-1.12.2-1.5.17.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Hwyla-1.8.26-B41_1.12.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding HatStand-1.12.2-7.1.0.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Morph-1.12.2-7.2.1.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding modtweaker-4.0.18.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding PTRLib-1.0.4.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Atum-1.12.2-2.0.20.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding mcw-fences-1.0.0-mc1.12.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding ImprovedBackpacks-1.12.2-1.5.0.0.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding RecurrentComplex-1.4.8.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding AutoRegLib-1.3-32.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding expandedbonemeal-1.11-1.2.1.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding GooglyEyes-1.12.2-7.1.1.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding advancedcombat-1.1.2-[1.12].jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding vending-1.12.2-3.0.1.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding comfycozy-1.3.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding themidnight-0.3.5.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Decocraft-2.6.3_1.12.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding FriendshipBracelet-1.1.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding MoreLootStuff-1.12.2-0.0.5.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Chisel-MC1.12.2-1.0.2.45.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding PattysMoreStuff-stable-1.1.8.5.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding fairylights-2.2.0-1.12.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Clumps-3.1.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding BiblioCraft[v2.4.5][MC1.12.2].jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding BabyMobs-1.12-1.5.5.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding wings-1.1.6-1.12.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding jei_1.12.2-4.16.1.301.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding outfox-0.1.5-mc1.12.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding CTM-MC1.12.2-1.0.2.31.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding gravestone-1.10.3.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Baubles-1.12-1.5.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding twilightforest-1.12.2-3.11.1021-universal.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Floocraft 1.12.2-1.9.6.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding inventorypets-1.12-2.0.12.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Skye's Bakery 2.1.1 for MC1.12.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding BiomesOPlenty-1.12.2-7.0.1.2293-universal.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding MTLib-3.0.6.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding aether_ii-1.12.2-0.3.0+build411-universal.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding RoguelikeDungeons-1.12.2-1.8.0.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding Craftable Saddles[1.12]-1.3.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding furniture-6.3.1-1.12.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding mcw-bridges-1.0.4-mc1.12.2.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Adding JRFTL[1.12.2]-1.1.jar to the mod list
[15:05:54] [main/DEBUG] [FML]: Examining for coremod candidacy advancedcombat-1.1.2-[1.12].jar
[15:05:54] [main/DEBUG] [FML]: Not found coremod data in advancedcombat-1.1.2-[1.12].jar
[15:05:54] [main/DEBUG] [FML]: Examining for coremod candidacy aether_ii-1.12.2-0.3.0+build411-universal.jar
[15:05:54] [main/DEBUG] [FML]: Not found coremod data in aether_ii-1.12.2-0.3.0+build411-universal.jar
[15:05:54] [main/DEBUG] [FML]: Examining for coremod candidacy Atum-1.12.2-2.0.20.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in Atum-1.12.2-2.0.20.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy AutoRegLib-1.3-32.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in AutoRegLib-1.3-32.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy BabyMobs-1.12-1.5.5.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in BabyMobs-1.12-1.5.5.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Baubles-1.12-1.5.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in Baubles-1.12-1.5.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy BetterFps-1.4.8.jar
[15:05:55] [main/INFO] [FML]: Loading tweaker guichaguri.betterfps.tweaker.BetterFpsTweaker from BetterFps-1.4.8.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy BiblioCraft[v2.4.5][MC1.12.2].jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in BiblioCraft[v2.4.5][MC1.12.2].jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy BiomesOPlenty-1.12.2-7.0.1.2293-universal.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in BiomesOPlenty-1.12.2-7.0.1.2293-universal.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Chisel-MC1.12.2-1.0.2.45.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in Chisel-MC1.12.2-1.0.2.45.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Clumps-3.1.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in Clumps-3.1.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy comfycozy-1.3.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in comfycozy-1.3.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Craftable Saddles[1.12]-1.3.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in Craftable Saddles[1.12]-1.3.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy CraftTweaker2-1.12-4.1.20.618.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in CraftTweaker2-1.12-4.1.20.618.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy CTM-MC1.12.2-1.0.2.31.jar
[15:05:55] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in CTM-MC1.12.2-1.0.2.31.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[15:05:55] [main/DEBUG] [FML]: Instantiating coremod class CTMCorePlugin
[15:05:55] [main/WARN] [FML]: The coremod team.chisel.ctm.client.asm.CTMCorePlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft
[15:05:55] [main/WARN] [FML]: The coremod CTMCorePlugin (team.chisel.ctm.client.asm.CTMCorePlugin) is not signed!
[15:05:55] [main/DEBUG] [FML]: Enqueued coremod CTMCorePlugin
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Decocraft-2.6.3_1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in Decocraft-2.6.3_1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy expandedbonemeal-1.11-1.2.1.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in expandedbonemeal-1.11-1.2.1.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy extrautils2-1.12-1.9.9.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in extrautils2-1.12-1.9.9.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy fairylights-2.2.0-1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in fairylights-2.2.0-1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Floocraft 1.12.2-1.9.6.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in Floocraft 1.12.2-1.9.6.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy foamflower-1.12.2-1.0.0.0-beta1.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in foamflower-1.12.2-1.0.0.0-beta1.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Forgelin-1.8.4.jar
[15:05:55] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in Forgelin-1.8.4.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[15:05:55] [main/DEBUG] [FML]: Instantiating coremod class ForgelinPlugin
[15:05:55] [main/WARN] [FML]: The coremod net.shadowfacts.forgelin.preloader.ForgelinPlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft
[15:05:55] [main/WARN] [FML]: The coremod ForgelinPlugin (net.shadowfacts.forgelin.preloader.ForgelinPlugin) is not signed!
[15:05:55] [main/DEBUG] [FML]: Enqueued coremod ForgelinPlugin
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy FriendshipBracelet-1.1.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in FriendshipBracelet-1.1.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy furniture-6.3.1-1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in furniture-6.3.1-1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy GooglyEyes-1.12.2-7.1.1.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in GooglyEyes-1.12.2-7.1.1.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy gravestone-1.10.3.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in gravestone-1.10.3.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Hats-1.12.2-7.1.1.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in Hats-1.12.2-7.1.1.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy HatStand-1.12.2-7.1.0.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in HatStand-1.12.2-7.1.0.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Hwyla-1.8.26-B41_1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in Hwyla-1.8.26-B41_1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy iceandfire-1.9.1-1.12.2.jar
[15:05:55] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in iceandfire-1.9.1-1.12.2.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[15:05:55] [main/DEBUG] [FML]: Instantiating coremod class IceAndFirePlugin
[15:05:55] [main/TRACE] [FML]: coremod named iceandfire is loading
[15:05:55] [main/DEBUG] [FML]: The coremod com.github.alexthe666.iceandfire.asm.IceAndFirePlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
[15:05:55] [main/WARN] [FML]: The coremod iceandfire (com.github.alexthe666.iceandfire.asm.IceAndFirePlugin) is not signed!
[15:05:55] [main/DEBUG] [FML]: Enqueued coremod iceandfire
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy iChunUtil-1.12.2-7.2.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in iChunUtil-1.12.2-7.2.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy ImprovedBackpacks-1.12.2-1.5.0.0.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in ImprovedBackpacks-1.12.2-1.5.0.0.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy inventorypets-1.12-2.0.12.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in inventorypets-1.12-2.0.12.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy IvToolkit-1.3.3-1.12.jar
[15:05:55] [main/TRACE] [FML]: Adding IvToolkit-1.3.3-1.12.jar to the list of known coremods, it will not be examined again
[15:05:55] [main/DEBUG] [FML]: Instantiating coremod class IvToolkitLoadingPlugin
[15:05:55] [main/TRACE] [FML]: coremod named IvToolkit is loading
[15:05:55] [main/WARN] [FML]: The coremod ivorius.ivtoolkit.IvToolkitLoadingPlugin does not have a MCVersion annotation, it may cause issues with this version of Minecraft
[15:05:55] [main/WARN] [FML]: The coremod IvToolkit (ivorius.ivtoolkit.IvToolkitLoadingPlugin) is not signed!
[15:05:55] [main/DEBUG] [FML]: Enqueued coremod IvToolkit
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy jei_1.12.2-4.16.1.301.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in jei_1.12.2-4.16.1.301.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy JRFTL[1.12.2]-1.1.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in JRFTL[1.12.2]-1.1.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy ldshadowlady-customcraftingtables-1.0.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in ldshadowlady-customcraftingtables-1.0.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy mcw-bridges-1.0.4-mc1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in mcw-bridges-1.0.4-mc1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy mcw-fences-1.0.0-mc1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in mcw-fences-1.0.0-mc1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy modtweaker-4.0.18.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in modtweaker-4.0.18.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy MoreLootStuff-1.12.2-0.0.5.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in MoreLootStuff-1.12.2-0.0.5.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Morph-1.12.2-7.2.1.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in Morph-1.12.2-7.2.1.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy MTLib-3.0.6.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in MTLib-3.0.6.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy NaturesCompass-1.12.2-1.8.5.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in NaturesCompass-1.12.2-1.8.5.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy outfox-0.1.5-mc1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in outfox-0.1.5-mc1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Patchouli-1.0-23.6.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in Patchouli-1.0-23.6.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy PattysMoreStuff-stable-1.1.8.5.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in PattysMoreStuff-stable-1.1.8.5.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy placeableitems-3.3.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in placeableitems-3.3.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy PTRLib-1.0.4.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in PTRLib-1.0.4.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Quark-r1.6-179.jar
[15:05:55] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in Quark-r1.6-179.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[15:05:55] [main/DEBUG] [FML]: Instantiating coremod class LoadingPlugin
[15:05:55] [main/TRACE] [FML]: coremod named Quark Plugin is loading
[15:05:55] [main/DEBUG] [FML]: The coremod vazkii.quark.base.asm.LoadingPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
[15:05:55] [main/WARN] [FML]: The coremod Quark Plugin (vazkii.quark.base.asm.LoadingPlugin) is not signed!
[15:05:55] [main/DEBUG] [FML]: Enqueued coremod Quark Plugin
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy RecurrentComplex-1.4.8.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in RecurrentComplex-1.4.8.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy RoguelikeDungeons-1.12.2-1.8.0.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in RoguelikeDungeons-1.12.2-1.8.0.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Skye's Bakery 2.1.1 for MC1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in Skye's Bakery 2.1.1 for MC1.12.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy tropicraft-MC1.12.2-7.1.9.115.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in tropicraft-MC1.12.2-7.1.9.115.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy twilightforest-1.12.2-3.11.1021-universal.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in twilightforest-1.12.2-3.11.1021-universal.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy ultimate_unicorn_mod-1.12.2-1.5.17.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in ultimate_unicorn_mod-1.12.2-1.5.17.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy vending-1.12.2-3.0.1.2.jar
[15:05:55] [main/DEBUG] [FML]: Not found coremod data in vending-1.12.2-3.0.1.2.jar
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy wings-1.1.6-1.12.2.jar
[15:05:55] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in wings-1.1.6-1.12.2.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[15:05:55] [main/DEBUG] [FML]: Instantiating coremod class WingsLoadingPlugin
[15:05:55] [main/TRACE] [FML]: coremod named wings is loading
[15:05:55] [main/DEBUG] [FML]: The coremod me.paulf.wings.server.asm.plugin.WingsLoadingPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
[15:05:55] [main/WARN] [FML]: The coremod wings (me.paulf.wings.server.asm.plugin.WingsLoadingPlugin) is not signed!
[15:05:55] [main/DEBUG] [FML]: Enqueued coremod wings
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy Xaeros_Minimap_21.4.1_Forge_1.12.jar
[15:05:55] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in Xaeros_Minimap_21.4.1_Forge_1.12.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[15:05:55] [main/DEBUG] [FML]: Instantiating coremod class XaeroMinimapPlugin
[15:05:55] [main/DEBUG] [FML]: The coremod xaero.common.core.XaeroMinimapPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
[15:05:55] [main/WARN] [FML]: The coremod XaeroMinimapPlugin (xaero.common.core.XaeroMinimapPlugin) is not signed!
[15:05:55] [main/DEBUG] [FML]: Enqueued coremod XaeroMinimapPlugin
[15:05:55] [main/DEBUG] [FML]: Examining for coremod candidacy llibrary-core-1.0.11-1.12.2.jar
[15:05:55] [main/TRACE] [FML]: Adding llibrary-core-1.0.11-1.12.2.jar to the list of known coremods, it will not be examined again
[15:05:55] [main/DEBUG] [FML]: Instantiating coremod class LLibraryPlugin
[15:05:56] [main/TRACE] [FML]: coremod named llibrary is loading
[15:05:56] [main/DEBUG] [FML]: The coremod net.ilexiconn.llibrary.server.core.plugin.LLibraryPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
[15:05:56] [main/DEBUG] [FML]: Found signing certificates for coremod llibrary (net.ilexiconn.llibrary.server.core.plugin.LLibraryPlugin)
[15:05:56] [main/DEBUG] [FML]: Found certificate b9f30a813bee3b9dd5652c460310cfcd54f6b7ec
[15:05:56] [main/DEBUG] [FML]: Enqueued coremod llibrary
[15:05:56] [main/DEBUG] [FML]: Examining for coremod candidacy llibrary-1.7.20-1.12.2.jar
[15:05:56] [main/DEBUG] [FML]: Not found coremod data in llibrary-1.7.20-1.12.2.jar
[15:05:56] [main/DEBUG] [FML]: Examining for coremod candidacy themidnight-0.3.5.jar
[15:05:56] [main/WARN] [FML]: Found FMLCorePluginContainsFMLMod marker in themidnight-0.3.5.jar. This is not recommended, @Mods should be in a separate jar from the coremod.
[15:05:56] [main/DEBUG] [FML]: Instantiating coremod class MidnightLoadingPlugin
[15:05:56] [main/TRACE] [FML]: coremod named midnight is loading
[15:05:56] [main/DEBUG] [FML]: The coremod com.mushroom.midnight.core.MidnightLoadingPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
[15:05:56] [main/WARN] [FML]: The coremod midnight (com.mushroom.midnight.core.MidnightLoadingPlugin) is not signed!
[15:05:56] [main/DEBUG] [FML]: Enqueued coremod midnight
[15:05:56] [main/DEBUG] [FML]: Examining for coremod candidacy orbis-lib-1.12.2-0.2.0+build411.jar
[15:05:56] [main/DEBUG] [FML]: Not found coremod data in orbis-lib-1.12.2-0.2.0+build411.jar
[15:05:56] [main/DEBUG] [FML]: Examining for coremod candidacy phosphor-1.12.2-0.2.6+build50.jar
[15:05:56] [main/INFO] [FML]: Loading tweaker org.spongepowered.asm.launch.MixinTweaker from phosphor-1.12.2-0.2.6+build50.jar
[15:05:56] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker
[15:05:56] [main/INFO] [LaunchWrapper]: Loading tweak class name guichaguri.betterfps.tweaker.BetterFpsTweaker
[15:05:56] [main/INFO] [LaunchWrapper]: Loading tweak class name org.spongepowered.asm.launch.MixinTweaker
[15:05:56] [main/DEBUG] [mixin]: MixinService [LaunchWrapper] was successfully booted in sun.misc.Launcher$AppClassLoader@18b4aac2
[15:05:56] [main/INFO] [mixin]: SpongePowered MIXIN Subsystem Version=0.7.11 Source=file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar Service=LaunchWrapper Env=SERVER
[15:05:57] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #1
[15:05:57] [main/DEBUG] [mixin]: Initialising Mixin Platform Manager
[15:05:57] [main/DEBUG] [mixin]: Mixin platform: primary container is file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
[15:05:57] [main/DEBUG] [mixin]: Adding mixin platform agents for container file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
[15:05:57] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentFML for file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
[15:05:57] [main/DEBUG] [mixin]: ForceLoadAsMod was specified for phosphor-1.12.2-0.2.6+build50.jar, attempting force-load
[15:05:57] [main/DEBUG] [mixin]: Adding phosphor-1.12.2-0.2.6+build50.jar to reparseable coremod collection
[15:05:57] [main/DEBUG] [mixin]: phosphor-1.12.2-0.2.6+build50.jar has core plugin me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin. Injecting it into FML for co-initialisation:
[15:05:57] [main/DEBUG] [FML]: Instantiating coremod class PhosphorFMLLoadingPlugin
[15:05:57] [main/DEBUG] [FML]: The coremod me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin requested minecraft version 1.12.2 and minecraft is 1.12.2. It will be loaded.
[15:05:57] [main/DEBUG] [FML]: Found signing certificates for coremod PhosphorFMLLoadingPlugin (me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin)
[15:05:57] [main/DEBUG] [FML]: Found certificate f0387d288626cc2d937daa504e74af570c52a2f1
[15:05:57] [main/DEBUG] [FML]: Enqueued coremod PhosphorFMLLoadingPlugin
[15:05:57] [main/DEBUG] [mixin]: Instancing new MixinPlatformAgentDefault for file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
[15:05:57] [main/DEBUG] [mixin]: Scanning file:/server/forge.jar for mixin tweaker
[15:05:57] [main/DEBUG] [mixin]: Scanning file:/jolokia/jolokia.jar for mixin tweaker
[15:05:57] [main/DEBUG] [mixin]: Scanning file:/server/./mods/BetterFps-1.4.8.jar for mixin tweaker
[15:05:57] [main/DEBUG] [mixin]: Scanning file:/server/./mods/CTM-MC1.12.2-1.0.2.31.jar for mixin tweaker
[15:05:57] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Forgelin-1.8.4.jar for mixin tweaker
[15:05:57] [main/DEBUG] [mixin]: Scanning file:/server/./mods/iceandfire-1.9.1-1.12.2.jar for mixin tweaker
[15:05:57] [main/DEBUG] [mixin]: Scanning file:/server/./mods/IvToolkit-1.3.3-1.12.jar for mixin tweaker
[15:05:57] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Quark-r1.6-179.jar for mixin tweaker
[15:05:57] [main/DEBUG] [mixin]: Scanning file:/server/./mods/wings-1.1.6-1.12.2.jar for mixin tweaker
[15:05:57] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Xaeros_Minimap_21.4.1_Forge_1.12.jar for mixin tweaker
[15:05:57] [main/DEBUG] [mixin]: Scanning file:/server/./mods/memory_repo/net/ilexiconn/llibrary-core/1.0.11-1.12.2/llibrary-core-1.0.11-1.12.2.jar for mixin tweaker
[15:05:57] [main/DEBUG] [mixin]: Scanning file:/server/./mods/themidnight-0.3.5.jar for mixin tweaker
[15:05:57] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.FMLDeobfTweaker
[15:05:57] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker
[15:05:57] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLInjectionAndSortingTweaker
[15:05:57] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[15:05:57] [main/DEBUG] [FML]: Injecting coremod FMLCorePlugin \{net.minecraftforge.fml.relauncher.FMLCorePlugin\} class transformers
[15:05:57] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.SideTransformer
[15:05:57] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[PREINIT]
[15:05:57] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer
[15:05:57] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer
[15:05:57] [main/TRACE] [FML]: Registering transformer net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer
[15:05:57] [main/DEBUG] [FML]: Injection complete
[15:05:57] [main/DEBUG] [FML]: Running coremod plugin for FMLCorePlugin \{net.minecraftforge.fml.relauncher.FMLCorePlugin\}
[15:05:57] [main/DEBUG] [FML]: Running coremod plugin FMLCorePlugin
[15:06:05] [main/DEBUG] [FML]: Read 1154 binary patches
[15:06:06] [main/DEBUG] [FML]: Loading deobfuscation resource /deobfuscation_data-1.12.2.lzma with 36076 records
[15:06:10] [main/INFO] [FML]: Found valid fingerprint for Minecraft Forge. Certificate fingerprint e3c3d50c7c986df74c645c0ac54639741c90a557
[15:06:10] [main/DEBUG] [FML]: Coremod plugin class FMLCorePlugin run successfully
[15:06:10] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[15:06:10] [main/DEBUG] [FML]: Injecting coremod FMLForgePlugin \{net.minecraftforge.classloading.FMLForgePlugin\} class transformers
[15:06:10] [main/DEBUG] [FML]: Injection complete
[15:06:10] [main/DEBUG] [FML]: Running coremod plugin for FMLForgePlugin \{net.minecraftforge.classloading.FMLForgePlugin\}
[15:06:10] [main/DEBUG] [FML]: Running coremod plugin FMLForgePlugin
[15:06:10] [main/DEBUG] [FML]: Coremod plugin class FMLForgePlugin run successfully
[15:06:10] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[15:06:10] [main/DEBUG] [FML]: Injecting coremod ForgelinPlugin \{net.shadowfacts.forgelin.preloader.ForgelinPlugin\} class transformers
[15:06:10] [main/DEBUG] [FML]: Injection complete
[15:06:10] [main/DEBUG] [FML]: Running coremod plugin for ForgelinPlugin \{net.shadowfacts.forgelin.preloader.ForgelinPlugin\}
[15:06:10] [main/DEBUG] [FML]: Running coremod plugin ForgelinPlugin
[15:06:10] [main/DEBUG] [FML]: Coremod plugin class ForgelinPlugin run successfully
[15:06:10] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[15:06:10] [main/DEBUG] [FML]: Injecting coremod IvToolkit \{ivorius.ivtoolkit.IvToolkitLoadingPlugin\} class transformers
[15:06:10] [main/DEBUG] [FML]: Injection complete
[15:06:10] [main/DEBUG] [FML]: Running coremod plugin for IvToolkit \{ivorius.ivtoolkit.IvToolkitLoadingPlugin\}
[15:06:10] [main/DEBUG] [FML]: Running coremod plugin IvToolkit
[15:06:10] [main/DEBUG] [FML]: Coremod plugin class IvToolkitLoadingPlugin run successfully
[15:06:10] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[15:06:10] [main/DEBUG] [FML]: Injecting coremod XaeroMinimapPlugin \{xaero.common.core.XaeroMinimapPlugin\} class transformers
[15:06:10] [main/TRACE] [FML]: Registering transformer xaero.common.core.transformer.ChunkTransformer
[15:06:10] [main/TRACE] [FML]: Registering transformer xaero.common.core.transformer.NetHandlerPlayClientTransformer
[15:06:10] [main/TRACE] [FML]: Registering transformer xaero.common.core.transformer.EntityPlayerTransformer
[15:06:10] [main/TRACE] [FML]: Registering transformer xaero.common.core.transformer.AbstractClientPlayerTransformer
[15:06:10] [main/TRACE] [FML]: Registering transformer xaero.common.core.transformer.WorldClientTransformer
[15:06:10] [main/TRACE] [FML]: Registering transformer xaero.common.core.transformer.EntityPlayerSPTransformer
[15:06:10] [main/TRACE] [FML]: Registering transformer xaero.common.core.transformer.PlayerListTransformer
[15:06:10] [main/TRACE] [FML]: Registering transformer xaero.common.core.transformer.GuiIngameForgeTransformer
[15:06:10] [main/TRACE] [FML]: Registering transformer xaero.common.core.transformer.GuiBossOverlayTransformer
[15:06:10] [main/DEBUG] [FML]: Injection complete
[15:06:10] [main/DEBUG] [FML]: Running coremod plugin for XaeroMinimapPlugin \{xaero.common.core.XaeroMinimapPlugin\}
[15:06:10] [main/DEBUG] [FML]: Running coremod plugin XaeroMinimapPlugin
[15:06:10] [main/DEBUG] [FML]: Coremod plugin class XaeroMinimapPlugin run successfully
[15:06:10] [main/INFO] [LaunchWrapper]: Calling tweak class org.spongepowered.asm.launch.MixinTweaker
[15:06:10] [main/DEBUG] [mixin]: Processing prepare() for PlatformAgent[MixinPlatformAgentFML:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
[15:06:10] [main/DEBUG] [mixin]: Processing prepare() for PlatformAgent[MixinPlatformAgentDefault:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
[15:06:10] [main/DEBUG] [mixin]: Processing launch tasks for PlatformAgent[MixinPlatformAgentFML:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
[15:06:10] [main/DEBUG] [mixin]: Creating FML remapper adapter: org.spongepowered.asm.bridge.RemapperAdapterFML
[15:06:10] [main/INFO] [mixin]: Initialised Mixin FML Remapper Adapter with net.minecraftforge.fml.common.asm.transformers.deobf.FMLDeobfuscatingRemapper@67c277a0
[15:06:10] [main/DEBUG] [mixin]: Processing launch tasks for PlatformAgent[MixinPlatformAgentDefault:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
[15:06:10] [main/DEBUG] [mixin]: Scanning file:/server/forge.jar for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: Scanning file:/jolokia/jolokia.jar for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: Scanning file:/server/./mods/BetterFps-1.4.8.jar for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: Scanning file:/server/./mods/CTM-MC1.12.2-1.0.2.31.jar for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Forgelin-1.8.4.jar for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: Scanning file:/server/./mods/iceandfire-1.9.1-1.12.2.jar for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: Scanning file:/server/./mods/IvToolkit-1.3.3-1.12.jar for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Quark-r1.6-179.jar for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: Scanning file:/server/./mods/wings-1.1.6-1.12.2.jar for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: Scanning file:/server/./mods/Xaeros_Minimap_21.4.1_Forge_1.12.jar for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: Scanning file:/server/./mods/memory_repo/net/ilexiconn/llibrary-core/1.0.11-1.12.2/llibrary-core-1.0.11-1.12.2.jar for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: Scanning file:/server/./mods/themidnight-0.3.5.jar for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: Scanning asmgen:/ for mixin tweaker
[15:06:10] [main/DEBUG] [mixin]: inject() running with 1 agents
[15:06:10] [main/DEBUG] [mixin]: Processing inject() for PlatformAgent[MixinPlatformAgentFML:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
[15:06:10] [main/DEBUG] [mixin]: FML agent is co-initiralising coremod instance PhosphorFMLLoadingPlugin {[]} for file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
[15:06:10] [main/DEBUG] [FML]: Injecting coremod PhosphorFMLLoadingPlugin \{me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin\} class transformers
[15:06:10] [main/DEBUG] [FML]: Injection complete
[15:06:10] [main/DEBUG] [FML]: Running coremod plugin for PhosphorFMLLoadingPlugin \{me.jellysquid.mods.phosphor.core.PhosphorFMLLoadingPlugin\}
[15:06:10] [main/DEBUG] [FML]: Running coremod plugin PhosphorFMLLoadingPlugin
[15:06:10] [main/DEBUG] [Phosphor Forge Core]: Success! Phosphor has been called into from Forge... initializing Mixin environment and configurations
[15:06:11] [main/INFO] [mixin]: Compatibility level set to JAVA_8
[15:06:11] [main/DEBUG] [FML]: Coremod plugin class PhosphorFMLLoadingPlugin run successfully
[15:06:11] [main/DEBUG] [mixin]: Processing inject() for PlatformAgent[MixinPlatformAgentDefault:file:/server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar]
[15:06:11] [main/INFO] [LaunchWrapper]: Calling tweak class guichaguri.betterfps.tweaker.BetterFpsTweaker
[15:06:11] [main/DEBUG] [BetterFps]: Loading Mappings...
[15:06:11] [main/DEBUG] [mixin]: Checking for additional mixins for MixinEnvironment[PREINIT]
[15:06:11] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.FMLDeobfTweaker
[15:06:11] [main/DEBUG] [FML]: Loaded 215 rules from AccessTransformer config file forge_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 16 rules from AccessTransformer mod jar file ./mods/Atum-1.12.2-2.0.20.jar!META-INF/atum_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 13 rules from AccessTransformer mod jar file ./mods/jei_1.12.2-4.16.1.301.jar!META-INF/jei_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 21 rules from AccessTransformer mod jar file ./mods/twilightforest-1.12.2-3.11.1021-universal.jar!META-INF/tf_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 11 rules from AccessTransformer mod jar file ./mods/llibrary-1.7.20-1.12.2.jar!META-INF/llibrary_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 9 rules from AccessTransformer mod jar file ./mods/memory_repo/com/gildedgames/orbis-lib/1.12.2-0.2.0+build411/orbis-lib-1.12.2-0.2.0+build411.jar!META-INF/orbis-lib_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 8 rules from AccessTransformer mod jar file ./mods/Chisel-MC1.12.2-1.0.2.45.jar!META-INF/chisel_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file ./mods/expandedbonemeal-1.11-1.2.1.jar!META-INF/expandedbonemeal_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 29 rules from AccessTransformer mod jar file ./mods/aether_ii-1.12.2-0.3.0+build411-universal.jar!META-INF/aether_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 119 rules from AccessTransformer mod jar file ./mods/iChunUtil-1.12.2-7.2.2.jar!META-INF/iChunUtil_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 19 rules from AccessTransformer mod jar file ./mods/CraftTweaker2-1.12-4.1.20.618.jar!META-INF/crafttweaker_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 97 rules from AccessTransformer mod jar file ./mods/extrautils2-1.12-1.9.9.jar!META-INF/extrautils2_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 3 rules from AccessTransformer mod jar file ./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar!META-INF/phosphor_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 6 rules from AccessTransformer mod jar file ./mods/themidnight-0.3.5.jar!META-INF/midnight_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 13 rules from AccessTransformer mod jar file ./mods/BiomesOPlenty-1.12.2-7.0.1.2293-universal.jar!META-INF/biomesoplenty_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file ./mods/Decocraft-2.6.3_1.12.2.jar!META-INF/decocraft_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 1 rules from AccessTransformer mod jar file ./mods/Quark-r1.6-179.jar!META-INF/quark_at.cfg
[15:06:11] [main/DEBUG] [FML]: Loaded 5 rules from AccessTransformer mod jar file ./mods/CTM-MC1.12.2-1.0.2.31.jar!META-INF/ctm_at.cfg
[15:06:11] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #2
[15:06:11] [main/DEBUG] [FML]: Validating minecraft
[15:06:12] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[INIT]
[15:06:15] [main/DEBUG] [FML]: Minecraft validated, launching...
[15:06:15] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[15:06:15] [main/DEBUG] [FML]: Injecting coremod Quark Plugin \{vazkii.quark.base.asm.LoadingPlugin\} class transformers
[15:06:15] [main/TRACE] [FML]: Registering transformer vazkii.quark.base.asm.ClassTransformer
[15:06:15] [main/DEBUG] [FML]: Injection complete
[15:06:15] [main/DEBUG] [FML]: Running coremod plugin for Quark Plugin \{vazkii.quark.base.asm.LoadingPlugin\}
[15:06:15] [main/DEBUG] [FML]: Running coremod plugin Quark Plugin
[15:06:15] [main/DEBUG] [FML]: Coremod plugin class LoadingPlugin run successfully
[15:06:15] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[15:06:15] [main/DEBUG] [FML]: Injecting coremod llibrary \{net.ilexiconn.llibrary.server.core.plugin.LLibraryPlugin\} class transformers
[15:06:15] [main/TRACE] [FML]: Registering transformer net.ilexiconn.llibrary.server.core.plugin.LLibraryTransformer
[15:06:15] [main/TRACE] [FML]: Registering transformer net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher
[15:06:15] [main/DEBUG] [LLibrary Core]: Found runtime patcher net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher
[15:06:15] [main/DEBUG] [FML]: Injection complete
[15:06:15] [main/DEBUG] [FML]: Running coremod plugin for llibrary \{net.ilexiconn.llibrary.server.core.plugin.LLibraryPlugin\}
[15:06:15] [main/DEBUG] [FML]: Running coremod plugin llibrary
[15:06:16] [main/DEBUG] [FML]: Coremod plugin class LLibraryPlugin run successfully
[15:06:16] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[15:06:16] [main/DEBUG] [FML]: Injecting coremod midnight \{com.mushroom.midnight.core.MidnightLoadingPlugin\} class transformers
[15:06:16] [main/TRACE] [FML]: Registering transformer com.mushroom.midnight.core.transformer.MidnightClassTransformer
[15:06:16] [main/DEBUG] [LLibrary Core]: Found no method mapping for java/lang/String/format(Ljava/lang/String;[Ljava/lang/Object;)Ljava/lang/String;
[15:06:16] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/minecraft/client/model/ModelBiped/<init>(FZ)V
[15:06:16] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/minecraft/client/renderer/entity/RenderPlayer/<init>(Lnet/minecraft/client/renderer/entity/RenderManager;Z)V
[15:06:16] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/minecraftforge/client/ForgeHooksClient/handleCameraTransforms(Lnet/minecraft/client/renderer/block/model/IBakedModel;Lnet/minecraft/client/renderer/block/model/ItemCameraTransforms$TransformType;Z)Lnet/minecraft/client/renderer/block/model/IBakedModel;
[15:06:16] [main/DEBUG] [FML]: Injection complete
[15:06:16] [main/DEBUG] [FML]: Running coremod plugin for midnight \{com.mushroom.midnight.core.MidnightLoadingPlugin\}
[15:06:16] [main/DEBUG] [FML]: Running coremod plugin midnight
[15:06:16] [main/DEBUG] [FML]: Coremod plugin class MidnightLoadingPlugin run successfully
[15:06:16] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[15:06:16] [main/DEBUG] [FML]: Injecting coremod iceandfire \{com.github.alexthe666.iceandfire.asm.IceAndFirePlugin\} class transformers
[15:06:16] [main/DEBUG] [LLibrary Core]: Found runtime patcher com.github.alexthe666.iceandfire.patcher.IceAndFireRuntimePatcher
[15:06:16] [main/TRACE] [FML]: Registering transformer com.github.alexthe666.iceandfire.patcher.IceAndFireRuntimePatcher
[15:06:16] [main/DEBUG] [FML]: Injection complete
[15:06:16] [main/DEBUG] [FML]: Running coremod plugin for iceandfire \{com.github.alexthe666.iceandfire.asm.IceAndFirePlugin\}
[15:06:16] [main/DEBUG] [FML]: Running coremod plugin iceandfire
[15:06:16] [main/DEBUG] [FML]: Coremod plugin class IceAndFirePlugin run successfully
[15:06:16] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[15:06:16] [main/DEBUG] [FML]: Injecting coremod wings \{me.paulf.wings.server.asm.plugin.WingsLoadingPlugin\} class transformers
[15:06:16] [main/TRACE] [FML]: Registering transformer me.paulf.wings.server.asm.WingsRuntimePatcher
[15:06:16] [main/DEBUG] [LLibrary Core]: Found runtime patcher me.paulf.wings.server.asm.WingsRuntimePatcher
[15:06:16] [main/TRACE] [FML]: Registering transformer me.paulf.wings.server.asm.mobends.WingsMoBendsRuntimePatcher
[15:06:16] [main/DEBUG] [LLibrary Core]: Found no method mapping for /()L;
[15:06:16] [main/DEBUG] [LLibrary Core]: Found no method mapping for /()L;
[15:06:16] [main/DEBUG] [LLibrary Core]: Found no method mapping for /()L;
[15:06:16] [main/DEBUG] [LLibrary Core]: Found no method mapping for /()L;
[15:06:16] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/minecraftforge/client/ForgeHooksClient/shouldCauseReequipAnimation(Lnet/minecraft/item/ItemStack;Lnet/minecraft/item/ItemStack;I)Z
[15:06:16] [main/DEBUG] [LLibrary Core]: Found runtime patcher me.paulf.wings.server.asm.mobends.WingsMoBendsRuntimePatcher
[15:06:16] [main/DEBUG] [FML]: Injection complete
[15:06:16] [main/DEBUG] [FML]: Running coremod plugin for wings \{me.paulf.wings.server.asm.plugin.WingsLoadingPlugin\}
[15:06:16] [main/DEBUG] [FML]: Running coremod plugin wings
[15:06:17] [main/DEBUG] [FML]: Coremod plugin class WingsLoadingPlugin run successfully
[15:06:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.relauncher.CoreModManager$FMLPluginWrapper
[15:06:17] [main/DEBUG] [FML]: Injecting coremod CTMCorePlugin \{team.chisel.ctm.client.asm.CTMCorePlugin\} class transformers
[15:06:17] [main/TRACE] [FML]: Registering transformer team.chisel.ctm.client.asm.CTMTransformer
[15:06:17] [main/DEBUG] [FML]: Injection complete
[15:06:17] [main/DEBUG] [FML]: Running coremod plugin for CTMCorePlugin \{team.chisel.ctm.client.asm.CTMCorePlugin\}
[15:06:17] [main/DEBUG] [FML]: Running coremod plugin CTMCorePlugin
[15:06:17] [main/DEBUG] [FML]: Coremod plugin class CTMCorePlugin run successfully
[15:06:17] [main/INFO] [LaunchWrapper]: Loading tweak class name net.minecraftforge.fml.common.launcher.TerminalTweaker
[15:06:17] [main/INFO] [LaunchWrapper]: Loading tweak class name org.spongepowered.asm.mixin.EnvironmentStateTweaker
[15:06:17] [main/INFO] [LaunchWrapper]: Calling tweak class net.minecraftforge.fml.common.launcher.TerminalTweaker
[15:06:17] [main/INFO] [LaunchWrapper]: Calling tweak class org.spongepowered.asm.mixin.EnvironmentStateTweaker
[15:06:17] [main/DEBUG] [mixin]: Adding new mixin transformer proxy #3
[15:06:17] [main/DEBUG] [LLibrary Core]: Patching class net/minecraft/server/MinecraftServer
[15:06:17] [main/DEBUG] [LLibrary Core]: Patching method run()V
[15:06:17] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getTickRate()J
[15:06:17] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getTickRate()J
[15:06:17] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getTickRate()J
[15:06:17] [main/DEBUG] [LLibrary Core]: Found no method mapping for net/ilexiconn/llibrary/server/core/patcher/LLibraryHooks/getTickRate()J
[15:06:17] [main/DEBUG] [mixin]: Preparing mixins for MixinEnvironment[DEFAULT]
[15:06:17] [main/DEBUG] [mixin]: Selecting config mixins.phosphor.json
[15:06:17] [main/DEBUG] [Phosphor Plugin]: Loading configuration
[15:06:17] [main/DEBUG] [mixin]: Preparing mixins.phosphor.json (9)
[15:06:17] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
[15:06:17] [main/DEBUG] [mixin]: Rebuilding transformer delegation list:
[15:06:17] [main/DEBUG] [mixin]: Found name transformer: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PatchingTransformer
[15:06:17] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SideTransformer
[15:06:17] [main/DEBUG] [mixin]: Excluding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriptionTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.EventSubscriberTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.net.minecraftforge.fml.common.asm.transformers.SoundEngineFixTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.xaero.common.core.transformer.ChunkTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.xaero.common.core.transformer.NetHandlerPlayClientTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.xaero.common.core.transformer.EntityPlayerTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.xaero.common.core.transformer.AbstractClientPlayerTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.xaero.common.core.transformer.WorldClientTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.xaero.common.core.transformer.EntityPlayerSPTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.xaero.common.core.transformer.PlayerListTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.xaero.common.core.transformer.GuiIngameForgeTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.xaero.common.core.transformer.GuiBossOverlayTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: guichaguri.betterfps.transformers.PatcherTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: guichaguri.betterfps.transformers.MathTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.DeobfuscationTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.AccessTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ModAccessTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemStackTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.ItemBlockSpecialTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: net.minecraftforge.fml.common.asm.transformers.PotionEffectTransformer
[15:06:17] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.vazkii.quark.base.asm.ClassTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.net.ilexiconn.llibrary.server.core.plugin.LLibraryTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.net.ilexiconn.llibrary.server.core.patcher.LLibraryRuntimePatcher
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.com.mushroom.midnight.core.transformer.MidnightClassTransformer
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.com.github.alexthe666.iceandfire.patcher.IceAndFireRuntimePatcher
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.me.paulf.wings.server.asm.WingsRuntimePatcher
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.me.paulf.wings.server.asm.mobends.WingsMoBendsRuntimePatcher
[15:06:17] [main/DEBUG] [mixin]: Adding: $wrapper.team.chisel.ctm.client.asm.CTMTransformer
[15:06:17] [main/DEBUG] [mixin]: Excluding: net.minecraftforge.fml.common.asm.transformers.TerminalTransformer
[15:06:17] [main/DEBUG] [mixin]: Excluding: org.spongepowered.asm.mixin.transformer.Proxy
[15:06:17] [main/DEBUG] [mixin]: Transformer delegation list created with 30 entries
[15:06:18] [main/DEBUG] [Phosphor Plugin]: Disabled patch 'me.jellysquid.mods.phosphor.mixins.lighting.client.MixinMinecraft' because it targets an client-side class unavailable in the current environment
[15:06:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/storage/AnvilChunkLoader to metadata cache
[15:06:18] [main/INFO] [STDOUT]: [xaero.common.core.transformer.ClassNodeTransformer:transform:26]: Transforming class axw net.minecraft.world.chunk.Chunk
[15:06:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/Chunk to metadata cache
[15:06:18] [main/DEBUG] [Phosphor Plugin]: Disabled patch 'me.jellysquid.mods.phosphor.mixins.lighting.common.MixinChunk$Sponge' because we are in a standard Vanilla/Forge environment
[15:06:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/gen/ChunkProviderServer to metadata cache
[15:06:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/storage/ExtendedBlockStorage to metadata cache
[15:06:18] [main/TRACE] [mixin]: Added class metadata for net/minecraft/network/play/server/SPacketChunkData to metadata cache
[15:06:19] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/World to metadata cache
[15:06:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/chunk/Chunk$EnumCreateEntityType to metadata cache
[15:06:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/EnumFacing$Plane to metadata cache
[15:06:20] [main/DEBUG] [mixin]: Prepared 7 mixins in 2.403 sec (343.3ms avg) (34ms load, 1280ms transform, 0ms plugin)
[15:06:20] [main/DEBUG] [mixin]: Mixing common.MixinWorld from mixins.phosphor.json into net.minecraft.world.World
[15:06:20] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/ILightingEngineProvider to metadata cache
[15:06:20] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/mod/world/lighting/LightingEngine to metadata cache
[15:06:20] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/ILightingEngine to metadata cache
[15:06:20] [main/TRACE] [mixin]: Added class metadata for java/lang/Boolean to metadata cache
[15:06:20] [main/TRACE] [mixin]: Added class metadata for java/io/Serializable to metadata cache
[15:06:20] [main/TRACE] [mixin]: Added class metadata for java/lang/Comparable to metadata cache
[15:06:20] [main/TRACE] [mixin]: Added class metadata for org/spongepowered/asm/mixin/injection/callback/CallbackInfoReturnable to metadata cache
[15:06:20] [main/TRACE] [mixin]: Added class metadata for org/spongepowered/asm/mixin/injection/callback/CallbackInfo to metadata cache
[15:06:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/world/EnumSkyBlock to metadata cache
[15:06:20] [main/TRACE] [mixin]: Added class metadata for net/minecraft/util/math/BlockPos to metadata cache
[15:06:21] [main/INFO] [Quark ASM]: Transforming net.minecraft.world.WorldServer
[15:06:21] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [areAllPlayersAsleep, func_73056_e] Descriptor ()Z)
[15:06:21] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:21] [main/INFO] [Quark ASM]: Patch result: true
[15:06:21] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [wakeAllPlayers, func_73053_d] Descriptor ()V)
[15:06:21] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:21] [main/INFO] [Quark ASM]: Patch result: true
[15:06:22] [main/INFO] [STDOUT]: [xaero.common.core.transformer.ClassNodeTransformer:transform:26]: Transforming class pl net.minecraft.server.management.PlayerList
[15:06:22] [main/INFO] [STDOUT]: [xaero.common.core.transformer.ClassNodeTransformer:transform:26]: Transforming class aed net.minecraft.entity.player.EntityPlayer
[15:06:22] [main/DEBUG] [LLibrary Core]: Patching class net/minecraft/entity/player/EntityPlayer
[15:06:22] [main/DEBUG] [LLibrary Core]: Patching method func_184808_cD()V
[15:06:22] [main/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooks/onFlightCheck(Lnet/minecraft/entity/player/EntityPlayer;Z)Z
[15:06:22] [main/DEBUG] [LLibrary Core]: Patching method func_71000_j(DDD)V
[15:06:22] [main/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooks/onAddFlown(Lnet/minecraft/entity/player/EntityPlayer;DDD)V
[15:06:22] [main/DEBUG] [LLibrary Core]: Patching method func_70047_e()F
[15:06:22] [main/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooks/onFlightCheck(Lnet/minecraft/entity/player/EntityPlayer;Z)Z
[15:06:22] [main/DEBUG] [LLibrary Core]: Patching method func_174820_d(ILnet/minecraft/item/ItemStack;)Z
[15:06:22] [main/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooks/onReplaceItemSlotCheck(Lnet/minecraft/item/Item;Lnet/minecraft/item/ItemStack;)Z
[15:06:22] [main/WARN] [LLibrary Core]: Failed to fetch hierarchy node for net.minecraft.entity.EntityLivingBase. This may cause patch issues
[15:06:22] [main/WARN] [LLibrary Core]: Failed to fetch hierarchy node for net.minecraft.entity.Entity. This may cause patch issues
[15:06:22] [main/DEBUG] [LLibrary Core]: Patching class net/minecraft/entity/EntityLivingBase
[15:06:22] [main/DEBUG] [LLibrary Core]: Patching method func_110146_f(FF)F
[15:06:22] [main/DEBUG] [LLibrary Core]: Found no method mapping for me/paulf/wings/server/asm/WingsHooks/onUpdateBodyRotation(Lnet/minecraft/entity/EntityLivingBase;F)V
[15:06:22] [main/WARN] [LLibrary Core]: Failed to fetch hierarchy node for net.minecraft.nbt.NBTTagList. This may cause patch issues
[15:06:22] [main/WARN] [LLibrary Core]: Failed to fetch hierarchy node for net.minecraft.entity.player.EntityPlayerMP. This may cause patch issues
[15:06:23] [main/INFO] [Quark ASM]: Transforming net.minecraft.entity.Entity
[15:06:23] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [move, func_70091_d] Descriptor (Lnet/minecraft/entity/MoverType;DDD)V)
[15:06:23] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:23] [main/INFO] [Quark ASM]: Patch result: true
[15:06:23] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:23] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/entity/Entity.func_145775_I ()V
[15:06:23] [main/INFO] [Quark ASM]: Patch result: true
[15:06:23] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [onEntityUpdate, func_70030_z] Descriptor ()V)
[15:06:23] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:23] [main/INFO] [Quark ASM]: Patch result: true
[15:06:23] [main/DEBUG] [LLibrary Core]: Patching class net/minecraft/entity/Entity
[15:06:23] [main/INFO] [LaunchWrapper]: Launching wrapped minecraft {net.minecraft.server.MinecraftServer}
[15:06:24] [main/INFO] [BetterFps]: Patching net.minecraft.block.Block... (aow)
[15:06:24] [main/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:preTransform:230]: Transforming Class [net.minecraft.block.Block], Method [getExtendedState]
[15:06:24] [main/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:finishTransform:242]: Transforming net.minecraft.block.Block Finished.
[15:06:26] [main/INFO] [Quark ASM]: Transforming net.minecraft.enchantment.Enchantment
[15:06:26] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [canApply, func_92089_a] Descriptor (Lnet/minecraft/item/ItemStack;)Z)
[15:06:26] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:26] [main/INFO] [Quark ASM]: Located patch target node IRETURN
[15:06:26] [main/INFO] [Quark ASM]: Patch result: true
[15:06:27] [main/INFO] [Quark ASM]: Transforming net.minecraft.entity.item.EntityItem
[15:06:27] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [onUpdate, func_70071_h_] Descriptor ()V)
[15:06:27] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:27] [main/INFO] [Quark ASM]: Patch result: true
[15:06:28] [main/INFO] [Quark ASM]: Transforming net.minecraft.item.ItemStack
[15:06:28] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [getTextComponent, func_151000_E] Descriptor ()Lnet/minecraft/util/text/ITextComponent;)
[15:06:28] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:28] [main/INFO] [Quark ASM]: Located patch target node ARETURN
[15:06:28] [main/INFO] [Quark ASM]: Patch result: true
[15:06:29] [main/INFO] [Quark ASM]: Transforming net.minecraft.block.BlockDynamicLiquid
[15:06:29] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [isBlocked, func_176372_g] Descriptor (Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/block/state/IBlockState;)Z)
[15:06:29] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:29] [main/INFO] [Quark ASM]: Located patch target node IRETURN
[15:06:29] [main/INFO] [Quark ASM]: Located patch target node IRETURN
[15:06:29] [main/INFO] [Quark ASM]: Patch result: true
[15:06:30] [main/INFO] [BetterFps]: Patching math utils with "RIVENS_HALF" algorithm
[15:06:31] [main/INFO] [Quark ASM]: Transforming net.minecraft.block.BlockPistonBase
[15:06:31] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [canPush, func_185646_a] Descriptor (Lnet/minecraft/block/state/IBlockState;Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/util/EnumFacing;ZLnet/minecraft/util/EnumFacing;)Z)
[15:06:31] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:31] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/block/Block.hasTileEntity (Lnet/minecraft/block/state/IBlockState;)Z
[15:06:31] [main/INFO] [Quark ASM]: Patch result: true
[15:06:31] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [doMove, func_176319_a] Descriptor (Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/util/EnumFacing;Z)Z)
[15:06:31] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:31] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/block/state/BlockPistonStructureHelper.func_177254_c ()Ljava/util/List;
[15:06:31] [main/INFO] [Quark ASM]: Patch result: true
[15:06:31] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [doMove, func_176319_a] Descriptor (Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/util/EnumFacing;Z)Z)
[15:06:31] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:31] [main/INFO] [Quark ASM]: Located patch target node INVOKESPECIAL net/minecraft/block/state/BlockPistonStructureHelper.<init> (Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/util/EnumFacing;Z)V
[15:06:31] [main/INFO] [Quark ASM]: Patch result: true
[15:06:31] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [checkForMove, func_176316_e] Descriptor (Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/block/state/IBlockState;)V)
[15:06:31] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:31] [main/INFO] [Quark ASM]: Located patch target node INVOKESPECIAL net/minecraft/block/state/BlockPistonStructureHelper.<init> (Lnet/minecraft/world/World;Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/util/EnumFacing;Z)V
[15:06:31] [main/INFO] [Quark ASM]: Patch result: true
[15:06:31] [main/INFO] [Quark ASM]: Transforming net.minecraft.tileentity.TileEntityPiston
[15:06:31] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [update, func_73660_a] Descriptor ()V)
[15:06:31] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:31] [main/INFO] [Quark ASM]: Patch result: true
[15:06:31] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [clearPistonTileEntity, func_145866_f] Descriptor ()V)
[15:06:31] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:31] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/world/World.func_180501_a (Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/block/state/IBlockState;I)Z
[15:06:31] [main/INFO] [Quark ASM]: Patch result: true
[15:06:31] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [update, func_73660_a] Descriptor ()V)
[15:06:31] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:31] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/world/World.func_180501_a (Lnet/minecraft/util/math/BlockPos;Lnet/minecraft/block/state/IBlockState;I)Z
[15:06:31] [main/INFO] [Quark ASM]: Patch result: true
[15:06:38] [main/INFO] [BetterFps]: Patching net.minecraft.tileentity.TileEntityBeacon... (avh)
[15:06:39] [main/INFO] [BetterFps]: Patching net.minecraft.block.BlockHopper... (arl)
[15:06:39] [main/INFO] [BetterFps]: Patching net.minecraft.tileentity.TileEntityHopper... (avw)
[15:06:42] [main/INFO] [Quark ASM]: Transforming net.minecraft.enchantment.EnchantmentDamage
[15:06:43] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [canApply, func_92089_a] Descriptor (Lnet/minecraft/item/ItemStack;)Z)
[15:06:43] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:43] [main/INFO] [Quark ASM]: Located patch target node IRETURN
[15:06:43] [main/INFO] [Quark ASM]: Located patch target node IRETURN
[15:06:43] [main/INFO] [Quark ASM]: Patch result: true
[15:06:44] [main/INFO] [Quark ASM]: Transforming net.minecraft.entity.item.EntityMinecart
[15:06:44] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [killMinecart, func_94095_a] Descriptor (Lnet/minecraft/util/DamageSource;)V)
[15:06:44] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:44] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/entity/item/EntityMinecart.func_70099_a (Lnet/minecraft/item/ItemStack;F)Lnet/minecraft/entity/item/EntityItem;
[15:06:44] [main/INFO] [Quark ASM]: Patch result: true
[15:06:44] [main/INFO] [Quark ASM]: Transforming net.minecraft.entity.item.EntityBoat
[15:06:44] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [attackEntityFrom, func_70097_a] Descriptor (Lnet/minecraft/util/DamageSource;F)Z)
[15:06:44] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:44] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/entity/item/EntityBoat.func_145778_a (Lnet/minecraft/item/Item;IF)Lnet/minecraft/entity/item/EntityItem;
[15:06:44] [main/INFO] [Quark ASM]: Patch result: true
[15:06:45] [main/INFO] [Quark ASM]: Transforming net.minecraft.item.ItemBanner
[15:06:45] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [appendHoverTextFromTileEntityTag, func_185054_a] Descriptor (Lnet/minecraft/item/ItemStack;Ljava/util/List;)V)
[15:06:45] [main/INFO] [Quark ASM]: Failed to locate the method!
[15:06:48] [main/INFO] [Quark ASM]: Transforming net.minecraft.entity.ai.EntityAITarget
[15:06:48] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [isSuitableTarget, func_179445_a] Descriptor (Lnet/minecraft/entity/EntityLiving;Lnet/minecraft/entity/EntityLivingBase;ZZ)Z)
[15:06:48] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:48] [main/INFO] [Quark ASM]: Patch result: true
[15:06:51] [main/INFO] [Quark ASM]: Transforming net.minecraft.item.crafting.RecipesBanners$RecipeAddPattern
[15:06:51] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [matches, func_77569_a] Descriptor (Lnet/minecraft/inventory/InventoryCrafting;Lnet/minecraft/world/World;)Z)
[15:06:51] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:51] [main/INFO] [Quark ASM]: Located patch target node INVOKESTATIC net/minecraft/tileentity/TileEntityBanner.func_175113_c (Lnet/minecraft/item/ItemStack;)I
[15:06:51] [main/INFO] [Quark ASM]: Patch result: true
[15:06:58] [main/DEBUG] [FML]: Creating vanilla freeze snapshot
[15:06:58] [main/DEBUG] [FML]: Vanilla freeze snapshot created
[15:06:58] [main/INFO] [BetterFps]: Patching net.minecraft.server.dedicated.DedicatedServer... (nz)
[15:06:59] [main/INFO] [Quark ASM]: Transforming net.minecraft.inventory.ContainerMerchant
[15:06:59] [main/INFO] [Quark ASM]: Applying Transformation to method (Names [transferStackInSlot, func_82846_b] Descriptor (Lnet/minecraft/entity/player/EntityPlayer;I)Lnet/minecraft/item/ItemStack;)
[15:06:59] [main/INFO] [Quark ASM]: Located Method, patching...
[15:06:59] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerMerchant.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[15:06:59] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerMerchant.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[15:06:59] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerMerchant.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[15:06:59] [main/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerMerchant.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[15:06:59] [main/INFO] [Quark ASM]: Patch result: true
[15:06:59] [main/DEBUG] [mixin]: Mixing common.MixinAnvilChunkLoader from mixins.phosphor.json into net.minecraft.world.chunk.storage.AnvilChunkLoader
[15:06:59] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/mod/world/lighting/LightingHooks to metadata cache
[15:06:59] [main/TRACE] [mixin]: Added class metadata for net/minecraft/nbt/NBTTagCompound to metadata cache
[15:06:59] [main/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/IChunkLightingData to metadata cache
[15:06:59] [main/TRACE] [mixin]: Added class metadata for java/lang/Exception to metadata cache
[15:06:59] [main/TRACE] [mixin]: Added class metadata for java/lang/Throwable to metadata cache
[15:06:59] [main/TRACE] [mixin]: Added class metadata for net/minecraft/nbt/NBTBase to metadata cache
[15:07:00] [Server thread/INFO] [net.minecraft.server.dedicated.DedicatedServer]: Starting minecraft server version 1.12.2
[15:07:00] [Server thread/INFO] [FML]: MinecraftForge v14.23.5.2854 Initialized
[15:07:01] [Server thread/INFO] [FML]: Starts to replace vanilla recipe ingredients with ore ingredients.
[15:07:02] [Server thread/INFO] [FML]: Invalid recipe found with multiple oredict ingredients in the same ingredient...
[15:07:04] [Server thread/INFO] [FML]: Replaced 1227 ore ingredients
[15:07:05] [Server thread/DEBUG] [FML]: File /server/config/injectedDependencies.json not found. No dependencies injected
[15:07:05] [Server thread/DEBUG] [FML]: Building injected Mod Containers [net.minecraftforge.fml.common.FMLContainer, net.minecraftforge.common.ForgeModContainer, ivorius.ivtoolkit.IvToolkitCoreContainer, xaero.common.core.CoreModContainer]
[15:07:06] [Server thread/DEBUG] [FML]: Attempting to load mods contained in the minecraft jar file and associated classes
[15:07:06] [Server thread/DEBUG] [FML]: Found a minecraft related file at /server/forge.jar, examining for mod candidates
[15:07:06] [Server thread/DEBUG] [FML]: Found a minecraft related file at /jolokia/jolokia.jar, examining for mod candidates
[15:07:06] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/BetterFps-1.4.8.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/CTM-MC1.12.2-1.0.2.31.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/Forgelin-1.8.4.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/iceandfire-1.9.1-1.12.2.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/IvToolkit-1.3.3-1.12.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/Quark-r1.6-179.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/wings-1.1.6-1.12.2.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/Xaeros_Minimap_21.4.1_Forge_1.12.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/memory_repo/net/ilexiconn/llibrary-core/1.0.11-1.12.2/llibrary-core-1.0.11-1.12.2.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/themidnight-0.3.5.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping known library file /server/./mods/memory_repo/me/jellysquid/mods/phosphor/1.12.2-0.2.6+build50/phosphor-1.12.2-0.2.6+build50.jar
[15:07:06] [Server thread/DEBUG] [FML]: Minecraft jar mods loaded successfully
[15:07:06] [Server thread/INFO] [FML]: Searching /server/./mods for mods
[15:07:06] [Server thread/DEBUG] [FML]: Adding NaturesCompass-1.12.2-1.8.5.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding foamflower-1.12.2-1.0.0.0-beta1.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding placeableitems-3.3.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding ldshadowlady-customcraftingtables-1.0.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Forgelin-1.8.4.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding tropicraft-MC1.12.2-7.1.9.115.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding iceandfire-1.9.1-1.12.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Xaeros_Minimap_21.4.1_Forge_1.12.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding CraftTweaker2-1.12-4.1.20.618.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Patchouli-1.0-23.6.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding llibrary-1.7.20-1.12.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Hats-1.12.2-7.1.1.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding IvToolkit-1.3.3-1.12.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding BetterFps-1.4.8.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding iChunUtil-1.12.2-7.2.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Quark-r1.6-179.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding extrautils2-1.12-1.9.9.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding ultimate_unicorn_mod-1.12.2-1.5.17.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Hwyla-1.8.26-B41_1.12.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding HatStand-1.12.2-7.1.0.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Morph-1.12.2-7.2.1.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding modtweaker-4.0.18.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding PTRLib-1.0.4.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Atum-1.12.2-2.0.20.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding mcw-fences-1.0.0-mc1.12.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding ImprovedBackpacks-1.12.2-1.5.0.0.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding RecurrentComplex-1.4.8.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding AutoRegLib-1.3-32.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding expandedbonemeal-1.11-1.2.1.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding GooglyEyes-1.12.2-7.1.1.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding advancedcombat-1.1.2-[1.12].jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding vending-1.12.2-3.0.1.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding comfycozy-1.3.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding themidnight-0.3.5.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Decocraft-2.6.3_1.12.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding FriendshipBracelet-1.1.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding MoreLootStuff-1.12.2-0.0.5.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Chisel-MC1.12.2-1.0.2.45.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding PattysMoreStuff-stable-1.1.8.5.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding fairylights-2.2.0-1.12.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Clumps-3.1.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding BiblioCraft[v2.4.5][MC1.12.2].jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding BabyMobs-1.12-1.5.5.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding wings-1.1.6-1.12.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding jei_1.12.2-4.16.1.301.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding outfox-0.1.5-mc1.12.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding CTM-MC1.12.2-1.0.2.31.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding gravestone-1.10.3.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Baubles-1.12-1.5.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding twilightforest-1.12.2-3.11.1021-universal.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Floocraft 1.12.2-1.9.6.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding inventorypets-1.12-2.0.12.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Skye's Bakery 2.1.1 for MC1.12.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding BiomesOPlenty-1.12.2-7.0.1.2293-universal.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding MTLib-3.0.6.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding aether_ii-1.12.2-0.3.0+build411-universal.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding RoguelikeDungeons-1.12.2-1.8.0.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding Craftable Saddles[1.12]-1.3.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding furniture-6.3.1-1.12.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding mcw-bridges-1.0.4-mc1.12.2.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Adding JRFTL[1.12.2]-1.1.jar to the mod list
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file advancedcombat-1.1.2-[1.12].jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file aether_ii-1.12.2-0.3.0+build411-universal.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Atum-1.12.2-2.0.20.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file AutoRegLib-1.3-32.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file BabyMobs-1.12-1.5.5.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Baubles-1.12-1.5.2.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping already parsed coremod or tweaker BetterFps-1.4.8.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file BiblioCraft[v2.4.5][MC1.12.2].jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file BiomesOPlenty-1.12.2-7.0.1.2293-universal.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Chisel-MC1.12.2-1.0.2.45.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Clumps-3.1.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file comfycozy-1.3.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Craftable Saddles[1.12]-1.3.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CraftTweaker2-1.12-4.1.20.618.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file CTM-MC1.12.2-1.0.2.31.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Decocraft-2.6.3_1.12.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file expandedbonemeal-1.11-1.2.1.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file extrautils2-1.12-1.9.9.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file fairylights-2.2.0-1.12.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Floocraft 1.12.2-1.9.6.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file foamflower-1.12.2-1.0.0.0-beta1.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Forgelin-1.8.4.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file FriendshipBracelet-1.1.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file furniture-6.3.1-1.12.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file GooglyEyes-1.12.2-7.1.1.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file gravestone-1.10.3.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Hats-1.12.2-7.1.1.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file HatStand-1.12.2-7.1.0.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Hwyla-1.8.26-B41_1.12.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file iceandfire-1.9.1-1.12.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file iChunUtil-1.12.2-7.2.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file ImprovedBackpacks-1.12.2-1.5.0.0.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file inventorypets-1.12-2.0.12.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping already parsed coremod or tweaker IvToolkit-1.3.3-1.12.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file jei_1.12.2-4.16.1.301.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file JRFTL[1.12.2]-1.1.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file ldshadowlady-customcraftingtables-1.0.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file mcw-bridges-1.0.4-mc1.12.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file mcw-fences-1.0.0-mc1.12.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file modtweaker-4.0.18.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file MoreLootStuff-1.12.2-0.0.5.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Morph-1.12.2-7.2.1.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file MTLib-3.0.6.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file NaturesCompass-1.12.2-1.8.5.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file outfox-0.1.5-mc1.12.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Patchouli-1.0-23.6.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file PattysMoreStuff-stable-1.1.8.5.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file placeableitems-3.3.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file PTRLib-1.0.4.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Quark-r1.6-179.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file RecurrentComplex-1.4.8.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file RoguelikeDungeons-1.12.2-1.8.0.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Skye's Bakery 2.1.1 for MC1.12.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file tropicraft-MC1.12.2-7.1.9.115.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file twilightforest-1.12.2-3.11.1021-universal.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file ultimate_unicorn_mod-1.12.2-1.5.17.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file vending-1.12.2-3.0.1.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file wings-1.1.6-1.12.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file Xaeros_Minimap_21.4.1_Forge_1.12.jar
[15:07:06] [Server thread/TRACE] [FML]: Skipping already parsed coremod or tweaker llibrary-core-1.0.11-1.12.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file llibrary-1.7.20-1.12.2.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file themidnight-0.3.5.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file orbis-lib-1.12.2-0.2.0+build411.jar
[15:07:06] [Server thread/DEBUG] [FML]: Found a candidate zip or jar file phosphor-1.12.2-0.2.6+build50.jar
[15:07:06] [Server thread/DEBUG] [FML]: Examining file forge.jar for potential mods
[15:07:06] [Server thread/DEBUG] [FML]: The mod container forge.jar appears to be missing an mcmod.info file
[15:07:09] [Server thread/DEBUG] [FML]: Examining file jolokia.jar for potential mods
[15:07:09] [Server thread/DEBUG] [FML]: The mod container jolokia.jar appears to be missing an mcmod.info file
[15:07:10] [Server thread/DEBUG] [FML]: Examining file advancedcombat-1.1.2-[1.12].jar for potential mods
[15:07:10] [Server thread/TRACE] [FML]: Located mcmod.info file in file advancedcombat-1.1.2-[1.12].jar
[15:07:10] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.advancedcombat.AdvancedCombat) - loading
[15:07:10] [Server thread/TRACE] [FML]: Parsed dependency info for advancedcombat: Requirements: [] After:[] Before:[]
[15:07:10] [Server thread/DEBUG] [FML]: Examining file aether_ii-1.12.2-0.3.0+build411-universal.jar for potential mods
[15:07:10] [Server thread/TRACE] [FML]: Located mcmod.info file in file aether_ii-1.12.2-0.3.0+build411-universal.jar
[15:07:11] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.gildedgames.aether.common.AetherCore) - loading
[15:07:11] [Server thread/TRACE] [FML]: Parsed dependency info for aether: Requirements: [forge@[14.23.5.2816,), orbis-lib@[0.2.0,)] After:[orbis-lib@[0.2.0,), forge@[14.23.5.2816,)] Before:[]
[15:07:12] [Server thread/DEBUG] [FML]: Examining file Atum-1.12.2-2.0.20.jar for potential mods
[15:07:12] [Server thread/TRACE] [FML]: Located mcmod.info file in file Atum-1.12.2-2.0.20.jar
[15:07:13] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.teammetallurgy.atum.Atum) - loading
[15:07:13] [Server thread/TRACE] [FML]: Parsed dependency info for atum: Requirements: [forge@[14.23.5.2768,)] After:[forge@[14.23.5.2768,), baubles] Before:[]
[15:07:13] [Server thread/DEBUG] [FML]: Examining file AutoRegLib-1.3-32.jar for potential mods
[15:07:13] [Server thread/TRACE] [FML]: Located mcmod.info file in file AutoRegLib-1.3-32.jar
[15:07:13] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (vazkii.arl.AutoRegLib) - loading
[15:07:13] [Server thread/TRACE] [FML]: Parsed dependency info for autoreglib: Requirements: [forge@[14.21.1.2387,)] After:[forge@[14.21.1.2387,)] Before:[]
[15:07:13] [Server thread/DEBUG] [FML]: Examining file BabyMobs-1.12-1.5.5.jar for potential mods
[15:07:13] [Server thread/TRACE] [FML]: Located mcmod.info file in file BabyMobs-1.12-1.5.5.jar
[15:07:13] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (furgl.babyMobs.common.BabyMobs) - loading
[15:07:13] [Server thread/TRACE] [FML]: Parsed dependency info for babymobs: Requirements: [] After:[] Before:[]
[15:07:13] [Server thread/DEBUG] [FML]: Examining file Baubles-1.12-1.5.2.jar for potential mods
[15:07:13] [Server thread/TRACE] [FML]: Located mcmod.info file in file Baubles-1.12-1.5.2.jar
[15:07:13] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (baubles.common.Baubles) - loading
[15:07:13] [Server thread/TRACE] [FML]: Parsed dependency info for baubles: Requirements: [forge@[14.21.0.2348,)] After:[forge@[14.21.0.2348,)] Before:[]
[15:07:13] [Server thread/DEBUG] [FML]: Examining file BiblioCraft[v2.4.5][MC1.12.2].jar for potential mods
[15:07:13] [Server thread/TRACE] [FML]: Located mcmod.info file in file BiblioCraft[v2.4.5][MC1.12.2].jar
[15:07:13] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (jds.bibliocraft.BiblioCraft) - loading
[15:07:13] [Server thread/TRACE] [FML]: Parsed dependency info for bibliocraft: Requirements: [] After:[] Before:[]
[15:07:13] [Server thread/DEBUG] [FML]: Examining file BiomesOPlenty-1.12.2-7.0.1.2293-universal.jar for potential mods
[15:07:13] [Server thread/TRACE] [FML]: Located mcmod.info file in file BiomesOPlenty-1.12.2-7.0.1.2293-universal.jar
[15:07:14] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (biomesoplenty.core.BiomesOPlenty) - loading
[15:07:14] [Server thread/TRACE] [FML]: Parsed dependency info for biomesoplenty: Requirements: [forge@[14.23.0.2491,)] After:[forge@[14.23.0.2491,)] Before:[]
[15:07:14] [Server thread/DEBUG] [FML]: Examining file Chisel-MC1.12.2-1.0.2.45.jar for potential mods
[15:07:14] [Server thread/TRACE] [FML]: Located mcmod.info file in file Chisel-MC1.12.2-1.0.2.45.jar
[15:07:14] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (team.chisel.Chisel) - loading
[15:07:14] [Server thread/TRACE] [FML]: Parsed dependency info for chisel: Requirements: [forge@[14.23.5.2806,)] After:[forge@[14.23.5.2806,), jei@[4.12.0,5)] Before:[]
[15:07:15] [Server thread/DEBUG] [FML]: Examining file Clumps-3.1.2.jar for potential mods
[15:07:15] [Server thread/TRACE] [FML]: Located mcmod.info file in file Clumps-3.1.2.jar
[15:07:15] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.blamejared.clumps.Clumps) - loading
[15:07:15] [Server thread/TRACE] [FML]: Parsed dependency info for clumps: Requirements: [] After:[] Before:[]
[15:07:15] [Server thread/DEBUG] [FML]: Examining file comfycozy-1.3.jar for potential mods
[15:07:15] [Server thread/TRACE] [FML]: Located mcmod.info file in file comfycozy-1.3.jar
[15:07:15] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (bee.beeshroom.ComfyCozy.Main) - loading
[15:07:15] [Server thread/TRACE] [FML]: Parsed dependency info for comfycozy: Requirements: [] After:[] Before:[]
[15:07:15] [Server thread/DEBUG] [FML]: Examining file Craftable Saddles[1.12]-1.3.jar for potential mods
[15:07:15] [Server thread/TRACE] [FML]: Located mcmod.info file in file Craftable Saddles[1.12]-1.3.jar
[15:07:15] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (at.crimsonbit.craftablesaddles.CraftableSaddles) - loading
[15:07:15] [Server thread/TRACE] [FML]: Parsed dependency info for craftablesaddles: Requirements: [] After:[] Before:[]
[15:07:15] [Server thread/DEBUG] [FML]: Examining file CraftTweaker2-1.12-4.1.20.618.jar for potential mods
[15:07:15] [Server thread/TRACE] [FML]: Located mcmod.info file in file CraftTweaker2-1.12-4.1.20.618.jar
[15:07:16] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.blamejared.ctgui.MTRecipe) - loading
[15:07:16] [Server thread/INFO] [FML]: Disabling mod ctgui it is client side only.
[15:07:16] [Server thread/DEBUG] [FML]: Skipping mod com.blamejared.ctgui.MTRecipe, container opted to not load.
[15:07:16] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crafttweaker.mc1120.CraftTweaker) - loading
[15:07:16] [Server thread/TRACE] [FML]: Parsed dependency info for crafttweaker: Requirements: [] After:[] Before:[]
[15:07:16] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (crafttweaker.mods.jei.JEIMod) - loading
[15:07:16] [Server thread/TRACE] [FML]: Parsed dependency info for crafttweakerjei: Requirements: [] After:[jei@[4.12.0,)] Before:[]
[15:07:16] [Server thread/DEBUG] [FML]: Examining file CTM-MC1.12.2-1.0.2.31.jar for potential mods
[15:07:16] [Server thread/TRACE] [FML]: Located mcmod.info file in file CTM-MC1.12.2-1.0.2.31.jar
[15:07:17] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (team.chisel.ctm.CTM) - loading
[15:07:17] [Server thread/INFO] [FML]: Disabling mod ctm it is client side only.
[15:07:17] [Server thread/DEBUG] [FML]: Skipping mod team.chisel.ctm.CTM, container opted to not load.
[15:07:17] [Server thread/DEBUG] [FML]: Examining file Decocraft-2.6.3_1.12.2.jar for potential mods
[15:07:17] [Server thread/TRACE] [FML]: Located mcmod.info file in file Decocraft-2.6.3_1.12.2.jar
[15:07:17] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mia.props.Props) - loading
[15:07:17] [Server thread/TRACE] [FML]: Parsed dependency info for props: Requirements: [] After:[ptrmodellib] Before:[]
[15:07:17] [Server thread/DEBUG] [FML]: Examining file expandedbonemeal-1.11-1.2.1.jar for potential mods
[15:07:17] [Server thread/TRACE] [FML]: Located mcmod.info file in file expandedbonemeal-1.11-1.2.1.jar
[15:07:17] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (josephcsible.expandedbonemeal.ExpandedBonemeal) - loading
[15:07:17] [Server thread/TRACE] [FML]: Parsed dependency info for expandedbonemeal: Requirements: [] After:[] Before:[]
[15:07:17] [Server thread/DEBUG] [FML]: Examining file extrautils2-1.12-1.9.9.jar for potential mods
[15:07:17] [Server thread/TRACE] [FML]: Located mcmod.info file in file extrautils2-1.12-1.9.9.jar
[15:07:17] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.rwtema.extrautils2.ExtraUtils2) - loading
[15:07:17] [Server thread/TRACE] [FML]: Parsed dependency info for extrautils2: Requirements: [] After:[tconstruct] Before:[]
[15:07:18] [Server thread/DEBUG] [FML]: Examining file fairylights-2.2.0-1.12.2.jar for potential mods
[15:07:18] [Server thread/TRACE] [FML]: Located mcmod.info file in file fairylights-2.2.0-1.12.2.jar
[15:07:18] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.pau101.fairylights.FairyLights) - loading
[15:07:18] [Server thread/TRACE] [FML]: Parsed dependency info for fairylights: Requirements: [forge@[14.23.5.2847,)] After:[forge@[14.23.5.2847,)] Before:[]
[15:07:18] [Server thread/DEBUG] [FML]: Examining file Floocraft 1.12.2-1.9.6.jar for potential mods
[15:07:18] [Server thread/TRACE] [FML]: Located mcmod.info file in file Floocraft 1.12.2-1.9.6.jar
[15:07:18] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.fredtargaryen.floocraft.FloocraftBase) - loading
[15:07:18] [Server thread/TRACE] [FML]: Using mcmod dependency info for floocraftft: [] [mirage] []
[15:07:19] [Server thread/DEBUG] [FML]: Examining file foamflower-1.12.2-1.0.0.0-beta1.jar for potential mods
[15:07:19] [Server thread/TRACE] [FML]: Located mcmod.info file in file foamflower-1.12.2-1.0.0.0-beta1.jar
[15:07:19] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.kamildanak.minecraft.foamflower.Foamflower) - loading
[15:07:19] [Server thread/TRACE] [FML]: Parsed dependency info for foamflower: Requirements: [] After:[] Before:[]
[15:07:19] [Server thread/DEBUG] [FML]: Examining file Forgelin-1.8.4.jar for potential mods
[15:07:19] [Server thread/TRACE] [FML]: Located mcmod.info file in file Forgelin-1.8.4.jar
[15:07:19] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.shadowfacts.forgelin.Forgelin) - loading
[15:07:19] [Server thread/TRACE] [FML]: Using custom language adapter net.shadowfacts.forgelin.KotlinAdapter for net.shadowfacts.forgelin.Forgelin (modid: forgelin)
[15:07:19] [Server thread/TRACE] [FML]: Parsed dependency info for forgelin: Requirements: [] After:[] Before:[]
[15:07:23] [Server thread/DEBUG] [FML]: Examining file FriendshipBracelet-1.1.2.jar for potential mods
[15:07:23] [Server thread/TRACE] [FML]: Located mcmod.info file in file FriendshipBracelet-1.1.2.jar
[15:07:23] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.elytradev.friendshipbracelet.FriendshipBracelet) - loading
[15:07:23] [Server thread/TRACE] [FML]: Parsed dependency info for friendshipbracelet: Requirements: [baubles@[1.5.2,)] After:[baubles@[1.5.2,)] Before:[]
[15:07:23] [Server thread/DEBUG] [FML]: Examining file furniture-6.3.1-1.12.2.jar for potential mods
[15:07:23] [Server thread/TRACE] [FML]: Located mcmod.info file in file furniture-6.3.1-1.12.2.jar
[15:07:23] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mrcrayfish.furniture.MrCrayfishFurnitureMod) - loading
[15:07:23] [Server thread/TRACE] [FML]: Parsed dependency info for cfm: Requirements: [] After:[crafttweaker] Before:[]
[15:07:23] [Server thread/DEBUG] [FML]: Examining file GooglyEyes-1.12.2-7.1.1.jar for potential mods
[15:07:23] [Server thread/TRACE] [FML]: Located mcmod.info file in file GooglyEyes-1.12.2-7.1.1.jar
[15:07:23] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ichun.mods.googlyeyes.common.GooglyEyes) - loading
[15:07:23] [Server thread/INFO] [FML]: Disabling mod googlyeyes it is client side only.
[15:07:23] [Server thread/DEBUG] [FML]: Skipping mod me.ichun.mods.googlyeyes.common.GooglyEyes, container opted to not load.
[15:07:23] [Server thread/DEBUG] [FML]: Examining file gravestone-1.10.3.jar for potential mods
[15:07:23] [Server thread/TRACE] [FML]: Located mcmod.info file in file gravestone-1.10.3.jar
[15:07:23] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (de.maxhenkel.gravestone.Main) - loading
[15:07:23] [Server thread/TRACE] [FML]: Parsed dependency info for gravestone: Requirements: [] After:[] Before:[]
[15:07:24] [Server thread/DEBUG] [FML]: Examining file Hats-1.12.2-7.1.1.jar for potential mods
[15:07:24] [Server thread/TRACE] [FML]: Located mcmod.info file in file Hats-1.12.2-7.1.1.jar
[15:07:24] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ichun.mods.hats.common.Hats) - loading
[15:07:24] [Server thread/TRACE] [FML]: Parsed dependency info for hats: Requirements: [ichunutil@[7.0.2,8.0.0)] After:[ichunutil@[7.0.2,8.0.0)] Before:[]
[15:07:24] [Server thread/DEBUG] [FML]: Examining file HatStand-1.12.2-7.1.0.jar for potential mods
[15:07:24] [Server thread/DEBUG] [FML]: The mod container HatStand-1.12.2-7.1.0.jar appears to be missing an mcmod.info file
[15:07:24] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ichun.mods.hats.addons.hatstand.common.HatStand) - loading
[15:07:24] [Server thread/TRACE] [FML]: Parsed dependency info for hatstand: Requirements: [hats@[7.0.0,)] After:[hats@[7.0.0,)] Before:[]
[15:07:24] [Server thread/DEBUG] [FML]: Examining file Hwyla-1.8.26-B41_1.12.2.jar for potential mods
[15:07:24] [Server thread/TRACE] [FML]: Located mcmod.info file in file Hwyla-1.8.26-B41_1.12.2.jar
[15:07:24] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (mcp.mobius.waila.Waila) - loading
[15:07:24] [Server thread/TRACE] [FML]: Parsed dependency info for waila: Requirements: [] After:[] Before:[]
[15:07:24] [Server thread/DEBUG] [FML]: Examining file iceandfire-1.9.1-1.12.2.jar for potential mods
[15:07:24] [Server thread/TRACE] [FML]: Located mcmod.info file in file iceandfire-1.9.1-1.12.2.jar
[15:07:25] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.github.alexthe666.iceandfire.IceAndFire) - loading
[15:07:25] [Server thread/TRACE] [FML]: Using mcmod dependency info for iceandfire: [llibrary, forge] [llibrary, forge] []
[15:07:25] [Server thread/DEBUG] [FML]: Examining file iChunUtil-1.12.2-7.2.2.jar for potential mods
[15:07:25] [Server thread/TRACE] [FML]: Located mcmod.info file in file iChunUtil-1.12.2-7.2.2.jar
[15:07:25] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ichun.mods.ichunutil.common.iChunUtil) - loading
[15:07:25] [Server thread/TRACE] [FML]: Parsed dependency info for ichunutil: Requirements: [forge@[14.23.5.2781,99999.24.0.0)] After:[forge@[14.23.5.2781,99999.24.0.0)] Before:[]
[15:07:25] [Server thread/DEBUG] [FML]: Examining file ImprovedBackpacks-1.12.2-1.5.0.0.jar for potential mods
[15:07:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file ImprovedBackpacks-1.12.2-1.5.0.0.jar
[15:07:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (ru.poopycoders.improvedbackpacks.ImprovedBackpacks) - loading
[15:07:26] [Server thread/TRACE] [FML]: Parsed dependency info for improvedbackpacks: Requirements: [] After:[] Before:[]
[15:07:26] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from ImprovedBackpacks-1.12.2-1.5.0.0.jar to locate a version number for mod improvedbackpacks
[15:07:26] [Server thread/WARN] [FML]: Mod improvedbackpacks is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.12.2-1.5.0.0
[15:07:26] [Server thread/DEBUG] [FML]: Examining file inventorypets-1.12-2.0.12.jar for potential mods
[15:07:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file inventorypets-1.12-2.0.12.jar
[15:07:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.inventorypets.InventoryPets) - loading
[15:07:26] [Server thread/TRACE] [FML]: Parsed dependency info for inventorypets: Requirements: [] After:[] Before:[]
[15:07:26] [Server thread/DEBUG] [FML]: Examining file jei_1.12.2-4.16.1.301.jar for potential mods
[15:07:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file jei_1.12.2-4.16.1.301.jar
[15:07:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (mezz.jei.JustEnoughItems) - loading
[15:07:26] [Server thread/TRACE] [FML]: Parsed dependency info for jei: Requirements: [forge@[14.23.5.2816,)] After:[forge@[14.23.5.2816,)] Before:[]
[15:07:26] [Server thread/DEBUG] [FML]: Examining file JRFTL[1.12.2]-1.1.jar for potential mods
[15:07:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file JRFTL[1.12.2]-1.1.jar
[15:07:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (at.xander.jrftl.JRFTL) - loading
[15:07:26] [Server thread/TRACE] [FML]: Parsed dependency info for jrftl: Requirements: [] After:[] Before:[]
[15:07:26] [Server thread/DEBUG] [FML]: Examining file ldshadowlady-customcraftingtables-1.0.jar for potential mods
[15:07:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file ldshadowlady-customcraftingtables-1.0.jar
[15:07:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.ldshadowlady.customcraftingtables.CustomCraftingTables) - loading
[15:07:26] [Server thread/TRACE] [FML]: Parsed dependency info for customcraftingtables: Requirements: [] After:[] Before:[]
[15:07:26] [Server thread/DEBUG] [FML]: Examining file mcw-bridges-1.0.4-mc1.12.2.jar for potential mods
[15:07:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file mcw-bridges-1.0.4-mc1.12.2.jar
[15:07:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mcwbridges.kikoz.Mcwbridges) - loading
[15:07:26] [Server thread/TRACE] [FML]: Parsed dependency info for mcwbridges: Requirements: [] After:[] Before:[]
[15:07:26] [Server thread/DEBUG] [FML]: Examining file mcw-fences-1.0.0-mc1.12.2.jar for potential mods
[15:07:26] [Server thread/TRACE] [FML]: Located mcmod.info file in file mcw-fences-1.0.0-mc1.12.2.jar
[15:07:26] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mcwfences.kikoz.Mcwfences) - loading
[15:07:26] [Server thread/TRACE] [FML]: Parsed dependency info for mcwfences: Requirements: [] After:[] Before:[]
[15:07:27] [Server thread/DEBUG] [FML]: Examining file modtweaker-4.0.18.jar for potential mods
[15:07:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file modtweaker-4.0.18.jar
[15:07:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.blamejared.ModTweaker) - loading
[15:07:27] [Server thread/TRACE] [FML]: Parsed dependency info for modtweaker: Requirements: [crafttweaker, mtlib] After:[crafttweaker, mtlib] Before:[jei]
[15:07:27] [Server thread/DEBUG] [FML]: Examining file MoreLootStuff-1.12.2-0.0.5.jar for potential mods
[15:07:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file MoreLootStuff-1.12.2-0.0.5.jar
[15:07:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (leviathan143.morelootstuff.MoreLootStuff) - loading
[15:07:27] [Server thread/TRACE] [FML]: Parsed dependency info for morelootstuff: Requirements: [forge@[14.23.1.2577,)] After:[forge@[14.23.1.2577,), loottweaker@[0.0.8,)] Before:[]
[15:07:27] [Server thread/DEBUG] [FML]: Examining file Morph-1.12.2-7.2.1.jar for potential mods
[15:07:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file Morph-1.12.2-7.2.1.jar
[15:07:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ichun.mods.morph.common.Morph) - loading
[15:07:27] [Server thread/TRACE] [FML]: Parsed dependency info for morph: Requirements: [ichunutil@[7.2.0,8.0.0)] After:[ichunutil@[7.2.0,8.0.0)] Before:[]
[15:07:27] [Server thread/DEBUG] [FML]: Examining file MTLib-3.0.6.jar for potential mods
[15:07:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file MTLib-3.0.6.jar
[15:07:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.blamejared.mtlib.MTLib) - loading
[15:07:27] [Server thread/TRACE] [FML]: Parsed dependency info for mtlib: Requirements: [] After:[] Before:[]
[15:07:27] [Server thread/DEBUG] [FML]: Examining file NaturesCompass-1.12.2-1.8.5.jar for potential mods
[15:07:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file NaturesCompass-1.12.2-1.8.5.jar
[15:07:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.chaosthedude.naturescompass.NaturesCompass) - loading
[15:07:27] [Server thread/TRACE] [FML]: Parsed dependency info for naturescompass: Requirements: [] After:[] Before:[]
[15:07:27] [Server thread/DEBUG] [FML]: Examining file outfox-0.1.5-mc1.12.2.jar for potential mods
[15:07:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file outfox-0.1.5-mc1.12.2.jar
[15:07:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (kais.outfox.Outfox) - loading
[15:07:27] [Server thread/TRACE] [FML]: Parsed dependency info for outfox: Requirements: [forge@[14.23.3.2678,)] After:[forge@[14.23.3.2678,), theoneprobe@[1.4.28,), waila@[1.8.26,)] Before:[]
[15:07:27] [Server thread/DEBUG] [FML]: Examining file Patchouli-1.0-23.6.jar for potential mods
[15:07:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file Patchouli-1.0-23.6.jar
[15:07:27] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (vazkii.patchouli.common.base.Patchouli) - loading
[15:07:27] [Server thread/TRACE] [FML]: Parsed dependency info for patchouli: Requirements: [] After:[] Before:[]
[15:07:27] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from Patchouli-1.0-23.6.jar to locate a version number for mod patchouli
[15:07:27] [Server thread/WARN] [FML]: Mod patchouli is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.0-23.6
[15:07:27] [Server thread/DEBUG] [FML]: Examining file PattysMoreStuff-stable-1.1.8.5.jar for potential mods
[15:07:27] [Server thread/TRACE] [FML]: Located mcmod.info file in file PattysMoreStuff-stable-1.1.8.5.jar
[15:07:28] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.stc.pattysmorestuff.PattysMoreStuff) - loading
[15:07:28] [Server thread/TRACE] [FML]: Parsed dependency info for pattysmorestuff: Requirements: [] After:[] Before:[]
[15:07:28] [Server thread/DEBUG] [FML]: Examining file placeableitems-3.3.jar for potential mods
[15:07:28] [Server thread/TRACE] [FML]: Located mcmod.info file in file placeableitems-3.3.jar
[15:07:29] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.ferdz.placeableitems.PlaceableItems) - loading
[15:07:29] [Server thread/TRACE] [FML]: Parsed dependency info for placeableitems: Requirements: [] After:[] Before:[]
[15:07:29] [Server thread/DEBUG] [FML]: Examining file PTRLib-1.0.4.jar for potential mods
[15:07:29] [Server thread/TRACE] [FML]: Located mcmod.info file in file PTRLib-1.0.4.jar
[15:07:29] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mia.craftstudio.minecraft.forge.CSLibMod) - loading
[15:07:29] [Server thread/INFO] [FML]: Disabling mod ptrmodellib it is client side only.
[15:07:29] [Server thread/DEBUG] [FML]: Skipping mod com.mia.craftstudio.minecraft.forge.CSLibMod, container opted to not load.
[15:07:29] [Server thread/DEBUG] [FML]: Examining file Quark-r1.6-179.jar for potential mods
[15:07:29] [Server thread/TRACE] [FML]: Located mcmod.info file in file Quark-r1.6-179.jar
[15:07:29] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (vazkii.quark.base.Quark) - loading
[15:07:29] [Server thread/TRACE] [FML]: Parsed dependency info for quark: Requirements: [autoreglib@[1.3-32,), forge@[14.23.5.2831,)] After:[forge@[14.23.5.2831,), jei@[4.6.0,)] Before:[autoreglib@[1.3-32,)]
[15:07:29] [Server thread/DEBUG] [FML]: Examining file RecurrentComplex-1.4.8.2.jar for potential mods
[15:07:29] [Server thread/TRACE] [FML]: Located mcmod.info file in file RecurrentComplex-1.4.8.2.jar
[15:07:29] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (ivorius.reccomplex.RecurrentComplex) - loading
[15:07:29] [Server thread/TRACE] [FML]: Parsed dependency info for reccomplex: Requirements: [ivtoolkit] After:[ivtoolkit] Before:[]
[15:07:30] [Server thread/DEBUG] [FML]: Examining file RoguelikeDungeons-1.12.2-1.8.0.jar for potential mods
[15:07:30] [Server thread/TRACE] [FML]: Located mcmod.info file in file RoguelikeDungeons-1.12.2-1.8.0.jar
[15:07:30] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (greymerk.roguelike.Roguelike) - loading
[15:07:30] [Server thread/TRACE] [FML]: Parsed dependency info for roguelike: Requirements: [] After:[] Before:[]
[15:07:30] [Server thread/DEBUG] [FML]: Examining file Skye's Bakery 2.1.1 for MC1.12.2.jar for potential mods
[15:07:30] [Server thread/TRACE] [FML]: Located mcmod.info file in file Skye's Bakery 2.1.1 for MC1.12.2.jar
[15:07:31] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.mcreator.skyes_bakery.skyes_bakery) - loading
[15:07:31] [Server thread/TRACE] [FML]: Using mcmod dependency info for skyes_bakery: [] [] []
[15:07:31] [Server thread/DEBUG] [FML]: Examining file tropicraft-MC1.12.2-7.1.9.115.jar for potential mods
[15:07:31] [Server thread/TRACE] [FML]: Located mcmod.info file in file tropicraft-MC1.12.2-7.1.9.115.jar
[15:07:31] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.tropicraft.Tropicraft) - loading
[15:07:31] [Server thread/TRACE] [FML]: Parsed dependency info for tropicraft: Requirements: [] After:[forge@[14.23.0.2544,)] Before:[]
[15:07:31] [Server thread/DEBUG] [FML]: Examining file twilightforest-1.12.2-3.11.1021-universal.jar for potential mods
[15:07:31] [Server thread/TRACE] [FML]: Located mcmod.info file in file twilightforest-1.12.2-3.11.1021-universal.jar
[15:07:31] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (twilightforest.TwilightForestMod) - loading
[15:07:31] [Server thread/TRACE] [FML]: Parsed dependency info for twilightforest: Requirements: [forge@[14.23.5.2813,)] After:[ctm@[MC1.12.2-0.3.2.18,), forge@[14.23.5.2813,), thaumcraft@[6.1.BETA21,)] Before:[immersiveengineering@[0.12-83,), tconstruct]
[15:07:32] [Server thread/DEBUG] [FML]: Examining file ultimate_unicorn_mod-1.12.2-1.5.17.jar for potential mods
[15:07:32] [Server thread/TRACE] [FML]: Located mcmod.info file in file ultimate_unicorn_mod-1.12.2-1.5.17.jar
[15:07:32] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.hackshop.ultimate_unicorn.UltimateUnicornMod) - loading
[15:07:32] [Server thread/TRACE] [FML]: Parsed dependency info for ultimate_unicorn_mod: Requirements: [] After:[] Before:[]
[15:07:32] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from ultimate_unicorn_mod-1.12.2-1.5.17.jar to locate a version number for mod ultimate_unicorn_mod
[15:07:32] [Server thread/WARN] [FML]: Mod ultimate_unicorn_mod is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.5.17
[15:07:32] [Server thread/DEBUG] [FML]: Examining file vending-1.12.2-3.0.1.2.jar for potential mods
[15:07:32] [Server thread/TRACE] [FML]: Located mcmod.info file in file vending-1.12.2-3.0.1.2.jar
[15:07:32] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (info.jbcs.minecraft.vending.Vending) - loading
[15:07:32] [Server thread/TRACE] [FML]: Parsed dependency info for vending: Requirements: [foamflower] After:[enderpay, foamflower] Before:[]
[15:07:32] [Server thread/DEBUG] [FML]: Examining file wings-1.1.6-1.12.2.jar for potential mods
[15:07:32] [Server thread/TRACE] [FML]: Located mcmod.info file in file wings-1.1.6-1.12.2.jar
[15:07:32] [Server thread/DEBUG] [FML]: Identified a mod of type Lme/paulf/wings/server/asm/plugin/Integration; (me.paulf.wings.server.integration.MowziesMobsIntegration) - loading
[15:07:32] [Server thread/TRACE] [FML]: Parsed dependency info for mowzies_wings: Requirements: [wings] After:[wings, mowziesmobs] Before:[]
[15:07:32] [Server thread/DEBUG] [FML]: Identified a mod of type Lme/paulf/wings/server/asm/plugin/Integration; (me.paulf.wings.server.integration.WingsBaublesIntegration) - loading
[15:07:32] [Server thread/TRACE] [FML]: Parsed dependency info for bauble_wings: Requirements: [wings] After:[wings, baubles@[1.5,1.6)] Before:[]
[15:07:32] [Server thread/DEBUG] [FML]: Identified a mod of type Lme/paulf/wings/server/asm/plugin/Integration; (me.paulf.wings.server.integration.WingsMoBendsIntegration) - loading
[15:07:32] [Server thread/TRACE] [FML]: Parsed dependency info for mobends_wings: Requirements: [wings] After:[wings, mobends@[0.24,0.25)] Before:[]
[15:07:32] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.paulf.wings.WingsMod) - loading
[15:07:32] [Server thread/TRACE] [FML]: Using mcmod dependency info for wings: [forge@[14.23.5.2816,), llibrary@[1.7,1.8)] [forge@[14.23.5.2816,), llibrary@[1.7,1.8), jei@[4.8,5)] []
[15:07:32] [Server thread/DEBUG] [FML]: Attempting to load the file version.properties from wings-1.1.6-1.12.2.jar to locate a version number for mod wings
[15:07:32] [Server thread/WARN] [FML]: Mod wings is missing the required element 'version' and a version.properties file could not be found. Falling back to metadata version 1.1.6
[15:07:32] [Server thread/DEBUG] [FML]: Examining file Xaeros_Minimap_21.4.1_Forge_1.12.jar for potential mods
[15:07:32] [Server thread/TRACE] [FML]: Located mcmod.info file in file Xaeros_Minimap_21.4.1_Forge_1.12.jar
[15:07:32] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (xaero.minimap.XaeroMinimap) - loading
[15:07:32] [Server thread/TRACE] [FML]: Parsed dependency info for xaerominimap: Requirements: [] After:[] Before:[]
[15:07:32] [Server thread/DEBUG] [FML]: Examining file llibrary-1.7.20-1.12.2.jar for potential mods
[15:07:32] [Server thread/TRACE] [FML]: Located mcmod.info file in file llibrary-1.7.20-1.12.2.jar
[15:07:32] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (net.ilexiconn.llibrary.LLibrary) - loading
[15:07:32] [Server thread/TRACE] [FML]: Parsed dependency info for llibrary: Requirements: [forge@[14.23.5.2772,)] After:[forge@[14.23.5.2772,)] Before:[]
[15:07:33] [Server thread/DEBUG] [FML]: Examining file themidnight-0.3.5.jar for potential mods
[15:07:33] [Server thread/TRACE] [FML]: Located mcmod.info file in file themidnight-0.3.5.jar
[15:07:33] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.mushroom.midnight.Midnight) - loading
[15:07:33] [Server thread/TRACE] [FML]: Parsed dependency info for midnight: Requirements: [forge@[14.23.5.2768,)] After:[] Before:[]
[15:07:33] [Server thread/DEBUG] [FML]: Examining file orbis-lib-1.12.2-0.2.0+build411.jar for potential mods
[15:07:33] [Server thread/TRACE] [FML]: Located mcmod.info file in file orbis-lib-1.12.2-0.2.0+build411.jar
[15:07:33] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (com.gildedgames.orbis.lib.OrbisLib) - loading
[15:07:33] [Server thread/TRACE] [FML]: Using mcmod dependency info for orbis-lib: [] [] []
[15:07:33] [Server thread/DEBUG] [FML]: Examining file phosphor-1.12.2-0.2.6+build50.jar for potential mods
[15:07:33] [Server thread/TRACE] [FML]: Located mcmod.info file in file phosphor-1.12.2-0.2.6+build50.jar
[15:07:33] [Server thread/DEBUG] [FML]: Identified a mod of type Lnet/minecraftforge/fml/common/Mod; (me.jellysquid.mods.phosphor.mod.PhosphorMod) - loading
[15:07:33] [Server thread/TRACE] [FML]: Parsed dependency info for phosphor-lighting: Requirements: [] After:[neid@[**.**.**.**,), spongeforge@[1.12.2-2838-7.1.7-RC3844,)] Before:[]
[15:07:34] [Server thread/INFO] [FML]: Forge Mod Loader has identified 68 mods to load
[15:07:35] [Server thread/DEBUG] [FML]: Found API vazkii.quark.api (owned by quark providing QuarkAPI) embedded in quark
[15:07:35] [Server thread/DEBUG] [FML]: Found API team.chisel.api.carving (owned by Chisel providing ChiselAPI|Carving) embedded in chisel
[15:07:35] [Server thread/DEBUG] [FML]: Found API baubles.api (owned by Baubles providing Baubles|API) embedded in baubles
[15:07:35] [Server thread/DEBUG] [FML]: Found API baubles.api (owned by Baubles providing Baubles|API) embedded in improvedbackpacks
[15:07:35] [Server thread/DEBUG] [FML]: Found API ru.poopycoders.improvedbackpacks.api (owned by improvedbackpacks providing ImprovedBackpacks|API) embedded in improvedbackpacks
[15:07:35] [Server thread/DEBUG] [FML]: Found API com.teammetallurgy.atum.api (owned by atum providing AtumAPI) embedded in atum
[15:07:35] [Server thread/DEBUG] [FML]: Found API mezz.jei.api (owned by jei providing JustEnoughItemsAPI) embedded in jei
[15:07:35] [Server thread/DEBUG] [FML]: Found API me.ichun.mods.ichunutil.api (owned by iChun providing iChunUtil API) embedded in ichunutil
[15:07:35] [Server thread/DEBUG] [FML]: Found API team.chisel.api (owned by chisel providing Chisel-API) embedded in chisel
[15:07:35] [Server thread/DEBUG] [FML]: Found API mcp.mobius.waila.api (owned by Waila providing WailaAPI) embedded in waila
[15:07:35] [Server thread/DEBUG] [FML]: Found API vazkii.patchouli.api (owned by patchouli providing PatchouliAPI) embedded in patchouli
[15:07:35] [Server thread/INFO] [FML]: Found mod(s) [inventorypets] containing declared API package baubles.api (owned by Baubles) without associated API reference
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API Baubles|API: owner: Baubles, dependents: [baubles, improvedbackpacks, inventorypets]
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API iChunUtil API: owner: iChun, dependents: [ichunutil]
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API JustEnoughItemsAPI: owner: jei, dependents: []
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API AtumAPI: owner: atum, dependents: []
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-events: owner: ctm, dependents: []
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API WailaAPI: owner: Waila, dependents: [waila]
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-utils: owner: ctm, dependents: []
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API ImprovedBackpacks|API: owner: improvedbackpacks, dependents: []
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API Chisel-API: owner: chisel, dependents: []
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API PatchouliAPI: owner: patchouli, dependents: []
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-models: owner: ctm, dependents: []
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api-textures: owner: ctm, dependents: []
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API QuarkAPI: owner: quark, dependents: []
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API ChiselAPI|Carving: owner: Chisel, dependents: [chisel]
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API ctm-api: owner: ctm, dependents: []
[15:07:35] [Server thread/DEBUG] [FML]: Creating API container dummy for API CSLib|API: owner: ptrmodellib, dependents: []
[15:07:35] [Server thread/TRACE] [FML]: Received a system property request ''
[15:07:35] [Server thread/TRACE] [FML]: System property request managing the state of 0 mods
[15:07:35] [Server thread/DEBUG] [FML]: After merging, found state information for 0 mods
[15:07:35] [Server thread/WARN] [FML]: Missing English translation for FML: assets/fml/lang/en_us.lang
[15:07:35] [Server thread/DEBUG] [FML]: Enabling mod advancedcombat
[15:07:35] [Server thread/DEBUG] [FML]: Enabling mod aether
[15:07:35] [Server thread/DEBUG] [FML]: Enabling mod atum
[15:07:35] [Server thread/DEBUG] [FML]: Enabling mod autoreglib
[15:07:35] [Server thread/DEBUG] [FML]: Enabling mod babymobs
[15:07:35] [Server thread/DEBUG] [FML]: Enabling mod baubles
[15:07:35] [Server thread/DEBUG] [FML]: Enabling mod bibliocraft
[15:07:35] [Server thread/DEBUG] [FML]: Enabling mod biomesoplenty
[15:07:35] [Server thread/DEBUG] [FML]: Enabling mod chisel
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod clumps
[15:07:36] [Server thread/WARN] [FML]: Missing English translation for clumps: assets/clumps/lang/en_us.lang
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod comfycozy
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod craftablesaddles
[15:07:36] [Server thread/WARN] [FML]: Missing English translation for craftablesaddles: assets/craftablesaddles/lang/en_us.lang
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod crafttweaker
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod crafttweakerjei
[15:07:36] [Server thread/WARN] [FML]: Missing English translation for crafttweakerjei: assets/crafttweakerjei/lang/en_us.lang
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod props
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod expandedbonemeal
[15:07:36] [Server thread/WARN] [FML]: Missing English translation for expandedbonemeal: assets/expandedbonemeal/lang/en_us.lang
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod extrautils2
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod fairylights
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod floocraftft
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod foamflower
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod forgelin
[15:07:36] [Server thread/WARN] [FML]: Missing English translation for forgelin: assets/forgelin/lang/en_us.lang
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod friendshipbracelet
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod cfm
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod gravestone
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod hats
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod hatstand
[15:07:36] [Server thread/WARN] [FML]: Missing English translation for hatstand: assets/hatstand/lang/en_us.lang
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod waila
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod iceandfire
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod ichunutil
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod improvedbackpacks
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod inventorypets
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod jei
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod jrftl
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod customcraftingtables
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod mcwbridges
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod mcwfences
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod modtweaker
[15:07:36] [Server thread/WARN] [FML]: Missing English translation for modtweaker: assets/modtweaker/lang/en_us.lang
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod morelootstuff
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod morph
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod mtlib
[15:07:36] [Server thread/WARN] [FML]: Missing English translation for mtlib: assets/mtlib/lang/en_us.lang
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod naturescompass
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod outfox
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod patchouli
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod pattysmorestuff
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod placeableitems
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod quark
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod reccomplex
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod roguelike
[15:07:36] [Server thread/WARN] [FML]: Missing English translation for roguelike: assets/roguelike/lang/en_us.lang
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod skyes_bakery
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod tropicraft
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod twilightforest
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod ultimate_unicorn_mod
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod vending
[15:07:36] [Server thread/WARN] [FML]: Mod mowzies_wings has been disabled through configuration
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod bauble_wings
[15:07:36] [Server thread/WARN] [FML]: Missing English translation for bauble_wings: assets/bauble_wings/lang/en_us.lang
[15:07:36] [Server thread/WARN] [FML]: Mod mobends_wings has been disabled through configuration
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod wings
[15:07:36] [Server thread/DEBUG] [FML]: Enabling mod xaerominimap
[15:07:37] [Server thread/WARN] [FML]: Missing English translation for xaerominimap: assets/xaerominimap/lang/en_us.lang
[15:07:37] [Server thread/DEBUG] [FML]: Enabling mod llibrary
[15:07:37] [Server thread/DEBUG] [FML]: Enabling mod midnight
[15:07:37] [Server thread/DEBUG] [FML]: Enabling mod orbis-lib
[15:07:37] [Server thread/WARN] [FML]: Missing English translation for orbis-lib: assets/orbis-lib/lang/en_us.lang
[15:07:37] [Server thread/DEBUG] [FML]: Enabling mod phosphor-lighting
[15:07:37] [Server thread/WARN] [FML]: Missing English translation for phosphor-lighting: assets/phosphor-lighting/lang/en_us.lang
[15:07:37] [Server thread/TRACE] [FML]: Verifying mod requirements are satisfied
[15:07:37] [Server thread/TRACE] [FML]: All mod requirements are satisfied
[15:07:37] [Server thread/TRACE] [FML]: Sorting mods into an ordered list
[15:07:37] [Server thread/TRACE] [FML]: Mod sorting completed successfully
[15:07:37] [Server thread/DEBUG] [FML]: Mod sorting data
[15:07:37] [Server thread/DEBUG] [FML]: advancedcombat(Advanced Combat:1.1.2): advancedcombat-1.1.2-[1.12].jar ()
[15:07:37] [Server thread/DEBUG] [FML]: orbis-lib(OrbisLib:0.2.0): orbis-lib-1.12.2-0.2.0+build411.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: aether(Aether II:0.3.0): aether_ii-1.12.2-0.3.0+build411-universal.jar (required-after:orbis-lib@[0.2.0,);required-after:forge@[14.23.5.2816,))
[15:07:37] [Server thread/DEBUG] [FML]: Baubles|API(API: Baubles|API:**.**.**.**): Baubles-1.12-1.5.2.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: baubles(Baubles:1.5.2): Baubles-1.12-1.5.2.jar (required-after:forge@[14.21.0.2348,);)
[15:07:37] [Server thread/DEBUG] [FML]: atum(Atum 2:2.0.20): Atum-1.12.2-2.0.20.jar (required-after:forge@[14.23.5.2768,);after:baubles)
[15:07:37] [Server thread/DEBUG] [FML]: crafttweaker(CraftTweaker2:4.1.20): CraftTweaker2-1.12-4.1.20.618.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: mtlib(MTLib:3.0.6): MTLib-3.0.6.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: modtweaker(Mod Tweaker:4.0.18): modtweaker-4.0.18.jar (required-after:crafttweaker;required-after:mtlib;before:jei)
[15:07:37] [Server thread/DEBUG] [FML]: jei(Just Enough Items:**.**.**.**): jei_1.12.2-4.16.1.301.jar (required-after:forge@[14.23.5.2816,);)
[15:07:37] [Server thread/DEBUG] [FML]: quark(Quark:r1.6-179): Quark-r1.6-179.jar (required-after:forge@[14.23.5.2831,);required-before:autoreglib@[1.3-32,);after:jei@[4.6.0,);)
[15:07:37] [Server thread/DEBUG] [FML]: autoreglib(AutoRegLib:1.3-32): AutoRegLib-1.3-32.jar (required-after:forge@[14.21.1.2387,))
[15:07:37] [Server thread/DEBUG] [FML]: babymobs(Baby Mobs:1.5.5): BabyMobs-1.12-1.5.5.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: bibliocraft(BiblioCraft:2.4.5): BiblioCraft[v2.4.5][MC1.12.2].jar ()
[15:07:37] [Server thread/DEBUG] [FML]: biomesoplenty(Biomes O' Plenty:7.0.1.2293): BiomesOPlenty-1.12.2-7.0.1.2293-universal.jar (required-after:forge@[14.23.0.2491,))
[15:07:37] [Server thread/DEBUG] [FML]: ChiselAPI|Carving(API: ChiselAPI|Carving:0.0.1): Chisel-MC1.12.2-1.0.2.45.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: chisel(Chisel:MC1.12.2-1.0.2.45): Chisel-MC1.12.2-1.0.2.45.jar (required-after:forge@[14.23.5.2806,);required-after-client:ctm@[MC1.12.2-1.0.2.31,);after:jei@[4.12.0,5))
[15:07:37] [Server thread/DEBUG] [FML]: clumps(Clumps:3.1.2): Clumps-3.1.2.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: comfycozy(Comfy Cozy:1.3): comfycozy-1.3.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: craftablesaddles(Craftable Saddles:1.3): Craftable Saddles[1.12]-1.3.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: crafttweakerjei(CraftTweaker JEI Support:2.0.3): CraftTweaker2-1.12-4.1.20.618.jar (after:jei@[4.12.0,);)
[15:07:37] [Server thread/DEBUG] [FML]: props(Decocraft:2.6.3): Decocraft-2.6.3_1.12.2.jar (required-after-client:ptrmodellib@[1.0.3,);after:ptrmodellib)
[15:07:37] [Server thread/DEBUG] [FML]: expandedbonemeal(ExpandedBonemeal:1.2.1): expandedbonemeal-1.11-1.2.1.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: extrautils2(Extra Utilities 2:1.0): extrautils2-1.12-1.9.9.jar (after:tconstruct)
[15:07:37] [Server thread/DEBUG] [FML]: fairylights(Fairy Lights:2.1.10): fairylights-2.2.0-1.12.2.jar (required-after:forge@[14.23.5.2847,))
[15:07:37] [Server thread/DEBUG] [FML]: floocraftft(Floocraft:1.9.6): Floocraft 1.12.2-1.9.6.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: foamflower(Foamflower:1.12.2-1.0.0.0-beta1): foamflower-1.12.2-1.0.0.0-beta1.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: forgelin(Shadowfacts' Forgelin:1.8.4): Forgelin-1.8.4.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: friendshipbracelet(Friendship Bracelet:1.1.2): FriendshipBracelet-1.1.2.jar (required-after:baubles@[1.5.2,))
[15:07:37] [Server thread/DEBUG] [FML]: cfm(MrCrayfish's Furniture Mod:6.3.1): furniture-6.3.1-1.12.2.jar (after:crafttweaker)
[15:07:37] [Server thread/DEBUG] [FML]: gravestone(Gravestone Mod:1.10.3): gravestone-1.10.3.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: iChunUtil API(API: iChunUtil API:1.2.0): iChunUtil-1.12.2-7.2.2.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: ichunutil(iChunUtil:7.2.2): iChunUtil-1.12.2-7.2.2.jar (required-after:forge@[14.23.5.2781,99999.24.0.0))
[15:07:37] [Server thread/DEBUG] [FML]: hats(Hats:7.1.1): Hats-1.12.2-7.1.1.jar (required-after:ichunutil@[7.0.2,8.0.0))
[15:07:37] [Server thread/DEBUG] [FML]: hatstand(HatStand:7.1.0): HatStand-1.12.2-7.1.0.jar (required-after:hats@[7.0.0,))
[15:07:37] [Server thread/DEBUG] [FML]: WailaAPI(API: WailaAPI:1.3): Hwyla-1.8.26-B41_1.12.2.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: waila(Waila:1.8.26): Hwyla-1.8.26-B41_1.12.2.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: llibrary(LLibrary:1.7.20): llibrary-1.7.20-1.12.2.jar (required-after:forge@[14.23.5.2772,))
[15:07:37] [Server thread/DEBUG] [FML]: iceandfire(Ice and Fire:1.9.1): iceandfire-1.9.1-1.12.2.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: improvedbackpacks(Improved Backpacks:1.12.2-1.5.0.0): ImprovedBackpacks-1.12.2-1.5.0.0.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: inventorypets(Inventory Pets:2.0.12): inventorypets-1.12-2.0.12.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: jrftl(Just Another Rotten Flesh to Leather Mod:1.1): JRFTL[1.12.2]-1.1.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: customcraftingtables(CustomCraftingTables:1.0.0): ldshadowlady-customcraftingtables-1.0.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: mcwbridges(Macaw's Bridges:1.0.4): mcw-bridges-1.0.4-mc1.12.2.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: mcwfences(Macaw's Fences and Walls:1.0.0): mcw-fences-1.0.0-mc1.12.2.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: morelootstuff(More Loot Stuff:0.0.5): MoreLootStuff-1.12.2-0.0.5.jar (required-after:forge@[14.23.1.2577,);after:loottweaker@[0.0.8,))
[15:07:37] [Server thread/DEBUG] [FML]: morph(Morph:7.2.0): Morph-1.12.2-7.2.1.jar (required-after:ichunutil@[7.2.0,8.0.0))
[15:07:37] [Server thread/DEBUG] [FML]: naturescompass(Nature's Compass:1.8.5): NaturesCompass-1.12.2-1.8.5.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: outfox(Outfox:0.1.5): outfox-0.1.5-mc1.12.2.jar (required-after:forge@[14.23.3.2678,);after:theoneprobe@[1.4.28,);after:waila@[1.8.26,))
[15:07:37] [Server thread/DEBUG] [FML]: patchouli(Patchouli:1.0-23.6): Patchouli-1.0-23.6.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: pattysmorestuff(PattysMoreStuff:1.1.9): PattysMoreStuff-stable-1.1.8.5.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: placeableitems(Placeable Items Mod:3.3): placeableitems-3.3.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: reccomplex(Recurrent Complex:**.**.**.**): RecurrentComplex-1.4.8.2.jar (required-after:ivtoolkit)
[15:07:37] [Server thread/DEBUG] [FML]: roguelike(Roguelike Dungeons:1.8.0): RoguelikeDungeons-1.12.2-1.8.0.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: skyes_bakery(Skye's Bakery:2.1.1): Skye's Bakery 2.1.1 for MC1.12.2.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: tropicraft(Tropicraft:**.**.**.**): tropicraft-MC1.12.2-7.1.9.115.jar (after:forge@[14.23.0.2544,))
[15:07:37] [Server thread/DEBUG] [FML]: twilightforest(The Twilight Forest:3.11.1021): twilightforest-1.12.2-3.11.1021-universal.jar (after:ctm@[MC1.12.2-0.3.2.18,);before:immersiveengineering@[0.12-83,);before:tconstruct;required-after:forge@[14.23.5.2813,);after:thaumcraft@[6.1.BETA21,))
[15:07:37] [Server thread/DEBUG] [FML]: ultimate_unicorn_mod(Wings, Horns, and Hooves, the Ultimate Unicorn Mod!:1.5.17): ultimate_unicorn_mod-1.12.2-1.5.17.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: vending(Vending:1.12.2-3.0.1.2): vending-1.12.2-3.0.1.2.jar (after:enderpay;required-after:foamflower)
[15:07:37] [Server thread/DEBUG] [FML]: wings(Wings:1.1.6): wings-1.1.6-1.12.2.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: bauble_wings(Bauble Wings:1.0.0): wings-1.1.6-1.12.2.jar (required-after:wings;after:baubles@[1.5,1.6))
[15:07:37] [Server thread/DEBUG] [FML]: xaerominimap(Xaero's Minimap:21.4.1): Xaeros_Minimap_21.4.1_Forge_1.12.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: midnight(Midnight:0.3.5): themidnight-0.3.5.jar (required:forge@[14.23.5.2768,))
[15:07:37] [Server thread/DEBUG] [FML]: phosphor-lighting(Phosphor Lighting Engine:1.12.2-0.2.6): phosphor-1.12.2-0.2.6+build50.jar (after:neid@[**.**.**.**,);after:spongeforge@[1.12.2-2838-7.1.7-RC3844,))
[15:07:37] [Server thread/DEBUG] [FML]: JustEnoughItemsAPI(API: JustEnoughItemsAPI:4.13.0): jei_1.12.2-4.16.1.301.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: AtumAPI(API: AtumAPI:0.0.2): Atum-1.12.2-2.0.20.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: ctm-api-events(API: ctm-api-events:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: ctm-api-utils(API: ctm-api-utils:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: ImprovedBackpacks|API(API: ImprovedBackpacks|API:**.**.**.**): ImprovedBackpacks-1.12.2-1.5.0.0.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: Chisel-API(API: Chisel-API:0.0.1): Chisel-MC1.12.2-1.0.2.45.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: PatchouliAPI(API: PatchouliAPI:6): Patchouli-1.0-23.6.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: ctm-api-models(API: ctm-api-models:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: ctm-api-textures(API: ctm-api-textures:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: QuarkAPI(API: QuarkAPI:4): Quark-r1.6-179.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: ctm-api(API: ctm-api:0.1.0): CTM-MC1.12.2-1.0.2.31.jar ()
[15:07:37] [Server thread/DEBUG] [FML]: CSLib|API(API: CSLib|API:1.0.1): PTRLib-1.0.4.jar ()
[15:07:37] [Server thread/INFO] [FML]: FML has found a non-mod file CTM-MC1.12.2-1.0.2.31.jar in your mods directory. It will now be injected into your classpath. This could severe stability issues, it should be removed if possible.
[15:07:37] [Server thread/INFO] [FML]: FML has found a non-mod file GooglyEyes-1.12.2-7.1.1.jar in your mods directory. It will now be injected into your classpath. This could severe stability issues, it should be removed if possible.
[15:07:37] [Server thread/INFO] [FML]: FML has found a non-mod file PTRLib-1.0.4.jar in your mods directory. It will now be injected into your classpath. This could severe stability issues, it should be removed if possible.
[15:07:37] [Server thread/DEBUG] [FML]: Loading @Config anotation data
[15:07:37] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod minecraft
[15:07:37] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod minecraft
[15:07:37] [Server thread/DEBUG] [FML]: Bar Step: Construction - Minecraft took 0.012s
[15:07:37] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mcp
[15:07:37] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mcp
[15:07:37] [Server thread/DEBUG] [FML]: Bar Step: Construction - Minecraft Coder Pack took 0.006s
[15:07:37] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod FML
[15:07:46] [Server thread/TRACE] [FML]: Mod FML is using network checker : Invoking method checkModLists
[15:07:46] [Server thread/TRACE] [FML]: Testing mod FML to verify it accepts its own version in a remote connection
[15:07:46] [Server thread/TRACE] [FML]: The mod FML accepts its own version (**.**.**.**)
[15:07:46] [Server thread/INFO] [FML]: Attempting connection with missing mods [minecraft, mcp, FML, forge, ivtoolkit, xaerominimap_core, advancedcombat, aether, atum, autoreglib, babymobs, baubles, bibliocraft, biomesoplenty, chisel, clumps, comfycozy, craftablesaddles, crafttweaker, crafttweakerjei, props, expandedbonemeal, extrautils2, fairylights, floocraftft, foamflower, forgelin, friendshipbracelet, cfm, gravestone, hats, hatstand, waila, iceandfire, ichunutil, improvedbackpacks, inventorypets, jei, jrftl, customcraftingtables, mcwbridges, mcwfences, modtweaker, morelootstuff, morph, mtlib, naturescompass, outfox, patchouli, pattysmorestuff, placeableitems, quark, reccomplex, roguelike, skyes_bakery, tropicraft, twilightforest, ultimate_unicorn_mod, vending, bauble_wings, wings, xaerominimap, llibrary, midnight, orbis-lib, phosphor-lighting] at CLIENT
[15:07:46] [Server thread/INFO] [FML]: Attempting connection with missing mods [minecraft, mcp, FML, forge, ivtoolkit, xaerominimap_core, advancedcombat, aether, atum, autoreglib, babymobs, baubles, bibliocraft, biomesoplenty, chisel, clumps, comfycozy, craftablesaddles, crafttweaker, crafttweakerjei, props, expandedbonemeal, extrautils2, fairylights, floocraftft, foamflower, forgelin, friendshipbracelet, cfm, gravestone, hats, hatstand, waila, iceandfire, ichunutil, improvedbackpacks, inventorypets, jei, jrftl, customcraftingtables, mcwbridges, mcwfences, modtweaker, morelootstuff, morph, mtlib, naturescompass, outfox, patchouli, pattysmorestuff, placeableitems, quark, reccomplex, roguelike, skyes_bakery, tropicraft, twilightforest, ultimate_unicorn_mod, vending, bauble_wings, wings, xaerominimap, llibrary, midnight, orbis-lib, phosphor-lighting] at SERVER
[15:07:48] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod FML
[15:07:48] [Server thread/DEBUG] [FML]: Bar Step: Construction - Forge Mod Loader took 10.970s
[15:07:48] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod forge
[15:07:48] [Server thread/DEBUG] [forge]: Loading Vanilla annotations: null
[15:07:48] [Server thread/DEBUG] [forge]: Preloading CrashReport Classes
[15:07:48] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable
[15:07:48] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Alignment
[15:07:48] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Column
[15:07:48] [Server thread/DEBUG] [forge]: net/minecraftforge/common/util/TextTable$Row
[15:07:48] [Server thread/DEBUG] [forge]: net/minecraftforge/fml/client/SplashProgress$1
[15:07:48] [Server thread/DEBUG] [forge]: net/minecraftforge/fml/common/FMLCommonHandler$1
[15:07:48] [Server thread/DEBUG] [forge]: net/minecraftforge/fml/common/Loader$1
[15:07:48] [Server thread/TRACE] [FML]: Mod forge is using network checker : No network checking performed
[15:07:48] [Server thread/TRACE] [FML]: Testing mod forge to verify it accepts its own version in a remote connection
[15:07:48] [Server thread/TRACE] [FML]: The mod forge accepts its own version (14.23.5.2854)
[15:07:48] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into forge for type INSTANCE
[15:07:49] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod forge
[15:07:49] [Server thread/DEBUG] [FML]: Bar Step: Construction - Minecraft Forge took 0.405s
[15:07:49] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ivtoolkit
[15:07:49] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ivtoolkit
[15:07:49] [Server thread/DEBUG] [FML]: Bar Step: Construction - IvToolkit took 0.000s
[15:07:49] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod xaerominimap_core
[15:07:49] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod xaerominimap_core
[15:07:49] [Server thread/DEBUG] [FML]: Bar Step: Construction - XaeroMinimapCore took 0.000s
[15:07:49] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod advancedcombat
[15:07:49] [Server thread/TRACE] [FML]: Mod advancedcombat is using network checker : Accepting version 1.1.2
[15:07:49] [Server thread/TRACE] [FML]: Testing mod advancedcombat to verify it accepts its own version in a remote connection
[15:07:49] [Server thread/TRACE] [FML]: The mod advancedcombat accepts its own version (1.1.2)
[15:07:49] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into advancedcombat
[15:07:49] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for advancedcombat
[15:07:49] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into advancedcombat for type INSTANCE
[15:07:49] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod advancedcombat
[15:07:49] [Server thread/DEBUG] [FML]: Bar Step: Construction - Advanced Combat took 0.253s
[15:07:49] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod orbis-lib
[15:07:49] [Server thread/TRACE] [FML]: Mod orbis-lib is using network checker : Accepting version 0.2.0
[15:07:49] [Server thread/TRACE] [FML]: Testing mod orbis-lib to verify it accepts its own version in a remote connection
[15:07:49] [Server thread/TRACE] [FML]: The mod orbis-lib accepts its own version (0.2.0)
[15:07:49] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into orbis-lib
[15:07:49] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for orbis-lib
[15:07:49] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.orbis.lib.CapabilityManagerOrbisLib for mod orbis-lib
[15:07:49] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.orbis.lib.CapabilityManagerOrbisLib
[15:07:49] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.orbis.lib.OrbisLib for mod orbis-lib
[15:07:49] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.orbis.lib.OrbisLib
[15:07:49] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into orbis-lib for type INSTANCE
[15:07:49] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod orbis-lib
[15:07:49] [Server thread/DEBUG] [FML]: Bar Step: Construction - OrbisLib took 0.539s
[15:07:49] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod aether
[15:07:50] [Server thread/TRACE] [FML]: Mod aether is using network checker : Accepting version 0.3.0
[15:07:50] [Server thread/TRACE] [FML]: Testing mod aether to verify it accepts its own version in a remote connection
[15:07:50] [Server thread/TRACE] [FML]: The mod aether accepts its own version (0.3.0)
[15:07:50] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into aether
[15:07:53] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for aether
[15:07:53] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerRespawnListener for mod aether
[15:07:53] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerRespawnListener
[15:07:53] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.capabilities.CapabilityManagerAether for mod aether
[15:07:53] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.capabilities.CapabilityManagerAether
[15:07:53] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerEatListener for mod aether
[15:07:53] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerEatListener
[15:07:53] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.items.weapons.swords.ItemSkyrootSword for mod aether
[15:07:53] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.items.weapons.swords.ItemSkyrootSword
[15:07:53] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityFallListener for mod aether
[15:07:53] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityFallListener
[15:07:53] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemSkyrootSwordListener for mod aether
[15:07:53] [Server thread/INFO] [Quark ASM]: Transforming net.minecraft.util.DamageSource
[15:07:53] [Server thread/INFO] [Quark ASM]: Applying Transformation to method (Names [causePlayerDamage, func_76365_a] Descriptor (Lnet/minecraft/entity/player/EntityPlayer;)Lnet/minecraft/util/DamageSource;)
[15:07:53] [Server thread/INFO] [Quark ASM]: Located Method, patching...
[15:07:53] [Server thread/INFO] [Quark ASM]: Patch result: true
[15:07:53] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemSkyrootSwordListener
[15:07:53] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemToolListener for mod aether
[15:07:53] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemToolListener
[15:07:53] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.world.preparation.PrepEventListener for mod aether
[15:07:53] [Server thread/INFO] [STDOUT]: [xaero.common.core.transformer.ClassNodeTransformer:transform:26]: Transforming class axw net.minecraft.world.chunk.Chunk
[15:07:53] [Server thread/DEBUG] [mixin]: Mixing common.MixinChunk from mixins.phosphor.json into net.minecraft.world.chunk.Chunk
[15:07:53] [Server thread/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/api/IChunkLighting to metadata cache
[15:07:53] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/util/math/Vec3i to metadata cache
[15:07:53] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/WorldProvider to metadata cache
[15:07:53] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/profiler/Profiler to metadata cache
[15:07:53] [Server thread/TRACE] [mixin]: Added class metadata for me/jellysquid/mods/phosphor/mod/world/WorldChunkSlice to metadata cache
[15:07:53] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/util/EnumFacing to metadata cache
[15:07:53] [Server thread/TRACE] [mixin]: Added class metadata for java/lang/Math to metadata cache
[15:07:53] [Server thread/DEBUG] [mixin]: Mixing common.MixinChunk$Vanilla from mixins.phosphor.json into net.minecraft.world.chunk.Chunk
[15:07:54] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/block/state/IBlockState to metadata cache
[15:07:54] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/world/IBlockAccess to metadata cache
[15:07:54] [Server thread/INFO] [BetterFps]: Patching net.minecraft.block.Block... (aow)
[15:07:54] [Server thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:preTransform:230]: Transforming Class [net.minecraft.block.Block], Method [getExtendedState]
[15:07:54] [Server thread/INFO] [STDOUT]: [team.chisel.ctm.client.asm.CTMTransformer:finishTransform:242]: Transforming net.minecraft.block.Block Finished.
[15:07:54] [Server thread/TRACE] [mixin]: Added class metadata for net/minecraft/block/Block to metadata cache
[15:07:55] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.world.preparation.PrepEventListener
[15:07:55] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerJoinListener for mod aether
[15:07:55] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerJoinListener
[15:07:55] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityXPListener for mod aether
[15:07:55] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityXPListener
[15:07:55] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerHealListener for mod aether
[15:07:55] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerHealListener
[15:07:55] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerWakeListener for mod aether
[15:07:55] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerWakeListener
[15:07:55] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityDeathListener for mod aether
[15:07:55] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityDeathListener
[15:07:55] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerAttackListener for mod aether
[15:07:55] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerAttackListener
[15:07:55] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.BlocksAetherInit for mod aether
[15:07:56] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.BlocksAetherInit
[15:07:56] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.capabilities.DamageSystem for mod aether
[15:07:56] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.capabilities.DamageSystem
[15:07:56] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerEquipItemListener for mod aether
[15:07:56] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerEquipItemListener
[15:07:56] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerMovementListener for mod aether
[15:07:56] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerMovementListener
[15:07:56] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.RecipesAether for mod aether
[15:07:56] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.RecipesAether
[15:07:56] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemBucketEventListener for mod aether
[15:07:56] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemBucketEventListener
[15:07:56] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerAetherListener for mod aether
[15:07:56] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerAetherListener
[15:07:56] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.world.WorldFallListener for mod aether
[15:07:56] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.world.WorldFallListener
[15:07:56] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.BiomesAetherInit for mod aether
[15:07:57] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.BiomesAetherInit
[15:07:57] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.ServerTickListener for mod aether
[15:07:57] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.ServerTickListener
[15:07:57] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerTeleportListener for mod aether
[15:07:57] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerTeleportListener
[15:07:57] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemGlovesListener for mod aether
[15:07:57] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemGlovesListener
[15:07:57] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.trade.TradeInteractListener for mod aether
[15:07:57] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.trade.TradeInteractListener
[15:07:57] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.SoundsAetherInit for mod aether
[15:07:57] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.SoundsAetherInit
[15:07:57] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.init.ItemsAetherInit for mod aether
[15:07:57] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.init.ItemsAetherInit
[15:07:57] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.trade.TradeItemPickupListener for mod aether
[15:07:57] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.trade.TradeItemPickupListener
[15:07:57] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemAetherShieldListener for mod aether
[15:07:57] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemAetherShieldListener
[15:07:57] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerMountListener for mod aether
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerMountListener
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.entity.EntityJumpListener for mod aether
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.entity.EntityJumpListener
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.player.PlayerPlaceBlockListener for mod aether
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.player.PlayerPlaceBlockListener
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.world.WorldTickListener for mod aether
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.world.WorldTickListener
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.CapabilityAttachListener for mod aether
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.CapabilityAttachListener
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.gildedgames.aether.common.events.listeners.items.ItemCrossbowSpecialListener for mod aether
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.gildedgames.aether.common.events.listeners.items.ItemCrossbowSpecialListener
[15:07:58] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into aether for type INSTANCE
[15:07:58] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod aether
[15:07:58] [Server thread/DEBUG] [FML]: Bar Step: Construction - Aether II took 8.721s
[15:07:58] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod baubles
[15:07:58] [Server thread/TRACE] [FML]: Mod baubles is using network checker : Accepting version 1.5.2
[15:07:58] [Server thread/TRACE] [FML]: Testing mod baubles to verify it accepts its own version in a remote connection
[15:07:58] [Server thread/TRACE] [FML]: The mod baubles accepts its own version (1.5.2)
[15:07:58] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into baubles
[15:07:58] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for baubles
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for baubles.common.items.ItemRing for mod baubles
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class baubles.common.items.ItemRing
[15:07:58] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into baubles for type INSTANCE
[15:07:58] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod baubles
[15:07:58] [Server thread/DEBUG] [FML]: Bar Step: Construction - Baubles took 0.115s
[15:07:58] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod atum
[15:07:58] [Server thread/TRACE] [FML]: Mod atum is using network checker : Accepting version 2.0.20
[15:07:58] [Server thread/TRACE] [FML]: Testing mod atum to verify it accepts its own version in a remote connection
[15:07:58] [Server thread/TRACE] [FML]: The mod atum accepts its own version (2.0.20)
[15:07:58] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into atum
[15:07:58] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for atum
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.utils.recipe.RecipeMapExtendingScroll for mod atum
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.utils.recipe.RecipeMapExtendingScroll
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.world.teleporter.AtumStartTeleporter for mod atum
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.world.teleporter.AtumStartTeleporter
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.atum.ItemAtumsProtection for mod atum
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.atum.ItemAtumsProtection
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.montu.ItemMontusStrike for mod atum
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.montu.ItemMontusStrike
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.ra.ItemBodyOfRa for mod atum
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.ra.ItemBodyOfRa
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.atum.ItemLegsOfAtum for mod atum
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.atum.ItemLegsOfAtum
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.anput.ItemAnputsHunger for mod atum
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.anput.ItemAnputsHunger
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.seth.ItemSethsSting for mod atum
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.seth.ItemSethsSting
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.utils.recipe.RecipesDesertArmorDyes for mod atum
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.utils.recipe.RecipesDesertArmorDyes
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.tools.ItemGauntlet for mod atum
[15:07:58] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.tools.ItemGauntlet
[15:07:58] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.nuit.ItemNuitsIre for mod atum
[15:07:59] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.nuit.ItemNuitsIre
[15:07:59] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.world.WorldProviderAtum for mod atum
[15:07:59] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.world.WorldProviderAtum
[15:07:59] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.anubis.ItemAnubisWrath for mod atum
[15:07:59] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.anubis.ItemAnubisWrath
[15:07:59] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.atum.ItemBodyOfAtum for mod atum
[15:07:59] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.atum.ItemBodyOfAtum
[15:07:59] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.blocks.stone.limestone.chest.BlockSarcophagus for mod atum
[15:07:59] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.blocks.stone.limestone.chest.BlockSarcophagus
[15:07:59] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.utils.AtumRegistry for mod atum
[15:07:59] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.utils.AtumRegistry
[15:07:59] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.init.AtumRecipes for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.init.AtumRecipes
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.tools.ItemGreatsword for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.tools.ItemGreatsword
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.nuit.ItemNuitsQuarter for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.nuit.ItemNuitsQuarter
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.tools.ItemClub for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.tools.ItemClub
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.ptah.ItemPtahsUndoing for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.ptah.ItemPtahsUndoing
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.utils.event.FurnaceFuel for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.utils.event.FurnaceFuel
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.anubis.ItemAnubisMercy for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.anubis.ItemAnubisMercy
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.ra.ItemLegsOfRa for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.ra.ItemLegsOfRa
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.atum.ItemFeetOfAtum for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.atum.ItemFeetOfAtum
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.tools.ItemKhopesh for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.tools.ItemKhopesh
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.utils.event.AtumEventListener for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.utils.event.AtumEventListener
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.blocks.wood.BlockAtumTorchUnlit for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.blocks.wood.BlockAtumTorchUnlit
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.ptah.ItemPtahsDecadence for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.ptah.ItemPtahsDecadence
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.nuit.ItemNuitsVanishing for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.nuit.ItemNuitsVanishing
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.entity.animal.EntityDesertWolf for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.entity.animal.EntityDesertWolf
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.atum.ItemAtumsWill for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.atum.ItemAtumsWill
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.utils.recipe.RecipeDisenchant for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.utils.recipe.RecipeDisenchant
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.tefnut.ItemTefnutsCall for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.tefnut.ItemTefnutsCall
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.shu.ItemShusExile for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.shu.ItemShusExile
[15:08:00] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.teammetallurgy.atum.items.artifacts.ra.ItemHaloOfRa for mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.teammetallurgy.atum.items.artifacts.ra.ItemHaloOfRa
[15:08:00] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into atum for type INSTANCE
[15:08:00] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod atum
[15:08:00] [Server thread/DEBUG] [FML]: Bar Step: Construction - Atum 2 took 1.953s
[15:08:00] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod crafttweaker
[15:08:00] [Server thread/TRACE] [FML]: Mod crafttweaker is using network checker : Accepting version 4.1.20
[15:08:00] [Server thread/TRACE] [FML]: Testing mod crafttweaker to verify it accepts its own version in a remote connection
[15:08:00] [Server thread/TRACE] [FML]: The mod crafttweaker accepts its own version (4.1.20)
[15:08:00] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into crafttweaker
[15:08:00] [Server thread/DEBUG] [FML]: Skipping proxy injection for com.blamejared.ctgui.MTRecipe.PROXY since it is not for mod crafttweaker
[15:08:00] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for crafttweaker
[15:08:00] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into crafttweaker for type INSTANCE
[15:08:00] [Server thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for com.blamejared.ctgui.MTRecipe.INSTANCE since it is not for mod crafttweaker
[15:08:06] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod crafttweaker
[15:08:06] [Server thread/DEBUG] [FML]: Bar Step: Construction - CraftTweaker2 took 6.131s
[15:08:06] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mtlib
[15:08:06] [Server thread/TRACE] [FML]: Mod mtlib is using network checker : Accepting version 3.0.6
[15:08:06] [Server thread/TRACE] [FML]: Testing mod mtlib to verify it accepts its own version in a remote connection
[15:08:06] [Server thread/TRACE] [FML]: The mod mtlib accepts its own version (3.0.6)
[15:08:06] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into mtlib
[15:08:06] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for mtlib
[15:08:06] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into mtlib for type INSTANCE
[15:08:06] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mtlib
[15:08:06] [Server thread/DEBUG] [FML]: Bar Step: Construction - MTLib took 0.030s
[15:08:06] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod modtweaker
[15:08:06] [Server thread/TRACE] [FML]: Mod modtweaker is using network checker : Accepting version 4.0.18
[15:08:06] [Server thread/TRACE] [FML]: Testing mod modtweaker to verify it accepts its own version in a remote connection
[15:08:06] [Server thread/TRACE] [FML]: The mod modtweaker accepts its own version (4.0.18)
[15:08:06] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into modtweaker
[15:08:06] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for modtweaker
[15:08:06] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into modtweaker for type INSTANCE
[15:08:06] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod modtweaker
[15:08:06] [Server thread/DEBUG] [FML]: Bar Step: Construction - Mod Tweaker took 0.052s
[15:08:06] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod jei
[15:08:06] [Server thread/TRACE] [FML]: Mod jei is using network checker : Invoking method checkModLists
[15:08:06] [Server thread/TRACE] [FML]: Testing mod jei to verify it accepts its own version in a remote connection
[15:08:06] [Server thread/TRACE] [FML]: The mod jei accepts its own version (**.**.**.**)
[15:08:06] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into jei
[15:08:06] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for jei
[15:08:06] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into jei for type INSTANCE
[15:08:06] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod jei
[15:08:06] [Server thread/DEBUG] [FML]: Bar Step: Construction - Just Enough Items took 0.113s
[15:08:06] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod quark
[15:08:06] [Server thread/TRACE] [FML]: Mod quark is using network checker : Invoking method acceptsMods
[15:08:06] [Server thread/TRACE] [FML]: Testing mod quark to verify it accepts its own version in a remote connection
[15:08:06] [Server thread/TRACE] [FML]: The mod quark accepts its own version (r1.6-179)
[15:08:06] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into quark
[15:08:06] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for quark
[15:08:06] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.quark.base.module.ModuleLoader$EventHandler for mod quark
[15:08:06] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.quark.base.module.ModuleLoader$EventHandler
[15:08:06] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.quark.base.client.ContributorRewardHandler for mod quark
[15:08:07] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.quark.base.client.ContributorRewardHandler
[15:08:07] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.quark.base.capability.CapabilityHandler for mod quark
[15:08:07] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.quark.base.capability.CapabilityHandler
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into quark for type INSTANCE
[15:08:07] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod quark
[15:08:07] [Server thread/DEBUG] [FML]: Bar Step: Construction - Quark took 0.188s
[15:08:07] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod autoreglib
[15:08:07] [Server thread/TRACE] [FML]: Mod autoreglib is using network checker : Accepting version 1.3-32
[15:08:07] [Server thread/TRACE] [FML]: Testing mod autoreglib to verify it accepts its own version in a remote connection
[15:08:07] [Server thread/TRACE] [FML]: The mod autoreglib accepts its own version (1.3-32)
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into autoreglib
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for autoreglib
[15:08:07] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for vazkii.arl.util.ProxyRegistry for mod autoreglib
[15:08:07] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class vazkii.arl.util.ProxyRegistry
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into autoreglib for type INSTANCE
[15:08:07] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod autoreglib
[15:08:07] [Server thread/DEBUG] [FML]: Bar Step: Construction - AutoRegLib took 0.041s
[15:08:07] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod babymobs
[15:08:07] [Server thread/TRACE] [FML]: Mod babymobs is using network checker : Accepting version 1.5.5
[15:08:07] [Server thread/TRACE] [FML]: Testing mod babymobs to verify it accepts its own version in a remote connection
[15:08:07] [Server thread/TRACE] [FML]: The mod babymobs accepts its own version (1.5.5)
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into babymobs
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for babymobs
[15:08:07] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for furgl.babyMobs.common.item.ModItems$RegistrationHandler for mod babymobs
[15:08:07] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class furgl.babyMobs.common.item.ModItems$RegistrationHandler
[15:08:07] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for furgl.babyMobs.common.block.ModBlocks$RegistrationHandler for mod babymobs
[15:08:07] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class furgl.babyMobs.common.block.ModBlocks$RegistrationHandler
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into babymobs for type INSTANCE
[15:08:07] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod babymobs
[15:08:07] [Server thread/DEBUG] [FML]: Bar Step: Construction - Baby Mobs took 0.100s
[15:08:07] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod bibliocraft
[15:08:07] [Server thread/TRACE] [FML]: Mod bibliocraft is using network checker : Accepting version 2.4.5
[15:08:07] [Server thread/TRACE] [FML]: Testing mod bibliocraft to verify it accepts its own version in a remote connection
[15:08:07] [Server thread/TRACE] [FML]: The mod bibliocraft accepts its own version (2.4.5)
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into bibliocraft
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for bibliocraft
[15:08:07] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for jds.bibliocraft.BiblioCraft$RegisterTheThings for mod bibliocraft
[15:08:07] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class jds.bibliocraft.BiblioCraft$RegisterTheThings
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into bibliocraft for type INSTANCE
[15:08:07] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod bibliocraft
[15:08:07] [Server thread/DEBUG] [FML]: Bar Step: Construction - BiblioCraft took 0.084s
[15:08:07] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod biomesoplenty
[15:08:07] [Server thread/TRACE] [FML]: Mod biomesoplenty is using network checker : Accepting version 7.0.1.2293
[15:08:07] [Server thread/TRACE] [FML]: Testing mod biomesoplenty to verify it accepts its own version in a remote connection
[15:08:07] [Server thread/TRACE] [FML]: The mod biomesoplenty accepts its own version (7.0.1.2293)
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into biomesoplenty
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for biomesoplenty
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into biomesoplenty for type INSTANCE
[15:08:07] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod biomesoplenty
[15:08:07] [Server thread/DEBUG] [FML]: Bar Step: Construction - Biomes O' Plenty took 0.019s
[15:08:07] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod chisel
[15:08:07] [Server thread/TRACE] [FML]: Mod chisel is using network checker : Accepting version MC1.12.2-1.0.2.45
[15:08:07] [Server thread/TRACE] [FML]: Testing mod chisel to verify it accepts its own version in a remote connection
[15:08:07] [Server thread/TRACE] [FML]: The mod chisel accepts its own version (MC1.12.2-1.0.2.45)
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into chisel
[15:08:07] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for chisel
[15:08:07] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for team.chisel.common.block.BreakSpeedHandler for mod chisel
[15:08:07] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class team.chisel.common.block.BreakSpeedHandler
[15:08:07] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for team.chisel.Features for mod chisel
[15:08:08] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class team.chisel.Features
[15:08:08] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into chisel for type INSTANCE
[15:08:08] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod chisel
[15:08:08] [Server thread/DEBUG] [FML]: Bar Step: Construction - Chisel took 1.196s
[15:08:08] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod clumps
[15:08:08] [Server thread/TRACE] [FML]: Mod clumps is using network checker : Accepting version 3.1.2
[15:08:08] [Server thread/TRACE] [FML]: Testing mod clumps to verify it accepts its own version in a remote connection
[15:08:08] [Server thread/TRACE] [FML]: The mod clumps accepts its own version (3.1.2)
[15:08:08] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into clumps
[15:08:08] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for clumps
[15:08:08] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into clumps for type INSTANCE
[15:08:08] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod clumps
[15:08:08] [Server thread/DEBUG] [FML]: Bar Step: Construction - Clumps took 0.062s
[15:08:08] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod comfycozy
[15:08:08] [Server thread/TRACE] [FML]: Mod comfycozy is using network checker : Accepting version 1.3
[15:08:08] [Server thread/TRACE] [FML]: Testing mod comfycozy to verify it accepts its own version in a remote connection
[15:08:08] [Server thread/TRACE] [FML]: The mod comfycozy accepts its own version (1.3)
[15:08:08] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into comfycozy
[15:08:08] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for comfycozy
[15:08:08] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for bee.beeshroom.ComfyCozy.util.handlers.RegistryHandlerTwo for mod comfycozy
[15:08:08] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class bee.beeshroom.ComfyCozy.util.handlers.RegistryHandlerTwo
[15:08:08] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for bee.beeshroom.ComfyCozy.events.ChairEvent for mod comfycozy
[15:08:08] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class bee.beeshroom.ComfyCozy.events.ChairEvent
[15:08:08] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for bee.beeshroom.ComfyCozy.util.handlers.RegistryHandler for mod comfycozy
[15:08:08] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class bee.beeshroom.ComfyCozy.util.handlers.RegistryHandler
[15:08:08] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for bee.beeshroom.ComfyCozy.events.OatSheepEvent for mod comfycozy
[15:08:08] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class bee.beeshroom.ComfyCozy.events.OatSheepEvent
[15:08:08] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for bee.beeshroom.ComfyCozy.events.GolemEvent for mod comfycozy
[15:08:08] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class bee.beeshroom.ComfyCozy.events.GolemEvent
[15:08:08] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for bee.beeshroom.ComfyCozy.events.ComfySummonEvent for mod comfycozy
[15:08:08] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class bee.beeshroom.ComfyCozy.events.ComfySummonEvent
[15:08:08] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into comfycozy for type INSTANCE
[15:08:08] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod comfycozy
[15:08:08] [Server thread/DEBUG] [FML]: Bar Step: Construction - Comfy Cozy took 0.224s
[15:08:08] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod craftablesaddles
[15:08:08] [Server thread/TRACE] [FML]: Mod craftablesaddles is using network checker : Accepting version 1.3
[15:08:08] [Server thread/TRACE] [FML]: Testing mod craftablesaddles to verify it accepts its own version in a remote connection
[15:08:08] [Server thread/TRACE] [FML]: The mod craftablesaddles accepts its own version (1.3)
[15:08:08] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into craftablesaddles
[15:08:08] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for craftablesaddles
[15:08:08] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into craftablesaddles for type INSTANCE
[15:08:08] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod craftablesaddles
[15:08:08] [Server thread/DEBUG] [FML]: Bar Step: Construction - Craftable Saddles took 0.005s
[15:08:08] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod crafttweakerjei
[15:08:09] [Server thread/TRACE] [FML]: Mod crafttweakerjei is using network checker : Accepting version 2.0.3
[15:08:09] [Server thread/TRACE] [FML]: Testing mod crafttweakerjei to verify it accepts its own version in a remote connection
[15:08:09] [Server thread/TRACE] [FML]: The mod crafttweakerjei accepts its own version (2.0.3)
[15:08:09] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into crafttweakerjei
[15:08:09] [Server thread/DEBUG] [FML]: Skipping proxy injection for crafttweaker.mc1120.CraftTweaker.PROXY since it is not for mod crafttweakerjei
[15:08:09] [Server thread/DEBUG] [FML]: Skipping proxy injection for com.blamejared.ctgui.MTRecipe.PROXY since it is not for mod crafttweakerjei
[15:08:09] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for crafttweakerjei
[15:08:09] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into crafttweakerjei for type INSTANCE
[15:08:09] [Server thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for crafttweaker.mc1120.CraftTweaker.INSTANCE since it is not for mod crafttweakerjei
[15:08:09] [Server thread/DEBUG] [FML]: Skipping @net.minecraftforge.fml.common.Mod$Instance injection for com.blamejared.ctgui.MTRecipe.INSTANCE since it is not for mod crafttweakerjei
[15:08:09] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod crafttweakerjei
[15:08:09] [Server thread/DEBUG] [FML]: Bar Step: Construction - CraftTweaker JEI Support took 0.619s
[15:08:09] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod props
[15:08:09] [Server thread/TRACE] [FML]: Mod props is using network checker : Accepting version 2.6.3
[15:08:09] [Server thread/TRACE] [FML]: Testing mod props to verify it accepts its own version in a remote connection
[15:08:09] [Server thread/TRACE] [FML]: The mod props accepts its own version (2.6.3)
[15:08:09] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into props
[15:08:09] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for props
[15:08:09] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into props for type INSTANCE
[15:08:09] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod props
[15:08:09] [Server thread/DEBUG] [FML]: Bar Step: Construction - Decocraft took 0.416s
[15:08:09] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod expandedbonemeal
[15:08:10] [Server thread/TRACE] [FML]: Mod expandedbonemeal is using network checker : Accepting version 1.2.1
[15:08:10] [Server thread/TRACE] [FML]: Testing mod expandedbonemeal to verify it accepts its own version in a remote connection
[15:08:10] [Server thread/TRACE] [FML]: The mod expandedbonemeal accepts its own version (1.2.1)
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into expandedbonemeal
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for expandedbonemeal
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into expandedbonemeal for type INSTANCE
[15:08:10] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod expandedbonemeal
[15:08:10] [Server thread/DEBUG] [FML]: Bar Step: Construction - ExpandedBonemeal took 0.178s
[15:08:10] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod extrautils2
[15:08:10] [Server thread/TRACE] [FML]: Mod extrautils2 is using network checker : Accepting version 1.0
[15:08:10] [Server thread/TRACE] [FML]: Testing mod extrautils2 to verify it accepts its own version in a remote connection
[15:08:10] [Server thread/TRACE] [FML]: The mod extrautils2 accepts its own version (1.0)
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into extrautils2
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for extrautils2
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into extrautils2 for type INSTANCE
[15:08:10] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod extrautils2
[15:08:10] [Server thread/DEBUG] [FML]: Bar Step: Construction - Extra Utilities 2 took 0.522s
[15:08:10] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod fairylights
[15:08:10] [Server thread/TRACE] [FML]: Mod fairylights is using network checker : Accepting version 2.1.10
[15:08:10] [Server thread/TRACE] [FML]: Testing mod fairylights to verify it accepts its own version in a remote connection
[15:08:10] [Server thread/TRACE] [FML]: The mod fairylights accepts its own version (2.1.10)
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into fairylights
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for fairylights
[15:08:10] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.pau101.fairylights.server.item.crafting.Recipes for mod fairylights
[15:08:10] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.pau101.fairylights.server.item.crafting.Recipes
[15:08:10] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.pau101.fairylights.server.entity.FLEntities for mod fairylights
[15:08:10] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.pau101.fairylights.server.entity.FLEntities
[15:08:10] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.pau101.fairylights.server.sound.FLSounds for mod fairylights
[15:08:10] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.pau101.fairylights.server.sound.FLSounds
[15:08:10] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.pau101.fairylights.server.block.FLBlocks for mod fairylights
[15:08:10] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.pau101.fairylights.server.block.FLBlocks
[15:08:10] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.pau101.fairylights.server.item.FLItems for mod fairylights
[15:08:10] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.pau101.fairylights.server.item.FLItems
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into fairylights for type INSTANCE
[15:08:10] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod fairylights
[15:08:10] [Server thread/DEBUG] [FML]: Bar Step: Construction - Fairy Lights took 0.300s
[15:08:10] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod floocraftft
[15:08:10] [Server thread/TRACE] [FML]: Mod floocraftft is using network checker : Accepting version 1.9.6
[15:08:10] [Server thread/TRACE] [FML]: Testing mod floocraftft to verify it accepts its own version in a remote connection
[15:08:10] [Server thread/TRACE] [FML]: The mod floocraftft accepts its own version (1.9.6)
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into floocraftft
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for floocraftft
[15:08:10] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.fredtargaryen.floocraft.FloocraftBase for mod floocraftft
[15:08:10] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.fredtargaryen.floocraft.FloocraftBase
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into floocraftft for type INSTANCE
[15:08:10] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod floocraftft
[15:08:10] [Server thread/DEBUG] [FML]: Bar Step: Construction - Floocraft took 0.087s
[15:08:10] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod foamflower
[15:08:10] [Server thread/TRACE] [FML]: Mod foamflower is using network checker : Accepting version 1.12.2-1.0.0.0-beta1
[15:08:10] [Server thread/TRACE] [FML]: Testing mod foamflower to verify it accepts its own version in a remote connection
[15:08:10] [Server thread/TRACE] [FML]: The mod foamflower accepts its own version (1.12.2-1.0.0.0-beta1)
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into foamflower
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for foamflower
[15:08:10] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into foamflower for type INSTANCE
[15:08:10] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod foamflower
[15:08:10] [Server thread/DEBUG] [FML]: Bar Step: Construction - Foamflower took 0.008s
[15:08:10] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod forgelin
[15:08:11] [Server thread/DEBUG] [KotlinAdapter]: FML has asked for Forgelin to be constructed
[15:08:24] [Server thread/TRACE] [FML]: Mod forgelin is using network checker : No network checking performed
[15:08:24] [Server thread/TRACE] [FML]: Testing mod forgelin to verify it accepts its own version in a remote connection
[15:08:24] [Server thread/TRACE] [FML]: The mod forgelin accepts its own version (1.8.4)
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into forgelin
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for forgelin
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into forgelin for type INSTANCE
[15:08:24] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod forgelin
[15:08:24] [Server thread/DEBUG] [FML]: Bar Step: Construction - Shadowfacts' Forgelin took 13.205s
[15:08:24] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod friendshipbracelet
[15:08:24] [Server thread/TRACE] [FML]: Mod friendshipbracelet is using network checker : Accepting version 1.1.2
[15:08:24] [Server thread/TRACE] [FML]: Testing mod friendshipbracelet to verify it accepts its own version in a remote connection
[15:08:24] [Server thread/TRACE] [FML]: The mod friendshipbracelet accepts its own version (1.1.2)
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into friendshipbracelet
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for friendshipbracelet
[15:08:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.elytradev.friendshipbracelet.FriendshipBracelet$RegistrationHandler for mod friendshipbracelet
[15:08:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.elytradev.friendshipbracelet.FriendshipBracelet$RegistrationHandler
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into friendshipbracelet for type INSTANCE
[15:08:24] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod friendshipbracelet
[15:08:24] [Server thread/DEBUG] [FML]: Bar Step: Construction - Friendship Bracelet took 0.081s
[15:08:24] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod cfm
[15:08:24] [Server thread/TRACE] [FML]: Mod cfm is using network checker : Accepting version 6.3.1
[15:08:24] [Server thread/TRACE] [FML]: Testing mod cfm to verify it accepts its own version in a remote connection
[15:08:24] [Server thread/TRACE] [FML]: The mod cfm accepts its own version (6.3.1)
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into cfm
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for cfm
[15:08:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mrcrayfish.furniture.init.RegistrationHandler$Items for mod cfm
[15:08:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mrcrayfish.furniture.init.RegistrationHandler$Items
[15:08:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mrcrayfish.furniture.handler.ContainerEvents for mod cfm
[15:08:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mrcrayfish.furniture.handler.ContainerEvents
[15:08:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mrcrayfish.furniture.init.RegistrationHandler$Recipes for mod cfm
[15:08:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mrcrayfish.furniture.init.RegistrationHandler$Recipes
[15:08:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mrcrayfish.furniture.init.RegistrationHandler$Blocks for mod cfm
[15:08:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mrcrayfish.furniture.init.RegistrationHandler$Blocks
[15:08:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mrcrayfish.furniture.init.RegistrationHandler$Sounds for mod cfm
[15:08:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mrcrayfish.furniture.init.RegistrationHandler$Sounds
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into cfm for type INSTANCE
[15:08:24] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod cfm
[15:08:24] [Server thread/DEBUG] [FML]: Bar Step: Construction - MrCrayfish's Furniture Mod took 0.196s
[15:08:24] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod gravestone
[15:08:24] [Server thread/TRACE] [FML]: Mod gravestone is using network checker : Accepting version 1.10.3
[15:08:24] [Server thread/TRACE] [FML]: Testing mod gravestone to verify it accepts its own version in a remote connection
[15:08:24] [Server thread/TRACE] [FML]: The mod gravestone accepts its own version (1.10.3)
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into gravestone
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for gravestone
[15:08:24] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for de.maxhenkel.gravestone.Registry for mod gravestone
[15:08:24] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class de.maxhenkel.gravestone.Registry
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into gravestone for type INSTANCE
[15:08:24] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod gravestone
[15:08:24] [Server thread/DEBUG] [FML]: Bar Step: Construction - Gravestone Mod took 0.075s
[15:08:24] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ichunutil
[15:08:24] [Server thread/TRACE] [FML]: Mod ichunutil is using network checker : Accepting range 7.2.0 or above, and below 7.3.0
[15:08:24] [Server thread/TRACE] [FML]: Testing mod ichunutil to verify it accepts its own version in a remote connection
[15:08:24] [Server thread/TRACE] [FML]: The mod ichunutil accepts its own version (7.2.2)
[15:08:24] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ichunutil
[15:08:25] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ichunutil
[15:08:25] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into ichunutil for type INSTANCE
[15:08:25] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ichunutil
[15:08:25] [Server thread/DEBUG] [FML]: Bar Step: Construction - iChunUtil took 0.488s
[15:08:25] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod hats
[15:08:25] [Server thread/TRACE] [FML]: Mod hats is using network checker : Accepting range 7.1.0 or above, and below 7.2.0
[15:08:25] [Server thread/TRACE] [FML]: Testing mod hats to verify it accepts its own version in a remote connection
[15:08:25] [Server thread/TRACE] [FML]: The mod hats accepts its own version (7.1.1)
[15:08:25] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into hats
[15:08:25] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for hats
[15:08:25] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into hats for type INSTANCE
[15:08:25] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod hats
[15:08:25] [Server thread/DEBUG] [FML]: Bar Step: Construction - Hats took 0.539s
[15:08:25] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod hatstand
[15:08:25] [Server thread/TRACE] [FML]: Mod hatstand is using network checker : Accepting range 7.1.0 or above, and below 7.2.0
[15:08:25] [Server thread/TRACE] [FML]: Testing mod hatstand to verify it accepts its own version in a remote connection
[15:08:25] [Server thread/TRACE] [FML]: The mod hatstand accepts its own version (7.1.0)
[15:08:25] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into hatstand
[15:08:25] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for hatstand
[15:08:25] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into hatstand for type INSTANCE
[15:08:25] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod hatstand
[15:08:25] [Server thread/DEBUG] [FML]: Bar Step: Construction - HatStand took 0.142s
[15:08:25] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod waila
[15:08:25] [Server thread/TRACE] [FML]: Mod waila is using network checker : No network checking performed
[15:08:25] [Server thread/TRACE] [FML]: Testing mod waila to verify it accepts its own version in a remote connection
[15:08:25] [Server thread/TRACE] [FML]: The mod waila accepts its own version (1.8.26)
[15:08:25] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into waila
[15:08:26] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for waila
[15:08:26] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for mcp.mobius.waila.handlers.NetworkHandler for mod waila
[15:08:26] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class mcp.mobius.waila.handlers.NetworkHandler
[15:08:26] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into waila for type INSTANCE
[15:08:26] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod waila
[15:08:26] [Server thread/DEBUG] [FML]: Bar Step: Construction - Waila took 0.330s
[15:08:26] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod llibrary
[15:08:26] [Server thread/TRACE] [FML]: Mod llibrary is using network checker : Accepting version 1.7.20
[15:08:26] [Server thread/TRACE] [FML]: Testing mod llibrary to verify it accepts its own version in a remote connection
[15:08:26] [Server thread/TRACE] [FML]: The mod llibrary accepts its own version (1.7.20)
[15:08:26] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into llibrary
[15:08:26] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for llibrary
[15:08:26] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into llibrary for type INSTANCE
[15:08:26] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod llibrary
[15:08:26] [Server thread/DEBUG] [FML]: Bar Step: Construction - LLibrary took 0.240s
[15:08:26] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod iceandfire
[15:08:26] [Server thread/DEBUG] [forge]: Preloading CrashReport Classes
[15:08:26] [Server thread/DEBUG] [forge]: com/github/alexthe666/iceandfire/client/particle/IceAndFireParticleSpawner$1
[15:08:26] [Server thread/TRACE] [FML]: Mod iceandfire is using network checker : Accepting version 1.9.1
[15:08:26] [Server thread/TRACE] [FML]: Testing mod iceandfire to verify it accepts its own version in a remote connection
[15:08:26] [Server thread/TRACE] [FML]: The mod iceandfire accepts its own version (1.9.1)
[15:08:26] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into iceandfire
[15:08:26] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for iceandfire
[15:08:26] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.github.alexthe666.iceandfire.ClientProxy for mod iceandfire
[15:08:27] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.github.alexthe666.iceandfire.ClientProxy
[15:08:27] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.github.alexthe666.iceandfire.CommonProxy for mod iceandfire
[15:08:27] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.github.alexthe666.iceandfire.CommonProxy
[15:08:27] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into iceandfire for type INSTANCE
[15:08:27] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod iceandfire
[15:08:27] [Server thread/DEBUG] [FML]: Bar Step: Construction - Ice and Fire took 1.091s
[15:08:27] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod improvedbackpacks
[15:08:27] [Server thread/TRACE] [FML]: Mod improvedbackpacks is using network checker : Accepting version 1.12.2-1.5.0.0
[15:08:27] [Server thread/TRACE] [FML]: Testing mod improvedbackpacks to verify it accepts its own version in a remote connection
[15:08:27] [Server thread/TRACE] [FML]: The mod improvedbackpacks accepts its own version (1.12.2-1.5.0.0)
[15:08:27] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into improvedbackpacks
[15:08:27] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for improvedbackpacks
[15:08:27] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into improvedbackpacks for type INSTANCE
[15:08:27] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod improvedbackpacks
[15:08:27] [Server thread/DEBUG] [FML]: Bar Step: Construction - Improved Backpacks took 0.151s
[15:08:27] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod inventorypets
[15:08:28] [Server thread/TRACE] [FML]: Mod inventorypets is using network checker : Accepting version 2.0.12
[15:08:28] [Server thread/TRACE] [FML]: Testing mod inventorypets to verify it accepts its own version in a remote connection
[15:08:28] [Server thread/TRACE] [FML]: The mod inventorypets accepts its own version (2.0.12)
[15:08:28] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into inventorypets
[15:08:28] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for inventorypets
[15:08:28] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.inventorypets.events.RecipeHandler for mod inventorypets
[15:08:28] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.inventorypets.events.RecipeHandler
[15:08:28] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into inventorypets for type INSTANCE
[15:08:28] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod inventorypets
[15:08:28] [Server thread/DEBUG] [FML]: Bar Step: Construction - Inventory Pets took 1.216s
[15:08:28] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod jrftl
[15:08:28] [Server thread/TRACE] [FML]: Mod jrftl is using network checker : Accepting version 1.1
[15:08:28] [Server thread/TRACE] [FML]: Testing mod jrftl to verify it accepts its own version in a remote connection
[15:08:28] [Server thread/TRACE] [FML]: The mod jrftl accepts its own version (1.1)
[15:08:28] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into jrftl
[15:08:28] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for jrftl
[15:08:28] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into jrftl for type INSTANCE
[15:08:28] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod jrftl
[15:08:28] [Server thread/DEBUG] [FML]: Bar Step: Construction - Just Another Rotten Flesh to Leather Mod took 0.038s
[15:08:28] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod customcraftingtables
[15:08:28] [Server thread/TRACE] [FML]: Mod customcraftingtables is using network checker : Accepting version 1.0.0
[15:08:28] [Server thread/TRACE] [FML]: Testing mod customcraftingtables to verify it accepts its own version in a remote connection
[15:08:28] [Server thread/TRACE] [FML]: The mod customcraftingtables accepts its own version (1.0.0)
[15:08:28] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into customcraftingtables
[15:08:28] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for customcraftingtables
[15:08:28] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks for mod customcraftingtables
[15:08:28] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks
[15:08:28] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesItems for mod customcraftingtables
[15:08:28] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesItems
[15:08:28] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into customcraftingtables for type INSTANCE
[15:08:28] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod customcraftingtables
[15:08:28] [Server thread/DEBUG] [FML]: Bar Step: Construction - CustomCraftingTables took 0.105s
[15:08:28] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mcwbridges
[15:08:28] [Server thread/TRACE] [FML]: Mod mcwbridges is using network checker : Accepting version 1.0.4
[15:08:28] [Server thread/TRACE] [FML]: Testing mod mcwbridges to verify it accepts its own version in a remote connection
[15:08:28] [Server thread/TRACE] [FML]: The mod mcwbridges accepts its own version (1.0.4)
[15:08:28] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into mcwbridges
[15:08:28] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for mcwbridges
[15:08:28] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mcwbridges.kikoz.util.handlers.RegistryHandler for mod mcwbridges
[15:08:28] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mcwbridges.kikoz.util.handlers.RegistryHandler
[15:08:28] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into mcwbridges for type INSTANCE
[15:08:28] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mcwbridges
[15:08:28] [Server thread/DEBUG] [FML]: Bar Step: Construction - Macaw's Bridges took 0.077s
[15:08:28] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod mcwfences
[15:08:29] [Server thread/TRACE] [FML]: Mod mcwfences is using network checker : Accepting version 1.0.0
[15:08:29] [Server thread/TRACE] [FML]: Testing mod mcwfences to verify it accepts its own version in a remote connection
[15:08:29] [Server thread/TRACE] [FML]: The mod mcwfences accepts its own version (1.0.0)
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into mcwfences
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for mcwfences
[15:08:29] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mcwfences.kikoz.util.handlers.RegistryHandler for mod mcwfences
[15:08:29] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mcwfences.kikoz.util.handlers.RegistryHandler
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into mcwfences for type INSTANCE
[15:08:29] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod mcwfences
[15:08:29] [Server thread/DEBUG] [FML]: Bar Step: Construction - Macaw's Fences and Walls took 0.095s
[15:08:29] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod morelootstuff
[15:08:29] [Server thread/TRACE] [FML]: Mod morelootstuff is using network checker : Accepting version 0.0.5
[15:08:29] [Server thread/TRACE] [FML]: Testing mod morelootstuff to verify it accepts its own version in a remote connection
[15:08:29] [Server thread/TRACE] [FML]: The mod morelootstuff accepts its own version (0.0.5)
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into morelootstuff
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for morelootstuff
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into morelootstuff for type INSTANCE
[15:08:29] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod morelootstuff
[15:08:29] [Server thread/DEBUG] [FML]: Bar Step: Construction - More Loot Stuff took 0.160s
[15:08:29] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod morph
[15:08:29] [Server thread/TRACE] [FML]: Mod morph is using network checker : Accepting range 7.2.0 or above, and below 7.3.0
[15:08:29] [Server thread/TRACE] [FML]: Testing mod morph to verify it accepts its own version in a remote connection
[15:08:29] [Server thread/TRACE] [FML]: The mod morph accepts its own version (7.2.0)
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into morph
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for morph
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into morph for type INSTANCE
[15:08:29] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod morph
[15:08:29] [Server thread/DEBUG] [FML]: Bar Step: Construction - Morph took 0.493s
[15:08:29] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod naturescompass
[15:08:29] [Server thread/TRACE] [FML]: Mod naturescompass is using network checker : Accepting version 1.8.5
[15:08:29] [Server thread/TRACE] [FML]: Testing mod naturescompass to verify it accepts its own version in a remote connection
[15:08:29] [Server thread/TRACE] [FML]: The mod naturescompass accepts its own version (1.8.5)
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into naturescompass
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for naturescompass
[15:08:29] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.chaosthedude.naturescompass.registry.NaturesCompassRegistry for mod naturescompass
[15:08:29] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.chaosthedude.naturescompass.registry.NaturesCompassRegistry
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into naturescompass for type INSTANCE
[15:08:29] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod naturescompass
[15:08:29] [Server thread/DEBUG] [FML]: Bar Step: Construction - Nature's Compass took 0.130s
[15:08:29] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod outfox
[15:08:29] [Server thread/TRACE] [FML]: Mod outfox is using network checker : Accepting version 0.1.5
[15:08:29] [Server thread/TRACE] [FML]: Testing mod outfox to verify it accepts its own version in a remote connection
[15:08:29] [Server thread/TRACE] [FML]: The mod outfox accepts its own version (0.1.5)
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into outfox
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for outfox
[15:08:29] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for kais.outfox.Outfox for mod outfox
[15:08:29] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class kais.outfox.Outfox
[15:08:29] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for kais.outfox.OutfoxConfig for mod outfox
[15:08:29] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class kais.outfox.OutfoxConfig
[15:08:29] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into outfox for type INSTANCE
[15:08:30] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod outfox
[15:08:30] [Server thread/DEBUG] [FML]: Bar Step: Construction - Outfox took 0.267s
[15:08:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod patchouli
[15:08:30] [Server thread/DEBUG] [forge]: Preloading CrashReport Classes
[15:08:30] [Server thread/DEBUG] [forge]: vazkii/patchouli/client/handler/BookCrashHandler
[15:08:30] [Server thread/TRACE] [FML]: Mod patchouli is using network checker : Accepting version 1.0-23.6
[15:08:30] [Server thread/TRACE] [FML]: Testing mod patchouli to verify it accepts its own version in a remote connection
[15:08:30] [Server thread/TRACE] [FML]: The mod patchouli accepts its own version (1.0-23.6)
[15:08:30] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into patchouli
[15:08:30] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for patchouli
[15:08:30] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into patchouli for type INSTANCE
[15:08:30] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod patchouli
[15:08:30] [Server thread/DEBUG] [FML]: Bar Step: Construction - Patchouli took 0.158s
[15:08:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod pattysmorestuff
[15:08:30] [Server thread/TRACE] [FML]: Mod pattysmorestuff is using network checker : Accepting version 1.1.9
[15:08:30] [Server thread/TRACE] [FML]: Testing mod pattysmorestuff to verify it accepts its own version in a remote connection
[15:08:30] [Server thread/TRACE] [FML]: The mod pattysmorestuff accepts its own version (1.1.9)
[15:08:30] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into pattysmorestuff
[15:08:30] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for pattysmorestuff
[15:08:30] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.stc.pattysmorestuff.handlers.RegistryHandler for mod pattysmorestuff
[15:08:30] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.stc.pattysmorestuff.handlers.RegistryHandler
[15:08:30] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into pattysmorestuff for type INSTANCE
[15:08:30] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod pattysmorestuff
[15:08:30] [Server thread/DEBUG] [FML]: Bar Step: Construction - PattysMoreStuff took 0.067s
[15:08:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod placeableitems
[15:08:30] [Server thread/TRACE] [FML]: Mod placeableitems is using network checker : Accepting version 3.3
[15:08:30] [Server thread/TRACE] [FML]: Testing mod placeableitems to verify it accepts its own version in a remote connection
[15:08:30] [Server thread/TRACE] [FML]: The mod placeableitems accepts its own version (3.3)
[15:08:30] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into placeableitems
[15:08:30] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for placeableitems
[15:08:30] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into placeableitems for type INSTANCE
[15:08:30] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod placeableitems
[15:08:30] [Server thread/DEBUG] [FML]: Bar Step: Construction - Placeable Items Mod took 0.078s
[15:08:30] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod reccomplex
[15:08:30] [Server thread/TRACE] [FML]: Mod reccomplex is using network checker : Invoking method checkNetwork
[15:08:30] [Server thread/TRACE] [FML]: Testing mod reccomplex to verify it accepts its own version in a remote connection
[15:08:30] [Server thread/TRACE] [FML]: The mod reccomplex accepts its own version (**.**.**.**)
[15:08:31] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into reccomplex
[15:08:32] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for reccomplex
[15:08:32] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into reccomplex for type INSTANCE
[15:08:32] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod reccomplex
[15:08:32] [Server thread/DEBUG] [FML]: Bar Step: Construction - Recurrent Complex took 1.906s
[15:08:32] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod roguelike
[15:08:32] [Server thread/TRACE] [FML]: Mod roguelike is using network checker : No network checking performed
[15:08:32] [Server thread/TRACE] [FML]: Testing mod roguelike to verify it accepts its own version in a remote connection
[15:08:32] [Server thread/TRACE] [FML]: The mod roguelike accepts its own version (1.8.0)
[15:08:32] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into roguelike
[15:08:32] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for roguelike
[15:08:32] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into roguelike for type INSTANCE
[15:08:32] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod roguelike
[15:08:32] [Server thread/DEBUG] [FML]: Bar Step: Construction - Roguelike Dungeons took 0.144s
[15:08:32] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod skyes_bakery
[15:08:32] [Server thread/TRACE] [FML]: Mod skyes_bakery is using network checker : Accepting version 2.1.1
[15:08:32] [Server thread/TRACE] [FML]: Testing mod skyes_bakery to verify it accepts its own version in a remote connection
[15:08:32] [Server thread/TRACE] [FML]: The mod skyes_bakery accepts its own version (2.1.1)
[15:08:32] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into skyes_bakery
[15:08:32] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for skyes_bakery
[15:08:32] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into skyes_bakery for type INSTANCE
[15:08:32] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod skyes_bakery
[15:08:32] [Server thread/DEBUG] [FML]: Bar Step: Construction - Skye's Bakery took 0.123s
[15:08:32] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod tropicraft
[15:08:32] [Server thread/TRACE] [FML]: Mod tropicraft is using network checker : Accepting version **.**.**.**
[15:08:32] [Server thread/TRACE] [FML]: Testing mod tropicraft to verify it accepts its own version in a remote connection
[15:08:32] [Server thread/TRACE] [FML]: The mod tropicraft accepts its own version (**.**.**.**)
[15:08:32] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into tropicraft
[15:08:32] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for tropicraft
[15:08:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for net.tropicraft.core.client.TropicraftRenderUtils for mod tropicraft
[15:08:32] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class net.tropicraft.core.client.TropicraftRenderUtils
[15:08:32] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for net.tropicraft.core.registry.BlockRegistry for mod tropicraft
[15:08:33] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class net.tropicraft.core.registry.BlockRegistry
[15:08:33] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for net.tropicraft.core.common.block.BlockBongoDrum for mod tropicraft
[15:08:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class net.tropicraft.core.common.block.BlockBongoDrum
[15:08:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for net.tropicraft.core.common.config.TropicsConfigs for mod tropicraft
[15:08:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class net.tropicraft.core.common.config.TropicsConfigs
[15:08:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for net.tropicraft.core.registry.SmeltingRegistry for mod tropicraft
[15:08:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class net.tropicraft.core.registry.SmeltingRegistry
[15:08:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for net.tropicraft.core.registry.EntityRegistry for mod tropicraft
[15:08:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class net.tropicraft.core.registry.EntityRegistry
[15:08:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for net.tropicraft.core.registry.FluidRegistry for mod tropicraft
[15:08:34] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class net.tropicraft.core.registry.FluidRegistry
[15:08:34] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for net.tropicraft.core.registry.ItemRegistry for mod tropicraft
[15:08:35] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class net.tropicraft.core.registry.ItemRegistry
[15:08:35] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into tropicraft for type INSTANCE
[15:08:35] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod tropicraft
[15:08:35] [Server thread/DEBUG] [FML]: Bar Step: Construction - Tropicraft took 2.445s
[15:08:35] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod twilightforest
[15:08:35] [Server thread/TRACE] [FML]: Mod twilightforest is using network checker : Accepting version 3.11.1021
[15:08:35] [Server thread/TRACE] [FML]: Testing mod twilightforest to verify it accepts its own version in a remote connection
[15:08:35] [Server thread/TRACE] [FML]: The mod twilightforest accepts its own version (3.11.1021)
[15:08:35] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into twilightforest
[15:08:35] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for twilightforest
[15:08:35] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.block.RegisterBlockEvent for mod twilightforest
[15:08:36] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.block.RegisterBlockEvent
[15:08:36] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.TFSounds for mod twilightforest
[15:08:36] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.TFSounds
[15:08:36] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.TFTickHandler for mod twilightforest
[15:08:36] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.TFTickHandler
[15:08:36] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.ItemTFKnightlySword for mod twilightforest
[15:08:36] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.ItemTFKnightlySword
[15:08:36] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.RegisterItemEvent for mod twilightforest
[15:08:37] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.RegisterItemEvent
[15:08:37] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.entity.TFEntities for mod twilightforest
[15:08:37] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.entity.TFEntities
[15:08:37] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.potions.TFRegisterPotionEvent for mod twilightforest
[15:08:37] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.potions.TFRegisterPotionEvent
[15:08:37] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.ItemTFFieryPick for mod twilightforest
[15:08:37] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.ItemTFFieryPick
[15:08:37] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.TFConfig for mod twilightforest
[15:08:37] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.TFConfig
[15:08:37] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.recipe.TFRecipes for mod twilightforest
[15:08:37] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.recipe.TFRecipes
[15:08:37] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.TFEventListener for mod twilightforest
[15:08:37] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.TFEventListener
[15:08:37] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.item.ItemTFMinotaurAxe for mod twilightforest
[15:08:37] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.item.ItemTFMinotaurAxe
[15:08:37] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for twilightforest.biomes.RegistryBiomeEvent for mod twilightforest
[15:08:38] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class twilightforest.biomes.RegistryBiomeEvent
[15:08:38] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into twilightforest for type INSTANCE
[15:08:38] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod twilightforest
[15:08:38] [Server thread/DEBUG] [FML]: Bar Step: Construction - The Twilight Forest took 3.399s
[15:08:38] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod ultimate_unicorn_mod
[15:08:38] [Server thread/TRACE] [FML]: Mod ultimate_unicorn_mod is using network checker : Accepting version 1.5.17
[15:08:38] [Server thread/TRACE] [FML]: Testing mod ultimate_unicorn_mod to verify it accepts its own version in a remote connection
[15:08:38] [Server thread/TRACE] [FML]: The mod ultimate_unicorn_mod accepts its own version (1.5.17)
[15:08:38] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into ultimate_unicorn_mod
[15:08:39] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for ultimate_unicorn_mod
[15:08:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.hackshop.ultimate_unicorn.CommonProxy for mod ultimate_unicorn_mod
[15:08:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.hackshop.ultimate_unicorn.CommonProxy
[15:08:39] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into ultimate_unicorn_mod for type INSTANCE
[15:08:39] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod ultimate_unicorn_mod
[15:08:39] [Server thread/DEBUG] [FML]: Bar Step: Construction - Wings, Horns, and Hooves, the Ultimate Unicorn Mod! took 0.765s
[15:08:39] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod vending
[15:08:39] [Server thread/TRACE] [FML]: Mod vending is using network checker : Accepting version 1.12.2-3.0.1.2
[15:08:39] [Server thread/TRACE] [FML]: Testing mod vending to verify it accepts its own version in a remote connection
[15:08:39] [Server thread/TRACE] [FML]: The mod vending accepts its own version (1.12.2-3.0.1.2)
[15:08:39] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into vending
[15:08:39] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for vending
[15:08:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for info.jbcs.minecraft.vending.init.RegistryEventHandler for mod vending
[15:08:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class info.jbcs.minecraft.vending.init.RegistryEventHandler
[15:08:39] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into vending for type INSTANCE
[15:08:39] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod vending
[15:08:39] [Server thread/DEBUG] [FML]: Bar Step: Construction - Vending took 0.199s
[15:08:39] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod wings
[15:08:39] [Server thread/TRACE] [FML]: Mod wings is using network checker : Accepting version 1.1.6
[15:08:39] [Server thread/TRACE] [FML]: Testing mod wings to verify it accepts its own version in a remote connection
[15:08:39] [Server thread/TRACE] [FML]: The mod wings accepts its own version (1.1.6)
[15:08:39] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into wings
[15:08:39] [Server thread/DEBUG] [FML]: Skipping proxy injection for me.paulf.wings.server.integration.MowziesMobsIntegration.proxy since it is not for mod wings
[15:08:39] [Server thread/DEBUG] [FML]: Skipping proxy injection for me.paulf.wings.server.integration.WingsMoBendsIntegration.proxy since it is not for mod wings
[15:08:39] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for wings
[15:08:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for me.paulf.wings.server.sound.WingsSounds for mod wings
[15:08:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class me.paulf.wings.server.sound.WingsSounds
[15:08:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for me.paulf.wings.server.item.WingsDict for mod wings
[15:08:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class me.paulf.wings.server.item.WingsDict
[15:08:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for me.paulf.wings.server.dreamcatcher.InSomniableCapability for mod wings
[15:08:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class me.paulf.wings.server.dreamcatcher.InSomniableCapability
[15:08:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for me.paulf.wings.server.world.GenerationHandler for mod wings
[15:08:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class me.paulf.wings.server.world.GenerationHandler
[15:08:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for me.paulf.wings.server.dreamcatcher.InSomniableEventHandler for mod wings
[15:08:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class me.paulf.wings.server.dreamcatcher.InSomniableEventHandler
[15:08:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for me.paulf.wings.server.ServerEventHandler for mod wings
[15:08:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class me.paulf.wings.server.ServerEventHandler
[15:08:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for me.paulf.wings.server.block.WingsBlocks for mod wings
[15:08:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class me.paulf.wings.server.block.WingsBlocks
[15:08:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for me.paulf.wings.server.flight.Flights for mod wings
[15:08:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class me.paulf.wings.server.flight.Flights
[15:08:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for me.paulf.wings.server.item.WingsItems for mod wings
[15:08:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class me.paulf.wings.server.item.WingsItems
[15:08:39] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for me.paulf.wings.server.fix.WingsFixes for mod wings
[15:08:39] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class me.paulf.wings.server.fix.WingsFixes
[15:08:39] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into wings for type INSTANCE
[15:08:40] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod wings
[15:08:40] [Server thread/DEBUG] [FML]: Bar Step: Construction - Wings took 0.713s
[15:08:40] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod bauble_wings
[15:08:40] [Server thread/TRACE] [FML]: Mod bauble_wings is using network checker : Accepting version 1.0.0
[15:08:40] [Server thread/TRACE] [FML]: Testing mod bauble_wings to verify it accepts its own version in a remote connection
[15:08:40] [Server thread/TRACE] [FML]: The mod bauble_wings accepts its own version (1.0.0)
[15:08:40] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping proxy injection for me.paulf.wings.WingsMod.proxy since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping proxy injection for me.paulf.wings.server.integration.MowziesMobsIntegration.proxy since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping proxy injection for me.paulf.wings.server.integration.WingsMoBendsIntegration.proxy since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for me.paulf.wings.server.sound.WingsSounds since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for me.paulf.wings.server.item.WingsDict since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for me.paulf.wings.server.dreamcatcher.InSomniableCapability since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for me.paulf.wings.server.world.GenerationHandler since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for me.paulf.wings.server.dreamcatcher.InSomniableEventHandler since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for me.paulf.wings.server.ServerEventHandler since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for me.paulf.wings.server.block.WingsBlocks since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for me.paulf.wings.server.flight.Flights since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for me.paulf.wings.server.item.WingsItems since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Skipping @EventBusSubscriber injection for me.paulf.wings.server.fix.WingsFixes since it is not for mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into bauble_wings for type INSTANCE
[15:08:40] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod bauble_wings
[15:08:40] [Server thread/DEBUG] [FML]: Bar Step: Construction - Bauble Wings took 0.008s
[15:08:40] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod xaerominimap
[15:08:40] [Server thread/TRACE] [FML]: Mod xaerominimap is using network checker : No network checking performed
[15:08:40] [Server thread/TRACE] [FML]: Testing mod xaerominimap to verify it accepts its own version in a remote connection
[15:08:40] [Server thread/TRACE] [FML]: The mod xaerominimap accepts its own version (21.4.1)
[15:08:40] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into xaerominimap
[15:08:40] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for xaerominimap
[15:08:40] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into xaerominimap for type INSTANCE
[15:08:40] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod xaerominimap
[15:08:40] [Server thread/DEBUG] [FML]: Bar Step: Construction - Xaero's Minimap took 0.434s
[15:08:40] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod midnight
[15:08:40] [Server thread/TRACE] [FML]: Mod midnight is using network checker : Accepting version 0.3.5
[15:08:40] [Server thread/TRACE] [FML]: Testing mod midnight to verify it accepts its own version in a remote connection
[15:08:40] [Server thread/TRACE] [FML]: The mod midnight accepts its own version (0.3.5)
[15:08:40] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into midnight
[15:08:40] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for midnight
[15:08:40] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.config.MidnightConfig for mod midnight
[15:08:40] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.config.MidnightConfig
[15:08:40] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.registry.ModEffects for mod midnight
[15:08:40] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.registry.ModEffects
[15:08:40] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.registry.ModBlocks for mod midnight
[15:08:41] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.registry.ModBlocks
[15:08:41] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.loot.FishingLoot for mod midnight
[15:08:41] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.loot.FishingLoot
[15:08:41] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.registry.ModEntities for mod midnight
[15:08:41] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.registry.ModEntities
[15:08:41] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.CommonEventHandler for mod midnight
[15:08:41] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.CommonEventHandler
[15:08:41] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.registry.ModItems for mod midnight
[15:08:41] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.registry.ModItems
[15:08:41] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.registry.ModSounds for mod midnight
[15:08:41] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.registry.ModSounds
[15:08:41] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.Midnight for mod midnight
[15:08:41] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.Midnight
[15:08:41] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.registry.ModCavernousBiomes for mod midnight
[15:08:41] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.registry.ModCavernousBiomes
[15:08:41] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.registry.ModSurfaceBiomes for mod midnight
[15:08:42] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.registry.ModSurfaceBiomes
[15:08:42] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.world.GlobalBridgeManager for mod midnight
[15:08:42] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.world.GlobalBridgeManager
[15:08:42] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.entity.projectile.EntityBladeshroomCap for mod midnight
[15:08:42] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.entity.projectile.EntityBladeshroomCap
[15:08:42] [Server thread/DEBUG] [FML]: Registering @EventBusSubscriber for com.mushroom.midnight.common.util.SessionLocal for mod midnight
[15:08:42] [Server thread/DEBUG] [FML]: Injected @EventBusSubscriber class com.mushroom.midnight.common.util.SessionLocal
[15:08:42] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into midnight for type INSTANCE
[15:08:42] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod midnight
[15:08:42] [Server thread/DEBUG] [FML]: Bar Step: Construction - Midnight took 1.572s
[15:08:42] [Server thread/TRACE] [FML]: Sending event FMLConstructionEvent to mod phosphor-lighting
[15:08:42] [Server thread/TRACE] [FML]: Mod phosphor-lighting is using network checker : No network checking performed
[15:08:42] [Server thread/TRACE] [FML]: Testing mod phosphor-lighting to verify it accepts its own version in a remote connection
[15:08:42] [Server thread/TRACE] [FML]: The mod phosphor-lighting accepts its own version (1.12.2-0.2.6)
[15:08:42] [Server thread/DEBUG] [FML]: Attempting to inject @SidedProxy classes into phosphor-lighting
[15:08:42] [Server thread/DEBUG] [FML]: Attempting to inject @EventBusSubscriber classes into the eventbus for phosphor-lighting
[15:08:42] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into phosphor-lighting for type INSTANCE
[15:08:42] [Server thread/TRACE] [FML]: Sent event FMLConstructionEvent to mod phosphor-lighting
[15:08:42] [Server thread/DEBUG] [FML]: Bar Step: Construction - Phosphor Lighting Engine took 0.009s
[15:08:42] [Server thread/DEBUG] [FML]: Bar Finished: Construction took 64.490s
[15:08:42] [Server thread/DEBUG] [FML]: Mod signature data
[15:08:42] [Server thread/DEBUG] [FML]: Valid Signatures:
[15:08:42] [Server thread/DEBUG] [FML]: (e3c3d50c7c986df74c645c0ac54639741c90a557) FML (Forge Mod Loader **.**.**.**) forge.jar
[15:08:42] [Server thread/DEBUG] [FML]: (e3c3d50c7c986df74c645c0ac54639741c90a557) forge (Minecraft Forge 14.23.5.2854) forge.jar
[15:08:42] [Server thread/DEBUG] [FML]: (db341c083b1b8ce9160a769b569ef6737b3f4cdf) orbis-lib (OrbisLib 0.2.0) orbis-lib-1.12.2-0.2.0+build411.jar
[15:08:42] [Server thread/DEBUG] [FML]: (db341c083b1b8ce9160a769b569ef6737b3f4cdf) aether (Aether II 0.3.0) aether_ii-1.12.2-0.3.0+build411-universal.jar
[15:08:42] [Server thread/DEBUG] [FML]: (4db5c2bd1b556f252a5b8b54b256d381b2a0a6b8) ichunutil (iChunUtil 7.2.2) iChunUtil-1.12.2-7.2.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: (4db5c2bd1b556f252a5b8b54b256d381b2a0a6b8) hats (Hats 7.1.1) Hats-1.12.2-7.1.1.jar
[15:08:42] [Server thread/DEBUG] [FML]: (b9f30a813bee3b9dd5652c460310cfcd54f6b7ec) llibrary (LLibrary 1.7.20) llibrary-1.7.20-1.12.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: (4db5c2bd1b556f252a5b8b54b256d381b2a0a6b8) morph (Morph 7.2.0) Morph-1.12.2-7.2.1.jar
[15:08:42] [Server thread/DEBUG] [FML]: (f0387d288626cc2d937daa504e74af570c52a2f1) phosphor-lighting (Phosphor Lighting Engine 1.12.2-0.2.6) phosphor-1.12.2-0.2.6+build50.jar
[15:08:42] [Server thread/DEBUG] [FML]: Missing Signatures:
[15:08:42] [Server thread/DEBUG] [FML]: minecraft (Minecraft 1.12.2) minecraft.jar
[15:08:42] [Server thread/DEBUG] [FML]: mcp (Minecraft Coder Pack 9.42) minecraft.jar
[15:08:42] [Server thread/DEBUG] [FML]: ivtoolkit (IvToolkit 1.3.3-1.12) minecraft.jar
[15:08:42] [Server thread/DEBUG] [FML]: xaerominimap_core (XaeroMinimapCore 1.12.2-1.0) minecraft.jar
[15:08:42] [Server thread/DEBUG] [FML]: advancedcombat (Advanced Combat 1.1.2) advancedcombat-1.1.2-[1.12].jar
[15:08:42] [Server thread/DEBUG] [FML]: baubles (Baubles 1.5.2) Baubles-1.12-1.5.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: atum (Atum 2 2.0.20) Atum-1.12.2-2.0.20.jar
[15:08:42] [Server thread/DEBUG] [FML]: crafttweaker (CraftTweaker2 4.1.20) CraftTweaker2-1.12-4.1.20.618.jar
[15:08:42] [Server thread/DEBUG] [FML]: mtlib (MTLib 3.0.6) MTLib-3.0.6.jar
[15:08:42] [Server thread/DEBUG] [FML]: modtweaker (Mod Tweaker 4.0.18) modtweaker-4.0.18.jar
[15:08:42] [Server thread/DEBUG] [FML]: jei (Just Enough Items **.**.**.**) jei_1.12.2-4.16.1.301.jar
[15:08:42] [Server thread/DEBUG] [FML]: quark (Quark r1.6-179) Quark-r1.6-179.jar
[15:08:42] [Server thread/DEBUG] [FML]: autoreglib (AutoRegLib 1.3-32) AutoRegLib-1.3-32.jar
[15:08:42] [Server thread/DEBUG] [FML]: babymobs (Baby Mobs 1.5.5) BabyMobs-1.12-1.5.5.jar
[15:08:42] [Server thread/DEBUG] [FML]: bibliocraft (BiblioCraft 2.4.5) BiblioCraft[v2.4.5][MC1.12.2].jar
[15:08:42] [Server thread/DEBUG] [FML]: biomesoplenty (Biomes O' Plenty 7.0.1.2293) BiomesOPlenty-1.12.2-7.0.1.2293-universal.jar
[15:08:42] [Server thread/DEBUG] [FML]: chisel (Chisel MC1.12.2-1.0.2.45) Chisel-MC1.12.2-1.0.2.45.jar
[15:08:42] [Server thread/DEBUG] [FML]: clumps (Clumps 3.1.2) Clumps-3.1.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: comfycozy (Comfy Cozy 1.3) comfycozy-1.3.jar
[15:08:42] [Server thread/DEBUG] [FML]: craftablesaddles (Craftable Saddles 1.3) Craftable Saddles[1.12]-1.3.jar
[15:08:42] [Server thread/DEBUG] [FML]: crafttweakerjei (CraftTweaker JEI Support 2.0.3) CraftTweaker2-1.12-4.1.20.618.jar
[15:08:42] [Server thread/DEBUG] [FML]: props (Decocraft 2.6.3) Decocraft-2.6.3_1.12.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: expandedbonemeal (ExpandedBonemeal 1.2.1) expandedbonemeal-1.11-1.2.1.jar
[15:08:42] [Server thread/DEBUG] [FML]: extrautils2 (Extra Utilities 2 1.0) extrautils2-1.12-1.9.9.jar
[15:08:42] [Server thread/DEBUG] [FML]: fairylights (Fairy Lights 2.1.10) fairylights-2.2.0-1.12.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: floocraftft (Floocraft 1.9.6) Floocraft 1.12.2-1.9.6.jar
[15:08:42] [Server thread/DEBUG] [FML]: foamflower (Foamflower 1.12.2-1.0.0.0-beta1) foamflower-1.12.2-1.0.0.0-beta1.jar
[15:08:42] [Server thread/DEBUG] [FML]: forgelin (Shadowfacts' Forgelin 1.8.4) Forgelin-1.8.4.jar
[15:08:42] [Server thread/DEBUG] [FML]: friendshipbracelet (Friendship Bracelet 1.1.2) FriendshipBracelet-1.1.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: cfm (MrCrayfish's Furniture Mod 6.3.1) furniture-6.3.1-1.12.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: gravestone (Gravestone Mod 1.10.3) gravestone-1.10.3.jar
[15:08:42] [Server thread/DEBUG] [FML]: hatstand (HatStand 7.1.0) HatStand-1.12.2-7.1.0.jar
[15:08:42] [Server thread/DEBUG] [FML]: waila (Waila 1.8.26) Hwyla-1.8.26-B41_1.12.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: iceandfire (Ice and Fire 1.9.1) iceandfire-1.9.1-1.12.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: improvedbackpacks (Improved Backpacks 1.12.2-1.5.0.0) ImprovedBackpacks-1.12.2-1.5.0.0.jar
[15:08:42] [Server thread/DEBUG] [FML]: inventorypets (Inventory Pets 2.0.12) inventorypets-1.12-2.0.12.jar
[15:08:42] [Server thread/DEBUG] [FML]: jrftl (Just Another Rotten Flesh to Leather Mod 1.1) JRFTL[1.12.2]-1.1.jar
[15:08:42] [Server thread/DEBUG] [FML]: customcraftingtables (CustomCraftingTables 1.0.0) ldshadowlady-customcraftingtables-1.0.jar
[15:08:42] [Server thread/DEBUG] [FML]: mcwbridges (Macaw's Bridges 1.0.4) mcw-bridges-1.0.4-mc1.12.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: mcwfences (Macaw's Fences and Walls 1.0.0) mcw-fences-1.0.0-mc1.12.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: morelootstuff (More Loot Stuff 0.0.5) MoreLootStuff-1.12.2-0.0.5.jar
[15:08:42] [Server thread/DEBUG] [FML]: naturescompass (Nature's Compass 1.8.5) NaturesCompass-1.12.2-1.8.5.jar
[15:08:42] [Server thread/DEBUG] [FML]: outfox (Outfox 0.1.5) outfox-0.1.5-mc1.12.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: patchouli (Patchouli 1.0-23.6) Patchouli-1.0-23.6.jar
[15:08:42] [Server thread/DEBUG] [FML]: pattysmorestuff (PattysMoreStuff 1.1.9) PattysMoreStuff-stable-1.1.8.5.jar
[15:08:42] [Server thread/DEBUG] [FML]: placeableitems (Placeable Items Mod 3.3) placeableitems-3.3.jar
[15:08:42] [Server thread/DEBUG] [FML]: reccomplex (Recurrent Complex **.**.**.**) RecurrentComplex-1.4.8.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: roguelike (Roguelike Dungeons 1.8.0) RoguelikeDungeons-1.12.2-1.8.0.jar
[15:08:42] [Server thread/DEBUG] [FML]: skyes_bakery (Skye's Bakery 2.1.1) Skye's Bakery 2.1.1 for MC1.12.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: tropicraft (Tropicraft **.**.**.**) tropicraft-MC1.12.2-7.1.9.115.jar
[15:08:42] [Server thread/DEBUG] [FML]: twilightforest (The Twilight Forest 3.11.1021) twilightforest-1.12.2-3.11.1021-universal.jar
[15:08:42] [Server thread/DEBUG] [FML]: ultimate_unicorn_mod (Wings, Horns, and Hooves, the Ultimate Unicorn Mod! 1.5.17) ultimate_unicorn_mod-1.12.2-1.5.17.jar
[15:08:42] [Server thread/DEBUG] [FML]: vending (Vending 1.12.2-3.0.1.2) vending-1.12.2-3.0.1.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: wings (Wings 1.1.6) wings-1.1.6-1.12.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: bauble_wings (Bauble Wings 1.0.0) wings-1.1.6-1.12.2.jar
[15:08:42] [Server thread/DEBUG] [FML]: xaerominimap (Xaero's Minimap 21.4.1) Xaeros_Minimap_21.4.1_Forge_1.12.jar
[15:08:42] [Server thread/DEBUG] [FML]: midnight (Midnight 0.3.5) themidnight-0.3.5.jar
[15:08:42] [Server thread/INFO] [FML]: Processing ObjectHolder annotations
[15:08:55] [Server thread/INFO] [FML]: Found 3173 ObjectHolder annotations
[15:08:55] [Server thread/INFO] [FML]: Identifying ItemStackHolder annotations
[15:08:55] [Server thread/INFO] [FML]: Found 0 ItemStackHolder annotations
[15:08:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod minecraft
[15:08:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod minecraft
[15:08:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Minecraft took 0.012s
[15:08:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mcp
[15:08:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mcp
[15:08:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Minecraft Coder Pack took 0.000s
[15:08:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod FML
[15:08:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod FML
[15:08:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Forge Mod Loader took 0.000s
[15:08:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod forge
[15:08:55] [Server thread/INFO] [FML]: Configured a dormant chunk cache size of 0
[15:08:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod forge
[15:08:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Minecraft Forge took 0.436s
[15:08:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod ivtoolkit
[15:08:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod ivtoolkit
[15:08:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - IvToolkit took 0.000s
[15:08:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod xaerominimap_core
[15:08:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod xaerominimap_core
[15:08:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - XaeroMinimapCore took 0.000s
[15:08:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod advancedcombat
[15:08:55] [Forge Version Check/INFO] [forge.VersionCheck]: [forge] Starting version check at http://files.minecraftforge.net/maven/net/minecraftforge/forge/promotions_slim.json
[15:08:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod advancedcombat
[15:08:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Advanced Combat took 0.100s
[15:08:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod orbis-lib
[15:08:55] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod orbis-lib
[15:08:55] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - OrbisLib took 0.001s
[15:08:55] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod aether
[15:08:56] [Forge Version Check/DEBUG] [forge.VersionCheck]: [forge] Received version check data:
"homepage": "http://files.minecraftforge.net/maven/net/minecraftforge/forge/",
"1.1-latest": "**.**.**.**",
"1.10-latest": "12.18.0.2000",
"1.10.2-latest": "12.18.3.2511",
"1.10.2-recommended": "12.18.3.2185",
"1.11-latest": "13.19.1.2199",
"1.11-recommended": "13.19.1.2189",
"1.11.2-latest": "13.20.1.2588",
"1.11.2-recommended": "13.20.1.2386",
"1.12-latest": "14.21.1.2443",
"1.12-recommended": "14.21.1.2387",
"1.12.1-latest": "14.22.1.2485",
"1.12.1-recommended": "14.22.1.2478",
"1.12.2-latest": "14.23.5.2854",
"1.12.2-recommended": "14.23.5.2854",
"1.13.2-latest": "25.0.219",
"1.14.2-latest": "26.0.63",
"1.14.3-latest": "27.0.60",
"1.14.4-latest": "28.2.23",
"1.14.4-recommended": "28.2.0",
"1.15.1-latest": "30.0.51",
"1.15.2-latest": "31.2.49",
"1.15.2-recommended": "31.2.0",
"1.16.1-latest": "32.0.108",
"1.16.2-latest": "33.0.61",
"1.16.3-latest": "34.1.42",
"1.16.3-recommended": "34.1.0",
"1.16.4-latest": "35.1.37",
"1.16.4-recommended": "35.1.4",
"1.16.5-latest": "36.1.0",
"1.16.5-recommended": "36.1.0",
"1.5.2-latest": "**.**.**.**",
"1.5.2-recommended": "**.**.**.**",
"1.6.1-latest": "**.**.**.**",
"1.6.2-latest": "**.**.**.**",
"1.6.2-recommended": "**.**.**.**",
"1.6.3-latest": "**.**.**.**",
"1.6.4-latest": "9.11.1.1345",
"1.6.4-recommended": "9.11.1.1345",
"1.7.10-latest": "10.13.4.1614",
"1.7.10-latest-1.7.10": "10.13.2.1343",
"1.7.10-recommended": "10.13.4.1558",
"1.7.2-latest": "10.12.2.1147",
"1.7.2-recommended": "10.12.2.1121",
"1.8-latest": "11.14.4.1577",
"1.8-recommended": "11.14.4.1563",
"1.8.8-latest": "11.15.0.1655",
"1.8.9-latest": "11.15.1.2318",
"1.8.9-recommended": "11.15.1.1722",
"1.9-latest": "12.16.0.1942",
"1.9-recommended": "12.16.1.1887",
"1.9.4-latest": "12.17.0.2051",
"1.9.4-recommended": "12.17.0.1976",
"latest-1.7.10": "10.13.2.1343"
[15:08:56] [Forge Version Check/INFO] [forge.VersionCheck]: [forge] Found status: UP_TO_DATE Target: null
[15:08:56] [Forge Version Check/INFO] [forge.VersionCheck]: [twilightforest] Starting version check at https://raw.githubusercontent.com/TeamTwilight/twilightforest/1.12.x/update.json
[15:08:56] [Forge Version Check/DEBUG] [forge.VersionCheck]: [twilightforest] Received version check data:
"homepage": "https://minecraft.curseforge.com/projects/the-twilight-forest",
"3.8.689": "ADDED:\n • Extra Mob transformations for Powder of Transformation!\n\nCHANGED:\n • Improved textures for Uncrafting Table, Trophy Pedestal, Block-Chain Goblins, and Hermit Crabs.\n • Shield Scepter's magic shields render fully lit now, unaffected by darkness.\n • The magic shields also render in first-person.\n\nFIXED:\n • Fix crash when parrying Naga.\n • Fix crash with Trophy Pedestals upon unexpected Moonworm.\n • Small-time optimizations and code tidying here and there!",
"3.8.654": "FIXES:\n • Hotfix: Fixed a crash that happened on dedicated servers due to the new IE shaders.",
"3.8.652": "ADDED:\n • Added a Quadraxis to the team, A great addition to the mod.\n • Added Auroralized Glass.\n • Added actual Castle Brick Stairs, literally the sequel to Jesus.\n • Cicadas can now be shot from an Immersive Engineering Railgun. You monster.\n • Added the Skylight Forest.\n • Skylight Forest is a skyblock variant of Twilight Forest with only structures generating on their own little islands and everything else as void.\n • Parrots can now mimic any and all mobs in the mod. :parrot_party:\n • Added the Scepter of Fortification\n • A new scepter dropped by the Lich that summons five (5) shields around you that each block a hit.\n • Progression advancements each grant three (3) shields that don't decay over time.\n • The Naga Can now be dazed if it rams a blocking shield with its charge attack, knocking you both backwards in the process.\n • Giant Tools now have a longer reach.\n • The uncrafting Table is now compatible with shapeless recipes. It totally didn't become twice as broken in potential!\n • It can now also cycle through multiple recipes in case of conflict.\n • Added tool shaders for Immersive Engineering with their own rarity, these include:\nTwilight, Firefly, Pinch Beetle, Snakestone, Mazestone, Underbrick, Towerwood, Carminite, Auroralized, Ironwood, Steeleaf, Knightly, Fiery, Final Castle, Cube of Annihilation, Questing Ram, Naga, Lich, Minoshroom, Hydra, Knight Phantom, Ur-Ghast, Alpha Yeti, Snow Queen.\n\nCHANGED:\n • Reworked the Druid Huts completely.\n • Druid Huts are no longer the number one fire hazard in the forest. \n • /tffeature now can locate structures and can use tab-completion for so.\n • Phantom Armor when worn is now kept on death.\n • It also cannot be enchanted with Curse of Binding and Curse of Vanishing anymore.\n • Improved handling of items displaced by a Charm of Keeping, should be more reliable now.\n • Tweaked Axe damage and speed values to better match vanilla.\n • Blacklisted surface lakes from some of the biomes.\n • Mobs like Deer, Boars, etc. are now unable to spawn on the Glacier.\n • The Minoshroom's charge attack now breaks through blocks.\n • Spiral Bricks are now in the creative menu.\n • Maze ceilings now always generated if there is no terrain.\n • Strongholds are now marked as clear on the last Knight's death.\n • Tweaked the Synergy tool trait.\n • There can now be multiple portal activations items specified in the config.\n • Twilight Saplings can now be used as Furnace fuel.\n • The Encased Firejet and Smoker now count as a wood material instead of stone.\n • Arctic Fur Blocks now break faster with shears.\n • Fiddleheads now require Shears to harvest.\n • The Lich's shields are now proper 3D models instead of two textures loosely glued together.\n • TF now registers its TEs under our own namespace, not the default. We have a datafixer that handles the transition, but once updated to this version the datafix is irreversible.\n\nFIXED:\n • Players can no longer spawn on top of the portal which would teleport them back into the overworld right away. Good lord that was annoying.\n • Improved a lot of the logic relating to the Twilight Forest portal.\n • Fixed an issue with Trophy Pedestal progression where it didn't unlock after the Lich.\n • Remeasured the sizes of goblin's feet. Their boots should render on and fit them again.\n • The Seeker Bow now actually, you know, seeks again.\n • Fixed crash related to getting localized names of saplings on servers.\n • Removed a redundant language key in the Forgotten Explorer book for Yeti Caves.\n • Fixed Minotaurs dropping Magic Map foci instead of Maze Map.\n • Fiery tool heads now correctly have the missing Twilit and Flammable traits.\n • Changed the grip on the Moonworm Queen to be more comfortable, now correctly holding it as a tool in third person view.\n • Fixed a portal generation issue where it would generate underwater.\n • Added a null-check to tile entity access, fixing a crash with Mystcraft.\n • Cleaned up Bauble handling code, fixing console spam.\n • Fixed the blockstate rotations for Castle Brick Stair variants.\n • Fixed the lighting on some of the stair blocks.\n • Fixed incorrect level cost being shown for some recrafting recipes.\n • Giant blocks now correctly tile their texture.\n • Fixed a lighting issue on Fiery Blocks.\n • Portals are now prevented from generating inside of structures.\n • Refactored Naga Courtyard code, hopefully fixes generation issues.\n • Alternate Naga Courtyard Terrace pieces now generate again. #BlameDrullkus\n • Fixed a crash with the Uncrafting Table by adding some more checks.\n • The Fiery Pickaxe now correctly smelts every item a block drops if it drops multiple.\n • Fixed a Repeater in the Dark Tower not repeating what should be repeated, with delay.\n • Giant Leaves are now correctly tinted in inventories.\n • Fixed Uberous Soil not generating at the correct height.\n • Fixed the Snow Queen marking the wrong structure conquered on death.\n • Fixed the Charm of Keeping effects.\n • Setting the game to peaceful now correctly has the Snow waifu Queen put her spawner back.\n • Snow Queen minions now correctly spawn inside of the boss room during the fight.\n • Giant Tools are now held in a more human like fashion.\n • Firefly, Moonworm, and Cicada no longer use Soul Sand as their breaking particles.\n • Fixed the texture auto generator only processing first texture in array.\n • Lampposts can now generate again after several years. Neat.\n • Large mushrooms should no longer piggyback on top of each other.\n • Seeds even with only numbers were being used as seeds to make a random number seed instead of directing being used as a random number seed. Confusing, we know!",
"3.7.424": "ADDED:\n • We split the progression into three separate lines, meaning that instead of clearing one dungeon and moving to the next in line, you now have the choice after defeating the Lich to go to the Hydra, Ur-Ghast, or Aurora Palace first.\nDefeating all three is still necessary to gain access to the Highlands.\n • Tinkers' Construct integration!\n • Added Tinker's Construct Integration with Naga Scales, Steeleaves, Fiery Ingots, Knightmetal Ingots, and Raven's Feathers to make materials & tools out of.\n • Added unique traits for each material:\n • Twilit appears on all Twilight Forest materials, meaning your tool gains +2 speed in the Twilight Forest and deals +2 damage in any other dimension.\n • Precipitate appears on Naga Scale materials, it lets you use the tool quicker with the lesser health on your Player.\n • Synergy appears on Steeleaf materials, it will passively repair the tool if you have Steeleaf in your hotbar. The more Steeleaves you have in the hotbar, the faster it repairs.\n • Stalwart appears on Knightmetal materials, it will make you more resilient in combat.\n • Veiled appears on Raven's Feather materials, it will render arrows invisible.\n • Baubles integration!\n • All charms can now be used in the off-hand and also equipped in the Baubles inventory.\n • All tiers of the Charm of Keeping will keep the Baubles Inventory.\n • Thaumcraft Compat: Live & Reloaded! All items and blocks (aside from unobtainable and some WIP items) now have aspects.\n • Added a config option to make the Portal creation lightning not cause fires, disable it if you're against pyromania derrived fun.\n • Made a new potion effect for the ice render effect from Ice Bombs, Ice Bow, etc. instead of putting it on the Slowness effect.\n • This also stops ice getting applied getting the slowness effect under certain conditions.\n • The Block and Chain now disables shields like an axe.\n • Added config option for players spawning for the first time to spawn in the Twilight Forest. Off by default.\n • Added config option to make Twilight Portals create a blocked-off portal at their destination. Toss in the activation item to unblock the portal. Off by default.\n • Added recipes where Iron armor and tools can be crafted directly into their Fiery counterparts.\n • Added Shield-Parrying for all Twilight Forest Projectiles. Installing https://minecraft.curseforge.com/projects/parry Shield Parry mod causes Twilight Forest to skip its parrying methods.\n • Updated the Japanese language file.\n • Updated the Chinese language file.\n • The Russian language file now covers everything in the mod.\nCHANGED:\n • Changed the Creative menu icon to the Miniature Portal item.\n • The advancements Past the Thorns and So Castle Very Wow now have a [NYI] tag in their names to signify they are not functional yet.\n • All tiers of the Charm of Keeping now preserve items in the off-hand slot.\n • Charm of Keeping usage now drops any items that would be overwritten by an item saved to prevent item loss if something is put in the player's inventory.\n • Code Improvements for Naga Courtyard.\nFIXED:\n • Magic Maps now properly update after switching Dimensions\n • The Zombie Scepter no longer joins its zombie kind by destroying itself at 0 durability.\n • Special leaves in Twilight Forest are now using the ore dictionary properly. (This totally wasn’t solved previously and went undocumented we swear.)\n • Ore magnet no longer checks ModID in the registry string.\n • Mazestone and its variants once again consume 16 durability from your mining tools when mined.\n • Castle Doors no longer have their texture broken.\n • Charm of Life effect upon death now uses the correct sprite.\n • Improved algorithm for the Miner's Tree, it should be less confused and stuck when trying to pull ores from the ground.\n • Fixed some blocks missing getBlockFaceShape overrides, causing glass panes, fences, walls, etc. to connect to blocks when they shouldn't.\n • Fixed the placement problems with Spiral Bricks and took off the [WIP] tag.\n • Finally fixed texture and UV problems with Knightly Armor and Phantom Armor; rejoice!\n • Ur-Ghast's tears should be visible again in Multiplayer when it's throwing a tantrum.",
"3.6.345": "FIXES:\n • Hotfix: Fixed players getting kicked from servers when near locked structures.",
"3.6.343": "FIXES:\n • Hotfix: Fixed Sponge server crashing related to packet fix last release.",
"3.6.342": "ADDED:\n • Not yet fully implemented Tinkers' Construct compatibility for some of our materials to make tools out of.\n\nFIXES:\n • Fixed our Forge minimum version dependency string being behind.\n • Fixed potential console spam related to weather rendering when the mod 'Fancy Block Particles' is present.\n • Added a message that if Sponge is installed the max bounding-box-size should be adjusted for Hydras to show up properly.\n • Removed the structure layout print debug that appears in the console, made it into the release on accident.\n • Fixed a config-related crash.\n • Fixed a generation problem with terraces being mashed together despite us telling them not do.",
"3.6.324": "ADDED:\n • The Naga Courtyard has received a complete revamp while maintaining the old style of it.\n • More things are planned at a later date for a second batch.\n • Many new blocks styled for and after the Naga including but not limited to:\n • Etched Nagastone\n • Block is available in 6 rotations. It's a block that kind of is placed like a pillar except the swirls on the block are placed dependent on the direction you placed.\n • Has 2x2 stone tiles on the end.\n • Comes in normal, mossy, and cracked variants.\n • Nagastone Pillar\n • Block is available in 3 axal rotations.\n • Works like vanilla Quartz Pillar Block.\n • Comes in normal, mossy, and cracked variants.\n • Nagastone Stairs\n • Textures like Etched Nagastone.\n • Has Left and Right facing variants dictating which way the swirls go.\n • Both Left and Right come in normal, mossy, and cracked variants.\n • Spiral Stone Bricks\n • Can be used in a 2x2 patterns to make a complete spiral.\n • The block itself is in 3D and has depth not only through shading.\n • The Uncrafting Table was added to the list of Crafting Tables for the Crafting Category in JEI.\n • Two original music tracks by MrOwltkins were added.\n • Updated our Chinese language file thanks to 3TUSK.\nCHANGED:\n • Block And Chain now appears from your left hand if used in the off-hand slot.\n • Also cleaned up the code around there.\n • shifted the Knightmetal Loop texture to the middle.\n • Block and Chain + Cube of Annihilation leave their x16 boundary to accommodate their texture.\n • Made the Block and Chain thicker when held.\n • The Block and Chain recieved a model override, the texture will change to only the loop when it is thrown.\n • Cube of Annihilation recieved a new texture for this too.\n • Optimized Cicadas, Fireflies, and Moonworms for the server side.\n • Made TF Critters not tick at all on the server side.\n • Wispy Clouds are now dropped when broken.\n • Removed unused EntityTFTinyFirefly (old version of ParticleFirefly).\n • Made Castle Doors breakable again so people can use them until the Final Castle is implemented fully, afterwards we'll prevent them from breaking until the structure is cleared.\n • Broke the fourth wall, wont fix.\nFIXES:\n • Made the player invulnerable when teleporting across dimensions, this was the issue causing players to wrongly teleport.\n • Fixed the issue when going through a portal would displace you up in the air.\n • Moved the language key for \"Underbrick Floor\" from meta 2 to meta 3 to fix lang entry collision for Underbrick.\n • Fixed a crash that happened due to the mod OpenTerrainGenerator.\n • Magic Beans once again properly grow into beanstalks on dedicated servers.\n • The vignette that appears in low light no longer randomly flickers in the Twilight Forest.\n • Fixed Root Strands being offset downwards for the second time, hopefully preventing them to sag with age.\n • Placing a giant block where it would replace a snow layer no longer crashes the client.\n • Moonworm Queen no longer breaks like a tool when it hits 0 durability.\n • Only the Moonworm Queen you're using should wiggle now instead of all of them when you have multiple.\n • Scepter of Twilight/Life Draining once again can be recharged.\n • Fixed the broken fourth wall.",
"3.5.263": "ADDED:\n • Added compatibility for many of our blocks with Chisel.\n • Crafting recipes added for Final Castle related blocks.\n • Vanilla's block to stairs ratio in crafting makes no sense, we opted for the stair recipes to give you 8 instead of the usual 4.\n\nCHANGED:\n • \"And Drullkus said; \"let portals be shapeless!\" And it was so.\"\n • Portals can now be made into any horizontal shape.\n • They still have the same requirements (water pool, plants surrounding it, etc.)\n\nFIXES:\n • Fixed a serious crash involving the Anti-Builder.\n • Fixed an issue with the Trophies interacting with other mods such as Skillable.\n • Also caught an Item Stack null.\n • All magic tree log variants now drop their respective wood properly.\n • Made sure bosses are recognised as such by the game.\n • Collected all of the Fireflies that escaped the Firefly Jar and put them back in.\n • The Firefly \"block\" also gives off its little firefly lights again.\n • Resolved some Hydra rotation issues; it should no longer track you by spinning around at the speed of sound.",
"3.4.239": "ADDED:\n • We now have loading screens when going to the Twilight Forest! \n • The Naga and Lich now have fancy incremental boss bars for the body segments and phases respectively.\n • The Block of Fiery Metal now has a fancy model.\n • Arctic armour now has lore text that makes it clear it can be dyed.\n • Also added a advancement related to dying Arctic armour.\n • Armour made from boss drops now have damage resistance, balanced relative to the progression.\n • Death Tome has a chance to drop enchanted books.\n\nCHANGED:\n • Quest Ram now pulls rewards from a loot table.\n • Uncrafting Table now returns materials directly to inventory like 1.12 vanilla Crafting Table.\n • Changing dimension ID of the TF now requires a relaunch.\n • Changing seed of your world now needs the world reloaded.\n • The 'shedding' from Death Tomes now draws from a loot table.\n • Block of Fiery Metal now stays lit when set on fire.\n • Made the boss spawner unbreakable, no more pacifist route unless on peaceful.\n • The Ore Magnet no longer moves ores if it is a tile entity.\n • Ghast Trap advancement is more specific in its wording.\n • Updated our JEI dependency to a newer version.\n\nFIXES:\n • Fixed Ironwood model.\n • Set particle Firefly size to 0 so they don't keep blinking in and out in F3+B mode.\n • Fixed a bug where all storage blocks worked as fuel.\n • Fixed Block of Fiery Metal and Block of Ironwood having parts render solid black without CTM.\n • Spruce trees in the snow biomes are no longer partially oak logs.\n • Giant blocks no longer destroy other blocks upon placement, including bedrock and the laws of physics.\n • Charm of Keeping and Charm of Life no longer conflict resulting in item loss, they now properly take turns and play nice.\n • Fiery Tears and Blood now show as interchangeable in JEI.\n • Roots no longer replace important blocks in generation.\n • Cleaned up the chunk generator some more.",
"3.3.202": "ADDED:\n • Block of Fiery Metal now deals damage when walked on.\n • Block of Arctic Fur reduces fall damage by 90%.\n • Block of Steeleaf reduces fall damage by 25%.\n • Advancement called \"Something Strange in The Towerwood\" was added.\n • Questing Ram has its own spawn egg now.\n • Questing Ram Trophy makes adorable noises now.\n • When a worn bug dies it now makes a *squish* sound.\n • The Anti-Builder now has a blacklist feature for people to prevent blocks being destroyed, a must have for mods that add graves.\n • Added proper breaking particles to Device Translucent and the Castle Doors.\n • Added names to multiple unlocalised blocks.\n\nCHANGES:\n • Made axes not terrible damage wise.\n • Buffed the Giant Sword.\n • Added proper sounds and material to the new storage blocks.\n • Tri-Bow no longer creates free arrows, only one can be picked up again when shot.\n • New storage blocks can now be used as base blocks for a beacon.\n • Magic tree cores no longer drop with Silk Touch.\n • Final Castle doors are now in the creative menu and can be pick-blocked.\n • Some advancement names and descriptions had changes.\n\nFIXES:\n • Fixed the Magic Map grinding your FPS to a halt over time, thousands of duplicate icons were hogging up all the precious memory over time.\n • The new storage blocks now show up in the creative menu.\n • Fixed the shadows of several mobs, no longer does the Alpha Yeti feel like a Beta Yeti.\n • Knightly Axe now properly deals extra damage to unarmoured targets.\n • Temporary workaround to not display the dismount message when a Pinch Beetle grabs you.\n • Fixed Magic Beans not getting consumed upon use.\n • Hydra can now rotate its body again.\n • Hydra will no longer harm itself, it enjoys life once again.\n • Unstable Ice Cores will no longer be griefing jerks with the MobGriefing gamerule being false.\n • The Hydra's mortar attack now also respects MobGriefing.\n • All mobs with a breath like attacks now have it functioning properly again.\n • Also fixed the particle rendering of the Snow Queen's icy breath.\n • Charm of Keeping should now activate before a gravestone mod can take hold of your items.\n • Fixed a transparency issue when wearing the Quest Ram Trophy.\n • The mushroom growing on the Minoshroom's head is back where it belongs.\n • Roots are no longer offset by one pixel down.\n • Swarm Spiders and Carminite Broodlings are no longer intimate with ceilings to the point of death."
"1.12.2-latest": "3.8.689",
"1.12.2-recommended": "3.8.689",
"1.7.10-latest": "2.3.7",
"1.7.10-recommended": "2.3.7"
[15:08:56] [Forge Version Check/INFO] [forge.VersionCheck]: [twilightforest] Found status: AHEAD Target: null
[15:08:56] [Forge Version Check/INFO] [forge.VersionCheck]: [placeableitems] Starting version check at https://raw.githubusercontent.com/Ferdzz/PlaceableItems/master/update.json
[15:08:56] [Forge Version Check/DEBUG] [forge.VersionCheck]: [placeableitems] Received version check data:
"homepage": "http://minecraft.curseforge.com/mc-mods/227951-placeableitems/files",
"1.9.4-latest": "**.**.**.**",
"1.9.4-recommended": "**.**.**.**",
"1.10.2-latest": "**.**.**.**",
"1.10.2-recommended": "**.**.**.**",
"1.11.2-latest": "**.**.**.**",
"1.11.2-recommended": "**.**.**.**",
"1.12.2-recommended": "3.3",
"1.14.4-latest": "4.1.1",
"1.14.4-recommended": "4.1.1",
"1.15.2-latest": "4.2.2",
"1.15.2-recommended": "4.2.2"
"**.**.**.**": "Added recipe for stands, removed block attraction AI",
"3.0.4": "Added horse armor stands and saddle stands",
"**.**.**.**": "Various fixes",
"3.0.3": "Added plates, crash fixes",
"**.**.**.**": "Fixed ingots drops (again). Drops are also de-stackable with shift-right click with an empty hand",
"**.**.**.**": "Fixed ingots drops",
"**.**.**.**": "Fixed book and quill not dropping",
"3.0.2": "Content update",
"**.**.**.**": "Small update",
"**.**.**.**": "Small hotfix",
"3.0.1": "Big update, check the curseforge",
"3.0": "The mod is completely reborn! \nThis means that no old models where used, no old textures either. The entirety of the code and the logic has been updated, and any lag issues you might have experienced are now fixed. Have fun discovering the new features! Stay tuned for more!"
"**.**.**.**": "Added recipe for stands, removed block attraction AI",
"3.0.4": "Added horse armor stands and saddle stands",
"**.**.**.**": "Various fixes",
"3.0.3": "Added plates, crash fixes",
"**.**.**.**": "Fixed ingots drops (again). Drops are also de-stackable with shift-right click with an empty hand",
"**.**.**.**": "Fixed ingots drops",
"**.**.**.**": "Fixed book and quill not dropping",
"3.0.2": "Content update",
"**.**.**.**": "Small update",
"**.**.**.**": "Small hotfix",
"3.0.1": "Big update, check the curseforge",
"3.0": "The mod is completely reborn! \nThis means that no old models where used, no old textures either. The entirety of the code and the logic has been updated, and any lag issues you might have experienced are now fixed. Have fun discovering the new features! Stay tuned for more!"
"**.**.**.**": "Added recipe for stands, removed block attraction AI",
"3.0.4": "Added horse armor stands and saddle stands",
"**.**.**.**": "Various fixes"
"3.1": "Added tons of new models - 1.12 support",
"3.1.1": "Updated models and textures",
"3.2": "Re-introducing entity attraction AI! Also updated a few models",
"3.3": "New translations, updated models & textures"
"4.0": "Updated the mod to 1.14.4",
"4.1": "New content & bugfixes",
"4.1.1": "Fixes crash when pressing shift on title screen"
"4.2": "Updated the mod to 1.15.2",
"4.2.2": "Features, bugfixes"
[15:08:56] [Forge Version Check/INFO] [forge.VersionCheck]: [placeableitems] Found status: UP_TO_DATE Target: null
[15:08:56] [Forge Version Check/INFO] [forge.VersionCheck]: [babymobs] Starting version check at https://raw.githubusercontent.com/Furgl/BabyMobs/1.12/update.json
[15:08:56] [Forge Version Check/DEBUG] [forge.VersionCheck]: [babymobs] Received version check data:
"homepage": "http://minecraft.curseforge.com/projects/baby-mobs/files",
"1.12-recommended": "1.5.5"
[15:08:56] [Forge Version Check/INFO] [forge.VersionCheck]: [babymobs] Found status: BETA Target: null
[15:08:56] [Forge Version Check/INFO] [forge.VersionCheck]: [midnight] Starting version check at https://gist.githubusercontent.com/gegy1000/a3f1f593c43f88d7f01a3560ac32e216/raw/midnight_updates.json
[15:08:57] [Forge Version Check/DEBUG] [forge.VersionCheck]: Failed to process update information
java.io.FileNotFoundException: https://gist.githubusercontent.com/gegy1000/a3f1f593c43f88d7f01a3560ac32e216/raw/midnight_updates.json
at sun.reflect.NativeConstructorAccessorImpl.newInstance0(Native Method) ~[?:1.8.0_265]
at sun.reflect.NativeConstructorAccessorImpl.newInstance(NativeConstructorAccessorImpl.java:62) ~[?:1.8.0_265]
at sun.reflect.DelegatingConstructorAccessorImpl.newInstance(DelegatingConstructorAccessorImpl.java:45) ~[?:1.8.0_265]
at java.lang.reflect.Constructor.newInstance(Constructor.java:423) ~[?:1.8.0_265]
at sun.net.www.protocol.http.HttpURLConnection$10.run(HttpURLConnection.java:1950) ~[?:1.8.0_265]
at sun.net.www.protocol.http.HttpURLConnection$10.run(HttpURLConnection.java:1945) ~[?:1.8.0_265]
at java.security.AccessController.doPrivileged(Native Method) ~[?:1.8.0_265]
at sun.net.www.protocol.http.HttpURLConnection.getChainedException(HttpURLConnection.java:1944) ~[?:1.8.0_265]
at sun.net.www.protocol.http.HttpURLConnection.getInputStream0(HttpURLConnection.java:1514) ~[?:1.8.0_265]
at sun.net.www.protocol.http.HttpURLConnection.access$200(HttpURLConnection.java:92) ~[?:1.8.0_265]
at sun.net.www.protocol.http.HttpURLConnection$9.run(HttpURLConnection.java:1490) ~[?:1.8.0_265]
at sun.net.www.protocol.http.HttpURLConnection$9.run(HttpURLConnection.java:1488) ~[?:1.8.0_265]
at java.security.AccessController.doPrivileged(Native Method) ~[?:1.8.0_265]
at java.security.AccessController.doPrivilegedWithCombiner(AccessController.java:784) ~[?:1.8.0_265]
at sun.net.www.protocol.http.HttpURLConnection.getInputStream(HttpURLConnection.java:1487) ~[?:1.8.0_265]
at sun.net.www.protocol.https.HttpsURLConnectionImpl.getInputStream(HttpsURLConnectionImpl.java:268) ~[?:1.8.0_265]
at net.minecraftforge.common.ForgeVersion$1.openUrlStream(ForgeVersion.java:239) ~[ForgeVersion$1.class:14.23.5.2854]
at net.minecraftforge.common.ForgeVersion$1.process(ForgeVersion.java:252) [ForgeVersion$1.class:14.23.5.2854]
at net.minecraftforge.common.ForgeVersion$1.run(ForgeVersion.java:201) [ForgeVersion$1.class:14.23.5.2854]
Caused by: java.io.FileNotFoundException: https://gist.githubusercontent.com/gegy1000/a3f1f593c43f88d7f01a3560ac32e216/raw/midnight_updates.json
at sun.net.www.protocol.http.HttpURLConnection.getInputStream0(HttpURLConnection.java:1896) ~[?:1.8.0_265]
at sun.net.www.protocol.http.HttpURLConnection.access$200(HttpURLConnection.java:92) ~[?:1.8.0_265]
at sun.net.www.protocol.http.HttpURLConnection$9.run(HttpURLConnection.java:1490) ~[?:1.8.0_265]
at sun.net.www.protocol.http.HttpURLConnection$9.run(HttpURLConnection.java:1488) ~[?:1.8.0_265]
at java.security.AccessController.doPrivileged(Native Method) ~[?:1.8.0_265]
at java.security.AccessController.doPrivilegedWithCombiner(AccessController.java:784) ~[?:1.8.0_265]
at sun.net.www.protocol.http.HttpURLConnection.getInputStream(HttpURLConnection.java:1487) ~[?:1.8.0_265]
at java.net.HttpURLConnection.getResponseCode(HttpURLConnection.java:480) ~[?:1.8.0_265]
at sun.net.www.protocol.https.HttpsURLConnectionImpl.getResponseCode(HttpsURLConnectionImpl.java:352) ~[?:1.8.0_265]
at net.minecraftforge.common.ForgeVersion$1.openUrlStream(ForgeVersion.java:223) ~[ForgeVersion$1.class:14.23.5.2854]
[15:08:57] [Forge Version Check/INFO] [forge.VersionCheck]: [crafttweaker] Starting version check at https://updates.blamejared.com/get?n=crafttweaker&gv=1.12.2
[15:08:57] [Forge Version Check/DEBUG] [forge.VersionCheck]: [crafttweaker] Received version check data:
{"homepage":"https://www.curseforge.com/minecraft/mc-mods/crafttweaker","promos":{"1.12.2-latest":"1.12-4.1.20.626"}}
[15:08:57] [Forge Version Check/INFO] [forge.VersionCheck]: [crafttweaker] Found status: BETA Target: null
[15:08:57] [Forge Version Check/INFO] [forge.VersionCheck]: [llibrary] Starting version check at https://gist.githubusercontent.com/Gegy/a6639456aeb8edd92cbf7cbfcf9d65d9/raw/llibrary_updates.json
[15:08:57] [Forge Version Check/DEBUG] [forge.VersionCheck]: [llibrary] Received version check data:
"homepage": "https://minecraft.curseforge.com/projects/llibrary",
"1.7.4": "* Allow custom particles for Tabula baked models\n* Support transformations for Tabula baked models\n* If cuboid has a transparent texture, each face will be rendered both inward and outwards\n* Fix occasional jitter when rendering the LLibrary patron cube\n* Fix the LLibrary logger not printing formatted strings",
"1.7.5": "* Add support for Qubble JSON models\n* Fix baked tabula texture error on newer Forge versions\n* Deprecate update checker if favor of Forge checker",
"1.7.6": "* Implement fast-fail for untransformed RuntimePatchers\n* Implement more ASM patch predicates",
"1.7.7": "+ Add ItemTESRContext, allowing mods to retrieve context of an Item TESR such as perspective and NBT\n + View distance override event\n + ApplyRenderRotationsEvent, allowing mods to apply rotations to the player"
"1.7.4": "* Allow custom particles for Tabula baked models\n* Support transformations for Tabula baked models\n* If cuboid has a transparent texture, each face will be rendered both inward and outwards\n* Fix occasional jitter when rendering the LLibrary patron cube\n* Fix the LLibrary logger not printing formatted strings",
"1.7.5": "* Add support for Qubble JSON models\n* Fix baked tabula texture error on newer Forge versions\n* Deprecate update checker if favor of Forge checker",
"1.7.6": "* Implement fast-fail for untransformed RuntimePatchers\n* Implement more ASM patch predicates",
"1.7.7": "+ Add ItemTESRContext, allowing mods to retrieve context of an Item TESR such as perspective and NBT\n + View distance override event\n + ApplyRenderRotationsEvent, allowing mods to apply rotations to the player",
"1.7.10": "* Fix log spam related to issues with config system\n* Fix texture mirroring on Tabula models\n* Fix techne texture parsing\n* Fix crashes related to patron effect with some mods\n* Enable COMPUTE_FRAMES for RuntimePatchers, allowing for more complex transforms",
"1.7.11": "* Fix server crash"
"1.7.6": "* Initial port to 1.12",
"1.7.7": "+ Add ItemTESRContext, allowing mods to retrieve context of an Item TESR such as perspective and NBT\n + View distance override event\n + ApplyRenderRotationsEvent, allowing mods to apply rotations to the player",
"1.7.8": "* Fix LLibrary patron effect being displayed incorrectly\n* Fix TabulaModel mirror not being set",
"1.7.9": "* Fix a crash when game profile id was null\n* Fix a crash with MineLittlePony due to replacement of arm renderers\n* Fix invalid logger formatting for the TabulaModelHelper\n+ Add dispose method to Element, called when the element is no longer used"
"1.7.7": "* Initial port to 1.12.1",
"1.7.8": "* Fix LLibrary patron effect being displayed incorrectly\n* Fix TabulaModel mirror not being set",
"1.7.9": "* Fix a crash when game profile id was null\n* Fix a crash with MineLittlePony due to replacement of arm renderers\n* Fix invalid logger formatting for the TabulaModelHelper\n+ Add dispose method to Element, called when the element is no longer used"
"1.7.7": "* Initial port to 1.12.2",
"1.7.8": "* Fix LLibrary patron effect being displayed incorrectly\n* Fix TabulaModel mirror not being set",
"1.7.9": "* Fix a crash when game profile id was null\n* Fix a crash with MineLittlePony due to replacement of arm renderers\n* Fix invalid logger formatting for the TabulaModelHelper\n+ Add dispose method to Element, called when the element is no longer used",
"1.7.10": "* Fix log spam related to issues with config system\n* Fix techne texture parsing\n* Fix crashes related to patron effect with some mods\n* Enable COMPUTE_FRAMES for RuntimePatchers, allowing for more complex transforms\n* Fix mod signature",
"1.7.11": "* Fix server crash",
"1.7.12": "* Fix crash with sponge",
"1.7.13": "* Fix memory leak relating to entities not being removed from cache",
"1.7.14": "* Fix occasional crash on player death",
"1.7.15": "* Optimize entity data lookup\n* Add opacity controls to AdvancedModelRenderers (@BobMowzie)\n* Add helper methods to AdvancedModelRenderer allowing transformation of positions into world or model space",
"1.7.17": "* Fix crash on newer forge versions",
"1.7.18": "* Fix LLibrary crashing without a report in some circumstances",
"1.7.19": "* Optimize entity property tracking system (@Shadows-of-Fire)",
"1.7.20": "* Don't print a misleading crash report on failure to receive data from URL"
"1.10.2-latest": "1.7.7",
"1.10.2-recommended": "1.7.6",
"1.11.2-latest": "1.7.11",
"1.11.2-recommended": "1.7.11",
"1.12-recommended": "1.7.9",
"1.12.1-latest": "1.7.9",
"1.12.1-recommended": "1.7.9",
"1.12.2-latest": "1.7.20",
"1.12.2-recommended": "1.7.20"
[15:08:57] [Forge Version Check/INFO] [forge.VersionCheck]: [llibrary] Found status: UP_TO_DATE Target: null
[15:08:57] [Forge Version Check/INFO] [forge.VersionCheck]: [gravestone] Starting version check at http://maxhenkel.de/update/gravestone.json
[15:08:58] [Forge Version Check/DEBUG] [forge.VersionCheck]: [gravestone] Received version check data:
{"homepage":"https://www.curseforge.com/minecraft/mc-mods/gravestone-mod","promos":{"1.10-recommended":"1.4.9","1.10-latest":"1.4.9","1.9.4-recommended":"1.3.6","1.9.4-latest":"1.3.6","1.9-recommended":"1.2.10","1.9-latest":"1.2.10","1.8.9-recommended":"1.1.7","1.8.9-latest":"1.1.7","1.8.8-recommended":"1.1.7","1.8.8-latest":"1.1.7","1.8-recommended":"1.0.5","1.8-latest":"1.0.5","1.7.10-recommended":"**.**.**.**","1.7.10-latest":"**.**.**.**","1.11-recommended":"1.6.6","1.11-latest":"1.6.6","1.10.2-recommended":"1.5.13","1.10.2-latest":"1.5.13","1.12-recommended":"1.8.4","1.12-latest":"1.8.4","1.11.2-recommended":"**.**.**.**","1.11.2-latest":"**.**.**.**","1.12.1-recommended":"1.9.0","1.12.1-latest":"1.9.0","1.13.2-latest":"1.12.7","1.14.3-latest":"1.14.3","1.14.2-latest":"1.13.3","1.12.2-latest":"1.10.2","1.12.2-recommended":"1.10.2","1.14.4-recommended":"1.15.3","1.14.4-latest":"1.15.3","1.14.3-recommended":"1.14.3","1.14.2-recommended":"1.13.3","1.13.2-recommended":"1.12.7","1.15.1-recommended":"1.16.2","1.15.1-latest":"1.16.2","1.15.2-recommended":"1.17.6","1.15.2-latest":"1.17.6","1.16.1-recommended":"1.16.1-1.0.6","1.16.1-latest":"1.16.1-1.0.6","1.16.2-recommended":"1.16.2-1.0.6","1.16.2-latest":"1.16.2-1.0.6","1.16.3-recommended":"1.16.3-1.0.2","1.16.3-latest":"1.16.3-2.0.4","1.16.4-recommended":"1.16.4-1.0.9","1.16.4-latest":"1.16.4-1.0.9","1.16.5-recommended":"1.16.5-1.0.1","1.16.5-latest":"1.16.5-1.0.1"},"1.10":{"1.4.9":"Bugfixes"},"1.9.4":{"1.3.6":"Bugfixes"},"1.9":{"1.2.10":"Bugfixes"},"1.8.9":{"1.1.7":"Bugfixes"},"1.8.8":{"1.1.7":"Bugfixes"},"1.8":{"1.0.5":"Bugfixes"},"1.7.10":{"**.**.**.**":"Bugfixes"},"1.11":{"1.6.6":"Bugfixes"},"1.10.2":{"1.5.13":"Bugfixes"},"1.12":{"1.8.4":"Added recipe for recipe book"},"1.11.2":{"**.**.**.**":"Improved version checking"},"1.12.1":{"1.9.0":"Updated to 1.12.1"},"1.13.2":{"1.12.0":"Update to 1.13.2","1.12.1":"Fixed dimension translation issue","1.12.2":"Fixed recipes and added zh_cn language","1.12.3":"Improved GraveStone bounding volume","1.12.4":"Fixed game crashing bug","1.12.5":"Added zh_tw language","1.12.7":"Improved en_us language and added pl_pl language"},"1.14.3":{"1.14.0":"Update to 1.14.3","1.14.1":"Fixed crash on servers","1.14.2":"Fixed gravestone block can't explode","1.14.3":"Improved en_us language and added pl_pl language"},"1.14.2":{"1.13.0":"Update to 1.14.2","1.13.1":"Fixed ghost not rendering","1.13.2":"Fixed crash on servers","1.13.3":"Improved en_us language and added pl_pl language"},"1.12.2":{"1.10.0":"Update to 1.12.2","1.10.1":"Bugfixes","1.10.3":"Improved en_us language and added pl_pl language","1.10.2":"Updated Forge version"},"1.14.4":{"1.15.0":"Update to 1.14.4","1.15.1":"Updated to latest Forge version\nFixed gravestone recipe\nFixed gravestone block material","1.15.2":"Fixed duplicate config name\nFixed crash caused by dying multiple times with the death note in your inventory","1.15.3":"Fixed config reset issue"},"1.15.1":{"1.16.0":"Updated to 1.15.1\nAdded configurable color for the gravestone","1.16.1":"Fixed crouching issue with death info","1.16.2":"Fixed crash with forge 30.0.17+"},"1.15.2":{"1.17.0":"Updated to 1.15.2","1.17.1":"Added spanish language","1.17.2":"Updated forge and mcp mappings","1.17.3":"Fixed config reset issue","1.17.4":"Updated Forge version\nUpdated MCP mapping version","1.17.5":"Updated Forge version\nUpdated MCP mapping version\nUpdated Gradle wrapper","1.17.6":"Updated polish translation"},"1.16.1":{"1.16.1-1.0.0":"Updated to 1.16.1","1.16.1-1.0.1":"Fixed death info GUI text","1.16.1-1.0.2":"Re added player ghost","1.16.1-1.0.3":"Fixed hand animation with placed gravestone","1.16.1-1.0.4":"Internal changes","1.16.1-1.0.5":"Fixed GUIs not showing tooltips","1.16.1-1.0.6":"Fixed gravestone items can be picked up with a hopper"},"1.16.2":{"1.16.1-1.0.0":"Updated to 1.16.2","1.16.1-1.0.1":"Updated pack format","1.16.1-1.0.2":"Removed syncing the gravestone inventory to the client to avoid packets being too big","1.16.1-1.0.3":"Fixed dimension names resetting","1.16.2-1.0.4":"Fixed wrong version","1.16.2-1.0.5":"Fixed potential crashes","1.16.2-1.0.6":"Fixed nether dimension name\nUpdated russian translation\nFixed remove death note option"},"1.16.3":{"1.16.3-1.0.0":"Updated to 1.16.3","1.16.3-1.0.1":"Fixed crash on servers","1.16.3-1.0.2":"Updated mods.toml","1.16.3-2.0.0":"Ghost players can now have equipment\nItems can now be sorted back into their original slots\nItems can now be picked up by sneaking on the grave (Config option)\nAdded restore command\nAdded death ID to obituary\nAdded item tooltips to obituary","1.16.3-2.0.1":"Fixed obituary not being removed when using sneak pickup","1.16.3-2.0.2":"Added WAILA/HWYLA compatibility","1.16.3-2.0.3":"Added swedish translation","1.16.3-2.0.4":"Fixed grave disappearing when having sneaking on toggle"},"1.16.4":{"1.16.4-1.0.0":"Updated to 1.16.4","1.16.4-1.0.1":"Fixed grave disappearing when having sneaking on toggle","1.16.4-1.0.2":"Fixed crash when spawning a player ghost\nRemoved ghost player transparency","1.16.4-1.0.3":"Added grave_replaceable tag\nAdded tag support in config","1.16.4-1.0.4":"Improved translations","1.16.4-1.0.5":"Updated polish translation","1.16.4-1.0.6":"Added death not found message","1.16.4-1.0.7":"Updated polish translation","1.16.4-1.0.8":"Added korean translation","1.16.4-1.0.9":"Update chinese translation"},"1.16.5":{"1.16.5-1.0.0":"Updated to 1.16.5","1.16.5-1.0.1":"Updated chinese translation"}}
[15:08:58] [Forge Version Check/INFO] [forge.VersionCheck]: [gravestone] Found status: AHEAD Target: null
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.altar`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.holystone_furnace`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.skyroot_chest`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.skyroot_sign`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.multiblock_dummy`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.moa_egg`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.icestone_cooler`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.incubator`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.present`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.wildcard`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.masonry_bench`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.outpost_campfire`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.aether_teleporter`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `aether.skyroot_bed`, expected `aether`. This could be a intended override, but in most cases indicates a broken mod.
[15:09:00] [Server thread/DEBUG] [AetherII]: 'Pre-initialize tiles' completed in 558ms
[15:09:01] [Server thread/DEBUG] [AetherII]: 'Pre-initialize dimensions' completed in 360ms
[15:09:01] [Server thread/DEBUG] [AetherII]: 'Pre-initialize loot tables' completed in 36ms
[15:09:01] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.aechor_plant as aether:aechor_plant
[15:09:01] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.aerbunny as aether:aerbunny
[15:09:01] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.carrion_sprout as aether:carrion_sprout
[15:09:01] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.cockatrice as aether:cockatrice
[15:09:01] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.kirrid as aether:kirrid
[15:09:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.aerwhale as aether:aerwhale
[15:09:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.zephyr as aether:zephyr
[15:09:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.tempest as aether:tempest
[15:09:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.swet as aether:swet
[15:09:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.taegore as aether:taegore
[15:09:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.glitterwing as aether:glitterwing
[15:09:02] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.edison as aether:edison
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.burrukai as aether:burrukai
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.necromancer as aether:necromancer
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.josediya as aether:josediya
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.tivalier as aether:tivalier
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.glactrix as aether:glactrix
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.mysterious_figure as aether:mysterious_figure
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.varanys as aether:varanys
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.skyroot_lizard as aether:skyroot_lizard
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.sheepuff as aether:sheepuff
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.frostpine_totem as aether:frostpine_totem
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.kraisith as aether:kraisith
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.shade_of_arkenzus as aether:shade_of_arkenzus
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.ethereal_wisp as aether:ethereal_wisp
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.fleeting_wisp as aether:fleeting_wisp
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.soaring_wisp as aether:soaring_wisp
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.fangrin as aether:fangrin
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.nex_spirit as aether:nex_spirit
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.pink_baby_swet as aether:pink_baby_swet
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.floating_block as aether:floating_block
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.moving_block as aether:moving_block
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.dart as aether:dart
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.daggerfrost_snowball as aether:daggerfrost_snowball
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.bolt as aether:bolt
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.parachute as aether:parachute
[15:09:03] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.tnt_present as aether:tnt_present
[15:09:04] [Server thread/TRACE] [FML]: Automatically registered mod aether entity aether.moa as aether:moa
[15:09:04] [Server thread/DEBUG] [AetherII]: 'Pre-initialize entities' completed in 2869ms
[15:09:06] [Server thread/INFO] [Quark ASM]: Transforming net.minecraft.inventory.ContainerWorkbench
[15:09:06] [Server thread/INFO] [Quark ASM]: Applying Transformation to method (Names [transferStackInSlot, func_82846_b] Descriptor (Lnet/minecraft/entity/player/EntityPlayer;I)Lnet/minecraft/item/ItemStack;)
[15:09:06] [Server thread/INFO] [Quark ASM]: Located Method, patching...
[15:09:06] [Server thread/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerWorkbench.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[15:09:06] [Server thread/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerWorkbench.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[15:09:06] [Server thread/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerWorkbench.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[15:09:06] [Server thread/INFO] [Quark ASM]: Located patch target node INVOKEVIRTUAL net/minecraft/inventory/ContainerWorkbench.func_75135_a (Lnet/minecraft/item/ItemStack;IIZ)Z
[15:09:06] [Server thread/INFO] [Quark ASM]: Patch result: true
[15:09:06] [Server thread/DEBUG] [AetherII]: 'Pre-initialize networking' completed in 2667ms
[15:09:06] [Server thread/DEBUG] [AetherII]: 'Pre-initialize patron rewards' completed in 71ms
[15:09:06] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/aechor_plant.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/aerbunny.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/burrukai.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/carrion_sprout.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/cockatrice.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/glactrix.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/glitterwing.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/kirrid.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/moa.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/sheepuff.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/skyroot_lizard.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/swet.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/taegore.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/tempest.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/varanys.json
[15:09:07] [Server thread/INFO] [AetherII]: Loading definitions from file /assets/aether/travellers_guidebook/definitions/zephyr.json
[15:09:07] [Server thread/DEBUG] [AetherII]: 'Pre-initialize definitions' completed in 241ms
[15:09:07] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod aether
[15:09:07] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Aether II took 11.401s
[15:09:07] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod baubles
[15:09:07] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod baubles
[15:09:07] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Baubles took 0.188s
[15:09:07] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod atum
[15:09:08] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod atum
[15:09:08] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Atum 2 took 1.066s
[15:09:08] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod crafttweaker
[15:09:12] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod crafttweaker
[15:09:12] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - CraftTweaker2 took 3.770s
[15:09:12] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mtlib
[15:09:12] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mtlib
[15:09:12] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - MTLib took 0.000s
[15:09:12] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod modtweaker
[15:09:12] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod modtweaker
[15:09:12] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Mod Tweaker took 0.014s
[15:09:12] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod jei
[15:09:12] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod jei
[15:09:12] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Just Enough Items took 0.144s
[15:09:12] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod quark
[15:09:18] [Server thread/INFO] [Quark]: Module management is enabled
[15:09:18] [Server thread/INFO] [Quark]: Module automation is enabled
[15:09:18] [Server thread/INFO] [Quark]: Module building is enabled
[15:09:18] [Server thread/INFO] [Quark]: Module tweaks is enabled
[15:09:18] [Server thread/INFO] [Quark]: Module vanity is enabled
[15:09:18] [Server thread/INFO] [Quark]: Module misc is enabled
[15:09:18] [Server thread/INFO] [Quark]: Module experimental is enabled
[15:09:18] [Server thread/INFO] [Quark]: Module world is enabled
[15:09:18] [Server thread/INFO] [Quark]: Module decoration is enabled
[15:09:18] [Server thread/INFO] [Quark]: Module client is enabled
[15:09:18] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:chest_passenger as quark:chest_passenger
[15:09:18] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:gravisand as quark:gravisand
[15:09:23] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:seat as quark:seat
[15:09:23] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:pickarang as quark:pickarang
[15:09:23] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:arrow_ender as quark:arrow_ender
[15:09:23] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:arrow_explosive as quark:arrow_explosive
[15:09:23] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:arrow_torch as quark:arrow_torch
[15:09:23] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:dragon_breath_bottle as quark:dragon_breath_bottle
[15:09:23] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:soul_powder as quark:soul_powder
[15:09:23] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:parrot_egg as quark:parrot_egg
[15:09:24] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:stoneling as quark:stoneling
[15:09:24] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:archaeologist as quark:archaeologist
[15:09:24] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:foxhound as quark:foxhound
[15:09:24] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:dweller as quark:dweller
[15:09:24] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:ashen as quark:ashen
[15:09:24] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:frog as quark:frog
[15:09:24] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:pirate as quark:pirate
[15:09:24] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:crab as quark:crab
[15:09:25] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:wraith as quark:wraith
[15:09:25] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:flat_item_frame as quark:flat_item_frame
[15:09:33] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:leash_knot as quark:leash_knot
[15:09:33] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:colored_item_frame as quark:colored_item_frame
[15:09:35] [Server thread/TRACE] [FML]: Automatically registered mod quark entity quark:glass_item_frame as quark:glass_item_frame
[15:09:35] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod quark
[15:09:35] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Quark took 23.538s
[15:09:35] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod autoreglib
[15:09:35] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod autoreglib
[15:09:35] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - AutoRegLib took 0.011s
[15:09:35] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod babymobs
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babyspider as babymobs:babyspider
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babyskeleton as babymobs:babyskeleton
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babycreeper as babymobs:babycreeper
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babywitherskeleton as babymobs:babywitherskeleton
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babyenderman as babymobs:babyenderman
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babyblaze as babymobs:babyblaze
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babywitch as babymobs:babywitch
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babyguardian as babymobs:babyguardian
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babysquid as babymobs:babysquid
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babycavespider as babymobs:babycavespider
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babyzombie as babymobs:babyzombie
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babypigzombie as babymobs:babypigzombie
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babyghast as babymobs:babyghast
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babysnowman as babymobs:babysnowman
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babyirongolem as babymobs:babyirongolem
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babywither as babymobs:babywither
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babyshulker as babymobs:babyshulker
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babydragon as babymobs:babydragon
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babyocelot as babymobs:babyocelot
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity zombiechicken as babymobs:zombiechicken
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity zombiepig as babymobs:zombiepig
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity cavespidervenom as babymobs:cavespidervenom
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity snowmansnowball as babymobs:snowmansnowball
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity blazeflamethrower as babymobs:blazeflamethrower
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity creeperexplosion as babymobs:creeperexplosion
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity witherskeletonsmoke as babymobs:witherskeletonsmoke
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity squidink as babymobs:squidink
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity witherwitherskull as babymobs:witherwitherskull
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity witherexplosion as babymobs:witherexplosion
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod babymobs entity babyshulkerbullet as babymobs:babyshulkerbullet
[15:09:36] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod babymobs
[15:09:36] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Baby Mobs took 0.335s
[15:09:36] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod bibliocraft
[15:09:36] [Server thread/TRACE] [FML]: Automatically registered mod bibliocraft entity SeatEntity as bibliocraft:biblioseat
[15:09:36] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod bibliocraft
[15:09:36] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - BiblioCraft took 0.535s
[15:09:36] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod biomesoplenty
[15:09:40] [Server thread/TRACE] [FML]: Automatically registered mod biomesoplenty entity biomesoplenty.mudball as biomesoplenty:biomesoplenty.mudball
[15:09:40] [Server thread/TRACE] [FML]: Automatically registered mod biomesoplenty entity biomesoplenty.wasp as biomesoplenty:biomesoplenty.wasp
[15:09:40] [Server thread/TRACE] [FML]: Automatically registered mod biomesoplenty entity biomesoplenty.pixie as biomesoplenty:biomesoplenty.pixie
[15:09:44] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod biomesoplenty
[15:09:44] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Biomes O' Plenty took 8.068s
[15:09:44] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod chisel
[15:09:44] [Server thread/INFO] [FML]: Applying holder lookups
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:assassin for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.ASSASSIN. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:bandit_warlord for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.BANDIT_WARLORD. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:barbarian for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.BARBARIAN. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:bonestorm for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.BONESTORM. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:brigand for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.BRIGAND. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:camel for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.CAMEL. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_wolf for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.DESERT_WOLF. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:forsaken for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.FORSAKEN. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:mummy for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.MUMMY. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:nomad for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.NOMAD. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:pharaoh for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.PHARAOH. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:rabbit for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.RABBIT. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:scarab for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.SCARAB. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:stoneguard for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.STONEGUARD. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:stonewarden for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.STONEWARDEN. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:sunspeaker for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.SUNSPEAKER. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:tarantula for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.TARANTULA. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:wraith for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.WRAITH. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:camel_spit for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.CAMEL_SPIT. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:double_shot_black for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.DOUBLE_SHOT_BLACK. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:double_shot_white for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.DOUBLE_SHOT_WHITE. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:explosive_arrow for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.EXPLOSIVE_ARROW. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:fire_arrow for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.FIRE_ARROW. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:heart_of_ra for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.HEART_OF_RA. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:poison_arrow for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.POISON_ARROW. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:quickdraw_arrow for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.QUICKDRAW_ARROW. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:rain_arrow for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.RAIN_ARROW. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:slowness_arrow for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.SLOWNESS_ARROW. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:small_bone for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.SMALL_BONE. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:straight_arrow for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.STRAIGHT_ARROW. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:tefnuts_call for public static net.minecraftforge.fml.common.registry.EntityEntry com.teammetallurgy.atum.init.AtumEntities.TEFNUTS_CALL. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:dead_oasis for public static com.teammetallurgy.atum.world.biome.base.AtumBiome com.teammetallurgy.atum.init.AtumBiomes.DEAD_OASIS. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:deadwood_forest for public static com.teammetallurgy.atum.world.biome.base.AtumBiome com.teammetallurgy.atum.init.AtumBiomes.DEADWOOD_FOREST. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:dried_river for public static com.teammetallurgy.atum.world.biome.base.AtumBiome com.teammetallurgy.atum.init.AtumBiomes.DRIED_RIVER. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_crags for public static com.teammetallurgy.atum.world.biome.base.AtumBiome com.teammetallurgy.atum.init.AtumBiomes.LIMESTONE_CRAGS. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_mountains for public static com.teammetallurgy.atum.world.biome.base.AtumBiome com.teammetallurgy.atum.init.AtumBiomes.LIMESTONE_MOUNTAINS. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:oasis for public static com.teammetallurgy.atum.world.biome.base.AtumBiome com.teammetallurgy.atum.init.AtumBiomes.OASIS. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:sand_dunes for public static com.teammetallurgy.atum.world.biome.base.AtumBiome com.teammetallurgy.atum.init.AtumBiomes.SAND_DUNES. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:sand_hills for public static com.teammetallurgy.atum.world.biome.base.AtumBiome com.teammetallurgy.atum.init.AtumBiomes.SAND_HILLS. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:sand_plains for public static com.teammetallurgy.atum.world.biome.base.AtumBiome com.teammetallurgy.atum.init.AtumBiomes.SAND_PLAINS. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_log for public static net.minecraft.block.Block twilightforest.block.TFBlocks.twilight_log. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_leaves for public static net.minecraft.block.BlockLeaves twilightforest.block.TFBlocks.twilight_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:firefly for public static net.minecraft.block.Block twilightforest.block.TFBlocks.firefly. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_portal for public static twilightforest.block.BlockTFPortal twilightforest.block.TFBlocks.twilight_portal. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_stone for public static net.minecraft.block.Block twilightforest.block.TFBlocks.maze_stone. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:hedge for public static net.minecraft.block.Block twilightforest.block.TFBlocks.hedge. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:boss_spawner for public static net.minecraft.block.Block twilightforest.block.TFBlocks.boss_spawner. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:firefly_jar for public static net.minecraft.block.Block twilightforest.block.TFBlocks.firefly_jar. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_plant for public static net.minecraft.block.Block twilightforest.block.TFBlocks.twilight_plant. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cicada for public static net.minecraft.block.Block twilightforest.block.TFBlocks.cicada. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:root for public static net.minecraft.block.Block twilightforest.block.TFBlocks.root. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:uncrafting_table for public static net.minecraft.block.Block twilightforest.block.TFBlocks.uncrafting_table. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fire_jet for public static net.minecraft.block.Block twilightforest.block.TFBlocks.fire_jet. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:naga_stone for public static net.minecraft.block.Block twilightforest.block.TFBlocks.naga_stone. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_sapling for public static net.minecraft.block.BlockBush twilightforest.block.TFBlocks.twilight_sapling. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_log for public static net.minecraft.block.Block twilightforest.block.TFBlocks.magic_log. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_log_core for public static net.minecraft.block.Block twilightforest.block.TFBlocks.magic_log_core. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_leaves for public static net.minecraft.block.BlockLeaves twilightforest.block.TFBlocks.magic_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:moonworm for public static net.minecraft.block.Block twilightforest.block.TFBlocks.moonworm. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:tower_wood for public static net.minecraft.block.Block twilightforest.block.TFBlocks.tower_wood. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:tower_device for public static twilightforest.block.BlockTFTowerDevice twilightforest.block.TFBlocks.tower_device. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:tower_translucent for public static net.minecraft.block.Block twilightforest.block.TFBlocks.tower_translucent. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trophy for public static net.minecraft.block.Block twilightforest.block.TFBlocks.trophy. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:stronghold_shield for public static net.minecraft.block.Block twilightforest.block.TFBlocks.stronghold_shield. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trophy_pedestal for public static net.minecraft.block.Block twilightforest.block.TFBlocks.trophy_pedestal. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:aurora_block for public static net.minecraft.block.Block twilightforest.block.TFBlocks.aurora_block. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:underbrick for public static net.minecraft.block.Block twilightforest.block.TFBlocks.underbrick. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:thorns for public static net.minecraft.block.Block twilightforest.block.TFBlocks.thorns. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:burnt_thorns for public static net.minecraft.block.Block twilightforest.block.TFBlocks.burnt_thorns. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:thorn_rose for public static net.minecraft.block.Block twilightforest.block.TFBlocks.thorn_rose. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_leaves_3 for public static net.minecraft.block.BlockLeaves twilightforest.block.TFBlocks.twilight_leaves_3. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:deadrock for public static net.minecraft.block.Block twilightforest.block.TFBlocks.deadrock. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_leaves for public static net.minecraft.block.Block twilightforest.block.TFBlocks.dark_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:aurora_pillar for public static net.minecraft.block.Block twilightforest.block.TFBlocks.aurora_pillar. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:aurora_slab for public static net.minecraft.block.BlockSlab twilightforest.block.TFBlocks.aurora_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:double_aurora_slab for public static net.minecraft.block.BlockSlab twilightforest.block.TFBlocks.double_aurora_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trollsteinn for public static net.minecraft.block.Block twilightforest.block.TFBlocks.trollsteinn. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:wispy_cloud for public static net.minecraft.block.Block twilightforest.block.TFBlocks.wispy_cloud. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fluffy_cloud for public static net.minecraft.block.Block twilightforest.block.TFBlocks.fluffy_cloud. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_cobblestone for public static net.minecraft.block.Block twilightforest.block.TFBlocks.giant_cobblestone. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_log for public static net.minecraft.block.Block twilightforest.block.TFBlocks.giant_log. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_leaves for public static net.minecraft.block.Block twilightforest.block.TFBlocks.giant_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_obsidian for public static net.minecraft.block.Block twilightforest.block.TFBlocks.giant_obsidian. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:uberous_soil for public static net.minecraft.block.Block twilightforest.block.TFBlocks.uberous_soil. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:huge_stalk for public static net.minecraft.block.Block twilightforest.block.TFBlocks.huge_stalk. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:huge_mushgloom for public static net.minecraft.block.Block twilightforest.block.TFBlocks.huge_mushgloom. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trollvidr for public static net.minecraft.block.Block twilightforest.block.TFBlocks.trollvidr. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:unripe_trollber for public static net.minecraft.block.Block twilightforest.block.TFBlocks.unripe_trollber. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trollber for public static net.minecraft.block.Block twilightforest.block.TFBlocks.trollber. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_block for public static net.minecraft.block.Block twilightforest.block.TFBlocks.knightmetal_block. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:huge_lilypad for public static net.minecraft.block.Block twilightforest.block.TFBlocks.huge_lilypad. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:huge_waterlily for public static net.minecraft.block.Block twilightforest.block.TFBlocks.huge_waterlily. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:slider for public static net.minecraft.block.Block twilightforest.block.TFBlocks.slider. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_brick for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_brick. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_stairs for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_pillar for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_pillar. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_rune_brick for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_rune_brick. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:force_field for public static net.minecraft.block.Block twilightforest.block.TFBlocks.force_field. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cinder_furnace for public static net.minecraft.block.Block twilightforest.block.TFBlocks.cinder_furnace. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cinder_furnace_lit for public static net.minecraft.block.Block twilightforest.block.TFBlocks.cinder_furnace_lit. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cinder_log for public static net.minecraft.block.Block twilightforest.block.TFBlocks.cinder_log. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_door for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_door. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_door_vanished for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_door_vanished. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:experiment_115 for public static net.minecraft.block.Block twilightforest.block.TFBlocks.experiment_115. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:miniature_structure for public static net.minecraft.block.Block twilightforest.block.TFBlocks.miniature_structure. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:block_storage for public static net.minecraft.block.Block twilightforest.block.TFBlocks.block_storage. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:spiral_bricks for public static net.minecraft.block.Block twilightforest.block.TFBlocks.spiral_bricks. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:etched_nagastone for public static net.minecraft.block.Block twilightforest.block.TFBlocks.etched_nagastone. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:nagastone_pillar for public static net.minecraft.block.Block twilightforest.block.TFBlocks.nagastone_pillar. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:nagastone_stairs for public static net.minecraft.block.Block twilightforest.block.TFBlocks.nagastone_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:etched_nagastone_mossy for public static net.minecraft.block.Block twilightforest.block.TFBlocks.etched_nagastone_mossy. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:nagastone_pillar_mossy for public static net.minecraft.block.Block twilightforest.block.TFBlocks.nagastone_pillar_mossy. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:nagastone_stairs_mossy for public static net.minecraft.block.Block twilightforest.block.TFBlocks.nagastone_stairs_mossy. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:etched_nagastone_weathered for public static net.minecraft.block.Block twilightforest.block.TFBlocks.etched_nagastone_weathered. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:nagastone_pillar_weathered for public static net.minecraft.block.Block twilightforest.block.TFBlocks.nagastone_pillar_weathered. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:nagastone_stairs_weathered for public static net.minecraft.block.Block twilightforest.block.TFBlocks.nagastone_stairs_weathered. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:auroralized_glass for public static net.minecraft.block.Block twilightforest.block.TFBlocks.auroralized_glass. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_stairs_brick for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_stairs_brick. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_stairs_cracked for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_stairs_cracked. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_stairs_worn for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_stairs_worn. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_stairs_mossy for public static net.minecraft.block.Block twilightforest.block.TFBlocks.castle_stairs_mossy. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:iron_ladder for public static twilightforest.block.BlockTFLadderBars twilightforest.block.TFBlocks.iron_ladder. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:terrorcotta_circle for public static net.minecraft.block.Block twilightforest.block.TFBlocks.terrorcotta_circle. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:terrorcotta_diagonal for public static net.minecraft.block.Block twilightforest.block.TFBlocks.terrorcotta_diagonal. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:stone_twist for public static net.minecraft.block.Block twilightforest.block.TFBlocks.stone_twist. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:stone_twist_thin for public static net.minecraft.block.Block twilightforest.block.TFBlocks.stone_twist_thin. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.twilight_oak_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.twilight_oak_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.twilight_oak_doubleslab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.twilight_oak_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.twilight_oak_button. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.twilight_oak_fence. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.twilight_oak_gate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_oak_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.twilight_oak_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.canopy_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.canopy_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.canopy_doubleslab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.canopy_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.canopy_button. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.canopy_fence. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.canopy_gate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:canopy_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.canopy_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.mangrove_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.mangrove_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.mangrove_doubleslab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.mangrove_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.mangrove_button. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.mangrove_fence. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.mangrove_gate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mangrove_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.mangrove_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.dark_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.dark_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.dark_doubleslab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.dark_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.dark_button. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.dark_fence. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.dark_gate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.dark_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.time_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.time_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.time_doubleslab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.time_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.time_button. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.time_fence. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.time_gate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:time_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.time_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.trans_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.trans_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.trans_doubleslab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.trans_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.trans_button. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.trans_fence. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.trans_gate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trans_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.trans_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.mine_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.mine_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.mine_doubleslab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.mine_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.mine_button. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.mine_fence. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.mine_gate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mine_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.mine_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_planks for public static twilightforest.block.BlockTF twilightforest.block.TFBlocks.sort_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_stairs for public static twilightforest.block.BlockTFStairs twilightforest.block.TFBlocks.sort_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_doubleslab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.sort_doubleslab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_slab for public static twilightforest.block.BlockTFSlab twilightforest.block.TFBlocks.sort_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_button for public static twilightforest.block.BlockTFButtonWood twilightforest.block.TFBlocks.sort_button. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_fence for public static twilightforest.block.BlockTFFence twilightforest.block.TFBlocks.sort_fence. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_gate for public static twilightforest.block.BlockTFFenceGate twilightforest.block.TFBlocks.sort_gate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:sort_plate for public static twilightforest.block.BlockTFPressurePlate twilightforest.block.TFBlocks.sort_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup atum:pharaoh_spawn for public static net.minecraft.util.SoundEvent com.teammetallurgy.atum.init.AtumSounds.PHARAOH_SPAWN. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:aechor_petal for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aechor_petal. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:aerwhale_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aerwhale_music_disc. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_saddle for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.aether_saddle. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:antitoxin_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.antitoxin_vial. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:antivenom_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.antivenom_vial. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_chunk for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ambrosium_chunk. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_shard for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ambrosium_shard. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_crossbow. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_door_item. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_gloves. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shears for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shears. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shield. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_strip for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_strip. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.arkenium_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:bandage for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.bandage. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.blueberries. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberry_lollipop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.blueberry_lollipop. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:bolt for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.bolt. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_cane for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_cane. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_grass for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_grass. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_rope for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.brettl_rope. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_gloves. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_pelt_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_pelt_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_rib_cut for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_rib_cut. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:burrukai_ribs for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.burrukai_ribs. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.candy_cane. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_corn for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.candy_corn. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloud_parachute for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cloud_parachute. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudtwine for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cloudtwine. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:cockatrice_feather for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cockatrice_feather. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:cocoatrice for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.cocoatrice. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_shard for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.crude_scatterglass_shard. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:dart for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.dart. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:dart_shooter for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.dart_shooter. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:eggnog for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.eggnog. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:enchanted_blueberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.enchanted_blueberry. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:enchanted_wyndberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.enchanted_wyndberry. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:fried_moa_egg for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.fried_moa_egg. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:ginger_bread_man for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.ginger_bread_man. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:golden_amber for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.golden_amber. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_crossbow. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_gloves. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_plate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_shield. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.gravitite_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:healing_stone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.healing_stone. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:healing_stone_depleted for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.healing_stone_depleted. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_crossbow. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_shield. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.holystone_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.icestone. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_poprocks for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.icestone_poprocks. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_armor for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_armor. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_charm for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_charm. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_chunk for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_chunk. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_dust for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_dust. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_neckwear for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_neckwear. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_ring for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_ring. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_tool for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.irradiated_tool. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:jelly_plumproot for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.jelly_plumproot. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:kirrid_cutlet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.kirrid_cutlet. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:kirrid_loin for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.kirrid_loin. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:labyrinth_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.labyrinth_music_disc. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_egg_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_egg_item. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feather for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feather. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed_blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed_blueberries. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_feed_enchanted_blueberries for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_feed_enchanted_blueberries. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.moa_music_disc. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.orange. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange_lollipop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.orange_lollipop. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot_mash for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.plumproot_mash. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot_pie for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.plumproot_pie. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:rainbow_moa_egg for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.rainbow_moa_egg. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:raw_taegore_meat for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.raw_taegore_meat. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:recording_892 for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.recording_892. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.scatterglass_vial. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.secret_skyroot_door_item. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:shard_of_life for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.shard_of_life. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bed_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_bed_item. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_bucket. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_crossbow. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_door_item for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_door_item. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_lizard_stick for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_lizard_stick. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_lizard_stick_roasted for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_lizard_stick_roasted. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_milk_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_milk_bucket. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pinecone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_pinecone. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_poison_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_poison_bucket. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_shield. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sign for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_sign. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_stick for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_stick. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_water_bucket for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.skyroot_water_bucket. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:splint for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.splint. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:stomper_pop for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.stomper_pop. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_gel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_gel. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_jelly for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_jelly. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:swet_sugar for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.swet_sugar. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_gloves. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_hide_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_hide_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:taegore_steak for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.taegore_steak. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_music_disc for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_music_disc. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_tea for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_tea. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_wings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.valkyrie_wings. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:water_vial for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.water_vial. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:winter_hat for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.winter_hat. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:wrapped_chocolates for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wrapped_chocolates. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:wrapping_paper for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wrapping_paper. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:wyndberry for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.wyndberry. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:yule_log for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.yule_log. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_axe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_boots for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_chestplate for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_crossbow for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_crossbow. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_gemstone for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_gemstone. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_gloves for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_gloves. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_helmet for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_leggings for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_pickaxe for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_shield for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_shield. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_shovel for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_sword for public static net.minecraft.item.Item com.gildedgames.aether.api.registrar.ItemsAether.zanite_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup outfox:fox for public static net.minecraftforge.fml.common.registry.EntityEntry kais.outfox.Outfox$Entities.FOX. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_iron for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_iron. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_diamond for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_diamond. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup chisel:chisel_hitech for public static team.chisel.common.item.ItemChisel team.chisel.common.init.ChiselItems.chisel_hitech. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup chisel:offsettool for public static team.chisel.common.item.ItemOffsetTool team.chisel.common.init.ChiselItems.offsettool. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_door for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.SHADOWROOT_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_door for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.DARK_WILLOW_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_door for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.DEAD_WOOD_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_door for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NIGHTSHROOM_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_door for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.DEWSHROOM_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_door for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.VIRIDSHROOM_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_door for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.TENEBRUM_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bogshroom_powder for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.BOGSHROOM_POWDER. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_powder for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NIGHTSHROOM_POWDER. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_powder for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.DEWSHROOM_POWDER. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_powder for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.VIRIDSHROOM_POWDER. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:geode for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.GEODE. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_pearl for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.DARK_PEARL. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_stick for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.DARK_STICK. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_clump for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.ROCKSHROOM_CLUMP. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_ingot for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.TENEBRUM_INGOT. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_nugget for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.TENEBRUM_NUGGET. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nagrilite_ingot for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NAGRILITE_INGOT. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nagrilite_nugget for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NAGRILITE_NUGGET. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:ebonys for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.EBONYS. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:archaic_shard for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.ARCHAIC_SHARD. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bladeshroom_cap for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.BLADESHROOM_CAP. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bladeshroom_spores for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.BLADESHROOM_SPORES. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:raw_suavis for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.RAW_SUAVIS. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:cook_suavis for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.COOK_SUAVIS. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:deceitful_snapper for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.DECEITFUL_SNAPPER. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:raw_stag_flank for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.RAW_STAG_FLANK. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:cook_stag_flank for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.COOK_STAG_FLANK. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:cook_stinger_egg for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.COOK_STINGER_EGG. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:hunter_wing for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.HUNTER_WING. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:cook_hunter_wing for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.COOK_HUNTER_WING. This means the object wasn't registered. It's likely just mod options.
[15:09:44] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bulb_fungus_hand for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.BULB_FUNGUS_HAND. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:unstable_seeds for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.UNSTABLE_SEEDS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:unstable_fruit_blue for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.UNSTABLE_FRUIT_BLUE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:unstable_fruit_lime for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.UNSTABLE_FRUIT_LIME. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:unstable_fruit_green for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.UNSTABLE_FRUIT_GREEN. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:spore_bomb for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.SPORE_BOMB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_pickaxe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.SHADOWROOT_PICKAXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_pickaxe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NIGHTSTONE_PICKAXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:ebonys_pickaxe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.EBONYS_PICKAXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nagrilite_pickaxe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NAGRILITE_PICKAXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_pickaxe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.TENEBRUM_PICKAXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_shovel for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.SHADOWROOT_SHOVEL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_shovel for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NIGHTSTONE_SHOVEL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:ebonys_shovel for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.EBONYS_SHOVEL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nagrilite_shovel for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NAGRILITE_SHOVEL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_shovel for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.TENEBRUM_SHOVEL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_axe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.SHADOWROOT_AXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_axe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NIGHTSTONE_AXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:ebonys_axe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.EBONYS_AXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nagrilite_axe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NAGRILITE_AXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_axe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.TENEBRUM_AXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_hoe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.SHADOWROOT_HOE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_hoe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NIGHTSTONE_HOE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:ebonys_hoe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.EBONYS_HOE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nagrilite_hoe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NAGRILITE_HOE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_hoe for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.TENEBRUM_HOE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_sword for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.SHADOWROOT_SWORD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_sword for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NIGHTSTONE_SWORD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:ebonys_sword for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.EBONYS_SWORD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nagrilite_sword for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.NAGRILITE_SWORD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_sword for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.TENEBRUM_SWORD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_helmet for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.ROCKSHROOM_HELMET. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_chestplate for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.ROCKSHROOM_CHESTPLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_leggings for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.ROCKSHROOM_LEGGINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_boots for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.ROCKSHROOM_BOOTS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_helmet for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.TENEBRUM_HELMET. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_chestplate for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.TENEBRUM_CHESTPLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_leggings for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.TENEBRUM_LEGGINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_boots for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.TENEBRUM_BOOTS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_shield for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.ROCKSHROOM_SHIELD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:advancement_snapper for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.ADVANCEMENT_SNAPPER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:advancement_highness for public static net.minecraft.item.Item com.mushroom.midnight.common.registry.ModItems.ADVANCEMENT_HIGHNESS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:dust_bone_stick for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DUST_BONE_STICK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:khnumite for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.KHNUMITE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:dirty_coin for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DIRTY_COIN. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:gold_coin for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.GOLD_COIN. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:efreet_heart for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.EFREET_HEART. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:scarab for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.SCARAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:idol_of_labor for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.IDOL_OF_LABOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:fertile_soil_pile for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.FERTILE_SOIL_PILE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:short_bow for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.SHORT_BOW. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_shovel for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.LIMESTONE_SHOVEL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_pickaxe for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.LIMESTONE_PICKAXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_axe for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.LIMESTONE_AXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_sword for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.LIMESTONE_SWORD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_hoe for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.LIMESTONE_HOE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:dagger_iron for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DAGGER_IRON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:poison_dagger for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.POISON_DAGGER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:scimitar_iron for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.SCIMITAR_IRON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:greatsword_iron for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.GREATSWORD_IRON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:club_iron for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.CLUB_IRON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:khopesh_iron for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.KHOPESH_IRON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:stoneguard_sword for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.STONEGUARD_SWORD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:stoneguard_greatsword for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.STONEGUARD_GREATSWORD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:stoneguard_club for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.STONEGUARD_CLUB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:stoneguard_khopesh for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.STONEGUARD_KHOPESH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:stoneguard_shield for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.STONEGUARD_SHIELD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:brigand_shield for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.BRIGAND_SHIELD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:eyes_of_atum for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.EYES_OF_ATUM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:body_of_atum for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.BODY_OF_ATUM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:legs_of_atum for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.LEGS_OF_ATUM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:feet_of_atum for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.FEET_OF_ATUM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:atums_will for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.ATUMS_WILL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:atums_protection for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.ATUMS_PROTECTION. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:atums_bounty for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.ATUMS_BOUNTY. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:atums_homecoming for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.ATUMS_HOMECOMING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:halo_of_ra for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.HALO_OF_RA. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:body_of_ra for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.BODY_OF_RA. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:legs_of_ra for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.LEGS_OF_RA. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:feet_of_ra for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.FEET_OF_RA. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:ras_fury for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.RAS_FURY. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:ptahs_decadence for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.PTAHS_DECADENCE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:ptahs_undoing for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.PTAHS_UNDOING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:gebs_toil for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.GEBS_TOIL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:gebs_grounding for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.GEBS_GROUNDING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:gebs_might for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.GEBS_MIGHT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:tefnuts_rain for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.TEFNUTS_RAIN. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:tefnuts_call for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.TEFNUTS_CALL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:tefnuts_blessing for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.TEFNUTS_BLESSING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:shus_breath for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.SHUS_BREATH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:shus_exile for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.SHUS_EXILE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:shus_swiftness for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.SHUS_SWIFTNESS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:horuss_soaring for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.HORUSS_SOARING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:horuss_ascension for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.HORUSS_ASCENSION. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:seths_sting for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.SETHS_STING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:seths_venom for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.SETHS_VENOM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:isis_healing for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.ISIS_HEALING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:montus_blast for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.MONTUS_BLAST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:montus_strike for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.MONTUS_STRIKE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:thoths_bearings for public static com.teammetallurgy.atum.items.artifacts.thoth.ItemThothsBearings com.teammetallurgy.atum.init.AtumItems.THOTHS_BEARINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:thoths_direction for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.THOTHS_DIRECTION. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:anubis_mercy for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.ANUBIS_MERCY. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:anubis_wrath for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.ANUBIS_WRATH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:nuits_vanishing for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.NUITS_VANISHING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:nuits_duality for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.NUITS_DUALITY. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:nuits_ire for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.NUITS_IRE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:nuits_quarter for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.NUITS_QUARTER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:anputs_hunger for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.ANPUTS_HUNGER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:mummy_helmet for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.MUMMY_HELMET. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:mummy_chest for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.MUMMY_CHEST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:mummy_legs for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.MUMMY_LEGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:mummy_boots for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.MUMMY_BOOTS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:wanderer_helmet for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.WANDERER_HELMET. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:wanderer_chest for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.WANDERER_CHEST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:wanderer_legs for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.WANDERER_LEGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:wanderer_boots for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.WANDERER_BOOTS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_helmet_iron for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_HELMET_IRON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_chest_iron for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_CHEST_IRON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_legs_iron for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_LEGS_IRON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_boots_iron for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_BOOTS_IRON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_helmet_gold for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_HELMET_GOLD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_chest_gold for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_CHEST_GOLD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_legs_gold for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_LEGS_GOLD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_boots_gold for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_BOOTS_GOLD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_helmet_diamond for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_HELMET_DIAMOND. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_chest_diamond for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_CHEST_DIAMOND. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_legs_diamond for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_LEGS_DIAMOND. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_boots_diamond for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_BOOTS_DIAMOND. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:papyrus_plant for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.PAPYRUS_PLANT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_wolf_iron_armor for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_WOLF_IRON_ARMOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_wolf_gold_armor for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_WOLF_GOLD_ARMOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:desert_wolf_diamond_armor for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DESERT_WOLF_DIAMOND_ARMOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:camel_iron_armor for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.CAMEL_IRON_ARMOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:camel_gold_armor for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.CAMEL_GOLD_ARMOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:camel_diamond_armor for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.CAMEL_DIAMOND_ARMOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:graverobbers_map for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.GRAVEROBBERS_MAP. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:disenchanting_scroll for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DISENCHANTING_SCROLL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:scroll for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.SCROLL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:scrap for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.SCRAP. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:linen_bandage for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.LINEN_BANDAGE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:linen_thread for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.LINEN_THREAD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:linen_cloth for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.LINEN_CLOTH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:dye_black for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DYE_BLACK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:dye_brown for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DYE_BROWN. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:flax_seeds for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.FLAX_SEEDS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:flax for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.FLAX. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:ophidian_tongue_flower for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.OPHIDIAN_TONGUE_FLOWER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:emmer_seeds for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.EMMER_SEEDS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:anputs_fingers_spores for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.ANPUTS_FINGERS_SPORES. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:emmer for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.EMMER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:emmer_flour for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.EMMER_FLOUR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:emmer_dough for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.EMMER_DOUGH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:emmer_bread for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.EMMER_BREAD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:camel_raw for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.CAMEL_RAW. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:camel_cooked for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.CAMEL_COOKED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:date for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:glistering_date for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.GLISTERING_DATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:golden_date for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.GOLDEN_DATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:enchanted_golden_date for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.ENCHANTED_GOLDEN_DATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:ectoplasm for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.ECTOPLASM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:mandibles for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.MANDIBLES. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:dusty_bone for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.DUSTY_BONE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:wolf_pelt for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.WOLF_PELT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:forsaken_fish for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.FORSAKEN_FISH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:mummified_fish for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.MUMMIFIED_FISH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:jeweled_fish for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.JEWELED_FISH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:skeletal_fish for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.SKELETAL_FISH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:crunchy_scarab for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.CRUNCHY_SCARAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:crunchy_gold_scarab for public static net.minecraft.item.Item com.teammetallurgy.atum.init.AtumItems.CRUNCHY_GOLD_SCARAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:fairy_dust for public static net.minecraft.item.Item me.paulf.wings.server.item.WingsItems.FAIRY_DUST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:amethyst for public static net.minecraft.item.Item me.paulf.wings.server.item.WingsItems.AMETHYST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:bat_blood for public static net.minecraft.item.Item me.paulf.wings.server.item.WingsItems.BAT_BLOOD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:angel_wings for public static net.minecraft.item.Item me.paulf.wings.server.item.WingsItems.ANGEL_WINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:slime_wings for public static net.minecraft.item.Item me.paulf.wings.server.item.WingsItems.SLIME_WINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:blue_butterfly_wings for public static net.minecraft.item.Item me.paulf.wings.server.item.WingsItems.BLUE_BUTTERFLY_WINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:monarch_butterfly_wings for public static net.minecraft.item.Item me.paulf.wings.server.item.WingsItems.MONARCH_BUTTERFLY_WINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:fire_wings for public static net.minecraft.item.Item me.paulf.wings.server.item.WingsItems.FIRE_WINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:bat_wings for public static net.minecraft.item.Item me.paulf.wings.server.item.WingsItems.BAT_WINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:fairy_wings for public static net.minecraft.item.Item me.paulf.wings.server.item.WingsItems.FAIRY_WINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:evil_wings for public static net.minecraft.item.Item me.paulf.wings.server.item.WingsItems.EVIL_WINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:dragon_wings for public static net.minecraft.item.Item me.paulf.wings.server.item.WingsItems.DRAGON_WINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:light for public static com.pau101.fairylights.server.item.ItemLight com.pau101.fairylights.server.item.FLItems.LIGHT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:hanging_lights for public static com.pau101.fairylights.server.item.ItemConnection com.pau101.fairylights.server.item.FLItems.HANGING_LIGHTS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:garland for public static com.pau101.fairylights.server.item.ItemConnection com.pau101.fairylights.server.item.FLItems.GARLAND. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:tinsel for public static com.pau101.fairylights.server.item.ItemConnection com.pau101.fairylights.server.item.FLItems.TINSEL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:pennant_bunting for public static com.pau101.fairylights.server.item.ItemConnection com.pau101.fairylights.server.item.FLItems.PENNANT_BUNTING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:letter_bunting for public static com.pau101.fairylights.server.item.ItemConnection com.pau101.fairylights.server.item.FLItems.LETTER_BUNTING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:pennant for public static net.minecraft.item.Item com.pau101.fairylights.server.item.FLItems.PENNANT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:ladder for public static net.minecraft.item.Item com.pau101.fairylights.server.item.FLItems.LADDER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_log for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_LOG. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_leaves for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_LEAVES. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_planks for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_PLANKS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_log for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEAD_WOOD_LOG. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_planks for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEAD_WOOD_PLANKS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_log for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_LOG. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_leaves for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_LEAVES. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_planks for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_PLANKS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSTONE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_bricks for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSTONE_BRICKS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:chiseled_nightstone_bricks for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.CHISELED_NIGHTSTONE_BRICKS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:trenchstone for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TRENCHSTONE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:trenchstone_bricks for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TRENCHSTONE_BRICKS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_pearl_ore for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_PEARL_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_pearl_block for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_PEARL_BLOCK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_ore for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TENEBRUM_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_block for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TENEBRUM_BLOCK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nagrilite_ore for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NAGRILITE_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nagrilite_block for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NAGRILITE_BLOCK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:ebonys_ore for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.EBONYS_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:ebonys_block for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.EBONYS_BLOCK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:archaic_ore for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ARCHAIC_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_crafting_table for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_chest for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_CHEST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:midnight_furnace for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.MIDNIGHT_FURNACE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:midnight_furnace_lit for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.MIDNIGHT_FURNACE_LIT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:midnight_coarse_dirt for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.MIDNIGHT_COARSE_DIRT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:midnight_dirt for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.MIDNIGHT_DIRT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:midnight_grass for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.MIDNIGHT_GRASS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:midnight_mycelium for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.MIDNIGHT_MYCELIUM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tall_midnight_grass for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TALL_MIDNIGHT_GRASS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:double_midnight_grass for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DOUBLE_MIDNIGHT_GRASS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:double_nightshroom for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DOUBLE_NIGHTSHROOM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_shelf for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_SHELF. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:double_dewshroom for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DOUBLE_DEWSHROOM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_shelf for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_SHELF. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_planks for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_PLANKS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:double_viridshroom for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DOUBLE_VIRIDSHROOM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_shelf for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_SHELF. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_planks for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_PLANKS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_stem for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_STEM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_hat for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_HAT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_stem for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_STEM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_hat for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_HAT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_planks for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_PLANKS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_stem for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_STEM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_hat for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_HAT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bogshroom for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.BOGSHROOM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:double_bogshroom for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DOUBLE_BOGSHROOM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bogshroom_shelf for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.BOGSHROOM_SHELF. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bogshroom_stem for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.BOGSHROOM_STEM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bogshroom_hat for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.BOGSHROOM_HAT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bulb_fungus for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.BULB_FUNGUS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bulb_fungus_stem for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.BULB_FUNGUS_STEM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bulb_fungus_hat for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.BULB_FUNGUS_HAT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ROCKSHROOM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_bricks for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ROCKSHROOM_BRICKS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:lumen_bud for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.LUMEN_BUD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:double_lumen_bud for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DOUBLE_LUMEN_BUD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bladeshroom for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.BLADESHROOM. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bogweed for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.BOGWEED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:ghost_plant for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.GHOST_PLANT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:fingered_grass for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.FINGERED_GRASS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tendrilweed for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TENDRILWEED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:runebush for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.RUNEBUSH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dragon_nest for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DRAGON_NEST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:violeaf for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIOLEAF. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:crystal_flower for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.CRYSTAL_FLOWER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_sapling for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_SAPLING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_sapling for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_SAPLING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_door for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_door for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEAD_WOOD_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_door for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_door for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TENEBRUM_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_door for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_door for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_door for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_trapdoor for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_TRAPDOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_trapdoor for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEAD_WOOD_TRAPDOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_trapdoor for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_TRAPDOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_trapdoor for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TENEBRUM_TRAPDOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_trapdoor for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_TRAPDOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_trapdoor for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_TRAPDOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_trapdoor for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_TRAPDOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bloomcrystal for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.BLOOMCRYSTAL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bloomcrystal_rock for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.BLOOMCRYSTAL_ROCK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rouxe for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ROUXE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rouxe_rock for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ROUXE_ROCK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:archaic_glass for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ARCHAIC_GLASS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:archaic_glass_pane for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ARCHAIC_GLASS_PANE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:miasma_surface for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.MIASMA_SURFACE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:miasma for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.MIASMA. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_water for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WATER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:mushroom_inside for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.MUSHROOM_INSIDE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:deceitful_peat for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DECEITFUL_PEAT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:deceitful_mud for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DECEITFUL_MUD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:deceitful_algae for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DECEITFUL_ALGAE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:deceitful_moss for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DECEITFUL_MOSS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEAD_WOOD_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSTONE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_brick_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSTONE_BRICK_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:trenchstone_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TRENCHSTONE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:trenchstone_brick_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TRENCHSTONE_BRICK_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_bricks_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ROCKSHROOM_BRICKS_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_double_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_DOUBLE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_double_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEAD_WOOD_DOUBLE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_double_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_DOUBLE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_double_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSTONE_DOUBLE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_brick_double_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSTONE_BRICK_DOUBLE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:trenchstone_double_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TRENCHSTONE_DOUBLE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:trenchstone_brick_double_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TRENCHSTONE_BRICK_DOUBLE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_double_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_DOUBLE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_double_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_DOUBLE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_double_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_DOUBLE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_bricks_double_slab for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ROCKSHROOM_BRICKS_DOUBLE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_stairs for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_stairs for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEAD_WOOD_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_stairs for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_stairs for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSTONE_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_brick_stairs for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSTONE_BRICK_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:trenchstone_stairs for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TRENCHSTONE_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:trenchstone_brick_stairs for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TRENCHSTONE_BRICK_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_stairs for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_stairs for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_stairs for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_bricks_stairs for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ROCKSHROOM_BRICKS_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_fence for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_FENCE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_fence for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEAD_WOOD_FENCE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_fence for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_FENCE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_wall for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSTONE_WALL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_brick_wall for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSTONE_BRICK_WALL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:trenchstone_wall for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TRENCHSTONE_WALL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:trenchstone_brick_wall for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TRENCHSTONE_BRICK_WALL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_bricks_wall for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ROCKSHROOM_BRICKS_WALL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_fence for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_FENCE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_fence for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_FENCE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_fence for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_FENCE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_fence_gate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_FENCE_GATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_fence_gate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEAD_WOOD_FENCE_GATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_fence_gate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_FENCE_GATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_fence_gate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_FENCE_GATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_fence_gate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_FENCE_GATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_fence_gate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_FENCE_GATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:suavis for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SUAVIS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_ladder for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_LADDER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_ladder for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEAD_WOOD_LADDER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_ladder for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_LADDER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_ladder for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_LADDER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_ladder for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_LADDER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_ladder for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_LADDER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:stinger_egg for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.STINGER_EGG. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:unstable_bush for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.UNSTABLE_BUSH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:unstable_bush_blue_bloomed for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.UNSTABLE_BUSH_BLUE_BLOOMED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:unstable_bush_green_bloomed for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.UNSTABLE_BUSH_GREEN_BLOOMED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:unstable_bush_lime_bloomed for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.UNSTABLE_BUSH_LIME_BLOOMED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:bogshroom_sporch for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.BOGSHROOM_SPORCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_sporch for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_SPORCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_sporch for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_SPORCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_sporch for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_SPORCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:crystalotus for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.CRYSTALOTUS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_button for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_BUTTON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_button for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEAD_WOOD_BUTTON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_button for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_BUTTON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_button for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_BUTTON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_button for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_BUTTON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_button for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_BUTTON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_button for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSTONE_BUTTON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:trenchstone_button for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TRENCHSTONE_BUTTON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_bricks_button for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ROCKSHROOM_BRICKS_BUTTON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:shadowroot_pressure_plate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.SHADOWROOT_PRESSURE_PLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dead_wood_pressure_plate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEAD_WOOD_PRESSURE_PLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dark_willow_pressure_plate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DARK_WILLOW_PRESSURE_PLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dewshroom_pressure_plate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.DEWSHROOM_PRESSURE_PLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:viridshroom_pressure_plate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.VIRIDSHROOM_PRESSURE_PLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightshroom_pressure_plate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSHROOM_PRESSURE_PLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nightstone_pressure_plate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NIGHTSTONE_PRESSURE_PLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:trenchstone_pressure_plate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TRENCHSTONE_PRESSURE_PLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:rockshroom_bricks_pressure_plate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.ROCKSHROOM_BRICKS_PRESSURE_PLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:nagrilite_pressure_plate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.NAGRILITE_PRESSURE_PLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tenebrum_pressure_plate for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.TENEBRUM_PRESSURE_PLATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:midnight_lever for public static net.minecraft.block.Block com.mushroom.midnight.common.registry.ModBlocks.MIDNIGHT_LEVER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:portal for public static com.teammetallurgy.atum.blocks.BlockPortal com.teammetallurgy.atum.init.AtumBlocks.PORTAL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:chest_spawner for public static com.teammetallurgy.atum.blocks.stone.limestone.chest.BlockChestSpawner com.teammetallurgy.atum.init.AtumBlocks.CHEST_SPAWNER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:sand for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.SAND. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_gravel for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.LIMESTONE_GRAVEL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:marl for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.MARL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:khnumite_block for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.KHNUMITE_BLOCK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:khnumite_face for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.KHNUMITE_FACE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_cracked for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.LIMESTONE_CRACKED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.LIMESTONE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_wall for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.LIMESTONE_WALL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_cracked_wall for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.LIMESTONE_CRACKED_WALL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:alabaster for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.ALABASTER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:porphyry for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.PORPHYRY. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:ra_stone for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.RA_STONE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:smooth_stairs for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.SMOOTH_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:cracked_stairs for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.CRACKED_STAIRS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:smooth_limestone_slab for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.SMOOTH_LIMESTONE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:cracked_limestone_slab for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.CRACKED_LIMESTONE_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_door for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.LIMESTONE_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_cracked_door for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.LIMESTONE_CRACKED_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:sand_layered for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.SAND_LAYERED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:radiant_beacon for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.RADIANT_BEACON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:radiant_beacon_framed for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.RADIANT_BEACON_FRAMED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:crystal_glass for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.CRYSTAL_GLASS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:framed_glass for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.FRAMED_GLASS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:date_block for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.DATE_BLOCK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:emmer_wheat for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.EMMER_WHEAT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:anputs_fingers for public static com.teammetallurgy.atum.blocks.vegetation.BlockAnputsFingers com.teammetallurgy.atum.init.AtumBlocks.ANPUTS_FINGERS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:oasis_grass for public static com.teammetallurgy.atum.blocks.vegetation.BlockOasisGrass com.teammetallurgy.atum.init.AtumBlocks.OASIS_GRASS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:dead_grass for public static com.teammetallurgy.atum.blocks.vegetation.BlockDeadGrass com.teammetallurgy.atum.init.AtumBlocks.DEAD_GRASS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:shrub for public static com.teammetallurgy.atum.blocks.vegetation.BlockShrub com.teammetallurgy.atum.init.AtumBlocks.SHRUB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:weed for public static com.teammetallurgy.atum.blocks.vegetation.BlockShrub com.teammetallurgy.atum.init.AtumBlocks.WEED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:papyrus for public static com.teammetallurgy.atum.blocks.vegetation.BlockPapyrus com.teammetallurgy.atum.init.AtumBlocks.PAPYRUS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:ophidian_tongue for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.OPHIDIAN_TONGUE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:flax for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.FLAX. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:fertile_soil for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.FERTILE_SOIL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:fertile_soil_tilled for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.FERTILE_SOIL_TILLED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:palm_door for public static com.teammetallurgy.atum.blocks.base.BlockAtumDoor com.teammetallurgy.atum.init.AtumBlocks.PALM_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:palm_fence for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.PALM_FENCE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:palm_fence_gate for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.PALM_FENCE_GATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:palm_hatch for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.PALM_HATCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:palm_ladder for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.PALM_LADDER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:thin_crystal_glass for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.THIN_CRYSTAL_GLASS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:thin_framed_glass for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.THIN_FRAMED_GLASS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:palm_log for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.PALM_LOG. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:deadwood_log for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.DEADWOOD_LOG. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:deadwood_branch for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.DEADWOOD_BRANCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:palm_torch for public static com.teammetallurgy.atum.blocks.wood.BlockAtumTorch com.teammetallurgy.atum.init.AtumBlocks.PALM_TORCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:deadwood_torch for public static com.teammetallurgy.atum.blocks.wood.BlockAtumTorch com.teammetallurgy.atum.init.AtumBlocks.DEADWOOD_TORCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_torch for public static com.teammetallurgy.atum.blocks.wood.BlockAtumTorch com.teammetallurgy.atum.init.AtumBlocks.LIMESTONE_TORCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:bone_torch for public static com.teammetallurgy.atum.blocks.wood.BlockAtumTorch com.teammetallurgy.atum.init.AtumBlocks.BONE_TORCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:pharaoh_torch for public static com.teammetallurgy.atum.blocks.wood.BlockAtumTorch com.teammetallurgy.atum.init.AtumBlocks.PHARAOH_TORCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:quern for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.QUERN. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:spinning_wheel for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.SPINNING_WHEEL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:kiln for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.KILN. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:kiln_fake for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.KILN_FAKE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:burning_trap for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.BURNING_TRAP. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:poison_trap for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.POISON_TRAP. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:tar_trap for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.TAR_TRAP. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:smoke_trap for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.SMOKE_TRAP. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:arrow_trap for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.ARROW_TRAP. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:sarcophagus for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.SARCOPHAGUS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_chest for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.LIMESTONE_CHEST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:gold_ore for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.GOLD_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:iron_ore for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.IRON_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:coal_ore for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.COAL_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:lapis_ore for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.LAPIS_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:emerald_ore for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.EMERALD_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:diamond_ore for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.DIAMOND_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:redstone_ore for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.REDSTONE_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:lit_redstone_ore for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.LIT_REDSTONE_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:bone_ore for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.BONE_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:relic_ore for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.RELIC_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:khnumite_raw for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.KHNUMITE_RAW. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:bone_dirty for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.BONE_DIRTY. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:bone_dirty_slab for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.BONE_DIRTY_SLAB. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:bone_ladder for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.BONE_LADDER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_furnace for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.LIMESTONE_FURNACE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:limestone_furnace_lit for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.LIMESTONE_FURNACE_LIT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:deadwood_door for public static com.teammetallurgy.atum.blocks.base.BlockAtumDoor com.teammetallurgy.atum.init.AtumBlocks.DEADWOOD_DOOR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:deadwood_fence for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.DEADWOOD_FENCE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:deadwood_fence_gate for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.DEADWOOD_FENCE_GATE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:deadwood_hatch for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.DEADWOOD_HATCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:deadwood_ladder for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.DEADWOOD_LADDER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup atum:heart_of_ra for public static net.minecraft.block.Block com.teammetallurgy.atum.init.AtumBlocks.HEART_OF_RA. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:fastener for public static com.pau101.fairylights.server.block.BlockFastener com.pau101.fairylights.server.block.FLBlocks.FASTENER. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:stunned for public static net.minecraft.potion.Potion com.mushroom.midnight.common.registry.ModEffects.STUNNED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:pollinated for public static net.minecraft.potion.Potion com.mushroom.midnight.common.registry.ModEffects.POLLINATED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:dragon_guard for public static net.minecraft.potion.Potion com.mushroom.midnight.common.registry.ModEffects.DRAGON_GUARD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:darkness for public static net.minecraft.potion.Potion com.mushroom.midnight.common.registry.ModEffects.DARKNESS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:tormented for public static net.minecraft.potion.Potion com.mushroom.midnight.common.registry.ModEffects.TORMENTED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:unstable_fall for public static net.minecraft.potion.Potion com.mushroom.midnight.common.registry.ModEffects.UNSTABLE_FALL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:confusion for public static net.minecraft.potion.Potion com.mushroom.midnight.common.registry.ModEffects.CONFUSION. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aercloud for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aercloud. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_crafting_table for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_crafting_table. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_dirt for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_dirt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_flower for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_flower. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_grass. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_portal for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_portal. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_teleporter for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.aether_teleporter. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_brick_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_pillar. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:agiosite_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.agiosite_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:altar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.altar. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:amberoot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.amberoot_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ambrosium_ore. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:ambrosium_torch for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ambrosium_torch. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:arctic_spikespring for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.arctic_spikespring. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_door for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.arkenium_door. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:arkenium_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.arkenium_ore. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:barkshroom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.barkshroom. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_dark_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_dark_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_light_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_light_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:blue_swingtip for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blue_swingtip. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:blueberry_bush for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.blueberry_bush. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:brettl_plant for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.brettl_plant. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.candy_cane_block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:candy_cane_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.candy_cane_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudwool_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.cloudwool_block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:cloudwool_carpet for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.cloudwool_carpet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_pane for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass_pane. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:crude_scatterglass_pane_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.crude_scatterglass_pane_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_blue_dark_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_blue_dark_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_blue_light_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_blue_light_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_blue_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_blue_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_beam. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_log. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:dark_skyroot_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.dark_skyroot_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_pillar. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:faded_holystone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.faded_holystone_brick_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:ferrosite for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ferrosite. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:ferrosite_sand for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.ferrosite_sand. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:forgotten_rose for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.forgotten_rose. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:golden_oak_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.golden_oak_log. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.gravitite_block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:gravitite_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.gravitite_ore. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_button. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_fence. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_fence_gate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_log_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_pressure_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_sapling. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:greatroot_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.greatroot_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_dark_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_dark_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_light_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_light_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_skyroot_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_skyroot_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:green_swingtip for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.green_swingtip. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_brick_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_lantern for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_lantern. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:hellfirestone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.hellfirestone_pillar. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_bush for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_bush. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_ice for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_ice. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_ice_crystal for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_ice_crystal. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_packed_ice for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_packed_ice. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_snow for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_snow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_snow_layer for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_snow_layer. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:highlands_tulips for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.highlands_tulips. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_bookshelf for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_bookshelf. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_brick_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_button. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_furnace for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_furnace. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_pillar. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_pressure_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_rock for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_rock. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:holystone_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.holystone_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_bricks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_bricks. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_bricks_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_bricks_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_cooler for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_cooler. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_ore. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_pillar. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:icestone_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.icestone_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:incubator for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.incubator. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:irradiated_flower for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.irradiated_flower. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_beam. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_log. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:light_skyroot_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.light_skyroot_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:magnetic_shroom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.magnetic_shroom. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:masonry_bench for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.masonry_bench. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:moa_egg for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.moa_egg. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mossy_holystone_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mossy_holystone_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mossy_holystone_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mossy_holystone_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mossy_holystone_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mossy_holystone_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:multiblock_dummy for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.multiblock_dummy. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:multiblock_dummy_half for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.multiblock_dummy_half. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mutant_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mutant_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mutant_leaves_decorated for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.mutant_leaves_decorated. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:neverbloom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.neverbloom. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:orange_tree for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.orange_tree. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:outpost_campfire for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.outpost_campfire. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:pink_swingtip for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.pink_swingtip. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:plumproot for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.plumproot. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:present for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.present. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:quickshoot for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quickshoot. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass_pane for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass_pane. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:quicksoil_glass_pane_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.quicksoil_glass_pane_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:rusted_ferrosite for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.rusted_ferrosite. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_pane for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_pane. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_pane_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_pane_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:scatterglass_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.scatterglass_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_door for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.secret_skyroot_door. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:secret_skyroot_trapdoor for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.secret_skyroot_trapdoor. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_decorative_lit for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_decorative_lit. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_brick_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_pillar. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:sentrystone_pillar_lit for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.sentrystone_pillar_lit. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_beam. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bed for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_bed. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_bookshelf for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_bookshelf. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_button. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_chest for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_chest. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_door for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_door. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_fence. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_fence_gate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_ladder for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_ladder. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_log. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_log_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_pressure_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_sapling. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_trapdoor for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_trapdoor. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:skyroot_twigs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.skyroot_twigs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:standing_skyroot_sign for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.standing_skyroot_sign. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:stoneshroom for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.stoneshroom. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:tall_aether_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.tall_aether_grass. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:thera_dirt for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.thera_dirt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:thera_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.thera_grass. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_brick_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_brick_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therastone_pillar for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therastone_pillar. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_beam for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_beam. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_decorative for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_decorative. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_fence. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_fence_gate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_leaves for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_leaves. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_log for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_log. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_log_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_planks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:therawood_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.therawood_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:unique_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.unique_sapling. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:valkyrie_grass for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.valkyrie_grass. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:wall_skyroot_sign for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wall_skyroot_sign. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:wildcard for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wildcard. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_button for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_button. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_fence for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_fence. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_fence_gate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_fence_gate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_log_wall for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_log_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_pressure_plate for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_pressure_plate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_sapling for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_sapling. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_slab for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:wisproot_stairs for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.wisproot_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:woven_sticks for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.woven_sticks. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_block for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.zanite_block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:zanite_ore for public static net.minecraft.block.Block com.gildedgames.aether.api.registrar.BlocksAether.zanite_ore. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:closed_cavern for public static com.mushroom.midnight.common.biome.cavern.CavernousBiome com.mushroom.midnight.common.registry.ModCavernousBiomes.CLOSED_CAVERN. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:great_cavern for public static com.mushroom.midnight.common.biome.cavern.CavernousBiome com.mushroom.midnight.common.registry.ModCavernousBiomes.GREAT_CAVERN. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:crystal_cavern for public static com.mushroom.midnight.common.biome.cavern.CavernousBiome com.mushroom.midnight.common.registry.ModCavernousBiomes.CRYSTAL_CAVERN. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:fungal_cavern for public static com.mushroom.midnight.common.biome.cavern.CavernousBiome com.mushroom.midnight.common.registry.ModCavernousBiomes.FUNGAL_CAVERN. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:viva_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.VIVA_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:milk_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.MILK_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:bow_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.BOW_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:gold_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.GOLD_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:diamond_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.DIAMOND_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:moon_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.MOON_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:spooky_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.SPOOKY_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:rainbow_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.RAINBOW_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:pink_mermaid_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.PINK_MERMAID_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:purple_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.PURPLE_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:white_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.WHITE_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:cyan_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.CYAN_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:pink_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.PINK_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:lime_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.LIME_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:magenta_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.MAGENTA_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:blue_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.BLUE_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:grey_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.GREY_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:red_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.RED_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:orange_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.ORANGE_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:yellow_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.YELLOW_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup customcraftingtables:ender_crafting_table for public static net.minecraft.block.Block com.ldshadowlady.customcraftingtables.registries.CustomCraftingTablesBlocks.ENDER_CRAFTING_TABLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:antiblock for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.antiblock. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:auto_chisel for public static team.chisel.common.block.BlockAutoChisel team.chisel.common.init.ChiselBlocks.auto_chisel. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:basalt for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.basalt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:basalt1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.basalt1. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:basalt2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.basalt2. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:block_charcoal2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.block_charcoal2. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bloodmagic for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bloodmagic. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_spruce for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_spruce. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_birch for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_birch. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_jungle for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_jungle. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_acacia for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_acacia. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:bookshelf_darkoak for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.bookshelf_darkoak. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:brownstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.brownstone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:carpet for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.carpet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:cloud for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.cloud. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_white for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_white. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_orange for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_orange. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_lightblue for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_lightblue. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_magenta for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_magenta. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_lime for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_lime. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_yellow for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_yellow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_pink for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_pink. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_gray for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_gray. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_lightgray for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_lightgray. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_blue for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_blue. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_cyan for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_cyan. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_purple for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_purple. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_green for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_green. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_brown for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_brown. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_red for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_red. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_black for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_black. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:concrete_powder for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.concrete_powder. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:dirt for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.dirt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:factory for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.factory. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:futura for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.futura. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:glowstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.glowstone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:glowstone1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.glowstone1. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:glowstone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.glowstone2. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:laboratory for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.laboratory. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:lavastone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.lavastone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:lavastone1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.lavastone1. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:lavastone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.lavastone2. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:limestone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.limestone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:limestone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.limestone2. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:marble for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.marble. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:marble2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.marble2. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:netherrack for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.netherrack. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:paper for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.paper. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:temple for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.temple. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:tyrian for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.tyrian. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:valentines for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.valentines. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:voidstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.voidstone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstone for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstone1 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstone1. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstone2 for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstone2. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup chisel:waterstoneextra for public static team.chisel.common.block.BlockCarvable team.chisel.common.init.ChiselBlocks.waterstoneextra. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:black_ridge for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.BLACK_RIDGE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:vigilant_forest for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.VIGILANT_FOREST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:deceitful_bog for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.DECEITFUL_BOG. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:fungi_forest for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.FUNGI_FOREST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:obscured_peaks for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.OBSCURED_PEAKS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:warped_fields for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.WARPED_FIELDS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:crystal_spires for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.CRYSTAL_SPIRES. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:night_plains for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.NIGHT_PLAINS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:obscured_plateau for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.OBSCURED_PLATEAU. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:phantasmal_valley for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.PHANTASMAL_VALLEY. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:runebush_grove for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.RUNEBUSH_GROVE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:hilly_vigilant_forest for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.HILLY_VIGILANT_FOREST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup midnight:hilly_fungi_forest for public static net.minecraft.world.biome.Biome com.mushroom.midnight.common.registry.ModSurfaceBiomes.HILLY_FUNGI_FOREST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:fairy_dust_ore for public static net.minecraft.block.Block me.paulf.wings.server.block.WingsBlocks.FAIRY_DUST_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:amethyst_ore for public static net.minecraft.block.Block me.paulf.wings.server.block.WingsBlocks.AMETHYST_ORE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_sword for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_ghoul_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DREAD_GHOUL_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:armor_shard_cluster for public static net.minecraft.item.Item twilightforest.item.TFItems.armor_shard_cluster. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_hoe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_hoe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_boots for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:darkbakingchocolate for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorDarkBakingChocolate.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cinnamonmunchkin for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCinnamonMunchkin.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:gooseberrycakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorGooseberryCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_adult_roar for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_ADULT_ROAR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:sakuramochi for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSakuraMochi.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_ring for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_ring. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_pickaxe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hippocampus_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.HIPPOCAMPUS_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_blood for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_blood. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.MYRMEX_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cherrydreamdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCherryDreamDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_fire_pickaxe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_fire_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:mob_skull for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumSkullType.skull_item. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:floopowder_one for public static net.minecraft.item.Item com.fredtargaryen.floocraft.FloocraftBase.floopowder1t. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:pixie_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.PIXIE_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:strawberrychocolatedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorStrawberryChocolateDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:taiyaki for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorTaiyaki.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_ice_block for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonsteel_ice_block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_staff for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_staff. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_pickaxe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_helmet for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.silver_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscale_white for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonscale_white. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.valkyrie for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_valkyrie. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_leggings for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cremechocolatedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCremeChocolateDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_shovel for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cremedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCremeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:raw_meef for public static net.minecraft.item.Item twilightforest.item.TFItems.raw_meef. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_egg for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_egg. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:feature.color_change for public static net.minecraft.util.SoundEvent com.pau101.fairylights.server.sound.FLSounds.FEATURE_COLOR_CHANGE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:shield_scepter for public static net.minecraft.item.Item twilightforest.item.TFItems.shield_scepter. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:pixie_taunt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.PIXIE_TAUNT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_giant_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DEATHWORM_GIANT_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscales_sapphire for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonscales_sapphire. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:pixie_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.PIXIE_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cube_talisman for public static net.minecraft.item.Item twilightforest.item.TFItems.cube_talisman. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:vanillachai for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorVanillaChai.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:lamp_of_cinders for public static net.minecraft.item.Item twilightforest.item.TFItems.lamp_of_cinders. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_giant_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DEATHWORM_GIANT_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hydra_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.HYDRA_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:tide_trident for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.tide_trident. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_adult_death for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_ADULT_DEATH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:omarkremedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorOmarKremeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscales_red for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonscales_red. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:gold_pile_step for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.GOLD_PILE_STEP. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:earthshakerpretzel for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorEarthShakerPretzel.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:eclair for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorEclair.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_clearing for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.clearing. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:item.wings.flying for public static net.minecraft.util.SoundEvent me.paulf.wings.server.sound.WingsSounds.ITEM_WINGS_FLYING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:saltedpretzel for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSaltedPretzel.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:strawberrycakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorStrawberryCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:chocolateraspberrydonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorChocolateRaspberryDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:chocolatefrosteddonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorChocolateFrostedDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_hurt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:finland100celebrationdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorFinland100CelebrationDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:ice_dragon_flesh for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.ice_dragon_flesh. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:troll_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.TROLL_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_hurt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:raspberrychocolatedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRaspberryChocolateDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_leggings for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.silver_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_bone_block for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragon_bone_block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonforge_fire_core for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonforge_fire_core_disabled. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:rumraisindonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRumRaisinDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_red_leggings for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_red_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:raven_feather for public static net.minecraft.item.Item twilightforest.item.TFItems.raven_feather. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hydra_heart for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.hydra_heart. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscale_bronze for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonscale_bronze. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_ambient. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:newyeardonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorNewYearDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:transformation_powder for public static net.minecraft.item.Item twilightforest.item.TFItems.transformation_powder. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hydra_fang for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.hydra_fang. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:cord.disconnect for public static net.minecraft.util.SoundEvent com.pau101.fairylights.server.sound.FLSounds.CORD_DISCONNECT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscale_red for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonscale_red. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_pickaxe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.silver_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_giant_attack for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DEATHWORM_GIANT_ATTACK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_fang for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.sea_serpent_fang. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscales_gray for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonscales_gray. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:gingercookie for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorGingerCookie.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:rubybakingchocolate for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRubyBakingChocolate.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.MYRMEX_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:vanillacakebatterdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorVanillaCakeBatterDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_map_focus for public static net.minecraft.item.Item twilightforest.item.TFItems.magic_map_focus. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:redbakinghatlegs for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRedBakingHat.legs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.SEA_SERPENT_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:naga_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.naga_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_fire_axe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_fire_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:troll_helmet for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumTroll.helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:block_storage for public static net.minecraft.item.Item twilightforest.item.TFItems.block_storage. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_red_boots for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_red_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:stollen for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorStollen.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:moonworm_queen for public static net.minecraft.item.Item twilightforest.item.TFItems.moonworm_queen. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dart_shooter.fire for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.dart_shooter_fire. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:bestiary_page for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.BESTIARY_PAGE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_bone_wall for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragon_bone_block_wall. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:birchswissroll for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBirchSwissRoll.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:frost_lily for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.frost_lily. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:frozen_dirt for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.frozenDirt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:armor_dragon_leggings for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumDragonArmor.leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonarmor_dragonsteel_fire for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_armor_dragonsteel_fire. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonbone_pickaxe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonbone_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:naga_attack for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.NAGA_ATTACK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ore_map_empty for public static net.minecraft.item.Item twilightforest.item.TFItems.ore_map_empty. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:coldbrew for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorColdBrew.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:bakeryspecialvanilladonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBakerySpecialVanillaDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:rawsaltedpretzel for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRawSaltedPretzel.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_ice for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragon_ice. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_ambient. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cinnamondonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCinnamonDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_helmet for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_death. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:lingonberrycakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorLingonberryCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:podium for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.podium. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:frost_stew for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.frost_stew. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_tears for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_tears. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:alpha_fur for public static net.minecraft.item.Item twilightforest.item.TFItems.alpha_fur. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.SEA_SERPENT_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:meringuetoffeedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorMeringueToffeeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:glutenfreedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorGlutenFreeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_arrow for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.sea_serpent_arrow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:usagi for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorUsagi.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_glacier for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.glacier. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:troll_boots for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumTroll.boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:naga_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.NAGA_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:armor_dragon_chestplate for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumDragonArmor.chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:spruceoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorSpruceOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:mymrex_desert_swarm for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.mymrex_desert_swarm. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:peacock_fan for public static net.minecraft.item.Item twilightforest.item.TFItems.peacock_fan. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_ambient. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonarmor_dragonsteel_ice for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_armor_dragonsteel_ice. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_sting for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.MYRMEX_STING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:sugarspecialdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSugarSpecialDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ore_map for public static net.minecraft.item.Item twilightforest.item.TFItems.ore_map. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:creative_dragon_meal for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.creative_dragon_meal. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_teen_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_TEEN_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_teen_roar for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_TEEN_ROAR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_axe for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:custardpudding for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCustardPudding.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_queen_sword for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dread_queen_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonegg_bronze for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonegg_bronze. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.light for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_light. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonflute for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DRAGONFLUTE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:valentinoscharmingchocolates for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorValentinosCharmingChocolates.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_ingot for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_ingot. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:quartzcafesign for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorQuartzCafeSign.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:floopowder_four for public static net.minecraft.item.Item com.fredtargaryen.floocraft.FloocraftBase.floopowder4t. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonegg_red for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonegg_red. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:quartzoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorQuartzOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:nest for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.nest. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_resin_block for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.myrmex_jungle_resin_block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonarmor_diamond for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_armor_diamond. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.snow.wind for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_snow_wind. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:flootorch for public static net.minecraft.block.Block com.fredtargaryen.floocraft.FloocraftBase.blockFlooTorch. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_death. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cherrycakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCherryCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:pumpkindonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorPumpkinDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:blackbakinghatlegs for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBlackBakingHat.legs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:redbakinghatboots for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRedBakingHat.boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DEATHWORM_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sheep_chestplate for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.sheep_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:chocolatecremedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorChocolateCremeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:torchberries for public static net.minecraft.item.Item twilightforest.item.TFItems.torchberries. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_ice_boots for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_ice_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_child_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_CHILD_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:icebreakerpretzel for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorIcebreakerPretzel.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:redstring for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRedString.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:yeti_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.yeti_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.aerwhale for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_aerwhale. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:goldpile for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.goldPile. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ice_bomb for public static net.minecraft.item.Item twilightforest.item.TFItems.ice_bomb. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:andesiteoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorAndesiteOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_stone_bricks for public static com.github.alexthe666.iceandfire.block.BlockDreadBase com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_stone_bricks. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:summoning_crystal_fire for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.summoning_crystal_fire. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_shield for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_shield. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:troll_leather for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumTroll.leather. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:instanced_zone for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.INSTANCED_ZONE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:cockatrice_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.COCKATRICE_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:donut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:shiny_scales for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.shiny_scales. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:birchoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorBirchOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:hydra_chop for public static net.minecraft.item.Item twilightforest.item.TFItems.hydra_chop. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:charlotte for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCharlotte.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup wings:item.armor.equip_wings for public static net.minecraft.util.SoundEvent me.paulf.wings.server.sound.WingsSounds.ITEM_ARMOR_EQUIP_WINGS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:feature.light_turnoff for public static net.minecraft.util.SoundEvent com.pau101.fairylights.server.sound.FLSounds.FEATURE_LIGHT_TURNOFF. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.darkForest. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:icedcoffee for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorIcedCoffee.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_axe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.silver_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:gorgon_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.GORGON_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ice_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.ice_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:americano for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorAmericano.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:yellowfruitedicedtea for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorYellowFruitedIcedTea.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_child_roar for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_CHILD_ROAR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:mermaid_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.MERMAID_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:greenflamesidle for public static net.minecraft.block.Block com.fredtargaryen.floocraft.FloocraftBase.greenFlamesIdle. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:yulelog for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorYuleLog.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:flick for public static net.minecraft.util.SoundEvent com.fredtargaryen.floocraft.FloocraftBase.flick. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:entity.ladder.place for public static net.minecraft.util.SoundEvent com.pau101.fairylights.server.sound.FLSounds.LADDER_PLACE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.giant_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_biolight for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.myrmex_jungle_biolight. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:troll_chestplate for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumTroll.chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.moa.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.moa_ambient. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hippocampus_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.HIPPOCAMPUS_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:acaciaoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorAcaciaOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:glazedchocolatemunchkin for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorGlazedChocolateMunchkin.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:trophy for public static net.minecraft.item.Item twilightforest.item.TFItems.trophy. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:raw_venison for public static net.minecraft.item.Item twilightforest.item.TFItems.raw_venison. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_ice_hoe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_ice_hoe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_death. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:fruitcake for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorFruitCake.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:stymphalian_arrow for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.stymphalian_arrow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:coffeecup for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCoffeeCup.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:whitechocolatedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorWhiteChocolateDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:enchanted_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.enchantedForest. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_irradiated_forests for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.IRRADIATED_FORESTS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:espressoglass for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorEspressoGlass.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:greened for public static net.minecraft.util.SoundEvent com.fredtargaryen.floocraft.FloocraftBase.greened. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hippogryph_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.HIPPOGRYPH_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:chared_cobblestone for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.charedCobblestone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:hexenhaus for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorHexenhaus.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonforge_ice_core_disabled for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonforge_ice_core. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:saltedglutenfreepretzel for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSaltedGlutenFreePretzel.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:montblanc for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorMontBlanc.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_hurt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup baubles:ring for public static net.minecraft.item.Item baubles.common.items.ItemRing.RING. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:chared_grass for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.charedGrass. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:cyclops_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.CYCLOPS_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_lich_summon for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DREAD_LICH_SUMMON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:waffle for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorWaffle.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_keeping_3 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_keeping_3. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:stone_statue for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.stone_statue. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sickly_dragon_meal for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.sickly_dragon_meal. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:chared_stone for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.charedStone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscales_white for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonscales_white. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:strawberrydonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorStrawberryDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_nugget for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.silverNugget. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_axe for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:salt for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSalt.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:ash for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.ash. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_hurt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:fire_dragon_flesh for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.fire_dragon_flesh. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:borer_essence for public static net.minecraft.item.Item twilightforest.item.TFItems.borer_essence. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:blackbakinghathelmet for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBlackBakingHat.helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:redvelvetswissroll for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRedVelvetSwissRoll.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:jellydonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorJellyDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:thornlands for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.thornlands. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:stymphalian_bird_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.STYMPHALIAN_BIRD_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:blackberrycakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBlackberryCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_horn_fire for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_horn_fire. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dreadwood_planks for public static com.github.alexthe666.iceandfire.block.BlockDreadBase com.github.alexthe666.iceandfire.block.IafBlockRegistry.dreadwood_planks. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:whitebakinghatlegs for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorWhiteBakingHat.legs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_life_1 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_life_1. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_ice_spikes for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragon_ice_spikes. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:jellymunchkin for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorJellyMunchkin.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:naga_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.NAGA_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:minotaur_axe for public static net.minecraft.item.Item twilightforest.item.TFItems.minotaur_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:chocolatedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorChocolateDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:coffee for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCoffee.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:frosted for public static net.minecraft.potion.Potion twilightforest.potions.TFPotions.frosty. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_fire_boots for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_fire_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cupcake for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCupcake.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:pixie_wings for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.pixie_wings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:earplugs for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.earplugs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:itemfloosign for public static net.minecraft.item.Item com.fredtargaryen.floocraft.FloocraftBase.itemFlooSign. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.SEA_SERPENT_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_magnetic_hills for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.MAGNETIC_HILLS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:frozen_grass_path for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.frozenGrassPath. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_leggings for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumSeaSerpent.leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:gorgon_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.GORGON_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:darkoakoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorDarkOakOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonforge_fire_brick for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonforge_fire_brick. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:mermaid_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.MERMAID_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hippogryph_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.HIPPOGRYPH_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.labyrinth for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_labyrinth. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:minotaur_axe_gold for public static net.minecraft.item.Item twilightforest.item.TFItems.minotaur_axe_gold. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:christmascake for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorChristmasCake.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_map for public static net.minecraft.item.Item twilightforest.item.TFItems.magic_map. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_hurt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_stone_bricks_cracked for public static com.github.alexthe666.iceandfire.block.BlockDreadBase com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_stone_bricks_cracked. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:chared_grass_path for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.charedGrassPath. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_shovel for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_ice_sword for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_ice_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_egg for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_egg. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_resin for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_resin. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:manuscript for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.manuscript. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_map for public static net.minecraft.item.Item twilightforest.item.TFItems.maze_map. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:diamond_hippogryph_armor for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.diamond_hippogryph_armor. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:raspberrycakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRaspberryCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:iron_hippogryph_armor for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.iron_hippogryph_armor. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:doughnut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorDoughnut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:englishmintdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorEnglishMintDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:jingle_bell for public static net.minecraft.util.SoundEvent com.pau101.fairylights.server.sound.FLSounds.JINGLE_BELL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_chestplate for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:cyclops_bite for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.CYCLOPS_BITE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_map_focus for public static net.minecraft.item.Item twilightforest.item.TFItems.maze_map_focus. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:stymphalian_feather_bundle for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.stymphalian_feather_bundle. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonarmor_silver for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_armor_silver. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:fire_lily for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.fire_lily. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:fancydiamondcafesign for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorFancyDiamondCafeSign.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:rawpretzel for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRawPretzel.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:birchoutdoorcafechair for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorBirchOutdoorCafeChair.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_staff for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_staff. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:gorgon_attack for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.GORGON_ATTACK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:arctic_fur for public static net.minecraft.item.Item twilightforest.item.TFItems.arctic_fur. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_gauntlet_red for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_gauntlet_red. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_ingot for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.silverIngot. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_biolight for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.myrmex_desert_biolight. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DEATHWORM_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:heartcake for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorHeartCake.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonegg_sapphire for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonegg_sapphire. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:yeti_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.yeti_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonbone_sword_fire for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonbone_sword_fire. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_death. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:naga_scale for public static net.minecraft.item.Item twilightforest.item.TFItems.naga_scale. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:frozen_grass for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.frozenGrass. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_hatch for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DRAGON_HATCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_attack for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DEATHWORM_ATTACK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cooked_meef for public static net.minecraft.item.Item twilightforest.item.TFItems.cooked_meef. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_boots for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumSeaSerpent.boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscale_sapphire for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonscale_sapphire. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonegg_blue for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonegg_blue. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_stone_bricks_chiseled for public static com.github.alexthe666.iceandfire.block.BlockDreadBase com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_stone_bricks_chiseled. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:candycane for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCandyCane.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscale_blue for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonscale_blue. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:chocolatenutdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorChocolateNutDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:stymphalian_bird_attack for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.STYMPHALIAN_BIRD_ATTACK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.lift for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_lift. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cube_of_annihilation for public static net.minecraft.item.Item twilightforest.item.TFItems.cube_of_annihilation. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_ingot for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_ingot. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_red_chestplate for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_red_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscale_green for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonscale_green. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hydra_arrow for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.hydra_arrow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_fire_ingot for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_fire_ingot. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:goldenpretzel for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorGoldenPretzel.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:entity.ladder.fall for public static net.minecraft.util.SoundEvent com.pau101.fairylights.server.sound.FLSounds.LADDER_FALL. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_death. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.puff for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_puff. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:valentinesdaycafesign for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorValentinesDayCafeSign.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_adult_roar for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_ADULT_ROAR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_yellow_chestplate for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_yellow_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:oldfashioneddonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorOldFashionedDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:chain_sticky for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.chain_sticky. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:cyclops_blinded for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.CYCLOPS_BLINDED. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscale_silver for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonscale_silver. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:gorgon_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.GORGON_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:icedmacchiato for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorIcedMacchiato.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:pixie_wand for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.PIXIE_WAND. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_flight for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DRAGON_FLIGHT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_red_helmet for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_red_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_attack. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:oak_savannah for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.oakSavanna. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:espresso for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorEspresso.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.generic.wings.flap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.generic_wing_flap. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonforge_ice_input for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonforge_ice_input. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:stymphalian_bird_feather for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.stymphalian_bird_feather. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:jar_pixie for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.jar_pixie. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:runebergtartdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRunebergTartDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:macaron for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorMacaron.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:stoneoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorStoneOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:rottendonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRottenDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonforge_ice_core for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonforge_ice_core_disabled. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:squareoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorSquareOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_horn for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_horn. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:cyclops_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.CYCLOPS_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:daifuku for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorDaifuku.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.angry for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_angry. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:floowerpot for public static net.minecraft.item.Item com.fredtargaryen.floocraft.FloocraftBase.iFloowerPot. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:cockatrice_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.COCKATRICE_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:greenflamesbusy for public static net.minecraft.block.Block com.fredtargaryen.floocraft.FloocraftBase.greenFlamesBusy. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_torch for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_torch. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:carminite for public static net.minecraft.item.Item twilightforest.item.TFItems.carminite. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:jaffadonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorJaffaDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ore_meter for public static net.minecraft.item.Item twilightforest.item.TFItems.ore_meter. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_stone_bricks_mossy for public static com.github.alexthe666.iceandfire.block.BlockDreadBase com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_stone_bricks_mossy. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_hoe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_hoe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:mudcakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorMudcakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_beans for public static net.minecraft.item.Item twilightforest.item.TFItems.magic_beans. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_fire_sword for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_fire_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.twilightForest. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_scale_block for public net.minecraft.block.Block com.github.alexthe666.iceandfire.enums.EnumSeaSerpent.scaleBlock. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_teen_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_TEEN_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:ambrosia for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.ambrosia. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:floopowder_eight for public static net.minecraft.item.Item com.fredtargaryen.floocraft.FloocraftBase.floopowder8t. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.electric_shock for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_electric_shock. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.recording_892 for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_recording_892. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:whitebakinghatboots for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorWhiteBakingHat.boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:tower_key for public static net.minecraft.item.Item twilightforest.item.TFItems.tower_key. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:gold_hippogryph_armor for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.gold_hippogryph_armor. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:pumpkinmunchkin for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorPumpkinMunchkin.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_bite for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.MYRMEX_BITE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dark_forest_center for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.darkForestCenter. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:redfruitedicedtea for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRedFruitedIcedTea.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:northernberriesdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorNorthernBerriesDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_meal for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_meal. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:bakingchocolate for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBakingChocolate.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonforge_fire_input for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonforge_fire_input. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:cord.stretch for public static net.minecraft.util.SoundEvent com.pau101.fairylights.server.sound.FLSounds.CORD_STRETCH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscale_gray for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonscale_gray. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:liquoricedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorLiquoriceDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:birchcafesign for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorBirchCafeSign.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:mariannekremedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorMarianneKremeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:icedlatte for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorIcedLatte.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscales_blue for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonscales_blue. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_stone_slab for public static com.github.alexthe666.iceandfire.block.BlockGenericSlab com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_stone_bricks_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_teen_death for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_TEEN_DEATH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:glass_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.glass_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:bananadonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBananaDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:madeleine for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorMadeleine.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:cyclops_eye for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.cyclops_eye. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_teen_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_TEEN_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:skyesdonutscoupon for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSkyesDonutsCoupon.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:yeti_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.yeti_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fire_swamp for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.fireSwamp. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_stone_stairs for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_stone_bricks_stairs. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:pretzel for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorPretzel.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_scale for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumSeaSerpent.scale. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:mymrex_jungle_swarm for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.mymrex_jungle_swarm. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_adult_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_ADULT_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_helmet for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:giant_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.giant_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_stone_double_slab for public static com.github.alexthe666.iceandfire.block.BlockGenericSlab com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_stone_bricks_double_slab. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_yellow_leggings for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_yellow_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_lake for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.tfLake. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_white_helmet for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_white_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_horn_ice for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_horn_ice. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:raspberrydonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRaspberryDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.MYRMEX_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:oakoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorOakOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:icedtea for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorIcedTea.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_resin_glass for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.myrmex_jungle_resin_glass. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_hoe for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_hoe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:mintkremedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorMintKremeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_yellow_helmet for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_yellow_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_wafer for public static net.minecraft.item.Item twilightforest.item.TFItems.maze_wafer. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hydra_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.HYDRA_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_ice_helmet for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_ice_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:chocolatechipcakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorChocolateChipCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:largeglass for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorLargeGlass.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:environment.rain.heavy for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.environment_rain_heavy. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hydra_regen_head for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.HYDRA_REGEN_HEAD. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonbone_bow for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonbone_bow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:miniature_structure for public static net.minecraft.item.Item twilightforest.item.TFItems.miniature_structure. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_fire_chestplate for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_fire_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:blockfloosign for public static net.minecraft.block.Block com.fredtargaryen.floocraft.FloocraftBase.blockFlooSign. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_fire_block for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonsteel_fire_block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_ambient. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:spooky_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.spookyForest. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_child_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_CHILD_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscales_silver for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonscales_silver. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_breath for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_BREATH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:chain for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.chain. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:graniteoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorGraniteOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:raspberrycremedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRaspberryCremeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_axe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hippogryph_egg for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.hippogryph_egg. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:gorgon_head for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.gorgon_head. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_hoe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.silver_hoe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_boots for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:skyesdonutscafesign for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorSkyesDonutsCafeSign.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:greenflamestemp for public static net.minecraft.block.Block com.fredtargaryen.floocraft.FloocraftBase.greenFlamesTemp. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:rawtaiyaki for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRawTaiyaki.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_scepter for public static net.minecraft.item.Item twilightforest.item.TFItems.twilight_scepter. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_portal for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_portal. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cupoftea for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCupofTea.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:chocolatecake for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorChocolateCake.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:burntpretzel for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBurntPretzel.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_raw for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_raw. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:zombie_scepter for public static net.minecraft.item.Item twilightforest.item.TFItems.zombie_scepter. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:monsterenergypunch for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorMonsterEnergyPunch.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:yeti_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.yeti_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_adult_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_ADULT_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:troll_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.TROLL_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:cockatrice_eye for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.cockatrice_eye. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hippocampus_fin for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.hippocampus_fin. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:englishliquoricedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorEnglishLiquoriceDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_resin_glass for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.myrmex_desert_resin_glass. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:burnt_torch for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.burnt_torch. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:blackbakinghatboots for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBlackBakingHat.boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:redbakinghatbody for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRedBakingHat.body. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:jungleoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorJungleOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:enderdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorEnderDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:glazeddarkchocolatecakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorGlazedDarkChocolateCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silverpile for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.silverPile. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.cockatrice.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.cockatrice_ambient. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:gold_pile_break for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.GOLD_PILE_BREAK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:teacup for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorTeaCup.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:tiramisu for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorTiramisu.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:smallglass for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSmallGlass.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:tigerdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorTigerDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_ice_leggings for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_ice_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.labyrinth_totem.drone for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.labyrinth_totem_drone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:weezer_blue_album for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.weezer_blue_album. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:cooked_venison for public static net.minecraft.item.Item twilightforest.item.TFItems.cooked_venison. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:cord.snap for public static net.minecraft.util.SoundEvent com.pau101.fairylights.server.sound.FLSounds.CORD_SNAP. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_shard for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dread_shard. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonbone_sword for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonbone_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_resin_block for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.myrmex_desert_resin_block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sapphire_block for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.sapphireBlock. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:stymphalian_bird_dagger for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.stymphalian_feather_dagger. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:frozen_stone for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.frozenStone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:skyesbakerylogo for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSkyesBakeryLogo.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_axe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:fire_stew for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.fire_stew. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:glazeddonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorGlazedDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_queen_staff for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dread_queen_staff. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonegg_gray for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonegg_gray. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_adult_death for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_ADULT_DEATH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_child_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_CHILD_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:ironchain for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorIronChain.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonforge_fire_core_disabled for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonforge_fire_core. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:creampuff for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCreamPuff.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:valentinesdaydonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorValentinesDayDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:baumkuchen for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBaumkuchen.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:meef_stroganoff for public static net.minecraft.item.Item twilightforest.item.TFItems.meef_stroganoff. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_chitin for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_chitin. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:blindfold for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.blindfold. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:sugareddonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSugaredDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:goldendonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorGoldenDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_fire_leggings for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_fire_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_knight_sword for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dread_knight_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:pixie_house for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.pixieHouse. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:icebreakerbaumkuchen for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorIcebreakerBaumkuchen.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:vanillafrosteddonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorVanillaFrostedDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_shovel for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.silver_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:amphithere_macuahuitl for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.amphithere_macuahuitl. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:whitebakinghathelmet for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorWhiteBakingHat.helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:flootorch for public static net.minecraft.item.Item com.fredtargaryen.floocraft.FloocraftBase.iFlooTorch. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:armor_dragon_boots for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumDragonArmor.boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_breath for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_BREATH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:frozen_cobblestone for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.frozenCobblestone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonegg_green for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonegg_green. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_swamp for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.tfSwamp. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:snowy_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.snowy_forest. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonarmor_gold for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_armor_gold. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cremestrawberrydonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCremeStrawberryDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:wither_shard for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.wither_shard. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:darkoakoutdoorcafechair for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorDarkOakOutdoorCafeChair.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:spruceoutdoorcafechair for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorSpruceOutdoorCafeChair.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:armor_dragon_helmet for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumDragonArmor.helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:blackbakinghatbody for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBlackBakingHat.body. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:berlinkremedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBerlinKremeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_hoe for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_hoe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.travel for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_travel. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_walk for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.MYRMEX_WALK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:frozen_gravel for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.frozenGravel. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:swissroll for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSwissRoll.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_stream for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.stream. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cremebruleedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCremeBruleeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_resin_sticky for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.myrmex_resin_sticky. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_chestplate for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:ice_dragon_blood for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.ice_dragon_blood. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_roar for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.SEA_SERPENT_ROAR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ender_bow for public static net.minecraft.item.Item twilightforest.item.TFItems.ender_bow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerwhale.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerwhale_ambient. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:saltore for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorSaltOre.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:cord.connect for public static net.minecraft.util.SoundEvent com.pau101.fairylights.server.sound.FLSounds.CORD_CONNECT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:oakswissroll for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorOakSwissRoll.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_gauntlet_yellow for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_gauntlet_yellow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:maze_map_empty for public static net.minecraft.item.Item twilightforest.item.TFItems.maze_map_empty. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:amphithere_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.AMPHITHERE_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:bostonkremedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBostonKremeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:troll_leggings for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumTroll.leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_stone for public static com.github.alexthe666.iceandfire.block.BlockDreadBase com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_stone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:frozen_splinters for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.frozenSplinters. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:strawberrycremedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorStrawberryCremeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:fire_dragon_blood for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.fire_dragon_blood. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sheep_boots for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.sheep_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_giant_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DEATHWORM_GIANT_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:roundoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorRoundOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:sealedpretzelbox for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorSealedPretzelBox.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:chared_gravel for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.charedGravel. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:latte for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorLatte.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:tp for public static net.minecraft.util.SoundEvent com.fredtargaryen.floocraft.FloocraftBase.tp. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:lich_staff for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.lich_staff. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:troll_roar for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.TROLL_ROAR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:glutenfreepretzel for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorGlutenFreePretzel.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_stone_tile for public static com.github.alexthe666.iceandfire.block.BlockDreadBase com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_stone_tile. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hippocampus_slapper for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.hippocampus_slapper. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:twilight_highlands for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.highlands. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mazebreaker_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.mazebreaker_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:munchkin for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorMunchkin.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:siren_tear for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.siren_tear. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:jungleoutdoorcafechair for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorJungleOutdoorCafeChair.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:chain_link for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.chain_link. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_adult_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_ADULT_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonforge_ice_brick for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dragonforge_ice_brick. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_gauntlet_white for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_gauntlet_white. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cremeraspberrydonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCremeRaspberryDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_chestplate for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumSeaSerpent.chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:passiondreamdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorPassionDreamDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cloudberrycakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCloudberryCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_ice_ingot for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_ice_ingot. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:acaciaoutdoorcafechair for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorAcaciaOutdoorCafeChair.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:powderedmunchkin for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorPowderedMunchkin.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:redbakinghathelmet for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRedBakingHat.helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:orangedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorOrangeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:jar_empty for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.jar_empty. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_splash for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.SEA_SERPENT_SPLASH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_teen_roar for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_TEEN_ROAR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:valentinosvalentinegift for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorValentinosValentineGift.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscales_bronze for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonscales_bronze. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_white_leggings for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_white_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_sword for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.silver_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:pixie_wand for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.pixie_wand. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_keeping_1 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_keeping_1. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:hotchocolate for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorHotChocolate.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_chitin for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_chitin. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_ice_pickaxe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_ice_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:floopowder_two for public static net.minecraft.item.Item com.fredtargaryen.floocraft.FloocraftBase.floopowder2t. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_shovel for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.taegore.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.taegore_hurt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:gorgon_turn_stone for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.GORGON_TURN_STONE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:emptyheartshapedchocolatebox for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorEmptyHeartShapedChocolateBox.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:donutbox for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorDonutBox.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:mermaid_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.MERMAID_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:burntdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBurntDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:troll_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.TROLL_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:floopowder_infinite for public static net.minecraft.item.Item com.fredtargaryen.floocraft.FloocraftBase.floopowderc. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonbone for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonbone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:earthshakerbaumkuchen for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorEarthShakerBaumkuchen.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:stymphalian_bird_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.STYMPHALIAN_BIRD_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.present_unwrap for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.present_unwrap. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:darkoakcafesign for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorDarkOakCafeSign.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_fire_helmet for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_fire_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:liveroot for public static net.minecraft.item.Item twilightforest.item.TFItems.liveroot. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sapphire_ore for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.sapphireOre. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:anmitsu for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorAnmitsu.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_white_boots for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_white_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:magic_map_empty for public static net.minecraft.item.Item twilightforest.item.TFItems.magic_map_empty. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:egginice for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.eggInIce. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:bestiary for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.bestiary. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonegg_white for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonegg_white. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_child_death for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_CHILD_DEATH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.tempest.hurt for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.tempest_hurt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_resin for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_resin. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hydra_spit for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.HYDRA_SPIT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cappuccino for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCappuccino.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_ice_axe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_ice_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_adult_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_ADULT_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:pixie_dust for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.pixie_dust. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.trigger for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_trigger. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_sword_venom for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_sword_venom. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_ore for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.silverOre. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:macchiato for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorMacchiato.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:deep_mushroom_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.deepMushrooms. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_teen_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_TEEN_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:witherbone for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.witherbone. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.kirrid.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.kirrid_ambient. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_helmet for public net.minecraft.item.Item com.github.alexthe666.iceandfire.enums.EnumSeaSerpent.helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonbone_shovel for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonbone_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ore_magnet for public static net.minecraft.item.Item twilightforest.item.TFItems.ore_magnet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:oakcafesign for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorOakCafeSign.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_void for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.VOID. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_child_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_CHILD_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_debug_stick for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_debug_stick. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hippogryph_talon for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.hippogryph_talon. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:bananacakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBananaCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ice_bow for public static net.minecraft.item.Item twilightforest.item.TFItems.ice_bow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:amphithere_feather for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.amphithere_feather. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:fancygoldencafesign for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorFancyGoldenCafeSign.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:goldenbaumkuchen for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorGoldenBaumkuchen.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:chocolatestrawberrydonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorChocolateStrawberryDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:block.aercloud.bounce for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aercloud_bounce. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_boots for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.silver_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:bakeryspecialstrawberrydonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBakerySpecialStrawberryDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_child_roar for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_CHILD_ROAR. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:skyesbakerycoupon for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSkyesBakeryCoupon.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:firedragon_child_death for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.FIREDRAGON_CHILD_DEATH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:pixie_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.PIXIE_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_stone_face for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_stone_face. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:summoning_crystal_ice for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.summoning_crystal_ice. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:siren_flute for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.siren_flute. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_boots for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_keeping_2 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_keeping_2. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:darkoakswissroll for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorDarkOakSwissRoll.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:nougatdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorNougatDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_skull for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_skull. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_ice_chestplate for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_ice_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_flute for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_flute. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:fancyironcafesign for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorFancyIronCafeSign.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:steeleaf_ingot for public static net.minecraft.item.Item twilightforest.item.TFItems.steeleaf_ingot. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:lectern for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.lectern. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonscales_green for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonscales_green. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:sparklyvalentineschocolatedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSparklyValentinesChocolateDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:phantom_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.phantom_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonbone_sword_ice for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonbone_sword_ice. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:americanoglass for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorAmericanoGlass.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_yellow_boots for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_yellow_boots. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_ice_shovel for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_ice_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hydra_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.HYDRA_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:biscuit for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBiscuit.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:random.dungeon.container.smash for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.break_labyrinth_container. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:highlands_center for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.highlandsCenter. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:icebreakerdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorIcebreakerDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:earthshakerdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorEarthShakerDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_chitin for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_chitin. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_breath for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.SEA_SERPENT_BREATH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragon_stick for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_stick. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dreadwood_log for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dreadwood_log. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_tounge for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_tounge. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sheep_helmet for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.sheep_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:celebrationcake20k for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCelebrationCake20K.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:block_and_chain for public static net.minecraft.item.Item twilightforest.item.TFItems.block_and_chain. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:seeker_bow for public static net.minecraft.item.Item twilightforest.item.TFItems.seeker_bow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_white_chestplate for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_white_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:jungle_myrmex_cocoon for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.jungle_myrmex_cocoon. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:pretzelbox for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorPretzelBox.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_sword_venom for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_sword_venom. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonbone_axe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonbone_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_shovel for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_desert_sword for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_desert_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonbone_hoe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonbone_hoe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:skyesdonutslogo for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSkyesDonutsLogo.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_resin for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.myrmex_resin. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup floocraftft:floowerpot for public static net.minecraft.block.Block com.fredtargaryen.floocraft.FloocraftBase.floowerPot. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:gorgon_petrify for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.GORGON_PETRIFY. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:acaciaswissroll for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorAcaciaSwissRoll.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:darkchocolatedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorDarkChocolateDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:feature.light_turnon for public static net.minecraft.util.SoundEvent com.pau101.fairylights.server.sound.FLSounds.FEATURE_LIGHT_TURNON. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:naga_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.NAGA_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:chared_dirt for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.charedDirt. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:christmasdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorChristmasDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:mushroom_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.mushrooms. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:triple_bow for public static net.minecraft.item.Item twilightforest.item.TFItems.triple_bow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_egg for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.deathworm_egg. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:whitebakingchocolate for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorWhiteBakingChocolate.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:glazedchocolatecakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorGlazedChocolateCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonbone_arrow for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonbone_arrow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:glazedwhitechocolatecakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorGlazedWhiteChocolateCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:cockatrice_scepter for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.cockatrice_scepter. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.zephyr.ambient for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.zephyr_ambient. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dreadwood_planks_lock for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dreadwood_planks_lock. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_arctic_peaks for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.ARCTIC_PEAKS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_sword for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:mushroomdonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorMushroomDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:troll_tusk for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.troll_tusk. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:sealeddonutbox for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorSealedDonutBox.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:stymphalian_bird_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.STYMPHALIAN_BIRD_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:sugaredmunchkin for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSugaredMunchkin.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:amphithere_arrow for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.amphithere_arrow. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hippogryph_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.HIPPOGRYPH_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:icedragon_teen_death for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.ICEDRAGON_TEEN_DEATH. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_chestplate for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.silver_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_fire_hoe for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_fire_hoe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:cockatrice_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.COCKATRICE_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:fire_dragon_heart for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.fire_dragon_heart. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:spruceswissroll for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSpruceSwissRoll.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:record.moa for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.record_moa. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:desert_myrmex_cocoon for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.desert_myrmex_cocoon. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:experiment_115 for public static net.minecraft.item.Item twilightforest.item.TFItems.experiment_115. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_sword for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dread_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:amphithere_gust for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.AMPHITHERE_GUST. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:firefly_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.fireflyForest. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hippocampus_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.HIPPOCAMPUS_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:blueberrycakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBlueberryCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:cranberrycakedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCranberryCakeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:fiery_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.fiery_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_ingot for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_ingot. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_axe for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_axe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:hippogryph_sword for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.hippogryph_sword. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_stinger for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_stinger. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:naga_leggings for public static net.minecraft.item.Item twilightforest.item.TFItems.naga_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:amphithere_hurt for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.AMPHITHERE_HURT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:dense_twilight_forest for public static net.minecraft.world.biome.Biome twilightforest.biomes.TFBiomes.denseTwilightForest. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:whitebakinghatbody for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorWhiteBakingHat.body. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:crumble_horn for public static net.minecraft.item.Item twilightforest.item.TFItems.crumble_horn. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:portal.glowstone.hum for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.glowstone_portal_hum. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.attack for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_attack. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:siren_song for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.SIREN_SONG. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:rottenpretzel for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorRottenPretzel.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.burrukai.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.burrukai_death. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:bakeryspecialchocolatedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBakerySpecialChocolateDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:tart for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorTart.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:rotten_egg for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.rotten_egg. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonsteel_fire_shovel for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonsteel_fire_shovel. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:nosenergypunch for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorNOSEnergyPunch.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:armor_shard for public static net.minecraft.item.Item twilightforest.item.TFItems.armor_shard. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_pickaxe for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_pickaxe. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:entity.ladder.hit for public static net.minecraft.util.SoundEvent com.pau101.fairylights.server.sound.FLSounds.LADDER_HIT. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:blackboard for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorBlackBoard.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:sprucecafesign for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorSpruceCafeSign.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:lifedrain_scepter for public static net.minecraft.item.Item twilightforest.item.TFItems.lifedrain_scepter. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonegg_silver for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragonegg_silver. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:dango for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorDango.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:junglecafesign for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorJungleCafeSign.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sea_serpent_bite for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.SEA_SERPENT_BITE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:caramelfudgedonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorCaramelFudgeDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:oakoutdoorcafechair for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorOakOutdoorCafeChair.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:ironwood_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.ironwood_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:deathworm_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.DEATHWORM_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:acaciacafesign for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorAcaciaCafeSign.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:jungleswissroll for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorJungleSwissRoll.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:cyclops_die for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.CYCLOPS_DIE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:knightmetal_chestplate for public static net.minecraft.item.Item twilightforest.item.TFItems.knightmetal_chestplate. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:charm_of_life_2 for public static net.minecraft.item.Item twilightforest.item.TFItems.charm_of_life_2. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:silver_block for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.silverBlock. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:sparklyvalentinespretzel for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorSparklyValentinesPretzel.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:amphithere_idle for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.AMPHITHERE_IDLE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_key for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dread_key. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sapphire_gem for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.sapphireGem. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dread_spawner for public static net.minecraft.block.Block com.github.alexthe666.iceandfire.block.IafBlockRegistry.dread_spawner. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:dioriteoutdoorcafetable for public static net.minecraft.block.Block net.mcreator.skyes_bakery.MCreatorDioriteOutdoorCafeTable.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:fishing_spear for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.fishing_spear. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:cockatrice_cry for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.COCKATRICE_CRY. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:aether_forgotten_highlands for public static net.minecraft.world.biome.Biome com.gildedgames.aether.api.registrar.BiomesAether.FORGOTTEN_HIGHLANDS. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:amphithere_bite for public static net.minecraft.util.SoundEvent com.github.alexthe666.iceandfire.misc.IafSoundRegistry.AMPHITHERE_BITE. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup aether:mob.aerbunny.death for public static net.minecraft.util.SoundEvent com.gildedgames.aether.api.registrar.SoundsAether.aerbunny_death. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:dragonarmor_iron for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.dragon_armor_iron. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:powdereddonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorPowderedDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:phantom_helmet for public static net.minecraft.item.Item twilightforest.item.TFItems.phantom_helmet. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup fairylights:entity.ladder.break for public static net.minecraft.util.SoundEvent com.pau101.fairylights.server.sound.FLSounds.LADDER_BREAK. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:sheep_leggings for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.sheep_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:ice_dragon_heart for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.ice_dragon_heart. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup skyes_bakery:strawberryfrosteddonut for public static net.minecraft.item.Item net.mcreator.skyes_bakery.MCreatorStrawberryFrostedDonut.block. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup twilightforest:castle_door for public static net.minecraft.item.Item twilightforest.item.TFItems.castle_door. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/DEBUG] [FML]: Unable to lookup iceandfire:myrmex_jungle_leggings for public static net.minecraft.item.Item com.github.alexthe666.iceandfire.item.IafItemRegistry.myrmex_jungle_leggings. This means the object wasn't registered. It's likely just mod options.
[15:09:45] [Server thread/INFO] [FML]: Holder lookups applied
[15:09:45] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod chisel
[15:09:45] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Chisel took 0.576s
[15:09:45] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod clumps
[15:09:45] [Server thread/TRACE] [FML]: Automatically registered mod clumps entity xp_orb_big as clumps:xp_orb_big
[15:09:45] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod clumps
[15:09:45] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Clumps took 0.044s
[15:09:45] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod comfycozy
[15:09:46] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod comfycozy
[15:09:46] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Comfy Cozy took 1.244s
[15:09:46] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod craftablesaddles
[15:09:46] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod craftablesaddles
[15:09:46] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Craftable Saddles took 0.000s
[15:09:46] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod crafttweakerjei
[15:09:46] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod crafttweakerjei
[15:09:46] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - CraftTweaker JEI Support took 0.000s
[15:09:46] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod props
[15:09:47] [Server thread/TRACE] [FML]: Automatically registered mod props entity FakeChairEntity as props:chair
[15:09:47] [Server thread/INFO] [com.mia.craftstudio.CSPack]: Original locale was en, switching to Locale.US
[15:09:47] [Server thread/INFO] [com.mia.craftstudio.CSPack]: Locale is now en_US
[15:09:47] [Server thread/INFO] [com.mia.craftstudio.CSPack]: Locale was restored to en
[15:10:04] [Server thread/DEBUG] [FML]: Bar Finished: Loading models took 16.359s
[15:10:04] [Server thread/DEBUG] [FML]: Bar Finished: Loading models took 16.360s
[15:11:35] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod props
[15:11:35] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Decocraft took 109.134s
[15:11:35] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod expandedbonemeal
[15:11:35] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod expandedbonemeal
[15:11:35] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - ExpandedBonemeal took 0.002s
[15:11:35] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod extrautils2
[15:11:35] [Server thread/DEBUG] [extrautils2]: OTL: Network Handler Static Init
[15:11:35] [Server thread/DEBUG] [extrautils2]: OTL: Register Packet
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketAngelRingNotifier with discriminator: 0
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketBiomeChange with discriminator: 1
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketBlueArrow with discriminator: 2
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketCrashLog with discriminator: 3
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketEditScreen with discriminator: 4
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketEntityChunkData with discriminator: 5
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketEntityIsEvil with discriminator: 6
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketFlightData with discriminator: 7
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketGUIData with discriminator: 8
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketGUIInput with discriminator: 9
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketLawSwordNotifier with discriminator: 10
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketOpenGui with discriminator: 11
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketParticleGeneric with discriminator: 12
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketParticleSplineCurve with discriminator: 13
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketParticleSplosion with discriminator: 14
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketPing with discriminator: 15
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketPong with discriminator: 16
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketPower with discriminator: 17
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketPowerInfo with discriminator: 18
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketProxyFlow with discriminator: 19
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketSendLeftClick with discriminator: 20
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketSetGhost with discriminator: 21
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class PacketUseItemAlt with discriminator: 22
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class SpecialChat with discriminator: 23
[15:11:47] [Server thread/DEBUG] [extrautils2]: Registering Packet class TimeHandlerPacket with discriminator: 24
[15:11:47] [Server thread/DEBUG] [extrautils2]: OTL: CreatePacketHandler Server
[15:11:47] [Server thread/DEBUG] [extrautils2]: OTL: Network Init
[15:11:47] [Server thread/DEBUG] [extrautils2]: OTL: Start {CLIENT=[id: 0xembedded, L:embedded - R:embedded], SERVER=[id: 0xembedded, L:embedded - R:embedded]}
[15:11:47] [Server thread/DEBUG] [extrautils2]: OTL: Start Side: CLIENT
[15:11:47] [Server thread/DEBUG] [extrautils2]: OTL: Start Channel Handler: (CLIENT)(0) fml:outbound - net.minecraftforge.fml.common.network.FMLOutboundHandler@78669746
[15:11:47] [Server thread/DEBUG] [extrautils2]: OTL: Start Channel Handler: (CLIENT)(1) PacketCodec#0 - com.rwtema.extrautils2.network.PacketCodec@4dd78d58
[15:11:47] [Server thread/DEBUG] [extrautils2]: OTL: Start Channel Handler: (CLIENT)(2) PacketHandler#0 - com.rwtema.extrautils2.network.PacketHandler@35c3f3e5
[15:11:47] [Server thread/DEBUG] [extrautils2]: OTL: Start Side: SERVER
[15:11:47] [Server thread/DEBUG] [extrautils2]: OTL: Start Channel Handler: (SERVER)(0) fml:outbound - net.minecraftforge.fml.common.network.FMLOutboundHandler@1ae6eda5
[15:11:47] [Server thread/DEBUG] [extrautils2]: OTL: Start Channel Handler: (SERVER)(1) PacketCodec#0 - com.rwtema.extrautils2.network.PacketCodec@4dd78d58
[15:11:47] [Server thread/DEBUG] [extrautils2]: OTL: Start Channel Handler: (SERVER)(2) PacketHandler#0 - com.rwtema.extrautils2.network.PacketHandler@35c3f3e5
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:furnace from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:crusher from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:enchanter from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_survival from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_culinary from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_lava from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_redstone from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_ender from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_potion from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_pink from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_overclock from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_tnt from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_netherstar from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_dragonsbreath from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_ice from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_death from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_enchant from FMLMod:extrautils2{1.0}
[15:11:59] [Server thread/TRACE] [ExtraMachinaAPI]: Registering extrautils2:generator_slime from FMLMod:extrautils2{1.0}
[15:12:00] [Server thread/TRACE] [FML]: Automatically registered mod extrautils2 entity boomerang as extrautils2:boomerang
[15:12:00] [Server thread/TRACE] [FML]: Automatically registered mod extrautils2 entity chunkdata as extrautils2:chunkdata
[15:12:00] [Server thread/DEBUG] [extrautils2]: OTL: Key Alt Register
[15:12:12] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `xutesrtile`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilesoundmuffler`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tiletrashcan`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tiletrashcanfluids`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tiletrashcanenergy`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilepassivegenerator`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilepowerhandcrank`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilesupermobspawner`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilepoweroverload`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileresonator`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilespotlight`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilescreen`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tiletransferholder`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileplayerchest`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilechunkloader`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileindexer`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilecrafter`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilescanner`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilemine`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileuse`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tank16`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tank256`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tank4096`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tank65536`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tankinf`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilemachineprovider`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilemachinereceiver`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileteleporter`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilepowertransmitter`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilepowerbattery`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilequarryproxy`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilequarry`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilelargishchest`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileminchest`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilerainbowgenerator`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilecreativechest`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilecreativeenergy`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tilecreativeharvest`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileterraformer`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileterraformerclimograph`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tiletrashchest`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileanalogcrafter`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:13] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `xu2` for name `tileinteractionproxy`, expected `extrautils2`. This could be a intended override, but in most cases indicates a broken mod.
[15:12:14] [Server thread/DEBUG] [extrautils2]: Registering XUShapelessRecipe to RecipeSorter
[15:12:14] [Server thread/DEBUG] [extrautils2]: Registering XUShapedRecipe to RecipeSorter
[15:12:14] [Server thread/DEBUG] [extrautils2]: Registering UnstableIngotRecipe to RecipeSorter
[15:12:14] [Server thread/DEBUG] [extrautils2]: Registering EnchantRecipe to RecipeSorter
[15:12:14] [Server thread/DEBUG] [extrautils2]: Registering UpgradeRecipe to RecipeSorter
[15:12:14] [Server thread/DEBUG] [extrautils2]: Registering XUShapelessRecipeClearNBT to RecipeSorter
[15:12:14] [Server thread/DEBUG] [extrautils2]: Registering AnvilRecipe to RecipeSorter
[15:12:14] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod extrautils2
[15:12:14] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Extra Utilities 2 took 39.079s
[15:12:15] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod fairylights
[15:12:15] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod fairylights
[15:12:15] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Fairy Lights took 0.515s
[15:12:15] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod floocraftft
[15:12:33] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod floocraftft
[15:12:33] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Floocraft took 17.603s
[15:12:33] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod foamflower
[15:12:33] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod foamflower
[15:12:33] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Foamflower took 0.001s
[15:12:33] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod forgelin
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for advancedcombat since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for orbis-lib since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for aether since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for baubles since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for atum since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for ctgui since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for crafttweaker since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for crafttweakerjei since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for mtlib since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for modtweaker since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for jei since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for quark since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for autoreglib since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for babymobs since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for bibliocraft since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for biomesoplenty since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for chisel since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for clumps since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for comfycozy since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for craftablesaddles since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for ctgui since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for crafttweaker since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for crafttweakerjei since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for props since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for expandedbonemeal since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for extrautils2 since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for fairylights since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for floocraftft since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for foamflower since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Attempting to register Kotlin @EventBusSubscriber objects for forgelin
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for friendshipbracelet since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for cfm since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for gravestone since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for ichunutil since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for hats since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for hatstand since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for waila since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for llibrary since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for iceandfire since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for improvedbackpacks since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for inventorypets since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for jrftl since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for customcraftingtables since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for mcwbridges since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for mcwfences since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for morelootstuff since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for morph since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for naturescompass since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for outfox since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for patchouli since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for pattysmorestuff since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for placeableitems since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for reccomplex since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for roguelike since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for skyes_bakery since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for tropicraft since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for twilightforest since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for ultimate_unicorn_mod since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for vending since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for wings since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for wings since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for xaerominimap since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for midnight since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for phosphor-lighting since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for wings since it does not use KotlinAdapter
[15:12:33] [Server thread/DEBUG] [net.shadowfacts.forgelin.ForgelinAutomaticEventSubscriber]: Skipping @EventBusSubscriber injection for wings since it does not use KotlinAdapter
[15:12:33] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod forgelin
[15:12:33] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Shadowfacts' Forgelin took 0.028s
[15:12:33] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod friendshipbracelet
[15:12:33] [Server thread/INFO] [Friendship Bracelet]: Friendship Bracelet is loading!
[15:12:33] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod friendshipbracelet
[15:12:33] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Friendship Bracelet took 0.098s
[15:12:33] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod cfm
[15:13:05] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod cfm
[15:13:05] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - MrCrayfish's Furniture Mod took 32.113s
[15:13:05] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod gravestone
[15:13:05] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod gravestone
[15:13:05] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Gravestone Mod took 0.012s
[15:13:05] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod ichunutil
[15:13:05] [Server thread/TRACE] [FML]: Automatically registered mod ichunutil entity EntityBlock as ichunutil:entity_block
[15:13:05] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod ichunutil
[15:13:05] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - iChunUtil took 0.148s
[15:13:05] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod hats
[15:13:05] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod hats
[15:13:05] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Hats took 0.460s
[15:13:05] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod hatstand
[15:13:06] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod hatstand
[15:13:06] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - HatStand took 0.096s
[15:13:06] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod waila
[15:13:06] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod waila
[15:13:06] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Waila took 0.640s
[15:13:06] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod llibrary
[15:13:23] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod llibrary
[15:13:23] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - LLibrary took 16.634s
[15:13:23] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod iceandfire
[15:13:38] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `lectern`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:38] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `podium`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:39] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `egginice`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:39] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `pixie_house`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:39] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `jar`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:39] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `dread_portal`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:39] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `dread_spawner`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:39] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `dummygorgonheadidle`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:39] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `dummygorgonheadactive`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:39] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `myrmexcocoon`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:39] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `dragonforge`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:39] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `dragonforgeinput`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:39] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `dragonforgebrick`, expected `iceandfire`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:39] [Server thread/INFO] [Ice And Fire]: A raven flies from the north to the sea
[15:13:39] [Server thread/INFO] [Ice And Fire]: A dragon whispers her name in the east
[15:13:39] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod iceandfire
[15:13:39] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Ice and Fire took 16.202s
[15:13:39] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod improvedbackpacks
[15:13:51] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `backpack`, expected `improvedbackpacks`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:51] [Server thread/WARN] [FML]: Potentially Dangerous alternative prefix `minecraft` for name `ender_backpack`, expected `improvedbackpacks`. This could be a intended override, but in most cases indicates a broken mod.
[15:13:52] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod improvedbackpacks
[15:13:52] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Improved Backpacks took 12.553s
[15:13:52] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod inventorypets
[15:14:04] [Hats Download/Read Hats Thread/INFO] [Hats]: [7.1.1] Loaded 198 hats. 68 are contributor hats.
[15:14:04] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod inventorypets
[15:14:04] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Inventory Pets took 12.740s
[15:14:04] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod jrftl
[15:14:04] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod jrftl
[15:14:04] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Just Another Rotten Flesh to Leather Mod took 0.029s
[15:14:04] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod customcraftingtables
[15:14:04] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod customcraftingtables
[15:14:04] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - CustomCraftingTables took 0.001s
[15:14:04] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mcwbridges
[15:14:04] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mcwbridges
[15:14:04] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Macaw's Bridges took 0.001s
[15:14:04] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod mcwfences
[15:14:04] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod mcwfences
[15:14:04] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Macaw's Fences and Walls took 0.001s
[15:14:04] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod morelootstuff
[15:14:05] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod morelootstuff
[15:14:05] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - More Loot Stuff took 0.222s
[15:14:05] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod morph
[15:14:05] [Server thread/WARN] [iChunUtil]: Config property enableFlight from mod Morph may not be localized!
[15:14:18] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod morph
[15:14:18] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Morph took 13.025s
[15:14:18] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod naturescompass
[15:14:18] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod naturescompass
[15:14:18] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Nature's Compass took 0.132s
[15:14:18] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod outfox
[15:14:18] [Server thread/DEBUG] [FML]: Attempting to inject @Config classes into outfox for type INSTANCE
[15:14:18] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod outfox
[15:14:18] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Outfox took 0.010s
[15:14:18] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod patchouli
[15:14:18] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod patchouli
[15:14:18] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - Patchouli took 0.523s
[15:14:18] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod pattysmorestuff
[15:15:00] [Server thread/TRACE] [FML]: Sent event FMLPreInitializationEvent to mod pattysmorestuff
[15:15:00] [Server thread/DEBUG] [FML]: Bar Step: PreInitialization - PattysMoreStuff took 41.503s
[15:15:00] [Server thread/TRACE] [FML]: Sending event FMLPreInitializationEvent to mod placeableitems
[15:15:00] [Server thread/INFO] [placeableitems]: Started loading placeableitems version 3.3
[15:15:48] [Aternos System/ERROR] [LOG]: Server was stopped because it took too long to start. Try reducing the load to avoid this in the future.